FI60205C - Analogifoerfarande foer framstaellning av terapeutiskt aktiva 1-(aminoalkyl)-2-arylsyklohexanalkoholer och -estrar - Google Patents
Analogifoerfarande foer framstaellning av terapeutiskt aktiva 1-(aminoalkyl)-2-arylsyklohexanalkoholer och -estrar Download PDFInfo
- Publication number
- FI60205C FI60205C FI750601A FI750601A FI60205C FI 60205 C FI60205 C FI 60205C FI 750601 A FI750601 A FI 750601A FI 750601 A FI750601 A FI 750601A FI 60205 C FI60205 C FI 60205C
- Authority
- FI
- Finland
- Prior art keywords
- formula
- compound
- solution
- give
- methyl
- Prior art date
Links
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 title description 17
- 230000001225 therapeutic effect Effects 0.000 title 2
- 230000004913 activation Effects 0.000 title 1
- KVFDZFBHBWTVID-UHFFFAOYSA-N cyclohexanecarbaldehyde Chemical compound O=CC1CCCCC1 KVFDZFBHBWTVID-UHFFFAOYSA-N 0.000 title 1
- 239000000203 mixture Substances 0.000 claims description 61
- -1 alkanoyl chloride Chemical compound 0.000 claims description 46
- 238000002360 preparation method Methods 0.000 claims description 46
- 238000000034 method Methods 0.000 claims description 45
- 150000001875 compounds Chemical class 0.000 claims description 33
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 claims description 28
- 150000003839 salts Chemical class 0.000 claims description 21
- 239000002253 acid Substances 0.000 claims description 19
- 150000002148 esters Chemical class 0.000 claims description 13
- RWRDLPDLKQPQOW-UHFFFAOYSA-N Pyrrolidine Chemical compound C1CCNC1 RWRDLPDLKQPQOW-UHFFFAOYSA-N 0.000 claims description 12
- YNAVUWVOSKDBBP-UHFFFAOYSA-N Morpholine Chemical compound C1COCCN1 YNAVUWVOSKDBBP-UHFFFAOYSA-N 0.000 claims description 10
- 229910052739 hydrogen Inorganic materials 0.000 claims description 10
- 239000001257 hydrogen Substances 0.000 claims description 9
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 8
- 125000004103 aminoalkyl group Chemical group 0.000 claims description 7
- 229910052757 nitrogen Inorganic materials 0.000 claims description 7
- YZTJYBJCZXZGCT-UHFFFAOYSA-N phenylpiperazine Chemical group C1CNCCN1C1=CC=CC=C1 YZTJYBJCZXZGCT-UHFFFAOYSA-N 0.000 claims description 5
- 150000001412 amines Chemical class 0.000 claims description 4
- 150000002431 hydrogen Chemical class 0.000 claims description 4
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 4
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 claims description 3
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 3
- 150000001298 alcohols Chemical class 0.000 claims description 3
- 125000004432 carbon atom Chemical group C* 0.000 claims description 3
- 230000009467 reduction Effects 0.000 claims description 3
- 150000008064 anhydrides Chemical class 0.000 claims description 2
- 239000003638 chemical reducing agent Substances 0.000 claims description 2
- 239000003814 drug Substances 0.000 claims description 2
- 238000009472 formulation Methods 0.000 claims description 2
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 2
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 claims description 2
- 230000008569 process Effects 0.000 claims description 2
- 125000001589 carboacyl group Chemical group 0.000 claims 2
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims 2
- 241000412298 Harma Species 0.000 claims 1
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 90
- 239000000243 solution Substances 0.000 description 69
- 239000000047 product Substances 0.000 description 53
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 52
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 46
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 45
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 39
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 36
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 33
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 31
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 28
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 26
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 24
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 21
- WETWJCDKMRHUPV-UHFFFAOYSA-N acetyl chloride Chemical compound CC(Cl)=O WETWJCDKMRHUPV-UHFFFAOYSA-N 0.000 description 20
- ROSDSFDQCJNGOL-UHFFFAOYSA-N Dimethylamine Chemical compound CNC ROSDSFDQCJNGOL-UHFFFAOYSA-N 0.000 description 18
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 18
- 239000012346 acetyl chloride Substances 0.000 description 17
- 239000002904 solvent Substances 0.000 description 17
- 238000006243 chemical reaction Methods 0.000 description 14
- 239000012043 crude product Substances 0.000 description 14
- 238000002844 melting Methods 0.000 description 14
- 230000008018 melting Effects 0.000 description 14
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 13
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 13
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 12
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 12
- 239000002585 base Substances 0.000 description 11
- 239000010410 layer Substances 0.000 description 11
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 11
- POPDOWPKMHATOS-UHFFFAOYSA-N 1-[1-(dimethylamino)propan-2-yl]-2-phenylcyclohexan-1-ol Chemical compound CN(C)CC(C)C1(O)CCCCC1C1=CC=CC=C1 POPDOWPKMHATOS-UHFFFAOYSA-N 0.000 description 10
- 239000007787 solid Substances 0.000 description 10
