FI66001C - Foerfarande foer framstaellning av 3-aminoetyltio-6-(1-hydroxietyl)-1-azabicyklo(3.2.0)hept-2-en-7-on-2-karboxylsyra och dess farmaceutiskt godtagbara salter och estrar - Google Patents
Foerfarande foer framstaellning av 3-aminoetyltio-6-(1-hydroxietyl)-1-azabicyklo(3.2.0)hept-2-en-7-on-2-karboxylsyra och dess farmaceutiskt godtagbara salter och estrar Download PDFInfo
- Publication number
- FI66001C FI66001C FI791378A FI791378A FI66001C FI 66001 C FI66001 C FI 66001C FI 791378 A FI791378 A FI 791378A FI 791378 A FI791378 A FI 791378A FI 66001 C FI66001 C FI 66001C
- Authority
- FI
- Finland
- Prior art keywords
- tai
- mmol
- formula
- tert
- solution
- Prior art date
Links
- 238000000034 method Methods 0.000 title claims description 6
- 150000003839 salts Chemical class 0.000 title claims description 6
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 claims description 100
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 claims description 33
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 claims description 32
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 claims description 28
- -1 methanesulfonic anhydride sulfonyl chloride Chemical compound 0.000 claims description 28
- 239000002904 solvent Substances 0.000 claims description 25
- 238000002360 preparation method Methods 0.000 claims description 23
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 claims description 18
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 claims description 16
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 claims description 15
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 claims description 15
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 claims description 14
- 150000001875 compounds Chemical class 0.000 claims description 14
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 claims description 12
- JGFZNNIVVJXRND-UHFFFAOYSA-N N,N-Diisopropylethylamine (DIPEA) Chemical compound CCN(C(C)C)C(C)C JGFZNNIVVJXRND-UHFFFAOYSA-N 0.000 claims description 9
- 125000006503 p-nitrobenzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1[N+]([O-])=O)C([H])([H])* 0.000 claims description 8
- 239000003054 catalyst Substances 0.000 claims description 7
- 125000004066 1-hydroxyethyl group Chemical group [H]OC([H])([*])C([H])([H])[H] 0.000 claims description 6
- WKDDRNSBRWANNC-UHFFFAOYSA-N 3-(2-azaniumylethylsulfanyl)-6-(1-hydroxyethyl)-7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate Chemical compound C1C(SCCN)=C(C(O)=O)N2C(=O)C(C(O)C)C21 WKDDRNSBRWANNC-UHFFFAOYSA-N 0.000 claims description 6
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 claims description 6
- 239000003795 chemical substances by application Substances 0.000 claims description 6
- VHYFNPMBLIVWCW-UHFFFAOYSA-N 4-Dimethylaminopyridine Chemical compound CN(C)C1=CC=NC=C1 VHYFNPMBLIVWCW-UHFFFAOYSA-N 0.000 claims description 4
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 claims description 4
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 claims description 4
- 150000002148 esters Chemical class 0.000 claims description 4
- 239000001257 hydrogen Substances 0.000 claims description 4
- 229910052739 hydrogen Inorganic materials 0.000 claims description 4
- CTSLXHKWHWQRSH-UHFFFAOYSA-N oxalyl chloride Chemical compound ClC(=O)C(Cl)=O CTSLXHKWHWQRSH-UHFFFAOYSA-N 0.000 claims description 4
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 claims description 4
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 claims description 4
- PDVFSPNIEOYOQL-UHFFFAOYSA-N (4-methylphenyl)sulfonyl 4-methylbenzenesulfonate Chemical compound C1=CC(C)=CC=C1S(=O)(=O)OS(=O)(=O)C1=CC=C(C)C=C1 PDVFSPNIEOYOQL-UHFFFAOYSA-N 0.000 claims description 3
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 claims description 3
- UIIMBOGNXHQVGW-DEQYMQKBSA-M Sodium bicarbonate-14C Chemical compound [Na+].O[14C]([O-])=O UIIMBOGNXHQVGW-DEQYMQKBSA-M 0.000 claims description 3
- 229910052763 palladium Inorganic materials 0.000 claims description 3
- ITDJKCJYYAQMRO-UHFFFAOYSA-L rhodium(2+);diacetate Chemical compound [Rh+2].CC([O-])=O.CC([O-])=O ITDJKCJYYAQMRO-UHFFFAOYSA-L 0.000 claims description 3
- KUQSHRXUEGEMBF-UHFFFAOYSA-N (4-nitrophenyl)sulfonyl 4-nitrobenzenesulfonate Chemical compound C1=CC([N+](=O)[O-])=CC=C1S(=O)(=O)OS(=O)(=O)C1=CC=C([N+]([O-])=O)C=C1 KUQSHRXUEGEMBF-UHFFFAOYSA-N 0.000 claims description 2
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 2
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 claims description 2
- 230000010933 acylation Effects 0.000 claims description 2
- 238000005917 acylation reaction Methods 0.000 claims description 2
- 229910052802 copper Inorganic materials 0.000 claims description 2
- 239000010949 copper Substances 0.000 claims description 2
- ARUVKPQLZAKDPS-UHFFFAOYSA-L copper(II) sulfate Chemical compound [Cu+2].[O-][S+2]([O-])([O-])[O-] ARUVKPQLZAKDPS-UHFFFAOYSA-L 0.000 claims description 2
- 230000002140 halogenating effect Effects 0.000 claims description 2
- 230000026030 halogenation Effects 0.000 claims description 2
- 238000005658 halogenation reaction Methods 0.000 claims description 2
- GNOIPBMMFNIUFM-UHFFFAOYSA-N hexamethylphosphoric triamide Chemical compound CN(C)P(=O)(N(C)C)N(C)C GNOIPBMMFNIUFM-UHFFFAOYSA-N 0.000 claims description 2
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 2
- YJVFFLUZDVXJQI-UHFFFAOYSA-L palladium(ii) acetate Chemical compound [Pd+2].CC([O-])=O.CC([O-])=O YJVFFLUZDVXJQI-UHFFFAOYSA-L 0.000 claims description 2
- 239000011591 potassium Substances 0.000 claims description 2
- 229910052700 potassium Inorganic materials 0.000 claims description 2
- 229910000027 potassium carbonate Inorganic materials 0.000 claims description 2
