EA016071B1 - Соединения и способы лечения или предотвращения флавивирусных инфекций - Google Patents
Соединения и способы лечения или предотвращения флавивирусных инфекций Download PDFInfo
- Publication number
- EA016071B1 EA016071B1 EA200702493A EA200702493A EA016071B1 EA 016071 B1 EA016071 B1 EA 016071B1 EA 200702493 A EA200702493 A EA 200702493A EA 200702493 A EA200702493 A EA 200702493A EA 016071 B1 EA016071 B1 EA 016071B1
- Authority
- EA
- Eurasian Patent Office
- Prior art keywords
- trans
- amino
- thiophene
- optionally substituted
- methylcyclohexanecarbonyl
- Prior art date
Links
- 150000001875 compounds Chemical class 0.000 title claims abstract description 302
- 238000000034 method Methods 0.000 title claims description 63
- 230000002265 prevention Effects 0.000 title description 4
- 206010054261 Flavivirus infection Diseases 0.000 title description 3
- 150000003839 salts Chemical class 0.000 claims abstract description 48
- 239000012453 solvate Substances 0.000 claims abstract description 36
- -1 -Ν ^ Κ ^^ ΝΚΟ-ΝΚ ^ Chemical group 0.000 claims description 467
- 125000000217 alkyl group Chemical group 0.000 claims description 288
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 203
- QERYCTSHXKAMIS-UHFFFAOYSA-N thiophene-2-carboxylic acid Chemical compound OC(=O)C1=CC=CS1 QERYCTSHXKAMIS-UHFFFAOYSA-N 0.000 claims description 133
- 125000000623 heterocyclic group Chemical group 0.000 claims description 118
- 125000003118 aryl group Chemical group 0.000 claims description 112
- 125000001072 heteroaryl group Chemical group 0.000 claims description 107
- 125000003710 aryl alkyl group Chemical group 0.000 claims description 100
- 125000003342 alkenyl group Chemical group 0.000 claims description 74
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical group N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 claims description 73
- 125000000304 alkynyl group Chemical group 0.000 claims description 71
- 125000004475 heteroaralkyl group Chemical group 0.000 claims description 69
- 125000003545 alkoxy group Chemical group 0.000 claims description 67
- 125000000882 C2-C6 alkenyl group Chemical group 0.000 claims description 65
- 229910052799 carbon Inorganic materials 0.000 claims description 61
- 125000003601 C2-C6 alkynyl group Chemical group 0.000 claims description 60
- 229910052736 halogen Inorganic materials 0.000 claims description 60
- 125000000592 heterocycloalkyl group Chemical group 0.000 claims description 58
- 150000002367 halogens Chemical class 0.000 claims description 51
- 229910052739 hydrogen Inorganic materials 0.000 claims description 51
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 49
- 229910052757 nitrogen Inorganic materials 0.000 claims description 49
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 47
- 125000005133 alkynyloxy group Chemical group 0.000 claims description 46
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 claims description 46
- 125000003320 C2-C6 alkenyloxy group Chemical group 0.000 claims description 43
- 125000000018 nitroso group Chemical group N(=O)* 0.000 claims description 43
- 230000003612 virological effect Effects 0.000 claims description 42
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims description 41
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 38
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 37
- 125000000392 cycloalkenyl group Chemical group 0.000 claims description 34
- 125000000852 azido group Chemical group *N=[N+]=[N-] 0.000 claims description 32
- 239000003795 chemical substances by application Substances 0.000 claims description 32
- 239000003112 inhibitor Substances 0.000 claims description 30
- 125000004043 oxo group Chemical group O=* 0.000 claims description 29
- 125000004104 aryloxy group Chemical group 0.000 claims description 28
- 238000002360 preparation method Methods 0.000 claims description 26
- 125000001424 substituent group Chemical group 0.000 claims description 26
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 23
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 22
- 208000015181 infectious disease Diseases 0.000 claims description 18
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 17
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 claims description 16
- 150000002923 oximes Chemical class 0.000 claims description 16
- 125000004430 oxygen atom Chemical group O* 0.000 claims description 16
- 241000700605 Viruses Species 0.000 claims description 15
- 125000002795 guanidino group Chemical group C(N)(=N)N* 0.000 claims description 15
- 125000000582 cycloheptyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 claims description 14
- 125000004368 propenyl group Chemical group C(=CC)* 0.000 claims description 14
- 229920006395 saturated elastomer Polymers 0.000 claims description 14
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 claims description 14
- 229910052700 potassium Inorganic materials 0.000 claims description 13
- 108060004795 Methyltransferase Proteins 0.000 claims description 12
- 125000000596 cyclohexenyl group Chemical group C1(=CCCCC1)* 0.000 claims description 12
