FI58634C - Herbisida n-acylbiskarbamater - Google Patents
Herbisida n-acylbiskarbamater Download PDFInfo
- Publication number
- FI58634C FI58634C FI403/72A FI40372A FI58634C FI 58634 C FI58634 C FI 58634C FI 403/72 A FI403/72 A FI 403/72A FI 40372 A FI40372 A FI 40372A FI 58634 C FI58634 C FI 58634C
- Authority
- FI
- Finland
- Prior art keywords
- compounds
- carbamate
- cfl
- phenyl
- acetyl
- Prior art date
Links
- 150000001875 compounds Chemical class 0.000 description 28
- -1 hydrazides Chemical class 0.000 description 14
- 241000196324 Embryophyta Species 0.000 description 12
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 12
- 239000004480 active ingredient Substances 0.000 description 12
- 238000002360 preparation method Methods 0.000 description 12
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 11
- 125000004432 carbon atom Chemical group C* 0.000 description 7
- 229910052739 hydrogen Inorganic materials 0.000 description 7
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 7
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 6
- KXDHJXZQYSOELW-UHFFFAOYSA-M Carbamate Chemical compound NC([O-])=O KXDHJXZQYSOELW-UHFFFAOYSA-M 0.000 description 6
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 6
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 6
- 125000000217 alkyl group Chemical group 0.000 description 6
- 238000000034 method Methods 0.000 description 6
- 239000000203 mixture Substances 0.000 description 6
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 6
- 239000000243 solution Substances 0.000 description 6
- 230000002363 herbicidal effect Effects 0.000 description 5
- 239000001257 hydrogen Substances 0.000 description 5
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 4
- 239000002253 acid Substances 0.000 description 4
- 125000002252 acyl group Chemical group 0.000 description 4
- 229910052799 carbon Inorganic materials 0.000 description 4
- 239000000969 carrier Substances 0.000 description 4
- 125000001309 chloro group Chemical group Cl* 0.000 description 4
- JHIVVAPYMSGYDF-UHFFFAOYSA-N cyclohexanone Chemical compound O=C1CCCCC1 JHIVVAPYMSGYDF-UHFFFAOYSA-N 0.000 description 4
- 230000000694 effects Effects 0.000 description 4
- 239000000839 emulsion Substances 0.000 description 4
- 239000004009 herbicide Substances 0.000 description 4
- HJOVHMDZYOCNQW-UHFFFAOYSA-N isophorone Chemical compound CC1=CC(=O)CC(C)(C)C1 HJOVHMDZYOCNQW-UHFFFAOYSA-N 0.000 description 4
- 239000007858 starting material Substances 0.000 description 4
- 239000000126 substance Substances 0.000 description 4
- 229910052717 sulfur Inorganic materials 0.000 description 4
- QAOWNCQODCNURD-UHFFFAOYSA-N sulfuric acid Substances OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 4
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 3
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 3
- ZAFNJMIOTHYJRJ-UHFFFAOYSA-N Diisopropyl ether Chemical compound CC(C)OC(C)C ZAFNJMIOTHYJRJ-UHFFFAOYSA-N 0.000 description 3
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 3
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- 150000008065 acid anhydrides Chemical class 0.000 description 3
- 150000007513 acids Chemical class 0.000 description 3
- 150000001721 carbon Chemical group 0.000 description 3
- 239000007788 liquid Substances 0.000 description 3
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 3
- 235000019341 magnesium sulphate Nutrition 0.000 description 3