- QCQCHGYLTSGIGX-GHXANHINSA-N 4-[[(3ar,5ar,5br,7ar,9s,11ar,11br,13as)-5a,5b,8,8,11a-pentamethyl-3a-[(5-methylpyridine-3-carbonyl)amino]-2-oxo-1-propan-2-yl-4,5,6,7,7a,9,10,11,11b,12,13,13a-dodecahydro-3h-cyclopenta[a]chrysen-9-yl]oxy]-2,2-dimethyl-4-oxobutanoic acid Chemical compound N([C@@]12CC[C@@]3(C)[C@]4(C)CC[C@H]5C(C)(C)[C@@H](OC(=O)CC(C)(C)C(O)=O)CC[C@]5(C)[C@H]4CC[C@@H]3C1=C(C(C2)=O)C(C)C)C(=O)C1=CN=CC(C)=C1 QCQCHGYLTSGIGX-GHXANHINSA-N 0.000 description 9
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 9
- 241001465754 Metazoa Species 0.000 description 9
- 230000000202 analgesic effect Effects 0.000 description 9
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 9
- 238000001704 evaporation Methods 0.000 description 9
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 9
- 235000019341 magnesium sulphate Nutrition 0.000 description 9
- DRLVMOAWNVOSPE-UHFFFAOYSA-N 2-phenylcyclohexan-1-one Chemical compound O=C1CCCCC1C1=CC=CC=C1 DRLVMOAWNVOSPE-UHFFFAOYSA-N 0.000 description 8
- 230000008020 evaporation Effects 0.000 description 8
- 238000001953 recrystallisation Methods 0.000 description 8
- 238000010992 reflux Methods 0.000 description 8
- VKNQPZKJCJNZCT-UHFFFAOYSA-N 2-(1-hydroxy-2-phenylcyclohexyl)propanoic acid Chemical compound OC(=O)C(C)C1(O)CCCCC1C1=CC=CC=C1 VKNQPZKJCJNZCT-UHFFFAOYSA-N 0.000 description 7
- ZGWAEFYIIIZRIZ-UHFFFAOYSA-N 2-phenyl-1-(1-pyrrolidin-1-ylpropan-2-yl)cyclohexan-1-ol;hydrochloride Chemical compound Cl.C1CCCC(C=2C=CC=CC=2)C1(O)C(C)CN1CCCC1 ZGWAEFYIIIZRIZ-UHFFFAOYSA-N 0.000 description 7
- 150000002009 diols Chemical class 0.000 description 7
- 239000000284 extract Substances 0.000 description 7
- 239000000706 filtrate Substances 0.000 description 7
- 239000007789 gas Substances 0.000 description 7
- 230000003287 optical effect Effects 0.000 description 7
- NCASAAMAZUGGPQ-UHFFFAOYSA-N 2-phenyl-1-(1-piperidin-1-ylpropan-2-yl)cyclohexan-1-ol Chemical compound C1CCCC(C=2C=CC=CC=2)C1(O)C(C)CN1CCCCC1 NCASAAMAZUGGPQ-UHFFFAOYSA-N 0.000 description 6
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 6
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 6
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 6
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 6
- 230000000694 effects Effects 0.000 description 6
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 6
- 230000035484 reaction time Effects 0.000 description 6
- BRFXZNBXJIHYKK-UHFFFAOYSA-N 1-[2-(dimethylamino)ethyl]-2-phenylcyclohexan-1-ol Chemical compound CN(C)CCC1(O)CCCCC1C1=CC=CC=C1 BRFXZNBXJIHYKK-UHFFFAOYSA-N 0.000 description 5
- LPMXVESGRSUGHW-UHFFFAOYSA-N Acolongiflorosid K Natural products OC1C(O)C(O)C(C)OC1OC1CC2(O)CCC3C4(O)CCC(C=5COC(=O)C=5)C4(C)CC(O)C3C2(CO)C(O)C1 LPMXVESGRSUGHW-UHFFFAOYSA-N 0.000 description 5
- 241000699670 Mus sp. Species 0.000 description 5
- LPMXVESGRSUGHW-GHYGWZAOSA-N Ouabain Natural products O([C@@H]1[C@@H](O)[C@@H](O)[C@@H](O)[C@H](C)O1)[C@H]1C[C@@H](O)[C@@]2(CO)[C@@](O)(C1)CC[C@H]1[C@]3(O)[C@@](C)([C@H](C4=CC(=O)OC4)CC3)C[C@@H](O)[C@H]21 LPMXVESGRSUGHW-GHYGWZAOSA-N 0.000 description 5
- 244000166550 Strophanthus gratus Species 0.000 description 5
- 229940035676 analgesics Drugs 0.000 description 5
- 239000000730 antalgic agent Substances 0.000 description 5
- 238000001816 cooling Methods 0.000 description 5
- 239000012458 free base Substances 0.000 description 5
- 150000003840 hydrochlorides Chemical class 0.000 description 5
- LPMXVESGRSUGHW-HBYQJFLCSA-N ouabain Chemical compound O[C@@H]1[C@H](O)[C@@H](O)[C@H](C)O[C@H]1O[C@@H]1C[C@@]2(O)CC[C@H]3[C@@]4(O)CC[C@H](C=5COC(=O)C=5)[C@@]4(C)C[C@@H](O)[C@@H]3[C@@]2(CO)[C@H](O)C1 LPMXVESGRSUGHW-HBYQJFLCSA-N 0.000 description 5
- 229960003343 ouabain Drugs 0.000 description 5
- 239000011541 reaction mixture Substances 0.000 description 5
- 238000012360 testing method Methods 0.000 description 5
- YYROPELSRYBVMQ-UHFFFAOYSA-N 4-toluenesulfonyl chloride Chemical compound CC1=CC=C(S(Cl)(=O)=O)C=C1 YYROPELSRYBVMQ-UHFFFAOYSA-N 0.000 description 4
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 4
- BAVYZALUXZFZLV-UHFFFAOYSA-N Methylamine Chemical compound NC BAVYZALUXZFZLV-UHFFFAOYSA-N 0.000 description 4
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 4
- 229910052783 alkali metal Inorganic materials 0.000 description 4
- 238000004587 chromatography analysis Methods 0.000 description 4
- 238000002425 crystallisation Methods 0.000 description 4
- 230000008025 crystallization Effects 0.000 description 4
- ZAJNGDIORYACQU-UHFFFAOYSA-N decan-2-one Chemical compound CCCCCCCCC(C)=O ZAJNGDIORYACQU-UHFFFAOYSA-N 0.000 description 4
- DNJIEGIFACGWOD-UHFFFAOYSA-N ethanethiol Chemical compound CCS DNJIEGIFACGWOD-UHFFFAOYSA-N 0.000 description 4
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 4
- 238000002474 experimental method Methods 0.000 description 4
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 4
- 239000012280 lithium aluminium hydride Substances 0.000 description 4
- 239000003589 local anesthetic agent Substances 0.000 description 4
- 239000000463 material Substances 0.000 description 4
- 150000002825 nitriles Chemical class 0.000 description 4
- 239000002002 slurry Substances 0.000 description 4
- 238000003756 stirring Methods 0.000 description 4
- AHADKPPAKAEBQR-BTJKTKAUSA-N (z)-but-2-enedioic acid;[1-[1-(dimethylamino)propan-2-yl]-2-phenylcyclohexyl] acetate Chemical compound OC(=O)\C=C/C(O)=O.CN(C)CC(C)C1(OC(C)=O)CCCCC1C1=CC=CC=C1 AHADKPPAKAEBQR-BTJKTKAUSA-N 0.000 description 3
- ZHKZBCHUBSBFCZ-UHFFFAOYSA-N 1-(1-hydroxypropan-2-yl)-2-phenylcyclohexan-1-ol Chemical compound OCC(C)C1(O)CCCCC1C1=CC=CC=C1 ZHKZBCHUBSBFCZ-UHFFFAOYSA-N 0.000 description 3
