ES2512727T3 - Nuevos compuestos - Google Patents
Nuevos compuestos Download PDFInfo
- Publication number
- ES2512727T3 ES2512727T3 ES10819801.1T ES10819801T ES2512727T3 ES 2512727 T3 ES2512727 T3 ES 2512727T3 ES 10819801 T ES10819801 T ES 10819801T ES 2512727 T3 ES2512727 T3 ES 2512727T3
- Authority
- ES
- Spain
- Prior art keywords
- methyl
- ring
- optionally substituted
- nitrogen
- mmol
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Active
Links
- 150000001875 compounds Chemical class 0.000 title claims abstract description 391
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims abstract description 181
- IJGRMHOSHXDMSA-UHFFFAOYSA-N nitrogen Substances N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 claims abstract description 143
- 229910052739 hydrogen Inorganic materials 0.000 claims abstract description 116
- 239000001257 hydrogen Substances 0.000 claims abstract description 116
- -1 1,3-oxazol-2-yl Chemical group 0.000 claims abstract description 115
- 229910052757 nitrogen Inorganic materials 0.000 claims abstract description 106
- 125000002947 alkylene group Chemical group 0.000 claims abstract description 98
- 150000003839 salts Chemical class 0.000 claims abstract description 98
- 125000006273 (C1-C3) alkyl group Chemical group 0.000 claims abstract description 85
- 229910052736 halogen Inorganic materials 0.000 claims abstract description 82
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 claims abstract description 80
- 150000002367 halogens Chemical group 0.000 claims abstract description 63
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims abstract description 46
- 229910052731 fluorine Inorganic materials 0.000 claims abstract description 32
- 239000011737 fluorine Substances 0.000 claims abstract description 32
- 125000004435 hydrogen atom Chemical class [H]* 0.000 claims abstract description 32
- 125000006274 (C1-C3)alkoxy group Chemical group 0.000 claims abstract description 29
- 125000004433 nitrogen atom Chemical group N* 0.000 claims abstract description 29
- 125000000217 alkyl group Chemical group 0.000 claims abstract description 26
- 125000003349 3-pyridyl group Chemical group N1=C([H])C([*])=C([H])C([H])=C1[H] 0.000 claims abstract description 25
- 125000003545 alkoxy group Chemical group 0.000 claims abstract description 24
- 125000003226 pyrazolyl group Chemical group 0.000 claims abstract description 21
- 125000004076 pyridyl group Chemical group 0.000 claims abstract description 21
- 125000005843 halogen group Chemical group 0.000 claims abstract description 20
- 125000004093 cyano group Chemical group *C#N 0.000 claims abstract description 19
- 125000001153 fluoro group Chemical group F* 0.000 claims abstract description 18
- 125000004498 isoxazol-4-yl group Chemical group O1N=CC(=C1)* 0.000 claims abstract description 17
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 claims abstract description 17
- 125000004940 pyridazin-4-yl group Chemical group N1=NC=C(C=C1)* 0.000 claims abstract description 15
- CBOIHMRHGLHBPB-UHFFFAOYSA-N hydroxymethyl Chemical compound O[CH2] CBOIHMRHGLHBPB-UHFFFAOYSA-N 0.000 claims abstract description 14
- 125000004429 atom Chemical group 0.000 claims abstract description 13
- 125000000842 isoxazolyl group Chemical group 0.000 claims abstract description 12
- 125000002206 pyridazin-3-yl group Chemical group [H]C1=C([H])C([H])=C(*)N=N1 0.000 claims abstract description 12
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims abstract description 11
- 229910052760 oxygen Inorganic materials 0.000 claims abstract description 11
- 239000001301 oxygen Substances 0.000 claims abstract description 11
- 125000004105 2-pyridyl group Chemical group N1=C([*])C([H])=C([H])C([H])=C1[H] 0.000 claims abstract description 10
- 125000006583 (C1-C3) haloalkyl group Chemical group 0.000 claims abstract description 9
- 125000004528 pyrimidin-5-yl group Chemical group N1=CN=CC(=C1)* 0.000 claims abstract description 9
- 125000004356 hydroxy functional group Chemical group O* 0.000 claims abstract 10
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 claims abstract 2
- 238000011282 treatment Methods 0.000 claims description 51
- 150000002431 hydrogen Chemical class 0.000 claims description 39
- 208000018737 Parkinson disease Diseases 0.000 claims description 31
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 23
- 239000003814 drug Substances 0.000 claims description 18
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 claims description 12
- 239000008194 pharmaceutical composition Substances 0.000 claims description 12
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 12
- KXDAEFPNCMNJSK-UHFFFAOYSA-N Benzamide Chemical compound NC(=O)C1=CC=CC=C1 KXDAEFPNCMNJSK-UHFFFAOYSA-N 0.000 claims description 10
- AAACBXVBBDAYRQ-UHFFFAOYSA-N 5-chloro-2-phenylmethoxy-n-pyridin-3-ylbenzamide Chemical compound C=1C=CN=CC=1NC(=O)C1=CC(Cl)=CC=C1OCC1=CC=CC=C1 AAACBXVBBDAYRQ-UHFFFAOYSA-N 0.000 claims description 6
- 239000003937 drug carrier Substances 0.000 claims description 6
- GHPHJDFIOQSUBE-UHFFFAOYSA-N 2-[(3,4-difluorophenyl)methoxy]-5-(1-hydroxyethyl)-n-pyridazin-4-ylbenzamide Chemical compound C=1C=NN=CC=1NC(=O)C1=CC(C(O)C)=CC=C1OCC1=CC=C(F)C(F)=C1 GHPHJDFIOQSUBE-UHFFFAOYSA-N 0.000 claims description 5
- 125000000250 methylamino group Chemical group [H]N(*)C([H])([H])[H] 0.000 claims description 5
- 239000000546 pharmaceutical excipient Substances 0.000 claims description 5
- 238000011321 prophylaxis Methods 0.000 claims description 5
- XSAKVPQLGQBNEP-UHFFFAOYSA-N 5-chloro-2-[(2-cyanophenyl)methoxy]-n-phenylbenzamide Chemical compound C=1C=CC=CC=1NC(=O)C1=CC(Cl)=CC=C1OCC1=CC=CC=C1C#N XSAKVPQLGQBNEP-UHFFFAOYSA-N 0.000 claims description 4
- KRFOCQGPEDYXBQ-UHFFFAOYSA-N 5-amino-2-[(2,4-dimethylphenyl)methoxy]-n-phenylbenzamide Chemical compound CC1=CC(C)=CC=C1COC1=CC=C(N)C=C1C(=O)NC1=CC=CC=C1 KRFOCQGPEDYXBQ-UHFFFAOYSA-N 0.000 claims 1
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 429
- 239000000203 mixture Substances 0.000 description 243
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 203
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Chemical compound O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 203
- 239000000243 solution Substances 0.000 description 198
- 239000007787 solid Substances 0.000 description 197
- 229910001868 water Inorganic materials 0.000 description 179
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 150
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 148
- WMFOQBRAJBCJND-UHFFFAOYSA-M Lithium hydroxide Chemical compound [Li+].[OH-] WMFOQBRAJBCJND-UHFFFAOYSA-M 0.000 description 121
- 239000011541 reaction mixture Substances 0.000 description 117
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 97
- 239000002904 solvent Substances 0.000 description 95
- 238000006243 chemical reaction Methods 0.000 description 89
- 238000000034 method Methods 0.000 description 88
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 80
- 239000012074 organic phase Substances 0.000 description 78
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 77
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 77
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 72
- 239000012043 crude product Substances 0.000 description 68
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 65
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 64
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 59
- 229910000027 potassium carbonate Inorganic materials 0.000 description 48
- CUYKNJBYIJFRCU-UHFFFAOYSA-N 3-aminopyridine Chemical compound NC1=CC=CN=C1 CUYKNJBYIJFRCU-UHFFFAOYSA-N 0.000 description 45
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical group CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 45
- 239000011734 sodium Substances 0.000 description 44
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 42
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 41
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 40
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 40
- 229910052938 sodium sulfate Inorganic materials 0.000 description 40
- 235000011152 sodium sulphate Nutrition 0.000 description 40
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 37
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 36
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 36
- 235000019341 magnesium sulphate Nutrition 0.000 description 36
- 239000000725 suspension Substances 0.000 description 36
- 244000257039 Duranta repens Species 0.000 description 35
- 238000010992 reflux Methods 0.000 description 35
- WSLDOOZREJYCGB-UHFFFAOYSA-N 1,2-Dichloroethane Chemical compound ClCCCl WSLDOOZREJYCGB-UHFFFAOYSA-N 0.000 description 33
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 33
- 102100032693 Leucine-rich repeat serine/threonine-protein kinase 2 Human genes 0.000 description 33
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 33
- IAZDPXIOMUYVGZ-WFGJKAKNSA-N Dimethyl sulfoxide Chemical compound [2H]C([2H])([2H])S(=O)C([2H])([2H])[2H] IAZDPXIOMUYVGZ-WFGJKAKNSA-N 0.000 description 32
- 108010020246 Leucine-Rich Repeat Serine-Threonine Protein Kinase-2 Proteins 0.000 description 32
- 239000000706 filtrate Substances 0.000 description 32
- LMDZBCPBFSXMTL-UHFFFAOYSA-N 1-Ethyl-3-(3-dimethylaminopropyl)carbodiimide Substances CCN=C=NCCCN(C)C LMDZBCPBFSXMTL-UHFFFAOYSA-N 0.000 description 30
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 30
- 239000002253 acid Substances 0.000 description 28
- YCKRFDGAMUMZLT-UHFFFAOYSA-N Fluorine atom Chemical compound [F] YCKRFDGAMUMZLT-UHFFFAOYSA-N 0.000 description 27
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 27
- 239000000741 silica gel Substances 0.000 description 27
- 229910002027 silica gel Inorganic materials 0.000 description 27
- PFKFTWBEEFSNDU-UHFFFAOYSA-N carbonyldiimidazole Chemical compound C1=CN=CN1C(=O)N1C=CN=C1 PFKFTWBEEFSNDU-UHFFFAOYSA-N 0.000 description 25
- 239000003921 oil Substances 0.000 description 25
- 235000019198 oils Nutrition 0.000 description 25
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 24
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 24
- 230000002829 reductive effect Effects 0.000 description 24
- RIOQSEWOXXDEQQ-UHFFFAOYSA-N triphenylphosphine Chemical compound C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 RIOQSEWOXXDEQQ-UHFFFAOYSA-N 0.000 description 24
- NFHFRUOZVGFOOS-UHFFFAOYSA-N palladium;triphenylphosphane Chemical compound [Pd].C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 NFHFRUOZVGFOOS-UHFFFAOYSA-N 0.000 description 23
- JGFZNNIVVJXRND-UHFFFAOYSA-N N,N-Diisopropylethylamine (DIPEA) Chemical compound CCN(C(C)C)C(C)C JGFZNNIVVJXRND-UHFFFAOYSA-N 0.000 description 22
- 125000005587 carbonate group Chemical group 0.000 description 22
- CTSLXHKWHWQRSH-UHFFFAOYSA-N oxalyl chloride Chemical compound ClC(=O)C(Cl)=O CTSLXHKWHWQRSH-UHFFFAOYSA-N 0.000 description 22
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 21
- 239000008346 aqueous phase Substances 0.000 description 21
- IEJOONSLOGAXNO-UHFFFAOYSA-N 5-bromo-2-hydroxybenzoic acid Chemical compound OC(=O)C1=CC(Br)=CC=C1O IEJOONSLOGAXNO-UHFFFAOYSA-N 0.000 description 20
- DTQVDTLACAAQTR-UHFFFAOYSA-N Trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 description 20
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 20
- 239000012267 brine Substances 0.000 description 19
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 18
- 208000024827 Alzheimer disease Diseases 0.000 description 18
- 201000011240 Frontotemporal dementia Diseases 0.000 description 18
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 18
- 201000010099 disease Diseases 0.000 description 18
- 239000003208 petroleum Substances 0.000 description 18
- AGEZXYOZHKGVCM-UHFFFAOYSA-N benzyl bromide Chemical compound BrCC1=CC=CC=C1 AGEZXYOZHKGVCM-UHFFFAOYSA-N 0.000 description 17
- 238000001816 cooling Methods 0.000 description 17
- 239000012044 organic layer Substances 0.000 description 17
- 239000012230 colorless oil Substances 0.000 description 16
- 239000000047 product Substances 0.000 description 16
- QPJVMBTYPHYUOC-UHFFFAOYSA-N Methyl benzoate Natural products COC(=O)C1=CC=CC=C1 QPJVMBTYPHYUOC-UHFFFAOYSA-N 0.000 description 15
- 238000005481 NMR spectroscopy Methods 0.000 description 15
- FJDQFPXHSGXQBY-UHFFFAOYSA-L caesium carbonate Chemical compound [Cs+].[Cs+].[O-]C([O-])=O FJDQFPXHSGXQBY-UHFFFAOYSA-L 0.000 description 15
- 229940095102 methyl benzoate Drugs 0.000 description 15
- 239000002244 precipitate Substances 0.000 description 15
- 238000005160 1H NMR spectroscopy Methods 0.000 description 14
- 150000001412 amines Chemical class 0.000 description 14
- 229910000024 caesium carbonate Inorganic materials 0.000 description 14
- XTHFKEDIFFGKHM-UHFFFAOYSA-N Dimethoxyethane Chemical compound COCCOC XTHFKEDIFFGKHM-UHFFFAOYSA-N 0.000 description 13
- 239000000460 chlorine Substances 0.000 description 13
- 229910052801 chlorine Inorganic materials 0.000 description 13
- 238000004440 column chromatography Methods 0.000 description 13
- 235000015320 potassium carbonate Nutrition 0.000 description 13
- 125000006239 protecting group Chemical group 0.000 description 13
- 208000031261 Acute myeloid leukaemia Diseases 0.000 description 12
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 12
- 208000033776 Myeloid Acute Leukemia Diseases 0.000 description 12
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 12
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 12
- 238000001914 filtration Methods 0.000 description 12
- 125000002485 formyl group Chemical group [H]C(*)=O 0.000 description 12
- 230000035772 mutation Effects 0.000 description 12
- 238000000746 purification Methods 0.000 description 12
- VIQAXGLEBKDMGC-UHFFFAOYSA-N 5-bromo-2-phenylmethoxybenzoic acid Chemical compound OC(=O)C1=CC(Br)=CC=C1OCC1=CC=CC=C1 VIQAXGLEBKDMGC-UHFFFAOYSA-N 0.000 description 11
- 239000007832 Na2SO4 Substances 0.000 description 11
- 150000001263 acyl chlorides Chemical class 0.000 description 11
- 230000001012 protector Effects 0.000 description 11
- 238000010898 silica gel chromatography Methods 0.000 description 11
- ASOKPJOREAFHNY-UHFFFAOYSA-N 1-Hydroxybenzotriazole Chemical compound C1=CC=C2N(O)N=NC2=C1 ASOKPJOREAFHNY-UHFFFAOYSA-N 0.000 description 10
- 125000004214 1-pyrrolidinyl group Chemical group [H]C1([H])N(*)C([H])([H])C([H])([H])C1([H])[H] 0.000 description 10
- FPQQSJJWHUJYPU-UHFFFAOYSA-N 3-(dimethylamino)propyliminomethylidene-ethylazanium;chloride Chemical compound Cl.CCN=C=NCCCN(C)C FPQQSJJWHUJYPU-UHFFFAOYSA-N 0.000 description 10
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 10
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical group [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 10
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 10
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical class [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 10
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 10
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 10
- 229910052794 bromium Inorganic materials 0.000 description 10
- 238000004587 chromatography analysis Methods 0.000 description 10
