FI66873C - Foerfarande foer framstaellning av 3-klorcefemderivat - Google Patents
Foerfarande foer framstaellning av 3-klorcefemderivat Download PDFInfo
- Publication number
- FI66873C FI66873C FI772339A FI772339A FI66873C FI 66873 C FI66873 C FI 66873C FI 772339 A FI772339 A FI 772339A FI 772339 A FI772339 A FI 772339A FI 66873 C FI66873 C FI 66873C
- Authority
- FI
- Finland
- Prior art keywords
- cephem
- formula
- hydroxy
- carboxylate
- nitrobenzyl
- Prior art date
Links
- -1 3,5-dimethoxybenzyl Chemical group 0.000 claims description 47
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 claims description 38
- 238000000034 method Methods 0.000 claims description 13
- 239000000203 mixture Substances 0.000 claims description 12
- 125000000217 alkyl group Chemical group 0.000 claims description 10
- 230000008569 process Effects 0.000 claims description 9
- 125000006503 p-nitrobenzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1[N+]([O-])=O)C([H])([H])* 0.000 claims description 8
- 238000002360 preparation method Methods 0.000 claims description 8
- 125000002252 acyl group Chemical group 0.000 claims description 7
- 125000005982 diphenylmethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])(*)C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 claims description 7
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 7
- OAZLXJCFUYYYGO-ZCFIWIBFSA-N (6r)-3-chloro-5-thia-1-azabicyclo[4.2.0]oct-2-en-8-one Chemical class S1CC(Cl)=CN2C(=O)C[C@H]21 OAZLXJCFUYYYGO-ZCFIWIBFSA-N 0.000 claims description 6
- 125000003545 alkoxy group Chemical group 0.000 claims description 6
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims description 6
- 125000002541 furyl group Chemical group 0.000 claims description 6
- 229910052736 halogen Inorganic materials 0.000 claims description 6
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 6
- 125000001544 thienyl group Chemical group 0.000 claims description 6
- ZUBXPSDFPQTKQN-ZCFIWIBFSA-N (6r)-3-hydroxy-5-thia-1-azabicyclo[4.2.0]oct-2-en-8-one Chemical class S1CC(O)=CN2C(=O)C[C@H]21 ZUBXPSDFPQTKQN-ZCFIWIBFSA-N 0.000 claims description 5
- 125000004217 4-methoxybenzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1OC([H])([H])[H])C([H])([H])* 0.000 claims description 5
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 5
- 239000003795 chemical substances by application Substances 0.000 claims description 5
- 125000005843 halogen group Chemical group 0.000 claims description 5
- 230000002140 halogenating effect Effects 0.000 claims description 5
- 125000000453 2,2,2-trichloroethyl group Chemical group [H]C([H])(*)C(Cl)(Cl)Cl 0.000 claims description 4
- UHZYTMXLRWXGPK-UHFFFAOYSA-N phosphorus pentachloride Chemical compound ClP(Cl)(Cl)(Cl)Cl UHZYTMXLRWXGPK-UHFFFAOYSA-N 0.000 claims description 4
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 claims description 4
- HCXJFMDOHDNDCC-UHFFFAOYSA-N 5-$l^{1}-oxidanyl-3,4-dihydropyrrol-2-one Chemical group O=C1CCC(=O)[N]1 HCXJFMDOHDNDCC-UHFFFAOYSA-N 0.000 claims description 3
- YGYAWVDWMABLBF-UHFFFAOYSA-N Phosgene Chemical compound ClC(Cl)=O YGYAWVDWMABLBF-UHFFFAOYSA-N 0.000 claims description 3
- XAKBSHICSHRJCL-UHFFFAOYSA-N [CH2]C(=O)C1=CC=CC=C1 Chemical group [CH2]C(=O)C1=CC=CC=C1 XAKBSHICSHRJCL-UHFFFAOYSA-N 0.000 claims description 3
- 229910052739 hydrogen Inorganic materials 0.000 claims description 3
- 239000001257 hydrogen Substances 0.000 claims description 3
- 125000004184 methoxymethyl group Chemical group [H]C([H])([H])OC([H])([H])* 0.000 claims description 3
- 229910052757 nitrogen Inorganic materials 0.000 claims description 3
- 125000000636 p-nitrophenyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)[N+]([O-])=O 0.000 claims description 3
- 125000005544 phthalimido group Chemical group 0.000 claims description 3
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 2
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 2
- HEDRZPFGACZZDS-UHFFFAOYSA-N chloroform Substances ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 claims 1
- 239000000243 solution Substances 0.000 description 14
- 150000003462 sulfoxides Chemical class 0.000 description 13
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 12
- 239000011541 reaction mixture Substances 0.000 description 12
- 150000002148 esters Chemical class 0.000 description 10