- VGIRWKXCAKWIFE-UHFFFAOYSA-N 2-(3,4-dimethoxyphenyl)-1-[1-(dimethylamino)propan-2-yl]cyclohexan-1-ol Chemical compound C1=C(OC)C(OC)=CC=C1C1C(C(C)CN(C)C)(O)CCCC1 VGIRWKXCAKWIFE-UHFFFAOYSA-N 0.000 description 3
- RLQZIECDMISZHS-UHFFFAOYSA-N 2-phenylcyclohexa-2,5-diene-1,4-dione Chemical compound O=C1C=CC(=O)C(C=2C=CC=CC=2)=C1 RLQZIECDMISZHS-UHFFFAOYSA-N 0.000 description 3
- AAIBYZBZXNWTPP-UHFFFAOYSA-N 2-phenylcyclohexan-1-ol Chemical compound OC1CCCCC1C1=CC=CC=C1 AAIBYZBZXNWTPP-UHFFFAOYSA-N 0.000 description 3
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 3
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 3
- 101100334117 Caenorhabditis elegans fah-1 gene Proteins 0.000 description 3
- 206010010904 Convulsion Diseases 0.000 description 3
- SJRJJKPEHAURKC-UHFFFAOYSA-N N-Methylmorpholine Chemical compound CN1CCOCC1 SJRJJKPEHAURKC-UHFFFAOYSA-N 0.000 description 3
- 229910004298 SiO 2 Inorganic materials 0.000 description 3
- 150000001340 alkali metals Chemical class 0.000 description 3
- 239000007864 aqueous solution Substances 0.000 description 3
- 230000015572 biosynthetic process Effects 0.000 description 3
- 238000001035 drying Methods 0.000 description 3
- NLFBCYMMUAKCPC-KQQUZDAGSA-N ethyl (e)-3-[3-amino-2-cyano-1-[(e)-3-ethoxy-3-oxoprop-1-enyl]sulfanyl-3-oxoprop-1-enyl]sulfanylprop-2-enoate Chemical compound CCOC(=O)\C=C\SC(=C(C#N)C(N)=O)S\C=C\C(=O)OCC NLFBCYMMUAKCPC-KQQUZDAGSA-N 0.000 description 3
- ARFLASKVLJTEJD-UHFFFAOYSA-N ethyl 2-bromopropanoate Chemical compound CCOC(=O)C(C)Br ARFLASKVLJTEJD-UHFFFAOYSA-N 0.000 description 3
- GNOIPBMMFNIUFM-UHFFFAOYSA-N hexamethylphosphoric triamide Chemical compound CN(C)P(=O)(N(C)C)N(C)C GNOIPBMMFNIUFM-UHFFFAOYSA-N 0.000 description 3
- 239000012452 mother liquor Substances 0.000 description 3
- 230000003533 narcotic effect Effects 0.000 description 3
- TVQPXLMQOZWEBA-UHFFFAOYSA-N nexeridine Chemical compound CN(C)CC(C)C1(OC(C)=O)CCCCC1C1=CC=CC=C1 TVQPXLMQOZWEBA-UHFFFAOYSA-N 0.000 description 3
- 230000000144 pharmacologic effect Effects 0.000 description 3
- 239000011736 potassium bicarbonate Substances 0.000 description 3
- 235000015497 potassium bicarbonate Nutrition 0.000 description 3
- 229910000028 potassium bicarbonate Inorganic materials 0.000 description 3
- 229910000027 potassium carbonate Inorganic materials 0.000 description 3
- 235000011181 potassium carbonates Nutrition 0.000 description 3
- TYJJADVDDVDEDZ-UHFFFAOYSA-M potassium hydrogencarbonate Chemical compound [K+].OC([O-])=O TYJJADVDDVDEDZ-UHFFFAOYSA-M 0.000 description 3
- 238000011084 recovery Methods 0.000 description 3
- 230000004044 response Effects 0.000 description 3
- 210000003497 sciatic nerve Anatomy 0.000 description 3
- 150000003459 sulfonic acid esters Chemical class 0.000 description 3
- 238000003786 synthesis reaction Methods 0.000 description 3
- BNMKGJXJUUMGNL-UHFFFAOYSA-N 1-(1-aminoethyl)-2-phenylcyclohexan-1-ol;hydrochloride Chemical compound Cl.CC(N)C1(O)CCCCC1C1=CC=CC=C1 BNMKGJXJUUMGNL-UHFFFAOYSA-N 0.000 description 2
- IWBZWAZMDRWOGH-UHFFFAOYSA-N 1-(1-hydroxypropan-2-yl)-2-(4-methoxyphenyl)cyclohexan-1-ol Chemical compound C1=CC(OC)=CC=C1C1C(C(C)CO)(O)CCCC1 IWBZWAZMDRWOGH-UHFFFAOYSA-N 0.000 description 2
- VENOQVYFLMYTLU-UHFFFAOYSA-N 1-(2-hydroxyethyl)-2-(3-methylphenyl)cyclohexan-1-ol Chemical compound CC1=CC=CC(C2C(CCCC2)(O)CCO)=C1 VENOQVYFLMYTLU-UHFFFAOYSA-N 0.000 description 2
- AMKITVWINGFELA-UHFFFAOYSA-N 1-[1-(dimethylamino)ethyl]-2-phenylcyclohexan-1-ol;hydrochloride Chemical compound Cl.CN(C)C(C)C1(O)CCCCC1C1=CC=CC=C1 AMKITVWINGFELA-UHFFFAOYSA-N 0.000 description 2
- YBEZEXWSGXVVIJ-UHFFFAOYSA-N 1-[1-(dimethylamino)propan-2-yl]-2-(4-methoxyphenyl)cyclohexan-1-ol;hydrochloride Chemical compound Cl.C1=CC(OC)=CC=C1C1C(C(C)CN(C)C)(O)CCCC1 YBEZEXWSGXVVIJ-UHFFFAOYSA-N 0.000 description 2
- AOBWKWRRCXKGKN-UHFFFAOYSA-N 2-(1-hydroxy-2-phenylcyclohexyl)propyl 4-methylbenzenesulfonate Chemical compound C1CCCC(C=2C=CC=CC=2)C1(O)C(C)COS(=O)(=O)C1=CC=C(C)C=C1 AOBWKWRRCXKGKN-UHFFFAOYSA-N 0.000 description 2
- BQHZVXXUIHNXAP-UHFFFAOYSA-N 2-(3-methylphenyl)cyclohexan-1-one Chemical compound CC1=CC=CC(C2C(CCCC2)=O)=C1 BQHZVXXUIHNXAP-UHFFFAOYSA-N 0.000 description 2
- BEBTXYAQBNBPJY-UHFFFAOYSA-N 2-(4-methoxyphenyl)cyclohexan-1-one Chemical compound C1=CC(OC)=CC=C1C1C(=O)CCCC1 BEBTXYAQBNBPJY-UHFFFAOYSA-N 0.000 description 2
- AOGYKGCEFYNAKD-UHFFFAOYSA-N 2-[1-hydroxy-2-(4-methoxyphenyl)cyclohexyl]propanoic acid Chemical compound C1=CC(OC)=CC=C1C1C(C(C)C(O)=O)(O)CCCC1 AOGYKGCEFYNAKD-UHFFFAOYSA-N 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- WAOMUEDGHWHBRW-BTJKTKAUSA-N C(\C=C/C(=O)O)(=O)O.CN(CC(C)C1(C(CCCC1)C1=CC=CC=C1)C(C(=O)O)C)C Chemical compound C(\C=C/C(=O)O)(=O)O.CN(CC(C)C1(C(CCCC1)C1=CC=CC=C1)C(C(=O)O)C)C WAOMUEDGHWHBRW-BTJKTKAUSA-N 0.000 description 2
- 229910010082 LiAlH Inorganic materials 0.000 description 2
- NNJVILVZKWQKPM-UHFFFAOYSA-N Lidocaine Chemical compound CCN(CC)CC(=O)NC1=C(C)C=CC=C1C NNJVILVZKWQKPM-UHFFFAOYSA-N 0.000 description 2
- XADCESSVHJOZHK-UHFFFAOYSA-N Meperidine Chemical compound C=1C=CC=CC=1C1(C(=O)OCC)CCN(C)CC1 XADCESSVHJOZHK-UHFFFAOYSA-N 0.000 description 2
- MZRVEZGGRBJDDB-UHFFFAOYSA-N N-Butyllithium Chemical compound [Li]CCCC MZRVEZGGRBJDDB-UHFFFAOYSA-N 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- OFOBLEOULBTSOW-UHFFFAOYSA-N Propanedioic acid Natural products OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 2
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 2
