FI63019C - N-fenyl-n'-bensoylkarbamider anvaendbara saosom insekticider - Google Patents
N-fenyl-n'-bensoylkarbamider anvaendbara saosom insekticider Download PDFInfo
- Publication number
- FI63019C FI63019C FI770137A FI770137A FI63019C FI 63019 C FI63019 C FI 63019C FI 770137 A FI770137 A FI 770137A FI 770137 A FI770137 A FI 770137A FI 63019 C FI63019 C FI 63019C
- Authority
- FI
- Finland
- Prior art keywords
- spp
- phenyl
- active ingredient
- benzoyl
- block
- Prior art date
Links
- 125000001309 chloro group Chemical group Cl* 0.000 description 29
- 239000000460 chlorine Substances 0.000 description 27
- 239000004480 active ingredient Substances 0.000 description 19
- 241000238631 Hexapoda Species 0.000 description 16
- -1 for example Chemical class 0.000 description 15
- 238000002360 preparation method Methods 0.000 description 15
- 239000002904 solvent Substances 0.000 description 14
- 230000006378 damage Effects 0.000 description 13
- 238000012360 testing method Methods 0.000 description 13
- 241000196324 Embryophyta Species 0.000 description 12
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 9
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 8
- 239000003995 emulsifying agent Substances 0.000 description 8
- LURYMYITPCOQAU-UHFFFAOYSA-N benzoyl isocyanate Chemical class O=C=NC(=O)C1=CC=CC=C1 LURYMYITPCOQAU-UHFFFAOYSA-N 0.000 description 7
- 238000006243 chemical reaction Methods 0.000 description 7
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 7
- 239000000126 substance Substances 0.000 description 7
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 6
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 6
- 239000013543 active substance Substances 0.000 description 6
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 5
- 238000000034 method Methods 0.000 description 5
- DGTNSSLYPYDJGL-UHFFFAOYSA-N phenyl isocyanate Chemical class O=C=NC1=CC=CC=C1 DGTNSSLYPYDJGL-UHFFFAOYSA-N 0.000 description 5
- 239000000843 powder Substances 0.000 description 5
- 239000007858 starting material Substances 0.000 description 5
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 5
- KXDAEFPNCMNJSK-UHFFFAOYSA-N Benzamide Chemical compound NC(=O)C1=CC=CC=C1 KXDAEFPNCMNJSK-UHFFFAOYSA-N 0.000 description 4
- 240000007124 Brassica oleracea Species 0.000 description 4
- 241001608568 Phaedon Species 0.000 description 4
- 241000500439 Plutella Species 0.000 description 4
- 241000607479 Yersinia pestis Species 0.000 description 4
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 4
- 150000001875 compounds Chemical class 0.000 description 4
- 230000000749 insecticidal effect Effects 0.000 description 4
- 238000002844 melting Methods 0.000 description 4
- 230000008018 melting Effects 0.000 description 4
- 239000007787 solid Substances 0.000 description 4
- 125000000876 trifluoromethoxy group Chemical group FC(F)(F)O* 0.000 description 4
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 3
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- 235000003899 Brassica oleracea var acephala Nutrition 0.000 description 3
- 235000011301 Brassica oleracea var capitata Nutrition 0.000 description 3
- 235000001169 Brassica oleracea var oleracea Nutrition 0.000 description 3
- 241000254173 Coleoptera Species 0.000 description 3
- 239000004606 Fillers/Extenders Substances 0.000 description 3
- 241001323321 Pluto Species 0.000 description 3
- 241000256248 Spodoptera Species 0.000 description 3
- 125000002877 alkyl aryl group Chemical group 0.000 description 3
- 239000000969 carrier Substances 0.000 description 3
- 239000012141 concentrate Substances 0.000 description 3
- 150000002170 ethers Chemical class 0.000 description 3
- 239000008187 granular material Substances 0.000 description 3
- 239000007788 liquid Substances 0.000 description 3
- 229920000151 polyglycol Polymers 0.000 description 3
- 239000010695 polyglycol Substances 0.000 description 3
- 241001517925 Bucculatrix Species 0.000 description 2
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 2
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 2
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 2
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 2
- 241000257303 Hymenoptera Species 0.000 description 2
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 2
- UQSXHKLRYXJYBZ-UHFFFAOYSA-N Iron oxide Chemical compound [Fe]=O UQSXHKLRYXJYBZ-UHFFFAOYSA-N 0.000 description 2
- 241001465754 Metazoa Species 0.000 description 2
- 206010028980 Neoplasm Diseases 0.000 description 2
- YGYAWVDWMABLBF-UHFFFAOYSA-N Phosgene Chemical compound ClC(Cl)=O YGYAWVDWMABLBF-UHFFFAOYSA-N 0.000 description 2
- ATUOYWHBWRKTHZ-UHFFFAOYSA-N Propane Chemical compound CCC ATUOYWHBWRKTHZ-UHFFFAOYSA-N 0.000 description 2
- 150000001338 aliphatic hydrocarbons Chemical class 0.000 description 2
- 150000001448 anilines Chemical class 0.000 description 2
- 229940054066 benzamide antipsychotics Drugs 0.000 description 2
- 150000003936 benzamides Chemical class 0.000 description 2
- 235000013339 cereals Nutrition 0.000 description 2
- 229910052801 chlorine Inorganic materials 0.000 description 2
- JHIVVAPYMSGYDF-UHFFFAOYSA-N cyclohexanone Chemical compound O=C1CCCCC1 JHIVVAPYMSGYDF-UHFFFAOYSA-N 0.000 description 2