- 125000006239 protecting group Chemical group 0.000 claims description 2
- 239000007858 starting material Substances 0.000 claims description 2
- RIOQSEWOXXDEQQ-UHFFFAOYSA-N triphenylphosphine Chemical compound C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 RIOQSEWOXXDEQQ-UHFFFAOYSA-N 0.000 claims description 2
- ZPUCINDJVBIVPJ-LJISPDSOSA-N cocaine Chemical compound O([C@H]1C[C@@H]2CC[C@@H](N2C)[C@H]1C(=O)OC)C(=O)C1=CC=CC=C1 ZPUCINDJVBIVPJ-LJISPDSOSA-N 0.000 claims 2
- ZFFMLCVRJBZUDZ-UHFFFAOYSA-N 2,3-dimethylbutane Chemical group CC(C)C(C)C ZFFMLCVRJBZUDZ-UHFFFAOYSA-N 0.000 claims 1
- FDHRGQIRBRQMPF-UHFFFAOYSA-N 2h-pyridin-1-amine Chemical compound NN1CC=CC=C1 FDHRGQIRBRQMPF-UHFFFAOYSA-N 0.000 claims 1
- CSKRBHOAJUMOKJ-UHFFFAOYSA-N 3,4-diacetylhexane-2,5-dione Chemical compound CC(=O)C(C(C)=O)C(C(C)=O)C(C)=O CSKRBHOAJUMOKJ-UHFFFAOYSA-N 0.000 claims 1
- KMUWWBNTTNUCDI-UHFFFAOYSA-N 5-amino-1h-imidazo[4,5-d][1,3]oxazin-7-one Chemical compound O=C1OC(N)=NC2=C1N=CN2 KMUWWBNTTNUCDI-UHFFFAOYSA-N 0.000 claims 1
- CQUWXWBXHVKQBR-UHFFFAOYSA-N C1(=CC=CC=C1)[ClH]P([ClH]C1=CC=CC=C1)[ClH]C1=CC=CC=C1 Chemical compound C1(=CC=CC=C1)[ClH]P([ClH]C1=CC=CC=C1)[ClH]C1=CC=CC=C1 CQUWXWBXHVKQBR-UHFFFAOYSA-N 0.000 claims 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 claims 1
- 241000792859 Enema Species 0.000 claims 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 claims 1
- QNAYBMKLOCPYGJ-REOHCLBHSA-N L-alanine Chemical compound C[C@H](N)C(O)=O QNAYBMKLOCPYGJ-REOHCLBHSA-N 0.000 claims 1
- UEZICNJAMKJQMZ-UHFFFAOYSA-N [2,4,6-tri(propan-2-yl)phenyl]sulfonyl 2,4,6-tri(propan-2-yl)benzenesulfonate Chemical compound CC(C)C1=CC(C(C)C)=CC(C(C)C)=C1S(=O)(=O)OS(=O)(=O)C1=C(C(C)C)C=C(C(C)C)C=C1C(C)C UEZICNJAMKJQMZ-UHFFFAOYSA-N 0.000 claims 1
- 235000004279 alanine Nutrition 0.000 claims 1
- 229960003920 cocaine Drugs 0.000 claims 1
- 229910000365 copper sulfate Inorganic materials 0.000 claims 1
- 239000007920 enema Substances 0.000 claims 1
- 229940095399 enema Drugs 0.000 claims 1
- 125000004185 ester group Chemical group 0.000 claims 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 claims 1
- 125000000896 monocarboxylic acid group Chemical group 0.000 claims 1
- 238000000746 purification Methods 0.000 claims 1
- 229910052703 rhodium Inorganic materials 0.000 claims 1
- 239000010948 rhodium Substances 0.000 claims 1
- MHOVAHRLVXNVSD-UHFFFAOYSA-N rhodium atom Chemical compound [Rh] MHOVAHRLVXNVSD-UHFFFAOYSA-N 0.000 claims 1
- 238000007363 ring formation reaction Methods 0.000 claims 1
- 229910052708 sodium Inorganic materials 0.000 claims 1
- 239000011734 sodium Substances 0.000 claims 1
- 239000000243 solution Substances 0.000 description 60
- 239000000203 mixture Substances 0.000 description 41
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 35
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 33
- 125000001981 tert-butyldimethylsilyl group Chemical group [H]C([H])([H])[Si]([H])(C([H])([H])[H])[*]C(C([H])([H])[H])(C([H])([H])[H])C([H])([H])[H] 0.000 description 21
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 21
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 18
- 238000005481 NMR spectroscopy Methods 0.000 description 16
- 239000012267 brine Substances 0.000 description 16
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 16
- 235000019341 magnesium sulphate Nutrition 0.000 description 16
- 239000003208 petroleum Substances 0.000 description 16
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 16
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 14
- 239000000460 chlorine Substances 0.000 description 13
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 12
- 239000011541 reaction mixture Substances 0.000 description 12
- 239000000741 silica gel Substances 0.000 description 12
- 229910002027 silica gel Inorganic materials 0.000 description 12
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 11
- 239000000706 filtrate Substances 0.000 description 10
- OKKJLVBELUTLKV-UHFFFAOYSA-N methanol Substances OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 10
- 229920006395 saturated elastomer Polymers 0.000 description 10
- 239000007787 solid Substances 0.000 description 10
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 9
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 9
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 8
- 101100054666 Streptomyces halstedii sch3 gene Proteins 0.000 description 8
- 239000003921 oil Substances 0.000 description 8
- 235000019198 oils Nutrition 0.000 description 8
- 239000012074 organic phase Substances 0.000 description 7
- 239000002244 precipitate Substances 0.000 description 7
- MNFORVFSTILPAW-UHFFFAOYSA-N azetidin-2-one Chemical compound O=C1CCN1 MNFORVFSTILPAW-UHFFFAOYSA-N 0.000 description 6
- 238000001816 cooling Methods 0.000 description 6
- UAOMVDZJSHZZME-UHFFFAOYSA-N diisopropylamine Chemical compound CC(C)NC(C)C UAOMVDZJSHZZME-UHFFFAOYSA-N 0.000 description 6
- NLKNQRATVPKPDG-UHFFFAOYSA-M potassium iodide Chemical compound [K+].[I-] NLKNQRATVPKPDG-UHFFFAOYSA-M 0.000 description 6
- 235000017557 sodium bicarbonate Nutrition 0.000 description 6
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 6
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 5
- MZRVEZGGRBJDDB-UHFFFAOYSA-N N-Butyllithium Chemical compound [Li]CCCC MZRVEZGGRBJDDB-UHFFFAOYSA-N 0.000 description 5
- WKDDRNSBRWANNC-ATRFCDNQSA-N Thienamycin Chemical compound C1C(SCCN)=C(C(O)=O)N2C(=O)[C@H]([C@H](O)C)[C@H]21 WKDDRNSBRWANNC-ATRFCDNQSA-N 0.000 description 5
- 238000006243 chemical reaction Methods 0.000 description 5
- 239000013078 crystal Substances 0.000 description 5
- 238000001819 mass spectrum Methods 0.000 description 5
- 125000003118 aryl group Chemical group 0.000 description 4