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 3
- 229910052698 phosphorus Inorganic materials 0.000 description 3
- 239000013558 reference substance Substances 0.000 description 3
- 239000007787 solid Substances 0.000 description 3
- LJGHYPLBDBRCRZ-UHFFFAOYSA-N 3-(3-aminophenyl)sulfonylaniline Chemical group NC1=CC=CC(S(=O)(=O)C=2C=C(N)C=CC=2)=C1 LJGHYPLBDBRCRZ-UHFFFAOYSA-N 0.000 description 2
- 235000016068 Berberis vulgaris Nutrition 0.000 description 2
- 241000335053 Beta vulgaris Species 0.000 description 2
- 101100334117 Caenorhabditis elegans fah-1 gene Proteins 0.000 description 2
- 244000000626 Daucus carota Species 0.000 description 2
- 235000002767 Daucus carota Nutrition 0.000 description 2
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 2
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 2
- 244000042664 Matricaria chamomilla Species 0.000 description 2
- 235000007232 Matricaria chamomilla Nutrition 0.000 description 2
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 2
- 240000003705 Senecio vulgaris Species 0.000 description 2
- 240000005498 Setaria italica Species 0.000 description 2
- 235000007226 Setaria italica Nutrition 0.000 description 2
- 240000006694 Stellaria media Species 0.000 description 2
- 240000008042 Zea mays Species 0.000 description 2
- 235000005824 Zea mays ssp. parviglumis Nutrition 0.000 description 2
- 235000002017 Zea mays subsp mays Nutrition 0.000 description 2
- 239000000654 additive Substances 0.000 description 2
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 2
- SHGAZHPCJJPHSC-YCNIQYBTSA-N all-trans-retinoic acid Chemical compound OC(=O)\C=C(/C)\C=C\C=C(/C)\C=C\C1=C(C)CCCC1(C)C SHGAZHPCJJPHSC-YCNIQYBTSA-N 0.000 description 2
- 150000001408 amides Chemical class 0.000 description 2
- 150000001412 amines Chemical class 0.000 description 2
- 239000007795 chemical reaction product Substances 0.000 description 2
- CWJSHJJYOPWUGX-UHFFFAOYSA-N chlorpropham Chemical compound CC(C)OC(=O)NC1=CC=CC(Cl)=C1 CWJSHJJYOPWUGX-UHFFFAOYSA-N 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- 235000005822 corn Nutrition 0.000 description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 2
- 238000011156 evaluation Methods 0.000 description 2
- 150000003977 halocarboxylic acids Chemical class 0.000 description 2
- 150000002431 hydrogen Chemical class 0.000 description 2
- 229910052500 inorganic mineral Inorganic materials 0.000 description 2
- 239000011707 mineral Substances 0.000 description 2
- 235000010755 mineral Nutrition 0.000 description 2
- 239000000843 powder Substances 0.000 description 2
- 239000011347 resin Substances 0.000 description 2
- 229920005989 resin Polymers 0.000 description 2
- 150000003839 salts Chemical class 0.000 description 2
- 239000007921 spray Substances 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- 239000004094 surface-active agent Substances 0.000 description 2
- 235000013311 vegetables Nutrition 0.000 description 2
- HGQRMIIROOLCKG-UHFFFAOYSA-N (3-aminophenyl) N-acetyl-N-(3-methylphenyl)carbamate Chemical compound CC(=O)N(C(=O)OC1=CC(N)=CC=C1)C1=CC(C)=CC=C1 HGQRMIIROOLCKG-UHFFFAOYSA-N 0.000 description 1
- NJYFRQQXXXRJHK-UHFFFAOYSA-N (4-aminophenyl) thiocyanate Chemical compound NC1=CC=C(SC#N)C=C1 NJYFRQQXXXRJHK-UHFFFAOYSA-N 0.000 description 1
- ZRRCPKLWTBJUHI-UHFFFAOYSA-N 1-[(2,3,6-trichlorophenyl)methoxy]propan-1-ol Chemical compound CCC(O)OCC1=C(Cl)C=CC(Cl)=C1Cl ZRRCPKLWTBJUHI-UHFFFAOYSA-N 0.000 description 1