- 125000003386 piperidinyl group Chemical group 0.000 description 10
- 230000008569 process Effects 0.000 description 10
- VVWRJUBEIPHGQF-MDZDMXLPSA-N propan-2-yl (ne)-n-propan-2-yloxycarbonyliminocarbamate Chemical compound CC(C)OC(=O)\N=N\C(=O)OC(C)C VVWRJUBEIPHGQF-MDZDMXLPSA-N 0.000 description 10
- IBMINJNGVGXXDY-UHFFFAOYSA-N 5-bromo-2-phenylmethoxy-n-pyridin-2-ylbenzamide Chemical compound C=1C=CC=NC=1NC(=O)C1=CC(Br)=CC=C1OCC1=CC=CC=C1 IBMINJNGVGXXDY-UHFFFAOYSA-N 0.000 description 9
- YNAVUWVOSKDBBP-UHFFFAOYSA-N Morpholine Chemical compound C1COCCN1 YNAVUWVOSKDBBP-UHFFFAOYSA-N 0.000 description 9
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 9
- 239000007822 coupling agent Substances 0.000 description 9
- 238000010511 deprotection reaction Methods 0.000 description 9
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 9
- 239000000499 gel Substances 0.000 description 9
- 239000005457 ice water Substances 0.000 description 9
- 125000002950 monocyclic group Chemical group 0.000 description 9
- 150000002894 organic compounds Chemical class 0.000 description 9
- 125000004193 piperazinyl group Chemical group 0.000 description 9
- 125000001255 4-fluorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1F 0.000 description 8
- IIPUXHBGINOLKK-UHFFFAOYSA-N 5-hydroxy-2-phenylmethoxy-n-pyridin-3-ylbenzamide Chemical compound C=1C=CN=CC=1NC(=O)C1=CC(O)=CC=C1OCC1=CC=CC=C1 IIPUXHBGINOLKK-UHFFFAOYSA-N 0.000 description 8
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical group C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 8
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 8
- 208000027089 Parkinsonian disease Diseases 0.000 description 8
- 238000003016 alphascreen Methods 0.000 description 8
- GLXDVVHUTZTUQK-UHFFFAOYSA-M lithium;hydroxide;hydrate Chemical compound [Li+].O.[OH-] GLXDVVHUTZTUQK-UHFFFAOYSA-M 0.000 description 8
- IUBQJLUDMLPAGT-UHFFFAOYSA-N potassium bis(trimethylsilyl)amide Chemical compound C[Si](C)(C)N([K])[Si](C)(C)C IUBQJLUDMLPAGT-UHFFFAOYSA-N 0.000 description 8
- 229910052717 sulfur Chemical group 0.000 description 8
- 239000011593 sulfur Chemical group 0.000 description 8
- LWIHDJKSTIGBAC-UHFFFAOYSA-K tripotassium phosphate Chemical compound [K+].[K+].[K+].[O-]P([O-])([O-])=O LWIHDJKSTIGBAC-UHFFFAOYSA-K 0.000 description 8
- MNLNIOZMKGDDDY-UHFFFAOYSA-N 3-methoxycarbonyl-4-phenylmethoxybenzoic acid Chemical compound COC(=O)C1=CC(C(O)=O)=CC=C1OCC1=CC=CC=C1 MNLNIOZMKGDDDY-UHFFFAOYSA-N 0.000 description 7
- 206010012289 Dementia Diseases 0.000 description 7
- 206010034010 Parkinsonism Diseases 0.000 description 7
- NXHFWYNZSJELII-UHFFFAOYSA-N benzyl 5-bromo-2-phenylmethoxybenzoate Chemical compound C=1C=CC=CC=1COC(=O)C1=CC(Br)=CC=C1OCC1=CC=CC=C1 NXHFWYNZSJELII-UHFFFAOYSA-N 0.000 description 7
- 210000000481 breast Anatomy 0.000 description 7
- FAMRKDQNMBBFBR-BQYQJAHWSA-N diethyl azodicarboxylate Substances CCOC(=O)\N=N\C(=O)OCC FAMRKDQNMBBFBR-BQYQJAHWSA-N 0.000 description 7
- VYFYYTLLBUKUHU-UHFFFAOYSA-N dopamine Chemical compound NCCC1=CC=C(O)C(O)=C1 VYFYYTLLBUKUHU-UHFFFAOYSA-N 0.000 description 7
- 230000000694 effects Effects 0.000 description 7
- 239000003480 eluent Substances 0.000 description 7
- 239000003112 inhibitor Substances 0.000 description 7
- 210000004072 lung Anatomy 0.000 description 7
- 102200092160 rs34637584 Human genes 0.000 description 7
- 238000003756 stirring Methods 0.000 description 7
- 229910052725 zinc Inorganic materials 0.000 description 7
- 239000011701 zinc Substances 0.000 description 7
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 6
- NVNPLEPBDPJYRZ-UHFFFAOYSA-N 1-(bromomethyl)-4-fluorobenzene Chemical compound FC1=CC=C(CBr)C=C1 NVNPLEPBDPJYRZ-UHFFFAOYSA-N 0.000 description 6
- 125000004484 1-methylpiperidin-4-yl group Chemical group CN1CCC(CC1)* 0.000 description 6
- YYROPELSRYBVMQ-UHFFFAOYSA-N 4-toluenesulfonyl chloride Chemical compound CC1=CC=C(S(Cl)(=O)=O)C=C1 YYROPELSRYBVMQ-UHFFFAOYSA-N 0.000 description 6
- RZVAJINKPMORJF-UHFFFAOYSA-N Acetaminophen Chemical compound CC(=O)NC1=CC=C(O)C=C1 RZVAJINKPMORJF-UHFFFAOYSA-N 0.000 description 6
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical group [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 6
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 6
- 239000007821 HATU Substances 0.000 description 6
- WTDHULULXKLSOZ-UHFFFAOYSA-N Hydroxylamine hydrochloride Chemical compound Cl.ON WTDHULULXKLSOZ-UHFFFAOYSA-N 0.000 description 6
- 229940124786 LRRK2 inhibitor Drugs 0.000 description 6
- XGDPKUKRQHHZTH-UHFFFAOYSA-N Methyl 2,5-dihydroxybenzoate Chemical compound COC(=O)C1=CC(O)=CC=C1O XGDPKUKRQHHZTH-UHFFFAOYSA-N 0.000 description 6
- 206010028980 Neoplasm Diseases 0.000 description 6
- 206010033799 Paralysis Diseases 0.000 description 6
- 208000000609 Pick Disease of the Brain Diseases 0.000 description 6
- DKGAVHZHDRPRBM-UHFFFAOYSA-N Tert-Butanol Chemical compound CC(C)(C)O DKGAVHZHDRPRBM-UHFFFAOYSA-N 0.000 description 6
- 239000007983 Tris buffer Substances 0.000 description 6
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 6
- 229960002903 benzyl benzoate Drugs 0.000 description 6
- 125000001246 bromo group Chemical group Br* 0.000 description 6
- 210000000349 chromosome Anatomy 0.000 description 6
- 208000010877 cognitive disease Diseases 0.000 description 6
- 208000035475 disorder Diseases 0.000 description 6
- 238000004128 high performance liquid chromatography Methods 0.000 description 6
- 210000003734 kidney Anatomy 0.000 description 6
- 208000027061 mild cognitive impairment Diseases 0.000 description 6
- 125000004573 morpholin-4-yl group Chemical group N1(CCOCC1)* 0.000 description 6
- QJPQVXSHYBGQGM-UHFFFAOYSA-N palladium;triphenylphosphane Chemical compound [Pd].C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 QJPQVXSHYBGQGM-UHFFFAOYSA-N 0.000 description 6
- IUGYQRQAERSCNH-UHFFFAOYSA-M pivalate Chemical compound CC(C)(C)C([O-])=O IUGYQRQAERSCNH-UHFFFAOYSA-M 0.000 description 6
- 239000000843 powder Substances 0.000 description 6
- 238000002953 preparative HPLC Methods 0.000 description 6
- 230000000750 progressive effect Effects 0.000 description 6
- 229910000029 sodium carbonate Inorganic materials 0.000 description 6
- 235000017550 sodium carbonate Nutrition 0.000 description 6
- 239000003826 tablet Substances 0.000 description 6
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 6
- 229940124597 therapeutic agent Drugs 0.000 description 6
- 208000011990 Corticobasal Degeneration Diseases 0.000 description 5
- AVXURJPOCDRRFD-UHFFFAOYSA-N Hydroxylamine Chemical compound ON AVXURJPOCDRRFD-UHFFFAOYSA-N 0.000 description 5
- WTDRDQBEARUVNC-LURJTMIESA-N L-DOPA Chemical compound OC(=O)[C@@H](N)CC1=CC=C(O)C(O)=C1 WTDRDQBEARUVNC-LURJTMIESA-N 0.000 description 5
- WTDRDQBEARUVNC-UHFFFAOYSA-N L-Dopa Natural products OC(=O)C(N)CC1=CC=C(O)C(O)=C1 WTDRDQBEARUVNC-UHFFFAOYSA-N 0.000 description 5
- 241000735215 Lepidocybium flavobrunneum Species 0.000 description 5
- 208000009829 Lewy Body Disease Diseases 0.000 description 5
- 201000002832 Lewy body dementia Diseases 0.000 description 5
- 201000004810 Vascular dementia Diseases 0.000 description 5
- UXRDAJMOOGEIAQ-CKOZHMEPSA-N [(8r,9s,10r,13s,14s,17r)-17-acetyl-10,13-dimethyl-16-methylidene-3-oxo-1,2,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthren-17-yl] acetate Chemical compound C1=CC2=CC(=O)CC[C@]2(C)[C@@H]2[C@@H]1[C@@H]1CC(=C)[C@](OC(=O)C)(C(C)=O)[C@@]1(C)CC2 UXRDAJMOOGEIAQ-CKOZHMEPSA-N 0.000 description 5
- 239000000556 agonist Substances 0.000 description 5
- 239000007864 aqueous solution Substances 0.000 description 5
- 239000003638 chemical reducing agent Substances 0.000 description 5
- IPZJQDSFZGZEOY-UHFFFAOYSA-N dimethylmethylene Chemical compound C[C]C IPZJQDSFZGZEOY-UHFFFAOYSA-N 0.000 description 5
- 238000003818 flash chromatography Methods 0.000 description 5
- 239000010410 layer Substances 0.000 description 5
- 238000004519 manufacturing process Methods 0.000 description 5
- 230000007074 memory dysfunction Effects 0.000 description 5
- GRVDJDISBSALJP-UHFFFAOYSA-N methyloxidanyl Chemical group [O]C GRVDJDISBSALJP-UHFFFAOYSA-N 0.000 description 5
- 125000002757 morpholinyl group Chemical group 0.000 description 5
- 125000004194 piperazin-1-yl group Chemical group [H]N1C([H])([H])C([H])([H])N(*)C([H])([H])C1([H])[H] 0.000 description 5
- 125000000587 piperidin-1-yl group Chemical group [H]C1([H])N(*)C([H])([H])C([H])([H])C([H])([H])C1([H])[H] 0.000 description 5
- 210000002307 prostate Anatomy 0.000 description 5
- GXHYSSQTUDRGKS-UHFFFAOYSA-N (4-fluorophenyl)methyl 5-bromo-2-[(4-fluorophenyl)methoxy]benzoate Chemical compound C1=CC(F)=CC=C1COC(=O)C1=CC(Br)=CC=C1OCC1=CC=C(F)C=C1 GXHYSSQTUDRGKS-UHFFFAOYSA-N 0.000 description 4
- KZPYGQFFRCFCPP-UHFFFAOYSA-N 1,1'-bis(diphenylphosphino)ferrocene Chemical compound [Fe+2].C1=CC=C[C-]1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=C[C-]1P(C=1C=CC=CC=1)C1=CC=CC=C1 KZPYGQFFRCFCPP-UHFFFAOYSA-N 0.000 description 4
- PVOAHINGSUIXLS-UHFFFAOYSA-N 1-Methylpiperazine Chemical compound CN1CCNCC1 PVOAHINGSUIXLS-UHFFFAOYSA-N 0.000 description 4
- AFABGHUZZDYHJO-UHFFFAOYSA-N 2-Methylpentane Chemical compound CCCC(C)C AFABGHUZZDYHJO-UHFFFAOYSA-N 0.000 description 4
- ICSNLGPSRYBMBD-UHFFFAOYSA-N 2-aminopyridine Chemical compound NC1=CC=CC=N1 ICSNLGPSRYBMBD-UHFFFAOYSA-N 0.000 description 4
- 125000004195 4-methylpiperazin-1-yl group Chemical group [H]C([H])([H])N1C([H])([H])C([H])([H])N(*)C([H])([H])C1([H])[H] 0.000 description 4
- DIXZZFJPRGMUDO-UHFFFAOYSA-N 5-bromo-2-hydroxy-n-pyridin-3-ylbenzamide Chemical compound OC1=CC=C(Br)C=C1C(=O)NC1=CC=CN=C1 DIXZZFJPRGMUDO-UHFFFAOYSA-N 0.000 description 4
- QFVLBJUZNZZXFF-UHFFFAOYSA-N 5-hydroxy-2-phenylmethoxybenzoic acid Chemical compound OC(=O)C1=CC(O)=CC=C1OCC1=CC=CC=C1 QFVLBJUZNZZXFF-UHFFFAOYSA-N 0.000 description 4
- XKRFYHLGVUSROY-UHFFFAOYSA-N Argon Chemical compound [Ar] XKRFYHLGVUSROY-UHFFFAOYSA-N 0.000 description 4
- WVDDGKGOMKODPV-UHFFFAOYSA-N Benzyl alcohol Chemical compound OCC1=CC=CC=C1 WVDDGKGOMKODPV-UHFFFAOYSA-N 0.000 description 4
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 4
- ROSDSFDQCJNGOL-UHFFFAOYSA-N Dimethylamine Chemical compound CNC ROSDSFDQCJNGOL-UHFFFAOYSA-N 0.000 description 4
- 208000012661 Dyskinesia Diseases 0.000 description 4
- 235000019502 Orange oil Nutrition 0.000 description 4
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 description 4
- 230000003281 allosteric effect Effects 0.000 description 4
- 150000003936 benzamides Chemical class 0.000 description 4
- MUALRAIOVNYAIW-UHFFFAOYSA-N binap Chemical compound C1=CC=CC=C1P(C=1C(=C2C=CC=CC2=CC=1)C=1C2=CC=CC=C2C=CC=1P(C=1C=CC=CC=1)C=1C=CC=CC=1)C1=CC=CC=C1 MUALRAIOVNYAIW-UHFFFAOYSA-N 0.000 description 4
- ZADPBFCGQRWHPN-UHFFFAOYSA-N boronic acid Chemical compound OBO ZADPBFCGQRWHPN-UHFFFAOYSA-N 0.000 description 4
- TVFDJXOCXUVLDH-UHFFFAOYSA-N caesium atom Chemical compound [Cs] TVFDJXOCXUVLDH-UHFFFAOYSA-N 0.000 description 4
- 229910052799 carbon Inorganic materials 0.000 description 4
- 229910002092 carbon dioxide Inorganic materials 0.000 description 4
- 239000003054 catalyst Substances 0.000 description 4
- 239000003795 chemical substances by application Substances 0.000 description 4
- 229940092727 claro Drugs 0.000 description 4
- 229940079593 drug Drugs 0.000 description 4
- 238000000338 in vitro Methods 0.000 description 4
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 4
- JCUQSWVHGVRETC-UHFFFAOYSA-N methyl 5-chlorosulfonyl-2-hydroxybenzoate Chemical compound COC(=O)C1=CC(S(Cl)(=O)=O)=CC=C1O JCUQSWVHGVRETC-UHFFFAOYSA-N 0.000 description 4
- 239000003607 modifier Substances 0.000 description 4
- 239000010502 orange oil Substances 0.000 description 4
- 238000002600 positron emission tomography Methods 0.000 description 4
- 239000012286 potassium permanganate Substances 0.000 description 4
- 238000002360 preparation method Methods 0.000 description 4
- VVWRJUBEIPHGQF-UHFFFAOYSA-N propan-2-yl n-propan-2-yloxycarbonyliminocarbamate Chemical compound CC(C)OC(=O)N=NC(=O)OC(C)C VVWRJUBEIPHGQF-UHFFFAOYSA-N 0.000 description 4
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 4
- 125000000719 pyrrolidinyl group Chemical group 0.000 description 4
- 235000017557 sodium bicarbonate Nutrition 0.000 description 4
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 4
- 239000012312 sodium hydride Substances 0.000 description 4
- 229910000104 sodium hydride Inorganic materials 0.000 description 4
- 239000012321 sodium triacetoxyborohydride Substances 0.000 description 4
- 238000002636 symptomatic treatment Methods 0.000 description 4
- 229910000404 tripotassium phosphate Inorganic materials 0.000 description 4
- 235000019798 tripotassium phosphate Nutrition 0.000 description 4
- CYPYTURSJDMMMP-WVCUSYJESA-N (1e,4e)-1,5-diphenylpenta-1,4-dien-3-one;palladium Chemical compound [Pd].[Pd].C=1C=CC=CC=1\C=C\C(=O)\C=C\C1=CC=CC=C1.C=1C=CC=CC=1\C=C\C(=O)\C=C\C1=CC=CC=C1.C=1C=CC=CC=1\C=C\C(=O)\C=C\C1=CC=CC=C1 CYPYTURSJDMMMP-WVCUSYJESA-N 0.000 description 3
- YHRKWEZBCLOCPE-UHFFFAOYSA-N (2-fluorophenyl)methyl 5-bromo-2-[(2-fluorophenyl)methoxy]benzoate Chemical compound FC1=CC=CC=C1COC(=O)C1=CC(Br)=CC=C1OCC1=CC=CC=C1F YHRKWEZBCLOCPE-UHFFFAOYSA-N 0.000 description 3
- MRAOSWLEJJDVGT-UHFFFAOYSA-N (3,4-difluorophenyl)methyl 5-bromo-2-[(3,4-difluorophenyl)methoxy]benzoate Chemical compound C1=C(F)C(F)=CC=C1COC(=O)C1=CC(Br)=CC=C1OCC1=CC=C(F)C(F)=C1 MRAOSWLEJJDVGT-UHFFFAOYSA-N 0.000 description 3
- BLDCMJILHPESIY-UHFFFAOYSA-N (3-aminophenyl)methyl acetate Chemical compound CC(=O)OCC1=CC=CC(N)=C1 BLDCMJILHPESIY-UHFFFAOYSA-N 0.000 description 3
- CVJWFLPNFJAOBK-UHFFFAOYSA-N (3-fluorophenyl)methyl 5-bromo-2-[(3-fluorophenyl)methoxy]benzoate Chemical compound FC1=CC=CC(COC(=O)C=2C(=CC=C(Br)C=2)OCC=2C=C(F)C=CC=2)=C1 CVJWFLPNFJAOBK-UHFFFAOYSA-N 0.000 description 3
- AYOCPXNZPXQURC-UHFFFAOYSA-N 1-n,1-n-dimethyl-4-phenylmethoxy-3-n-pyridin-3-ylbenzene-1,3-dicarboxamide Chemical compound C=1C=CN=CC=1NC(=O)C1=CC(C(=O)N(C)C)=CC=C1OCC1=CC=CC=C1 AYOCPXNZPXQURC-UHFFFAOYSA-N 0.000 description 3
- CZBPBWLZFLNRPK-UHFFFAOYSA-N 2-[2-[4-phenylmethoxy-3-(pyridin-3-ylcarbamoyl)phenoxy]ethoxy]ethyl 4-methylbenzenesulfonate Chemical compound C1=CC(C)=CC=C1S(=O)(=O)OCCOCCOC(C=C1C(=O)NC=2C=NC=CC=2)=CC=C1OCC1=CC=CC=C1 CZBPBWLZFLNRPK-UHFFFAOYSA-N 0.000 description 3
- XAISONUNKQTASN-UHFFFAOYSA-N 2-hydroxy-5-propan-2-ylbenzoic acid Chemical compound CC(C)C1=CC=C(O)C(C(O)=O)=C1 XAISONUNKQTASN-UHFFFAOYSA-N 0.000 description 3
- IWLMZXWRPDFASG-UHFFFAOYSA-N 2-phenylmethoxy-5-(piperidine-1-carbonyl)benzoic acid Chemical compound OC(=O)C1=CC(C(=O)N2CCCCC2)=CC=C1OCC1=CC=CC=C1 IWLMZXWRPDFASG-UHFFFAOYSA-N 0.000 description 3
- SVQGDEUJKHBGFI-UHFFFAOYSA-N 2-phenylmethoxy-5-(pyrrolidine-1-carbonyl)benzoic acid Chemical compound OC(=O)C1=CC(C(=O)N2CCCC2)=CC=C1OCC1=CC=CC=C1 SVQGDEUJKHBGFI-UHFFFAOYSA-N 0.000 description 3
- DMQBCDYDLMJIJU-UHFFFAOYSA-N 2-phenylmethoxy-5-piperidin-1-ylbenzoic acid Chemical compound OC(=O)C1=CC(N2CCCCC2)=CC=C1OCC1=CC=CC=C1 DMQBCDYDLMJIJU-UHFFFAOYSA-N 0.000 description 3
- FNMISDNZCSFRLA-UHFFFAOYSA-N 2-phenylmethoxy-5-piperidin-1-ylsulfonylbenzoic acid Chemical compound OC(=O)C1=CC(S(=O)(=O)N2CCCCC2)=CC=C1OCC1=CC=CC=C1 FNMISDNZCSFRLA-UHFFFAOYSA-N 0.000 description 3
