FI66174C - Foerfarande foer framstaellning av pyridinkarboxylsyra-piperazider - Google Patents
Foerfarande foer framstaellning av pyridinkarboxylsyra-piperazider Download PDFInfo
- Publication number
- FI66174C FI66174C FI782031A FI782031A FI66174C FI 66174 C FI66174 C FI 66174C FI 782031 A FI782031 A FI 782031A FI 782031 A FI782031 A FI 782031A FI 66174 C FI66174 C FI 66174C
- Authority
- FI
- Finland
- Prior art keywords
- general formula
- formula
- acid
- organic
- methyl
- Prior art date
Links
- 238000000034 method Methods 0.000 claims description 20
- SIOXPEMLGUPBBT-UHFFFAOYSA-N picolinic acid Chemical compound OC(=O)C1=CC=CC=N1 SIOXPEMLGUPBBT-UHFFFAOYSA-N 0.000 claims description 16
- 238000002360 preparation method Methods 0.000 claims description 11
- 150000003839 salts Chemical class 0.000 claims description 10
- SJRJJKPEHAURKC-UHFFFAOYSA-N N-Methylmorpholine Chemical compound CN1CCOCC1 SJRJJKPEHAURKC-UHFFFAOYSA-N 0.000 claims description 9
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 claims description 9
- GLUUGHFHXGJENI-UHFFFAOYSA-N diethylenediamine Natural products C1CNCCN1 GLUUGHFHXGJENI-UHFFFAOYSA-N 0.000 claims description 7
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 claims description 6
- 239000002253 acid Substances 0.000 claims description 5
- 239000000203 mixture Substances 0.000 claims description 5
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 4
- -1 chloroformic acid ester Chemical class 0.000 claims description 4
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 4
- IULDWWUGMGLWOB-UHFFFAOYSA-N piperazin-1-yl(pyridin-2-yl)methanone Chemical class C=1C=CC=NC=1C(=O)N1CCNCC1 IULDWWUGMGLWOB-UHFFFAOYSA-N 0.000 claims description 4
- 150000004885 piperazines Chemical class 0.000 claims description 4
- 238000000926 separation method Methods 0.000 claims description 4
- 125000000217 alkyl group Chemical group 0.000 claims description 3
- 239000012442 inert solvent Substances 0.000 claims description 3
- 150000007529 inorganic bases Chemical class 0.000 claims description 3
- 125000004432 carbon atom Chemical group C* 0.000 claims description 2
- 150000007530 organic bases Chemical class 0.000 claims description 2
- 150000003512 tertiary amines Chemical class 0.000 claims description 2
- 150000008044 alkali metal hydroxides Chemical class 0.000 claims 1
- 239000002585 base Substances 0.000 claims 1
- 229910017053 inorganic salt Inorganic materials 0.000 claims 1
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 21
- 238000006243 chemical reaction Methods 0.000 description 13
- 150000001875 compounds Chemical class 0.000 description 7
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 6
- 239000011541 reaction mixture Substances 0.000 description 6
- 238000002844 melting Methods 0.000 description 4
- 230000008018 melting Effects 0.000 description 4
- IQXXEPZFOOTTBA-UHFFFAOYSA-N 1-benzylpiperazine Chemical compound C=1C=CC=CC=1CN1CCNCC1 IQXXEPZFOOTTBA-UHFFFAOYSA-N 0.000 description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- 239000000047 product Substances 0.000 description 3
- 239000007858 starting material Substances 0.000 description 3
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 3