- NDUPDOJHUQKPAG-UHFFFAOYSA-M 2,2-Dichloropropanoate Chemical compound CC(Cl)(Cl)C([O-])=O NDUPDOJHUQKPAG-UHFFFAOYSA-M 0.000 description 1
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 1
- JSIAIROWMJGMQZ-UHFFFAOYSA-N 2h-triazol-4-amine Chemical class NC1=CNN=N1 JSIAIROWMJGMQZ-UHFFFAOYSA-N 0.000 description 1
- LXILAQXSFLCWDQ-UHFFFAOYSA-N 5-amino-4-chloro-2-phenyl-1,5-dihydropyridazin-6-one Chemical compound C1=C(Cl)C(N)C(=O)NN1C1=CC=CC=C1 LXILAQXSFLCWDQ-UHFFFAOYSA-N 0.000 description 1
- 241000743985 Alopecurus Species 0.000 description 1
- 239000005995 Aluminium silicate Substances 0.000 description 1
- 240000001592 Amaranthus caudatus Species 0.000 description 1
- 235000009328 Amaranthus caudatus Nutrition 0.000 description 1
- 244000105624 Arachis hypogaea Species 0.000 description 1
- 235000007320 Avena fatua Nutrition 0.000 description 1
- 241000209764 Avena fatua Species 0.000 description 1
- 241000339490 Brachyachne Species 0.000 description 1
- 240000007124 Brassica oleracea Species 0.000 description 1
- 235000003899 Brassica oleracea var acephala Nutrition 0.000 description 1
- 235000011301 Brassica oleracea var capitata Nutrition 0.000 description 1
- 235000001169 Brassica oleracea var oleracea Nutrition 0.000 description 1
- SWRSXFUHCXWTEV-UHFFFAOYSA-N C(C)(=O)N(C(OC1=CC(=CC=C1)N)=O)C1=CC=CC=C1 Chemical compound C(C)(=O)N(C(OC1=CC(=CC=C1)N)=O)C1=CC=CC=C1 SWRSXFUHCXWTEV-UHFFFAOYSA-N 0.000 description 1
- 102100028637 CLOCK-interacting pacemaker Human genes 0.000 description 1
- 101100175010 Caenorhabditis elegans gbf-1 gene Proteins 0.000 description 1
- 240000004385 Centaurea cyanus Species 0.000 description 1
- 235000005940 Centaurea cyanus Nutrition 0.000 description 1
- 240000006122 Chenopodium album Species 0.000 description 1
- 235000009344 Chenopodium album Nutrition 0.000 description 1
- 244000144786 Chrysanthemum segetum Species 0.000 description 1
- 235000005470 Chrysanthemum segetum Nutrition 0.000 description 1
- 229920000742 Cotton Polymers 0.000 description 1
- 241000195493 Cryptophyta Species 0.000 description 1
- 102100028717 Cytosolic 5'-nucleotidase 3A Human genes 0.000 description 1
- 101710095312 Cytosolic 5'-nucleotidase 3A Proteins 0.000 description 1
- 241000283014 Dama Species 0.000 description 1
- 241000192043 Echinochloa Species 0.000 description 1
- PXRROZVNOOEPPZ-UHFFFAOYSA-N Flupropanate Chemical compound OC(=O)C(F)(F)C(F)F PXRROZVNOOEPPZ-UHFFFAOYSA-N 0.000 description 1
- 244000214240 Galinsoga parviflora Species 0.000 description 1
- 235000018914 Galinsoga parviflora Nutrition 0.000 description 1
- 241000219146 Gossypium Species 0.000 description 1
- 101000766839 Homo sapiens CLOCK-interacting pacemaker Proteins 0.000 description 1
- 101000713575 Homo sapiens Tubulin beta-3 chain Proteins 0.000 description 1
- 102220580964 Induced myeloid leukemia cell differentiation protein Mcl-1_P44Y_mutation Human genes 0.000 description 1
- 241000520028 Lamium Species 0.000 description 1
- 244000303225 Lamium amplexicaule Species 0.000 description 1
- 235000009198 Lamium amplexicaule Nutrition 0.000 description 1
- 235000019738 Limestone Nutrition 0.000 description 1
- DTAFLBZLAZYRDX-UHFFFAOYSA-N OOOOOO Chemical compound OOOOOO DTAFLBZLAZYRDX-UHFFFAOYSA-N 0.000 description 1
- 240000007594 Oryza sativa Species 0.000 description 1
- 235000007164 Oryza sativa Nutrition 0.000 description 1
- JNOJRRIGRCMXLQ-UHFFFAOYSA-N PPPPPPPPP Chemical compound PPPPPPPPP JNOJRRIGRCMXLQ-UHFFFAOYSA-N 0.000 description 1