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 2
- PXIPVTKHYLBLMZ-UHFFFAOYSA-N Sodium azide Chemical compound [Na+].[N-]=[N+]=[N-] PXIPVTKHYLBLMZ-UHFFFAOYSA-N 0.000 description 2
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical class [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 2
- WNCSOEYPGVCWNU-UHFFFAOYSA-N [1-[1-(dimethylamino)propan-2-yl]-2-(4-phenylmethoxyphenyl)cyclohexyl] acetate Chemical compound CN(C)CC(C)C1(OC(C)=O)CCCCC1C(C=C1)=CC=C1OCC1=CC=CC=C1 WNCSOEYPGVCWNU-UHFFFAOYSA-N 0.000 description 2
- 150000007513 acids Chemical class 0.000 description 2
- 125000002252 acyl group Chemical group 0.000 description 2
- PNEYBMLMFCGWSK-UHFFFAOYSA-N aluminium oxide Inorganic materials [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 description 2
- 150000001408 amides Chemical class 0.000 description 2
- 150000001414 amino alcohols Chemical class 0.000 description 2
- 229910021529 ammonia Inorganic materials 0.000 description 2
- 230000003288 anthiarrhythmic effect Effects 0.000 description 2
- KCXMKQUNVWSEMD-UHFFFAOYSA-N benzyl chloride Chemical compound ClCC1=CC=CC=C1 KCXMKQUNVWSEMD-UHFFFAOYSA-N 0.000 description 2
- 229940073608 benzyl chloride Drugs 0.000 description 2
- 238000009835 boiling Methods 0.000 description 2
- 230000008859 change Effects 0.000 description 2
- 230000036461 convulsion Effects 0.000 description 2
- 239000013078 crystal Substances 0.000 description 2
- HPXRVTGHNJAIIH-UHFFFAOYSA-N cyclohexanol Chemical compound OC1CCCCC1 HPXRVTGHNJAIIH-UHFFFAOYSA-N 0.000 description 2
- JHIVVAPYMSGYDF-UHFFFAOYSA-N cyclohexanone Chemical compound O=C1CCCCC1 JHIVVAPYMSGYDF-UHFFFAOYSA-N 0.000 description 2
- HCAJEUSONLESMK-UHFFFAOYSA-N cyclohexylsulfamic acid Chemical class OS(=O)(=O)NC1CCCCC1 HCAJEUSONLESMK-UHFFFAOYSA-N 0.000 description 2
- XBDQKXXYIPTUBI-UHFFFAOYSA-N dimethylselenoniopropionate Natural products CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 2
- 239000012259 ether extract Substances 0.000 description 2
- WMXXSTZKCLLOFT-UHFFFAOYSA-N ethyl 2-[1-hydroxy-2-(4-methoxyphenyl)cyclohexyl]propanoate Chemical compound CCOC(=O)C(C)C1(O)CCCCC1C1=CC=C(OC)C=C1 WMXXSTZKCLLOFT-UHFFFAOYSA-N 0.000 description 2
- PQJJJMRNHATNKG-UHFFFAOYSA-N ethyl bromoacetate Chemical compound CCOC(=O)CBr PQJJJMRNHATNKG-UHFFFAOYSA-N 0.000 description 2
- 230000007062 hydrolysis Effects 0.000 description 2
- 238000006460 hydrolysis reaction Methods 0.000 description 2
- 239000005457 ice water Substances 0.000 description 2
- 239000012535 impurity Substances 0.000 description 2
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 2
- 239000011976 maleic acid Substances 0.000 description 2
- 239000000155 melt Substances 0.000 description 2
- GBMDVOWEEQVZKZ-UHFFFAOYSA-N methanol;hydrate Chemical compound O.OC GBMDVOWEEQVZKZ-UHFFFAOYSA-N 0.000 description 2
- DVSDBMFJEQPWNO-UHFFFAOYSA-N methyllithium Chemical compound C[Li] DVSDBMFJEQPWNO-UHFFFAOYSA-N 0.000 description 2
- BQJCRHHNABKAKU-KBQPJGBKSA-N morphine Chemical compound O([C@H]1[C@H](C=C[C@H]23)O)C4=C5[C@@]12CCN(C)[C@@H]3CC5=CC=C4O BQJCRHHNABKAKU-KBQPJGBKSA-N 0.000 description 2
- IOXXVNYDGIXMIP-UHFFFAOYSA-N n-methylprop-2-en-1-amine Chemical compound CNCC=C IOXXVNYDGIXMIP-UHFFFAOYSA-N 0.000 description 2
- DYUWTXWIYMHBQS-UHFFFAOYSA-N n-prop-2-enylprop-2-en-1-amine Chemical compound C=CCNCC=C DYUWTXWIYMHBQS-UHFFFAOYSA-N 0.000 description 2
- 229960000482 pethidine Drugs 0.000 description 2
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 2
- RZWZRACFZGVKFM-UHFFFAOYSA-N propanoyl chloride Chemical compound CCC(Cl)=O RZWZRACFZGVKFM-UHFFFAOYSA-N 0.000 description 2
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 2
- 239000000741 silica gel Substances 0.000 description 2
- 229910002027 silica gel Inorganic materials 0.000 description 2
- 239000012312 sodium hydride Substances 0.000 description 2
- 229910000104 sodium hydride Inorganic materials 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- 150000003467 sulfuric acid derivatives Chemical class 0.000 description 2
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 2
- GETQZCLCWQTVFV-UHFFFAOYSA-N trimethylamine Chemical compound CN(C)C GETQZCLCWQTVFV-UHFFFAOYSA-N 0.000 description 2
- 238000005406 washing Methods 0.000 description 2
- 239000011701 zinc Substances 0.000 description 2
- YOEGFCDKQWCDIA-UHFFFAOYSA-N 1-(1-aminopropan-2-yl)-2-phenylcyclohexan-1-ol Chemical compound NCC(C)C1(O)CCCCC1C1=CC=CC=C1 YOEGFCDKQWCDIA-UHFFFAOYSA-N 0.000 description 1
- RLEOZIQMUJSUMI-UHFFFAOYSA-N 1-(1-morpholin-4-ylpropan-2-yl)-2-phenylcyclohexan-1-ol;hydrochloride Chemical compound Cl.C1CCCC(C=2C=CC=CC=2)C1(O)C(C)CN1CCOCC1 RLEOZIQMUJSUMI-UHFFFAOYSA-N 0.000 description 1
- LHMQLQFVFCGKMX-UHFFFAOYSA-N 1-(2-hydroxyethyl)-2-phenylcyclohexan-1-ol Chemical compound OCCC1(O)CCCCC1C1=CC=CC=C1 LHMQLQFVFCGKMX-UHFFFAOYSA-N 0.000 description 1
- NJKZWRLPZDJFMM-UHFFFAOYSA-N 1-[1-(dimethylamino)propan-2-yl]-2-phenylcyclohexan-1-ol;hydrochloride Chemical compound Cl.CN(C)CC(C)C1(O)CCCCC1C1=CC=CC=C1 NJKZWRLPZDJFMM-UHFFFAOYSA-N 0.000 description 1
- BFFDBMGYCLHGOG-UHFFFAOYSA-N 1-[1-(methylamino)ethyl]-2-phenylcyclohexan-1-ol;hydrochloride Chemical compound Cl.CNC(C)C1(O)CCCCC1C1=CC=CC=C1 BFFDBMGYCLHGOG-UHFFFAOYSA-N 0.000 description 1
- ISZLWFWZTGNYJA-UHFFFAOYSA-N 1-[1-(methylamino)propan-2-yl]-2-phenylcyclohexan-1-ol;hydrochloride Chemical compound Cl.CNCC(C)C1(O)CCCCC1C1=CC=CC=C1 ISZLWFWZTGNYJA-UHFFFAOYSA-N 0.000 description 1
- PVBLJPCMWKGTOH-UHFFFAOYSA-N 1-aminocyclohexan-1-ol Chemical class NC1(O)CCCCC1 PVBLJPCMWKGTOH-UHFFFAOYSA-N 0.000 description 1