- 125000006652 (C3-C12) cycloalkyl group Chemical group 0.000 claims description 11
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 11
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 claims description 11
- 125000005843 halogen group Chemical group 0.000 claims description 11
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical group [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 10
- 125000001995 cyclobutyl group Chemical group [H]C1([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 claims description 10
- 125000002433 cyclopentenyl group Chemical group C1(=CCCC1)* 0.000 claims description 10
- 230000000694 effects Effects 0.000 claims description 10
- 229910052760 oxygen Inorganic materials 0.000 claims description 10
- 239000001301 oxygen Substances 0.000 claims description 10
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical group [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims description 9
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 claims description 9
- 239000008194 pharmaceutical composition Substances 0.000 claims description 9
- 239000003001 serine protease inhibitor Substances 0.000 claims description 9
- 125000004429 atom Chemical group 0.000 claims description 8
- 239000003814 drug Substances 0.000 claims description 8
- 230000002401 inhibitory effect Effects 0.000 claims description 8
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 8
- 229910052717 sulfur Inorganic materials 0.000 claims description 8
- 125000004169 (C1-C6) alkyl group Chemical group 0.000 claims description 7
- AMOXNTAMLUCWJT-UHFFFAOYSA-N 5-(4,4-dimethylcyclohexyl)-3-[(4-methoxycyclohexyl)-(4-methylcyclohexanecarbonyl)amino]thiophene-2-carboxylic acid Chemical compound C1CC(OC)CCC1N(C1=C(SC(=C1)C1CCC(C)(C)CC1)C(O)=O)C(=O)C1CCC(C)CC1 AMOXNTAMLUCWJT-UHFFFAOYSA-N 0.000 claims description 7
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 claims description 7
- 125000005842 heteroatom Chemical group 0.000 claims description 7
- 230000002519 immonomodulatory effect Effects 0.000 claims description 7
- OSZNFYRPACBWAD-UHFFFAOYSA-N 5-(cyclohexen-1-yl)-3-[(4-ethoxycyclohexyl)-(4-methylcyclohexanecarbonyl)amino]thiophene-2-carboxylic acid Chemical compound C1CC(OCC)CCC1N(C1=C(SC(=C1)C=1CCCCC=1)C(O)=O)C(=O)C1CCC(C)CC1 OSZNFYRPACBWAD-UHFFFAOYSA-N 0.000 claims description 6
- MGIDOELNCIGRPO-UHFFFAOYSA-N 5-(cyclohexen-1-yl)-3-[(4-hydroxycyclohexyl)-(4-methylcyclohexanecarbonyl)amino]thiophene-2-carboxylic acid Chemical compound C1CC(C)CCC1C(=O)N(C1=C(SC(=C1)C=1CCCCC=1)C(O)=O)C1CCC(O)CC1 MGIDOELNCIGRPO-UHFFFAOYSA-N 0.000 claims description 6
- HQUCUQJOQOFEQW-UHFFFAOYSA-N 5-(cyclohexen-1-yl)-3-[(4-methylcyclohexanecarbonyl)-(4-oxocyclohexyl)amino]thiophene-2-carboxylic acid Chemical compound C1CC(C)CCC1C(=O)N(C1=C(SC(=C1)C=1CCCCC=1)C(O)=O)C1CCC(=O)CC1 HQUCUQJOQOFEQW-UHFFFAOYSA-N 0.000 claims description 6
- HCTFEOYQHVJAEV-UAPYVXQJSA-N C1C[C@@H](C)CC[C@@H]1C(=O)N(C1=C(SC(=C1)C=1CCCCC=1)C(O)=O)C1CCN(C)CC1 Chemical compound C1C[C@@H](C)CC[C@@H]1C(=O)N(C1=C(SC(=C1)C=1CCCCC=1)C(O)=O)C1CCN(C)CC1 HCTFEOYQHVJAEV-UAPYVXQJSA-N 0.000 claims description 6
- 108010047761 Interferon-alpha Proteins 0.000 claims description 6
- 102000006992 Interferon-alpha Human genes 0.000 claims description 6
- YTPLMLYBLZKORZ-UHFFFAOYSA-N Thiophene Chemical group C=1C=CSC=1 YTPLMLYBLZKORZ-UHFFFAOYSA-N 0.000 claims description 6
- 230000000692 anti-sense effect Effects 0.000 claims description 6
- 239000003963 antioxidant agent Substances 0.000 claims description 6
- 239000003937 drug carrier Substances 0.000 claims description 6
- 239000011593 sulfur Chemical group 0.000 claims description 6
- JVSQRBKXYYHNAL-UHFFFAOYSA-N 3-[(4-hydroxycyclohexyl)-(4-methylcyclohexanecarbonyl)amino]-5-(4-phenoxycyclohexen-1-yl)thiophene-2-carboxylic acid Chemical compound C1CC(C)CCC1C(=O)N(C1=C(SC(=C1)C=1CCC(CC=1)OC=1C=CC=CC=1)C(O)=O)C1CCC(O)CC1 JVSQRBKXYYHNAL-UHFFFAOYSA-N 0.000 claims description 5
- DHZRKGZVOWHWSR-UHFFFAOYSA-N 5-(1,4-dioxaspiro[4.5]dec-7-en-8-yl)-3-[(4-hydroxycyclohexyl)-(4-methylcyclohexanecarbonyl)amino]thiophene-2-carboxylic acid Chemical compound C1CC(C)CCC1C(=O)N(C1=C(SC(=C1)C=1CCC2(CC=1)OCCO2)C(O)=O)C1CCC(O)CC1 DHZRKGZVOWHWSR-UHFFFAOYSA-N 0.000 claims description 5
- SNHOCYVWFCETLM-UHFFFAOYSA-N 5-(cyclohexen-1-yl)-3-[[4-(methoxymethoxy)cyclohexyl]-(4-methylcyclohexanecarbonyl)amino]thiophene-2-carboxylic acid Chemical compound C1CC(OCOC)CCC1N(C1=C(SC(=C1)C=1CCCCC=1)C(O)=O)C(=O)C1CCC(C)CC1 SNHOCYVWFCETLM-UHFFFAOYSA-N 0.000 claims description 5
- IWUCXVSUMQZMFG-AFCXAGJDSA-N Ribavirin Chemical compound N1=C(C(=O)N)N=CN1[C@H]1[C@H](O)[C@H](O)[C@@H](CO)O1 IWUCXVSUMQZMFG-AFCXAGJDSA-N 0.000 claims description 5
- 239000004599 antimicrobial Substances 0.000 claims description 5
- 239000003443 antiviral agent Substances 0.000 claims description 5
- 125000004122 cyclic group Chemical group 0.000 claims description 5
- WVIIMZNLDWSIRH-UHFFFAOYSA-N cyclohexylcyclohexane Chemical group C1CCCCC1C1CCCCC1 WVIIMZNLDWSIRH-UHFFFAOYSA-N 0.000 claims description 5
- 125000005879 dioxolanyl group Chemical group 0.000 claims description 5
- 229940042399 direct acting antivirals protease inhibitors Drugs 0.000 claims description 5