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 9
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 9
- 239000002253 acid Substances 0.000 description 7
- 150000001875 compounds Chemical class 0.000 description 7
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 6
- QMMFVYPAHWMCMS-UHFFFAOYSA-N Dimethyl sulfide Chemical compound CSC QMMFVYPAHWMCMS-UHFFFAOYSA-N 0.000 description 6
- JRNVZBWKYDBUCA-UHFFFAOYSA-N N-chlorosuccinimide Chemical compound ClN1C(=O)CCC1=O JRNVZBWKYDBUCA-UHFFFAOYSA-N 0.000 description 6
- 239000000047 product Substances 0.000 description 6
- 239000002904 solvent Substances 0.000 description 6
- 239000007858 starting material Substances 0.000 description 6
- BJYNEWYPMMYDKH-BDPMCISCSA-N (4-nitrophenyl)methyl (6r)-3-chloro-8-oxo-7-[(2-phenoxyacetyl)amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate Chemical compound C1=CC([N+](=O)[O-])=CC=C1COC(=O)C1=C(Cl)CS[C@H]2N1C(=O)C2NC(=O)COC1=CC=CC=C1 BJYNEWYPMMYDKH-BDPMCISCSA-N 0.000 description 5
- CBENFWSGALASAD-UHFFFAOYSA-N Ozone Chemical compound [O-][O+]=O CBENFWSGALASAD-UHFFFAOYSA-N 0.000 description 5
- 239000000543 intermediate Substances 0.000 description 5
- 238000005949 ozonolysis reaction Methods 0.000 description 5
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 4
- 239000003242 anti bacterial agent Substances 0.000 description 4
- 229940088710 antibiotic agent Drugs 0.000 description 4
- 239000003153 chemical reaction reagent Substances 0.000 description 4
- 239000003638 chemical reducing agent Substances 0.000 description 4
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 3
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 3
- 229930186147 Cephalosporin Natural products 0.000 description 3
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 3
- UCKMPCXJQFINFW-UHFFFAOYSA-N Sulphide Chemical compound [S-2] UCKMPCXJQFINFW-UHFFFAOYSA-N 0.000 description 3
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 3
- ZRRLCCCOCSDAKF-UHFFFAOYSA-N azetidin-2-one thionyl dichloride Chemical compound ClS(Cl)=O.O=C1CCN1 ZRRLCCCOCSDAKF-UHFFFAOYSA-N 0.000 description 3
- 230000003115 biocidal effect Effects 0.000 description 3
- 229940124587 cephalosporin Drugs 0.000 description 3
- 150000001780 cephalosporins Chemical class 0.000 description 3
- 238000006243 chemical reaction Methods 0.000 description 3
- 238000005660 chlorination reaction Methods 0.000 description 3
- 238000004587 chromatography analysis Methods 0.000 description 3
- 238000000354 decomposition reaction Methods 0.000 description 3
- 125000004185 ester group Chemical group 0.000 description 3
- 239000012044 organic layer Substances 0.000 description 3
- 239000003960 organic solvent Substances 0.000 description 3
- 230000003647 oxidation Effects 0.000 description 3
- 238000007254 oxidation reaction Methods 0.000 description 3
- 238000007363 ring formation reaction Methods 0.000 description 3
- 239000011701 zinc Substances 0.000 description 3
- 229910052725 zinc Inorganic materials 0.000 description 3
- LULAYUGMBFYYEX-UHFFFAOYSA-N 3-chlorobenzoic acid Chemical compound OC(=O)C1=CC=CC(Cl)=C1 LULAYUGMBFYYEX-UHFFFAOYSA-N 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- 239000002841 Lewis acid Substances 0.000 description 2
- RAHZWNYVWXNFOC-UHFFFAOYSA-N Sulphur dioxide Chemical compound O=S=O RAHZWNYVWXNFOC-UHFFFAOYSA-N 0.000 description 2
- DTQVDTLACAAQTR-UHFFFAOYSA-N Trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- 239000012267 brine Substances 0.000 description 2
- 229910052799 carbon Inorganic materials 0.000 description 2
- 239000003054 catalyst Substances 0.000 description 2
- 238000003776 cleavage reaction Methods 0.000 description 2
- 239000006184 cosolvent Substances 0.000 description 2
- 238000000855 fermentation Methods 0.000 description 2
- 230000004151 fermentation Effects 0.000 description 2
- ZXEKIIBDNHEJCQ-UHFFFAOYSA-N isobutanol Chemical compound CC(C)CO ZXEKIIBDNHEJCQ-UHFFFAOYSA-N 0.000 description 2
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 2
- 239000012299 nitrogen atmosphere Substances 0.000 description 2
- ODUCDPQEXGNKDN-UHFFFAOYSA-N nitroxyl Chemical compound O=N ODUCDPQEXGNKDN-UHFFFAOYSA-N 0.000 description 2
- BPLBGHOLXOTWMN-MBNYWOFBSA-N phenoxymethylpenicillin Chemical compound N([C@H]1[C@H]2SC([C@@H](N2C1=O)C(O)=O)(C)C)C(=O)COC1=CC=CC=C1 BPLBGHOLXOTWMN-MBNYWOFBSA-N 0.000 description 2