- 101710173835 Penton protein Proteins 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- 239000007868 Raney catalyst Substances 0.000 description 1
- NPXOKRUENSOPAO-UHFFFAOYSA-N Raney nickel Chemical compound [Al].[Ni] NPXOKRUENSOPAO-UHFFFAOYSA-N 0.000 description 1
- 229910000564 Raney nickel Inorganic materials 0.000 description 1
- 240000005499 Sasa Species 0.000 description 1
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 1
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 description 1
- 241000282887 Suidae Species 0.000 description 1
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 1
- 102100036790 Tubulin beta-3 chain Human genes 0.000 description 1
- LEHOTFFKMJEONL-UHFFFAOYSA-N Uric Acid Chemical compound N1C(=O)NC(=O)C2=C1NC(=O)N2 LEHOTFFKMJEONL-UHFFFAOYSA-N 0.000 description 1
- TVWHNULVHGKJHS-UHFFFAOYSA-N Uric acid Natural products N1C(=O)NC(=O)C2NC(=O)NC21 TVWHNULVHGKJHS-UHFFFAOYSA-N 0.000 description 1
- KVQHPUTZNWRHAP-UHFFFAOYSA-N acetyl-[2-(3-nitrophenyl)phenyl]carbamic acid Chemical compound CC(=O)N(C1=CC=CC=C1C2=CC(=CC=C2)[N+](=O)[O-])C(=O)O KVQHPUTZNWRHAP-UHFFFAOYSA-N 0.000 description 1
- 230000010933 acylation Effects 0.000 description 1
- 238000005917 acylation reaction Methods 0.000 description 1
- 150000007933 aliphatic carboxylic acids Chemical class 0.000 description 1
- 150000001338 aliphatic hydrocarbons Chemical class 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 235000012211 aluminium silicate Nutrition 0.000 description 1
- 235000012735 amaranth Nutrition 0.000 description 1
- 239000004178 amaranth Substances 0.000 description 1
- 229940051881 anilide analgesics and antipyretics Drugs 0.000 description 1
- 150000003931 anilides Chemical class 0.000 description 1
- 150000001448 anilines Chemical class 0.000 description 1
- 239000008346 aqueous phase Substances 0.000 description 1
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
- JXLHNMVSKXFWAO-UHFFFAOYSA-N azane;7-fluoro-2,1,3-benzoxadiazole-4-sulfonic acid Chemical compound N.OS(=O)(=O)C1=CC=C(F)C2=NON=C12 JXLHNMVSKXFWAO-UHFFFAOYSA-N 0.000 description 1
- 150000001559 benzoic acids Chemical class 0.000 description 1
- 239000012267 brine Substances 0.000 description 1
- 150000004657 carbamic acid derivatives Chemical class 0.000 description 1
- 235000013877 carbamide Nutrition 0.000 description 1
- 150000001735 carboxylic acids Chemical class 0.000 description 1
- 235000013339 cereals Nutrition 0.000 description 1
- 238000006243 chemical reaction Methods 0.000 description 1
- 125000000068 chlorophenyl group Chemical group 0.000 description 1
- 239000013256 coordination polymer Substances 0.000 description 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 150000004891 diazines Chemical class 0.000 description 1
- JNSGIVNNHKGGRU-JYRVWZFOSA-N diethoxyphosphinothioyl (2z)-2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetate Chemical compound CCOP(=S)(OCC)OC(=O)C(=N/OC)\C1=CSC(N)=N1 JNSGIVNNHKGGRU-JYRVWZFOSA-N 0.000 description 1
- 239000003085 diluting agent Substances 0.000 description 1
- 239000002270 dispersing agent Substances 0.000 description 1
- 239000003995 emulsifying agent Substances 0.000 description 1
- 230000001804 emulsifying effect Effects 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- 239000003337 fertilizer Substances 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 235000013312 flour Nutrition 0.000 description 1
- 235000019253 formic acid Nutrition 0.000 description 1