- 239000000137 peptide hydrolase inhibitor Substances 0.000 claims description 5
- 229960000329 ribavirin Drugs 0.000 claims description 5
- HZCAHMRRMINHDJ-DBRKOABJSA-N ribavirin Natural products O[C@@H]1[C@H](O)[C@@H](CO)O[C@H]1N1N=CN=C1 HZCAHMRRMINHDJ-DBRKOABJSA-N 0.000 claims description 5
- 229940021747 therapeutic vaccine Drugs 0.000 claims description 5
- 125000004178 (C1-C4) alkyl group Chemical group 0.000 claims description 4
- RWEPJHKNTQPJNB-UHFFFAOYSA-N 5-(2,6-difluorocyclohexen-1-yl)-3-[(4-methoxycyclohexyl)-(4-methylcyclohexanecarbonyl)amino]thiophene-2-carboxylic acid Chemical compound C1CC(OC)CCC1N(C1=C(SC(=C1)C=1C(CCCC=1F)F)C(O)=O)C(=O)C1CCC(C)CC1 RWEPJHKNTQPJNB-UHFFFAOYSA-N 0.000 claims description 4
- OGBAPGFURAIVAC-UHFFFAOYSA-N 5-(3-hydroxycyclohexen-1-yl)-3-[(4-hydroxycyclohexyl)-(4-methylcyclohexanecarbonyl)amino]thiophene-2-carboxylic acid Chemical compound C1CC(C)CCC1C(=O)N(C1=C(SC(=C1)C=1CCCC(O)C=1)C(O)=O)C1CCC(O)CC1 OGBAPGFURAIVAC-UHFFFAOYSA-N 0.000 claims description 4
- OFOMFFOXKMZUIW-UHFFFAOYSA-N 5-(cyclohexen-1-yl)-3-(n-(4-methylcyclohexanecarbonyl)anilino)thiophene-2-carboxylic acid Chemical compound C1CC(C)CCC1C(=O)N(C=1C=CC=CC=1)C1=C(C(O)=O)SC(C=2CCCCC=2)=C1 OFOMFFOXKMZUIW-UHFFFAOYSA-N 0.000 claims description 4
- AHQGMPPSKUDUDL-UHFFFAOYSA-N 5-(cyclohexen-1-yl)-3-[(4-fluorocyclohexyl)-(4-methylcyclohexanecarbonyl)amino]thiophene-2-carboxylic acid Chemical compound C1CC(C)CCC1C(=O)N(C1=C(SC(=C1)C=1CCCCC=1)C(O)=O)C1CCC(F)CC1 AHQGMPPSKUDUDL-UHFFFAOYSA-N 0.000 claims description 4
- NHRHXDMGFVGNRU-UHFFFAOYSA-N 5-(cyclohexen-1-yl)-3-[1,3-dioxan-5-yl-(4-methylcyclohexanecarbonyl)amino]thiophene-2-carboxylic acid Chemical compound C1CC(C)CCC1C(=O)N(C1=C(SC(=C1)C=1CCCCC=1)C(O)=O)C1COCOC1 NHRHXDMGFVGNRU-UHFFFAOYSA-N 0.000 claims description 4
- NRWYAVDHRVTITK-UPRSBDKSSA-N C1C[C@@H](C)CC[C@@H]1C(=O)N(C1=C(SC(=C1)C=1CCCC=1)C(O)=O)[C@@H]1CC[C@@H](O)CC1 Chemical compound C1C[C@@H](C)CC[C@@H]1C(=O)N(C1=C(SC(=C1)C=1CCCC=1)C(O)=O)[C@@H]1CC[C@@H](O)CC1 NRWYAVDHRVTITK-UPRSBDKSSA-N 0.000 claims description 4
- LBFROQIFJOYWFA-HDRKRICHSA-N C1C[C@@H](C)CC[C@@H]1C(=O)N(C1=C(SC(Br)=C1)C(O)=O)[C@@H]1CC[C@@H](O)CC1 Chemical compound C1C[C@@H](C)CC[C@@H]1C(=O)N(C1=C(SC(Br)=C1)C(O)=O)[C@@H]1CC[C@@H](O)CC1 LBFROQIFJOYWFA-HDRKRICHSA-N 0.000 claims description 4
- FBOBFRVOSFIYOQ-XHPGVBHPSA-N C1C[C@@H](OC)CC[C@@H]1N(C1=C(SC(=C1)C=1CCC(C)(C)CC=1)C(O)=O)C(=O)[C@@H]1CC[C@@H](C)CC1 Chemical compound C1C[C@@H](OC)CC[C@@H]1N(C1=C(SC(=C1)C=1CCC(C)(C)CC=1)C(O)=O)C(=O)[C@@H]1CC[C@@H](C)CC1 FBOBFRVOSFIYOQ-XHPGVBHPSA-N 0.000 claims description 4
- 125000003302 alkenyloxy group Chemical group 0.000 claims description 4
- DKNWSYNQZKUICI-UHFFFAOYSA-N amantadine Chemical compound C1C(C2)CC3CC2CC1(N)C3 DKNWSYNQZKUICI-UHFFFAOYSA-N 0.000 claims description 4
- 229960003805 amantadine Drugs 0.000 claims description 4
- 238000004891 communication Methods 0.000 claims description 4
- 229910052740 iodine Inorganic materials 0.000 claims description 4
- 239000000546 pharmaceutical excipient Substances 0.000 claims description 4
- 150000003536 tetrazoles Chemical class 0.000 claims description 4
- AQBYCVVVNOZWPR-UHFFFAOYSA-N 5-(cyclohexen-1-yl)-3-[(1-formylpiperidin-4-yl)-(4-methylcyclohexanecarbonyl)amino]thiophene-2-carboxylic acid Chemical compound C1CC(C)CCC1C(=O)N(C1=C(SC(=C1)C=1CCCCC=1)C(O)=O)C1CCN(C=O)CC1 AQBYCVVVNOZWPR-UHFFFAOYSA-N 0.000 claims description 3
- GJNZQSSHAVNWFW-UHFFFAOYSA-N 5-(cyclohexen-1-yl)-3-[(2,4-dichlorobenzoyl)-propan-2-ylamino]thiophene-2-carboxylic acid Chemical compound C1=C(C=2CCCCC=2)SC(C(O)=O)=C1N(C(C)C)C(=O)C1=CC=C(Cl)C=C1Cl GJNZQSSHAVNWFW-UHFFFAOYSA-N 0.000 claims description 3
- YZBWRCKPMKZIKM-UHFFFAOYSA-N 5-(cyclohexen-1-yl)-3-[(4-methylcyclohexanecarbonyl)-[1-(2-methylpropanoyl)piperidin-4-yl]amino]thiophene-2-carboxylic acid Chemical compound C1CN(C(=O)C(C)C)CCC1N(C1=C(SC(=C1)C=1CCCCC=1)C(O)=O)C(=O)C1CCC(C)CC1 YZBWRCKPMKZIKM-UHFFFAOYSA-N 0.000 claims description 3
- VCJJWZOMFHUKMX-UHFFFAOYSA-N 5-cyclohexyl-3-[(4-hydroxycyclohexyl)-(4-methylcyclohexanecarbonyl)amino]thiophene-2-carboxylic acid Chemical compound C1CC(C)CCC1C(=O)N(C1=C(SC(=C1)C1CCCCC1)C(O)=O)C1CCC(O)CC1 VCJJWZOMFHUKMX-UHFFFAOYSA-N 0.000 claims description 3
- GVYKMIALDJEPRQ-CPONINCNSA-N C1=C(C=2CCC(C)CC=2)SC(C(O)=O)=C1N(C(C)C)C(=O)[C@H]1CC[C@H](C)CC1 Chemical compound C1=C(C=2CCC(C)CC=2)SC(C(O)=O)=C1N(C(C)C)C(=O)[C@H]1CC[C@H](C)CC1 GVYKMIALDJEPRQ-CPONINCNSA-N 0.000 claims description 3
- HZCUBYGLTQHCPR-JCNLHEQBSA-N C1=C(C=2CCCCC=2)SC(C(O)=O)=C1N(C(C)C)C(=O)[C@H]1CC[C@H](C)CC1 Chemical compound C1=C(C=2CCCCC=2)SC(C(O)=O)=C1N(C(C)C)C(=O)[C@H]1CC[C@H](C)CC1 HZCUBYGLTQHCPR-JCNLHEQBSA-N 0.000 claims description 3
- FPARYJXWWMDFFU-KQEUCTNFSA-N C1C[C@@H](C)CC[C@@H]1C(=O)N(C1=C(SC(=C1)C1C=CCCC1)C(O)=O)[C@@H]1CC[C@@H](O)CC1 Chemical compound C1C[C@@H](C)CC[C@@H]1C(=O)N(C1=C(SC(=C1)C1C=CCCC1)C(O)=O)[C@@H]1CC[C@@H](O)CC1 FPARYJXWWMDFFU-KQEUCTNFSA-N 0.000 claims description 3
- MMKZHFVOWJFVHI-KESTWPANSA-N C1C[C@@H](C)CC[C@@H]1C(=O)N(C1=C(SC(=C1)C1CCC(C)(C)CC1)C(O)=O)C1CCN(C)CC1 Chemical compound C1C[C@@H](C)CC[C@@H]1C(=O)N(C1=C(SC(=C1)C1CCC(C)(C)CC1)C(O)=O)C1CCN(C)CC1 MMKZHFVOWJFVHI-KESTWPANSA-N 0.000 claims description 3