- 235000017557 sodium bicarbonate Nutrition 0.000 description 2
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 2
- 159000000000 sodium salts Chemical class 0.000 description 2
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 2
- VNDYJBBGRKZCSX-UHFFFAOYSA-L zinc bromide Chemical compound Br[Zn]Br VNDYJBBGRKZCSX-UHFFFAOYSA-L 0.000 description 2
- JIAARYAFYJHUJI-UHFFFAOYSA-L zinc dichloride Chemical compound [Cl-].[Cl-].[Zn+2] JIAARYAFYJHUJI-UHFFFAOYSA-L 0.000 description 2
- TXUICONDJPYNPY-UHFFFAOYSA-N (1,10,13-trimethyl-3-oxo-4,5,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl) heptanoate Chemical compound C1CC2CC(=O)C=C(C)C2(C)C2C1C1CCC(OC(=O)CCCCCC)C1(C)CC2 TXUICONDJPYNPY-UHFFFAOYSA-N 0.000 description 1
- GVVFCAFBYHYGEE-OGFXRTJISA-N (2r)-2-amino-2-phenylacetyl chloride;hydron;chloride Chemical compound Cl.ClC(=O)[C@H](N)C1=CC=CC=C1 GVVFCAFBYHYGEE-OGFXRTJISA-N 0.000 description 1
- UVZCXKHZXBJKSJ-AVKWCDSFSA-N (4-methoxyphenyl)methyl (6r)-3-hydroxy-8-oxo-7-[(2-phenylacetyl)amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate Chemical compound C1=CC(OC)=CC=C1COC(=O)C1=C(O)CS[C@H]2N1C(=O)C2NC(=O)CC1=CC=CC=C1 UVZCXKHZXBJKSJ-AVKWCDSFSA-N 0.000 description 1
- WCRKZNRTRADCRA-QRDQUSRPSA-N (4-nitrophenyl)methyl (6r)-3-hydroxy-5,8-dioxo-7-[(2-phenoxyacetyl)amino]-5$l^{4}-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate Chemical compound C1([C@@H]2N(C1=O)C(=C(CS2=O)O)C(=O)OCC=1C=CC(=CC=1)[N+]([O-])=O)NC(=O)COC1=CC=CC=C1 WCRKZNRTRADCRA-QRDQUSRPSA-N 0.000 description 1
- CCJOUTTZYREJDY-AVKWCDSFSA-N (4-nitrophenyl)methyl (6r)-3-hydroxy-7-[[2-(4-methoxyphenyl)acetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate Chemical compound C1=CC(OC)=CC=C1CC(=O)NC1C(=O)N2C(C(=O)OCC=3C=CC(=CC=3)[N+]([O-])=O)=C(O)CS[C@@H]21 CCJOUTTZYREJDY-AVKWCDSFSA-N 0.000 description 1
- MSJBRVIZZHKNPL-BDPMCISCSA-N (4-nitrophenyl)methyl (6r)-3-hydroxy-8-oxo-7-[(2-phenoxyacetyl)amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate Chemical compound C1([C@@H]2N(C1=O)C(=C(CS2)O)C(=O)OCC=1C=CC(=CC=1)[N+]([O-])=O)NC(=O)COC1=CC=CC=C1 MSJBRVIZZHKNPL-BDPMCISCSA-N 0.000 description 1
- FBZDCMZXVFLUJS-LRTDYKAYSA-N (4-nitrophenyl)methyl (6r)-3-hydroxy-8-oxo-7-[(2-thiophen-2-ylacetyl)amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate Chemical compound C1([C@@H]2N(C1=O)C(=C(CS2)O)C(=O)OCC=1C=CC(=CC=1)[N+]([O-])=O)NC(=O)CC1=CC=CS1 FBZDCMZXVFLUJS-LRTDYKAYSA-N 0.000 description 1
- XPVOGXOWTJMBLJ-FBLFFUNLSA-N (4-nitrophenyl)methyl (6r)-7-(1,3-dioxoisoindol-2-yl)-3-hydroxy-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate Chemical compound S([C@H]1N2C(C1N1C(C3=CC=CC=C3C1=O)=O)=O)CC(O)=C2C(=O)OCC1=CC=C([N+]([O-])=O)C=C1 XPVOGXOWTJMBLJ-FBLFFUNLSA-N 0.000 description 1
- SDLQWOIUATWYSP-WPZCJLIBSA-N (4-nitrophenyl)methyl (6r)-7-acetamido-3-hydroxy-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate Chemical compound S([C@@H]1C(C(N11)=O)NC(=O)C)CC(O)=C1C(=O)OCC1=CC=C([N+]([O-])=O)C=C1 SDLQWOIUATWYSP-WPZCJLIBSA-N 0.000 description 1
- BKHBMTWQAKIOHE-OTOKDRCRSA-N (4-nitrophenyl)methyl (6r)-7-benzamido-3-hydroxy-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate Chemical compound C1([C@@H]2N(C1=O)C(=C(CS2)O)C(=O)OCC=1C=CC(=CC=1)[N+]([O-])=O)NC(=O)C1=CC=CC=C1 BKHBMTWQAKIOHE-OTOKDRCRSA-N 0.000 description 1
- ZMPANRXWKQKPAE-FWXSHLFISA-N (6R)-3-hydroxy-4-[(4-methoxyphenyl)methyl]-8-oxo-7-(propanoylamino)-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound CCC(=O)NC1[C@@H]2N(C1=O)C(=C(C(S2)CC3=CC=C(C=C3)OC)O)C(=O)O ZMPANRXWKQKPAE-FWXSHLFISA-N 0.000 description 1
- ZAZNHURWWDCXGX-YNODCEANSA-N (6r)-3-hydroxy-8-oxo-4-[(2-phenoxyacetyl)amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound C([C@H]1S2)C(=O)N1C(C(=O)O)=C(O)C2NC(=O)COC1=CC=CC=C1 ZAZNHURWWDCXGX-YNODCEANSA-N 0.000 description 1
- FZEVMBJWXHDLDB-ZCFIWIBFSA-N (6r)-5-thia-1-azabicyclo[4.2.0]oct-2-en-8-one Chemical group S1CC=CN2C(=O)C[C@H]21 FZEVMBJWXHDLDB-ZCFIWIBFSA-N 0.000 description 1
- IKWLIQXIPRUIDU-ZCFIWIBFSA-N (6r)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound OC(=O)C1=CCS[C@@H]2CC(=O)N12 IKWLIQXIPRUIDU-ZCFIWIBFSA-N 0.000 description 1
- ORLCYMQZIPSODD-UHFFFAOYSA-N 1-chloro-2-[chloro(2,2,2-trichloroethoxy)phosphoryl]oxybenzene Chemical group ClC1=CC=CC=C1OP(Cl)(=O)OCC(Cl)(Cl)Cl ORLCYMQZIPSODD-UHFFFAOYSA-N 0.000 description 1