- 229910052757 nitrogen Inorganic materials 0.000 description 4
- 238000003756 stirring Methods 0.000 description 4
- 238000005406 washing Methods 0.000 description 4
- QHSNSUAFJJIIQW-VKHMYHEASA-N (4s)-4-(iodomethyl)azetidin-2-one Chemical compound IC[C@@H]1CC(=O)N1 QHSNSUAFJJIIQW-VKHMYHEASA-N 0.000 description 3
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 3
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- 239000008346 aqueous phase Substances 0.000 description 3
- 230000015572 biosynthetic process Effects 0.000 description 3
- 239000003153 chemical reaction reagent Substances 0.000 description 3
- 239000000047 product Substances 0.000 description 3
- FVAUCKIRQBBSSJ-UHFFFAOYSA-M sodium iodide Chemical compound [Na+].[I-] FVAUCKIRQBBSSJ-UHFFFAOYSA-M 0.000 description 3
- 238000003786 synthesis reaction Methods 0.000 description 3
- VGOMWQZLDKSLPY-JHJVBQTASA-N (3s,4r)-1-[tert-butyl(dimethyl)silyl]-3-[(1r)-1-hydroxyethyl]-4-[2,2,2-tris(methylsulfanyl)ethyl]azetidin-2-one Chemical compound CSC(SC)(SC)C[C@@H]1[C@@H]([C@@H](C)O)C(=O)N1[Si](C)(C)C(C)(C)C VGOMWQZLDKSLPY-JHJVBQTASA-N 0.000 description 2
- MQCGNFNQASAUNW-CHWSQXEVSA-N (3s,4r)-3-acetyl-1-[tert-butyl(dimethyl)silyl]-4-[2,2,2-tris(methylsulfanyl)ethyl]azetidin-2-one Chemical compound CSC(SC)(SC)C[C@@H]1[C@@H](C(C)=O)C(=O)N1[Si](C)(C)C(C)(C)C MQCGNFNQASAUNW-CHWSQXEVSA-N 0.000 description 2
- FUCNGCRKBIBOBV-QMMMGPOBSA-N (4s)-1-[tert-butyl(dimethyl)silyl]-4-(iodomethyl)azetidin-2-one Chemical compound CC(C)(C)[Si](C)(C)N1[C@H](CI)CC1=O FUCNGCRKBIBOBV-QMMMGPOBSA-N 0.000 description 2
- RFBOSMWISNYWGW-BZUAXINKSA-N 2-[(2r,3s)-1-[tert-butyl(dimethyl)silyl]-3-[(1r)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-oxoazetidin-2-yl]acetaldehyde Chemical compound CC(C)(C)[Si](C)(C)O[C@H](C)[C@@H]1[C@@H](CC=O)N([Si](C)(C)C(C)(C)C)C1=O RFBOSMWISNYWGW-BZUAXINKSA-N 0.000 description 2
- IKHGUXGNUITLKF-UHFFFAOYSA-N Acetaldehyde Chemical compound CC=O IKHGUXGNUITLKF-UHFFFAOYSA-N 0.000 description 2
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical compound [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 2
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 2
- GJMNDGSMSZLFFN-BYPYZUCNSA-N [(2s)-4-oxoazetidin-2-yl]methyl methanesulfonate Chemical compound CS(=O)(=O)OC[C@@H]1CC(=O)N1 GJMNDGSMSZLFFN-BYPYZUCNSA-N 0.000 description 2
- 229960000583 acetic acid Drugs 0.000 description 2
- 238000004458 analytical method Methods 0.000 description 2
- WGLLBHSIXLWVFU-VIFPVBQESA-N benzyl (2s)-4-oxoazetidine-2-carboxylate Chemical compound O=C([C@H]1NC(=O)C1)OCC1=CC=CC=C1 WGLLBHSIXLWVFU-VIFPVBQESA-N 0.000 description 2
- QUKGYYKBILRGFE-UHFFFAOYSA-N benzyl acetate Chemical compound CC(=O)OCC1=CC=CC=C1 QUKGYYKBILRGFE-UHFFFAOYSA-N 0.000 description 2
- WORJEOGGNQDSOE-UHFFFAOYSA-N chloroform;methanol Chemical compound OC.ClC(Cl)Cl WORJEOGGNQDSOE-UHFFFAOYSA-N 0.000 description 2
- IJOOHPMOJXWVHK-UHFFFAOYSA-N chlorotrimethylsilane Chemical compound C[Si](C)(C)Cl IJOOHPMOJXWVHK-UHFFFAOYSA-N 0.000 description 2
- BQAMWLOABQRMAO-INIZCTEOSA-N dibenzyl (2s)-2-aminobutanedioate Chemical compound C([C@H](N)C(=O)OCC=1C=CC=CC=1)C(=O)OCC1=CC=CC=C1 BQAMWLOABQRMAO-INIZCTEOSA-N 0.000 description 2
- 229940043279 diisopropylamine Drugs 0.000 description 2
- 239000011521 glass Substances 0.000 description 2
- 238000005984 hydrogenation reaction Methods 0.000 description 2
- 239000000543 intermediate Substances 0.000 description 2
- 229910052744 lithium Inorganic materials 0.000 description 2
- 239000012280 lithium aluminium hydride Substances 0.000 description 2
- ZCSHNCUQKCANBX-UHFFFAOYSA-N lithium diisopropylamide Chemical compound [Li+].CC(C)[N-]C(C)C ZCSHNCUQKCANBX-UHFFFAOYSA-N 0.000 description 2
- 125000002816 methylsulfanyl group Chemical group [H]C([H])([H])S[*] 0.000 description 2
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 2
- 239000012071 phase Substances 0.000 description 2
- 238000001953 recrystallisation Methods 0.000 description 2
- 239000012279 sodium borohydride Substances 0.000 description 2
- 229910000033 sodium borohydride Inorganic materials 0.000 description 2
- 239000000725 suspension Substances 0.000 description 2
- BCNZYOJHNLTNEZ-UHFFFAOYSA-N tert-butyldimethylsilyl chloride Chemical compound CC(C)(C)[Si](C)(C)Cl BCNZYOJHNLTNEZ-UHFFFAOYSA-N 0.000 description 2
- QAEDZJGFFMLHHQ-UHFFFAOYSA-N trifluoroacetic anhydride Chemical compound FC(F)(F)C(=O)OC(=O)C(F)(F)F QAEDZJGFFMLHHQ-UHFFFAOYSA-N 0.000 description 2
- CWGBFIRHYJNILV-UHFFFAOYSA-N (1,4-diphenyl-1,2,4-triazol-4-ium-3-yl)-phenylazanide Chemical compound C=1C=CC=CC=1[N-]C1=NN(C=2C=CC=CC=2)C=[N+]1C1=CC=CC=C1 CWGBFIRHYJNILV-UHFFFAOYSA-N 0.000 description 1
- WSVPCPKKQRAKMA-XTWCZFFVSA-N (4-nitrophenyl)methyl 2-diazo-4-[(2R,3S)-3-[(1R)-1-hydroxyethyl]-4-oxoazetidin-2-yl]-3-oxobutanoate Chemical compound C[C@@H](O)[C@@H]1[C@@H](CC(=O)C(=[N+]=[N-])C(=O)OCc2ccc(cc2)[N+]([O-])=O)NC1=O WSVPCPKKQRAKMA-XTWCZFFVSA-N 0.000 description 1
- OPNFCMKBKRDZFG-UHFFFAOYSA-N (4-nitrophenyl)methyl 3-hydroxy-4-(2-oxoazetidin-1-yl)butanoate Chemical compound [N+](=O)([O-])C1=CC=C(COC(=O)CC(CN2C(CC2)=O)O)C=C1 OPNFCMKBKRDZFG-UHFFFAOYSA-N 0.000 description 1
- HNPDDIQHIZOWOL-RZPHLTDDSA-N (4-nitrophenyl)methyl 4-[(2r,3s)-1-[tert-butyl(dimethyl)silyl]-3-[(1r)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-oxoazetidin-2-yl]-3-oxobutanoate Chemical compound CC(C)(C)[Si](C)(C)N1C(=O)[C@H]([C@H](O[Si](C)(C)C(C)(C)C)C)[C@H]1CC(=O)CC(=O)OCC1=CC=C([N+]([O-])=O)C=C1 HNPDDIQHIZOWOL-RZPHLTDDSA-N 0.000 description 1
- MHSGOABISYIYKP-UHFFFAOYSA-N (4-nitrophenyl)methyl carbonochloridate Chemical compound [O-][N+](=O)C1=CC=C(COC(Cl)=O)C=C1 MHSGOABISYIYKP-UHFFFAOYSA-N 0.000 description 1