- DRTQOSFDYDDNNA-YSXIEMCBSA-N C1C[C@@H](C)CC[C@@H]1C(=O)N(C1=C(SC(=C1)C1CCC(C)(C)CC1)C(O)=O)[C@@H]1CC[C@@H](O)CC1 Chemical compound C1C[C@@H](C)CC[C@@H]1C(=O)N(C1=C(SC(=C1)C1CCC(C)(C)CC1)C(O)=O)[C@@H]1CC[C@@H](O)CC1 DRTQOSFDYDDNNA-YSXIEMCBSA-N 0.000 claims description 3
- LMCDACUYZVUIFN-WXVWHJFISA-N C1C[C@@H](C)CC[C@@H]1C(=O)N(C1=C(SC(=C1)C=1CCC(C)(C)CC=1)C(O)=O)C1CCC2(C(N(C)C(=O)N2C)=O)CC1 Chemical compound C1C[C@@H](C)CC[C@@H]1C(=O)N(C1=C(SC(=C1)C=1CCC(C)(C)CC=1)C(O)=O)C1CCC2(C(N(C)C(=O)N2C)=O)CC1 LMCDACUYZVUIFN-WXVWHJFISA-N 0.000 claims description 3
- WJGGHFVZSJUBRZ-YSXIEMCBSA-N C1C[C@@H](C)CC[C@@H]1C(=O)N(C1=C(SC(=C1)C=1CCC(C)(C)CC=1)C(O)=O)[C@@H]1CC[C@@H](O)CC1 Chemical compound C1C[C@@H](C)CC[C@@H]1C(=O)N(C1=C(SC(=C1)C=1CCC(C)(C)CC=1)C(O)=O)[C@@H]1CC[C@@H](O)CC1 WJGGHFVZSJUBRZ-YSXIEMCBSA-N 0.000 claims description 3
- XMHTZCKCUJIEIC-PPFQCUIHSA-N C1C[C@@H](C)CC[C@@H]1C(=O)N(C1=C(SC(=C1)C=1CCCCC=1)C(O)=O)C1CC(C)CCC1 Chemical compound C1C[C@@H](C)CC[C@@H]1C(=O)N(C1=C(SC(=C1)C=1CCCCC=1)C(O)=O)C1CC(C)CCC1 XMHTZCKCUJIEIC-PPFQCUIHSA-N 0.000 claims description 3
- DTJARGIYIUHGII-KOMQPUFPSA-N C1C[C@@H](C)CC[C@@H]1C(=O)N(C1=C(SC(=C1)C=1CCCCC=1)C(O)=O)C1CC1 Chemical compound C1C[C@@H](C)CC[C@@H]1C(=O)N(C1=C(SC(=C1)C=1CCCCC=1)C(O)=O)C1CC1 DTJARGIYIUHGII-KOMQPUFPSA-N 0.000 claims description 3
- OSJUSKYSFLVNJA-SAABIXHNSA-N C1C[C@@H](C)CC[C@@H]1C(=O)N(C1=C(SC(=C1)C=1CCCCC=1)C(O)=O)C1CCC(F)(F)CC1 Chemical compound C1C[C@@H](C)CC[C@@H]1C(=O)N(C1=C(SC(=C1)C=1CCCCC=1)C(O)=O)C1CCC(F)(F)CC1 OSJUSKYSFLVNJA-SAABIXHNSA-N 0.000 claims description 3
- XFFTZCJYAKZMAI-AFARHQOCSA-N C1C[C@@H](C)CC[C@@H]1C(=O)N(C1=C(SC(=C1)C=1CCCCC=1)C(O)=O)C1CCN(C=2C=CC=CC=2)CC1 Chemical compound C1C[C@@H](C)CC[C@@H]1C(=O)N(C1=C(SC(=C1)C=1CCCCC=1)C(O)=O)C1CCN(C=2C=CC=CC=2)CC1 XFFTZCJYAKZMAI-AFARHQOCSA-N 0.000 claims description 3
- GDLYEIAVXRHMTA-XUTJKUGGSA-N C1C[C@@H](C)CC[C@@H]1C(=O)N(C1=C(SC(=C1)C=1CCCCC=1)C(O)=O)C1CCN(C=2N=CC=CN=2)CC1 Chemical compound C1C[C@@H](C)CC[C@@H]1C(=O)N(C1=C(SC(=C1)C=1CCCCC=1)C(O)=O)C1CCN(C=2N=CC=CN=2)CC1 GDLYEIAVXRHMTA-XUTJKUGGSA-N 0.000 claims description 3
- QJEOKVNLHVLDLL-SAABIXHNSA-N C1C[C@@H](C)CC[C@@H]1C(=O)N(C1=C(SC(=C1)C=1CCCCC=1)C(O)=O)C1CCOCC1 Chemical compound C1C[C@@H](C)CC[C@@H]1C(=O)N(C1=C(SC(=C1)C=1CCCCC=1)C(O)=O)C1CCOCC1 QJEOKVNLHVLDLL-SAABIXHNSA-N 0.000 claims description 3
- CEQRAOMBFIAWLT-SAABIXHNSA-N C1C[C@@H](C)CC[C@@H]1C(=O)N(C1=C(SC(=C1)C=1CCCCC=1)C(O)=O)C1CCSCC1 Chemical compound C1C[C@@H](C)CC[C@@H]1C(=O)N(C1=C(SC(=C1)C=1CCCCC=1)C(O)=O)C1CCSCC1 CEQRAOMBFIAWLT-SAABIXHNSA-N 0.000 claims description 3
- AHQGMPPSKUDUDL-VJVRBHMKSA-N C1C[C@@H](C)CC[C@@H]1C(=O)N(C1=C(SC(=C1)C=1CCCCC=1)C(O)=O)[C@@H]1CC[C@@H](F)CC1 Chemical compound C1C[C@@H](C)CC[C@@H]1C(=O)N(C1=C(SC(=C1)C=1CCCCC=1)C(O)=O)[C@@H]1CC[C@@H](F)CC1 AHQGMPPSKUDUDL-VJVRBHMKSA-N 0.000 claims description 3
- SATLBJQBKFNRNL-ICNBMTIMSA-N C1C[C@@H](C)CC[C@@H]1C(=O)N(C1=C(SC(=C1)C=1CCCCC=1)C(O)=O)[C@H]1CC[C@@H](C#N)CC1 Chemical compound C1C[C@@H](C)CC[C@@H]1C(=O)N(C1=C(SC(=C1)C=1CCCCC=1)C(O)=O)[C@H]1CC[C@@H](C#N)CC1 SATLBJQBKFNRNL-ICNBMTIMSA-N 0.000 claims description 3
- OUUFVRBISAEUNT-YSXIEMCBSA-N C1C[C@@H](C)CC[C@@H]1C(=O)N(C1=C(SC(=C1)C=1CCCCCC=1)C(O)=O)[C@@H]1CC[C@@H](O)CC1 Chemical compound C1C[C@@H](C)CC[C@@H]1C(=O)N(C1=C(SC(=C1)C=1CCCCCC=1)C(O)=O)[C@@H]1CC[C@@H](O)CC1 OUUFVRBISAEUNT-YSXIEMCBSA-N 0.000 claims description 3
- BVXHTXRVCMTCJW-GONJQHFYSA-N C1C[C@@H](C)CC[C@@H]1C(=O)N(C1=C(SC(=C1)[C@H]1CC[C@@H](C)CC1)C(O)=O)[C@@H]1CC[C@@H](O)CC1 Chemical compound C1C[C@@H](C)CC[C@@H]1C(=O)N(C1=C(SC(=C1)[C@H]1CC[C@@H](C)CC1)C(O)=O)[C@@H]1CC[C@@H](O)CC1 BVXHTXRVCMTCJW-GONJQHFYSA-N 0.000 claims description 3
- XLJOUVDPWPSXDM-VYUAXZJKSA-N C1C[C@@H](C)CC[C@@H]1N(C1=C(SC(=C1)C=1CCCCC=1)C(O)=O)C(=O)[C@@H]1CC[C@@H](C)CC1 Chemical compound C1C[C@@H](C)CC[C@@H]1N(C1=C(SC(=C1)C=1CCCCC=1)C(O)=O)C(=O)[C@@H]1CC[C@@H](C)CC1 XLJOUVDPWPSXDM-VYUAXZJKSA-N 0.000 claims description 3
- XLJOUVDPWPSXDM-ICNBMTIMSA-N C1C[C@@H](C)CC[C@H]1N(C1=C(SC(=C1)C=1CCCCC=1)C(O)=O)C(=O)[C@@H]1CC[C@@H](C)CC1 Chemical compound C1C[C@@H](C)CC[C@H]1N(C1=C(SC(=C1)C=1CCCCC=1)C(O)=O)C(=O)[C@@H]1CC[C@@H](C)CC1 XLJOUVDPWPSXDM-ICNBMTIMSA-N 0.000 claims description 3
- QOIHGTCVBFQWJO-DRLVJGDXSA-N C1C[C@@H](OC)CC[C@@H]1N(C1=C(SC(=C1)C1CCC(CC1)C(F)(F)F)C(O)=O)C(=O)[C@@H]1CC[C@@H](C)CC1 Chemical compound C1C[C@@H](OC)CC[C@@H]1N(C1=C(SC(=C1)C1CCC(CC1)C(F)(F)F)C(O)=O)C(=O)[C@@H]1CC[C@@H](C)CC1 QOIHGTCVBFQWJO-DRLVJGDXSA-N 0.000 claims description 3
- JFUHFSBVZUPBIF-IKYFGSHTSA-N C1C[C@@H](OC)CC[C@@H]1N(C1=C(SC(=C1)C=1CCC(CC=1)C(F)(F)F)C(O)=O)C(=O)[C@@H]1CC[C@@H](C)CC1 Chemical compound C1C[C@@H](OC)CC[C@@H]1N(C1=C(SC(=C1)C=1CCC(CC=1)C(F)(F)F)C(O)=O)C(=O)[C@@H]1CC[C@@H](C)CC1 JFUHFSBVZUPBIF-IKYFGSHTSA-N 0.000 claims description 3
- LNYKGELUODVSNS-YSXIEMCBSA-N C1C[C@@H](OC)CC[C@@H]1N(C1=C(SC(=C1)C=1CCCCC=1)C(O)=O)C(=O)[C@@H]1CC[C@@H](C)CC1 Chemical compound C1C[C@@H](OC)CC[C@@H]1N(C1=C(SC(=C1)C=1CCCCC=1)C(O)=O)C(=O)[C@@H]1CC[C@@H](C)CC1 LNYKGELUODVSNS-YSXIEMCBSA-N 0.000 claims description 3
- GZPCNCMYPJUFCL-BIAGXBKMSA-N C1C[C@@H](OC)CC[C@@H]1N(C1=C(SC=C1)C(O)=O)C(=O)[C@@H]1CC[C@@H](C)CC1 Chemical compound C1C[C@@H](OC)CC[C@@H]1N(C1=C(SC=C1)C(O)=O)C(=O)[C@@H]1CC[C@@H](C)CC1 GZPCNCMYPJUFCL-BIAGXBKMSA-N 0.000 claims description 3