- 101150000426 ftcd gene Proteins 0.000 description 1
- 239000000417 fungicide Substances 0.000 description 1
- GVVPGTZRZFNKDS-JXMROGBWSA-N geranyl diphosphate Chemical compound CC(C)=CCC\C(C)=C\CO[P@](O)(=O)OP(O)(O)=O GVVPGTZRZFNKDS-JXMROGBWSA-N 0.000 description 1
- 239000008187 granular material Substances 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 229940042795 hydrazides for tuberculosis treatment Drugs 0.000 description 1
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 1
- 229940072673 ismo Drugs 0.000 description 1
- YWXYYJSYQOXTPL-SLPGGIOYSA-N isosorbide mononitrate Chemical compound [O-][N+](=O)O[C@@H]1CO[C@@H]2[C@@H](O)CO[C@@H]21 YWXYYJSYQOXTPL-SLPGGIOYSA-N 0.000 description 1
- NLYAJNPCOHFWQQ-UHFFFAOYSA-N kaolin Chemical compound O.O.O=[Al]O[Si](=O)O[Si](=O)O[Al]=O NLYAJNPCOHFWQQ-UHFFFAOYSA-N 0.000 description 1
- 229920005610 lignin Polymers 0.000 description 1
- 239000006028 limestone Substances 0.000 description 1
- 239000000395 magnesium oxide Substances 0.000 description 1
- CPLXHLVBOLITMK-UHFFFAOYSA-N magnesium oxide Inorganic materials [Mg]=O CPLXHLVBOLITMK-UHFFFAOYSA-N 0.000 description 1
- AXZKOIWUVFPNLO-UHFFFAOYSA-N magnesium;oxygen(2-) Chemical compound [O-2].[Mg+2] AXZKOIWUVFPNLO-UHFFFAOYSA-N 0.000 description 1
- XMJHPCRAQCTCFT-UHFFFAOYSA-N methyl chloroformate Chemical compound COC(Cl)=O XMJHPCRAQCTCFT-UHFFFAOYSA-N 0.000 description 1
- PSZYNBSKGUBXEH-UHFFFAOYSA-N naphthalene-1-sulfonic acid Chemical class C1=CC=C2C(S(=O)(=O)O)=CC=CC2=C1 PSZYNBSKGUBXEH-UHFFFAOYSA-N 0.000 description 1
- 239000005645 nematicide Substances 0.000 description 1
- 230000007935 neutral effect Effects 0.000 description 1
- 150000002825 nitriles Chemical class 0.000 description 1
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 1
- 231100001184 nonphytotoxic Toxicity 0.000 description 1
- 239000012074 organic phase Substances 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 230000016087 ovulation Effects 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- 239000001301 oxygen Substances 0.000 description 1
- 210000002741 palatine tonsil Anatomy 0.000 description 1
- 235000020232 peanut Nutrition 0.000 description 1
- 239000000575 pesticide Substances 0.000 description 1
- BSCCSDNZEIHXOK-UHFFFAOYSA-N phenyl carbamate Chemical class NC(=O)OC1=CC=CC=C1 BSCCSDNZEIHXOK-UHFFFAOYSA-N 0.000 description 1
- WLJVXDMOQOGPHL-UHFFFAOYSA-N phenylacetic acid Chemical class OC(=O)CC1=CC=CC=C1 WLJVXDMOQOGPHL-UHFFFAOYSA-N 0.000 description 1
- 125000000286 phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- TYJJADVDDVDEDZ-UHFFFAOYSA-M potassium hydrogencarbonate Chemical compound [K+].OC([O-])=O TYJJADVDDVDEDZ-UHFFFAOYSA-M 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- 150000003254 radicals Chemical class 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 235000009566 rice Nutrition 0.000 description 1
- 239000000741 silica gel Substances 0.000 description 1
- 229910002027 silica gel Inorganic materials 0.000 description 1
- RMAQACBXLXPBSY-UHFFFAOYSA-N silicic acid Chemical compound O[Si](O)(O)O RMAQACBXLXPBSY-UHFFFAOYSA-N 0.000 description 1
- 235000012239 silicon dioxide Nutrition 0.000 description 1
- 239000001632 sodium acetate Substances 0.000 description 1
- 235000017281 sodium acetate Nutrition 0.000 description 1
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 238000001228 spectrum Methods 0.000 description 1