- IYUDSTOJSKIUKS-UHFFFAOYSA-N 2-(1-hydroxy-2-phenylcyclohexyl)acetic acid Chemical compound OC(=O)CC1(O)CCCCC1C1=CC=CC=C1 IYUDSTOJSKIUKS-UHFFFAOYSA-N 0.000 description 1
- RBJWCKKJEJTORH-UHFFFAOYSA-M 2-(1-hydroxy-2-phenylcyclohexyl)propyl-trimethylazanium;iodide Chemical compound [I-].C[N+](C)(C)CC(C)C1(O)CCCCC1C1=CC=CC=C1 RBJWCKKJEJTORH-UHFFFAOYSA-M 0.000 description 1
- KZFKFDSWAGMTTK-UHFFFAOYSA-N 2-(3,4-dimethoxyphenyl)cyclohexan-1-one Chemical compound C1=C(OC)C(OC)=CC=C1C1C(=O)CCCC1 KZFKFDSWAGMTTK-UHFFFAOYSA-N 0.000 description 1
- NTCZPFPZYWFKBW-UHFFFAOYSA-N 2-[2-(3,4-dimethoxyphenyl)-1-hydroxycyclohexyl]propanoic acid Chemical compound C1=C(OC)C(OC)=CC=C1C1C(C(C)C(O)=O)(O)CCCC1 NTCZPFPZYWFKBW-UHFFFAOYSA-N 0.000 description 1
- PYNYHMRMZOGVML-UHFFFAOYSA-N 2-bromopropanenitrile Chemical compound CC(Br)C#N PYNYHMRMZOGVML-UHFFFAOYSA-N 0.000 description 1
- 125000003006 2-dimethylaminoethyl group Chemical group [H]C([H])([H])N(C([H])([H])[H])C([H])([H])C([H])([H])* 0.000 description 1
- LBLYYCQCTBFVLH-UHFFFAOYSA-M 2-methylbenzenesulfonate Chemical compound CC1=CC=CC=C1S([O-])(=O)=O LBLYYCQCTBFVLH-UHFFFAOYSA-M 0.000 description 1
- XGRINRRETIMNAT-UHFFFAOYSA-N 2-phenyl-1-(1-pyrrolidin-1-ylpropan-2-yl)cyclohexan-1-ol Chemical compound C1CCCC(C=2C=CC=CC=2)C1(O)C(C)CN1CCCC1 XGRINRRETIMNAT-UHFFFAOYSA-N 0.000 description 1
- 125000003762 3,4-dimethoxyphenyl group Chemical group [H]C1=C([H])C(OC([H])([H])[H])=C(OC([H])([H])[H])C([H])=C1* 0.000 description 1
- NCOCXMDVFQONOG-UHFFFAOYSA-N 4-[2-[1-(dimethylamino)propan-2-yl]-2-hydroxycyclohexyl]phenol Chemical compound CN(C)CC(C)C1(O)CCCCC1C1=CC=C(O)C=C1 NCOCXMDVFQONOG-UHFFFAOYSA-N 0.000 description 1
- WRFYIYOXJWKONR-UHFFFAOYSA-N 4-bromo-2-methoxyaniline Chemical compound COC1=CC(Br)=CC=C1N WRFYIYOXJWKONR-UHFFFAOYSA-N 0.000 description 1
- OMIHGPLIXGGMJB-UHFFFAOYSA-N 7-oxabicyclo[4.1.0]hepta-1,3,5-triene Chemical compound C1=CC=C2OC2=C1 OMIHGPLIXGGMJB-UHFFFAOYSA-N 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- 101100178313 Aedes aegypti HP-I gene Proteins 0.000 description 1
- 206010002091 Anaesthesia Diseases 0.000 description 1
- 241000282472 Canis lupus familiaris Species 0.000 description 1
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 1
- XBPCUCUWBYBCDP-UHFFFAOYSA-N Dicyclohexylamine Chemical compound C1CCCCC1NC1CCCCC1 XBPCUCUWBYBCDP-UHFFFAOYSA-N 0.000 description 1
- 241000282326 Felis catus Species 0.000 description 1
- 241000699666 Mus <mouse, genus> Species 0.000 description 1
- QYHFWAPDJQMJAU-UHFFFAOYSA-N N,N-dimethyl-2-(2-phenylcyclohexyl)propan-1-amine Chemical class CN(C)CC(C)C1CCCCC1C1=CC=CC=C1 QYHFWAPDJQMJAU-UHFFFAOYSA-N 0.000 description 1
- 101001116283 Phanerodontia chrysosporium Manganese peroxidase H4 Proteins 0.000 description 1
- 101001018261 Protopolybia exigua Mastoparan-1 Proteins 0.000 description 1
- QTABKTCDARIYTC-UHFFFAOYSA-N S(=O)(=O)(O)O.S(=O)(=O)(O)O.C(C)(=O)OC1(C(CCCC1)C1=CC=CC=C1)C(CN1CCCC1)C Chemical compound S(=O)(=O)(O)O.S(=O)(=O)(O)O.C(C)(=O)OC1(C(CCCC1)C1=CC=CC=C1)C(CN1CCCC1)C QTABKTCDARIYTC-UHFFFAOYSA-N 0.000 description 1
- 241000906446 Theraps Species 0.000 description 1
- JVVXZOOGOGPDRZ-SLFFLAALSA-N [(1R,4aS,10aR)-1,4a-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthren-1-yl]methanamine Chemical compound NC[C@]1(C)CCC[C@]2(C)C3=CC=C(C(C)C)C=C3CC[C@H]21 JVVXZOOGOGPDRZ-SLFFLAALSA-N 0.000 description 1
- NQPDDAZGTZUXDS-UHFFFAOYSA-N [1-[1-(dimethylamino)propan-2-yl]-2-phenylcyclohexyl] 4-methylbenzenesulfonate Chemical compound C=1C=C(C)C=CC=1S(=O)(=O)OC1(C(CN(C)C)C)CCCCC1C1=CC=CC=C1 NQPDDAZGTZUXDS-UHFFFAOYSA-N 0.000 description 1
- WLPYJEKXZCJTTF-UHFFFAOYSA-N [1-[2-(dimethylamino)ethyl]-2-(3-methylphenyl)cyclohexyl] acetate Chemical compound CN(C)CCC1(OC(C)=O)CCCCC1C1=CC=CC(C)=C1 WLPYJEKXZCJTTF-UHFFFAOYSA-N 0.000 description 1
- BPWLFLLZEYWGAV-UHFFFAOYSA-N [2-(3,4-dimethoxyphenyl)-1-[1-(dimethylamino)propan-2-yl]cyclohexyl] acetate;hydrochloride Chemical compound Cl.C1=C(OC)C(OC)=CC=C1C1C(C(C)CN(C)C)(OC(C)=O)CCCC1 BPWLFLLZEYWGAV-UHFFFAOYSA-N 0.000 description 1
- AQSUQDVKZLJVDR-UHFFFAOYSA-N [2-phenyl-1-(1-piperidin-1-ylpropan-2-yl)cyclohexyl] acetate;hydrochloride Chemical compound Cl.C1CCCC(C=2C=CC=CC=2)C1(OC(C)=O)C(C)CN1CCCCC1 AQSUQDVKZLJVDR-UHFFFAOYSA-N 0.000 description 1
- WJGAPUXHSQQWQF-UHFFFAOYSA-N acetic acid;hydrochloride Chemical compound Cl.CC(O)=O WJGAPUXHSQQWQF-UHFFFAOYSA-N 0.000 description 1
- 230000021736 acetylation Effects 0.000 description 1
- 238000006640 acetylation reaction Methods 0.000 description 1
- 239000003929 acidic solution Substances 0.000 description 1
- 230000010933 acylation Effects 0.000 description 1
- 238000005917 acylation reaction Methods 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 230000037005 anaesthesia Effects 0.000 description 1
- 230000003444 anaesthetic effect Effects 0.000 description 1
- 238000010171 animal model Methods 0.000 description 1
- 239000003416 antiarrhythmic agent Substances 0.000 description 1
- 238000013459 approach Methods 0.000 description 1
- 239000006286 aqueous extract Substances 0.000 description 1
- 230000006399 behavior Effects 0.000 description 1
- 230000008901 benefit Effects 0.000 description 1
- 235000011089 carbon dioxide Nutrition 0.000 description 1
- JYYOBHFYCIDXHH-UHFFFAOYSA-N carbonic acid;hydrate Chemical compound O.OC(O)=O JYYOBHFYCIDXHH-UHFFFAOYSA-N 0.000 description 1