- DVILXXJXOMYLAA-UHFFFAOYSA-N 2-phenylmethoxy-5-propan-2-ylbenzoic acid Chemical compound OC(=O)C1=CC(C(C)C)=CC=C1OCC1=CC=CC=C1 DVILXXJXOMYLAA-UHFFFAOYSA-N 0.000 description 3
- ZCYHYHJRPVDWDW-HXUWFJFHSA-N 2-phenylmethoxy-n-pyridin-3-yl-5-[[(2r)-pyrrolidin-2-yl]methoxy]benzamide Chemical compound C=1C(OC[C@@H]2NCCC2)=CC=C(OCC=2C=CC=CC=2)C=1C(=O)NC1=CC=CN=C1 ZCYHYHJRPVDWDW-HXUWFJFHSA-N 0.000 description 3
- JJIFTOPVKWDHJI-UHFFFAOYSA-N 4-(bromomethyl)-1,2-difluorobenzene Chemical compound FC1=CC=C(CBr)C=C1F JJIFTOPVKWDHJI-UHFFFAOYSA-N 0.000 description 3
- LLLMLGQOFWRRTH-UHFFFAOYSA-N 4-nitro-1,2-oxazole Chemical compound [O-][N+](=O)C=1C=NOC=1 LLLMLGQOFWRRTH-UHFFFAOYSA-N 0.000 description 3
- JFILHZCMCBWTRC-UHFFFAOYSA-N 4-phenylmethoxybenzene-1,3-dicarboxylic acid Chemical compound OC(=O)C1=CC(C(=O)O)=CC=C1OCC1=CC=CC=C1 JFILHZCMCBWTRC-UHFFFAOYSA-N 0.000 description 3
- IECXBOCRHHKNKS-UHFFFAOYSA-N 5,6-dichloropyridazin-4-amine Chemical compound NC1=CN=NC(Cl)=C1Cl IECXBOCRHHKNKS-UHFFFAOYSA-N 0.000 description 3
- QMHQSGIKLZQKNJ-UHFFFAOYSA-N 5-(4-methylpiperazin-1-yl)-2-phenylmethoxybenzoic acid Chemical compound C1CN(C)CCN1C(C=C1C(O)=O)=CC=C1OCC1=CC=CC=C1 QMHQSGIKLZQKNJ-UHFFFAOYSA-N 0.000 description 3
- VTQAFQAMIBYSCR-UHFFFAOYSA-N 5-(4-methylpiperazine-1-carbonyl)-2-phenylmethoxybenzoic acid Chemical compound C1CN(C)CCN1C(=O)C(C=C1C(O)=O)=CC=C1OCC1=CC=CC=C1 VTQAFQAMIBYSCR-UHFFFAOYSA-N 0.000 description 3
- QOMCKKLADSCOLL-UHFFFAOYSA-N 5-(aminomethyl)-2-[(3,4-difluorophenyl)methoxy]-n-pyridin-3-ylbenzamide Chemical compound C=1C=CN=CC=1NC(=O)C1=CC(CN)=CC=C1OCC1=CC=C(F)C(F)=C1 QOMCKKLADSCOLL-UHFFFAOYSA-N 0.000 description 3
- IVALNPQJGCCPHR-UHFFFAOYSA-N 5-(dimethylcarbamoyl)-2-phenylmethoxybenzoic acid Chemical compound OC(=O)C1=CC(C(=O)N(C)C)=CC=C1OCC1=CC=CC=C1 IVALNPQJGCCPHR-UHFFFAOYSA-N 0.000 description 3
- LKGSOMVKASWNBI-UHFFFAOYSA-N 5-(dimethylsulfamoyl)-2-phenylmethoxybenzoic acid Chemical compound OC(=O)C1=CC(S(=O)(=O)N(C)C)=CC=C1OCC1=CC=CC=C1 LKGSOMVKASWNBI-UHFFFAOYSA-N 0.000 description 3
- XSUGUGAZJSSWPQ-UHFFFAOYSA-N 5-bromo-2-[(2-cyanophenyl)methoxy]benzoic acid Chemical compound OC(=O)C1=CC(Br)=CC=C1OCC1=CC=CC=C1C#N XSUGUGAZJSSWPQ-UHFFFAOYSA-N 0.000 description 3
- NOPORWFTNKIIGY-UHFFFAOYSA-N 5-bromo-2-[(3-chlorophenyl)methoxy]benzoic acid Chemical compound OC(=O)C1=CC(Br)=CC=C1OCC1=CC=CC(Cl)=C1 NOPORWFTNKIIGY-UHFFFAOYSA-N 0.000 description 3
- OXFDRZYQCZRECP-UHFFFAOYSA-N 5-bromo-2-[(3-cyanophenyl)methoxy]benzoic acid Chemical compound OC(=O)C1=CC(Br)=CC=C1OCC1=CC=CC(C#N)=C1 OXFDRZYQCZRECP-UHFFFAOYSA-N 0.000 description 3
- RHNMHQNTNNSFMZ-UHFFFAOYSA-N 5-bromo-2-[(3-methoxyphenyl)methoxy]benzoic acid Chemical compound COC1=CC=CC(COC=2C(=CC(Br)=CC=2)C(O)=O)=C1 RHNMHQNTNNSFMZ-UHFFFAOYSA-N 0.000 description 3
- VHGADUPANLWKAT-UHFFFAOYSA-N 5-bromo-2-[(4-cyanophenyl)methoxy]benzoic acid Chemical compound OC(=O)C1=CC(Br)=CC=C1OCC1=CC=C(C#N)C=C1 VHGADUPANLWKAT-UHFFFAOYSA-N 0.000 description 3
- ULFLACGIFMTNGR-UHFFFAOYSA-N 5-chloro-2-phenylmethoxybenzoic acid Chemical compound OC(=O)C1=CC(Cl)=CC=C1OCC1=CC=CC=C1 ULFLACGIFMTNGR-UHFFFAOYSA-N 0.000 description 3
- UHSCCXGQSHCZFM-UHFFFAOYSA-N 5-cyano-2-phenylmethoxybenzoic acid Chemical compound OC(=O)C1=CC(C#N)=CC=C1OCC1=CC=CC=C1 UHSCCXGQSHCZFM-UHFFFAOYSA-N 0.000 description 3
- WODKLCACFQNKBX-UHFFFAOYSA-N 5-fluoro-2-phenylmethoxybenzoic acid Chemical compound OC(=O)C1=CC(F)=CC=C1OCC1=CC=CC=C1 WODKLCACFQNKBX-UHFFFAOYSA-N 0.000 description 3
- UTCFOFWMEPQCSR-UHFFFAOYSA-N 5-formylsalicylic acid Chemical compound OC(=O)C1=CC(C=O)=CC=C1O UTCFOFWMEPQCSR-UHFFFAOYSA-N 0.000 description 3
- VRLHUTPCEBIETH-UHFFFAOYSA-N 5-methoxy-2-phenylmethoxybenzoic acid Chemical compound OC(=O)C1=CC(OC)=CC=C1OCC1=CC=CC=C1 VRLHUTPCEBIETH-UHFFFAOYSA-N 0.000 description 3
- DHIFEMYRGHSSEB-UHFFFAOYSA-N 5-methyl-2-phenylmethoxybenzoic acid Chemical compound OC(=O)C1=CC(C)=CC=C1OCC1=CC=CC=C1 DHIFEMYRGHSSEB-UHFFFAOYSA-N 0.000 description 3
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 3
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 3
- 241000238366 Cephalopoda Species 0.000 description 3
- 244000166102 Eucalyptus leucoxylon Species 0.000 description 3
- 235000004694 Eucalyptus leucoxylon Nutrition 0.000 description 3
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 3
- SJRJJKPEHAURKC-UHFFFAOYSA-N N-Methylmorpholine Chemical compound CN1CCOCC1 SJRJJKPEHAURKC-UHFFFAOYSA-N 0.000 description 3
- KNNUFFUGRZXENC-UHFFFAOYSA-N O=C1BCCC1=O Chemical compound O=C1BCCC1=O KNNUFFUGRZXENC-UHFFFAOYSA-N 0.000 description 3
- RWRDLPDLKQPQOW-UHFFFAOYSA-N Pyrrolidine Chemical compound C1CCNC1 RWRDLPDLKQPQOW-UHFFFAOYSA-N 0.000 description 3
- 241000718541 Tetragastris balsamifera Species 0.000 description 3
- 150000001299 aldehydes Chemical class 0.000 description 3
- 125000003118 aryl group Chemical group 0.000 description 3
- 229940054066 benzamide antipsychotics Drugs 0.000 description 3
- 150000001555 benzenes Chemical class 0.000 description 3
- QDPWXRQLWKGWTE-UHFFFAOYSA-N benzyl 5-chloro-2-phenylmethoxybenzoate Chemical compound C=1C=CC=CC=1COC(=O)C1=CC(Cl)=CC=C1OCC1=CC=CC=C1 QDPWXRQLWKGWTE-UHFFFAOYSA-N 0.000 description 3
- BPPMHCSGRHHXSV-UHFFFAOYSA-N benzyl 5-fluoro-2-phenylmethoxybenzoate Chemical compound C=1C=CC=CC=1COC(=O)C1=CC(F)=CC=C1OCC1=CC=CC=C1 BPPMHCSGRHHXSV-UHFFFAOYSA-N 0.000 description 3
- OCJAGRYUKAWYQD-UHFFFAOYSA-N benzyl 5-formyl-2-phenylmethoxybenzoate Chemical compound C=1C=CC=CC=1COC(=O)C1=CC(C=O)=CC=C1OCC1=CC=CC=C1 OCJAGRYUKAWYQD-UHFFFAOYSA-N 0.000 description 3
- CQKDHWJCNNENAO-UHFFFAOYSA-N benzyl 5-methyl-2-phenylmethoxybenzoate Chemical compound C=1C=CC=CC=1COC(=O)C1=CC(C)=CC=C1OCC1=CC=CC=C1 CQKDHWJCNNENAO-UHFFFAOYSA-N 0.000 description 3
- 230000003197 catalytic effect Effects 0.000 description 3
- 210000004027 cell Anatomy 0.000 description 3
- 125000001309 chloro group Chemical group Cl* 0.000 description 3
- CXQRZKIIGJLWPJ-UHFFFAOYSA-N diphenylphosphane;1-naphthalen-1-ylnaphthalene Chemical group C=1C=CC=CC=1PC1=CC=CC=C1.C1=CC=C2C(C=3C4=CC=CC=C4C=CC=3)=CC=CC2=C1 CXQRZKIIGJLWPJ-UHFFFAOYSA-N 0.000 description 3
- 229960003638 dopamine Drugs 0.000 description 3
- 239000000284 extract Substances 0.000 description 3
- 238000009472 formulation Methods 0.000 description 3
- JUXSVMLCFUKFSW-UHFFFAOYSA-N methyl 2-[(4-fluorophenyl)methoxy]-5-iodobenzoate Chemical compound COC(=O)C1=CC(I)=CC=C1OCC1=CC=C(F)C=C1 JUXSVMLCFUKFSW-UHFFFAOYSA-N 0.000 description 3
- IHIDHZXSOHCTQL-UHFFFAOYSA-N methyl 2-hydroxy-5-(4-methylphenyl)sulfonyloxybenzoate Chemical compound C1=C(O)C(C(=O)OC)=CC(OS(=O)(=O)C=2C=CC(C)=CC=2)=C1 IHIDHZXSOHCTQL-UHFFFAOYSA-N 0.000 description 3
- IBDQMKMZFQZDRE-UHFFFAOYSA-N methyl 2-hydroxy-5-(4-methylpiperazin-1-yl)sulfonylbenzoate Chemical compound C1=C(O)C(C(=O)OC)=CC(S(=O)(=O)N2CCN(C)CC2)=C1 IBDQMKMZFQZDRE-UHFFFAOYSA-N 0.000 description 3
- XZZXAVGKSMXMDW-UHFFFAOYSA-N methyl 2-hydroxy-5-(morpholine-4-carbonyl)benzoate Chemical compound C1=C(O)C(C(=O)OC)=CC(C(=O)N2CCOCC2)=C1 XZZXAVGKSMXMDW-UHFFFAOYSA-N 0.000 description 3
- HXOJBZLYUKFNFK-UHFFFAOYSA-N methyl 2-hydroxy-5-morpholin-4-ylsulfonylbenzoate Chemical compound C1=C(O)C(C(=O)OC)=CC(S(=O)(=O)N2CCOCC2)=C1 HXOJBZLYUKFNFK-UHFFFAOYSA-N 0.000 description 3
- CHTQUBVPBMPHCN-UHFFFAOYSA-N methyl 2-hydroxy-5-piperidin-1-ylsulfonylbenzoate Chemical compound C1=C(O)C(C(=O)OC)=CC(S(=O)(=O)N2CCCCC2)=C1 CHTQUBVPBMPHCN-UHFFFAOYSA-N 0.000 description 3
- CQMZYHRZRYHBDW-UHFFFAOYSA-N methyl 2-phenylmethoxy-5-(pyrrolidine-1-carbonyl)benzoate Chemical compound COC(=O)C1=CC(C(=O)N2CCCC2)=CC=C1OCC1=CC=CC=C1 CQMZYHRZRYHBDW-UHFFFAOYSA-N 0.000 description 3
- UNDOKEPJDABQLS-UHFFFAOYSA-N methyl 5-(4-methylphenyl)sulfonyloxy-2-phenylmethoxybenzoate Chemical compound C=1C=C(OCC=2C=CC=CC=2)C(C(=O)OC)=CC=1OS(=O)(=O)C1=CC=C(C)C=C1 UNDOKEPJDABQLS-UHFFFAOYSA-N 0.000 description 3
- KLWACWZIPUBSAO-UHFFFAOYSA-N methyl 5-(4-methylpiperazin-1-yl)sulfonyl-2-phenylmethoxybenzoate Chemical compound COC(=O)C1=CC(S(=O)(=O)N2CCN(C)CC2)=CC=C1OCC1=CC=CC=C1 KLWACWZIPUBSAO-UHFFFAOYSA-N 0.000 description 3
- ZPOUBOAIXXVSDY-UHFFFAOYSA-N methyl 5-(4-methylpiperazine-1-carbonyl)-2-phenylmethoxybenzoate Chemical compound COC(=O)C1=CC(C(=O)N2CCN(C)CC2)=CC=C1OCC1=CC=CC=C1 ZPOUBOAIXXVSDY-UHFFFAOYSA-N 0.000 description 3
- DFGPSFKVVNEWGQ-UHFFFAOYSA-N methyl 5-(dimethylcarbamoyl)-2-phenylmethoxybenzoate Chemical compound COC(=O)C1=CC(C(=O)N(C)C)=CC=C1OCC1=CC=CC=C1 DFGPSFKVVNEWGQ-UHFFFAOYSA-N 0.000 description 3
- QHOSKPKGJGXSFX-UHFFFAOYSA-N methyl 5-(dimethylsulfamoyl)-2-hydroxybenzoate Chemical compound COC(=O)C1=CC(S(=O)(=O)N(C)C)=CC=C1O QHOSKPKGJGXSFX-UHFFFAOYSA-N 0.000 description 3
- KWBKSXGTPZRGTG-UHFFFAOYSA-N methyl 5-(dimethylsulfamoyl)-2-phenylmethoxybenzoate Chemical compound COC(=O)C1=CC(S(=O)(=O)N(C)C)=CC=C1OCC1=CC=CC=C1 KWBKSXGTPZRGTG-UHFFFAOYSA-N 0.000 description 3
- YIRBTHXNELVAOX-NSHDSACASA-N methyl 5-bromo-2-[(1s)-1-phenylethoxy]benzoate Chemical compound COC(=O)C1=CC(Br)=CC=C1O[C@@H](C)C1=CC=CC=C1 YIRBTHXNELVAOX-NSHDSACASA-N 0.000 description 3
- WNLGGSGBOQGUHV-UHFFFAOYSA-N methyl 5-cyano-2-hydroxybenzoate Chemical compound COC(=O)C1=CC(C#N)=CC=C1O WNLGGSGBOQGUHV-UHFFFAOYSA-N 0.000 description 3
- XSLZLFFVVCBHGZ-UHFFFAOYSA-N methyl 5-cyano-2-phenylmethoxybenzoate Chemical compound COC(=O)C1=CC(C#N)=CC=C1OCC1=CC=CC=C1 XSLZLFFVVCBHGZ-UHFFFAOYSA-N 0.000 description 3
- 230000001537 neural effect Effects 0.000 description 3
- YJVFFLUZDVXJQI-UHFFFAOYSA-L palladium(ii) acetate Chemical compound [Pd+2].CC([O-])=O.CC([O-])=O YJVFFLUZDVXJQI-UHFFFAOYSA-L 0.000 description 3
- 239000012071 phase Substances 0.000 description 3
- 239000006187 pill Substances 0.000 description 3
- 125000004482 piperidin-4-yl group Chemical group N1CCC(CC1)* 0.000 description 3
- 239000011591 potassium Substances 0.000 description 3
- 229910052700 potassium Inorganic materials 0.000 description 3
- 230000004224 protection Effects 0.000 description 3
- LUCGBEPEAUHERV-UHFFFAOYSA-N pyridazin-4-amine Chemical compound NC1=CC=NN=C1 LUCGBEPEAUHERV-UHFFFAOYSA-N 0.000 description 3
- 239000000018 receptor agonist Substances 0.000 description 3
- 229940044601 receptor agonist Drugs 0.000 description 3
- 238000005932 reductive alkylation reaction Methods 0.000 description 3
- 102200092223 rs33939927 Human genes 0.000 description 3
- 239000000377 silicon dioxide Substances 0.000 description 3
- 239000012279 sodium borohydride Substances 0.000 description 3
- 229910000033 sodium borohydride Inorganic materials 0.000 description 3
- 235000011149 sulphuric acid Nutrition 0.000 description 3
- WMDTWRXJALRTGX-UHFFFAOYSA-N tert-butyl n-(3-methyl-1,2-oxazol-4-yl)carbamate Chemical compound CC1=NOC=C1NC(=O)OC(C)(C)C WMDTWRXJALRTGX-UHFFFAOYSA-N 0.000 description 3
- KPEQFSNGRGZBLS-UHFFFAOYSA-N tert-butyl n-(5-methyl-1,2-oxazol-4-yl)carbamate Chemical compound CC=1ON=CC=1NC(=O)OC(C)(C)C KPEQFSNGRGZBLS-UHFFFAOYSA-N 0.000 description 3
- XCAQIUOFDMREBA-UHFFFAOYSA-N tert-butyl n-[(2-methylpropan-2-yl)oxycarbonyl]carbamate Chemical compound CC(C)(C)OC(=O)NC(=O)OC(C)(C)C XCAQIUOFDMREBA-UHFFFAOYSA-N 0.000 description 3
- 238000004809 thin layer chromatography Methods 0.000 description 3
- GGUBFICZYGKNTD-UHFFFAOYSA-N triethyl phosphonoacetate Chemical compound CCOC(=O)CP(=O)(OCC)OCC GGUBFICZYGKNTD-UHFFFAOYSA-N 0.000 description 3
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 description 3
- MFXZCNURZIIWGB-UHFFFAOYSA-N (2-chlorophenyl)methyl 5-bromo-2-[(2-chlorophenyl)methoxy]benzoate Chemical compound ClC1=CC=CC=C1COC(=O)C1=CC(Br)=CC=C1OCC1=CC=CC=C1Cl MFXZCNURZIIWGB-UHFFFAOYSA-N 0.000 description 2
- GDMQYOKCJGELRC-UHFFFAOYSA-N (2-cyanophenyl)methyl 5-bromo-2-[(2-cyanophenyl)methoxy]benzoate Chemical compound C=1C=CC=C(C#N)C=1COC(=O)C1=CC(Br)=CC=C1OCC1=CC=CC=C1C#N GDMQYOKCJGELRC-UHFFFAOYSA-N 0.000 description 2
- HNCSVMNWPGRJKP-UHFFFAOYSA-N (3-aminopyridin-2-yl)methanol Chemical compound NC1=CC=CN=C1CO HNCSVMNWPGRJKP-UHFFFAOYSA-N 0.000 description 2
- VXHFPFMVXWCZLH-UHFFFAOYSA-N (3-aminopyridin-4-yl)methanol Chemical compound NC1=CN=CC=C1CO VXHFPFMVXWCZLH-UHFFFAOYSA-N 0.000 description 2
- XYOIHDWWODPZLK-UHFFFAOYSA-N (3-chlorophenyl)methyl 5-bromo-2-[(3-chlorophenyl)methoxy]benzoate Chemical compound ClC1=CC=CC(COC(=O)C=2C(=CC=C(Br)C=2)OCC=2C=C(Cl)C=CC=2)=C1 XYOIHDWWODPZLK-UHFFFAOYSA-N 0.000 description 2
- CJQGLKJPVIZCGW-UHFFFAOYSA-N (3-cyanophenyl)methyl 5-bromo-2-[(3-cyanophenyl)methoxy]benzoate Chemical compound C=1C=CC(C#N)=CC=1COC(=O)C1=CC(Br)=CC=C1OCC1=CC=CC(C#N)=C1 CJQGLKJPVIZCGW-UHFFFAOYSA-N 0.000 description 2
- PBFWBOMNIWYENT-UHFFFAOYSA-N (4-chlorophenyl)methyl 5-bromo-2-[(4-chlorophenyl)methoxy]benzoate Chemical compound C1=CC(Cl)=CC=C1COC(=O)C1=CC(Br)=CC=C1OCC1=CC=C(Cl)C=C1 PBFWBOMNIWYENT-UHFFFAOYSA-N 0.000 description 2
- XWRFITKBZXMXAR-UHFFFAOYSA-N (4-cyanophenyl)methyl 5-bromo-2-[(4-cyanophenyl)methoxy]benzoate Chemical compound C=1C=C(C#N)C=CC=1COC(=O)C1=CC(Br)=CC=C1OCC1=CC=C(C#N)C=C1 XWRFITKBZXMXAR-UHFFFAOYSA-N 0.000 description 2
- ZWNDHRHPRKBOLW-UHFFFAOYSA-N (4-fluorophenyl)methyl 2-[(4-fluorophenyl)methoxy]-5-(1-methylpyrazol-4-yl)benzoate Chemical compound C1=NN(C)C=C1C(C=C1C(=O)OCC=2C=CC(F)=CC=2)=CC=C1OCC1=CC=C(F)C=C1 ZWNDHRHPRKBOLW-UHFFFAOYSA-N 0.000 description 2
- IBLMYGXJKQIGSN-UHFFFAOYSA-N 1-(bromomethyl)-2,4-difluorobenzene Chemical compound FC1=CC=C(CBr)C(F)=C1 IBLMYGXJKQIGSN-UHFFFAOYSA-N 0.000 description 2
- CRRUGYDDEMGVDY-UHFFFAOYSA-N 1-bromoethylbenzene Chemical compound CC(Br)C1=CC=CC=C1 CRRUGYDDEMGVDY-UHFFFAOYSA-N 0.000 description 2
- PAWQVTBBRAZDMG-UHFFFAOYSA-N 2-(3-bromo-2-fluorophenyl)acetic acid Chemical compound OC(=O)CC1=CC=CC(Br)=C1F PAWQVTBBRAZDMG-UHFFFAOYSA-N 0.000 description 2
- ZBHWTIXMSZOJBD-UHFFFAOYSA-N 2-[3-[(5-chloro-2-phenylmethoxybenzoyl)amino]phenyl]acetic acid Chemical compound OC(=O)CC1=CC=CC(NC(=O)C=2C(=CC=C(Cl)C=2)OCC=2C=CC=CC=2)=C1 ZBHWTIXMSZOJBD-UHFFFAOYSA-N 0.000 description 2
- YQDOJQUHDQGQPH-UHFFFAOYSA-N 2-hydroxy-5-(trifluoromethyl)benzoic acid Chemical compound OC(=O)C1=CC(C(F)(F)F)=CC=C1O YQDOJQUHDQGQPH-UHFFFAOYSA-N 0.000 description 2
- XNFLMROREVXDOE-UHFFFAOYSA-N 2-phenylmethoxy-5-(piperidine-1-carbonyl)-n-pyridin-3-ylbenzamide Chemical compound C=1C(C(=O)N2CCCCC2)=CC=C(OCC=2C=CC=CC=2)C=1C(=O)NC1=CC=CN=C1 XNFLMROREVXDOE-UHFFFAOYSA-N 0.000 description 2
- APWYPSCDCSVTKP-UHFFFAOYSA-N 2-phenylmethoxy-5-piperidin-1-yl-n-pyridin-3-ylbenzamide Chemical compound C=1C(N2CCCCC2)=CC=C(OCC=2C=CC=CC=2)C=1C(=O)NC1=CC=CN=C1 APWYPSCDCSVTKP-UHFFFAOYSA-N 0.000 description 2
- HEPNMXCWDIIBRG-UHFFFAOYSA-N 2-phenylmethoxy-5-piperidin-1-ylsulfonyl-n-pyridin-3-ylbenzamide Chemical compound C=1C(S(=O)(=O)N2CCCCC2)=CC=C(OCC=2C=CC=CC=2)C=1C(=O)NC1=CC=CN=C1 HEPNMXCWDIIBRG-UHFFFAOYSA-N 0.000 description 2
- HPIOKLXOTKHNCU-UHFFFAOYSA-N 2-phenylmethoxy-5-propan-2-yl-n-pyridin-3-ylbenzamide Chemical compound C=1C=CN=CC=1NC(=O)C1=CC(C(C)C)=CC=C1OCC1=CC=CC=C1 HPIOKLXOTKHNCU-UHFFFAOYSA-N 0.000 description 2
- IOGZLTUKCAYBOA-UHFFFAOYSA-N 2-phenylmethoxy-5-pyridin-4-ylbenzoic acid Chemical compound OC(=O)C1=CC(C=2C=CN=CC=2)=CC=C1OCC1=CC=CC=C1 IOGZLTUKCAYBOA-UHFFFAOYSA-N 0.000 description 2