- YUIXIDHCLFDQRR-XHPGVBHPSA-N C1C[C@@H](OCSC)CC[C@@H]1N(C1=C(SC(=C1)C=1CCCCC=1)C(O)=O)C(=O)[C@@H]1CC[C@@H](C)CC1 Chemical compound C1C[C@@H](OCSC)CC[C@@H]1N(C1=C(SC(=C1)C=1CCCCC=1)C(O)=O)C(=O)[C@@H]1CC[C@@H](C)CC1 YUIXIDHCLFDQRR-XHPGVBHPSA-N 0.000 claims description 3
- YRXSLMCVIZCAFE-XUTJKUGGSA-N C[C@H]1CC[C@@H](CC1)C(=O)N(C1CCN(CC1)c1cncnc1)c1cc(sc1C(O)=O)C1=CCCCC1 Chemical compound C[C@H]1CC[C@@H](CC1)C(=O)N(C1CCN(CC1)c1cncnc1)c1cc(sc1C(O)=O)C1=CCCCC1 YRXSLMCVIZCAFE-XUTJKUGGSA-N 0.000 claims description 3
- NYTDFZMGNVINAW-SAABIXHNSA-N C[C@H]1CC[C@@H](CC1)C(=O)N(C1CCNCC1)c1cc(sc1C(O)=O)C1=CCCCC1 Chemical compound C[C@H]1CC[C@@H](CC1)C(=O)N(C1CCNCC1)c1cc(sc1C(O)=O)C1=CCCCC1 NYTDFZMGNVINAW-SAABIXHNSA-N 0.000 claims description 3
- 102000053642 Catalytic RNA Human genes 0.000 claims description 3
- 108090000994 Catalytic RNA Proteins 0.000 claims description 3
- PMATZTZNYRCHOR-CGLBZJNRSA-N Cyclosporin A Chemical compound CC[C@@H]1NC(=O)[C@H]([C@H](O)[C@H](C)C\C=C\C)N(C)C(=O)[C@H](C(C)C)N(C)C(=O)[C@H](CC(C)C)N(C)C(=O)[C@H](CC(C)C)N(C)C(=O)[C@@H](C)NC(=O)[C@H](C)NC(=O)[C@H](CC(C)C)N(C)C(=O)[C@H](C(C)C)NC(=O)[C@H](CC(C)C)N(C)C(=O)CN(C)C1=O PMATZTZNYRCHOR-CGLBZJNRSA-N 0.000 claims description 3
- 229930105110 Cyclosporin A Natural products 0.000 claims description 3
- 108010036949 Cyclosporine Proteins 0.000 claims description 3
- 208000005176 Hepatitis C Diseases 0.000 claims description 3
- 102000013462 Interleukin-12 Human genes 0.000 claims description 3
- 108010065805 Interleukin-12 Proteins 0.000 claims description 3
- 241000320380 Silybum Species 0.000 claims description 3
- 235000010841 Silybum marianum Nutrition 0.000 claims description 3
- 125000004369 butenyl group Chemical group C(=CCC)* 0.000 claims description 3
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 claims description 3
- 229960001265 ciclosporin Drugs 0.000 claims description 3
- 229930182912 cyclosporin Natural products 0.000 claims description 3
- 229940117681 interleukin-12 Drugs 0.000 claims description 3
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 claims description 3
- STUHQDIOZQUPGP-UHFFFAOYSA-N morpholin-4-ium-4-carboxylate Chemical compound OC(=O)N1CCOCC1 STUHQDIOZQUPGP-UHFFFAOYSA-N 0.000 claims description 3
- 125000001971 neopentyl group Chemical group [H]C([*])([H])C(C([H])([H])[H])(C([H])([H])[H])C([H])([H])[H] 0.000 claims description 3
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 claims description 3
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 claims description 3
- IBBLRJGOOANPTQ-JKVLGAQCSA-N quinapril hydrochloride Chemical compound Cl.C([C@@H](C(=O)OCC)N[C@@H](C)C(=O)N1[C@@H](CC2=CC=CC=C2C1)C(O)=O)CC1=CC=CC=C1 IBBLRJGOOANPTQ-JKVLGAQCSA-N 0.000 claims description 3
- 108091092562 ribozyme Proteins 0.000 claims description 3
- 229920002554 vinyl polymer Polymers 0.000 claims description 3
- YKLPAWHQHJTBDV-RXMQYKEDSA-N (2r)-2-amino-3-oxo-2-(sulfanylmethyl)butanoic acid Chemical compound CC(=O)[C@](N)(CS)C(O)=O YKLPAWHQHJTBDV-RXMQYKEDSA-N 0.000 claims description 2
- MERANRXZFXHYKZ-UHFFFAOYSA-N 5-(2,3-difluorocyclohexen-1-yl)-3-[(4-methoxycyclohexyl)-(4-methylcyclohexanecarbonyl)amino]thiophene-2-carboxylic acid Chemical compound C1CC(OC)CCC1N(C1=C(SC(=C1)C=1CCCC(F)C=1F)C(O)=O)C(=O)C1CCC(C)CC1 MERANRXZFXHYKZ-UHFFFAOYSA-N 0.000 claims description 2
- FBOBFRVOSFIYOQ-UHFFFAOYSA-N 5-(4,4-dimethylcyclohexen-1-yl)-3-[(4-methoxycyclohexyl)-(4-methylcyclohexanecarbonyl)amino]thiophene-2-carboxylic acid Chemical compound C1CC(OC)CCC1N(C1=C(SC(=C1)C=1CCC(C)(C)CC=1)C(O)=O)C(=O)C1CCC(C)CC1 FBOBFRVOSFIYOQ-UHFFFAOYSA-N 0.000 claims description 2
- CMBPRRDJOSJOPZ-UHFFFAOYSA-N 5-(4-tert-butylcyclohexen-1-yl)-3-[(4-hydroxycyclohexyl)-(4-methylcyclohexanecarbonyl)amino]thiophene-2-carboxylic acid Chemical compound C1CC(C)CCC1C(=O)N(C1=C(SC(=C1)C=1CCC(CC=1)C(C)(C)C)C(O)=O)C1CCC(O)CC1 CMBPRRDJOSJOPZ-UHFFFAOYSA-N 0.000 claims description 2
- VQNVTTOMIYUAAT-UHFFFAOYSA-N 5-(cyclohexen-1-yl)-3-[(4-methylbenzoyl)-propan-2-ylamino]thiophene-2-carboxylic acid Chemical compound C1=C(C=2CCCCC=2)SC(C(O)=O)=C1N(C(C)C)C(=O)C1=CC=C(C)C=C1 VQNVTTOMIYUAAT-UHFFFAOYSA-N 0.000 claims description 2
- PFOHWPCBSUQTAS-UHFFFAOYSA-N 5-(cyclohexen-1-yl)-3-[[4-[(1-methoxy-3-methyl-1-oxobutan-2-yl)carbamoyloxy]cyclohexyl]-(4-methylcyclohexanecarbonyl)amino]thiophene-2-carboxylic acid Chemical compound C1CC(OC(=O)NC(C(=O)OC)C(C)C)CCC1N(C1=C(SC(=C1)C=1CCCCC=1)C(O)=O)C(=O)C1CCC(C)CC1 PFOHWPCBSUQTAS-UHFFFAOYSA-N 0.000 claims description 2
- CHSWOVCXLYDIIY-UHFFFAOYSA-N 5-(cyclopenten-1-yl)-3-[(2,4-dichlorobenzoyl)-propan-2-ylamino]thiophene-2-carboxylic acid Chemical compound C1=C(C=2CCCC=2)SC(C(O)=O)=C1N(C(C)C)C(=O)C1=CC=C(Cl)C=C1Cl CHSWOVCXLYDIIY-UHFFFAOYSA-N 0.000 claims description 2
- NRWYAVDHRVTITK-UHFFFAOYSA-N 5-(cyclopenten-1-yl)-3-[(4-hydroxycyclohexyl)-(4-methylcyclohexanecarbonyl)amino]thiophene-2-carboxylic acid Chemical compound C1CC(C)CCC1C(=O)N(C1=C(SC(=C1)C=1CCCC=1)C(O)=O)C1CCC(O)CC1 NRWYAVDHRVTITK-UHFFFAOYSA-N 0.000 claims description 2