- PVOAHINGSUIXLS-UHFFFAOYSA-N 1-Methylpiperazine Chemical compound CN1CCNCC1 PVOAHINGSUIXLS-UHFFFAOYSA-N 0.000 description 2
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 2
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 2
- PVNIIMVLHYAWGP-UHFFFAOYSA-N Niacin Chemical compound OC(=O)C1=CC=CN=C1 PVNIIMVLHYAWGP-UHFFFAOYSA-N 0.000 description 2
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 2
- 238000009835 boiling Methods 0.000 description 2
- 150000004683 dihydrates Chemical class 0.000 description 2
- RIFGWPKJUGCATF-UHFFFAOYSA-N ethyl chloroformate Chemical compound CCOC(Cl)=O RIFGWPKJUGCATF-UHFFFAOYSA-N 0.000 description 2
- 239000012467 final product Substances 0.000 description 2
- 238000004508 fractional distillation Methods 0.000 description 2
- TWBYWOBDOCUKOW-UHFFFAOYSA-N isonicotinic acid Chemical compound OC(=O)C1=CC=NC=C1 TWBYWOBDOCUKOW-UHFFFAOYSA-N 0.000 description 2
- 238000000746 purification Methods 0.000 description 2
- 238000007086 side reaction Methods 0.000 description 2
- SCYULBFZEHDVBN-UHFFFAOYSA-N 1,1-Dichloroethane Chemical compound CC(Cl)Cl SCYULBFZEHDVBN-UHFFFAOYSA-N 0.000 description 1
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 229910021529 ammonia Inorganic materials 0.000 description 1
- 230000001430 anti-depressive effect Effects 0.000 description 1
- 239000000935 antidepressant agent Substances 0.000 description 1
- 229940005513 antidepressants Drugs 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 239000006227 byproduct Substances 0.000 description 1
- 230000000911 decarboxylating effect Effects 0.000 description 1
- 230000002526 effect on cardiovascular system Effects 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- 230000002349 favourable effect Effects 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- VZCYOOQTPOCHFL-OWOJBTEDSA-M fumarate(1-) Chemical compound OC(=O)\C=C\C([O-])=O VZCYOOQTPOCHFL-OWOJBTEDSA-M 0.000 description 1
- 229910052739 hydrogen Inorganic materials 0.000 description 1
- BTJRKNUKPQBLAL-UHFFFAOYSA-N hydron;4-methylmorpholine;chloride Chemical compound Cl.CN1CCOCC1 BTJRKNUKPQBLAL-UHFFFAOYSA-N 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- 239000000155 melt Substances 0.000 description 1
- XMJHPCRAQCTCFT-UHFFFAOYSA-N methyl chloroformate Chemical compound COC(Cl)=O XMJHPCRAQCTCFT-UHFFFAOYSA-N 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- 125000000896 monocarboxylic acid group Chemical group 0.000 description 1
- 229960003512 nicotinic acid Drugs 0.000 description 1
- 235000001968 nicotinic acid Nutrition 0.000 description 1
- 239000011664 nicotinic acid Substances 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- XAEFZNCEHLXOMS-UHFFFAOYSA-M potassium benzoate Chemical compound [K+].[O-]C(=O)C1=CC=CC=C1 XAEFZNCEHLXOMS-UHFFFAOYSA-M 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- UJJLJRQIPMGXEZ-UHFFFAOYSA-N tetrahydro-2-furoic acid Chemical compound OC(=O)C1CCCO1 UJJLJRQIPMGXEZ-UHFFFAOYSA-N 0.000 description 1
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 1
- 238000005292 vacuum distillation Methods 0.000 description 1
- 230000004580 weight loss Effects 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/60—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D213/78—Carbon atoms having three bonds to hetero atoms, with at the most one bond to halogen, e.g. ester or nitrile radicals