- ZNCZVAKSEXSUDM-UHFFFAOYSA-N 2-phenylmethoxy-n-pyridin-3-yl-5-(pyrrolidine-1-carbonyl)benzamide Chemical compound C=1C(C(=O)N2CCCC2)=CC=C(OCC=2C=CC=CC=2)C=1C(=O)NC1=CC=CN=C1 ZNCZVAKSEXSUDM-UHFFFAOYSA-N 0.000 description 2
- 125000004485 2-pyrrolidinyl group Chemical group [H]N1C([H])([H])C([H])([H])C([H])([H])C1([H])* 0.000 description 2
- MCIPQLOKVXSHTD-UHFFFAOYSA-N 3,3-diethoxyprop-1-ene Chemical compound CCOC(C=C)OCC MCIPQLOKVXSHTD-UHFFFAOYSA-N 0.000 description 2
- RPFJGTZUJUOCCL-UHFFFAOYSA-N 3,5-dichloropyridazin-4-amine Chemical compound NC1=C(Cl)C=NN=C1Cl RPFJGTZUJUOCCL-UHFFFAOYSA-N 0.000 description 2
- BNOWDJRGXLVJHD-UHFFFAOYSA-N 3-methyl-1,2-oxazol-4-amine Chemical compound CC1=NOC=C1N BNOWDJRGXLVJHD-UHFFFAOYSA-N 0.000 description 2
- JJYPMNFTHPTTDI-UHFFFAOYSA-N 3-methylaniline Chemical compound CC1=CC=CC(N)=C1 JJYPMNFTHPTTDI-UHFFFAOYSA-N 0.000 description 2
- JDUYMWSYTIJMJO-UHFFFAOYSA-N 4-hydroxy-3-methoxycarbonylbenzoic acid Chemical compound COC(=O)C1=CC(C(O)=O)=CC=C1O JDUYMWSYTIJMJO-UHFFFAOYSA-N 0.000 description 2
- MTYQZDNDNIUIPJ-UHFFFAOYSA-N 5-(1-methylpiperidin-4-yl)oxy-2-phenylmethoxy-n-pyridin-3-ylbenzamide Chemical compound C1CN(C)CCC1OC(C=C1C(=O)NC=2C=NC=CC=2)=CC=C1OCC1=CC=CC=C1 MTYQZDNDNIUIPJ-UHFFFAOYSA-N 0.000 description 2
- DWUBHKSIXDWORI-UHFFFAOYSA-N 5-(4-methylpiperazin-1-yl)sulfonyl-2-phenylmethoxy-n-pyridin-3-ylbenzamide Chemical compound C1CN(C)CCN1S(=O)(=O)C(C=C1C(=O)NC=2C=NC=CC=2)=CC=C1OCC1=CC=CC=C1 DWUBHKSIXDWORI-UHFFFAOYSA-N 0.000 description 2
- BHMYNCIWGPSHPJ-UHFFFAOYSA-N 5-(4-methylpiperazin-1-yl)sulfonyl-2-phenylmethoxybenzoic acid Chemical compound C1CN(C)CCN1S(=O)(=O)C(C=C1C(O)=O)=CC=C1OCC1=CC=CC=C1 BHMYNCIWGPSHPJ-UHFFFAOYSA-N 0.000 description 2
- GMCXFHSAMMWXLU-UHFFFAOYSA-N 5-(4-methylpiperazine-1-carbonyl)-2-phenylmethoxy-n-pyridin-3-ylbenzamide Chemical compound C1CN(C)CCN1C(=O)C(C=C1C(=O)NC=2C=NC=CC=2)=CC=C1OCC1=CC=CC=C1 GMCXFHSAMMWXLU-UHFFFAOYSA-N 0.000 description 2
- GEPOPKKKJQPCCE-UHFFFAOYSA-N 5-(morpholine-4-carbonyl)-2-phenylmethoxybenzoic acid Chemical compound OC(=O)C1=CC(C(=O)N2CCOCC2)=CC=C1OCC1=CC=CC=C1 GEPOPKKKJQPCCE-UHFFFAOYSA-N 0.000 description 2
- IDABGMHSZQYUJP-UHFFFAOYSA-N 5-[2-(dimethylamino)ethoxy]-2-phenylmethoxy-n-pyridin-3-ylbenzamide Chemical compound C=1C=CN=CC=1NC(=O)C1=CC(OCCN(C)C)=CC=C1OCC1=CC=CC=C1 IDABGMHSZQYUJP-UHFFFAOYSA-N 0.000 description 2
- DBXTVAJMFAXZKG-OAQYLSRUSA-N 5-[[(2r)-1-methylpyrrolidin-2-yl]methoxy]-2-phenylmethoxy-n-pyridin-3-ylbenzamide Chemical compound CN1CCC[C@@H]1COC(C=C1C(=O)NC=2C=NC=CC=2)=CC=C1OCC1=CC=CC=C1 DBXTVAJMFAXZKG-OAQYLSRUSA-N 0.000 description 2
- PXGMUUNXLCEOBW-UHFFFAOYSA-N 5-bromo-2-[(2-chlorophenyl)methoxy]benzoic acid Chemical compound OC(=O)C1=CC(Br)=CC=C1OCC1=CC=CC=C1Cl PXGMUUNXLCEOBW-UHFFFAOYSA-N 0.000 description 2
- YDMBCNVKNNVZKW-UHFFFAOYSA-N 5-bromo-2-[(2-cyanophenyl)methoxy]-n-pyridin-3-ylbenzamide Chemical compound C=1C=CN=CC=1NC(=O)C1=CC(Br)=CC=C1OCC1=CC=CC=C1C#N YDMBCNVKNNVZKW-UHFFFAOYSA-N 0.000 description 2
- RCTCBRGRXDLGJJ-UHFFFAOYSA-N 5-bromo-2-[(2-fluorophenyl)methoxy]benzoic acid Chemical compound OC(=O)C1=CC(Br)=CC=C1OCC1=CC=CC=C1F RCTCBRGRXDLGJJ-UHFFFAOYSA-N 0.000 description 2
- YNWCCXZSGGJVQF-UHFFFAOYSA-N 5-bromo-2-[(2-methoxyphenyl)methoxy]benzoic acid Chemical compound COC1=CC=CC=C1COC1=CC=C(Br)C=C1C(O)=O YNWCCXZSGGJVQF-UHFFFAOYSA-N 0.000 description 2
- OCISPIDWUSYWBN-UHFFFAOYSA-N 5-bromo-2-[(3,4-difluorophenyl)methoxy]benzoic acid Chemical compound OC(=O)C1=CC(Br)=CC=C1OCC1=CC=C(F)C(F)=C1 OCISPIDWUSYWBN-UHFFFAOYSA-N 0.000 description 2
- PRORQNYCQPAUHP-UHFFFAOYSA-N 5-bromo-2-[(3-chlorophenyl)methoxy]-n-pyridin-3-ylbenzamide Chemical compound ClC1=CC=CC(COC=2C(=CC(Br)=CC=2)C(=O)NC=2C=NC=CC=2)=C1 PRORQNYCQPAUHP-UHFFFAOYSA-N 0.000 description 2
- WMMZLOWZAVKUEF-UHFFFAOYSA-N 5-bromo-2-[(3-cyanophenyl)methoxy]-n-pyridin-3-ylbenzamide Chemical compound C=1C=CN=CC=1NC(=O)C1=CC(Br)=CC=C1OCC1=CC=CC(C#N)=C1 WMMZLOWZAVKUEF-UHFFFAOYSA-N 0.000 description 2
- UHVIMGXNJNCOQH-UHFFFAOYSA-N 5-bromo-2-[(3-fluorophenyl)methoxy]benzoic acid Chemical compound OC(=O)C1=CC(Br)=CC=C1OCC1=CC=CC(F)=C1 UHVIMGXNJNCOQH-UHFFFAOYSA-N 0.000 description 2
- ZDEGPBGWQFMEPI-UHFFFAOYSA-N 5-bromo-2-[(3-methoxyphenyl)methoxy]-n-pyridin-3-ylbenzamide Chemical compound COC1=CC=CC(COC=2C(=CC(Br)=CC=2)C(=O)NC=2C=NC=CC=2)=C1 ZDEGPBGWQFMEPI-UHFFFAOYSA-N 0.000 description 2
- PJXVXFMSGVGLET-UHFFFAOYSA-N 5-bromo-2-[(4-chlorophenyl)methoxy]-n-pyridin-3-ylbenzamide Chemical compound C1=CC(Cl)=CC=C1COC1=CC=C(Br)C=C1C(=O)NC1=CC=CN=C1 PJXVXFMSGVGLET-UHFFFAOYSA-N 0.000 description 2
- RTKVIEICPQFBFD-UHFFFAOYSA-N 5-bromo-2-[(4-chlorophenyl)methoxy]benzoic acid Chemical compound OC(=O)C1=CC(Br)=CC=C1OCC1=CC=C(Cl)C=C1 RTKVIEICPQFBFD-UHFFFAOYSA-N 0.000 description 2
- NYIGHZWKHZIQCM-UHFFFAOYSA-N 5-bromo-2-[(4-fluorophenyl)methoxy]benzoic acid Chemical compound OC(=O)C1=CC(Br)=CC=C1OCC1=CC=C(F)C=C1 NYIGHZWKHZIQCM-UHFFFAOYSA-N 0.000 description 2
- GJVGTMDBHVAMMV-UHFFFAOYSA-N 5-bromo-2-[(4-methoxyphenyl)methoxy]benzoic acid Chemical compound C1=CC(OC)=CC=C1COC1=CC=C(Br)C=C1C(O)=O GJVGTMDBHVAMMV-UHFFFAOYSA-N 0.000 description 2
- QIMKYQWHJJFABT-UHFFFAOYSA-N 5-bromo-2-phenylmethoxy-n-pyridazin-3-ylbenzamide Chemical compound C=1C=CN=NC=1NC(=O)C1=CC(Br)=CC=C1OCC1=CC=CC=C1 QIMKYQWHJJFABT-UHFFFAOYSA-N 0.000 description 2
- FKJQZXKKRQMVIG-UHFFFAOYSA-N 5-bromo-2-phenylmethoxy-n-pyridazin-4-ylbenzamide Chemical compound C=1C=NN=CC=1NC(=O)C1=CC(Br)=CC=C1OCC1=CC=CC=C1 FKJQZXKKRQMVIG-UHFFFAOYSA-N 0.000 description 2
- RWPNRVUWWFFJHI-UHFFFAOYSA-N 5-bromo-2-phenylmethoxy-n-pyridin-3-ylbenzamide Chemical compound C=1C=CN=CC=1NC(=O)C1=CC(Br)=CC=C1OCC1=CC=CC=C1 RWPNRVUWWFFJHI-UHFFFAOYSA-N 0.000 description 2
- NRLOBGSFUFWJEX-UHFFFAOYSA-N 5-bromo-2-phenylmethoxy-n-pyrimidin-5-ylbenzamide Chemical compound C=1N=CN=CC=1NC(=O)C1=CC(Br)=CC=C1OCC1=CC=CC=C1 NRLOBGSFUFWJEX-UHFFFAOYSA-N 0.000 description 2
- BSAHUMPLCPZMJU-UHFFFAOYSA-N 5-bromo-n-(3-chlorophenyl)-2-phenylmethoxybenzamide Chemical compound ClC1=CC=CC(NC(=O)C=2C(=CC=C(Br)C=2)OCC=2C=CC=CC=2)=C1 BSAHUMPLCPZMJU-UHFFFAOYSA-N 0.000 description 2
- YOXKIXRHEHXIFA-UHFFFAOYSA-N 5-bromo-n-(3-ethylphenyl)-2-phenylmethoxybenzamide Chemical compound CCC1=CC=CC(NC(=O)C=2C(=CC=C(Br)C=2)OCC=2C=CC=CC=2)=C1 YOXKIXRHEHXIFA-UHFFFAOYSA-N 0.000 description 2
- ZDPCCYMAGFTZIO-UHFFFAOYSA-N 5-bromo-n-(3-fluorophenyl)-2-phenylmethoxybenzamide Chemical compound FC1=CC=CC(NC(=O)C=2C(=CC=C(Br)C=2)OCC=2C=CC=CC=2)=C1 ZDPCCYMAGFTZIO-UHFFFAOYSA-N 0.000 description 2
- OUOIOWDPXWKXST-UHFFFAOYSA-N 5-bromo-n-(3-methoxyphenyl)-2-phenylmethoxybenzamide Chemical compound COC1=CC=CC(NC(=O)C=2C(=CC=C(Br)C=2)OCC=2C=CC=CC=2)=C1 OUOIOWDPXWKXST-UHFFFAOYSA-N 0.000 description 2
- QGOKQMWDZNFWCI-UHFFFAOYSA-N 5-bromo-n-(3-methylphenyl)-2-phenylmethoxybenzamide Chemical compound CC1=CC=CC(NC(=O)C=2C(=CC=C(Br)C=2)OCC=2C=CC=CC=2)=C1 QGOKQMWDZNFWCI-UHFFFAOYSA-N 0.000 description 2
- ADXYDPZBNMSCBJ-UHFFFAOYSA-N 5-cyano-2-phenylmethoxy-n-pyridin-3-ylbenzamide Chemical compound C=1C(C#N)=CC=C(OCC=2C=CC=CC=2)C=1C(=O)NC1=CC=CN=C1 ADXYDPZBNMSCBJ-UHFFFAOYSA-N 0.000 description 2
- RIDLRJKGESNMJC-UHFFFAOYSA-N 5-fluoro-2-phenylmethoxy-n-pyridin-3-ylbenzamide Chemical compound C=1C=CN=CC=1NC(=O)C1=CC(F)=CC=C1OCC1=CC=CC=C1 RIDLRJKGESNMJC-UHFFFAOYSA-N 0.000 description 2
- FTTVXHXKTPOQDV-UHFFFAOYSA-N 5-formyl-2-phenylmethoxybenzoic acid Chemical compound OC(=O)C1=CC(C=O)=CC=C1OCC1=CC=CC=C1 FTTVXHXKTPOQDV-UHFFFAOYSA-N 0.000 description 2
- GXCORBHGAGBVSF-UHFFFAOYSA-N 5-methoxy-2-phenylmethoxy-n-pyridin-3-ylbenzamide Chemical compound C=1C=CN=CC=1NC(=O)C1=CC(OC)=CC=C1OCC1=CC=CC=C1 GXCORBHGAGBVSF-UHFFFAOYSA-N 0.000 description 2
- QGMHRTDVNDXDBB-UHFFFAOYSA-N 5-methyl-1,2-oxazol-4-amine Chemical compound CC=1ON=CC=1N QGMHRTDVNDXDBB-UHFFFAOYSA-N 0.000 description 2
- XNMNYWJQAAXJTI-UHFFFAOYSA-N 5-methyl-2-phenylmethoxy-n-pyridin-3-ylbenzamide Chemical compound C=1C=CN=CC=1NC(=O)C1=CC(C)=CC=C1OCC1=CC=CC=C1 XNMNYWJQAAXJTI-UHFFFAOYSA-N 0.000 description 2
- IIMOPPLJRHQSMF-UHFFFAOYSA-N 5-morpholin-4-ylsulfonyl-2-phenylmethoxy-n-pyridin-3-ylbenzamide Chemical compound C=1C(S(=O)(=O)N2CCOCC2)=CC=C(OCC=2C=CC=CC=2)C=1C(=O)NC1=CC=CN=C1 IIMOPPLJRHQSMF-UHFFFAOYSA-N 0.000 description 2
- KICAYPSRUZWAJZ-UHFFFAOYSA-N 5-morpholin-4-ylsulfonyl-2-phenylmethoxybenzoic acid Chemical compound OC(=O)C1=CC(S(=O)(=O)N2CCOCC2)=CC=C1OCC1=CC=CC=C1 KICAYPSRUZWAJZ-UHFFFAOYSA-N 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 2
- 206010061818 Disease progression Diseases 0.000 description 2
- 229940123583 Factor Xa inhibitor Drugs 0.000 description 2
- 102000030595 Glucokinase Human genes 0.000 description 2
- 108010021582 Glucokinase Proteins 0.000 description 2
- 101000941879 Homo sapiens Leucine-rich repeat serine/threonine-protein kinase 2 Proteins 0.000 description 2
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 2
- IMNFDUFMRHMDMM-UHFFFAOYSA-N N-Heptane Chemical compound CCCCCCC IMNFDUFMRHMDMM-UHFFFAOYSA-N 0.000 description 2
- UEEJHVSXFDXPFK-UHFFFAOYSA-N N-dimethylaminoethanol Chemical compound CN(C)CCO UEEJHVSXFDXPFK-UHFFFAOYSA-N 0.000 description 2
- 108010016731 PPAR gamma Proteins 0.000 description 2
- 102000003728 Peroxisome Proliferator-Activated Receptors Human genes 0.000 description 2
- 108090000029 Peroxisome Proliferator-Activated Receptors Proteins 0.000 description 2
- 102100038825 Peroxisome proliferator-activated receptor gamma Human genes 0.000 description 2
- 108091000080 Phosphotransferase Proteins 0.000 description 2
- 208000000236 Prostatic Neoplasms Diseases 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 2
- HEDRZPFGACZZDS-MICDWDOJSA-N Trichloro(2H)methane Chemical compound [2H]C(Cl)(Cl)Cl HEDRZPFGACZZDS-MICDWDOJSA-N 0.000 description 2
- SORGEQQSQGNZFI-UHFFFAOYSA-N [azido(phenoxy)phosphoryl]oxybenzene Chemical compound C=1C=CC=CC=1OP(=O)(N=[N+]=[N-])OC1=CC=CC=C1 SORGEQQSQGNZFI-UHFFFAOYSA-N 0.000 description 2
- 230000004913 activation Effects 0.000 description 2
- 239000012190 activator Substances 0.000 description 2
- 150000001447 alkali salts Chemical class 0.000 description 2
- 229910021529 ammonia Inorganic materials 0.000 description 2
- 235000019270 ammonium chloride Nutrition 0.000 description 2
- 235000011114 ammonium hydroxide Nutrition 0.000 description 2
- 150000008064 anhydrides Chemical class 0.000 description 2
- 239000005557 antagonist Substances 0.000 description 2
- 229910052786 argon Inorganic materials 0.000 description 2
- 239000012298 atmosphere Substances 0.000 description 2
- 235000019445 benzyl alcohol Nutrition 0.000 description 2
- 229960004217 benzyl alcohol Drugs 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- 238000009835 boiling Methods 0.000 description 2
- KGBXLFKZBHKPEV-UHFFFAOYSA-N boric acid Chemical compound OB(O)O KGBXLFKZBHKPEV-UHFFFAOYSA-N 0.000 description 2
- 239000004327 boric acid Substances 0.000 description 2
- 239000002775 capsule Substances 0.000 description 2
- 125000004432 carbon atom Chemical group C* 0.000 description 2
- 239000001569 carbon dioxide Substances 0.000 description 2
- 150000001732 carboxylic acid derivatives Chemical group 0.000 description 2
- 210000003169 central nervous system Anatomy 0.000 description 2
- 239000003153 chemical reaction reagent Substances 0.000 description 2
- 238000002425 crystallisation Methods 0.000 description 2
- 230000008025 crystallization Effects 0.000 description 2
- 230000003247 decreasing effect Effects 0.000 description 2
- 230000007850 degeneration Effects 0.000 description 2
- HPNMFZURTQLUMO-UHFFFAOYSA-N diethylamine Chemical compound CCNCC HPNMFZURTQLUMO-UHFFFAOYSA-N 0.000 description 2
- 230000005750 disease progression Effects 0.000 description 2
- 206010013663 drug dependence Diseases 0.000 description 2
- 229920001971 elastomer Polymers 0.000 description 2
- 150000002148 esters Chemical class 0.000 description 2
- VFRSADQPWYCXDG-LEUCUCNGSA-N ethyl (2s,5s)-5-methylpyrrolidine-2-carboxylate;2,2,2-trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F.CCOC(=O)[C@@H]1CC[C@H](C)N1 VFRSADQPWYCXDG-LEUCUCNGSA-N 0.000 description 2
- VMWGMUQWKLSYDV-UHFFFAOYSA-N ethyl 3-[4-hydroxy-3-(pyridin-3-ylcarbamoyl)phenyl]propanoate Chemical compound CCOC(=O)CCC1=CC=C(O)C(C(=O)NC=2C=NC=CC=2)=C1 VMWGMUQWKLSYDV-UHFFFAOYSA-N 0.000 description 2
- IIEWJVIFRVWJOD-UHFFFAOYSA-N ethyl cyclohexane Natural products CCC1CCCCC1 IIEWJVIFRVWJOD-UHFFFAOYSA-N 0.000 description 2
- FAMRKDQNMBBFBR-UHFFFAOYSA-N ethyl n-ethoxycarbonyliminocarbamate Chemical compound CCOC(=O)N=NC(=O)OCC FAMRKDQNMBBFBR-UHFFFAOYSA-N 0.000 description 2
- 238000001704 evaporation Methods 0.000 description 2
- 230000008020 evaporation Effects 0.000 description 2
- 125000005842 heteroatom Chemical group 0.000 description 2
- 150000002430 hydrocarbons Chemical group 0.000 description 2
- 238000005984 hydrogenation reaction Methods 0.000 description 2
- 125000004029 hydroxymethyl group Chemical group [H]OC([H])([H])* 0.000 description 2
- 230000006951 hyperphosphorylation Effects 0.000 description 2
- 238000011065 in-situ storage Methods 0.000 description 2
- XVARCVCWNFACQC-RKQHYHRCSA-N indican Chemical compound O[C@@H]1[C@@H](O)[C@H](O)[C@@H](CO)O[C@H]1OC1=CNC2=CC=CC=C12 XVARCVCWNFACQC-RKQHYHRCSA-N 0.000 description 2
- JJWLVOIRVHMVIS-UHFFFAOYSA-N isopropylamine Chemical compound CC(C)N JJWLVOIRVHMVIS-UHFFFAOYSA-N 0.000 description 2
- 230000009021 linear effect Effects 0.000 description 2
- 239000007788 liquid Substances 0.000 description 2
- 239000000463 material Substances 0.000 description 2
- VNWKTOKETHGBQD-UHFFFAOYSA-N methane Natural products C VNWKTOKETHGBQD-UHFFFAOYSA-N 0.000 description 2
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 2
- OLRSDFSIPHACNC-UHFFFAOYSA-N methyl 2-[(4-fluorophenyl)methoxy]-5-(1h-pyrazol-4-yl)benzoate Chemical compound COC(=O)C1=CC(C2=CNN=C2)=CC=C1OCC1=CC=C(F)C=C1 OLRSDFSIPHACNC-UHFFFAOYSA-N 0.000 description 2
- XJKWVPNWHOCFBR-UHFFFAOYSA-N methyl 5-formyl-2-hydroxybenzoate Chemical compound COC(=O)C1=CC(C=O)=CC=C1O XJKWVPNWHOCFBR-UHFFFAOYSA-N 0.000 description 2
- GTCAXTIRRLKXRU-UHFFFAOYSA-N methyl carbamate Chemical compound COC(N)=O GTCAXTIRRLKXRU-UHFFFAOYSA-N 0.000 description 2
- OSWPMRLSEDHDFF-UHFFFAOYSA-N methyl salicylate Chemical compound COC(=O)C1=CC=CC=C1O OSWPMRLSEDHDFF-UHFFFAOYSA-N 0.000 description 2
- CXKWCBBOMKCUKX-UHFFFAOYSA-M methylene blue Chemical group [Cl-].C1=CC(N(C)C)=CC2=[S+]C3=CC(N(C)C)=CC=C3N=C21 CXKWCBBOMKCUKX-UHFFFAOYSA-M 0.000 description 2
- 230000000051 modifying effect Effects 0.000 description 2
- 208000015122 neurodegenerative disease Diseases 0.000 description 2
- 229910000069 nitrogen hydride Inorganic materials 0.000 description 2
- 239000003960 organic solvent Substances 0.000 description 2
- 102000020233 phosphotransferase Human genes 0.000 description 2
- XAEFZNCEHLXOMS-UHFFFAOYSA-M potassium benzoate Chemical compound [K+].[O-]C(=O)C1=CC=CC=C1 XAEFZNCEHLXOMS-UHFFFAOYSA-M 0.000 description 2
- LBKJNHPKYFYCLL-UHFFFAOYSA-N potassium;trimethyl(oxido)silane Chemical compound [K+].C[Si](C)(C)[O-] LBKJNHPKYFYCLL-UHFFFAOYSA-N 0.000 description 2
- FASDKYOPVNHBLU-ZETCQYMHSA-N pramipexole Chemical compound C1[C@@H](NCCC)CCC2=C1SC(N)=N2 FASDKYOPVNHBLU-ZETCQYMHSA-N 0.000 description 2
- 125000004497 pyrazol-5-yl group Chemical group N1N=CC=C1* 0.000 description 2
- 229940044551 receptor antagonist Drugs 0.000 description 2