- OHWPNFAZTZGNKZ-SAABIXHNSA-N C1=C(C=2CCCCC=2)SC(C(O)=O)=C1N(C(COC)COC)C(=O)[C@H]1CC[C@H](C)CC1 Chemical compound C1=C(C=2CCCCC=2)SC(C(O)=O)=C1N(C(COC)COC)C(=O)[C@H]1CC[C@H](C)CC1 OHWPNFAZTZGNKZ-SAABIXHNSA-N 0.000 claims description 2
- TVNILQLSTHSMLT-ZCYMVKBSSA-N C1CC(=NOCC)CCC1N(C1=C(SC(=C1)C=1CCCCC=1)C(O)=O)C(=O)[C@@H]1CC[C@@H](C)CC1 Chemical compound C1CC(=NOCC)CCC1N(C1=C(SC(=C1)C=1CCCCC=1)C(O)=O)C(=O)[C@@H]1CC[C@@H](C)CC1 TVNILQLSTHSMLT-ZCYMVKBSSA-N 0.000 claims description 2
- YBQKQVZAEDDNAU-CTYIDZIISA-N C1C[C@@H](C)CC[C@@H]1C(=O)N(C)C1=C(C(O)=O)SC(C=2CCCCC=2)=C1 Chemical compound C1C[C@@H](C)CC[C@@H]1C(=O)N(C)C1=C(C(O)=O)SC(C=2CCCCC=2)=C1 YBQKQVZAEDDNAU-CTYIDZIISA-N 0.000 claims description 2
- AIPXYNJQICQCPP-QFLLTADKSA-N C1C[C@@H](C)CC[C@@H]1C(=O)N(C1=C(SC(=C1)C1C2CCC(C2)C1)C(O)=O)[C@@H]1CC[C@@H](O)CC1 Chemical compound C1C[C@@H](C)CC[C@@H]1C(=O)N(C1=C(SC(=C1)C1C2CCC(C2)C1)C(O)=O)[C@@H]1CC[C@@H](O)CC1 AIPXYNJQICQCPP-QFLLTADKSA-N 0.000 claims description 2
- QHSXCGCAECGORC-LWLBLJAOSA-N C1C[C@@H](C)CC[C@@H]1C(=O)N(C1=C(SC(=C1)C1C=CC(C)CC1)C(O)=O)[C@@H]1CC[C@@H](O)CC1 Chemical compound C1C[C@@H](C)CC[C@@H]1C(=O)N(C1=C(SC(=C1)C1C=CC(C)CC1)C(O)=O)[C@@H]1CC[C@@H](O)CC1 QHSXCGCAECGORC-LWLBLJAOSA-N 0.000 claims description 2
- JZZHJWYJGBDGPG-BRWVVXTDSA-N C1C[C@@H](C)CC[C@@H]1C(=O)N(C1=C(SC(=C1)C1CC=C(C)CC1)C(O)=O)[C@@H]1CC[C@@H](O)CC1 Chemical compound C1C[C@@H](C)CC[C@@H]1C(=O)N(C1=C(SC(=C1)C1CC=C(C)CC1)C(O)=O)[C@@H]1CC[C@@H](O)CC1 JZZHJWYJGBDGPG-BRWVVXTDSA-N 0.000 claims description 2
- JFNVYOKGZLDNAH-KQEUCTNFSA-N C1C[C@@H](C)CC[C@@H]1C(=O)N(C1=C(SC(=C1)C1CC=CCC1)C(O)=O)[C@@H]1CC[C@@H](O)CC1 Chemical compound C1C[C@@H](C)CC[C@@H]1C(=O)N(C1=C(SC(=C1)C1CC=CCC1)C(O)=O)[C@@H]1CC[C@@H](O)CC1 JFNVYOKGZLDNAH-KQEUCTNFSA-N 0.000 claims description 2
- GTZZCRIWNBVETM-GUJRETQESA-N C1C[C@@H](C)CC[C@@H]1C(=O)N(C1=C(SC(=C1)C1CCC(C)(C)CC1)C(O)=O)[C@@H]1CC[C@@H](N2N=NC=C2)CC1 Chemical compound C1C[C@@H](C)CC[C@@H]1C(=O)N(C1=C(SC(=C1)C1CCC(C)(C)CC1)C(O)=O)[C@@H]1CC[C@@H](N2N=NC=C2)CC1 GTZZCRIWNBVETM-GUJRETQESA-N 0.000 claims description 2
- BVXHTXRVCMTCJW-LWLBLJAOSA-N C1C[C@@H](C)CC[C@@H]1C(=O)N(C1=C(SC(=C1)C1CCC(C)CC1)C(O)=O)[C@@H]1CC[C@@H](O)CC1 Chemical compound C1C[C@@H](C)CC[C@@H]1C(=O)N(C1=C(SC(=C1)C1CCC(C)CC1)C(O)=O)[C@@H]1CC[C@@H](O)CC1 BVXHTXRVCMTCJW-LWLBLJAOSA-N 0.000 claims description 2
- IUWYBOFGGDTQOR-KHBPEBPSSA-N C1C[C@@H](C)CC[C@@H]1C(=O)N(C1=C(SC(=C1)C1CCC(CC1)OC=1C=CC=CC=1)C(O)=O)[C@@H]1CC[C@@H](O)CC1 Chemical compound C1C[C@@H](C)CC[C@@H]1C(=O)N(C1=C(SC(=C1)C1CCC(CC1)OC=1C=CC=CC=1)C(O)=O)[C@@H]1CC[C@@H](O)CC1 IUWYBOFGGDTQOR-KHBPEBPSSA-N 0.000 claims description 2
- NINQOJCMYBIHMF-KCFDPAHWSA-N C1C[C@@H](C)CC[C@@H]1C(=O)N(C1=C(SC(=C1)C=1CCC(C)CC=1)C(O)=O)[C@@H]1CC[C@@H](O)CC1 Chemical compound C1C[C@@H](C)CC[C@@H]1C(=O)N(C1=C(SC(=C1)C=1CCC(C)CC=1)C(O)=O)[C@@H]1CC[C@@H](O)CC1 NINQOJCMYBIHMF-KCFDPAHWSA-N 0.000 claims description 2
- PAMOIOVTAUVDIT-PWZZDWAZSA-N C1C[C@@H](C)CC[C@@H]1C(=O)N(C1=C(SC(=C1)C=1CCC(CC=1)C=1C=CC=CC=1)C(O)=O)[C@@H]1CC[C@@H](O)CC1 Chemical compound C1C[C@@H](C)CC[C@@H]1C(=O)N(C1=C(SC(=C1)C=1CCC(CC=1)C=1C=CC=CC=1)C(O)=O)[C@@H]1CC[C@@H](O)CC1 PAMOIOVTAUVDIT-PWZZDWAZSA-N 0.000 claims description 2
- CRLPSZXQCTYECG-KESTWPANSA-N C1C[C@@H](C)CC[C@@H]1C(=O)N(C1=C(SC(=C1)C=1CCCCC=1)C(O)=O)C1CCC(C)(C)CC1 Chemical compound C1C[C@@H](C)CC[C@@H]1C(=O)N(C1=C(SC(=C1)C=1CCCCC=1)C(O)=O)C1CCC(C)(C)CC1 CRLPSZXQCTYECG-KESTWPANSA-N 0.000 claims description 2
- VRCATWVIEHHTHZ-UAPYVXQJSA-N C1C[C@@H](C)CC[C@@H]1C(=O)N(C1=C(SC(=C1)C=1CCCCC=1)C(O)=O)C1CCCCC1 Chemical compound C1C[C@@H](C)CC[C@@H]1C(=O)N(C1=C(SC(=C1)C=1CCCCC=1)C(O)=O)C1CCCCC1 VRCATWVIEHHTHZ-UAPYVXQJSA-N 0.000 claims description 2
- AHIZAJIZSMUYKS-KESTWPANSA-N C1C[C@@H](C)CC[C@@H]1C(=O)N(C1=C(SC(=C1)C=1CCCCC=1)C(O)=O)C1CCN(CCF)CC1 Chemical compound C1C[C@@H](C)CC[C@@H]1C(=O)N(C1=C(SC(=C1)C=1CCCCC=1)C(O)=O)C1CCN(CCF)CC1 AHIZAJIZSMUYKS-KESTWPANSA-N 0.000 claims description 2
- BZOWKCOXOYJPPR-XHPGVBHPSA-N C1C[C@@H](C)CC[C@@H]1C(=O)N(C1=C(SC(=C1)C=1CCCCC=1)C(O)=O)[C@@H]1CC[C@@H](N2N=NC=C2)CC1 Chemical compound C1C[C@@H](C)CC[C@@H]1C(=O)N(C1=C(SC(=C1)C=1CCCCC=1)C(O)=O)[C@@H]1CC[C@@H](N2N=NC=C2)CC1 BZOWKCOXOYJPPR-XHPGVBHPSA-N 0.000 claims description 2
- QPTQPRHLMQYGHB-ZULOPVSISA-N C1C[C@@H](C)CC[C@@H]1C(=O)N(C1=C(SC(=C1)C=1CCCCC=1)C(O)=O)[C@@H]1CC[C@H](N2N=CN=C2)CC1 Chemical compound C1C[C@@H](C)CC[C@@H]1C(=O)N(C1=C(SC(=C1)C=1CCCCC=1)C(O)=O)[C@@H]1CC[C@H](N2N=CN=C2)CC1 QPTQPRHLMQYGHB-ZULOPVSISA-N 0.000 claims description 2
- BZOWKCOXOYJPPR-ZULOPVSISA-N C1C[C@@H](C)CC[C@@H]1C(=O)N(C1=C(SC(=C1)C=1CCCCC=1)C(O)=O)[C@@H]1CC[C@H](N2N=NC=C2)CC1 Chemical compound C1C[C@@H](C)CC[C@@H]1C(=O)N(C1=C(SC(=C1)C=1CCCCC=1)C(O)=O)[C@@H]1CC[C@H](N2N=NC=C2)CC1 BZOWKCOXOYJPPR-ZULOPVSISA-N 0.000 claims description 2
- MGIDOELNCIGRPO-IXXJFMHHSA-N C1C[C@@H](C)CC[C@@H]1C(=O)N(C1=C(SC(=C1)C=1CCCCC=1)C(O)=O)[C@H]1CC[C@@H](O)CC1 Chemical compound C1C[C@@H](C)CC[C@@H]1C(=O)N(C1=C(SC(=C1)C=1CCCCC=1)C(O)=O)[C@H]1CC[C@@H](O)CC1 MGIDOELNCIGRPO-IXXJFMHHSA-N 0.000 claims description 2
- BVXHTXRVCMTCJW-XBFADQFBSA-N C1C[C@@H](C)CC[C@@H]1C(=O)N(C1=C(SC(=C1)[C@@H]1CC[C@@H](C)CC1)C(O)=O)[C@@H]1CC[C@@H](O)CC1 Chemical compound C1C[C@@H](C)CC[C@@H]1C(=O)N(C1=C(SC(=C1)[C@@H]1CC[C@@H](C)CC1)C(O)=O)[C@@H]1CC[C@@H](O)CC1 BVXHTXRVCMTCJW-XBFADQFBSA-N 0.000 claims description 2