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- RCTYPNKXASFOBE-UHFFFAOYSA-M chloromercury Chemical compound [Hg]Cl RCTYPNKXASFOBE-UHFFFAOYSA-M 0.000 description 1
- 239000013256 coordination polymer Substances 0.000 description 1
- 239000002178 crystalline material Substances 0.000 description 1
- OBVLFDIFJHWEFP-UHFFFAOYSA-N cyclohexylsulfamic acid;[1-[2-(dimethylamino)ethyl]-2-phenylcyclohexyl] acetate Chemical compound OS(=O)(=O)NC1CCCCC1.CN(C)CCC1(OC(C)=O)CCCCC1C1=CC=CC=C1 OBVLFDIFJHWEFP-UHFFFAOYSA-N 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- 238000010586 diagram Methods 0.000 description 1
- HDRXZJPWHTXQRI-BHDTVMLSSA-N diltiazem hydrochloride Chemical compound [Cl-].C1=CC(OC)=CC=C1[C@H]1[C@@H](OC(C)=O)C(=O)N(CC[NH+](C)C)C2=CC=CC=C2S1 HDRXZJPWHTXQRI-BHDTVMLSSA-N 0.000 description 1
- 239000006185 dispersion Substances 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 229940079593 drug Drugs 0.000 description 1
- 206010013663 drug dependence Diseases 0.000 description 1
- 230000032050 esterification Effects 0.000 description 1
- 238000005886 esterification reaction Methods 0.000 description 1
- RIFGWPKJUGCATF-UHFFFAOYSA-N ethyl chloroformate Chemical compound CCOC(Cl)=O RIFGWPKJUGCATF-UHFFFAOYSA-N 0.000 description 1
- 238000011156 evaluation Methods 0.000 description 1
- 239000012065 filter cake Substances 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 230000002706 hydrostatic effect Effects 0.000 description 1
- 238000002329 infrared spectrum Methods 0.000 description 1
- 239000000543 intermediate Substances 0.000 description 1
- HVTICUPFWKNHNG-UHFFFAOYSA-N iodoethane Chemical compound CCI HVTICUPFWKNHNG-UHFFFAOYSA-N 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- 229960004194 lidocaine Drugs 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 229960005015 local anesthetics Drugs 0.000 description 1
- 150000002688 maleic acid derivatives Chemical class 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 229960005181 morphine Drugs 0.000 description 1
- MBHINSULENHCMF-UHFFFAOYSA-N n,n-dimethylpropanamide Chemical compound CCC(=O)N(C)C MBHINSULENHCMF-UHFFFAOYSA-N 0.000 description 1
- SYSQUGFVNFXIIT-UHFFFAOYSA-N n-[4-(1,3-benzoxazol-2-yl)phenyl]-4-nitrobenzenesulfonamide Chemical class C1=CC([N+](=O)[O-])=CC=C1S(=O)(=O)NC1=CC=C(C=2OC3=CC=CC=C3N=2)C=C1 SYSQUGFVNFXIIT-UHFFFAOYSA-N 0.000 description 1
- 239000012044 organic layer Substances 0.000 description 1
- 230000037324 pain perception Effects 0.000 description 1
- NHKJPPKXDNZFBJ-UHFFFAOYSA-N phenyllithium Chemical compound [Li]C1=CC=CC=C1 NHKJPPKXDNZFBJ-UHFFFAOYSA-N 0.000 description 1
- 230000037081 physical activity Effects 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 238000001556 precipitation Methods 0.000 description 1
- 230000002265 prevention Effects 0.000 description 1
- 235000019260 propionic acid Nutrition 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- IAUBZYYUBMBVPI-UHFFFAOYSA-N pyridine;sulfuryl dichloride Chemical compound ClS(Cl)(=O)=O.C1=CC=NC=C1 IAUBZYYUBMBVPI-UHFFFAOYSA-N 0.000 description 1
- IUVKMZGDUIUOCP-BTNSXGMBSA-N quinbolone Chemical compound O([C@H]1CC[C@H]2[C@H]3[C@@H]([C@]4(C=CC(=O)C=C4CC3)C)CC[C@@]21C)C1=CCCC1 IUVKMZGDUIUOCP-BTNSXGMBSA-N 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 238000012216 screening Methods 0.000 description 1
- ODZPKZBBUMBTMG-UHFFFAOYSA-N sodium amide Chemical compound [NH2-].[Na+] ODZPKZBBUMBTMG-UHFFFAOYSA-N 0.000 description 1
- 208000011117 substance-related disease Diseases 0.000 description 1
- 150000003461 sulfonyl halides Chemical class 0.000 description 1
- 238000004809 thin layer chromatography Methods 0.000 description 1
- 230000007704 transition Effects 0.000 description 1
- 238000010792 warming Methods 0.000 description 1
- 229940072358 xylocaine Drugs 0.000 description 1
- 150000003752 zinc compounds Chemical class 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D263/00—Heterocyclic compounds containing 1,3-oxazole or hydrogenated 1,3-oxazole rings
- C07D263/52—Heterocyclic compounds containing 1,3-oxazole or hydrogenated 1,3-oxazole rings condensed with carbocyclic rings or ring systems
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D295/00—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms
- C07D295/04—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms
- C07D295/08—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms substituted by singly bound oxygen or sulfur atoms
- C07D295/096—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms substituted by singly bound oxygen or sulfur atoms with the ring nitrogen atoms and the oxygen or sulfur atoms separated by carbocyclic rings or by carbon chains interrupted by carbocyclic rings
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Hydrogenated Pyridines (AREA)
Applications Claiming Priority (4)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US44780474A | 1974-03-04 | 1974-03-04 | |
| US44780474 | 1974-03-04 | ||
| US05/545,074 US3974157A (en) | 1974-03-04 | 1975-01-29 | 1-(Amino-alkyl)-2-aryl-cyclohexane alcohols and esters |
| US54507475 | 1975-01-29 |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| FI750601A7 FI750601A7 (enFirst) | 1975-09-05 |
| FI60205B FI60205B (fi) | 1981-08-31 |
| FI60205C true FI60205C (fi) | 1981-12-10 |
Family
ID=27035098
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| FI750601A FI60205C (fi) | 1974-03-04 | 1975-02-28 | Analogifoerfarande foer framstaellning av terapeutiskt aktiva 1-(aminoalkyl)-2-arylsyklohexanalkoholer och -estrar |
Country Status (13)
| Country | Link |
|---|---|