- 239000002464 receptor antagonist Substances 0.000 description 2
- 230000009467 reduction Effects 0.000 description 2
- 238000006722 reduction reaction Methods 0.000 description 2
- 208000037803 restenosis Diseases 0.000 description 2
- 238000004007 reversed phase HPLC Methods 0.000 description 2
- UHSKFQJFRQCDBE-UHFFFAOYSA-N ropinirole Chemical compound CCCN(CCC)CCC1=CC=CC2=C1CC(=O)N2 UHSKFQJFRQCDBE-UHFFFAOYSA-N 0.000 description 2
- 229960001879 ropinirole Drugs 0.000 description 2
- 239000005060 rubber Substances 0.000 description 2
- 229920006395 saturated elastomer Polymers 0.000 description 2
- 229930195734 saturated hydrocarbon Natural products 0.000 description 2
- 229910052708 sodium Inorganic materials 0.000 description 2
- GEHJYWRUCIMESM-UHFFFAOYSA-L sodium sulfite Chemical compound [Na+].[Na+].[O-]S([O-])=O GEHJYWRUCIMESM-UHFFFAOYSA-L 0.000 description 2
- 239000007921 spray Substances 0.000 description 2
- 239000003381 stabilizer Substances 0.000 description 2
- 210000000130 stem cell Anatomy 0.000 description 2
- 208000011117 substance-related disease Diseases 0.000 description 2
- 239000000758 substrate Substances 0.000 description 2
- UITRJCUDQLTFDR-UHFFFAOYSA-N tert-butyl n-methyl-n-[2-[4-phenylmethoxy-3-(pyridin-3-ylcarbamoyl)phenoxy]ethyl]carbamate Chemical compound C=1C=CN=CC=1NC(=O)C1=CC(OCCN(C)C(=O)OC(C)(C)C)=CC=C1OCC1=CC=CC=C1 UITRJCUDQLTFDR-UHFFFAOYSA-N 0.000 description 2
- 230000001225 therapeutic effect Effects 0.000 description 2
- 238000002560 therapeutic procedure Methods 0.000 description 2
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 2
- QAEDZJGFFMLHHQ-UHFFFAOYSA-N trifluoroacetic anhydride Chemical compound FC(F)(F)C(=O)OC(=O)C(F)(F)F QAEDZJGFFMLHHQ-UHFFFAOYSA-N 0.000 description 2
- LENZDBCJOHFCAS-UHFFFAOYSA-N tris Chemical compound OCC(N)(CO)CO LENZDBCJOHFCAS-UHFFFAOYSA-N 0.000 description 2
- 238000001665 trituration Methods 0.000 description 2
- AILYJCHMDSZEOL-HFEGYEGKSA-N (1R)-1-phenylethanol Chemical compound C1(=CC=CC=C1)[C@@H](C)O.C1(=CC=CC=C1)[C@@H](C)O AILYJCHMDSZEOL-HFEGYEGKSA-N 0.000 description 1
- BFCDFTHTSVTWOG-PXNSSMCTSA-N (1r,2s)-2-(octylamino)-1-(4-propan-2-ylsulfanylphenyl)propan-1-ol Chemical compound CCCCCCCCN[C@@H](C)[C@H](O)C1=CC=C(SC(C)C)C=C1 BFCDFTHTSVTWOG-PXNSSMCTSA-N 0.000 description 1
- DKZWTSGLODEVLR-UHFFFAOYSA-N (2,4-difluorophenyl)methyl 5-bromo-2-[(2,4-difluorophenyl)methoxy]benzoate Chemical compound FC1=CC(F)=CC=C1COC(=O)C1=CC(Br)=CC=C1OCC1=CC=C(F)C=C1F DKZWTSGLODEVLR-UHFFFAOYSA-N 0.000 description 1
- VLVUHOMGWBJKFA-FQEVSTJZSA-N (2S)-2-[[4-phenylmethoxy-3-(pyridin-3-ylcarbamoyl)phenoxy]methyl]pyrrolidine-1-carboxylic acid Chemical compound OC(=O)N1CCC[C@H]1COC(C=C1C(=O)NC=2C=NC=CC=2)=CC=C1OCC1=CC=CC=C1 VLVUHOMGWBJKFA-FQEVSTJZSA-N 0.000 description 1
- PGTKSNGGUGZTTD-UHFFFAOYSA-N (4-fluorophenyl)methyl 2-[(4-fluorophenyl)methoxy]-5-(trifluoromethyl)benzoate Chemical compound C1=CC(F)=CC=C1COC(=O)C1=CC(C(F)(F)F)=CC=C1OCC1=CC=C(F)C=C1 PGTKSNGGUGZTTD-UHFFFAOYSA-N 0.000 description 1
- JYLDVABANFMMIR-UHFFFAOYSA-N (4-fluorophenyl)methyl 2-[(4-fluorophenyl)methoxy]-5-formylbenzoate Chemical compound C1=CC(F)=CC=C1COC(=O)C1=CC(C=O)=CC=C1OCC1=CC=C(F)C=C1 JYLDVABANFMMIR-UHFFFAOYSA-N 0.000 description 1
- 125000006526 (C1-C2) alkyl group Chemical group 0.000 description 1
- SCYULBFZEHDVBN-UHFFFAOYSA-N 1,1-Dichloroethane Chemical compound CC(Cl)Cl SCYULBFZEHDVBN-UHFFFAOYSA-N 0.000 description 1
- ACTKAGSPIFDCMF-UHFFFAOYSA-N 1,3-oxazol-2-amine Chemical compound NC1=NC=CO1 ACTKAGSPIFDCMF-UHFFFAOYSA-N 0.000 description 1
- WMKGGPCROCCUDY-UHFFFAOYSA-N 1,5-diphenylpenta-1,4-dien-3-one Chemical compound C=1C=CC=CC=1C=CC(=O)C=CC1=CC=CC=C1 WMKGGPCROCCUDY-UHFFFAOYSA-N 0.000 description 1
- PURSZYWBIQIANP-UHFFFAOYSA-N 1-(bromomethyl)-2-chlorobenzene Chemical compound ClC1=CC=CC=C1CBr PURSZYWBIQIANP-UHFFFAOYSA-N 0.000 description 1
- FFWQLZFIMNTUCZ-UHFFFAOYSA-N 1-(bromomethyl)-2-fluorobenzene Chemical compound FC1=CC=CC=C1CBr FFWQLZFIMNTUCZ-UHFFFAOYSA-N 0.000 description 1
- WGVYCXYGPNNUQA-UHFFFAOYSA-N 1-(bromomethyl)-2-methylbenzene Chemical compound CC1=CC=CC=C1CBr WGVYCXYGPNNUQA-UHFFFAOYSA-N 0.000 description 1
- LZIYAIRGDHSVED-UHFFFAOYSA-N 1-(bromomethyl)-3-chlorobenzene Chemical compound ClC1=CC=CC(CBr)=C1 LZIYAIRGDHSVED-UHFFFAOYSA-N 0.000 description 1
- SCBZBMXPJYMXRC-UHFFFAOYSA-N 1-(bromomethyl)-3-fluorobenzene Chemical compound FC1=CC=CC(CBr)=C1 SCBZBMXPJYMXRC-UHFFFAOYSA-N 0.000 description 1
- ZKSOJQDNSNJIQW-UHFFFAOYSA-N 1-(bromomethyl)-3-methoxybenzene Chemical compound COC1=CC=CC(CBr)=C1 ZKSOJQDNSNJIQW-UHFFFAOYSA-N 0.000 description 1
- KQNBRMUBPRGXSL-UHFFFAOYSA-N 1-(bromomethyl)-4-chlorobenzene Chemical compound ClC1=CC=C(CBr)C=C1 KQNBRMUBPRGXSL-UHFFFAOYSA-N 0.000 description 1
- GIGRWGTZFONRKA-UHFFFAOYSA-N 1-(bromomethyl)-4-methoxybenzene Chemical compound COC1=CC=C(CBr)C=C1 GIGRWGTZFONRKA-UHFFFAOYSA-N 0.000 description 1
- UAWVMPOAIVZWFQ-UHFFFAOYSA-N 1-(chloromethyl)-2-methoxybenzene Chemical compound COC1=CC=CC=C1CCl UAWVMPOAIVZWFQ-UHFFFAOYSA-N 0.000 description 1
- YZUPZGFPHUVJKC-UHFFFAOYSA-N 1-bromo-2-methoxyethane Chemical compound COCCBr YZUPZGFPHUVJKC-UHFFFAOYSA-N 0.000 description 1
- DFPYXQYWILNVAU-UHFFFAOYSA-N 1-hydroxybenzotriazole Chemical compound C1=CC=C2N(O)N=NC2=C1.C1=CC=C2N(O)N=NC2=C1 DFPYXQYWILNVAU-UHFFFAOYSA-N 0.000 description 1
- UCNGGGYMLHAMJG-UHFFFAOYSA-N 1-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole Chemical compound C1=NN(C)C=C1B1OC(C)(C)C(C)(C)O1 UCNGGGYMLHAMJG-UHFFFAOYSA-N 0.000 description 1
- BAUWRHPMUVYFOD-UHFFFAOYSA-N 1-methylpiperidin-4-ol Chemical compound CN1CCC(O)CC1 BAUWRHPMUVYFOD-UHFFFAOYSA-N 0.000 description 1
- XUSKZLBLGHBCLD-UHFFFAOYSA-N 2-(3-aminophenyl)acetic acid Chemical compound NC1=CC=CC(CC(O)=O)=C1 XUSKZLBLGHBCLD-UHFFFAOYSA-N 0.000 description 1
- QGXNHCXKWFNKCG-UHFFFAOYSA-N 2-(bromomethyl)benzonitrile Chemical compound BrCC1=CC=CC=C1C#N QGXNHCXKWFNKCG-UHFFFAOYSA-N 0.000 description 1
- OYWUUWZYUUMHBG-UHFFFAOYSA-N 2-[(3,4-difluorophenyl)methoxy]-5-formylbenzoic acid Chemical compound OC(=O)C1=CC(C=O)=CC=C1OCC1=CC=C(F)C(F)=C1 OYWUUWZYUUMHBG-UHFFFAOYSA-N 0.000 description 1
- NSKDOZWJXCOVQG-UHFFFAOYSA-N 2-[(4-fluorophenyl)methoxy]-5-(1-methylpyrazol-3-yl)-n-pyridazin-4-ylbenzamide Chemical compound CN1C=CC(C=2C=C(C(OCC=3C=CC(F)=CC=3)=CC=2)C(=O)NC=2C=NN=CC=2)=N1 NSKDOZWJXCOVQG-UHFFFAOYSA-N 0.000 description 1
- VUMUPUNGURLXSH-UHFFFAOYSA-N 2-[(4-fluorophenyl)methoxy]-5-(1-methylpyrazol-4-yl)-n-pyridin-3-ylbenzamide Chemical compound C1=NN(C)C=C1C(C=C1C(=O)NC=2C=NC=CC=2)=CC=C1OCC1=CC=C(F)C=C1 VUMUPUNGURLXSH-UHFFFAOYSA-N 0.000 description 1
- WUPQVUFQSHOBAA-UHFFFAOYSA-N 2-[(4-fluorophenyl)methoxy]-5-(1-methylpyrazol-4-yl)benzoic acid Chemical compound C1=NN(C)C=C1C(C=C1C(O)=O)=CC=C1OCC1=CC=C(F)C=C1 WUPQVUFQSHOBAA-UHFFFAOYSA-N 0.000 description 1
- SFTBLTQPYGHHJM-UHFFFAOYSA-N 2-[(4-fluorophenyl)methoxy]-5-(3-morpholin-4-ylpropyl)-n-pyridin-3-ylbenzamide Chemical compound C1=CC(F)=CC=C1COC(C(=C1)C(=O)NC=2C=NC=CC=2)=CC=C1CCCN1CCOCC1 SFTBLTQPYGHHJM-UHFFFAOYSA-N 0.000 description 1
- JPROMPHKSSPCDY-UHFFFAOYSA-N 2-[(4-fluorophenyl)methoxy]-5-(trifluoromethyl)benzoic acid Chemical compound OC(=O)C1=CC(C(F)(F)F)=CC=C1OCC1=CC=C(F)C=C1 JPROMPHKSSPCDY-UHFFFAOYSA-N 0.000 description 1
- BTLGQYRCXJZMSK-UHFFFAOYSA-N 2-[(4-fluorophenyl)methoxy]-5-[1-(2-morpholin-4-ylethyl)pyrazol-4-yl]-n-pyridazin-4-ylbenzamide Chemical compound C1=CC(F)=CC=C1COC1=CC=C(C2=CN(CCN3CCOCC3)N=C2)C=C1C(=O)NC1=CC=NN=C1 BTLGQYRCXJZMSK-UHFFFAOYSA-N 0.000 description 1
- KBZDUIWUFKYCDT-UHFFFAOYSA-N 2-[(4-fluorophenyl)methoxy]-5-[1-(2-morpholin-4-ylethyl)pyrazol-4-yl]benzoic acid Chemical compound OC(=O)C1=CC(C2=CN(CCN3CCOCC3)N=C2)=CC=C1OCC1=CC=C(F)C=C1 KBZDUIWUFKYCDT-UHFFFAOYSA-N 0.000 description 1
- SUXYYAYTUCFJJV-UHFFFAOYSA-N 2-[(4-fluorophenyl)methoxy]-5-formyl-n-pyridin-3-ylbenzamide Chemical compound C1=CC(F)=CC=C1COC1=CC=C(C=O)C=C1C(=O)NC1=CC=CN=C1 SUXYYAYTUCFJJV-UHFFFAOYSA-N 0.000 description 1
- NEVFYQBIZALSKZ-UHFFFAOYSA-N 2-[(4-fluorophenyl)methoxy]-5-formylbenzoic acid Chemical compound OC(=O)C1=CC(C=O)=CC=C1OCC1=CC=C(F)C=C1 NEVFYQBIZALSKZ-UHFFFAOYSA-N 0.000 description 1
- VYVPNTJBGPQTFA-UHFFFAOYSA-N 2-[2-(4-methylphenyl)sulfonyloxyethoxy]ethyl 4-methylbenzenesulfonate Chemical compound C1=CC(C)=CC=C1S(=O)(=O)OCCOCCOS(=O)(=O)C1=CC=C(C)C=C1 VYVPNTJBGPQTFA-UHFFFAOYSA-N 0.000 description 1
- DLGBEGBHXSAQOC-UHFFFAOYSA-N 2-hydroxy-5-methylbenzoic acid Chemical compound CC1=CC=C(O)C(C(O)=O)=C1 DLGBEGBHXSAQOC-UHFFFAOYSA-N 0.000 description 1
- NAKZCKOHULJEID-UHFFFAOYSA-N 2-methoxy-5-(trifluoromethyl)benzoic acid Chemical compound COC1=CC=C(C(F)(F)F)C=C1C(O)=O NAKZCKOHULJEID-UHFFFAOYSA-N 0.000 description 1
- MHNNAWXXUZQSNM-UHFFFAOYSA-N 2-methylbut-1-ene Chemical compound CCC(C)=C MHNNAWXXUZQSNM-UHFFFAOYSA-N 0.000 description 1
- YOETUEMZNOLGDB-UHFFFAOYSA-N 2-methylpropyl carbonochloridate Chemical compound CC(C)COC(Cl)=O YOETUEMZNOLGDB-UHFFFAOYSA-N 0.000 description 1
- 229940080296 2-naphthalenesulfonate Drugs 0.000 description 1
- GBAOOJAWDCNOGO-UHFFFAOYSA-N 3,4,5-trichloropyridazine Chemical compound ClC1=CN=NC(Cl)=C1Cl GBAOOJAWDCNOGO-UHFFFAOYSA-N 0.000 description 1
- IXWFNLOVKHPODY-UHFFFAOYSA-N 3-(aminomethyl)-2-[(3,4-difluorophenyl)methoxy]-N-pyridin-3-ylbenzamide Chemical compound NCC=1C(=C(C(=O)NC=2C=NC=CC2)C=CC1)OCC1=CC(=C(C=C1)F)F IXWFNLOVKHPODY-UHFFFAOYSA-N 0.000 description 1
- CVKOOKPNCVYHNY-UHFFFAOYSA-N 3-(bromomethyl)benzonitrile Chemical compound BrCC1=CC=CC(C#N)=C1 CVKOOKPNCVYHNY-UHFFFAOYSA-N 0.000 description 1
- BOOMHTFCWOJWFO-UHFFFAOYSA-N 3-aminopyridine-2-carboxylic acid Chemical compound NC1=CC=CN=C1C(O)=O BOOMHTFCWOJWFO-UHFFFAOYSA-N 0.000 description 1
- FYEQKMAVRYRMBL-UHFFFAOYSA-N 3-aminopyridine-4-carboxylic acid Chemical compound NC1=CN=CC=C1C(O)=O FYEQKMAVRYRMBL-UHFFFAOYSA-N 0.000 description 1
- PNPCRKVUWYDDST-UHFFFAOYSA-N 3-chloroaniline Chemical compound NC1=CC=CC(Cl)=C1 PNPCRKVUWYDDST-UHFFFAOYSA-N 0.000 description 1
- AMKPQMFZCBTTAT-UHFFFAOYSA-N 3-ethylaniline Chemical compound CCC1=CC=CC(N)=C1 AMKPQMFZCBTTAT-UHFFFAOYSA-N 0.000 description 1
- QZVQQUVWFIZUBQ-UHFFFAOYSA-N 3-fluoroaniline Chemical compound NC1=CC=CC(F)=C1 QZVQQUVWFIZUBQ-UHFFFAOYSA-N 0.000 description 1
- YBLSBWHFPXDRHC-UHFFFAOYSA-N 3-methyl-1,2-oxazole-4-carboxylic acid Chemical compound CC1=NOC=C1C(O)=O YBLSBWHFPXDRHC-UHFFFAOYSA-N 0.000 description 1
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 1
- UMLFTCYAQPPZER-UHFFFAOYSA-N 4-(bromomethyl)benzonitrile Chemical compound BrCC1=CC=C(C#N)C=C1 UMLFTCYAQPPZER-UHFFFAOYSA-N 0.000 description 1
- NSKXOMVIGLNALY-UHFFFAOYSA-N 4-[(4-fluorophenyl)methoxy]-3-(pyridin-3-ylcarbamoyl)benzoic acid Chemical compound C=1C=CN=CC=1NC(=O)C1=CC(C(=O)O)=CC=C1OCC1=CC=C(F)C=C1 NSKXOMVIGLNALY-UHFFFAOYSA-N 0.000 description 1
- 125000004801 4-cyanophenyl group Chemical group [H]C1=C([H])C(C#N)=C([H])C([H])=C1* 0.000 description 1
- HVCNXQOWACZAFN-UHFFFAOYSA-N 4-ethylmorpholine Chemical compound CCN1CCOCC1 HVCNXQOWACZAFN-UHFFFAOYSA-N 0.000 description 1
- WNWVKZTYMQWFHE-UHFFFAOYSA-N 4-ethylmorpholine Chemical group [CH2]CN1CCOCC1 WNWVKZTYMQWFHE-UHFFFAOYSA-N 0.000 description 1
- BCEQKAQCUWUNML-UHFFFAOYSA-N 4-hydroxybenzene-1,3-dicarboxylic acid Chemical compound OC(=O)C1=CC=C(O)C(C(O)=O)=C1 BCEQKAQCUWUNML-UHFFFAOYSA-N 0.000 description 1
- FJKROLUGYXJWQN-UHFFFAOYSA-N 4-hydroxybenzoic acid Chemical compound OC(=O)C1=CC=C(O)C=C1 FJKROLUGYXJWQN-UHFFFAOYSA-N 0.000 description 1
- LVQFHDAKZHGEAJ-UHFFFAOYSA-M 4-methylbenzenesulfonate Chemical compound [CH2]C1=CC=C(S([O-])(=O)=O)C=C1 LVQFHDAKZHGEAJ-UHFFFAOYSA-M 0.000 description 1
- ATRMIWLUDSNZRS-UHFFFAOYSA-N 4-nitro-2-phenylmethoxybenzamide Chemical class NC(=O)C1=CC=C([N+]([O-])=O)C=C1OCC1=CC=CC=C1 ATRMIWLUDSNZRS-UHFFFAOYSA-N 0.000 description 1
- UJXYQCNKKZCCPS-UHFFFAOYSA-N 5-(dimethylsulfamoyl)-2-phenylmethoxy-n-pyridin-3-ylbenzamide Chemical compound C=1C=CN=CC=1NC(=O)C1=CC(S(=O)(=O)N(C)C)=CC=C1OCC1=CC=CC=C1 UJXYQCNKKZCCPS-UHFFFAOYSA-N 0.000 description 1
- 108091005435 5-HT6 receptors Proteins 0.000 description 1
- CABLYLXHINBTKV-CQSZACIVSA-N 5-bromo-2-[(1r)-1-phenylethoxy]-n-pyridin-3-ylbenzamide Chemical compound O([C@H](C)C=1C=CC=CC=1)C1=CC=C(Br)C=C1C(=O)NC1=CC=CN=C1 CABLYLXHINBTKV-CQSZACIVSA-N 0.000 description 1
- CABLYLXHINBTKV-AWEZNQCLSA-N 5-bromo-2-[(1s)-1-phenylethoxy]-n-pyridin-3-ylbenzamide Chemical compound O([C@@H](C)C=1C=CC=CC=1)C1=CC=C(Br)C=C1C(=O)NC1=CC=CN=C1 CABLYLXHINBTKV-AWEZNQCLSA-N 0.000 description 1
- OKELEUWATPBQEA-UHFFFAOYSA-N 5-bromo-2-[(2,4-difluorophenyl)methoxy]benzoic acid Chemical compound OC(=O)C1=CC(Br)=CC=C1OCC1=CC=C(F)C=C1F OKELEUWATPBQEA-UHFFFAOYSA-N 0.000 description 1
- NKBASRXWGAGQDP-UHFFFAOYSA-N 5-chlorosalicylic acid Chemical compound OC(=O)C1=CC(Cl)=CC=C1O NKBASRXWGAGQDP-UHFFFAOYSA-N 0.000 description 1
- JWPRICQKUNODPZ-UHFFFAOYSA-N 5-fluoro-2-hydroxybenzoic acid Chemical compound OC(=O)C1=CC(F)=CC=C1O JWPRICQKUNODPZ-UHFFFAOYSA-N 0.000 description 1
- 102100022738 5-hydroxytryptamine receptor 1A Human genes 0.000 description 1
- 101710138638 5-hydroxytryptamine receptor 1A Proteins 0.000 description 1
- 102100036311 5-hydroxytryptamine receptor 1F Human genes 0.000 description 1
- 101710138086 5-hydroxytryptamine receptor 1F Proteins 0.000 description 1
- 102100040368 5-hydroxytryptamine receptor 6 Human genes 0.000 description 1
- 101710150235 5-hydroxytryptamine receptor 6 Proteins 0.000 description 1
- IZWNLPLYEITCTM-UHFFFAOYSA-N 5-methoxycarbonyl-2-phenylmethoxybenzoic acid Chemical compound OC(=O)C1=CC(C(=O)OC)=CC=C1OCC1=CC=CC=C1 IZWNLPLYEITCTM-UHFFFAOYSA-N 0.000 description 1
- IZZIWIAOVZOBLF-UHFFFAOYSA-N 5-methoxysalicylic acid Chemical compound COC1=CC=C(O)C(C(O)=O)=C1 IZZIWIAOVZOBLF-UHFFFAOYSA-N 0.000 description 1
- VQBXUKGMJCPBMF-UHFFFAOYSA-N 5-methyl-1,2-oxazole-4-carboxylic acid Chemical compound CC=1ON=CC=1C(O)=O VQBXUKGMJCPBMF-UHFFFAOYSA-N 0.000 description 1
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical group [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- QGZKDVFQNNGYKY-OUBTZVSYSA-N Ammonia-15N Chemical compound [15NH3] QGZKDVFQNNGYKY-OUBTZVSYSA-N 0.000 description 1
- ATRRKUHOCOJYRX-UHFFFAOYSA-N Ammonium bicarbonate Chemical compound [NH4+].OC([O-])=O ATRRKUHOCOJYRX-UHFFFAOYSA-N 0.000 description 1
- 201000001320 Atherosclerosis Diseases 0.000 description 1
- 239000005711 Benzoic acid Substances 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- KXDHJXZQYSOELW-UHFFFAOYSA-M Carbamate Chemical compound NC([O-])=O KXDHJXZQYSOELW-UHFFFAOYSA-M 0.000 description 1
- KRKNYBCHXYNGOX-UHFFFAOYSA-K Citrate Chemical compound [O-]C(=O)CC(O)(CC([O-])=O)C([O-])=O KRKNYBCHXYNGOX-UHFFFAOYSA-K 0.000 description 1
- 206010010774 Constipation Diseases 0.000 description 1
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 1
- 238000006969 Curtius rearrangement reaction Methods 0.000 description 1
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 1
- BDAGIHXWWSANSR-UHFFFAOYSA-M Formate Chemical compound [O-]C=O BDAGIHXWWSANSR-UHFFFAOYSA-M 0.000 description 1
- VZCYOOQTPOCHFL-OWOJBTEDSA-N Fumaric acid Chemical compound OC(=O)\C=C\C(O)=O VZCYOOQTPOCHFL-OWOJBTEDSA-N 0.000 description 1
- 102000013446 GTP Phosphohydrolases Human genes 0.000 description 1