- C07D213/81—Amides; Imides
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pyridine Compounds (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| HU77EE2510A HU175075B (hu) | 1977-06-30 | 1977-06-30 | Sposob poluchenija piperazidov piridin-karbonovoj kisloty |
| HUEE002510 | 1977-06-30 |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| FI782031A7 FI782031A7 (fi) | 1978-12-31 |
| FI66174B FI66174B (fi) | 1984-05-31 |
| FI66174C true FI66174C (fi) | 1984-09-10 |
Family
ID=10995734
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| FI782031A FI66174C (fi) | 1977-06-30 | 1978-06-26 | Foerfarande foer framstaellning av pyridinkarboxylsyra-piperazider |
Country Status (15)
| Country | Link |
|---|---|
| JP (1) | JPS5414985A (OSRAM) |
| AT (1) | AT365172B (OSRAM) |
| CA (1) | CA1103252A (OSRAM) |
| CH (1) | CH634572A5 (OSRAM) |
| CS (1) | CS199212B2 (OSRAM) |
| DD (1) | DD136136A5 (OSRAM) |
| DE (1) | DE2828888A1 (OSRAM) |
| DK (1) | DK148771C (OSRAM) |
| FI (1) | FI66174C (OSRAM) |
| GB (1) | GB2001062B (OSRAM) |
| HU (1) | HU175075B (OSRAM) |
| PL (1) | PL110336B1 (OSRAM) |
| SE (1) | SE429042B (OSRAM) |
| SU (1) | SU715023A3 (OSRAM) |
| YU (1) | YU40711B (OSRAM) |
Families Citing this family (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3985066A (en) * | 1975-05-15 | 1976-10-12 | S&S Corrugated Paper Machinery Co., Inc. | Single point means for slotter adjustment |
| DE10035908A1 (de) | 2000-07-21 | 2002-03-07 | Asta Medica Ag | Neue Heteroaryl-Derivate und deren Verwendung als Arzneimittel |
| EP1389189A2 (en) | 2001-05-22 | 2004-02-18 | Neurogen Corporation | Melanin concentrating hormone receptor ligands: substituted 1-benzyl-4-aryl piperazine analogues |
| CN105693601A (zh) * | 2009-08-24 | 2016-06-22 | 纽若斯丹公司 | 神经刺激性哌嗪的合成 |
Family Cites Families (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3865828A (en) * | 1972-03-22 | 1975-02-11 | Egyt Gyogyszervegyeszeti Gyar | Pyridine derivatives having antidepressant activity |
| GB1451994A (en) * | 1973-07-20 | 1976-10-06 | Smithe Machine Co Inc F L | Method and apparatus for cutting and applying patches |
| JPS5144957A (ja) * | 1974-10-14 | 1976-04-16 | Matsushita Electric Works Ltd | Dejitarutokei |
| JPS5246080A (en) * | 1975-10-06 | 1977-04-12 | Taiho Yakuhin Kogyo Kk | Preparation of pyridinecarbonyl aminoalkyl thiols |
-
1977
- 1977-06-30 HU HU77EE2510A patent/HU175075B/hu not_active IP Right Cessation
-
1978
- 1978-06-20 CA CA305,894A patent/CA1103252A/en not_active Expired
- 1978-06-21 AT AT0453178A patent/AT365172B/de active
- 1978-06-26 YU YU1499/78A patent/YU40711B/xx unknown
- 1978-06-26 DK DK285178A patent/DK148771C/da not_active IP Right Cessation
- 1978-06-26 SU SU782628948A patent/SU715023A3/ru active
- 1978-06-26 FI FI782031A patent/FI66174C/fi not_active IP Right Cessation
- 1978-06-28 GB GB7828118A patent/GB2001062B/en not_active Expired
- 1978-06-28 DD DD78206341A patent/DD136136A5/xx not_active IP Right Cessation
- 1978-06-29 CH CH709078A patent/CH634572A5/de not_active IP Right Cessation
- 1978-06-29 CS CS784300A patent/CS199212B2/cs unknown
- 1978-06-29 PL PL1978208009A patent/PL110336B1/pl unknown