- NDQNQSYMVOBIQW-NSHDSACASA-N (4s)-1-[tert-butyl(dimethyl)silyl]-4-[2,2,2-tris(methylsulfanyl)ethyl]azetidin-2-one Chemical compound CSC(SC)(SC)C[C@@H]1CC(=O)N1[Si](C)(C)C(C)(C)C NDQNQSYMVOBIQW-NSHDSACASA-N 0.000 description 1
- YTUSUDPOSFRAEO-VKHMYHEASA-N (4s)-4-(hydroxymethyl)azetidin-2-one Chemical compound OC[C@@H]1CC(=O)N1 YTUSUDPOSFRAEO-VKHMYHEASA-N 0.000 description 1
- WYEBFVQOFQAIMJ-UHFFFAOYSA-N (e)-3-diazonio-4-[(4-nitrophenyl)methoxy]-4-oxo-1-(2-oxoazetidin-1-yl)but-2-en-2-olate Chemical compound C=1C=C([N+]([O-])=O)C=CC=1COC(=O)C(\[N+]#N)=C(/[O-])CN1CCC1=O WYEBFVQOFQAIMJ-UHFFFAOYSA-N 0.000 description 1
- AHQTYUNPLZYCOL-UHFFFAOYSA-N 1,4-dioxane;ethanol;hydrate Chemical compound O.CCO.C1COCCO1 AHQTYUNPLZYCOL-UHFFFAOYSA-N 0.000 description 1
- 238000005160 1H NMR spectroscopy Methods 0.000 description 1
- NULDEVQACXJZLL-UHFFFAOYSA-N 2-(2-aminoethyldisulfanyl)ethylazanium;chloride Chemical compound Cl.NCCSSCCN NULDEVQACXJZLL-UHFFFAOYSA-N 0.000 description 1
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 1
- GFXKPZGNSSQMFN-UHFFFAOYSA-N 2-methyl-3,7-dioxoheptanoic acid Chemical compound OC(=O)C(C)C(=O)CCCC=O GFXKPZGNSSQMFN-UHFFFAOYSA-N 0.000 description 1
- HZAVSJRAODFHGF-UHFFFAOYSA-N 2-methyl-7-oxohept-2-enoic acid Chemical compound OC(=O)C(C)=CCCCC=O HZAVSJRAODFHGF-UHFFFAOYSA-N 0.000 description 1
- QVLJPRJCRHWAIE-UHFFFAOYSA-N 2-methylidene-7-oxoheptanoic acid Chemical compound OC(=O)C(=C)CCCCC=O QVLJPRJCRHWAIE-UHFFFAOYSA-N 0.000 description 1
- OWULJVXJAZBQLL-UHFFFAOYSA-N 4-azidosulfonylbenzoic acid Chemical compound OC(=O)C1=CC=C(S(=O)(=O)N=[N+]=[N-])C=C1 OWULJVXJAZBQLL-UHFFFAOYSA-N 0.000 description 1
- VOLRSQPSJGXRNJ-UHFFFAOYSA-N 4-nitrobenzyl bromide Chemical compound [O-][N+](=O)C1=CC=C(CBr)C=C1 VOLRSQPSJGXRNJ-UHFFFAOYSA-N 0.000 description 1
- 241000234282 Allium Species 0.000 description 1
- 235000002732 Allium cepa var. cepa Nutrition 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 1
- KQZYOBSVXISUKI-UHFFFAOYSA-N C1(=CC=CC=C1)[ClH]P(=O)([ClH]C1=CC=CC=C1)[ClH]C1=CC=CC=C1 Chemical compound C1(=CC=CC=C1)[ClH]P(=O)([ClH]C1=CC=CC=C1)[ClH]C1=CC=CC=C1 KQZYOBSVXISUKI-UHFFFAOYSA-N 0.000 description 1
- DBQKRCILGOLLBK-UHFFFAOYSA-N CSCCN1C(CC1)=O Chemical compound CSCCN1C(CC1)=O DBQKRCILGOLLBK-UHFFFAOYSA-N 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 1
- NOTFZGFABLVTIG-UHFFFAOYSA-N Cyclohexylethyl acetate Chemical compound CC(=O)OCCC1CCCCC1 NOTFZGFABLVTIG-UHFFFAOYSA-N 0.000 description 1
- XTHFKEDIFFGKHM-UHFFFAOYSA-N Dimethoxyethane Chemical compound COCCOC XTHFKEDIFFGKHM-UHFFFAOYSA-N 0.000 description 1
- 241000283074 Equus asinus Species 0.000 description 1
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 1
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 description 1
- XAZMYIUZZFUTAN-YYTBSQRUSA-N IC[C@@H]1CC(N1)=O.[Si](C)(C)(C(C)(C)C)N1C(C[C@H]1CI)=O Chemical compound IC[C@@H]1CC(N1)=O.[Si](C)(C)(C(C)(C)C)N1C(C[C@H]1CI)=O XAZMYIUZZFUTAN-YYTBSQRUSA-N 0.000 description 1
- 239000012359 Methanesulfonyl chloride Substances 0.000 description 1
- LSDPWZHWYPCBBB-UHFFFAOYSA-N Methanethiol Chemical compound SC LSDPWZHWYPCBBB-UHFFFAOYSA-N 0.000 description 1
- VIHYIVKEECZGOU-UHFFFAOYSA-N N-acetylimidazole Chemical compound CC(=O)N1C=CN=C1 VIHYIVKEECZGOU-UHFFFAOYSA-N 0.000 description 1
- 208000018583 New-onset refractory status epilepticus Diseases 0.000 description 1
- 235000019502 Orange oil Nutrition 0.000 description 1
- FEWJPZIEWOKRBE-UHFFFAOYSA-N Tartaric acid Natural products [H+].[H+].[O-]C(=O)C(O)C(O)C([O-])=O FEWJPZIEWOKRBE-UHFFFAOYSA-N 0.000 description 1
- 239000004809 Teflon Substances 0.000 description 1
- 229920006362 Teflon® Polymers 0.000 description 1
- HFRGQJTZPCWKDN-BYPYZUCNSA-N [(2S)-4-oxoazetidin-2-yl] methanesulfonate Chemical compound CS(=O)(=O)O[C@H]1CC(N1)=O HFRGQJTZPCWKDN-BYPYZUCNSA-N 0.000 description 1
- HLMUYZYLPUHSNV-NTISSMGPSA-N [(2s)-1,4-dioxo-1,4-bis(phenylmethoxy)butan-2-yl]azanium;4-methylbenzenesulfonate Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1.C([C@H](N)C(=O)OCC=1C=CC=CC=1)C(=O)OCC1=CC=CC=C1 HLMUYZYLPUHSNV-NTISSMGPSA-N 0.000 description 1
- XAXXTYXMWOFKLW-UHFFFAOYSA-N [C-]1=CC=[NH+]1 Chemical compound [C-]1=CC=[NH+]1 XAXXTYXMWOFKLW-UHFFFAOYSA-N 0.000 description 1
- FWBTYVYWGUQHSY-UHFFFAOYSA-L [K+].[K+].P(=O)([O-])([O-])O.O1CCCC1 Chemical compound [K+].[K+].P(=O)([O-])([O-])O.O1CCCC1 FWBTYVYWGUQHSY-UHFFFAOYSA-L 0.000 description 1
- AOMZYHXUFSLVAZ-GRZMOONWSA-N [Si](C)(C)(C(C)(C)C)O[C@H](C)C1C(NC1CC(=O)OC)=O Chemical compound [Si](C)(C)(C(C)(C)C)O[C@H](C)C1C(NC1CC(=O)OC)=O AOMZYHXUFSLVAZ-GRZMOONWSA-N 0.000 description 1
- PQFZWNNSXMOCAL-UHFFFAOYSA-N acetyl acetate;methylsulfinylmethane Chemical compound CS(C)=O.CC(=O)OC(C)=O PQFZWNNSXMOCAL-UHFFFAOYSA-N 0.000 description 1
- 125000005595 acetylacetonate group Chemical group 0.000 description 1
- 230000021736 acetylation Effects 0.000 description 1
- 238000006640 acetylation reaction Methods 0.000 description 1
- HSFWRNGVRCDJHI-UHFFFAOYSA-N alpha-acetylene Natural products C#C HSFWRNGVRCDJHI-UHFFFAOYSA-N 0.000 description 1
- IYCUCQGVEZOMMV-UHFFFAOYSA-N aminomethanethiol Chemical compound NCS IYCUCQGVEZOMMV-UHFFFAOYSA-N 0.000 description 1
- 235000019270 ammonium chloride Nutrition 0.000 description 1
- 150000008064 anhydrides Chemical class 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 229940007550 benzyl acetate Drugs 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- SIPUZPBQZHNSDW-UHFFFAOYSA-N bis(2-methylpropyl)aluminum Chemical compound CC(C)C[Al]CC(C)C SIPUZPBQZHNSDW-UHFFFAOYSA-N 0.000 description 1
- FUSUHKVFWTUUBE-UHFFFAOYSA-N buten-2-one Chemical compound CC(=O)C=C FUSUHKVFWTUUBE-UHFFFAOYSA-N 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 150000007942 carboxylates Chemical class 0.000 description 1
- 239000003638 chemical reducing agent Substances 0.000 description 1