- 108091006109 GTPases Proteins 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 1
- 208000008839 Kidney Neoplasms Diseases 0.000 description 1
- CKLJMWTZIZZHCS-REOHCLBHSA-N L-aspartic acid Chemical compound OC(=O)[C@@H](N)CC(O)=O CKLJMWTZIZZHCS-REOHCLBHSA-N 0.000 description 1
- WHUUTDBJXJRKMK-VKHMYHEASA-N L-glutamic acid Chemical compound OC(=O)[C@@H](N)CCC(O)=O WHUUTDBJXJRKMK-VKHMYHEASA-N 0.000 description 1
- OUYCCCASQSFEME-QMMMGPOBSA-N L-tyrosine Chemical compound OC(=O)[C@@H](N)CC1=CC=C(O)C=C1 OUYCCCASQSFEME-QMMMGPOBSA-N 0.000 description 1
- JVTAAEKCZFNVCJ-UHFFFAOYSA-M Lactate Chemical compound CC(O)C([O-])=O JVTAAEKCZFNVCJ-UHFFFAOYSA-M 0.000 description 1
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 1
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 1
- 108091022875 Microtubule Proteins 0.000 description 1
- 102000029749 Microtubule Human genes 0.000 description 1
- 102100027869 Moesin Human genes 0.000 description 1
- 102000014415 Muscarinic acetylcholine receptor Human genes 0.000 description 1
- 108050003473 Muscarinic acetylcholine receptor Proteins 0.000 description 1
- 229940121948 Muscarinic receptor antagonist Drugs 0.000 description 1
- 108010021466 Mutant Proteins Proteins 0.000 description 1
- 102000008300 Mutant Proteins Human genes 0.000 description 1
- HOKKHZGPKSLGJE-GSVOUGTGSA-N N-Methyl-D-aspartic acid Chemical compound CN[C@@H](C(O)=O)CC(O)=O HOKKHZGPKSLGJE-GSVOUGTGSA-N 0.000 description 1
- 102000003945 NF-kappa B Human genes 0.000 description 1
- 108010057466 NF-kappa B Proteins 0.000 description 1
- 229940127523 NMDA Receptor Antagonists Drugs 0.000 description 1
- 229910002651 NO3 Inorganic materials 0.000 description 1
- 208000012902 Nervous system disease Diseases 0.000 description 1
- 208000025966 Neurological disease Diseases 0.000 description 1
- 101100030361 Neurospora crassa (strain ATCC 24698 / 74-OR23-1A / CBS 708.71 / DSM 1257 / FGSC 987) pph-3 gene Proteins 0.000 description 1
- 244000061176 Nicotiana tabacum Species 0.000 description 1
- 235000002637 Nicotiana tabacum Nutrition 0.000 description 1
- 102000019315 Nicotinic acetylcholine receptors Human genes 0.000 description 1
- 108050006807 Nicotinic acetylcholine receptors Proteins 0.000 description 1
- NHNBFGGVMKEFGY-UHFFFAOYSA-N Nitrate Chemical compound [O-][N+]([O-])=O NHNBFGGVMKEFGY-UHFFFAOYSA-N 0.000 description 1
- 102000048266 Nociceptin Human genes 0.000 description 1
- 108090000622 Nociceptin Proteins 0.000 description 1
- 229910019142 PO4 Inorganic materials 0.000 description 1
- 229930040373 Paraformaldehyde Natural products 0.000 description 1
- 229910002666 PdCl2 Inorganic materials 0.000 description 1
- 208000008469 Peptic Ulcer Diseases 0.000 description 1
- 102000004160 Phosphoric Monoester Hydrolases Human genes 0.000 description 1
- 108090000608 Phosphoric Monoester Hydrolases Proteins 0.000 description 1
- XBDQKXXYIPTUBI-UHFFFAOYSA-M Propionate Chemical compound CCC([O-])=O XBDQKXXYIPTUBI-UHFFFAOYSA-M 0.000 description 1
- 108090000412 Protein-Tyrosine Kinases Proteins 0.000 description 1
- 102000004022 Protein-Tyrosine Kinases Human genes 0.000 description 1
- 102000042895 ROCO family Human genes 0.000 description 1
- 108091082329 ROCO family Proteins 0.000 description 1
- XSVMFMHYUFZWBK-NSHDSACASA-N Rivastigmine Chemical compound CCN(C)C(=O)OC1=CC=CC([C@H](C)N(C)C)=C1 XSVMFMHYUFZWBK-NSHDSACASA-N 0.000 description 1
- 208000000453 Skin Neoplasms Diseases 0.000 description 1
- 108010018242 Transcription Factor AP-1 Proteins 0.000 description 1
- 102100023132 Transcription factor Jun Human genes 0.000 description 1
- FYJKEHKQUPSJDH-UHFFFAOYSA-N [dimethyl-(trimethylsilylamino)silyl]methane;potassium Chemical compound [K].C[Si](C)(C)N[Si](C)(C)C FYJKEHKQUPSJDH-UHFFFAOYSA-N 0.000 description 1
- KXKVLQRXCPHEJC-UHFFFAOYSA-N acetic acid trimethyl ester Natural products COC(C)=O KXKVLQRXCPHEJC-UHFFFAOYSA-N 0.000 description 1
- 230000003213 activating effect Effects 0.000 description 1
- 239000011149 active material Substances 0.000 description 1
- 239000000443 aerosol Substances 0.000 description 1
- 230000002776 aggregation Effects 0.000 description 1
- 238000004220 aggregation Methods 0.000 description 1
- 229910052782 aluminium Inorganic materials 0.000 description 1
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 150000001413 amino acids Chemical group 0.000 description 1
- 235000012538 ammonium bicarbonate Nutrition 0.000 description 1
- 239000001099 ammonium carbonate Substances 0.000 description 1
- 235000012501 ammonium carbonate Nutrition 0.000 description 1
- 150000003863 ammonium salts Chemical class 0.000 description 1
- 230000003466 anti-cipated effect Effects 0.000 description 1
- 229940009098 aspartate Drugs 0.000 description 1
- 238000003556 assay Methods 0.000 description 1
- 238000011914 asymmetric synthesis Methods 0.000 description 1
- 125000003725 azepanyl group Chemical group 0.000 description 1
- 125000002393 azetidinyl group Chemical group 0.000 description 1
- SRSXLGNVWSONIS-UHFFFAOYSA-M benzenesulfonate Chemical compound [O-]S(=O)(=O)C1=CC=CC=C1 SRSXLGNVWSONIS-UHFFFAOYSA-M 0.000 description 1
- 229940077388 benzenesulfonate Drugs 0.000 description 1
- 235000010233 benzoic acid Nutrition 0.000 description 1
- DDPCRQOFPSYFEP-UHFFFAOYSA-N benzyl 2-phenylmethoxy-5-piperidin-1-ylbenzoate Chemical compound C=1C(N2CCCCC2)=CC=C(OCC=2C=CC=CC=2)C=1C(=O)OCC1=CC=CC=C1 DDPCRQOFPSYFEP-UHFFFAOYSA-N 0.000 description 1
- FAIPTVPAENBAPS-UHFFFAOYSA-N benzyl 2-phenylmethoxy-5-pyridin-4-ylbenzoate Chemical compound C=1C(C=2C=CN=CC=2)=CC=C(OCC=2C=CC=CC=2)C=1C(=O)OCC1=CC=CC=C1 FAIPTVPAENBAPS-UHFFFAOYSA-N 0.000 description 1
- FMUWPLCYOJZRQP-UHFFFAOYSA-N benzyl 5-(4-methylpiperazin-1-yl)-2-phenylmethoxybenzoate Chemical compound C1CN(C)CCN1C(C=C1C(=O)OCC=2C=CC=CC=2)=CC=C1OCC1=CC=CC=C1 FMUWPLCYOJZRQP-UHFFFAOYSA-N 0.000 description 1
- IBPPVAUGJDVAJS-UHFFFAOYSA-N benzyl 5-methoxy-2-phenylmethoxybenzoate Chemical compound C=1C=CC=CC=1COC(=O)C1=CC(OC)=CC=C1OCC1=CC=CC=C1 IBPPVAUGJDVAJS-UHFFFAOYSA-N 0.000 description 1
- 239000002439 beta secretase inhibitor Substances 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- 239000000090 biomarker Substances 0.000 description 1
- 239000008280 blood Substances 0.000 description 1
- 210000004369 blood Anatomy 0.000 description 1
- 210000004556 brain Anatomy 0.000 description 1
- 210000000133 brain stem Anatomy 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- 201000011510 cancer Diseases 0.000 description 1
- 150000001768 cations Chemical class 0.000 description 1
- 230000030833 cell death Effects 0.000 description 1
- 235000015218 chewing gum Nutrition 0.000 description 1
- 239000000544 cholinesterase inhibitor Substances 0.000 description 1
- 239000011248 coating agent Substances 0.000 description 1
- 230000001149 cognitive effect Effects 0.000 description 1
- 229940125773 compound 10 Drugs 0.000 description 1
- DOBRDRYODQBAMW-UHFFFAOYSA-N copper(i) cyanide Chemical compound [Cu+].N#[C-] DOBRDRYODQBAMW-UHFFFAOYSA-N 0.000 description 1
- 230000008878 coupling Effects 0.000 description 1
- 238000010168 coupling process Methods 0.000 description 1
- 238000005859 coupling reaction Methods 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- DEZRYPDIMOWBDS-UHFFFAOYSA-N dcm dichloromethane Chemical compound ClCCl.ClCCl DEZRYPDIMOWBDS-UHFFFAOYSA-N 0.000 description 1
- 230000007423 decrease Effects 0.000 description 1
- 238000013461 design Methods 0.000 description 1
- 125000005959 diazepanyl group Chemical group 0.000 description 1
- IHZMNFYRMGFJMQ-UHFFFAOYSA-N dibenzyl 4-phenylmethoxybenzene-1,3-dicarboxylate Chemical compound C=1C=C(OCC=2C=CC=CC=2)C(C(=O)OCC=2C=CC=CC=2)=CC=1C(=O)OCC1=CC=CC=C1 IHZMNFYRMGFJMQ-UHFFFAOYSA-N 0.000 description 1
- MHDVGSVTJDSBDK-UHFFFAOYSA-N dibenzyl ether Chemical class C=1C=CC=CC=1COCC1=CC=CC=C1 MHDVGSVTJDSBDK-UHFFFAOYSA-N 0.000 description 1
- WMKGGPCROCCUDY-PHEQNACWSA-N dibenzylideneacetone Chemical compound C=1C=CC=CC=1\C=C\C(=O)\C=C\C1=CC=CC=C1 WMKGGPCROCCUDY-PHEQNACWSA-N 0.000 description 1
- ZBCBWPMODOFKDW-UHFFFAOYSA-N diethanolamine Chemical compound OCCNCCO ZBCBWPMODOFKDW-UHFFFAOYSA-N 0.000 description 1
- 230000004069 differentiation Effects 0.000 description 1
- 125000004212 difluorophenyl group Chemical group 0.000 description 1
- 239000003085 diluting agent Substances 0.000 description 1
- 125000002147 dimethylamino group Chemical group [H]C([H])([H])N(*)C([H])([H])[H] 0.000 description 1
- GPAYUJZHTULNBE-UHFFFAOYSA-N diphenylphosphine Chemical compound C=1C=CC=CC=1PC1=CC=CC=C1 GPAYUJZHTULNBE-UHFFFAOYSA-N 0.000 description 1
- MKRTXPORKIRPDG-UHFFFAOYSA-N diphenylphosphoryl azide Chemical compound C=1C=CC=CC=1P(=O)(N=[N+]=[N-])C1=CC=CC=C1 MKRTXPORKIRPDG-UHFFFAOYSA-N 0.000 description 1
- 239000007884 disintegrant Substances 0.000 description 1
- 238000009826 distribution Methods 0.000 description 1
- UZZWBUYVTBPQIV-UHFFFAOYSA-N dme dimethoxyethane Chemical compound COCCOC.COCCOC UZZWBUYVTBPQIV-UHFFFAOYSA-N 0.000 description 1
- CETRZFQIITUQQL-UHFFFAOYSA-N dmso dimethylsulfoxide Chemical compound CS(C)=O.CS(C)=O CETRZFQIITUQQL-UHFFFAOYSA-N 0.000 description 1
- ADEBPBSSDYVVLD-UHFFFAOYSA-N donepezil Chemical compound O=C1C=2C=C(OC)C(OC)=CC=2CC1CC(CC1)CCN1CC1=CC=CC=C1 ADEBPBSSDYVVLD-UHFFFAOYSA-N 0.000 description 1
- XWAIAVWHZJNZQQ-UHFFFAOYSA-N donepezil hydrochloride Chemical compound [H+].[Cl-].O=C1C=2C=C(OC)C(OC)=CC=2CC1CC(CC1)CCN1CC1=CC=CC=C1 XWAIAVWHZJNZQQ-UHFFFAOYSA-N 0.000 description 1
- 229960003135 donepezil hydrochloride Drugs 0.000 description 1
- 229940052760 dopamine agonists Drugs 0.000 description 1
- 239000003136 dopamine receptor stimulating agent Substances 0.000 description 1
- 210000005064 dopaminergic neuron Anatomy 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- 238000005516 engineering process Methods 0.000 description 1
- CCIVGXIOQKPBKL-UHFFFAOYSA-M ethanesulfonate Chemical compound CCS([O-])(=O)=O CCIVGXIOQKPBKL-UHFFFAOYSA-M 0.000 description 1
- 125000001301 ethoxy group Chemical group [H]C([H])([H])C([H])([H])O* 0.000 description 1
- 125000000816 ethylene group Chemical group [H]C([H])([*:1])C([H])([H])[*:2] 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- 239000000945 filler Substances 0.000 description 1
- 239000012065 filter cake Substances 0.000 description 1
- 125000003784 fluoroethyl group Chemical group [H]C([H])(F)C([H])([H])* 0.000 description 1
- 235000019253 formic acid Nutrition 0.000 description 1
- 230000006870 function Effects 0.000 description 1
- 125000003838 furazanyl group Chemical group 0.000 description 1
- 230000005021 gait Effects 0.000 description 1
- 239000003540 gamma secretase inhibitor Substances 0.000 description 1
- 230000014509 gene expression Effects 0.000 description 1
- 229930195712 glutamate Natural products 0.000 description 1
- 239000003979 granulating agent Substances 0.000 description 1
- 125000001188 haloalkyl group Chemical group 0.000 description 1
- 125000000623 heterocyclic group Chemical group 0.000 description 1
- FUZZWVXGSFPDMH-UHFFFAOYSA-N hexanoic acid Chemical compound CCCCCC(O)=O FUZZWVXGSFPDMH-UHFFFAOYSA-N 0.000 description 1
- 150000004677 hydrates Chemical class 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- 125000005027 hydroxyaryl group Chemical group 0.000 description 1
- 206010020718 hyperplasia Diseases 0.000 description 1
- 238000003384 imaging method Methods 0.000 description 1
- 125000002632 imidazolidinyl group Chemical group 0.000 description 1
- 125000002883 imidazolyl group Chemical group 0.000 description 1
- 230000001900 immune effect Effects 0.000 description 1
- 239000007943 implant Substances 0.000 description 1
- LPAGFVYQRIESJQ-UHFFFAOYSA-N indoline Chemical class C1=CC=C2NCCC2=C1 LPAGFVYQRIESJQ-UHFFFAOYSA-N 0.000 description 1
- BXFFHSIDQOFMLE-UHFFFAOYSA-N indoxyl sulfate Natural products C1=CC=C2C(OS(=O)(=O)O)=CNC2=C1 BXFFHSIDQOFMLE-UHFFFAOYSA-N 0.000 description 1
- XVARCVCWNFACQC-UHFFFAOYSA-N indoxyl-beta-D-glucopyranoside Natural products OC1C(O)C(O)C(CO)OC1OC1=CNC2=CC=CC=C12 XVARCVCWNFACQC-UHFFFAOYSA-N 0.000 description 1
- 239000004615 ingredient Substances 0.000 description 1
- 230000002401 inhibitory effect Effects 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- 125000003253 isopropoxy group Chemical group [H]C([H])([H])C([H])(O*)C([H])([H])[H] 0.000 description 1
- 125000001786 isothiazolyl group Chemical group 0.000 description 1
- CTAPFRYPJLPFDF-UHFFFAOYSA-N isoxazole Chemical compound C=1C=NOC=1 CTAPFRYPJLPFDF-UHFFFAOYSA-N 0.000 description 1
- ZLVXBBHTMQJRSX-VMGNSXQWSA-N jdtic Chemical compound C1([C@]2(C)CCN(C[C@@H]2C)C[C@H](C(C)C)NC(=O)[C@@H]2NCC3=CC(O)=CC=C3C2)=CC=CC(O)=C1 ZLVXBBHTMQJRSX-VMGNSXQWSA-N 0.000 description 1
- 238000004895 liquid chromatography mass spectrometry Methods 0.000 description 1
- 238000002514 liquid chromatography mass spectrum Methods 0.000 description 1
- 102000004311 liver X receptors Human genes 0.000 description 1
- 108090000865 liver X receptors Proteins 0.000 description 1
- 239000000314 lubricant Substances 0.000 description 1
- 208000020816 lung neoplasm Diseases 0.000 description 1
- NCBZRJODKRCREW-UHFFFAOYSA-N m-anisidine Chemical compound COC1=CC=CC(N)=C1 NCBZRJODKRCREW-UHFFFAOYSA-N 0.000 description 1
- 239000011777 magnesium Substances 0.000 description 1
- 229910052749 magnesium Inorganic materials 0.000 description 1
- NXPHGHWWQRMDIA-UHFFFAOYSA-M magnesium;carbanide;bromide Chemical compound [CH3-].[Mg+2].[Br-] NXPHGHWWQRMDIA-UHFFFAOYSA-M 0.000 description 1
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 1
- 241001515942 marmosets Species 0.000 description 1
- 238000001819 mass spectrum Methods 0.000 description 1
- 108020004999 messenger RNA Proteins 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- OLDYLFUONNUMLA-UHFFFAOYSA-N methyl 2-[(2,4-difluorophenyl)methoxy]-5-(morpholine-4-carbonyl)benzoate Chemical compound COC(=O)C1=CC(C(=O)N2CCOCC2)=CC=C1OCC1=CC=C(F)C=C1F OLDYLFUONNUMLA-UHFFFAOYSA-N 0.000 description 1
- KVJUUXJHMGOENX-UHFFFAOYSA-N methyl 2-[(4-fluorophenyl)methoxy]-5-(morpholine-4-carbonyl)benzoate Chemical compound COC(=O)C1=CC(C(=O)N2CCOCC2)=CC=C1OCC1=CC=C(F)C=C1 KVJUUXJHMGOENX-UHFFFAOYSA-N 0.000 description 1
- PNTPCBDWWGRHFC-IHWYPQMZSA-N methyl 2-[(4-fluorophenyl)methoxy]-5-[(z)-3-oxoprop-1-enyl]benzoate Chemical compound COC(=O)C1=CC(\C=C/C=O)=CC=C1OCC1=CC=C(F)C=C1 PNTPCBDWWGRHFC-IHWYPQMZSA-N 0.000 description 1
- IXXKSINLALAEOO-UHFFFAOYSA-N methyl 2-[(4-fluorophenyl)methoxy]-5-[1-(2-morpholin-4-ylethyl)pyrazol-4-yl]benzoate Chemical compound COC(=O)C1=CC(C2=CN(CCN3CCOCC3)N=C2)=CC=C1OCC1=CC=C(F)C=C1 IXXKSINLALAEOO-UHFFFAOYSA-N 0.000 description 1
- RJESJXFFVYTQRR-UHFFFAOYSA-N methyl 2-[3-[(5-chloro-2-phenylmethoxybenzoyl)amino]phenyl]acetate Chemical compound COC(=O)CC1=CC=CC(NC(=O)C=2C(=CC=C(Cl)C=2)OCC=2C=CC=CC=2)=C1 RJESJXFFVYTQRR-UHFFFAOYSA-N 0.000 description 1
- NRSWJTRJHPRZMH-UHFFFAOYSA-N methyl 2-hydroxy-5-iodobenzoate Chemical compound COC(=O)C1=CC(I)=CC=C1O NRSWJTRJHPRZMH-UHFFFAOYSA-N 0.000 description 1
- WCYUZDWAKAUHBY-UHFFFAOYSA-N methyl 2-phenylmethoxy-5-(piperidine-1-carbonyl)benzoate Chemical compound COC(=O)C1=CC(C(=O)N2CCCCC2)=CC=C1OCC1=CC=CC=C1 WCYUZDWAKAUHBY-UHFFFAOYSA-N 0.000 description 1