- 239000002270 dispersing agent Substances 0.000 description 2
- 239000000975 dye Substances 0.000 description 2
- 239000004088 foaming agent Substances 0.000 description 2
- 229910052736 halogen Chemical group 0.000 description 2
- 150000002367 halogens Chemical group 0.000 description 2
- 239000001257 hydrogen Substances 0.000 description 2
- 229910052739 hydrogen Inorganic materials 0.000 description 2
- 239000002917 insecticide Substances 0.000 description 2
- 150000002576 ketones Chemical class 0.000 description 2
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 2
- 239000000203 mixture Substances 0.000 description 2
- 239000003960 organic solvent Substances 0.000 description 2
- 239000011541 reaction mixture Substances 0.000 description 2
- 235000012239 silicon dioxide Nutrition 0.000 description 2
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N silicon dioxide Inorganic materials O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 2
- 239000007921 spray Substances 0.000 description 2
- 239000004575 stone Substances 0.000 description 2
- 239000000725 suspension Substances 0.000 description 2
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 2
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- QIJNJJZPYXGIQM-UHFFFAOYSA-N 1lambda4,2lambda4-dimolybdacyclopropa-1,2,3-triene Chemical compound [Mo]=C=[Mo] QIJNJJZPYXGIQM-UHFFFAOYSA-N 0.000 description 1
- DDUNBNSBYRYUJO-UHFFFAOYSA-N 2,3,6-trichlorobenzoyl isocyanate Chemical compound ClC1=CC=C(Cl)C(C(=O)N=C=O)=C1Cl DDUNBNSBYRYUJO-UHFFFAOYSA-N 0.000 description 1
- YUSZXCRAZXSDRQ-UHFFFAOYSA-N 2,5-dichlorobenzoyl isocyanate Chemical compound ClC1=CC=C(Cl)C(C(=O)N=C=O)=C1 YUSZXCRAZXSDRQ-UHFFFAOYSA-N 0.000 description 1
- 125000004098 2,6-dichlorobenzoyl group Chemical group O=C([*])C1=C(Cl)C([H])=C([H])C([H])=C1Cl 0.000 description 1
- AVRQBXVUUXHRMY-UHFFFAOYSA-N 2,6-difluorobenzamide Chemical compound NC(=O)C1=C(F)C=CC=C1F AVRQBXVUUXHRMY-UHFFFAOYSA-N 0.000 description 1
- CPHXLFKIUVVIOQ-UHFFFAOYSA-N 2-(trifluoromethoxy)benzaldehyde Chemical group FC(F)(F)OC1=CC=CC=C1C=O CPHXLFKIUVVIOQ-UHFFFAOYSA-N 0.000 description 1
- WGFILESHIVMXAY-UHFFFAOYSA-N 2-bromobenzoyl isocyanate Chemical group BrC1=CC=CC=C1C(=O)N=C=O WGFILESHIVMXAY-UHFFFAOYSA-N 0.000 description 1
- QWXAYHAPQNMAKI-UHFFFAOYSA-N 2-chloro-4-isocyanato-1-(trifluoromethoxy)benzene Chemical compound FC(F)(F)OC1=CC=C(N=C=O)C=C1Cl QWXAYHAPQNMAKI-UHFFFAOYSA-N 0.000 description 1
- ZTUIVBFRTPPWEZ-UHFFFAOYSA-N 2-chlorobenzoyl isocyanate Chemical compound ClC1=CC=CC=C1C(=O)N=C=O ZTUIVBFRTPPWEZ-UHFFFAOYSA-N 0.000 description 1
- REUCDVKHMVGFOG-UHFFFAOYSA-N 2-fluorobenzoyl isocyanate Chemical group FC1=CC=CC=C1C(=O)N=C=O REUCDVKHMVGFOG-UHFFFAOYSA-N 0.000 description 1
- BNCPQMUBJJUOHP-UHFFFAOYSA-N 2-iodobenzoyl isocyanate Chemical group IC1=CC=CC=C1C(=O)N=C=O BNCPQMUBJJUOHP-UHFFFAOYSA-N 0.000 description 1
- ZZTXGLBRQLEFLX-UHFFFAOYSA-N 2-nitrobenzoyl isocyanate Chemical group [O-][N+](=O)C1=CC=CC=C1C(=O)N=C=O ZZTXGLBRQLEFLX-UHFFFAOYSA-N 0.000 description 1
- 125000004189 3,4-dichlorophenyl group Chemical group [H]C1=C([H])C(Cl)=C(Cl)C([H])=C1* 0.000 description 1
- DRCVWVLUBDJADC-UHFFFAOYSA-N 4-nitrobenzoyl isocyanate Chemical group [O-][N+](=O)C1=CC=C(C(=O)N=C=O)C=C1 DRCVWVLUBDJADC-UHFFFAOYSA-N 0.000 description 1
- 125000004863 4-trifluoromethoxyphenyl group Chemical group [H]C1=C([H])C(OC(F)(F)F)=C([H])C([H])=C1* 0.000 description 1
- QCVGEOXPDFCNHA-UHFFFAOYSA-N 5,5-dimethyl-2,4-dioxo-1,3-oxazolidine-3-carboxamide Chemical compound CC1(C)OC(=O)N(C(N)=O)C1=O QCVGEOXPDFCNHA-UHFFFAOYSA-N 0.000 description 1
- 241001143309 Acanthoscelides obtectus Species 0.000 description 1
- 241000256111 Aedes <genus> Species 0.000 description 1
- 241000902874 Agelastica alni Species 0.000 description 1
- 239000005995 Aluminium silicate Substances 0.000 description 1
- 241000411431 Anobium Species 0.000 description 1
- 241000256186 Anopheles <genus> Species 0.000 description 1
- 241001427556 Anoplura Species 0.000 description 1
- 241001414828 Aonidiella aurantii Species 0.000 description 1
- 241001162025 Archips podana Species 0.000 description 1
- 241000319476 Asellus Species 0.000 description 1
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 1
- 241000131286 Attagenus Species 0.000 description 1
- 241001142392 Bibio Species 0.000 description 1
- 241001573716 Blaniulus guttulatus Species 0.000 description 1
- 241000238662 Blatta orientalis Species 0.000 description 1
- 241000238657 Blattella germanica Species 0.000 description 1
- ZOXJGFHDIHLPTG-UHFFFAOYSA-N Boron Chemical compound [B] ZOXJGFHDIHLPTG-UHFFFAOYSA-N 0.000 description 1
- 235000011331 Brassica Nutrition 0.000 description 1
- 241000219198 Brassica Species 0.000 description 1
- 235000011303 Brassica alboglabra Nutrition 0.000 description 1
- 235000011302 Brassica oleracea Nutrition 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical group [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- 241001491790 Bupalus piniaria Species 0.000 description 1
- 229910021532 Calcite Inorganic materials 0.000 description 1
- 241001249699 Capitata Species 0.000 description 1