- 1978-06-29 SE SE7807383A patent/SE429042B/sv not_active IP Right Cessation
- 1978-06-29 JP JP7918978A patent/JPS5414985A/ja active Granted
- 1978-06-30 DE DE19782828888 patent/DE2828888A1/de active Granted
Also Published As
| Publication number | Publication date |
|---|---|
| CS199212B2 (en) | 1980-07-31 |
| HU175075B (hu) | 1980-05-28 |
| DK285178A (da) | 1978-12-31 |
| YU40711B (en) | 1986-04-30 |
| DK148771C (da) | 1986-03-10 |
| SE7807383L (sv) | 1978-12-31 |
| CA1103252A (en) | 1981-06-16 |
| PL110336B1 (en) | 1980-07-31 |
| JPS6152826B2 (OSRAM) | 1986-11-14 |
| CH634572A5 (de) | 1983-02-15 |
| FI66174B (fi) | 1984-05-31 |
| FI782031A7 (fi) | 1978-12-31 |
| PL208009A1 (pl) | 1979-05-07 |
| SE429042B (sv) | 1983-08-08 |
| ATA453178A (de) | 1981-05-15 |
| GB2001062A (en) | 1979-01-24 |
| DD136136A5 (de) | 1979-06-20 |
| DE2828888A1 (de) | 1979-01-18 |
| SU715023A3 (ru) | 1980-02-05 |
| DE2828888C2 (OSRAM) | 1987-10-29 |
| JPS5414985A (en) | 1979-02-03 |
| AT365172B (de) | 1981-12-28 |
| GB2001062B (en) | 1982-02-24 |
| DK148771B (da) | 1985-09-23 |
| YU149978A (en) | 1982-10-31 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| AU2010289802C1 (en) | Synthesis of a neurostimulative piperazine | |
| Sugimoto et al. | Activation of dithiocarbamate by 2-halothiazolium salts | |
| US3926976A (en) | 3,4-Dihydro-1,2,3-oxathiazine-4-ones and a process for their preparation | |
| SU521837A3 (ru) | Способ получени производных бензиламина или их солей | |
| US4032559A (en) | N,2-dicyanoacetimidates | |
| FI66174C (fi) | Foerfarande foer framstaellning av pyridinkarboxylsyra-piperazider | |
| US5977381A (en) | Process for making 3-amino-pyrolidine derivatives | |
| US4990232A (en) | Process for the preparation of carbodiimides | |
| JPS63145284A (ja) | イミダゾール誘導体およびその製法 | |
| JPS594422B2 (ja) | N−クロルホルミル炭酸アミドの製法 | |
| WO1992013835A1 (fr) | Sel d'acide dithiocarbamique, sa production, et production d'isothiocyanate a partir dudit sel | |
| IE51151B1 (en) | 2-guanidinothiazole derivatives | |
| US5654429A (en) | Method for the preparation of 3-amino-2-chloro-4-alkylpyridines | |
| KR20000067979A (ko) | 2-이미다졸린-5-온 제조용 중간체 | |
| US6147215A (en) | Process for producing 1-chlorocarbonyl-4-piperidinopiperidine or hydrochloride thereof | |
| CN119735562B (zh) | 一种噁唑啉类化合物的合成方法 | |
| CN118638038B (zh) | 一种n-n轴手性吲哚酰胺类化合物及其合成方法 | |
| IE922433A1 (en) | Process for preparing 13&-cinnamoyl-baccatine iii or - 10-¹deacetylbaccatine iii | |
| US3810900A (en) | Pyridine bis(dithiocarbamate)derivatives and preparation thereof | |
| EP0598396B1 (en) | Improved method for the preparation of 3-Amino-2-chloro-4-alkylpyridines | |
| MXPA06014373A (es) | Metodos para preparar irinotecan. | |
| Gong et al. | A convenient method for the synthesis of 2-oxazolidinones from ethylene carbonate and primary aryl amines | |
| KR100368895B1 (ko) | 1,2,3,9-테트라하이드로-9-메틸-3-[(2-메틸-1h-이미다졸-1-일)메틸]-4h-카바졸-4-온의 제조방법 | |
| SU523634A3 (ru) | Способ получени производных бензиламина или их солей | |
| FI73412C (fi) | 2-metoxi-4-amino-5-alkyltio- (eller alkylsulfonyl)benzoesyraderivat. |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MM | Patent lapsed |
Owner name: E GY T GYOGYSZERVEGYESZETI GYOER |