- NBZAEOOGFRZUQO-UHFFFAOYSA-N methyl 2-phenylmethoxy-5-piperidin-1-ylsulfonylbenzoate Chemical compound COC(=O)C1=CC(S(=O)(=O)N2CCCCC2)=CC=C1OCC1=CC=CC=C1 NBZAEOOGFRZUQO-UHFFFAOYSA-N 0.000 description 1
- JEMVEVUWSJXZMX-UHFFFAOYSA-N methyl 4-bromo-2-hydroxybenzoate Chemical compound COC(=O)C1=CC=C(Br)C=C1O JEMVEVUWSJXZMX-UHFFFAOYSA-N 0.000 description 1
- VDYDDLNRDCJPLM-UHFFFAOYSA-N methyl 5-(morpholine-4-carbonyl)-2-phenylmethoxybenzoate Chemical compound COC(=O)C1=CC(C(=O)N2CCOCC2)=CC=C1OCC1=CC=CC=C1 VDYDDLNRDCJPLM-UHFFFAOYSA-N 0.000 description 1
- FJYDBKPPGRZSOZ-UHFFFAOYSA-N methyl 5-bromo-2-hydroxybenzoate Chemical compound COC(=O)C1=CC(Br)=CC=C1O FJYDBKPPGRZSOZ-UHFFFAOYSA-N 0.000 description 1
- SOLIFHUPLZAUPP-UHFFFAOYSA-N methyl 5-morpholin-4-ylsulfonyl-2-phenylmethoxybenzoate Chemical compound COC(=O)C1=CC(S(=O)(=O)N2CCOCC2)=CC=C1OCC1=CC=CC=C1 SOLIFHUPLZAUPP-UHFFFAOYSA-N 0.000 description 1
- 229960001047 methyl salicylate Drugs 0.000 description 1
- 229960000907 methylthioninium chloride Drugs 0.000 description 1
- 230000000813 microbial effect Effects 0.000 description 1
- 210000004688 microtubule Anatomy 0.000 description 1
- 238000003801 milling Methods 0.000 description 1
- 230000002438 mitochondrial effect Effects 0.000 description 1
- 108010071525 moesin Proteins 0.000 description 1
- 239000003149 muscarinic antagonist Substances 0.000 description 1
- LNOPIUAQISRISI-UHFFFAOYSA-N n'-hydroxy-2-propan-2-ylsulfonylethanimidamide Chemical compound CC(C)S(=O)(=O)CC(N)=NO LNOPIUAQISRISI-UHFFFAOYSA-N 0.000 description 1
- XBECFEJUQZXMFE-UHFFFAOYSA-N n-(4-aminobutyl)acetamide;hydrochloride Chemical compound Cl.CC(=O)NCCCCN XBECFEJUQZXMFE-UHFFFAOYSA-N 0.000 description 1
- JAHRCIPAHYJENF-UHFFFAOYSA-N n-(5-methyl-1,2-oxazol-4-yl)-2-phenylmethoxy-5-pyridin-4-ylbenzamide Chemical compound O1N=CC(NC(=O)C=2C(=CC=C(C=2)C=2C=CN=CC=2)OCC=2C=CC=CC=2)=C1C JAHRCIPAHYJENF-UHFFFAOYSA-N 0.000 description 1
- ZIBBLYYUCCKCOZ-UHFFFAOYSA-N n-[2-(hydroxymethyl)pyridin-3-yl]-2-phenylmethoxy-5-pyridin-4-ylbenzamide Chemical compound OCC1=NC=CC=C1NC(=O)C1=CC(C=2C=CN=CC=2)=CC=C1OCC1=CC=CC=C1 ZIBBLYYUCCKCOZ-UHFFFAOYSA-N 0.000 description 1
- LEOPCBOUDQQSME-UHFFFAOYSA-N n-[4-(hydroxymethyl)pyridin-3-yl]-2-phenylmethoxy-5-pyridin-4-ylbenzamide Chemical compound OCC1=CC=NC=C1NC(=O)C1=CC(C=2C=CN=CC=2)=CC=C1OCC1=CC=CC=C1 LEOPCBOUDQQSME-UHFFFAOYSA-N 0.000 description 1
- WOOWBQQQJXZGIE-UHFFFAOYSA-N n-ethyl-n-propan-2-ylpropan-2-amine Chemical compound CCN(C(C)C)C(C)C.CCN(C(C)C)C(C)C WOOWBQQQJXZGIE-UHFFFAOYSA-N 0.000 description 1
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 239000002105 nanoparticle Substances 0.000 description 1
- PSZYNBSKGUBXEH-UHFFFAOYSA-M naphthalene-1-sulfonate Chemical compound C1=CC=C2C(S(=O)(=O)[O-])=CC=CC2=C1 PSZYNBSKGUBXEH-UHFFFAOYSA-M 0.000 description 1
- KVBGVZZKJNLNJU-UHFFFAOYSA-M naphthalene-2-sulfonate Chemical compound C1=CC=CC2=CC(S(=O)(=O)[O-])=CC=C21 KVBGVZZKJNLNJU-UHFFFAOYSA-M 0.000 description 1
- 238000002610 neuroimaging Methods 0.000 description 1
- 239000012299 nitrogen atmosphere Substances 0.000 description 1
- PULGYDLMFSFVBL-SMFNREODSA-N nociceptin Chemical compound C([C@@H](C(=O)N[C@H](C(=O)NCC(=O)N[C@@H](C)C(=O)N[C@@H](CCCNC(N)=N)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](CO)C(=O)N[C@@H](C)C(=O)N[C@@H](CCCNC(N)=N)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](C)C(=O)N[C@@H](CC(N)=O)C(=O)N[C@@H](CCC(N)=O)C(O)=O)[C@@H](C)O)NC(=O)CNC(=O)CNC(=O)[C@@H](N)CC=1C=CC=CC=1)C1=CC=CC=C1 PULGYDLMFSFVBL-SMFNREODSA-N 0.000 description 1
- 230000003287 optical effect Effects 0.000 description 1
- 230000002018 overexpression Effects 0.000 description 1
- 125000001715 oxadiazolyl group Chemical group 0.000 description 1
- 125000000160 oxazolidinyl group Chemical group 0.000 description 1
- 125000002971 oxazolyl group Chemical group 0.000 description 1
- 229940094443 oxytocics prostaglandins Drugs 0.000 description 1
- 125000001037 p-tolyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)C([H])([H])[H] 0.000 description 1
- 229910052763 palladium Inorganic materials 0.000 description 1
- PIBWKRNGBLPSSY-UHFFFAOYSA-L palladium(II) chloride Chemical compound Cl[Pd]Cl PIBWKRNGBLPSSY-UHFFFAOYSA-L 0.000 description 1
- 229920002866 paraformaldehyde Polymers 0.000 description 1
- 238000007911 parenteral administration Methods 0.000 description 1
- 230000036961 partial effect Effects 0.000 description 1
- 239000002245 particle Substances 0.000 description 1
- 230000007170 pathology Effects 0.000 description 1
- WLJVXDMOQOGPHL-UHFFFAOYSA-N phenylacetic acid Chemical class OC(=O)CC1=CC=CC=C1 WLJVXDMOQOGPHL-UHFFFAOYSA-N 0.000 description 1
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 1
- 239000010452 phosphate Substances 0.000 description 1
- YSWVIKAWHDUJFE-UHFFFAOYSA-N piperidin-1-yl(pyridin-2-yl)methanone Chemical class C=1C=CC=NC=1C(=O)N1CCCCC1 YSWVIKAWHDUJFE-UHFFFAOYSA-N 0.000 description 1
- 229960003089 pramipexole Drugs 0.000 description 1
- 238000012746 preparative thin layer chromatography Methods 0.000 description 1
- 150000003141 primary amines Chemical class 0.000 description 1
- 108090000765 processed proteins & peptides Proteins 0.000 description 1
- 150000003180 prostaglandins Chemical class 0.000 description 1
- 108090000623 proteins and genes Proteins 0.000 description 1
- 102000004169 proteins and genes Human genes 0.000 description 1
- 125000003373 pyrazinyl group Chemical group 0.000 description 1
- 125000003072 pyrazolidinyl group Chemical group 0.000 description 1
- LETVJWLLIMJADE-UHFFFAOYSA-N pyridazin-3-amine Chemical compound NC1=CC=CN=N1 LETVJWLLIMJADE-UHFFFAOYSA-N 0.000 description 1
- 125000002098 pyridazinyl group Chemical group 0.000 description 1
- QLULGIRFKAWHOJ-UHFFFAOYSA-N pyridin-4-ylboronic acid Chemical compound OB(O)C1=CC=NC=C1 QLULGIRFKAWHOJ-UHFFFAOYSA-N 0.000 description 1
- 150000003222 pyridines Chemical class 0.000 description 1
- FVLAYJRLBLHIPV-UHFFFAOYSA-N pyrimidin-5-amine Chemical compound NC1=CN=CN=C1 FVLAYJRLBLHIPV-UHFFFAOYSA-N 0.000 description 1
- 125000000714 pyrimidinyl group Chemical group 0.000 description 1
- 125000000168 pyrrolyl group Chemical group 0.000 description 1
- 102000005962 receptors Human genes 0.000 description 1
- 108020003175 receptors Proteins 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 230000001105 regulatory effect Effects 0.000 description 1
- 238000011160 research Methods 0.000 description 1
- 229960004136 rivastigmine Drugs 0.000 description 1
- 102220183540 rs146839931 Human genes 0.000 description 1
- 150000003873 salicylate salts Chemical class 0.000 description 1
- 239000012047 saturated solution Substances 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 150000003384 small molecules Chemical class 0.000 description 1
- UKLNMMHNWFDKNT-UHFFFAOYSA-M sodium chlorite Chemical compound [Na+].[O-]Cl=O UKLNMMHNWFDKNT-UHFFFAOYSA-M 0.000 description 1
- 229960002218 sodium chlorite Drugs 0.000 description 1
- 235000010265 sodium sulphite Nutrition 0.000 description 1
- AKHNMLFCWUSKQB-UHFFFAOYSA-L sodium thiosulfate Chemical class [Na+].[Na+].[O-]S([O-])(=O)=S AKHNMLFCWUSKQB-UHFFFAOYSA-L 0.000 description 1
- 239000012265 solid product Substances 0.000 description 1
- 239000012453 solvate Substances 0.000 description 1
- 238000010561 standard procedure Methods 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 230000000707 stereoselective effect Effects 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 238000006467 substitution reaction Methods 0.000 description 1
- KDYFGRWQOYBRFD-UHFFFAOYSA-L succinate(2-) Chemical compound [O-]C(=O)CCC([O-])=O KDYFGRWQOYBRFD-UHFFFAOYSA-L 0.000 description 1
- 125000000472 sulfonyl group Chemical group *S(*)(=O)=O 0.000 description 1
- 229910021653 sulphate ion Inorganic materials 0.000 description 1
- 230000016978 synaptic transmission, cholinergic Effects 0.000 description 1
- 239000006188 syrup Substances 0.000 description 1
- 235000020357 syrup Nutrition 0.000 description 1
- 229960001685 tacrine Drugs 0.000 description 1
- YLJREFDVOIBQDA-UHFFFAOYSA-N tacrine Chemical compound C1=CC=C2C(N)=C(CCCC3)C3=NC2=C1 YLJREFDVOIBQDA-UHFFFAOYSA-N 0.000 description 1
- 229940095064 tartrate Drugs 0.000 description 1
- 150000003512 tertiary amines Chemical class 0.000 description 1
- 238000012360 testing method Methods 0.000 description 1
- WHRNULOCNSKMGB-UHFFFAOYSA-N tetrahydrofuran thf Chemical compound C1CCOC1.C1CCOC1 WHRNULOCNSKMGB-UHFFFAOYSA-N 0.000 description 1
- 125000004853 tetrahydropyridinyl group Chemical group N1(CCCC=C1)* 0.000 description 1
- 125000003831 tetrazolyl group Chemical group 0.000 description 1
- 125000001113 thiadiazolyl group Chemical group 0.000 description 1
- 125000001984 thiazolidinyl group Chemical group 0.000 description 1
- 125000000335 thiazolyl group Chemical group 0.000 description 1
- 125000004568 thiomorpholinyl group Chemical group 0.000 description 1
- 210000001519 tissue Anatomy 0.000 description 1
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 1
- 238000011830 transgenic mouse model Methods 0.000 description 1
- 230000007704 transition Effects 0.000 description 1
- 125000004306 triazinyl group Chemical group 0.000 description 1
- 125000001425 triazolyl group Chemical group 0.000 description 1
- 125000004205 trifluoroethyl group Chemical group [H]C([H])(*)C(F)(F)F 0.000 description 1
- WRTSXKKAXLYBSH-UHFFFAOYSA-N trifluoromethyl benzoate Chemical compound FC(F)(F)OC(=O)C1=CC=CC=C1 WRTSXKKAXLYBSH-UHFFFAOYSA-N 0.000 description 1
- 125000003258 trimethylene group Chemical group [H]C([H])([*:2])C([H])([H])C([H])([H])[*:1] 0.000 description 1
- OUYCCCASQSFEME-UHFFFAOYSA-N tyrosine Natural products OC(=O)C(N)CC1=CC=C(O)C=C1 OUYCCCASQSFEME-UHFFFAOYSA-N 0.000 description 1
- 239000003643 water by type Substances 0.000 description 1
- 238000001238 wet grinding Methods 0.000 description 1
- 239000000080 wetting agent Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/60—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D213/72—Nitrogen atoms
- C07D213/75—Amino or imino radicals, acylated by carboxylic or carbonic acids, or by sulfur or nitrogen analogues thereof, e.g. carbamates
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C235/00—Carboxylic acid amides, the carbon skeleton of the acid part being further substituted by oxygen atoms
- C07C235/42—Carboxylic acid amides, the carbon skeleton of the acid part being further substituted by oxygen atoms having carbon atoms of carboxamide groups bound to carbon atoms of six-membered aromatic rings and singly-bound oxygen atoms bound to the same carbon skeleton
- C07C235/44—Carboxylic acid amides, the carbon skeleton of the acid part being further substituted by oxygen atoms having carbon atoms of carboxamide groups bound to carbon atoms of six-membered aromatic rings and singly-bound oxygen atoms bound to the same carbon skeleton with carbon atoms of carboxamide groups and singly-bound oxygen atoms bound to carbon atoms of the same non-condensed six-membered aromatic ring
- C07C235/58—Carboxylic acid amides, the carbon skeleton of the acid part being further substituted by oxygen atoms having carbon atoms of carboxamide groups bound to carbon atoms of six-membered aromatic rings and singly-bound oxygen atoms bound to the same carbon skeleton with carbon atoms of carboxamide groups and singly-bound oxygen atoms bound to carbon atoms of the same non-condensed six-membered aromatic ring with carbon atoms of carboxamide groups and singly-bound oxygen atoms, bound in ortho-position to carbon atoms of the same non-condensed six-membered aromatic ring
- C07C235/64—Carboxylic acid amides, the carbon skeleton of the acid part being further substituted by oxygen atoms having carbon atoms of carboxamide groups bound to carbon atoms of six-membered aromatic rings and singly-bound oxygen atoms bound to the same carbon skeleton with carbon atoms of carboxamide groups and singly-bound oxygen atoms bound to carbon atoms of the same non-condensed six-membered aromatic ring with carbon atoms of carboxamide groups and singly-bound oxygen atoms, bound in ortho-position to carbon atoms of the same non-condensed six-membered aromatic ring having the nitrogen atom of at least one of the carboxamide groups bound to a carbon atom of a six-membered aromatic ring
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P25/00—Drugs for disorders of the nervous system
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P25/00—Drugs for disorders of the nervous system
- A61P25/14—Drugs for disorders of the nervous system for treating abnormal movements, e.g. chorea, dyskinesia
- A61P25/16—Anti-Parkinson drugs
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P25/00—Drugs for disorders of the nervous system
- A61P25/28—Drugs for disorders of the nervous system for treating neurodegenerative disorders of the central nervous system, e.g. nootropic agents, cognition enhancers, drugs for treating Alzheimer's disease or other forms of dementia
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P43/00—Drugs for specific purposes, not provided for in groups A61P1/00-A61P41/00
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D231/00—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings
- C07D231/02—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings
- C07D231/10—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D231/14—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D231/38—Nitrogen atoms
- C07D231/40—Acylated on said nitrogen atom
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D237/00—Heterocyclic compounds containing 1,2-diazine or hydrogenated 1,2-diazine rings
- C07D237/02—Heterocyclic compounds containing 1,2-diazine or hydrogenated 1,2-diazine rings not condensed with other rings
- C07D237/06—Heterocyclic compounds containing 1,2-diazine or hydrogenated 1,2-diazine rings not condensed with other rings having three double bonds between ring members or between ring members and non-ring members
- C07D237/10—Heterocyclic compounds containing 1,2-diazine or hydrogenated 1,2-diazine rings not condensed with other rings having three double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D237/20—Nitrogen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D261/00—Heterocyclic compounds containing 1,2-oxazole or hydrogenated 1,2-oxazole rings
- C07D261/02—Heterocyclic compounds containing 1,2-oxazole or hydrogenated 1,2-oxazole rings not condensed with other rings
- C07D261/06—Heterocyclic compounds containing 1,2-oxazole or hydrogenated 1,2-oxazole rings not condensed with other rings having two or more double bonds between ring members or between ring members and non-ring members
- C07D261/10—Heterocyclic compounds containing 1,2-oxazole or hydrogenated 1,2-oxazole rings not condensed with other rings having two or more double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D261/14—Nitrogen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D263/00—Heterocyclic compounds containing 1,3-oxazole or hydrogenated 1,3-oxazole rings
- C07D263/02—Heterocyclic compounds containing 1,3-oxazole or hydrogenated 1,3-oxazole rings not condensed with other rings