- OVTIYPJPKHHYCK-GUJRETQESA-N C1C[C@@H](NC(=O)C(C)C)CC[C@@H]1N(C1=C(SC(=C1)C=1CCCCC=1)C(O)=O)C(=O)[C@@H]1CC[C@@H](C)CC1 Chemical compound C1C[C@@H](NC(=O)C(C)C)CC[C@@H]1N(C1=C(SC(=C1)C=1CCCCC=1)C(O)=O)C(=O)[C@@H]1CC[C@@H](C)CC1 OVTIYPJPKHHYCK-GUJRETQESA-N 0.000 claims description 2
- OVTIYPJPKHHYCK-FORLXOICSA-N C1C[C@@H](NC(=O)C(C)C)CC[C@H]1N(C1=C(SC(=C1)C=1CCCCC=1)C(O)=O)C(=O)[C@@H]1CC[C@@H](C)CC1 Chemical compound C1C[C@@H](NC(=O)C(C)C)CC[C@H]1N(C1=C(SC(=C1)C=1CCCCC=1)C(O)=O)C(=O)[C@@H]1CC[C@@H](C)CC1 OVTIYPJPKHHYCK-FORLXOICSA-N 0.000 claims description 2
- LNYKGELUODVSNS-URYRSFGFSA-N C1C[C@@H](OC)CC[C@@H]1N(C1=C(SC(=C1)C=1CCCCC=1)C(O)=O)C(=O)C1CCC(C)CC1 Chemical compound C1C[C@@H](OC)CC[C@@H]1N(C1=C(SC(=C1)C=1CCCCC=1)C(O)=O)C(=O)C1CCC(C)CC1 LNYKGELUODVSNS-URYRSFGFSA-N 0.000 claims description 2
- AMOXNTAMLUCWJT-ZULOPVSISA-N C1C[C@@H](OC)CC[C@H]1N(C1=C(SC(=C1)C1CCC(C)(C)CC1)C(O)=O)C(=O)[C@@H]1CC[C@@H](C)CC1 Chemical compound C1C[C@@H](OC)CC[C@H]1N(C1=C(SC(=C1)C1CCC(C)(C)CC1)C(O)=O)C(=O)[C@@H]1CC[C@@H](C)CC1 AMOXNTAMLUCWJT-ZULOPVSISA-N 0.000 claims description 2
- LNYKGELUODVSNS-HMYFDTNDSA-N C1C[C@@H](OC)CC[C@H]1N(C1=C(SC(=C1)C=1CCCCC=1)C(O)=O)C(=O)C1CCC(C)CC1 Chemical compound C1C[C@@H](OC)CC[C@H]1N(C1=C(SC(=C1)C=1CCCCC=1)C(O)=O)C(=O)C1CCC(C)CC1 LNYKGELUODVSNS-HMYFDTNDSA-N 0.000 claims description 2
- OWAQWJZQHJWZPO-RSUHOQBUSA-N Cl.C1C[C@@H](C)CC[C@@H]1C(=O)N(C1=C(SC(=C1)C1CCC(C)(C)CC1)C(O)=O)[C@@H]1CC[C@H](N2N=CN=C2)CC1 Chemical compound Cl.C1C[C@@H](C)CC[C@@H]1C(=O)N(C1=C(SC(=C1)C1CCC(C)(C)CC1)C(O)=O)[C@@H]1CC[C@H](N2N=CN=C2)CC1 OWAQWJZQHJWZPO-RSUHOQBUSA-N 0.000 claims description 2
- SNLFZVXDVWBLJR-FFPCIGOZSA-N [Cl-].C1(=CCCCC1)C1=CC(=C(S1)C(=O)OC)N(C1CC[NH+](CC1)C)C(=O)[C@@H]1CC[C@H](CC1)C Chemical compound [Cl-].C1(=CCCCC1)C1=CC(=C(S1)C(=O)OC)N(C1CC[NH+](CC1)C)C(=O)[C@@H]1CC[C@H](CC1)C SNLFZVXDVWBLJR-FFPCIGOZSA-N 0.000 claims description 2
- WMQSAOFWTROXBO-AFFTWYSYSA-N [Cl-].C1C[C@@H](C)CC[C@@H]1C(=O)N(C1=C(SC(=C1)C=1CCCCC=1)C(=O)OCOC(=O)C(C)(C)C)C1CC[NH+](C)CC1 Chemical compound [Cl-].C1C[C@@H](C)CC[C@@H]1C(=O)N(C1=C(SC(=C1)C=1CCCCC=1)C(=O)OCOC(=O)C(C)(C)C)C1CC[NH+](C)CC1 WMQSAOFWTROXBO-AFFTWYSYSA-N 0.000 claims description 2
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 claims description 2
- 125000004426 substituted alkynyl group Chemical group 0.000 claims 5
- 125000000547 substituted alkyl group Chemical group 0.000 claims 3
- 102000007501 Thymosin Human genes 0.000 claims 2
- 108010046075 Thymosin Proteins 0.000 claims 2
- 125000003107 substituted aryl group Chemical group 0.000 claims 2
- LCJVIYPJPCBWKS-NXPQJCNCSA-N thymosin Chemical compound SC[C@@H](N)C(=O)N[C@H](CO)C(=O)N[C@H](CC(O)=O)C(=O)N[C@@H](C)C(=O)N[C@@H](C)C(=O)N[C@H](C(C)C)C(=O)N[C@H](CC(O)=O)C(=O)N[C@H](C(C)C)C(=O)N[C@H](CO)C(=O)N[C@H](CO)C(=O)N[C@H](CCC(O)=O)C(=O)N[C@H]([C@@H](C)CC)C(=O)N[C@H]([C@H](C)O)C(=O)N[C@H](C(C)C)C(=O)N[C@H](CCCCN)C(=O)N[C@H](CC(O)=O)C(=O)N[C@H](CC(C)C)C(=O)N[C@H](CCCCN)C(=O)N[C@H](CCC(O)=O)C(=O)N[C@H](CCCCN)C(=O)N[C@H](CCCCN)C(=O)N[C@H](CCC(O)=O)C(=O)N[C@H](C(C)C)C(=O)N[C@H](C(C)C)C(=O)N[C@H](CCC(O)=O)C(=O)N[C@H](CCC(O)=O)C(=O)N[C@@H](C)C(=O)N[C@H](CCC(O)=O)C(O)=O LCJVIYPJPCBWKS-NXPQJCNCSA-N 0.000 claims 2
- QYCGBAJADAGLLK-UHFFFAOYSA-N 1-(cyclohepten-1-yl)cycloheptene Chemical group C1CCCCC=C1C1=CCCCCC1 QYCGBAJADAGLLK-UHFFFAOYSA-N 0.000 claims 1
- VSIYJQNFMOOGCU-UHFFFAOYSA-N 1-(cyclohexen-1-yl)cyclohexene Chemical group C1CCCC(C=2CCCCC=2)=C1 VSIYJQNFMOOGCU-UHFFFAOYSA-N 0.000 claims 1
- KQXCUMQUYNMNKA-UHFFFAOYSA-N 5-(cyclohexen-1-yl)-3-[(2,4-dimethylphenyl)sulfonylamino]thiophene-2-carboxylic acid Chemical compound CC1=CC(C)=CC=C1S(=O)(=O)NC1=C(C(O)=O)SC(C=2CCCCC=2)=C1 KQXCUMQUYNMNKA-UHFFFAOYSA-N 0.000 claims 1
- VRCATWVIEHHTHZ-UHFFFAOYSA-N 5-(cyclohexen-1-yl)-3-[cyclohexyl-(4-methylcyclohexanecarbonyl)amino]thiophene-2-carboxylic acid Chemical compound C1CC(C)CCC1C(=O)N(C1=C(SC(=C1)C=1CCCCC=1)C(O)=O)C1CCCCC1 VRCATWVIEHHTHZ-UHFFFAOYSA-N 0.000 claims 1
- 101100404726 Arabidopsis thaliana NHX7 gene Proteins 0.000 claims 1
- CMBPRRDJOSJOPZ-LBKZCYKOSA-N C1C[C@@H](C)CC[C@@H]1C(=O)N(C1=C(SC(=C1)C=1CCC(CC=1)C(C)(C)C)C(O)=O)[C@@H]1CC[C@@H](O)CC1 Chemical compound C1C[C@@H](C)CC[C@@H]1C(=O)N(C1=C(SC(=C1)C=1CCC(CC=1)C(C)(C)C)C(O)=O)[C@@H]1CC[C@@H](O)CC1 CMBPRRDJOSJOPZ-LBKZCYKOSA-N 0.000 claims 1
- NTQRCGGRNOJNJD-UAPYVXQJSA-N C1C[C@@H](C)CC[C@@H]1C(=O)N(C1=C(SC(=C1)C=1CCCCC=1)C(O)=O)C1CCN(S(C)(=O)=O)CC1 Chemical compound C1C[C@@H](C)CC[C@@H]1C(=O)N(C1=C(SC(=C1)C=1CCCCC=1)C(O)=O)C1CCN(S(C)(=O)=O)CC1 NTQRCGGRNOJNJD-UAPYVXQJSA-N 0.000 claims 1
- QPTQPRHLMQYGHB-XHPGVBHPSA-N C1C[C@@H](C)CC[C@@H]1C(=O)N(C1=C(SC(=C1)C=1CCCCC=1)C(O)=O)[C@@H]1CC[C@@H](N2N=CN=C2)CC1 Chemical compound C1C[C@@H](C)CC[C@@H]1C(=O)N(C1=C(SC(=C1)C=1CCCCC=1)C(O)=O)[C@@H]1CC[C@@H](N2N=CN=C2)CC1 QPTQPRHLMQYGHB-XHPGVBHPSA-N 0.000 claims 1
- PUWYENWRQJAVBI-AFARHQOCSA-N CC(C)OC(OCOC(C(SC(C1=CCCCC1)=C1)=C1N(C1CCN(C)CC1)C([C@H]1CC[C@H](C)CC1)=O)=O)=O Chemical compound CC(C)OC(OCOC(C(SC(C1=CCCCC1)=C1)=C1N(C1CCN(C)CC1)C([C@H]1CC[C@H](C)CC1)=O)=O)=O PUWYENWRQJAVBI-AFARHQOCSA-N 0.000 claims 1