- 235000002568 Capsicum frutescens Nutrition 0.000 description 1
- 241001350371 Capua Species 0.000 description 1
- 229920002134 Carboxymethyl cellulose Polymers 0.000 description 1
- 241000255942 Choristoneura fumiferana Species 0.000 description 1
- 241001124134 Chrysomelidae Species 0.000 description 1
- 241001414836 Cimex Species 0.000 description 1
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 1
- 241000256054 Culex <genus> Species 0.000 description 1
- 241000692095 Cuterebra Species 0.000 description 1
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 1
- MYMOFIZGZYHOMD-UHFFFAOYSA-N Dioxygen Chemical compound O=O MYMOFIZGZYHOMD-UHFFFAOYSA-N 0.000 description 1
- 241000258963 Diplopoda Species 0.000 description 1
- 241001425477 Dysdercus Species 0.000 description 1
- 102000002322 Egg Proteins Human genes 0.000 description 1
- 108010000912 Egg Proteins Proteins 0.000 description 1
- 241000122098 Ephestia kuehniella Species 0.000 description 1
- 241000483001 Euproctis chrysorrhoea Species 0.000 description 1
- 241000515838 Eurygaster Species 0.000 description 1
- 241000255896 Galleria mellonella Species 0.000 description 1
- 241001660203 Gasterophilus Species 0.000 description 1
- 241000248126 Geophilus Species 0.000 description 1
- 241001043186 Gibbium Species 0.000 description 1
- 241000219146 Gossypium Species 0.000 description 1
- 235000009438 Gossypium Nutrition 0.000 description 1
- 101100536414 Haloferax volcanii (strain ATCC 29605 / DSM 3757 / JCM 8879 / NBRC 14742 / NCIMB 2012 / VKM B-1768 / DS2) tatCt gene Proteins 0.000 description 1
- 241000256257 Heliothis Species 0.000 description 1
- 241000957299 Homona magnanima Species 0.000 description 1
- 241001417351 Hoplocampa Species 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- 241001508566 Hypera postica Species 0.000 description 1
- 241000257176 Hypoderma <fly> Species 0.000 description 1
- 241001495069 Ischnocera Species 0.000 description 1
- 241001149911 Isopoda Species 0.000 description 1
- 241000256602 Isoptera Species 0.000 description 1
- 239000005909 Kieselgur Substances 0.000 description 1
- 241001470016 Laodelphax Species 0.000 description 1
- 241000256686 Lasius <genus> Species 0.000 description 1
- 241000258915 Leptinotarsa Species 0.000 description 1
- 240000007472 Leucaena leucocephala Species 0.000 description 1
- 235000010643 Leucaena leucocephala Nutrition 0.000 description 1
- 241000254025 Locusta migratoria migratorioides Species 0.000 description 1
- 241001177134 Lyctus Species 0.000 description 1
- 241001164397 Maireana aphylla Species 0.000 description 1
- 241001599018 Melanogaster Species 0.000 description 1
- NTIZESTWPVYFNL-UHFFFAOYSA-N Methyl isobutyl ketone Chemical compound CC(C)CC(C)=O NTIZESTWPVYFNL-UHFFFAOYSA-N 0.000 description 1
- UIHCLUNTQKBZGK-UHFFFAOYSA-N Methyl isobutyl ketone Natural products CCC(C)C(C)=O UIHCLUNTQKBZGK-UHFFFAOYSA-N 0.000 description 1
- ZOKXTWBITQBERF-UHFFFAOYSA-N Molybdenum Chemical compound [Mo] ZOKXTWBITQBERF-UHFFFAOYSA-N 0.000 description 1
- 241000952627 Monomorium pharaonis Species 0.000 description 1
- 241000257229 Musca <genus> Species 0.000 description 1
- 241000359016 Nephotettix Species 0.000 description 1
- 241001385056 Niptus hololeucus Species 0.000 description 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
- 241000238814 Orthoptera Species 0.000 description 1
- 241000238661 Periplaneta Species 0.000 description 1
- 241001608567 Phaedon cochleariae Species 0.000 description 1
- 241000255972 Pieris <butterfly> Species 0.000 description 1
- 241000500437 Plutella xylostella Species 0.000 description 1
- 229920003171 Poly (ethylene oxide) Polymers 0.000 description 1
- 239000004698 Polyethylene Substances 0.000 description 1
- 239000004372 Polyvinyl alcohol Substances 0.000 description 1
- 241000526145 Psylla Species 0.000 description 1
- 241001180370 Psylliodes chrysocephalus Species 0.000 description 1
- 241001590455 Pyrausta Species 0.000 description 1
- 241001509970 Reticulitermes <genus> Species 0.000 description 1
- 241000722249 Rhodnius prolixus Species 0.000 description 1
- 241001510236 Rhyparobia maderae Species 0.000 description 1
- 241000318997 Rhyzopertha dominica Species 0.000 description 1
- 241000316887 Saissetia oleae Species 0.000 description 1
- 241000883293 Scutigerella Species 0.000 description 1
- 239000004113 Sepiolite Substances 0.000 description 1
- 241000258242 Siphonaptera Species 0.000 description 1
- 241000256247 Spodoptera exigua Species 0.000 description 1
- 241001494139 Stomoxys Species 0.000 description 1
- 241000883295 Symphyla Species 0.000 description 1
- 241000255626 Tabanus <genus> Species 0.000 description 1
- 241000339374 Thrips tabaci Species 0.000 description 1
- 241001414989 Thysanoptera Species 0.000 description 1
- 241000131345 Tipula <genus> Species 0.000 description 1
- GWEVSGVZZGPLCZ-UHFFFAOYSA-N Titan oxide Chemical compound O=[Ti]=O GWEVSGVZZGPLCZ-UHFFFAOYSA-N 0.000 description 1
- 241001238451 Tortrix viridana Species 0.000 description 1
- 241000255993 Trichoplusia ni Species 0.000 description 1
- BZHJMEDXRYGGRV-UHFFFAOYSA-N Vinyl chloride Chemical group ClC=C BZHJMEDXRYGGRV-UHFFFAOYSA-N 0.000 description 1