- 229940117975 chromium trioxide Drugs 0.000 description 1
- WGLPBDUCMAPZCE-UHFFFAOYSA-N chromium trioxide Inorganic materials O=[Cr](=O)=O WGLPBDUCMAPZCE-UHFFFAOYSA-N 0.000 description 1
- TWLCEYWYILDCDA-UHFFFAOYSA-N chromium(6+) oxygen(2-) pyridine Chemical compound [O-2].[O-2].[O-2].[Cr+6].C1=CC=NC=C1.C1=CC=NC=C1 TWLCEYWYILDCDA-UHFFFAOYSA-N 0.000 description 1
- GAMDZJFZMJECOS-UHFFFAOYSA-N chromium(6+);oxygen(2-) Chemical compound [O-2].[O-2].[O-2].[Cr+6] GAMDZJFZMJECOS-UHFFFAOYSA-N 0.000 description 1
- 239000012230 colorless oil Substances 0.000 description 1
- 230000000536 complexating effect Effects 0.000 description 1
- 239000002178 crystalline material Substances 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- 238000010511 deprotection reaction Methods 0.000 description 1
- KTZKVRPAKJKHMK-IBGZPJMESA-N dibenzyl (2s)-2-(trimethylsilylamino)butanedioate Chemical compound C([C@H](N[Si](C)(C)C)C(=O)OCC=1C=CC=CC=1)C(=O)OCC1=CC=CC=C1 KTZKVRPAKJKHMK-IBGZPJMESA-N 0.000 description 1
- ZPWVASYFFYYZEW-UHFFFAOYSA-L dipotassium hydrogen phosphate Chemical compound [K+].[K+].OP([O-])([O-])=O ZPWVASYFFYYZEW-UHFFFAOYSA-L 0.000 description 1
- 229920001971 elastomer Polymers 0.000 description 1
- SRCZQMGIVIYBBJ-UHFFFAOYSA-N ethoxyethane;ethyl acetate Chemical compound CCOCC.CCOC(C)=O SRCZQMGIVIYBBJ-UHFFFAOYSA-N 0.000 description 1
- 125000002534 ethynyl group Chemical group [H]C#C* 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- FATAVLOOLIRUNA-UHFFFAOYSA-N formylmethyl Chemical group [CH2]C=O FATAVLOOLIRUNA-UHFFFAOYSA-N 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 239000012362 glacial acetic acid Substances 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- RCBVKBFIWMOMHF-UHFFFAOYSA-L hydroxy-(hydroxy(dioxo)chromio)oxy-dioxochromium;pyridine Chemical compound C1=CC=NC=C1.C1=CC=NC=C1.O[Cr](=O)(=O)O[Cr](O)(=O)=O RCBVKBFIWMOMHF-UHFFFAOYSA-L 0.000 description 1
- JJWLVOIRVHMVIS-UHFFFAOYSA-N isopropylamine Chemical compound CC(C)N JJWLVOIRVHMVIS-UHFFFAOYSA-N 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- YNESATAKKCNGOF-UHFFFAOYSA-N lithium bis(trimethylsilyl)amide Chemical compound [Li+].C[Si](C)(C)[N-][Si](C)(C)C YNESATAKKCNGOF-UHFFFAOYSA-N 0.000 description 1
- WGOPGODQLGJZGL-UHFFFAOYSA-N lithium;butane Chemical compound [Li+].CC[CH-]C WGOPGODQLGJZGL-UHFFFAOYSA-N 0.000 description 1
- OTCKOJUMXQWKQG-UHFFFAOYSA-L magnesium bromide Chemical compound [Mg+2].[Br-].[Br-] OTCKOJUMXQWKQG-UHFFFAOYSA-L 0.000 description 1
- 229910001623 magnesium bromide Inorganic materials 0.000 description 1
- FRIJBUGBVQZNTB-UHFFFAOYSA-M magnesium;ethane;bromide Chemical compound [Mg+2].[Br-].[CH2-]C FRIJBUGBVQZNTB-UHFFFAOYSA-M 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 229960002523 mercuric chloride Drugs 0.000 description 1
- LWJROJCJINYWOX-UHFFFAOYSA-L mercury dichloride Chemical compound Cl[Hg]Cl LWJROJCJINYWOX-UHFFFAOYSA-L 0.000 description 1
- UKVIEHSSVKSQBA-UHFFFAOYSA-N methane;palladium Chemical compound C.[Pd] UKVIEHSSVKSQBA-UHFFFAOYSA-N 0.000 description 1
- 229940098779 methanesulfonic acid Drugs 0.000 description 1
- QARBMVPHQWIHKH-UHFFFAOYSA-N methanesulfonyl chloride Chemical compound CS(Cl)(=O)=O QARBMVPHQWIHKH-UHFFFAOYSA-N 0.000 description 1
- GBMDVOWEEQVZKZ-UHFFFAOYSA-N methanol;hydrate Chemical compound O.OC GBMDVOWEEQVZKZ-UHFFFAOYSA-N 0.000 description 1
- XAMIDDYNDGZERX-BFYDXBDKSA-N methyl 2-[(2r,3s)-1-[tert-butyl(dimethyl)silyl]-3-[(1r)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-oxoazetidin-2-yl]acetate Chemical compound COC(=O)C[C@@H]1[C@@H]([C@@H](C)O[Si](C)(C)C(C)(C)C)C(=O)N1[Si](C)(C)C(C)(C)C XAMIDDYNDGZERX-BFYDXBDKSA-N 0.000 description 1
- FUCQXQWFUDPABY-CKYFFXLPSA-N methyl 2-[(2r,3s)-1-[tert-butyl(dimethyl)silyl]-3-[(1r)-1-hydroxyethyl]-4-oxoazetidin-2-yl]acetate Chemical compound COC(=O)C[C@@H]1[C@@H]([C@@H](C)O)C(=O)N1[Si](C)(C)C(C)(C)C FUCQXQWFUDPABY-CKYFFXLPSA-N 0.000 description 1
- JXHNFUQSUDMDTN-UHFFFAOYSA-N n,n-diethylethanamine;methylsulfinylmethane;(2,2,2-trifluoroacetyl) 2,2,2-trifluoroacetate Chemical compound CS(C)=O.CCN(CC)CC.FC(F)(F)C(=O)OC(=O)C(F)(F)F JXHNFUQSUDMDTN-UHFFFAOYSA-N 0.000 description 1
- RIVIDPPYRINTTH-UHFFFAOYSA-N n-ethylpropan-2-amine Chemical compound CCNC(C)C RIVIDPPYRINTTH-UHFFFAOYSA-N 0.000 description 1
- 239000012299 nitrogen atmosphere Substances 0.000 description 1
- 239000010502 orange oil Substances 0.000 description 1
- 125000001181 organosilyl group Chemical group [SiH3]* 0.000 description 1
- 239000007800 oxidant agent Substances 0.000 description 1
- 230000003647 oxidation Effects 0.000 description 1
- 238000007254 oxidation reaction Methods 0.000 description 1
- 230000001590 oxidative effect Effects 0.000 description 1
- 230000020477 pH reduction Effects 0.000 description 1
- NXJCBFBQEVOTOW-UHFFFAOYSA-L palladium(2+);dihydroxide Chemical compound O[Pd]O NXJCBFBQEVOTOW-UHFFFAOYSA-L 0.000 description 1
- DDBREPKUVSBGFI-UHFFFAOYSA-N phenobarbital Chemical compound C=1C=CC=CC=1C1(CC)C(=O)NC(=O)NC1=O DDBREPKUVSBGFI-UHFFFAOYSA-N 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- TYJJADVDDVDEDZ-UHFFFAOYSA-M potassium hydrogencarbonate Chemical compound [K+].OC([O-])=O TYJJADVDDVDEDZ-UHFFFAOYSA-M 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 125000002914 sec-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 235000009518 sodium iodide Nutrition 0.000 description 1
- JERVILBAYMKXRX-UHFFFAOYSA-N sodium;tris(2-methoxyethoxy)alumane Chemical compound [Na].COCCO[Al](OCCOC)OCCOC JERVILBAYMKXRX-UHFFFAOYSA-N 0.000 description 1
- 239000012258 stirred mixture Substances 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 235000002906 tartaric acid Nutrition 0.000 description 1
- 239000011975 tartaric acid Substances 0.000 description 1