- HHWUXUALYAPKRI-WPZCJLIBSA-N 2,2,2-trichloroethyl (6r)-3-hydroxy-8-oxo-7-[(2-phenoxyacetyl)amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate Chemical compound C1([C@@H]2N(C1=O)C(=C(CS2)O)C(=O)OCC(Cl)(Cl)Cl)NC(=O)COC1=CC=CC=C1 HHWUXUALYAPKRI-WPZCJLIBSA-N 0.000 description 1
- UABNQYKMUBBTQE-IOJJLOCKSA-N 2,2,2-trichloroethyl (6r)-7-acetamido-3-hydroxy-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate Chemical compound S1CC(O)=C(C(=O)OCC(Cl)(Cl)Cl)N2C(=O)C(NC(=O)C)[C@H]21 UABNQYKMUBBTQE-IOJJLOCKSA-N 0.000 description 1
- 125000004201 2,4-dichlorophenyl group Chemical group [H]C1=C([H])C(*)=C(Cl)C([H])=C1Cl 0.000 description 1
- OCPQDIDASISMCV-UHFFFAOYSA-N 2-[2-chlorosulfinyl-4-oxo-3-[(2-phenoxyacetyl)amino]azetidin-1-yl]-3-methyl-2-[(4-nitrophenyl)methyl]but-3-enoic acid Chemical compound ClS(=O)C1C(NC(=O)COC=2C=CC=CC=2)C(=O)N1C(C(O)=O)(C(=C)C)CC1=CC=C([N+]([O-])=O)C=C1 OCPQDIDASISMCV-UHFFFAOYSA-N 0.000 description 1
- 125000004198 2-fluorophenyl group Chemical group [H]C1=C([H])C(F)=C(*)C([H])=C1[H] 0.000 description 1
- 125000004204 2-methoxyphenyl group Chemical group [H]C1=C([H])C(*)=C(OC([H])([H])[H])C([H])=C1[H] 0.000 description 1
- 125000004189 3,4-dichlorophenyl group Chemical group [H]C1=C([H])C(Cl)=C(Cl)C([H])=C1* 0.000 description 1
- 125000003762 3,4-dimethoxyphenyl group Chemical group [H]C1=C([H])C(OC([H])([H])[H])=C(OC([H])([H])[H])C([H])=C1* 0.000 description 1
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 1
- 125000001999 4-Methoxybenzoyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1OC([H])([H])[H])C(*)=O 0.000 description 1
- 125000004800 4-bromophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Br 0.000 description 1
- 125000004860 4-ethylphenyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000004861 4-isopropyl phenyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)C([H])(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 125000004172 4-methoxyphenyl group Chemical group [H]C1=C([H])C(OC([H])([H])[H])=C([H])C([H])=C1* 0.000 description 1
- 125000000590 4-methylphenyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)C([H])([H])[H] 0.000 description 1
- VOLRSQPSJGXRNJ-UHFFFAOYSA-N 4-nitrobenzyl bromide Chemical compound [O-][N+](=O)C1=CC=C(CBr)C=C1 VOLRSQPSJGXRNJ-UHFFFAOYSA-N 0.000 description 1
- SRBZCGSWQXZVJH-NWFFNWTBSA-N C1(=CC=CC=C1)CC(=O)NC1[C@@H]2N(C(=C(CS2)O)C(=O)OCC(Cl)(Cl)Cl)C1=O.[N+](=O)([O-])C1=CC=C(CC2S[C@H]3N(C(=C2O)C(=O)O)C(C3NC(CC3=CC=CC=C3)=O)=O)C=C1 Chemical compound C1(=CC=CC=C1)CC(=O)NC1[C@@H]2N(C(=C(CS2)O)C(=O)OCC(Cl)(Cl)Cl)C1=O.[N+](=O)([O-])C1=CC=C(CC2S[C@H]3N(C(=C2O)C(=O)O)C(C3NC(CC3=CC=CC=C3)=O)=O)C=C1 SRBZCGSWQXZVJH-NWFFNWTBSA-N 0.000 description 1
- AOGRYFYBFZTXSK-OTOKDRCRSA-N C1(C=2C(C(N1C1[C@@H]3N(C(=C(CS3)O)C(=O)OC3=CC=C(C=C3)[N+](=O)[O-])C1=O)=O)=CC=CC2)=O Chemical compound C1(C=2C(C(N1C1[C@@H]3N(C(=C(CS3)O)C(=O)OC3=CC=C(C=C3)[N+](=O)[O-])C1=O)=O)=CC=CC2)=O AOGRYFYBFZTXSK-OTOKDRCRSA-N 0.000 description 1
- 239000004215 Carbon black (E152) Substances 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 1
- 206010061218 Inflammation Diseases 0.000 description 1
- BNUOAQHMBAAMPR-CWEVVPMXSA-N O(C1=CC=CC=C1)CC(=O)NC1[C@@H]2N(C(=C(CS2)O)C(=O)OC(C)(C)C)C1=O.COC1=CC=C(CC2S[C@H]3N(C(=C2O)C(=O)O)C(C3NC(COC3=CC=CC=C3)=O)=O)C=C1 Chemical compound O(C1=CC=CC=C1)CC(=O)NC1[C@@H]2N(C(=C(CS2)O)C(=O)OC(C)(C)C)C1=O.COC1=CC=C(CC2S[C@H]3N(C(=C2O)C(=O)O)C(C3NC(COC3=CC=CC=C3)=O)=O)C=C1 BNUOAQHMBAAMPR-CWEVVPMXSA-N 0.000 description 1
- RRJHESVQVSRQEX-SUYBPPKGSA-N O-formylcefamandole Chemical compound CN1N=NN=C1SCC1=C(C(O)=O)N2C(=O)[C@@H](NC(=O)[C@H](OC=O)C=3C=CC=CC=3)[C@H]2SC1 RRJHESVQVSRQEX-SUYBPPKGSA-N 0.000 description 1
- 229930182555 Penicillin Natural products 0.000 description 1
- 229930195708 Penicillin V Natural products 0.000 description 1
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 1
- DWAQJAXMDSEUJJ-UHFFFAOYSA-M Sodium bisulfite Chemical compound [Na+].OS([O-])=O DWAQJAXMDSEUJJ-UHFFFAOYSA-M 0.000 description 1
- 229910021626 Tin(II) chloride Inorganic materials 0.000 description 1
- KXKVLQRXCPHEJC-UHFFFAOYSA-N acetic acid trimethyl ester Natural products COC(C)=O KXKVLQRXCPHEJC-UHFFFAOYSA-N 0.000 description 1
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 150000001338 aliphatic hydrocarbons Chemical class 0.000 description 1