- 241001274788 Viteus vitifoliae Species 0.000 description 1
- 235000013447 Xanthosoma atrovirens Nutrition 0.000 description 1
- 240000001781 Xanthosoma sagittifolium Species 0.000 description 1
- 241001414985 Zygentoma Species 0.000 description 1
- 239000000443 aerosol Substances 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 125000000217 alkyl group Chemical group 0.000 description 1
- 229940045714 alkyl sulfonate alkylating agent Drugs 0.000 description 1
- 150000008052 alkyl sulfonates Chemical class 0.000 description 1
- PNEYBMLMFCGWSK-UHFFFAOYSA-N aluminium oxide Inorganic materials [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 description 1
- 235000012211 aluminium silicate Nutrition 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 125000003277 amino group Chemical group 0.000 description 1
- AVKUERGKIZMTKX-NJBDSQKTSA-N ampicillin Chemical compound C1([C@@H](N)C(=O)N[C@H]2[C@H]3SC([C@@H](N3C2=O)C(O)=O)(C)C)=CC=CC=C1 AVKUERGKIZMTKX-NJBDSQKTSA-N 0.000 description 1
- 125000000129 anionic group Chemical group 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- 238000003556 assay Methods 0.000 description 1
- 229960000892 attapulgite Drugs 0.000 description 1
- 230000004888 barrier function Effects 0.000 description 1
- 150000008047 benzoylureas Chemical class 0.000 description 1
- 239000007844 bleaching agent Substances 0.000 description 1
- 229910052796 boron Inorganic materials 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Chemical group BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- 244000309464 bull Species 0.000 description 1
- 239000001273 butane Substances 0.000 description 1
- 239000002775 capsule Substances 0.000 description 1
- 235000013877 carbamide Nutrition 0.000 description 1
- 125000004432 carbon atom Chemical group C* 0.000 description 1
- 239000001569 carbon dioxide Substances 0.000 description 1
- 229910002092 carbon dioxide Inorganic materials 0.000 description 1
- 239000001768 carboxy methyl cellulose Substances 0.000 description 1
- 235000010948 carboxy methyl cellulose Nutrition 0.000 description 1
- 239000008112 carboxymethyl-cellulose Substances 0.000 description 1
- 150000008280 chlorinated hydrocarbons Chemical class 0.000 description 1
- 239000010941 cobalt Substances 0.000 description 1
- 229910017052 cobalt Inorganic materials 0.000 description 1
- GUTLYIVDDKVIGB-UHFFFAOYSA-N cobalt atom Chemical compound [Co] GUTLYIVDDKVIGB-UHFFFAOYSA-N 0.000 description 1
- 238000007796 conventional method Methods 0.000 description 1
- 229910052802 copper Inorganic materials 0.000 description 1
- 239000010949 copper Substances 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 230000001066 destructive effect Effects 0.000 description 1
- 238000011161 development Methods 0.000 description 1
- GUJOJGAPFQRJSV-UHFFFAOYSA-N dialuminum;dioxosilane;oxygen(2-);hydrate Chemical compound O.[O-2].[O-2].[O-2].[Al+3].[Al+3].O=[Si]=O.O=[Si]=O.O=[Si]=O.O=[Si]=O GUJOJGAPFQRJSV-UHFFFAOYSA-N 0.000 description 1
- 235000014113 dietary fatty acids Nutrition 0.000 description 1
- 125000004177 diethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 239000003085 diluting agent Substances 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 239000010459 dolomite Substances 0.000 description 1
- 229910000514 dolomite Inorganic materials 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 235000014103 egg white Nutrition 0.000 description 1
- 210000000969 egg white Anatomy 0.000 description 1
- 230000001804 emulsifying effect Effects 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- 239000003623 enhancer Substances 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- 230000012173 estrus Effects 0.000 description 1
- 125000001301 ethoxy group Chemical group [H]C([H])([H])C([H])([H])O* 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 230000007717 exclusion Effects 0.000 description 1
- 239000000194 fatty acid Substances 0.000 description 1
- 229930195729 fatty acid Natural products 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 235000013312 flour Nutrition 0.000 description 1
- 239000011737 fluorine Substances 0.000 description 1
- 229910052731 fluorine Inorganic materials 0.000 description 1
- 125000001153 fluoro group Chemical group F* 0.000 description 1
- 239000006260 foam Substances 0.000 description 1
- 238000009472 formulation Methods 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 125000001188 haloalkyl group Chemical group 0.000 description 1
- 150000008282 halocarbons Chemical class 0.000 description 1
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 1
- WGCNASOHLSPBMP-UHFFFAOYSA-N hydroxyacetaldehyde Natural products OCC=O WGCNASOHLSPBMP-UHFFFAOYSA-N 0.000 description 1
- 239000001023 inorganic pigment Substances 0.000 description 1
- 229910052740 iodine Inorganic materials 0.000 description 1
- 229910052742 iron Inorganic materials 0.000 description 1
- IQPQWNKOIGAROB-UHFFFAOYSA-N isocyanate group Chemical group [N-]=C=O IQPQWNKOIGAROB-UHFFFAOYSA-N 0.000 description 1
- 238000002955 isolation Methods 0.000 description 1
- NLYAJNPCOHFWQQ-UHFFFAOYSA-N kaolin Chemical compound O.O.O=[Al]O[Si](=O)O[Si](=O)O[Al]=O NLYAJNPCOHFWQQ-UHFFFAOYSA-N 0.000 description 1