| US (1) | US3974157A (enFirst) |
| JP (1) | JPS50157342A (enFirst) |
| BE (1) | BE826260A (enFirst) |
| CH (4) | CH621329A5 (enFirst) |
| DK (2) | DK143698C (enFirst) |
| FI (1) | FI60205C (enFirst) |
| FR (1) | FR2262974B1 (enFirst) |
| GB (1) | GB1474004A (enFirst) |
| IE (1) | IE40733B1 (enFirst) |
| LU (1) | LU71964A1 (enFirst) |
| NL (1) | NL7502450A (enFirst) |
| NO (1) | NO140100C (enFirst) |
| SE (2) | SE7502407L (enFirst) |
Families Citing this family (34)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4115589A (en) * | 1977-05-17 | 1978-09-19 | The Upjohn Company | Compounds, compositions and method of use |
| US4306097A (en) * | 1977-09-13 | 1981-12-15 | Pfizer Inc. | 3-[2-Hydroxy-4-(substituted)phenyl]-cycloalkanol analgesic agents |
| US4366172A (en) * | 1977-09-29 | 1982-12-28 | The Upjohn Company | 4-Amino-cyclohexanols, their pharmaceutical compositions and methods of use |
| FR2472559A1 (fr) * | 1979-12-31 | 1981-07-03 | Cerm Cent Europ Rech Mauvernay | Derives du 1-aminomethyl 2-phenoxy cyclohexanol, procede d'obtention, application en therapeutique et compositions les contenant |
| US4391827A (en) * | 1980-09-08 | 1983-07-05 | Pfizer Inc. | 3-(2-Hydroxy-4-(substituted)phenyl)-cycloalkanone and cycloalkanol analgesic agents and intermediates therefor |
| US4285867A (en) * | 1980-09-19 | 1981-08-25 | Pfizer Inc. | Pharmacologically active 4-[2-hydroxy-4-(substituted)phenyl]naphthalen-2(1H)-ones and 2-ols, derivatives thereof and intermediates therefor |
| US4921994A (en) * | 1980-09-19 | 1990-05-01 | Pfizer Inc. | Pharmacologically active 2-hydroxy-4-(substituted) phenyl cycloalkanes and derivatives thereof |
| US4331602A (en) * | 1980-09-19 | 1982-05-25 | Pfizer Inc. | Pharmacologically active 4-[2-hydroxy-4-(substituted]phenyl)naphthalen-2(1H)-ones and 2-ols, derivatives thereof and intermediates therefor |
| US4739079A (en) * | 1980-09-19 | 1988-04-19 | Pfizer Inc. | Pharmacologically active 4-[2-hydroxy-4-(substituted)phenyl]naphthalen-2(1H)-ones and 2-ols, derivatives thereof and intermediates therefor |
| US4831059A (en) * | 1980-09-19 | 1989-05-16 | Pfizer Inc. | Producing analgesia with pharmacologically active 2-hydroxy-4-(substituted) phenyl cycloalkanes derivatives |
| US4486609A (en) * | 1981-03-16 | 1984-12-04 | Pfizer Inc. | Pharmacologically active 4-[2-hydroxy-4-(substituted)phenyl]naphthalen-2(1H)-ones and 2-ols, derivatives thereof and intermediates therefor |
| US4371720A (en) * | 1980-09-19 | 1983-02-01 | Pfizer Inc. | 2-Hydroxy-4-(substituted) phenyl cycloalkanes and derivatives |
| US4835192A (en) * | 1980-09-19 | 1989-05-30 | Pfizer Inc. | Pharmacologically active 4-[2-hydroxy-4-(substituted)phenyl]naphthalen-2(1H)-ones and 2-ols, derivatives thereof and intermediates therefor |
| US4933475A (en) * | 1980-09-19 | 1990-06-12 | Pfizer, Inc. | Pharmacologically active 4-[2-hydroxy-4-(substituted)phenyl]naphthalen-2(1H)-ones and 2-ols, derivatives thereof and intermediates therefor |
| US4593131A (en) * | 1980-09-19 | 1986-06-03 | Pfizer Inc. | Pharmacologically active 4-[2-hydroxy-4-(substituted)phenyl]naphthalen-2(1H)-ones and 2-ols, derivatives thereof and intermediates therefor |
| JPS57122041A (en) * | 1981-01-21 | 1982-07-29 | Suntory Ltd | Phenylclohexane derivative |
| US4847414A (en) * | 1981-10-19 | 1989-07-11 | Hoechst-Roussel Pharmaceuticals, Inc. | 2'-substituted-spiro[benzofuran-2(3H),1'-cyclohexanes] and intermediates thereof |
| US4535186A (en) * | 1983-04-19 | 1985-08-13 | American Home Products Corporation | 2-Phenyl-2-(1-hydroxycycloalkyl or 1-hydroxycycloalk-2-enyl)ethylamine derivatives |
| ATE30715T1 (de) * | 1983-08-19 | 1987-11-15 | Pennwalt Corp | Cyclohexancarbonsaeuren und deren derivate als mittel gegen arrhythmie. |
| GB8405112D0 (en) * | 1984-02-28 | 1984-04-04 | Akzo Nv | Anti-arrhythmic amino-alcohols |
| US4760146A (en) * | 1986-02-18 | 1988-07-26 | Pennwalt Corporation | Cyclohexene carboxylic esters and amides as antidysrhythmic agents |
| US5248830A (en) * | 1989-08-24 | 1993-09-28 | Rhone-Poulenc Rorer Pharmaceuticals Inc. | Enantioselective preparation of acetylenic or olefinic substituted cycloalkenyl dihydroxybutyrates and 4-hydroxy-tetrahydro-pyran-2-ones |
| WO1992014692A1 (en) * | 1991-02-11 | 1992-09-03 | Rhone-Poulenc Rorer International (Holdings) Inc. | Enantioselective preparation of acetylenic or olefinic substituted cycloalkenyl dihydroxybutyrates and 4-hydroxy-tetrahydropyran-2-ones |
| NZ260408A (en) * | 1993-05-10 | 1996-05-28 | Euro Celtique Sa | Controlled release preparation comprising tramadol |
| KR100354702B1 (ko) * | 1993-11-23 | 2002-12-28 | 유로-셀티크 소시에떼 아노뉨 | 약학조성물의제조방법및서방형조성물 |
| US5891471A (en) * | 1993-11-23 | 1999-04-06 | Euro-Celtique, S.A. | Pharmaceutical multiparticulates |
| US5843480A (en) * | 1994-03-14 | 1998-12-01 | Euro-Celtique, S.A. | Controlled release diamorphine formulation |
| GB9422154D0 (en) * | 1994-11-03 | 1994-12-21 | Euro Celtique Sa | Pharmaceutical compositions and method of producing the same |
| US5965161A (en) | 1994-11-04 | 1999-10-12 | Euro-Celtique, S.A. | Extruded multi-particulates |
| DE19918325A1 (de) | 1999-04-22 | 2000-10-26 | Euro Celtique Sa | Verfahren zur Herstellung von Arzneiformen mit regulierter Wirkstofffreisetzung mittels Extrusion |
| DE10000311A1 (de) * | 2000-01-05 | 2001-07-12 | Gruenenthal Gmbh | Aminomethyl-Phonyl-Cyclohexanonderivate |
| DE10048714A1 (de) * | 2000-09-30 | 2002-04-11 | Gruenenthal Gmbh | 5-Amino-1-penlen-3-ol-Derivate |