- 238000006257 total synthesis reaction Methods 0.000 description 1
- ILWRPSCZWQJDMK-UHFFFAOYSA-N triethylazanium;chloride Chemical compound Cl.CCN(CC)CC ILWRPSCZWQJDMK-UHFFFAOYSA-N 0.000 description 1
- 239000005051 trimethylchlorosilane Substances 0.000 description 1
- YFMZQCCTZUJXEB-UHFFFAOYSA-N tris(methylsulfanyl)methane Chemical compound CSC(SC)SC YFMZQCCTZUJXEB-UHFFFAOYSA-N 0.000 description 1
- 230000001755 vocal effect Effects 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D477/00—Heterocyclic compounds containing 1-azabicyclo [3.2.0] heptane ring systems, i.e. compounds containing a ring system of the formula:, e.g. carbapenicillins, thienamycins; Such ring systems being further condensed, e.g. 2,3-condensed with an oxygen-, nitrogen- or sulphur-containing hetero ring
- C07D477/10—Heterocyclic compounds containing 1-azabicyclo [3.2.0] heptane ring systems, i.e. compounds containing a ring system of the formula:, e.g. carbapenicillins, thienamycins; Such ring systems being further condensed, e.g. 2,3-condensed with an oxygen-, nitrogen- or sulphur-containing hetero ring with hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached in position 4, and with a carbon atom having three bonds to hetero atoms with at the most one bond to halogen, e.g. an ester or nitrile radical, directly attached in position 2
- C07D477/12—Heterocyclic compounds containing 1-azabicyclo [3.2.0] heptane ring systems, i.e. compounds containing a ring system of the formula:, e.g. carbapenicillins, thienamycins; Such ring systems being further condensed, e.g. 2,3-condensed with an oxygen-, nitrogen- or sulphur-containing hetero ring with hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached in position 4, and with a carbon atom having three bonds to hetero atoms with at the most one bond to halogen, e.g. an ester or nitrile radical, directly attached in position 2 with hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, attached in position 6
- C07D477/16—Heterocyclic compounds containing 1-azabicyclo [3.2.0] heptane ring systems, i.e. compounds containing a ring system of the formula:, e.g. carbapenicillins, thienamycins; Such ring systems being further condensed, e.g. 2,3-condensed with an oxygen-, nitrogen- or sulphur-containing hetero ring with hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached in position 4, and with a carbon atom having three bonds to hetero atoms with at the most one bond to halogen, e.g. an ester or nitrile radical, directly attached in position 2 with hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, attached in position 6 with hetero atoms or carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. an ester or nitrile radical, directly attached in position 3
- C07D477/20—Sulfur atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D205/00—Heterocyclic compounds containing four-membered rings with one nitrogen atom as the only ring hetero atom
- C07D205/02—Heterocyclic compounds containing four-membered rings with one nitrogen atom as the only ring hetero atom not condensed with other rings
- C07D205/06—Heterocyclic compounds containing four-membered rings with one nitrogen atom as the only ring hetero atom not condensed with other rings having one double bond between ring members or between a ring member and a non-ring member
- C07D205/08—Heterocyclic compounds containing four-membered rings with one nitrogen atom as the only ring hetero atom not condensed with other rings having one double bond between ring members or between a ring member and a non-ring member with one oxygen atom directly attached in position 2, e.g. beta-lactams
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D477/00—Heterocyclic compounds containing 1-azabicyclo [3.2.0] heptane ring systems, i.e. compounds containing a ring system of the formula:, e.g. carbapenicillins, thienamycins; Such ring systems being further condensed, e.g. 2,3-condensed with an oxygen-, nitrogen- or sulphur-containing hetero ring
- C07D477/02—Preparation
- C07D477/04—Preparation by forming the ring or condensed ring systems
-
- Y—GENERAL TAGGING OF NEW TECHNOLOGICAL DEVELOPMENTS; GENERAL TAGGING OF CROSS-SECTIONAL TECHNOLOGIES SPANNING OVER SEVERAL SECTIONS OF THE IPC; TECHNICAL SUBJECTS COVERED BY FORMER USPC CROSS-REFERENCE ART COLLECTIONS [XRACs] AND DIGESTS
- Y02—TECHNOLOGIES OR APPLICATIONS FOR MITIGATION OR ADAPTATION AGAINST CLIMATE CHANGE
- Y02P—CLIMATE CHANGE MITIGATION TECHNOLOGIES IN THE PRODUCTION OR PROCESSING OF GOODS
- Y02P20/00—Technologies relating to chemical industry
- Y02P20/50—Improvements relating to the production of bulk chemicals
- Y02P20/55—Design of synthesis routes, e.g. reducing the use of auxiliary or protecting groups
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Life Sciences & Earth Sciences (AREA)
- Molecular Biology (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
Priority Applications (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| FI792497A FI75803C (fi) | 1978-08-14 | 1979-08-10 | Vid framstaellning av tienamycin och homotienamycin saosom mellanprodukt anvaendbar 4-jodmetylazetidin-2-on och foerfarande foer dess framstaellning. |
| FI832898A FI78071C (fi) | 1978-08-14 | 1983-08-11 | Mellanprodukt anvaendbar vid framstaellning av tienamycin. |
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US93332378 | 1978-08-14 | ||
| US05/933,323 US4174316A (en) | 1978-08-14 | 1978-08-14 | 4-Iodomethylazetidin-2-one |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| FI791378A7 FI791378A7 (fi) | 1980-02-15 |
| FI66001B FI66001B (fi) | 1984-04-30 |
| FI66001C true FI66001C (fi) | 1984-08-10 |
Family
ID=25463739