- 230000001418 larval effect Effects 0.000 description 1
- 229920005610 lignin Polymers 0.000 description 1
- WPBNNNQJVZRUHP-UHFFFAOYSA-L manganese(2+);methyl n-[[2-(methoxycarbonylcarbamothioylamino)phenyl]carbamothioyl]carbamate;n-[2-(sulfidocarbothioylamino)ethyl]carbamodithioate Chemical compound [Mn+2].[S-]C(=S)NCCNC([S-])=S.COC(=O)NC(=S)NC1=CC=CC=C1NC(=S)NC(=O)OC WPBNNNQJVZRUHP-UHFFFAOYSA-L 0.000 description 1
- 239000004579 marble Substances 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 229920000609 methyl cellulose Polymers 0.000 description 1
- 239000001923 methylcellulose Substances 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 239000011733 molybdenum Substances 0.000 description 1
- 229910052750 molybdenum Inorganic materials 0.000 description 1
- 229910052901 montmorillonite Inorganic materials 0.000 description 1
- IJDNQMDRQITEOD-UHFFFAOYSA-N n-butane Chemical compound CCCC IJDNQMDRQITEOD-UHFFFAOYSA-N 0.000 description 1
- OFBQJSOFQDEBGM-UHFFFAOYSA-N n-pentane Natural products CCCCC OFBQJSOFQDEBGM-UHFFFAOYSA-N 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- JCXJVPUVTGWSNB-UHFFFAOYSA-N nitrogen dioxide Inorganic materials O=[N]=O JCXJVPUVTGWSNB-UHFFFAOYSA-N 0.000 description 1
- 238000005457 optimization Methods 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- 239000001301 oxygen Substances 0.000 description 1
- 125000003854 p-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Cl 0.000 description 1
- 229910052625 palygorskite Inorganic materials 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- 239000001007 phthalocyanine dye Substances 0.000 description 1
- 229920000573 polyethylene Polymers 0.000 description 1
- 229920000642 polymer Polymers 0.000 description 1
- 229920002689 polyvinyl acetate Polymers 0.000 description 1
- 239000011118 polyvinyl acetate Substances 0.000 description 1
- 229920002451 polyvinyl alcohol Polymers 0.000 description 1
- 239000001294 propane Substances 0.000 description 1
- 239000003380 propellant Substances 0.000 description 1
- 108090000623 proteins and genes Proteins 0.000 description 1
- 102000004169 proteins and genes Human genes 0.000 description 1
- 239000008262 pumice Substances 0.000 description 1
- 239000010453 quartz Substances 0.000 description 1
- SYUHGPGVQRZVTB-UHFFFAOYSA-N radon atom Chemical compound [Rn] SYUHGPGVQRZVTB-UHFFFAOYSA-N 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 239000011435 rock Substances 0.000 description 1
- XMVJITFPVVRMHC-UHFFFAOYSA-N roxarsone Chemical group OC1=CC=C([As](O)(O)=O)C=C1[N+]([O-])=O XMVJITFPVVRMHC-UHFFFAOYSA-N 0.000 description 1
- 229910052624 sepiolite Inorganic materials 0.000 description 1
- 235000019355 sepiolite Nutrition 0.000 description 1
- 150000004760 silicates Chemical class 0.000 description 1
- RMAQACBXLXPBSY-UHFFFAOYSA-N silicic acid Chemical compound O[Si](O)(O)O RMAQACBXLXPBSY-UHFFFAOYSA-N 0.000 description 1
- 239000002002 slurry Substances 0.000 description 1
- 239000000779 smoke Substances 0.000 description 1
- 239000000243 solution Substances 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-L sulfite Chemical compound [O-]S([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-L 0.000 description 1
- 229910052717 sulfur Inorganic materials 0.000 description 1
- 125000004434 sulfur atom Chemical group 0.000 description 1
- 239000004094 surface-active agent Substances 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- OGIDPMRJRNCKJF-UHFFFAOYSA-N titanium oxide Inorganic materials [Ti]=O OGIDPMRJRNCKJF-UHFFFAOYSA-N 0.000 description 1
- 231100000331 toxic Toxicity 0.000 description 1
- 230000002588 toxic effect Effects 0.000 description 1
- 239000011573 trace mineral Substances 0.000 description 1
- 235000013619 trace mineral Nutrition 0.000 description 1
- 238000013519 translation Methods 0.000 description 1
- 150000003672 ureas Chemical class 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
- 239000002699 waste material Substances 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C323/00—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups
- C07C323/23—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups containing thio groups and nitrogen atoms, not being part of nitro or nitroso groups, bound to the same carbon skeleton
- C07C323/39—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups containing thio groups and nitrogen atoms, not being part of nitro or nitroso groups, bound to the same carbon skeleton at least one of the nitrogen atoms being part of any of the groups, X being a hetero atom, Y being any atom
- C07C323/43—Y being a hetero atom
- C07C323/44—X or Y being nitrogen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C275/00—Derivatives of urea, i.e. compounds containing any of the groups, the nitrogen atoms not being part of nitro or nitroso groups
- C07C275/46—Derivatives of urea, i.e. compounds containing any of the groups, the nitrogen atoms not being part of nitro or nitroso groups containing any of the groups, X being a hetero atom, Y being any atom, e.g. acylureas
- C07C275/48—Y being a hydrogen or a carbon atom