- 150000001408 amides Chemical group 0.000 description 1
- 239000003125 aqueous solvent Substances 0.000 description 1
- MNFORVFSTILPAW-UHFFFAOYSA-N azetidin-2-one Chemical compound O=C1CCN1 MNFORVFSTILPAW-UHFFFAOYSA-N 0.000 description 1
- 230000001580 bacterial effect Effects 0.000 description 1
- ZGQAAXNXPGTXGM-GWQXNCQPSA-N benzhydryl (6R)-7-(2,5-dioxopyrrolidin-1-yl)-3-hydroxy-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate Chemical compound C1(CCC(N1C1[C@@H]2N(C(=C(CS2)O)C(=O)OC(C2=CC=CC=C2)C2=CC=CC=C2)C1=O)=O)=O ZGQAAXNXPGTXGM-GWQXNCQPSA-N 0.000 description 1
- HJINVAQLVZRFTL-IQHZPMLTSA-N benzhydryl (6r)-3-hydroxy-8-oxo-7-[(2-phenylacetyl)amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate Chemical compound C1([C@@H]2N(C1=O)C(=C(CS2)O)C(=O)OC(C=1C=CC=CC=1)C=1C=CC=CC=1)NC(=O)CC1=CC=CC=C1 HJINVAQLVZRFTL-IQHZPMLTSA-N 0.000 description 1
- TXHKDEVLACDMAL-GBAZGAGXSA-N benzhydryl (6r)-7-[(2,6-dimethoxybenzoyl)amino]-3-hydroxy-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate Chemical compound COC1=CC=CC(OC)=C1C(=O)NC1C(=O)N2C(C(=O)OC(C=3C=CC=CC=3)C=3C=CC=CC=3)=C(O)CS[C@@H]21 TXHKDEVLACDMAL-GBAZGAGXSA-N 0.000 description 1
- HFJCJTYHTNBAKL-UIDYPRJRSA-N benzhydryl (6r)-7-[[2-(furan-2-yl)acetyl]amino]-3-hydroxy-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate Chemical compound C1([C@@H]2N(C1=O)C(=C(CS2)O)C(=O)OC(C=1C=CC=CC=1)C=1C=CC=CC=1)NC(=O)CC1=CC=CO1 HFJCJTYHTNBAKL-UIDYPRJRSA-N 0.000 description 1
- SIXZAHQXVUDASX-FBLFFUNLSA-N benzhydryl (6r)-7-acetamido-3-hydroxy-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate Chemical compound S([C@@H]1C(C(N11)=O)NC(=O)C)CC(O)=C1C(=O)OC(C=1C=CC=CC=1)C1=CC=CC=C1 SIXZAHQXVUDASX-FBLFFUNLSA-N 0.000 description 1
- 125000003236 benzoyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C(*)=O 0.000 description 1
- IHICEOVELGFLSK-LRTDYKAYSA-N benzyl (6r)-3-hydroxy-8-oxo-7-[(2-thiophen-2-ylacetyl)amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate Chemical compound C1([C@@H]2N(C1=O)C(=C(CS2)O)C(=O)OCC=1C=CC=CC=1)NC(=O)CC1=CC=CS1 IHICEOVELGFLSK-LRTDYKAYSA-N 0.000 description 1
- ZJQQFXKYQHHEOF-FBLFFUNLSA-N benzyl (6r)-7-(1,3-dioxoisoindol-2-yl)-3-hydroxy-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate Chemical compound S([C@H]1N2C(C1N1C(C3=CC=CC=C3C1=O)=O)=O)CC(O)=C2C(=O)OCC1=CC=CC=C1 ZJQQFXKYQHHEOF-FBLFFUNLSA-N 0.000 description 1
- OFDMJVKKPOXNPE-LRTDYKAYSA-N benzyl (6r)-7-[[2-(furan-2-yl)acetyl]amino]-3-hydroxy-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate Chemical compound C1([C@@H]2N(C1=O)C(=C(CS2)O)C(=O)OCC=1C=CC=CC=1)NC(=O)CC1=CC=CO1 OFDMJVKKPOXNPE-LRTDYKAYSA-N 0.000 description 1
- WCNMKKIIMHPROX-WPZCJLIBSA-N benzyl (6r)-7-acetamido-3-hydroxy-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate Chemical compound S([C@@H]1C(C(N11)=O)NC(=O)C)CC(O)=C1C(=O)OCC1=CC=CC=C1 WCNMKKIIMHPROX-WPZCJLIBSA-N 0.000 description 1
- 125000004063 butyryl group Chemical group O=C([*])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 150000001721 carbon Chemical group 0.000 description 1
- RBHJBMIOOPYDBQ-UHFFFAOYSA-N carbon dioxide;propan-2-one Chemical compound O=C=O.CC(C)=O RBHJBMIOOPYDBQ-UHFFFAOYSA-N 0.000 description 1
- 150000001735 carboxylic acids Chemical class 0.000 description 1
- 230000015556 catabolic process Effects 0.000 description 1
- 239000000460 chlorine Substances 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 125000001309 chloro group Chemical group Cl* 0.000 description 1
- 239000012043 crude product Substances 0.000 description 1
- 238000003381 deacetylation reaction Methods 0.000 description 1
- 238000005947 deacylation reaction Methods 0.000 description 1
- 230000007423 decrease Effects 0.000 description 1
- 238000007257 deesterification reaction Methods 0.000 description 1
- 238000006731 degradation reaction Methods 0.000 description 1
- JSYGRUBHOCKMGQ-UHFFFAOYSA-N dichloramine Chemical compound ClNCl JSYGRUBHOCKMGQ-UHFFFAOYSA-N 0.000 description 1
- 229940079593 drug Drugs 0.000 description 1
- 239000003814 drug Substances 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 238000005886 esterification reaction Methods 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 235000019253 formic acid Nutrition 0.000 description 1
- 230000008570 general process Effects 0.000 description 1