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| FI791378A FI66001C (fi) | 1978-08-14 | 1979-04-27 | Foerfarande foer framstaellning av 3-aminoetyltio-6-(1-hydroxietyl)-1-azabicyklo(3.2.0)hept-2-en-7-on-2-karboxylsyra och dess farmaceutiskt godtagbara salter och estrar |
Country Status (8)
| Country | Link |
|---|---|
| US (1) | US4174316A (en:Method) |
| EP (1) | EP0007973B1 (en:Method) |
| JP (4) | JPS5527169A (en:Method) |
| DE (1) | DE2966598D1 (en:Method) |
| DK (1) | DK169971B1 (en:Method) |
| ES (2) | ES480127A1 (en:Method) |
| FI (1) | FI66001C (en:Method) |
| IE (1) | IE48728B1 (en:Method) |
Families Citing this family (51)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4275207A (en) * | 1978-08-14 | 1981-06-23 | Merck & Co., Inc. | Process for preparing 7-(1-hydroxyethyl)-3-(2-aminoethylthio)-1-carbadethiaceph-3-em-3-carboxylic acid and intermediate therefor |
| JPS55147284A (en) * | 1979-04-17 | 1980-11-17 | Sanraku Inc | Novel beta-lactam derivative and its preparation |
| EP0018594B1 (en) * | 1979-04-27 | 1985-08-21 | Merck & Co. Inc. | Process for the preparation of 3-(1-hydroxyethyl)-azetidinones |
| PT71552B (en) * | 1979-07-23 | 1981-12-14 | Merck & Co Inc | Process for preparation of thienamycin and intermediates |
| PT71553B (en) * | 1979-07-23 | 1981-12-14 | Merck & Co Inc | Process for the preparation of thienamycin and intermediates |
| US4400323A (en) * | 1979-07-23 | 1983-08-23 | Merck & Co., Inc. | 3-[1-Hydroxyethyl]-4-carboxymethyl-azetidin-2-one |
| EP0028151A1 (en) * | 1979-10-29 | 1981-05-06 | Beecham Group Plc | Process for the preparation of antibiotics |
| US4262010A (en) * | 1979-12-03 | 1981-04-14 | Merck & Co., Inc. | 6-(1-Hydroxyethyl)-2-(2-aminoethylthio)-1,1-disubstituted-1-carbadethiapen-2-em-3-carboxylic acids |
| GR72296B (en:Method) * | 1979-12-03 | 1983-10-18 | Merck & Co Inc | |
| DE3167774D1 (en) * | 1980-02-28 | 1985-01-31 | Fujisawa Pharmaceutical Co | 4-substituted-2-oxoazetidine compounds, processes for their preparation, and their use for preparing antibiotics |
| EP0037082B1 (en) * | 1980-03-27 | 1985-03-20 | Merck & Co. Inc. | Process for the preparation of 1-carbapenems and intermediates via silyl-substituted dithioacetals |
| IE52147B1 (en) * | 1980-03-27 | 1987-07-08 | Merck & Co Inc | 4-(3-carboxy-2-oxopropyl)-azetidin-2-ones and process for their preparation |
| US4309346A (en) * | 1980-03-27 | 1982-01-05 | Merck & Co., Inc. | Process for the preparation of 1-carbapenems and intermediates via trithioorthoacetates |
| EP0038869A1 (en) * | 1980-04-30 | 1981-11-04 | Merck & Co. Inc. | Process for the preparation of 1-carbapenems, and intermediates for their preparation |
| JPS56154484A (en) * | 1980-05-01 | 1981-11-30 | Merck & Co Inc | 1-carbapenems derived from-4azetidinone and manufacture of intermediate therefor |
| JPS5777670A (en) * | 1980-10-31 | 1982-05-15 | Microbial Chem Res Found | Preparation of 2-azetidinone derivative |
| JPS57123182A (en) * | 1980-12-18 | 1982-07-31 | Merck & Co Inc | 6- and 4-substituted-1-azabicyclo(3,1,2,0)heptane- 3,7-dione-2-carboxylate |
| US4348325A (en) * | 1981-03-30 | 1982-09-07 | Merck & Co., Inc. | Methyl 3-azido-4-C-cyano-2,3,4,6-tetradeoxy-α-D-arabino-hexopyranoside |
| DE3276316D1 (en) * | 1981-08-27 | 1987-06-19 | Fujisawa Pharmaceutical Co | Carbapenam compound and processes for the preparation thereof |
| WO1983002614A1 (fr) * | 1982-02-02 | 1983-08-04 | Takeda Chemical Industries Ltd | Derives de l'acide 5,6-cis-carbapenem-3-carboxylique et leur procede de preparation |
| JPS5865291A (ja) * | 1981-10-14 | 1983-04-18 | Sankyo Co Ltd | カルバペネム−3−カルボン酸誘導体およびその製法 |
| CA1190236A (en) * | 1981-10-23 | 1985-07-09 | Edward J.J. Grabowski | Antibiotic synthesis |
| JPS58103391A (ja) * | 1981-12-11 | 1983-06-20 | Meiji Seika Kaisha Ltd | 1−オキサデチア−セフエム誘導体の製造法 |
| US4683301A (en) * | 1982-04-08 | 1987-07-28 | Bristol-Myers Company | Carbapenem antibiotics |
| US4642341A (en) * | 1982-04-09 | 1987-02-10 | Bristol-Myers Company | Carbapenem antibiotics |
| US4710568A (en) * | 1982-04-09 | 1987-12-01 | Bristol-Myers Company | Carbapenem antibiotics |
| US4640799A (en) * | 1982-06-18 | 1987-02-03 | Bristol-Myers Company | Carbapenem antibiotics |
| US4665170A (en) * | 1982-06-18 | 1987-05-12 | Bristol-Myers Company | Carbapenem antibiotics |
| US4536335A (en) * | 1982-06-18 | 1985-08-20 | Bristol-Myers Company | Carbapenem antibiotics |
| US4732977A (en) * | 1982-09-28 | 1988-03-22 | Bristol Myers Company | Carbapenem antibiotics |
| US4746736A (en) * | 1982-09-28 | 1988-05-24 | Bristol-Myers Company | Carbapenem antibiotics |
| US4472576A (en) * | 1982-12-03 | 1984-09-18 | Merck & Co., Inc. | Processes for the production of antibiotic 1-oxadethiacephalosporins |
| EP0117053A1 (en) * | 1983-02-10 | 1984-08-29 | Ajinomoto Co., Inc. | Azetidinone derivatives |
| CA1220215A (en) * | 1983-03-07 | 1987-04-07 | Yasutsugu Ueda | Carbapenem intermediates |
| EP0133670A3 (de) * | 1983-08-09 | 1985-12-18 | Bayer Ag | Verfahren zur Herstellung von 7-Acylamino-3-hydrocy-cephem-4-carbonsäuren und 7-Acylamino-3-hydroxy-1-de-thia-1-oxacephem-4-carbonsäuren |
| JPS60260580A (ja) * | 1985-04-05 | 1985-12-23 | Sankyo Co Ltd | カルバペネム−3−カルボン酸誘導体およびその製造法 |
| US4665171A (en) * | 1985-07-17 | 1987-05-12 | Harvard University | Process and intermediates for β-lactam antibiotics |
| US4783453A (en) * | 1985-06-10 | 1988-11-08 | Merck & Co., Inc. | 2-aza-substituted 1-carbadethiapen-2-em-3-carboxylic acids |
| US4892869A (en) * | 1985-06-10 | 1990-01-09 | Merck & Co., Inc. | 2-aza substituted-1-carbadethiapen-2-em-3-carboxylic acids |
| US4782051A (en) * | 1985-06-10 | 1988-11-01 | Merck & Co., Inc. | 2-aza-substituted 1-carbadethiapen-2-em-3 carboxylic acids |
| US4833167A (en) * | 1985-06-10 | 1989-05-23 | Merck & Co., Inc. | 2-aza-substituted 1-carbadethiapen-2-em-3-carboxylic acids |