- C07C275/54—Y being a carbon atom of a six-membered aromatic ring, e.g. benzoylureas
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Priority Applications (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| FI821020A FI65235C (fi) | 1976-01-20 | 1982-03-23 | Foerfarande foer framstaellning av n-fenyl-n'-benzoylkarbamider anvaendbara vid veterinaermedicin |
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2601780A DE2601780B2 (de) | 1976-01-20 | 1976-01-20 | N-Phenyl-N'-benzoylharnstoffe, Verfahren zu ihrer Herstellung und ihre Verwendung als Insektizide |
| DE2601780 | 1976-01-20 |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| FI770137A7 FI770137A7 (cs) | 1977-07-21 |
| FI63019B FI63019B (fi) | 1982-12-31 |
| FI63019C true FI63019C (fi) | 1983-04-11 |
Family
ID=5967721
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| FI770137A FI63019C (fi) | 1976-01-20 | 1977-01-18 | N-fenyl-n'-bensoylkarbamider anvaendbara saosom insekticider |
Country Status (38)
| Country | Link |
|---|---|
| US (1) | US4139636A (cs) |
| JP (1) | JPS6031820B2 (cs) |
| AR (1) | AR219487A1 (cs) |
| AT (1) | AT351864B (cs) |
| AU (1) | AU504246B2 (cs) |
| BE (1) | BE850524A (cs) |
| BG (1) | BG25060A3 (cs) |
| BR (1) | BR7700289A (cs) |
| CA (1) | CA1124747A (cs) |
| CH (1) | CH629759A5 (cs) |
| CS (1) | CS194790B2 (cs) |
| DD (1) | DD129394A5 (cs) |
| DE (1) | DE2601780B2 (cs) |
| DK (1) | DK150594C (cs) |
| EG (1) | EG12374A (cs) |
| ES (1) | ES455149A1 (cs) |
| FI (1) | FI63019C (cs) |
| FR (1) | FR2338928A1 (cs) |
| GB (1) | GB1501607A (cs) |
| GR (1) | GR62096B (cs) |
| HU (1) | HU176471B (cs) |
| IL (1) | IL51279A (cs) |
| IT (1) | IT1085852B (cs) |
| KE (1) | KE2871A (cs) |
| MY (1) | MY7800373A (cs) |
| NL (1) | NL7700578A (cs) |
| NO (1) | NO149173C (cs) |
| NZ (1) | NZ183094A (cs) |
| OA (1) | OA05531A (cs) |
| PH (1) | PH13080A (cs) |
| PL (1) | PL101199B1 (cs) |
| PT (1) | PT66078B (cs) |
| RO (1) | RO72521A (cs) |
| SE (1) | SE424858B (cs) |
| SU (1) | SU655278A3 (cs) |
| TR (1) | TR19015A (cs) |
| YU (1) | YU39788B (cs) |
| ZA (1) | ZA77303B (cs) |
Families Citing this family (56)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US5245071A (en) * | 1970-05-15 | 1993-09-14 | Duphar International Research B.V. | Organic compounds derived from urea or thiourea |
| NL160809C (nl) * | 1970-05-15 | 1979-12-17 | Duphar Int Res | Werkwijze ter bereiding van benzoylureumverbindingen, alsmede werkwijze ter bereiding van insekticide prepara- ten op basis van benzoylureumverbindingen. |
| US5342958A (en) * | 1970-05-15 | 1994-08-30 | Solvay Duphar International Research B.V. | Organic compounds derived from urea or thiourea |
| USRE32418E (en) * | 1977-05-13 | 1987-05-12 | The Dow Chemical Company | Substituted(((phenyl)amino)carbonyl)-benzamides |
| US4170657A (en) | 1977-05-13 | 1979-10-09 | The Dow Chemical Company | Substituted(((phenyl)amino)carbonyl)-benzamides |
| EP0001203B1 (de) * | 1977-07-28 | 1980-09-03 | Ciba-Geigy Ag | N-Phenyl-N'-Benzoylharnstoffe, Verfahren zu ihrer Herstellung, diese enthaltende Mittel und ihre Verwendung in der Schädlingsbekämpfung |
| DE2801316A1 (de) * | 1978-01-13 | 1979-07-19 | Bayer Ag | Substituierte n-phenyl-n'-(2-chlor- 6-fluor-benzoyl)-harnstoffe, verfahren zu ihrer herstellung und ihre verwendung als insektizide |
| EP0004030B1 (de) * | 1978-03-13 | 1981-12-30 | Ciba-Geigy Ag | Substituierte N-Phenyl-N'-fluorbenzoylharnstoffe, Verfahren zu ihrer Herstellung und ihre Verwendung in der Schädlingsbekämpfung |
| ZA793186B (en) * | 1978-07-06 | 1981-02-25 | Duphar Int Res | New urea and thiourea compounds, method of preparing the new compounds, as well as insecticidal compositions on the basis of these compounds |
| DE2839462A1 (de) * | 1978-09-11 | 1980-03-27 | Basf Ag | Aroylharnstoffe |
| GR73690B (cs) * | 1979-01-15 | 1984-04-02 | Celamerck Gmbh & Co Kg | |
| US4339460A (en) | 1979-02-01 | 1982-07-13 | Ciba-Geigy Corporation | Pesticidal N-[4-(3'-bromoallyloxy)-phenyl]-N'-benzoyl ureas |
| US4310548A (en) * | 1979-02-01 | 1982-01-12 | Ciba-Geigy Corporation | Pesticidal N-tetrafluorophenyl-N'-benzoyl ureas |
| US4505931A (en) * | 1979-02-01 | 1985-03-19 | Ciba-Geigy Corporation | Pesticidal N-(4-alkenylthio)-phenyl-N'-benzoylureas |
| US4243680A (en) * | 1979-02-07 | 1981-01-06 | Thompson-Hayward Chemical Company | Method of reducing infestation of citrus rust mites on citrus trees |
| DE2928410A1 (de) * | 1979-07-11 | 1981-01-29 | Schering Ag | Acylharnstoffe, insektizide mittel enthaltend diese verbindungen sowie verfahren zu ihrer herstellung |
| DE3064254D1 (en) * | 1979-07-11 | 1983-08-25 | Ciba Geigy Ag | N-phenyl-n'-benzoyl ureas, process for their preparation, compositions containing them and their use as pesticides |
| ZA804164B (en) * | 1979-07-11 | 1981-08-26 | Ciba Geigy | Phenylureas |
| US4399152A (en) * | 1980-04-03 | 1983-08-16 | Duphar International B.V. | Substituted benzoyl ureas as insecticides |
| DE3023328A1 (de) * | 1980-06-21 | 1982-01-14 | Bayer Ag, 5090 Leverkusen | Substituierte benzol-(thio)harnstoffe, verfahren zu ihrer herstellung und ihre verwendung als schaedlingsbekaempfungsmittel |
| US4431671A (en) * | 1980-12-12 | 1984-02-14 | Ciba-Geigy Corporation | Phenylureas |