- 239000011593 sulfur Substances 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 230000002195 synergetic effect Effects 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- 150000003585 thioureas Chemical class 0.000 description 1
- 125000003944 tolyl group Chemical group 0.000 description 1
- 150000003918 triazines Chemical class 0.000 description 1
- 150000003672 ureas Chemical class 0.000 description 1
- 229940116269 uric acid Drugs 0.000 description 1
- 244000045561 useful plants Species 0.000 description 1
- 238000009736 wetting Methods 0.000 description 1
- 239000000080 wetting agent Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C237/00—Carboxylic acid amides, the carbon skeleton of the acid part being further substituted by amino groups
- C07C237/02—Carboxylic acid amides, the carbon skeleton of the acid part being further substituted by amino groups having the carbon atoms of the carboxamide groups bound to acyclic carbon atoms of the carbon skeleton
- C07C237/22—Carboxylic acid amides, the carbon skeleton of the acid part being further substituted by amino groups having the carbon atoms of the carboxamide groups bound to acyclic carbon atoms of the carbon skeleton having nitrogen atoms of amino groups bound to the carbon skeleton of the acid part, further acylated
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C271/00—Derivatives of carbamic acids, i.e. compounds containing any of the groups, the nitrogen atom not being part of nitro or nitroso groups
- C07C271/06—Esters of carbamic acids
- C07C271/08—Esters of carbamic acids having oxygen atoms of carbamate groups bound to acyclic carbon atoms
- C07C271/26—Esters of carbamic acids having oxygen atoms of carbamate groups bound to acyclic carbon atoms with the nitrogen atom of at least one of the carbamate groups bound to a carbon atom of a six-membered aromatic ring
- C07C271/28—Esters of carbamic acids having oxygen atoms of carbamate groups bound to acyclic carbon atoms with the nitrogen atom of at least one of the carbamate groups bound to a carbon atom of a six-membered aromatic ring to a carbon atom of a non-condensed six-membered aromatic ring
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C271/00—Derivatives of carbamic acids, i.e. compounds containing any of the groups, the nitrogen atom not being part of nitro or nitroso groups
- C07C271/06—Esters of carbamic acids
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C333/00—Derivatives of thiocarbamic acids, i.e. compounds containing any of the groups, the nitrogen atom not being part of nitro or nitroso groups
- C07C333/02—Monothiocarbamic acids; Derivatives thereof
- C07C333/08—Monothiocarbamic acids; Derivatives thereof having nitrogen atoms of thiocarbamic groups bound to carbon atoms of six-membered aromatic rings
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Heterocyclic Carbon Compounds Containing A Hetero Ring Having Nitrogen And Oxygen As The Only Ring Hetero Atoms (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2108975A DE2108975C3 (de) | 1971-02-16 | 1971-02-16 | N-Acyl-Diurethane sowie diese enthaltendes herbizides Mittel |
| DE2108975 | 1971-02-16 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| FI58634B FI58634B (fi) | 1980-11-28 |
| FI58634C true FI58634C (fi) | 1981-03-10 |
Family
ID=5799808
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| FI403/72A FI58634C (fi) | 1971-02-16 | 1972-02-14 | Herbisida n-acylbiskarbamater |
Country Status (24)
| Country | Link |
|---|---|