| US4751296A (en) * | 1986-08-06 | 1988-06-14 | University Of Notre Dame Du Lac | Process for 4-halomethyl-azetidinones by cyclization of O-acylhydroxamates |
| JPS6345250A (ja) * | 1987-03-05 | 1988-02-26 | Sankyo Co Ltd | β−ラクタム化合物 |
| JPS6354359A (ja) * | 1987-03-05 | 1988-03-08 | Sankyo Co Ltd | 4―カルボキシメチルアゼチジノン誘導体の製法 |
| JP2503247B2 (ja) * | 1988-04-01 | 1996-06-05 | 三共株式会社 | アゼチジノン誘導体 |
| US5051502A (en) * | 1990-06-06 | 1991-09-24 | University Of Notre Dame Du Lac | Rhodium catalyzed cyclization process for bicyclic β-lactams |
| US5189158A (en) * | 1991-03-20 | 1993-02-23 | American Cyanamid Company | 4-substituted azetidinones as precursors to 2-substituted-3-carboxy carbapenem antibiotics and a method of producing them |
| EP0937725A3 (en) | 1992-04-28 | 2004-12-01 | Tanabe Seiyaku Co., Ltd. | Method for removing the protecting group for hydroxy group |
| US5587474A (en) * | 1992-06-18 | 1996-12-24 | Tanabe Seiyaku Co., Ltd. | Method for removing the protecting group for carboxyl group |
| BRPI0611257A2 (pt) * | 2005-05-06 | 2010-08-24 | Allergan Inc | beta-lactamas substituÍdas e uso em medicina do mesmo |
| US8202855B2 (en) | 2008-03-04 | 2012-06-19 | Allergan, Inc | Substituted beta-lactams |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4122086A (en) * | 1977-07-26 | 1978-10-24 | Smithkline Corporation | Isopenicillins |
| JPS55147284A (en) * | 1979-04-17 | 1980-11-17 | Sanraku Inc | Novel beta-lactam derivative and its preparation |
-
1978
- 1978-08-14 US US05/933,323 patent/US4174316A/en not_active Expired - Lifetime
-
1979
- 1979-04-20 IE IE374/79A patent/IE48728B1/en not_active IP Right Cessation
- 1979-04-27 FI FI791378A patent/FI66001C/fi not_active IP Right Cessation
- 1979-04-30 ES ES480127A patent/ES480127A1/es not_active Expired
- 1979-05-01 DK DK178979A patent/DK169971B1/da not_active IP Right Cessation
- 1979-05-01 EP EP79101307A patent/EP0007973B1/en not_active Expired
- 1979-05-01 DE DE7979101307T patent/DE2966598D1/de not_active Expired
- 1979-05-02 JP JP5353279A patent/JPS5527169A/ja active Granted
-
1980
- 1980-05-30 ES ES492056A patent/ES492056A0/es active Granted
-
1988
- 1988-08-24 JP JP63208472A patent/JPS6479182A/ja active Granted
-
1990
- 1990-11-30 JP JP2336948A patent/JPH03184954A/ja active Granted
- 1990-11-30 JP JP2336947A patent/JPH0780884B2/ja not_active Expired - Lifetime
Also Published As
| Publication number | Publication date |
|---|---|
| JPH03184954A (ja) | 1991-08-12 |
| DK169971B1 (da) | 1995-04-18 |
| EP0007973B1 (en) | 1984-02-01 |
| DE2966598D1 (en) | 1984-03-08 |
| JPH05384B2 (en:Method) | 1993-01-05 |
| US4174316A (en) | 1979-11-13 |
| JPS6479182A (en) | 1989-03-24 |
| FI791378A7 (fi) | 1980-02-15 |
| ES8104295A1 (es) | 1981-04-16 |
| FI66001B (fi) | 1984-04-30 |
| JPH0248556B2 (en:Method) | 1990-10-25 |
| JPS5527169A (en) | 1980-02-27 |
| JPH03184979A (ja) | 1991-08-12 |
| IE48728B1 (en) | 1985-05-01 |
| ES492056A0 (es) | 1981-04-16 |
| DK178979A (da) | 1980-02-15 |
| JPH0780884B2 (ja) | 1995-08-30 |
| ES480127A1 (es) | 1980-09-01 |
| IE790374L (en) | 1980-02-14 |
| JPH0353313B2 (en:Method) | 1991-08-14 |
| EP0007973A1 (en) | 1980-02-20 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| FI66001B (fi) | Foerfarande foer framstaellning av 3-aminoetyltio-6-(1-hydroxietyl)-1-azabicyklo(3.2.0)hept-2-en-7-on-2-karboxylsyra och dess farmaceutiskt godtagbara salter och estrar | |
| EP0071908B1 (en) | 1-, and 1,1-disubstituted-6-substituted-2-carbamimidoyl-1-carbadethiapen-2-em-3-carboxylic acids, a process for preparing and an antibiotic composition containing the same | |
| EP0037081A1 (en) | Process for the preparation of 1-carbapenems and intermediates via trithioorthoacetates | |
| US4290947A (en) | Process for the preparation of thienamycin and intermediates | |
| EP0037080B1 (en) | 4-(3-carboxy-2-oxopropyl)-azetidino-2-ones and process for their preparation | |
| EP0001627A1 (en) | 3-Substituted-6-(1'hydroxethyl)-7-oxo-1-azabicyclo(3.2.0.)-hept-2-ene-2-carboxylic acid, its preparation and pharmaceutical compositions containing it | |
| CN100422184C (zh) | 美罗培南的制备方法 | |
| EP0026816B1 (en) | Intermediates for the preparation of thienamycin and process for preparing intermediates | |
| EP0037082B1 (en) | Process for the preparation of 1-carbapenems and intermediates via silyl-substituted dithioacetals | |
| WO2007104219A1 (en) | A process for the preparation of the intermediate of β-methyl carbapenem | |
| CH667273A5 (de) | Enolsilyletherverbindungen. | |
| JPS6355514B2 (en:Method) | ||
| SE461734B (sv) | Nya karbapenem-antibiotika samt foerfarande foer framstaellning daerav | |
| HU192819B (en) | Process for preparing antibacterial penemic derivatives | |
| US4378315A (en) | Process for the preparation of thienamycin and intermediates | |
| US4739048A (en) | Process for the preparation of thienamycin and intermediates | |
| JP4481829B2 (ja) | 経口投与用カルバペネム化合物の新規合成中間体及びその製造方法 | |
| WO2004043961A1 (ja) | 経口投与用カルバペネム化合物の製造方法 | |
| EP0066301B1 (en) | Intermediates for the preparation of thienamycin and process for preparing the same | |
| US4610820A (en) | Process for the preparation of thienamycin and intermediates | |
| FI78071C (fi) | Mellanprodukt anvaendbar vid framstaellning av tienamycin. | |
| US4400323A (en) | 3-[1-Hydroxyethyl]-4-carboxymethyl-azetidin-2-one | |
| JPH0466872B2 (en:Method) | ||
| IE48729B1 (en) | Intermediates for the preparation of thienamycin and process for preparing same | |
| EP0026817A1 (en) | Preparation of azetidin-2-ones suitable for the synthesis of thienamycin and azetidin-2-ones useful in a synthesis of that kind |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MA | Patent expired | ||
| MA | Patent expired |
Owner name: MERCK & CO INC. |