| DK172687B1 (da) * | 1981-07-30 | 1999-05-31 | Dow Agrosciences Llc | Substituerede N-aroyl-N'-phenyl-urinstofforbindelser, mellemprodukt til brug ved fremstilling deraf, en fremgangsmåde til d |
| US5416102A (en) * | 1981-11-10 | 1995-05-16 | Ciba-Geigy Corporation | Method of preventing the reinfestation of dogs and cats by fleas |
| CA1190246A (en) * | 1982-04-23 | 1985-07-09 | Martin Anderson | Benzoylphenylurea derivatives, their preparation and use as pesticides |
| US4438110A (en) | 1982-04-28 | 1984-03-20 | Union Carbide Corporation | Chewing insect toxicant compositions |
| DE3217619A1 (de) * | 1982-05-11 | 1983-11-17 | Bayer Ag, 5090 Leverkusen | 2,4-dihalogenbenzoyl-(thio)harnstoffe, verfahren zu ihrer herstellung und ihre verwendung als schaedlingsbekaempfungsmittel |
| DE3217620A1 (de) * | 1982-05-11 | 1983-11-17 | Bayer Ag, 5090 Leverkusen | 2,5-dihalogenbenzoyl-(thio)harnstoffe, verfahren zu ihrer herstellung und ihre verwendung als schaedlingsbekaempfungsmittel |
| DE3223505A1 (de) * | 1982-06-24 | 1983-12-29 | Bayer Ag, 5090 Leverkusen | Substituierte benzoyl-(thio)harnstoffe, verfahren zu ihrer herstellung und ihre verwendung als schaedlingsbekaempfungsmittel |
| US4868215A (en) * | 1982-07-26 | 1989-09-19 | The Dow Chemical Company | Substituted N-aroyl N'-phenyl urea compounds |
| US5001266A (en) * | 1982-07-26 | 1991-03-19 | The Dow Chemical Company | Substituted aniline compounds |
| US4529819A (en) * | 1982-08-02 | 1985-07-16 | The Dow Chemical Company | Method for making benzoylphenylureas |
| ZA835661B (en) * | 1982-09-16 | 1984-04-25 | Shell Res Ltd | Pesticidal benzoylurea compounds |
| US4560770A (en) * | 1983-02-09 | 1985-12-24 | Ciba-Geigy Corporation | Pesticidal compositions based on N-pyrrolylphenyl-N'-benzoylurea compounds |
| JPS6092260A (ja) * | 1983-10-27 | 1985-05-23 | Nippon Tokushu Noyaku Seizo Kk | 新規アニリン誘導体 |
| DE3431219A1 (de) | 1984-08-24 | 1986-03-06 | Bayer Ag, 5090 Leverkusen | Benzoylharnstoffe |
| JPS6197255A (ja) * | 1984-10-18 | 1986-05-15 | チバ‐ガイギー アクチエンゲゼルシヤフト | 置換n―ベンゾイル―n’―2.5―ジクロロ―4―ヘキサフルオロプロピルオキシフェニル尿素、その製造方法及び該化合物を含有する組成物 |
| US5135953A (en) * | 1984-12-28 | 1992-08-04 | Ciba-Geigy | Use of acyl urea compounds for controlling endoparasites and ectoparasites of warm-blooded animals |
| US5288756A (en) * | 1985-10-14 | 1994-02-22 | Ciba-Geigy Corporation | Benzoylphenylureas |
| MX5413A (es) * | 1986-02-28 | 1993-10-01 | Ciba Geigy Ag | Procedimiento para la preparacion de n-benzoil-n'-fenilureas. |
| AU595417B2 (en) * | 1987-02-04 | 1990-03-29 | Sumitomo Chemical Company, Limited | A benzoylurea derivative and its production and use |
| US5157155A (en) * | 1987-02-04 | 1992-10-20 | Sumitomo Chemical Company, Limited | Benzoylurea derivative and its production and use |
| US4925875A (en) * | 1987-07-21 | 1990-05-15 | Ciba-Geigy Corporation | N-benzoyl-N'-2,5-dihalo-4-perfluoroalkoxyphenylureas, pesticidal compositions containing them and their use in the control of pests |
| JP2661709B2 (ja) * | 1988-07-08 | 1997-10-08 | ダウ・ケミカル日本株式会社 | 高活性な農薬水和剤の製法 |
| DE19953775A1 (de) | 1999-11-09 | 2001-05-10 | Bayer Ag | Wirkstoffkombinationen mit insektiziden und akariziden Eigenschaften |
| DE10018370A1 (de) * | 2000-04-14 | 2001-10-18 | Bayer Ag | Wirkstoffkombinationen mit insektiziden und akariziden Eigenschaften |
| DE10043610A1 (de) * | 2000-09-05 | 2002-03-14 | Bayer Ag | Wirkstoffkombinationen mit insektiziden und akariziden Eigenschaften |
| DE10248257A1 (de) * | 2002-10-16 | 2004-04-29 | Bayer Cropscience Ag | Wirkstoffkombinationen im insektiziden und akariziden Eigenschaften |
| DE102004001271A1 (de) | 2004-01-08 | 2005-08-04 | Bayer Cropscience Ag | Wirkstoffkombinationen mit insektiziden Eigenschaften |
| DE102006031978A1 (de) * | 2006-07-11 | 2008-01-17 | Bayer Cropscience Ag | Wirkstoffkombinationen mit insektiziden und akariziden Eigenschaften |
| EP2039248A1 (de) * | 2007-09-21 | 2009-03-25 | Bayer CropScience AG | Wirkstoffkombinationen mit insektiziden und akariziden Eigenschaften |
| DE102007045957A1 (de) | 2007-09-26 | 2009-04-09 | Bayer Cropscience Ag | Wirkstoffkombinationen mit insektiziden und akarziden Eigenschaften |
| EP2127522A1 (de) | 2008-05-29 | 2009-12-02 | Bayer CropScience AG | Wirkstoffkombinationen mit insektiziden und akariziden Eigenschaften |
| WO2010108506A1 (de) | 2009-03-25 | 2010-09-30 | Bayer Cropscience Ag | Wirkstoffkombinationen mit insektiziden und akariziden eigenschaften |
| EP2382865A1 (de) | 2010-04-28 | 2011-11-02 | Bayer CropScience AG | Synergistische Wirkstoffkombinationen |
| CN102177905B (zh) * | 2011-03-25 | 2013-07-17 | 通化农药化工股份有限公司 | 1-(4-三氟甲氧基苯基)-3-(2,6-二氟苯甲酰基)脲制剂 |
| CN102090409A (zh) * | 2011-03-25 | 2011-06-15 | 通化农药化工股份有限公司 | 1-(4-三氟甲氧基苯基)-3-(2,6-二氟苯甲酰基)脲与抗生素类杀虫剂农药复配制剂 |
Family Cites Families (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| NL160809C (nl) * | 1970-05-15 | 1979-12-17 | Duphar Int Res | Werkwijze ter bereiding van benzoylureumverbindingen, alsmede werkwijze ter bereiding van insekticide prepara- ten op basis van benzoylureumverbindingen. |