| US (1) | US3904669A (no) |
| JP (1) | JPS5244371B1 (no) |
| AT (1) | AT329914B (no) |
| AU (1) | AU460282B2 (no) |
| BE (1) | BE779443A (no) |
| CH (1) | CH567357A5 (no) |
| CS (1) | CS170176B2 (no) |
| DE (1) | DE2108975C3 (no) |
| DK (1) | DK133001C (no) |
| ES (1) | ES399808A1 (no) |
| FI (1) | FI58634C (no) |
| FR (1) | FR2125913A5 (no) |
| GB (1) | GB1338985A (no) |
| HU (1) | HU164147B (no) |
| IE (1) | IE36086B1 (no) |
| IL (1) | IL38738A (no) |
| IT (1) | IT948533B (no) |
| LU (1) | LU64633A1 (no) |
| NL (1) | NL7202061A (no) |
| NO (1) | NO135471C (no) |
| SE (1) | SE368395B (no) |
| SU (1) | SU673135A3 (no) |
| YU (1) | YU36695B (no) |
| ZA (1) | ZA72741B (no) |
Families Citing this family (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4076518A (en) * | 1970-08-20 | 1978-02-28 | Schering Aktiengesellschaft | Substituted phenyl thiocarbamates with herbicidal action and method for their production |
| DE2413933A1 (de) * | 1974-03-20 | 1975-09-25 | Schering Ag | Diurethane mit selektiver herbizider wirkung |
| US4202684A (en) * | 1975-12-18 | 1980-05-13 | Schering Aktiengesellschaft | Carbanilic acid esters, process for making the same and herbicidal compositions containing same |
| GR66157B (no) * | 1976-08-28 | 1981-01-20 | Basf Ag | |
| DE2703838A1 (de) * | 1977-01-31 | 1978-08-10 | Basf Ag | Diurethane |
| DE2732848A1 (de) * | 1977-07-18 | 1979-02-08 | Schering Ag | Diurethane, herbizide mittel enthaltend diese verbindungen sowie verfahren zu ihrer herstellung |
| BG28977A3 (en) | 1978-02-02 | 1980-08-15 | Montedison Spa | Fungicide means and method for fungus fighting |
| US4226613A (en) * | 1978-05-25 | 1980-10-07 | Basf Aktiengesellschaft | Bisthiocarbamic acid esters and herbicidal use thereof |
| DE2943965A1 (de) * | 1979-10-31 | 1981-05-27 | Basf Ag, 6700 Ludwigshafen | 1,2-oxazolylalkylcarbamate, ein verfahren zu ihrer herstellung und ihre verwendung als herbizide |
| JPS56123633A (en) * | 1980-03-04 | 1981-09-28 | Tokyo Shibaura Electric Co | Electrode structure for vacuum breaker |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3546343A (en) * | 1966-01-18 | 1970-12-08 | Union Carbide Corp | 4-(methylcarbamoyloxy) carbanilates as insecticides and nematocides |
-
1971
- 1971-02-16 DE DE2108975A patent/DE2108975C3/de not_active Expired
-
1972
- 1972-01-20 LU LU64633D patent/LU64633A1/xx unknown
- 1972-02-04 ZA ZA720741A patent/ZA72741B/xx unknown
- 1972-02-07 CS CS757A patent/CS170176B2/cs unknown
- 1972-02-08 DK DK55172*#A patent/DK133001C/da not_active IP Right Cessation
- 1972-02-09 AU AU38824/72A patent/AU460282B2/en not_active Expired
- 1972-02-10 JP JP47014768A patent/JPS5244371B1/ja active Pending
- 1972-02-10 IL IL38738A patent/IL38738A/xx unknown
- 1972-02-10 GB GB628972A patent/GB1338985A/en not_active Expired
- 1972-02-11 US US225626A patent/US3904669A/en not_active Expired - Lifetime
- 1972-02-11 SE SE01668/72A patent/SE368395B/xx unknown
- 1972-02-12 IT IT20512/72A patent/IT948533B/it active
- 1972-02-14 YU YU0360/72A patent/YU36695B/xx unknown
- 1972-02-14 FI FI403/72A patent/FI58634C/fi active
- 1972-02-15 FR FR7204979A patent/FR2125913A5/fr not_active Expired
- 1972-02-15 HU HUSCHE374*1A patent/HU164147B/hu unknown
- 1972-02-15 IE IE185/72A patent/IE36086B1/xx unknown
- 1972-02-15 NO NO434/72A patent/NO135471C/no unknown
- 1972-02-15 ES ES399808A patent/ES399808A1/es not_active Expired
- 1972-02-16 AT AT126172A patent/AT329914B/de not_active IP Right Cessation