- C07D263/30—Heterocyclic compounds containing 1,3-oxazole or hydrogenated 1,3-oxazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D263/34—Heterocyclic compounds containing 1,3-oxazole or hydrogenated 1,3-oxazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D263/48—Nitrogen atoms not forming part of a nitro radical
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D401/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom
- C07D401/02—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings
- C07D401/12—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings linked by a chain containing hetero atoms as chain links
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D403/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, not provided for by group C07D401/00
- C07D403/02—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, not provided for by group C07D401/00 containing two hetero rings
- C07D403/12—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, not provided for by group C07D401/00 containing two hetero rings linked by a chain containing hetero atoms as chain links
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D413/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and oxygen atoms as the only ring hetero atoms
- C07D413/02—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and oxygen atoms as the only ring hetero atoms containing two hetero rings
- C07D413/12—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and oxygen atoms as the only ring hetero atoms containing two hetero rings linked by a chain containing hetero atoms as chain links
Landscapes
- Organic Chemistry (AREA)
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Bioinformatics & Cheminformatics (AREA)
- Engineering & Computer Science (AREA)
- Neurosurgery (AREA)
- Neurology (AREA)
- Biomedical Technology (AREA)
- General Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Life Sciences & Earth Sciences (AREA)
- Animal Behavior & Ethology (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Public Health (AREA)
- Veterinary Medicine (AREA)
- Medicinal Chemistry (AREA)
- General Chemical & Material Sciences (AREA)
- Pharmacology & Pharmacy (AREA)
- Psychology (AREA)
- Hospice & Palliative Care (AREA)
- Psychiatry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Pyridine Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
- Heterocyclic Carbon Compounds Containing A Hetero Ring Having Nitrogen And Oxygen As The Only Ring Hetero Atoms (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (5)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US24655009P | 2009-09-29 | 2009-09-29 | |
| US246550P | 2009-09-29 | ||
| CN2010001334 | 2010-09-02 | ||
| WOPCT/CN2010/001334 | 2010-09-02 | ||
| PCT/CN2010/001501 WO2011038572A1 (en) | 2009-09-29 | 2010-09-27 | Novel compounds |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| ES2512727T3 true ES2512727T3 (es) | 2014-10-24 |
Family
ID=43825509
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| ES10819801.1T Active ES2512727T3 (es) | 2009-09-29 | 2010-09-27 | Nuevos compuestos |
Country Status (15)
| Country | Link |
|---|---|
| US (1) | US8778939B2 (enExample) |
| EP (1) | EP2483254B1 (enExample) |
| JP (1) | JP5752691B2 (enExample) |
| KR (1) | KR20120081609A (enExample) |
| AU (1) | AU2010302842B2 (enExample) |
| BR (1) | BR112012006859A2 (enExample) |
| CA (1) | CA2775753A1 (enExample) |
| EA (1) | EA021437B1 (enExample) |
| ES (1) | ES2512727T3 (enExample) |
| IL (1) | IL218674A (enExample) |
| IN (1) | IN2012DN02763A (enExample) |
| MX (1) | MX2012003778A (enExample) |
| SG (1) | SG179120A1 (enExample) |
| WO (1) | WO2011038572A1 (enExample) |
| ZA (1) | ZA201201877B (enExample) |
Families Citing this family (38)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| MX2012014158A (es) | 2010-06-04 | 2013-02-07 | Hoffmann La Roche | Derivados de aminopirimidina como moduladores de proteina cinasa rica repeticiones leucina 2 (lrrk2). |
| JP5781611B2 (ja) * | 2010-09-02 | 2015-09-24 | グラクソスミスクライン、インテレクチュアル、プロパティー、ディベロップメント、リミテッドGlaxosmithkline Intellectual Property Development Limited | Lrrk2キナーゼ阻害剤としての2−(ベンジルオキシ)ベンズアミド類 |
| PH12013500880A1 (en) | 2010-11-10 | 2013-07-01 | Hoffmann La Roche | Pyrazole aminopyrimidine derivatives as lrrk2 modulators |
| JP5985611B2 (ja) * | 2011-05-03 | 2016-09-06 | シンタ ファーマシューティカルズ コーポレーション | 炎症および免疫関連用途のための化合物 |
| RU2637936C2 (ru) | 2011-05-23 | 2017-12-08 | Элан Фармасьютикалз, Инк. | Ингибиторы активности киназы lrrk2 |
| ES2583477T3 (es) | 2011-09-30 | 2016-09-21 | Ipsen Pharma S.A.S. | Inhibidores macrocíclicos de cinasa de LRRK2 |
| DK2785711T3 (en) | 2011-11-29 | 2016-09-05 | Hoffmann La Roche | 2- (phenyl or pyrid-3-yl) aminopyrimidine derivatives AS KINASE LRRK2 modulators for the treatment of Parkinson's disease |
| KR102002198B1 (ko) * | 2011-11-29 | 2019-07-19 | 제넨테크, 인크. | Lrrk2 조절제로서의 아미노피리미딘 유도체 |
| CN106349234A (zh) | 2011-11-29 | 2017-01-25 | 霍夫曼-拉罗奇有限公司 | 作为lrrk2调节剂的氨基嘧啶衍生物 |
| AR089182A1 (es) | 2011-11-29 | 2014-08-06 | Hoffmann La Roche | Derivados de aminopirimidina como moduladores de lrrk2 |
| BR112014012822A8 (pt) * | 2011-11-30 | 2017-07-11 | Hoffmann La Roche | Radioligantes rotulados com flúor-18 e carbono-11 para imagiologia por tomografia por emissão de pósitrons (pet) para lrrk2 |
| MD20140130A2 (ro) | 2012-06-29 | 2015-04-30 | Pfizer Inc. | 4-(amino-substituite)-7H-pirolo[2,3-d]pirimidine noi ca inhibitori de LRRK2 |
| HUE042911T2 (hu) * | 2013-12-09 | 2019-07-29 | Unichem Lab Ltd | Javított eljárás a (3R,4R)-(1-benzil-4-metil-piperidin-3-il)-metilamin elõállítására |
| WO2015092592A1 (en) | 2013-12-17 | 2015-06-25 | Pfizer Inc. | Novel 3,4-disubstituted-1h-pyrrolo[2,3-b]pyridines and 4,5-disubstituted-7h-pyrrolo[2,3-c]pyridazines as lrrk2 inhibitors |
| PE20161443A1 (es) * | 2014-01-29 | 2017-01-06 | Glaxosmithkline Ip Dev Ltd | Compuestos |
| US9815841B2 (en) | 2014-01-29 | 2017-11-14 | Glaxosmithkline Intellectual Property Development Limited | Compounds |
| EP3398937A1 (en) * | 2014-03-31 | 2018-11-07 | The Trustees Of Columbia University In The City Of New York | Histone acetyltransferase activators and uses thereof |
| US10058559B2 (en) | 2014-05-15 | 2018-08-28 | The United States Of America, As Represented By The Secretary, Department Of Health & Human Services | Treatment or prevention of an intestinal disease or disorder |
| DK3174858T3 (da) | 2014-07-31 | 2019-07-15 | Basf Se | Fremgangsmåde til fremstilling af pyrazoler |
| CN105348182B (zh) * | 2014-08-24 | 2018-04-13 | 复旦大学 | 2‑烷氧基苯甲酰芳胺类化合物及其药物用途 |
| SG11201701936WA (en) | 2014-09-17 | 2017-04-27 | Oncodesign Sa | Macrocyclic lrrk2 kinase inhibitors |
| EP3623371A1 (en) | 2014-12-16 | 2020-03-18 | Axovant Sciences GmbH | Geminal substituted quinuclidine amide compounds as agonists of alpha-7 nicotinic acetylcholine receptors |
| MX390421B (es) | 2015-05-11 | 2025-03-20 | Basf Se | Proceso para preparar 4-amino-piridazinas. |
| BR122019027518B8 (pt) * | 2015-05-11 | 2021-04-13 | Basf Se | processos para a preparação de um composto, composto de amina de dicloropiridazina e mistura do composto de amina de dicloropiridazina |
| CA2988968A1 (en) | 2015-06-10 | 2016-12-15 | Forum Pharmaceuticals, Inc. | Aminobenzisoxazole compounds as agonists of a7-nicotinic acetylcholine receptors |
| JP2018523707A (ja) | 2015-08-12 | 2018-08-23 | アクソバント サイエンシズ ゲーエムベーハー | α7−ニコチン性アセチルコリン受容体のアゴニストとしてのジェミナル置換アミノベンゾイソオキサゾール化合物 |
| RU2722149C1 (ru) | 2015-09-14 | 2020-05-27 | Пфайзер Инк. | Новые производные имидазо[4,5-c] хинолинов и имидазо[4,5-c][1,5] нафтиридинов в качестве ингибиторов LRRK2 |
| EP3484877B1 (de) | 2016-07-12 | 2020-07-01 | Bayer CropScience Aktiengesellschaft | Bicyclische verbindungen als schädlingsbekämpfungsmittel |
| WO2018082964A1 (en) | 2016-11-04 | 2018-05-11 | Basf Se | Process for the production of pyridazinyl-amides in a one-pot synthesis |
| JP2020505398A (ja) * | 2017-01-25 | 2020-02-20 | グラクソスミスクライン、インテレクチュアル、プロパティー、ディベロップメント、リミテッドGlaxosmithkline Intellectual Property Development Limited | 化合物 |
| WO2018155947A1 (ko) | 2017-02-24 | 2018-08-30 | 재단법인 대구경북첨단의료산업진흥재단 | 혈액 뇌관문을 통과할 수 있는 화합물을 유효성분으로 함유하는 뇌암의 예방 또는 치료용 약학적 조성물 |
| KR101990739B1 (ko) | 2018-07-24 | 2019-06-19 | 재단법인 대구경북첨단의료산업진흥재단 | 혈액 뇌관문을 통과할 수 있는 화합물을 유효성분으로 함유하는 뇌암의 예방 또는 치료용 약학적 조성물 |
| KR101990738B1 (ko) | 2018-07-24 | 2019-06-19 | 재단법인 대구경북첨단의료산업진흥재단 | 혈액 뇌관문을 통과할 수 있는 화합물을 유효성분으로 함유하는 뇌암의 예방 또는 치료용 약학적 조성물 |
| KR101992059B1 (ko) | 2018-08-23 | 2019-06-21 | 재단법인 대구경북첨단의료산업진흥재단 | 혈액 뇌관문을 통과할 수 있는 화합물을 유효성분으로 함유하는 뇌암의 예방 또는 치료용 약학적 조성물 |
| CN114555595B (zh) | 2019-08-30 | 2023-12-26 | Tsd生命科学有限公司 | 咪唑并吡啶衍生物及将其作为有效成分的药学组合物 |
| WO2023076404A1 (en) | 2021-10-27 | 2023-05-04 | Aria Pharmaceuticals, Inc. | Methods for treating systemic lupus erythematosus |
| JP2025034990A (ja) * | 2023-08-31 | 2025-03-13 | 東京応化工業株式会社 | レジスト組成物、レジストパターン形成方法、化合物、及び酸拡散制御剤 |
| CN119432181B (zh) * | 2024-11-28 | 2025-07-15 | 佛山市德堡建材有限公司 | 一种环保型聚合物水泥防水涂料及其制备方法 |
Family Cites Families (26)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US5449691A (en) * | 1991-12-31 | 1995-09-12 | Sterling Winthrop Inc. | 3,4-disubstituted anilines-immunomodulating agents |
| CN1200725A (zh) * | 1995-08-30 | 1998-12-02 | 拜尔公司 | 酰基氨基水杨酰胺类化合物 |
| JP2002518985A (ja) | 1997-05-07 | 2002-06-25 | ユニバーシティー・オブ・ピッツバーグ | タンパク質イソプレニルトランスフェラーゼの阻害剤 |
| AU8270898A (en) | 1997-06-26 | 1999-01-19 | Eli Lilly And Company | Antithrombotic agents |
| EP1072263A4 (en) | 1998-03-26 | 2004-03-31 | Japan Tobacco Inc | AMID DERIVATIVES AND NOCICEPTINANT AGONISTS |
| JP2003528097A (ja) | 2000-03-17 | 2003-09-24 | ブリストル−マイヤーズ スクイブ ファーマ カンパニー | マトリックスメタロプロテアーゼおよびTNF−α阻害剤としてのβ−アミノ酸誘導体 |
| GB0023983D0 (en) | 2000-09-29 | 2000-11-15 | Prolifix Ltd | Therapeutic compounds |
| DE10159453A1 (de) | 2001-12-04 | 2003-06-18 | Merck Patent Gmbh | Verwendung von 1-Phenyl-oxazolidin-2-on-Verbindungen als Protease |
| EP1497260A1 (en) | 2002-04-09 | 2005-01-19 | 7TM Pharma A/S | Novel methoxybenzamide compounds for use in mch receptor related disorders |
| WO2003087044A2 (en) | 2002-04-09 | 2003-10-23 | 7Tm Pharma A/S | Novel carboxamide compounds for use in mch receptor related disorders |
| EA200501713A1 (ru) | 2003-04-30 | 2006-06-30 | ДЗЕ ИНСТИТЬЮТС ФОР ФАРМАСЬЮТИКАЛ ДИСКАВЕРИ, ЭлЭлСи | Фенилзамещённые карбоновые кислоты |
| WO2004099127A1 (en) | 2003-05-07 | 2004-11-18 | Novo Nordisk A/S | Novel compounds as kinase inhibitors |
| WO2005000309A2 (en) | 2003-06-27 | 2005-01-06 | Ionix Pharmaceuticals Limited | Chemical compounds |
| US7550485B2 (en) | 2003-10-14 | 2009-06-23 | Wyeth | Substituted N-heterocycle derivatives and methods of their use |
| CA2553084A1 (en) * | 2004-01-28 | 2005-08-11 | Kissei Pharmaceutical Co., Ltd. | Novel benzofuran derivative, medicinal composition containing the same, and uses of these |
| WO2006003923A1 (ja) | 2004-06-30 | 2006-01-12 | Sankyo Company, Limited | 置換ベンゼン化合物 |
| US7671077B2 (en) | 2004-07-19 | 2010-03-02 | Leu-Fen Hou Lin | Neuroprotective small organic molecules, compositions and uses related thereto |
| US20060276496A1 (en) * | 2005-03-17 | 2006-12-07 | Boehringer Ingelheim Pharmaceuticals, Inc. | Anti-Cytokine Heterocyclic Compounds |
| AU2006287521A1 (en) | 2005-09-07 | 2007-03-15 | Plexxikon, Inc. | PPARactive compounds |
| JP2007176799A (ja) | 2005-12-27 | 2007-07-12 | Sankyo Co Ltd | 置換ベンゼン化合物を含有する医薬 |
| MX2008011136A (es) | 2006-03-07 | 2008-09-08 | Squibb Bristol Myers Co | Compuestos de profamarco de pirrolotriazina anilina utiles como inhibidores de cinasa. |
| CA2649577A1 (en) | 2006-04-28 | 2007-11-08 | Transtech Pharma, Inc. | Benzamide glucokinase activators |
| CA2672631A1 (en) * | 2006-12-15 | 2008-06-19 | Glaxo Group Limited | Benzamide derivatives as ep4 receptor agonists |
| WO2009030270A1 (en) * | 2007-09-03 | 2009-03-12 | Novartis Ag | Dihydroindole derivatives useful in parkinson's disease |
| GB0722680D0 (en) | 2007-11-19 | 2007-12-27 | Topotarget As | Therapeutic compounds and their use |
| US20110230536A1 (en) | 2008-10-24 | 2011-09-22 | Calcimedica, Inc. | Phenylpyrazole inhibitors of store operated calcium release |
-
2010
- 2010-09-27 BR BR112012006859A patent/BR112012006859A2/pt not_active IP Right Cessation
- 2010-09-27 KR KR1020127010852A patent/KR20120081609A/ko not_active Abandoned
- 2010-09-27 EP EP10819801.1A patent/EP2483254B1/en active Active
- 2010-09-27 IN IN2763DEN2012 patent/IN2012DN02763A/en unknown
- 2010-09-27 SG SG2012017760A patent/SG179120A1/en unknown
- 2010-09-27 EA EA201270480A patent/EA021437B1/ru not_active IP Right Cessation
- 2010-09-27 CA CA2775753A patent/CA2775753A1/en not_active Abandoned
- 2010-09-27 AU AU2010302842A patent/AU2010302842B2/en not_active Ceased
- 2010-09-27 MX MX2012003778A patent/MX2012003778A/es active IP Right Grant
- 2010-09-27 ES ES10819801.1T patent/ES2512727T3/es active Active
- 2010-09-27 US US13/498,975 patent/US8778939B2/en not_active Expired - Fee Related
- 2010-09-27 WO PCT/CN2010/001501 patent/WO2011038572A1/en not_active Ceased
- 2010-09-27 JP JP2012531212A patent/JP5752691B2/ja not_active Expired - Fee Related
-
2012
- 2012-03-14 ZA ZA2012/01877A patent/ZA201201877B/en unknown
- 2012-03-15 IL IL218674A patent/IL218674A/en not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| KR20120081609A (ko) | 2012-07-19 |
| AU2010302842A1 (en) | 2012-04-12 |
| EP2483254A4 (en) | 2013-02-27 |
| IN2012DN02763A (enExample) | 2015-09-18 |
| MX2012003778A (es) | 2012-06-01 |
| WO2011038572A1 (en) | 2011-04-07 |
| EP2483254A1 (en) | 2012-08-08 |
| IL218674A (en) | 2015-11-30 |
| CA2775753A1 (en) | 2011-04-07 |
| JP2013505969A (ja) | 2013-02-21 |
| IL218674A0 (en) | 2012-05-31 |
| EA021437B1 (ru) | 2015-06-30 |
| EA201270480A1 (ru) | 2013-08-30 |
| AU2010302842B2 (en) | 2014-05-08 |
| BR112012006859A2 (pt) | 2019-09-24 |
| US8778939B2 (en) | 2014-07-15 |
| SG179120A1 (en) | 2012-05-30 |
| ZA201201877B (en) | 2012-11-28 |
| US20120184553A1 (en) | 2012-07-19 |
| JP5752691B2 (ja) | 2015-07-22 |
| EP2483254B1 (en) | 2014-08-13 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| ES2512727T3 (es) | Nuevos compuestos | |
| CA2986521C (en) | Selective sphingosine 1 phosphate receptor modulators and methods of chiral synthesis | |
| JP5085659B2 (ja) | L−cpt1阻害剤として有用なインダゾール誘導体 | |
| US7960377B2 (en) | Substituted pyridoxazines | |
| ES2358795T3 (es) | Derivados de indol o derivados de bencimidazol para modular la ikb quinasa. | |
| US10130633B2 (en) | Compounds | |
| JP5290972B2 (ja) | 2−(ヘテロシクリルベンジル)ピリダジノン誘導体 | |
| EP2611772B1 (en) | 2-(benzyloxy)benzamides as lrrk2 kinase inhibitors | |
| ES2423851T3 (es) | Compuesto de aciltiourea o sal del mismo y uso del mismo | |
| US20130023534A1 (en) | Pyrazolyl-pyrimidines as kinase inhibitors | |
| TW200902010A (en) | Anthranilamide inhibitors of aurora kinase | |
| JPWO2006054652A1 (ja) | アミド化合物 | |
| US20130045948A1 (en) | Azocyclic inhibitors of fatty acid amide hydrolase | |
| JP2021528454A (ja) | 化合物 | |
| CN102596921B (zh) | 新化合物 | |
| JP2009538865A (ja) | 2−フェニル−5−アミノ−1,3,4−オキサジアゾールおよびニコチン性アセチルコチン受容体リガンドとしてのその使用 | |
| US10696690B2 (en) | Imidazo-oxadiazole and imidazo-thiadiazole derivatives | |
| CN104903311A (zh) | 作为lrrk2抑制剂的氨基吡啶衍生的化合物 |