| DE2232730A1 (de) * | 1972-07-04 | 1974-01-24 | Bayer Ag | Substituierte cyclohexan-2,6-dion-1carbonsaeureanilide und -thioanilide, verfahren zu ihrer herstellung und ihre verwendung als insektizide, akarizide und fungizide |
| DE2405733C2 (de) * | 1974-02-07 | 1984-12-13 | Bayer Ag, 5090 Leverkusen | Amidocarbonylthiobarbitursäurederivate und deren Salze, Verfahren zu ihrer Herstellung sowie ihre Verwendung zur Bekämpfung von Insekten, Milben und Pilzen |
| DE2405732A1 (de) * | 1974-02-07 | 1975-08-21 | Bayer Ag | Ekto- und endoparasitenmittel |
| DE2438747C2 (de) * | 1974-08-13 | 1982-10-14 | Bayer Ag, 5090 Leverkusen | Benzoylureido-diphenyläther, Verfahren zu ihrer Herstellung und ihre Verwendung als Insektizide |
| GB1460419A (en) * | 1975-02-06 | 1977-01-06 | Bayer Ag | Benzoylureido-diphenyl ethers and their use as insecticides |
| DE2504983C2 (de) * | 1975-02-06 | 1982-10-21 | Bayer Ag, 5090 Leverkusen | Benzoylureido-nitro-diphenyläther, Verfahren zu ihrer Herstellung und ihre Verwendung als Insektizide |
| DE2531279C2 (de) * | 1975-07-12 | 1983-07-14 | Bayer Ag, 5090 Leverkusen | N-(3-Trifluormethyl-4-halogen-phenyl)- N'-benzoyl-harnstoffe, Verfahren zu ihrer Herstellung und ihre Verwendung als Insektizide |
-
1976
- 1976-01-20 DE DE2601780A patent/DE2601780B2/de active Granted
- 1976-12-30 OA OA56033A patent/OA05531A/xx unknown
-
1977
- 1977-01-06 NO NO770042A patent/NO149173C/no unknown
- 1977-01-07 YU YU37/77A patent/YU39788B/xx unknown
- 1977-01-13 RO RO7789040A patent/RO72521A/ro unknown
- 1977-01-14 PT PT66078A patent/PT66078B/pt unknown
- 1977-01-17 GB GB1687/77A patent/GB1501607A/en not_active Expired
- 1977-01-17 TR TR19015A patent/TR19015A/xx unknown
- 1977-01-17 CH CH55077A patent/CH629759A5/de not_active IP Right Cessation
- 1977-01-17 NZ NZ183094A patent/NZ183094A/xx unknown
- 1977-01-17 BG BG035178A patent/BG25060A3/xx unknown
- 1977-01-17 BR BR7700289A patent/BR7700289A/pt unknown
- 1977-01-18 IL IL51279A patent/IL51279A/xx unknown
- 1977-01-18 FI FI770137A patent/FI63019C/fi not_active IP Right Cessation
- 1977-01-18 IT IT19412/77A patent/IT1085852B/it active
- 1977-01-18 PL PL1977195379A patent/PL101199B1/pl unknown
- 1977-01-18 DD DD7700196993A patent/DD129394A5/xx unknown
- 1977-01-18 PH PH19359A patent/PH13080A/en unknown
- 1977-01-19 CS CS77367A patent/CS194790B2/cs unknown
- 1977-01-19 SU SU772439799A patent/SU655278A3/ru active
- 1977-01-19 ZA ZA77303A patent/ZA77303B/xx unknown
- 1977-01-19 HU HU77BA3498A patent/HU176471B/hu unknown
- 1977-01-19 ES ES455149A patent/ES455149A1/es not_active Expired
- 1977-01-19 CA CA270,015A patent/CA1124747A/en not_active Expired
- 1977-01-19 DK DK019877A patent/DK150594C/da not_active IP Right Cessation
- 1977-01-19 EG EG37/77A patent/EG12374A/xx active
- 1977-01-19 AU AU21449/77A patent/AU504246B2/en not_active Expired
- 1977-01-19 BE BE174196A patent/BE850524A/xx not_active IP Right Cessation
- 1977-01-19 GR GR52607A patent/GR62096B/el unknown
- 1977-01-19 SE SE7700531A patent/SE424858B/xx not_active IP Right Cessation
- 1977-01-20 AR AR266261A patent/AR219487A1/es active
- 1977-01-20 AT AT33777A patent/AT351864B/de not_active IP Right Cessation
- 1977-01-20 JP JP52004478A patent/JPS6031820B2/ja not_active Expired
- 1977-01-20 FR FR7701568A patent/FR2338928A1/fr active Granted
- 1977-01-20 NL NL7700578A patent/NL7700578A/xx not_active Application Discontinuation
-
1978
- 1978-02-27 US US05/882,295 patent/US4139636A/en not_active Expired - Lifetime
- 1978-08-10 KE KE2871A patent/KE2871A/xx unknown
- 1978-12-30 MY MY373/78A patent/MY7800373A/xx unknown
Also Published As
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| FI63019C (fi) | N-fenyl-n'-bensoylkarbamider anvaendbara saosom insekticider | |
| US4533676A (en) | 2,5-Dihalogenobenzoyl-(thio)urea insecticides | |
| FI63392B (fi) | N-fenyl-n'-(2-klor-6-fluor-bensoyl)-karbamider anvaendbara sominsekticider | |
| US4711905A (en) | 2,4-dihalogenobenzoyl-(thio)urea insecticides | |
| JPS5842184B2 (ja) | 新規ジフエニルエ−テル、その製造方法およびそれを含有する殺虫剤組成物 | |
| US4234600A (en) | Combating arthropods with N-benzoyl-N'-tert.-alkoxycarbonylphenyl-(thio) ureas | |
| US4103022A (en) | Combating arthropods with 3-(2,2,4,4-tetrafluoro-benz-1,3-dioxin-6-yl)-1-(substituted benzoyl)-ureas | |
| HU188062B (en) | Pesticide compositions containing benzyl-thiocarbamide derivatives as active substances and process for preparing the active substances | |
| US4552900A (en) | 3-(Pyrimidin-5-yl-oxyphenyl)-1-benzoyl-(thio)-urea compounds useful as pesticides | |
| PL106807B1 (pl) | Srodek owadobojczy | |
| EP0318782B1 (de) | Substituierte Benzoyl(thio)harnstoffe | |
| CA1099741A (en) | N-(.omega.-CHLOROALKANOYL)-N'-TRIFLUOROMETHYLPHENYL-UREAS, PROCESSES FOR THEIR PREPARATION AND THEIR USE AS PLANT PROTECTION AGENTS | |
| FI65235C (fi) | Foerfarande foer framstaellning av n-fenyl-n'-benzoylkarbamider anvaendbara vid veterinaermedicin | |
| US4211790A (en) | Combating arthropods with an oxime ester of N-carboxylated-carbamate | |
| US4613612A (en) | Benzoylureas | |
| KR0137478B1 (ko) | 치환된 벤조일(티오) 우레아 | |
| DE3309987A1 (de) | Benzoylharnstoffe | |
| JPH01160974A (ja) | フラザニル尿素 | |
| DE3341276A1 (de) | Benzoylharnstoffe |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MM | Patent lapsed |
Owner name: BAYER AG |