- 150000008282 halocarbons Chemical class 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- 150000002430 hydrocarbons Chemical class 0.000 description 1
- 150000002431 hydrogen Chemical class 0.000 description 1
- 238000005984 hydrogenation reaction Methods 0.000 description 1
- 208000027866 inflammatory disease Diseases 0.000 description 1
- 230000004054 inflammatory process Effects 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 239000010410 layer Substances 0.000 description 1
- 150000007517 lewis acids Chemical class 0.000 description 1
- 125000000040 m-tolyl group Chemical group [H]C1=C([H])C(*)=C([H])C(=C1[H])C([H])([H])[H] 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- HRDXJKGNWSUIBT-UHFFFAOYSA-N methoxybenzene Chemical group [CH2]OC1=CC=CC=C1 HRDXJKGNWSUIBT-UHFFFAOYSA-N 0.000 description 1
- YTPRBCFJDIQAPU-SBXXRYSUSA-N methoxymethyl (6r)-3-hydroxy-8-oxo-7-[(2-thiophen-2-ylacetyl)amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate Chemical compound C1([C@H]2SCC(O)=C(N2C1=O)C(=O)OCOC)NC(=O)CC1=CC=CS1 YTPRBCFJDIQAPU-SBXXRYSUSA-N 0.000 description 1
- 239000002808 molecular sieve Substances 0.000 description 1
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000001280 n-hexyl group Chemical group C(CCCCC)* 0.000 description 1
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 150000002825 nitriles Chemical class 0.000 description 1
- UUEVFMOUBSLVJW-UHFFFAOYSA-N oxo-[[1-[2-[2-[2-[4-(oxoazaniumylmethylidene)pyridin-1-yl]ethoxy]ethoxy]ethyl]pyridin-4-ylidene]methyl]azanium;dibromide Chemical compound [Br-].[Br-].C1=CC(=C[NH+]=O)C=CN1CCOCCOCCN1C=CC(=C[NH+]=O)C=C1 UUEVFMOUBSLVJW-UHFFFAOYSA-N 0.000 description 1
- 125000003854 p-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Cl 0.000 description 1
- 125000003232 p-nitrobenzoyl group Chemical group [N+](=O)([O-])C1=CC=C(C(=O)*)C=C1 0.000 description 1
- 229940056367 penicillin v Drugs 0.000 description 1
- 150000002960 penicillins Chemical class 0.000 description 1
- VQPJTCXWTUMDBH-AVKWCDSFSA-N phenacyl (6r)-7-[[2-(4-chlorophenyl)acetyl]amino]-3-hydroxy-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate Chemical compound C1([C@@H]2N(C1=O)C(=C(CS2)O)C(=O)OCC(=O)C=1C=CC=CC=1)NC(=O)CC1=CC=C(Cl)C=C1 VQPJTCXWTUMDBH-AVKWCDSFSA-N 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 125000001501 propionyl group Chemical group O=C([*])C([H])([H])C([H])([H])[H] 0.000 description 1
- 238000011946 reduction process Methods 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 230000007017 scission Effects 0.000 description 1
- 125000002914 sec-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 239000000741 silica gel Substances 0.000 description 1
- 229910002027 silica gel Inorganic materials 0.000 description 1
- URGAHOPLAPQHLN-UHFFFAOYSA-N sodium aluminosilicate Chemical compound [Na+].[Al+3].[O-][Si]([O-])=O.[O-][Si]([O-])=O URGAHOPLAPQHLN-UHFFFAOYSA-N 0.000 description 1
- 235000010267 sodium hydrogen sulphite Nutrition 0.000 description 1
- 239000001119 stannous chloride Substances 0.000 description 1
- 235000011150 stannous chloride Nutrition 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 125000003375 sulfoxide group Chemical group 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- 150000003568 thioethers Chemical class 0.000 description 1
- AXZWODMDQAVCJE-UHFFFAOYSA-L tin(II) chloride (anhydrous) Chemical compound [Cl-].[Cl-].[Sn+2] AXZWODMDQAVCJE-UHFFFAOYSA-L 0.000 description 1
- XJDNKRIXUMDJCW-UHFFFAOYSA-J titanium tetrachloride Chemical compound Cl[Ti](Cl)(Cl)Cl XJDNKRIXUMDJCW-UHFFFAOYSA-J 0.000 description 1
- CYTQBVOFDCPGCX-UHFFFAOYSA-N trimethyl phosphite Chemical compound COP(OC)OC CYTQBVOFDCPGCX-UHFFFAOYSA-N 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 1
- 229940102001 zinc bromide Drugs 0.000 description 1
- 235000005074 zinc chloride Nutrition 0.000 description 1
- 239000011592 zinc chloride Substances 0.000 description 1
- DUNKXUFBGCUVQW-UHFFFAOYSA-J zirconium tetrachloride Chemical compound Cl[Zr](Cl)(Cl)Cl DUNKXUFBGCUVQW-UHFFFAOYSA-J 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D501/00—Heterocyclic compounds containing 5-thia-1-azabicyclo [4.2.0] octane ring systems, i.e. compounds containing a ring system of the formula:, e.g. cephalosporins; Such ring systems being further condensed, e.g. 2,3-condensed with an oxygen-, nitrogen- or sulfur-containing hetero ring