- 1972-02-16 NL NL7202061A patent/NL7202061A/xx not_active Application Discontinuation
- 1972-02-16 SU SU721749422A patent/SU673135A3/ru active
- 1972-02-16 BE BE779443A patent/BE779443A/xx not_active IP Right Cessation
- 1972-02-16 CH CH220572A patent/CH567357A5/xx not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| SE368395B (no) | 1974-07-01 |
| AU460282B2 (en) | 1975-04-24 |
| FI58634B (fi) | 1980-11-28 |
| IL38738A (en) | 1975-04-25 |
| IE36086L (en) | 1972-08-16 |
| US3904669A (en) | 1975-09-09 |
| DE2108975A1 (de) | 1972-08-24 |
| YU36695B (en) | 1984-08-31 |
| IE36086B1 (en) | 1976-08-18 |
| DK133001B (da) | 1976-03-08 |
| YU36072A (en) | 1982-02-25 |
| NL7202061A (no) | 1972-08-18 |
| AU3882472A (en) | 1973-08-16 |
| SU673135A3 (ru) | 1979-07-05 |
| GB1338985A (en) | 1973-11-28 |
| NO135471B (no) | 1977-01-03 |
| BE779443A (fr) | 1972-08-16 |
| LU64633A1 (no) | 1972-06-26 |
| IT948533B (it) | 1973-06-11 |
| ZA72741B (en) | 1972-10-25 |
| HU164147B (no) | 1973-12-28 |
| DE2108975C3 (de) | 1979-12-20 |
| AT329914B (de) | 1976-06-10 |
| CS170176B2 (no) | 1976-08-27 |
| NO135471C (no) | 1977-04-13 |
| JPS5244371B1 (no) | 1977-11-08 |
| DK133001C (da) | 1976-08-02 |
| IL38738A0 (en) | 1972-04-27 |
| ES399808A1 (es) | 1974-12-01 |
| FR2125913A5 (no) | 1972-09-29 |
| CH567357A5 (no) | 1975-10-15 |
| ATA126172A (de) | 1975-08-15 |
| DE2108975B2 (de) | 1979-04-19 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| FI58634C (fi) | Herbisida n-acylbiskarbamater | |
| BG65454B1 (bg) | Заместени фенилсулфамоилкарбоксамиди | |
| EP0974587B1 (en) | 1-substituted 4-carbamoyl-1,2,4-triazol-5-one derivatives and herbicide | |
| IE46260B1 (en) | N-(azolylmethyl)-haloacetanilides and their use as herbicides | |
| JPH08501100A (ja) | 除草性ベンゼン化合物 | |
| US4663327A (en) | 1-heteroaryl-4-aryl-pyrazolin-5-ones | |
| PL137719B1 (en) | Herbicide | |
| HU194477B (en) | Herbicidal and fungicidal compositions comprising substituted propargyloxy-acetonitrile- derivatives as active substance and process for preparing the active substance | |
| JPS62167747A (ja) | 殺虫性化合物およびそれを含む殺虫組成物 | |
| US4067726A (en) | 3-Ureido phenylacetamide herbicides | |
| PT87646B (pt) | Processo para a preparacao duma composicao herbicida contendo triazolinonas substituidas, e de produtos intermediarios para a sua preparacao | |
| DE69110093T2 (de) | Pyrimidinderivate. | |
| ES2236509T3 (es) | 5-halogen-6-fenil-7-fluoroalquilamino-triazolopirimidinas utiles como fungicidas. | |
| CA1192195A (en) | Pyridazinone derivatives, their preparation and their use as fungicides | |
| US3492333A (en) | Carbamidoximes | |
| US4749812A (en) | N-(3-chloro-4-isopropylphenyl) carboxamide derivative and selective herbicide | |
| PT97249B (pt) | Processo para a preparacao de composicoes herbicidas que contem pelo menos um derivado de fenilpiridazina substituido | |
| US3535101A (en) | Herbicide and algicide means | |
| JP2002517413A (ja) | 殺菌剤としての２−（ｎ−フェニルアミノ）ピリジンの使用法、及び新規な２−（ｎ−フェニルアミノ）ピリミジン | |
| JPH02255657A (ja) | ２―アニリノ―シアノピリジンおよび該化合物を含有する殺菌剤 | |
| CA2046206A1 (en) | Pyrimidine derivative | |
| CS196228B2 (en) | Herbicide | |
| CS264282B2 (en) | Fungicide agent and preparation method for actives compounds | |
| US5266556A (en) | Arylindazole derivatives and their use | |
| PT91112B (pt) | Processo para a preparacao duma composicao pesticida nomeadamente, fungicida e/ou microbicida, contendo derivados de 4-halogeno-5-nitrotiazol e de compostos intermediarios |