| CN108178733A (zh) * | 2007-05-31 | 2018-06-19 | 赛诺维信制药公司 | 苯基取代的环烷胺作为一元胺再摄取抑制剂 |
| US10968209B2 (en) | 2016-05-19 | 2021-04-06 | Glaxosmithkline Intellectual Property (No.2) Limited | TRPV4 antagonist |
Family Cites Families (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2586512A (en) * | 1948-09-15 | 1952-02-19 | Searle & Co | Cyclohexyl-amino-alcohols |
| US2680115A (en) * | 1949-01-28 | 1954-06-01 | Maurice L Tainter | Substituted tertiary-aminoalkyl carbinols |
| US2656386A (en) * | 1951-02-24 | 1953-10-20 | Upjohn Co | Aminoethylhydrocarbonoxycyclohexenes |
| US3652589A (en) * | 1967-07-27 | 1972-03-28 | Gruenenthal Chemie | 1-(m-substituted phenyl)-2-aminomethyl cyclohexanols |
-
1975
- 1975-01-29 US US05/545,074 patent/US3974157A/en not_active Expired - Lifetime
- 1975-02-28 NL NL7502450A patent/NL7502450A/xx not_active Application Discontinuation
- 1975-02-28 FI FI750601A patent/FI60205C/fi not_active IP Right Cessation
- 1975-03-03 DK DK83575A patent/DK143698C/da not_active IP Right Cessation
- 1975-03-03 NO NO750706A patent/NO140100C/no unknown
- 1975-03-04 IE IE459/75A patent/IE40733B1/xx unknown
- 1975-03-04 SE SE7502407A patent/SE7502407L/xx not_active Application Discontinuation
- 1975-03-04 FR FR7506772A patent/FR2262974B1/fr not_active Expired
- 1975-03-04 BE BE153975A patent/BE826260A/xx not_active IP Right Cessation
- 1975-03-04 LU LU71964A patent/LU71964A1/xx unknown
- 1975-03-04 CH CH270775A patent/CH621329A5/de not_active IP Right Cessation
- 1975-03-04 GB GB891575A patent/GB1474004A/en not_active Expired
- 1975-03-04 JP JP50025688A patent/JPS50157342A/ja active Pending
-
1978
- 1978-12-11 CH CH1260378A patent/CH617921A5/de not_active IP Right Cessation
- 1978-12-11 CH CH1260278A patent/CH615413A5/de not_active IP Right Cessation
-
1979
- 1979-07-13 CH CH657979A patent/CH619207A5/de not_active IP Right Cessation
- 1979-08-03 DK DK328479A patent/DK328479A/da not_active Application Discontinuation
-
1982
- 1982-05-14 SE SE8203051A patent/SE8203051L/sv not_active Application Discontinuation
Also Published As
| Publication number | Publication date |
|---|---|
| IE40733L (en) | 1975-09-04 |
| DK143698C (da) | 1982-03-08 |
| US3974157A (en) | 1976-08-10 |
| IE40733B1 (en) | 1979-08-01 |
| FR2262974A1 (enFirst) | 1975-10-03 |
| NO750706L (enFirst) | 1975-09-05 |
| DK143698B (da) | 1981-09-28 |
| CH619207A5 (en) | 1980-09-15 |
| CH615413A5 (en) | 1980-01-31 |
| AU7877375A (en) | 1976-09-09 |
| SE8203051L (sv) | 1982-05-14 |
| NL7502450A (nl) | 1975-09-08 |
| FI750601A7 (enFirst) | 1975-09-05 |
| SE7502407L (enFirst) | 1975-09-05 |
| FR2262974B1 (enFirst) | 1980-01-25 |
| DK328479A (da) | 1979-08-03 |
| BE826260A (nl) | 1975-06-30 |
| LU71964A1 (enFirst) | 1975-08-20 |
| CH621329A5 (enFirst) | 1981-01-30 |
| NO140100B (no) | 1979-03-26 |
| JPS50157342A (enFirst) | 1975-12-19 |
| GB1474004A (en) | 1977-05-18 |
| FI60205B (fi) | 1981-08-31 |
| DK83575A (enFirst) | 1975-09-05 |
| CH617921A5 (en) | 1980-06-30 |
| NO140100C (no) | 1979-07-04 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| FI60205C (fi) | Analogifoerfarande foer framstaellning av terapeutiskt aktiva 1-(aminoalkyl)-2-arylsyklohexanalkoholer och -estrar | |
| AU664188B2 (en) | Aromatic compounds, pharmaceutical compositions containing them and their use in therapy | |
| FI98457C (fi) | Menetelmä piperidyylialkyyliamiinien valmistamiseksi | |
| US5382600A (en) | 3,3-diphenylpropylamines and pharmaceutical compositions thereof | |
| AU626949B2 (en) | 2-amino-4 or 5-methoxycyclohexyl amides useful as analgesics | |
| US6469010B1 (en) | Medicament for the alleviation or treatment of symptom derived from the ischemic disease and compound useful thereof | |
| EP0325571A1 (en) | New amines, their use and preparation | |
| RU2114108C1 (ru) | ПРОИЗВОДНЫЕ 7-(2-АМИНОЭТИЛ)БЕНЗОТИАЗОЛОНА ИЛИ ИХ ФАРМАЦЕВТИЧЕСКИ ПРИЕМЛЕМЫЕ СОЛИ, СПОСОБЫ ИХ ПОЛУЧЕНИЯ, ПРОИЗВОДНЫЕ N-[2-(4-ГИДРОКСИ-2-ОКСО-3H-1,3-БЕНЗОТИАЗОЛ-7-ИЛ)ЭТИЛАМИДА]ФАРМАЦЕВТИЧЕСКАЯ КОМПОЗИЦИЯ, ПРОЯВЛЯЮЩАЯ АГОНИСТИЧЕСКУЮ АКТИВНОСТЬ В ОТНОШЕНИИ β2-АДРЕНОРЕЦЕПТОРОВ | |
| JPH07267908A (ja) | 興奮性アミノ酸受容体拮抗剤 | |
| JPH0819065B2 (ja) | ベンゾ融合シクロアルカンおよびオキサ‐およびチア‐シクロアルカントランス‐1,2‐ジアミン誘導体 | |
| EP0164865B1 (en) | N-(aminoalkylphenyl)sulfonamides their preparation and therapeutic use | |
| HU184669B (en) | New process for producing n-alkyl-imidazol derivatives | |
| CS258150B2 (en) | Method of arylcyclobutylalkylamines production | |
| FI62052B (fi) | Foerfarande foer framstaellning av farmakologiskt vaerdefulla 4-aminofenyletanolaminer med saerskilt beta 2-mimetisk och/eller alfa 1-blockerande verkan | |
| NZ202728A (en) | 2-(phenylmethylene)-cycloalkylamine and-azetidine derivatives | |
| JP2543690B2 (ja) | 医薬組成物 | |
| AU725042B2 (en) | 3,4-disubstituted phenylethanolaminotetralincarboxamide derivatives | |
| CZ181891A3 (en) | Hexahydroazepine derivatives | |
| FI87068B (fi) | Foerfarande foer framstaellning av terapeutiskt aktiva aminoalkoholer. | |
| PT87503B (pt) | Processo para a preparacao de novos derivados de catecolamina | |
| NZ196086A (en) | 1-phenyl-2-cyclohexene-1-alkylamine derivatives and pharmaceutical compositions | |
| US20040034104A1 (en) | 2,2-Diphenylbutanamide derivatives and medicines containing the same | |
| US6498196B1 (en) | Compounds useful in pain management | |
| US6844368B1 (en) | Compounds useful in pain management | |
| US6417183B1 (en) | 1,4-diazacycloheptane derivatives |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MM | Patent lapsed |
Owner name: PENNWALT CORPORATION |