- C07D501/14—Compounds having a nitrogen atom directly attached in position 7
- C07D501/16—Compounds having a nitrogen atom directly attached in position 7 with a double bond between positions 2 and 3
- C07D501/59—Compounds having a nitrogen atom directly attached in position 7 with a double bond between positions 2 and 3 with hetero atoms directly attached in position 3
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Cephalosporin Compounds (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US71494876A | 1976-08-16 | 1976-08-16 | |
| US71494876 | 1976-08-16 |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| FI772339A7 FI772339A7 (fi) | 1978-02-17 |
| FI66873B FI66873B (fi) | 1984-08-31 |
| FI66873C true FI66873C (fi) | 1984-12-10 |
Family
ID=24872131
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| FI772339A FI66873C (fi) | 1976-08-16 | 1977-08-01 | Foerfarande foer framstaellning av 3-klorcefemderivat |
Country Status (20)
| Country | Link |
|---|---|
| US (1) | US4115643A (cs) |
| JP (1) | JPS5323994A (cs) |
| BE (1) | BE857244A (cs) |
| BG (1) | BG28068A3 (cs) |
| CA (1) | CA1099256A (cs) |
| CH (1) | CH630924A5 (cs) |
| CS (1) | CS192588B2 (cs) |
| DD (1) | DD131858A5 (cs) |
| DE (1) | DE2735454A1 (cs) |
| ES (1) | ES461587A1 (cs) |
| FI (1) | FI66873C (cs) |
| FR (1) | FR2362145A1 (cs) |
| GB (1) | GB1582044A (cs) |
| HU (1) | HU179459B (cs) |
| IE (1) | IE45158B1 (cs) |
| IL (1) | IL52416A (cs) |
| NL (1) | NL7709055A (cs) |
| PL (1) | PL110242B1 (cs) |
| RO (1) | RO71908A (cs) |
| SU (1) | SU1018586A3 (cs) |
Families Citing this family (15)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| AT342197B (de) * | 1975-02-20 | 1978-03-28 | Ciba Geigy Ag | Neues verfahren zur herstellung von 3-cephemverbindungen |
| US4223133A (en) * | 1979-02-01 | 1980-09-16 | Eli Lilly And Company | Cephalosporin reduction process |
| US4271305A (en) * | 1979-02-01 | 1981-06-02 | Eli Lilly And Company | Thiazolinoazetidinones and process therefor |
| US4226986A (en) * | 1979-02-01 | 1980-10-07 | Eli Lilly And Company | Process for halogenation of β-lactam compounds |
| US4237279A (en) * | 1979-07-27 | 1980-12-02 | Eli Lilly And Company | Crystalline 3-hydroxycephalosporin solvates |
| US4281117A (en) * | 1980-09-04 | 1981-07-28 | Eli Lilly And Company | Process for 3-chloro cephalosporin nucleus |
| US5159071A (en) * | 1990-09-06 | 1992-10-27 | Ranbaxy Laboratories Limited | Process for the manufacture of 7-amino-3-exomethylene-3-cepham-4-carboxylic acid ester |
| US5350845A (en) * | 1992-04-08 | 1994-09-27 | Eli Lilly And Company | Process for preparing 7-substituted-amino-3-hydroxy-3-cephem-4-protected carboxy-sulfoxide esters |
| IN181695B (cs) * | 1992-08-10 | 1998-09-05 | Ranbaxy Lab Ltd | |
| US5604222A (en) * | 1993-12-27 | 1997-02-18 | Lupin Laboratories, Ltd. | Method for the preparation of 2-chloro sulfinyl azetidinones |
| US5578721A (en) * | 1994-07-11 | 1996-11-26 | Lupin Laboratories Limited | Process for preparation of 3-exomethylene cepham sulfoxide esters |
| KR100390551B1 (ko) * | 1996-08-22 | 2003-11-17 | 주식회사 코오롱 | 3-할로메틸-3-세펨-4-카르복실레이트 1-옥사이드의 제조방법 |
| CN101190921B (zh) * | 2007-11-27 | 2010-05-19 | 吉林省石油化工设计研究院 | 一种对硝基苄基-7-苯氧基乙酰胺-3-外亚甲基头孢-4-羧酸酯-1-β-氧化物制备方法 |
| CN102443014B (zh) * | 2011-12-29 | 2014-07-09 | 上海右手医药科技开发有限公司 | 3-氯头孢菌素衍生物及其合成方法与在头孢克洛制备中的应用 |
| CN103588790A (zh) * | 2013-11-29 | 2014-02-19 | 中国科学院长春应用化学研究所 | 7-氨基-3-氯-3-头孢-4-羧酸-对硝基苄基酯的制备方法 |
Family Cites Families (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3641014A (en) * | 1968-10-03 | 1972-02-08 | Lilly Co Eli | Reduction of delta**3-cephalosporin sulfoxides |
| AR208068A1 (es) * | 1973-02-23 | 1976-11-30 | Lilly Co Eli | Un procedimiento para preparar derivados de acidos 7-acilamido-3-halo-cefem-4-carboxilico los esteres y las sales farmaceuticamente aceptables de los mismos |
| US3962227A (en) * | 1973-02-23 | 1976-06-08 | Eli Lilly And Company | 3-halo cephalosporins |
| YU36970B (en) * | 1973-02-23 | 1984-08-31 | Lilly Co Eli | Process for obtaining 7-(amino)-acylamido-3-halocephalosporins |
| US3925372A (en) * | 1973-02-23 | 1975-12-09 | Lilly Co Eli | Alpha-aminoacyl-3-halo cephalosporins |
-
1977
- 1977-06-28 IE IE1320/77A patent/IE45158B1/en not_active IP Right Cessation
- 1977-06-29 IL IL52416A patent/IL52416A/xx unknown
- 1977-07-18 CA CA282,954A patent/CA1099256A/en not_active Expired
- 1977-07-22 BG BG036981A patent/BG28068A3/xx unknown
- 1977-07-28 FR FR7723211A patent/FR2362145A1/fr active Granted
- 1977-07-28 BE BE1008305A patent/BE857244A/xx not_active IP Right Cessation
- 1977-08-01 FI FI772339A patent/FI66873C/fi not_active IP Right Cessation
- 1977-08-05 DE DE19772735454 patent/DE2735454A1/de active Granted
- 1977-08-08 US US05/822,472 patent/US4115643A/en not_active Expired - Lifetime
- 1977-08-09 CH CH977177A patent/CH630924A5/de not_active IP Right Cessation
- 1977-08-10 GB GB33451/77A patent/GB1582044A/en not_active Expired
- 1977-08-12 ES ES461587A patent/ES461587A1/es not_active Expired
- 1977-08-15 HU HU77EI758A patent/HU179459B/hu unknown
- 1977-08-15 SU SU772511154A patent/SU1018586A3/ru active
- 1977-08-15 RO RO7791365A patent/RO71908A/ro unknown
- 1977-08-15 PL PL1977200289A patent/PL110242B1/pl not_active IP Right Cessation
- 1977-08-16 NL NL7709055A patent/NL7709055A/xx not_active Application Discontinuation
- 1977-08-16 DD DD7700200594A patent/DD131858A5/xx unknown
- 1977-08-16 CS CS775383A patent/CS192588B2/cs unknown
- 1977-08-16 JP JP9817777A patent/JPS5323994A/ja active Granted
Also Published As
| Publication number | Publication date |
|---|---|
| FR2362145B1 (cs) | 1980-02-15 |
| DD131858A5 (de) | 1978-07-26 |
| CS192588B2 (en) | 1979-08-31 |
| DE2735454C2 (cs) | 1992-12-10 |
| GB1582044A (en) | 1980-12-31 |
| NL7709055A (nl) | 1978-02-20 |
| PL110242B1 (en) | 1980-07-31 |
| CA1099256A (en) | 1981-04-14 |
| PL200289A1 (pl) | 1978-05-08 |
| SU1018586A3 (ru) | 1983-05-15 |
| FI66873B (fi) | 1984-08-31 |
| US4115643A (en) | 1978-09-19 |
| ES461587A1 (es) | 1978-06-01 |
| CH630924A5 (de) | 1982-07-15 |
| HU179459B (en) | 1982-10-28 |
| BE857244A (fr) | 1978-01-30 |
| IL52416A (en) | 1980-02-29 |
| FI772339A7 (fi) | 1978-02-17 |
| IE45158L (en) | 1978-02-16 |
| IE45158B1 (en) | 1982-06-30 |
| DE2735454A1 (de) | 1978-02-23 |
| JPS5323994A (en) | 1978-03-06 |
| IL52416A0 (en) | 1977-08-31 |
| BG28068A3 (bg) | 1980-02-25 |
| JPS6120556B2 (cs) | 1986-05-22 |
| FR2362145A1 (fr) | 1978-03-17 |
| RO71908A (ro) | 1981-11-24 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| FI66873C (fi) | Foerfarande foer framstaellning av 3-klorcefemderivat | |
| CA1041523A (en) | Preparation of 1-oxapenicillins and novel intermediates therefor | |
| FI63035B (fi) | Foerfarande foer framstaellning av 7-alfa-aminoacyl-3-klorcefalosporinderivat | |
| US4031084A (en) | Process for cephalosporin antibiotic intermediates | |
| US3632578A (en) | Cleavage of acylamidocephalosporins and acylamidopenicillins | |
| US4456755A (en) | 7-Oxygen analogs of cephalosporins | |
| US3975385A (en) | 7-Trichloroacetamido-3-desacetoxy-cephalosporanic acid esters | |
| US4103085A (en) | 7-(Syn-α-alkoxy-iminofurylacetamido-3-(2-carboxyalkyl-2,3-dihydro-s-triazolo[4,3-b]pyridazin-3-on-6-ylthiomethyl)-3-cephem-4-carboxylic acids | |
| FI63240B (fi) | Analogifoerfarande foer framstaellning av antibakteriella 3-klorcefalosporinderivat | |
| US3941779A (en) | Method for producing 2-(substituted thio)-3-cephem derivatives | |
| JPS6133838B2 (cs) | ||
| US4208515A (en) | 3-Halo cephalosporins | |
| FI66186B (fi) | Foerfarande foer framstaellning av penicillansyra- och cefalosporansyraderivat | |
| US4187221A (en) | Process for preparing azetidinones | |
| US4334063A (en) | Cephalosporin vinyl halides | |
| HU197017B (en) | Process for producing cefem carboxylic acid derivatives from the appropriate esters | |
| US3991051A (en) | [(Oxyalkyl)thioacetyl]cephalosporin derivatives | |
| US4252950A (en) | 3-Halo cephalosporins | |
| JPS606960B2 (ja) | 3―メチレンセフアムスルホキシドの製法 | |
| US4005074A (en) | Process for cleaving an imido side chain from penicillins and cephalosporins | |
| US4299954A (en) | Cephalosporin vinyl halides | |
| US3994888A (en) | Cephalosporin cleavage process | |
| US4237280A (en) | Intermediate for cephalosporin type compound | |
| JPS5823395B2 (ja) | スルフイニルアゼチジノン化合物 | |
| HU187912B (en) | Process for producing new intermediates of pename-3-carboxylic acid and cepheme-4-carboxylic-acid derivatives |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MA | Patent expired | ||
| MA | Patent expired |
Owner name: ELI LILLY AND CO |