- OWAQWJZQHJWZPO-OMWMBCDQSA-N Cl.C1C[C@@H](C)CC[C@@H]1C(=O)N(C1=C(SC(=C1)C1CCC(C)(C)CC1)C(O)=O)[C@@H]1CC[C@@H](N2N=CN=C2)CC1 Chemical compound Cl.C1C[C@@H](C)CC[C@@H]1C(=O)N(C1=C(SC(=C1)C1CCC(C)(C)CC1)C(O)=O)[C@@H]1CC[C@@H](N2N=CN=C2)CC1 OWAQWJZQHJWZPO-OMWMBCDQSA-N 0.000 claims 1
- WTACZFZEZRUUSR-OMWMBCDQSA-N Cl.C1C[C@@H](C)CC[C@@H]1C(=O)N(C1=C(SC(=C1)C=1CCC(C)(C)CC=1)C(O)=O)[C@@H]1CC[C@@H](N2N=CN=C2)CC1 Chemical class Cl.C1C[C@@H](C)CC[C@@H]1C(=O)N(C1=C(SC(=C1)C=1CCC(C)(C)CC=1)C(O)=O)[C@@H]1CC[C@@H](N2N=CN=C2)CC1 WTACZFZEZRUUSR-OMWMBCDQSA-N 0.000 claims 1
- 241000282324 Felis Species 0.000 claims 1
- JRNVZBWKYDBUCA-UHFFFAOYSA-N N-Chlorosuccinimide Substances ClN1C(=O)CCC1=O JRNVZBWKYDBUCA-UHFFFAOYSA-N 0.000 claims 1
- 102000057028 SOS1 Human genes 0.000 claims 1
- 108700022176 SOS1 Proteins 0.000 claims 1
- 101100197320 Saccharomyces cerevisiae (strain ATCC 204508 / S288c) RPL35A gene Proteins 0.000 claims 1
- 101150100839 Sos1 gene Proteins 0.000 claims 1
- 229960004308 acetylcysteine Drugs 0.000 claims 1
- GNPOLXWLSIADMF-UHFFFAOYSA-N azanium thiophene-2-carboxylate Chemical compound [NH4+].[O-]C(=O)C1=CC=CS1 GNPOLXWLSIADMF-UHFFFAOYSA-N 0.000 claims 1
- 125000005605 benzo group Chemical group 0.000 claims 1
- 125000004432 carbon atom Chemical group C* 0.000 claims 1
- 230000002759 chromosomal effect Effects 0.000 claims 1
- 208000010710 hepatitis C virus infection Diseases 0.000 claims 1
- 208000036142 Viral infection Diseases 0.000 abstract description 3
- 230000009385 viral infection Effects 0.000 abstract description 3
- 241000710781 Flaviviridae Species 0.000 abstract 1
- 239000000203 mixture Substances 0.000 description 258
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 170
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 148
- 239000000243 solution Substances 0.000 description 142
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 117
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 112
- YMWUJEATGCHHMB-UHFFFAOYSA-N dichloromethane Natural products ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 100
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 72
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 67
- 239000011541 reaction mixture Substances 0.000 description 63
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 60
- 239000007787 solid Substances 0.000 description 51
- 239000000741 silica gel Substances 0.000 description 50
- 229910002027 silica gel Inorganic materials 0.000 description 50
- 125000001162 cycloheptenyl group Chemical group C1(=CCCCCC1)* 0.000 description 48
- 230000002829 reductive effect Effects 0.000 description 42
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 42
- 239000012267 brine Substances 0.000 description 41
- 239000003480 eluent Substances 0.000 description 41
- WMFOQBRAJBCJND-UHFFFAOYSA-M Lithium hydroxide Chemical compound [Li+].[OH-] WMFOQBRAJBCJND-UHFFFAOYSA-M 0.000 description 39
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 39
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 39
- 238000004440 column chromatography Methods 0.000 description 38
- 150000004702 methyl esters Chemical class 0.000 description 37
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 28
- 239000002904 solvent Substances 0.000 description 25
- 239000000460 chlorine Substances 0.000 description 23
- 239000012299 nitrogen atmosphere Substances 0.000 description 22
- 238000000746 purification Methods 0.000 description 22
- 239000000543 intermediate Substances 0.000 description 21
- 239000000725 suspension Substances 0.000 description 20
- 229940047124 interferons Drugs 0.000 description 19
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 19
- 238000010992 reflux Methods 0.000 description 19
- 239000007864 aqueous solution Substances 0.000 description 18
- 239000012044 organic layer Substances 0.000 description 18
- 238000010898 silica gel chromatography Methods 0.000 description 18
- 108090000623 proteins and genes Proteins 0.000 description 17
- DTQVDTLACAAQTR-UHFFFAOYSA-N Trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 description 16
- 239000002253 acid Substances 0.000 description 15
- UAOMVDZJSHZZME-UHFFFAOYSA-N diisopropylamine Chemical compound CC(C)NC(C)C UAOMVDZJSHZZME-UHFFFAOYSA-N 0.000 description 15
- 239000010410 layer Substances 0.000 description 15
- KDLHZDBZIXYQEI-UHFFFAOYSA-N palladium Substances [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 15
- 102000004169 proteins and genes Human genes 0.000 description 15
- 108010050904 Interferons Proteins 0.000 description 14
- 102000014150 Interferons Human genes 0.000 description 14
- 239000004480 active ingredient Substances 0.000 description 14
- 235000018102 proteins Nutrition 0.000 description 14
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 13
- 125000001624 naphthyl group Chemical group 0.000 description 13
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 12
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 12
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 12
- 238000006243 chemical reaction Methods 0.000 description 12
- 238000004587 chromatography analysis Methods 0.000 description 12
- 239000013058 crude material Substances 0.000 description 12
- 238000004128 high performance liquid chromatography Methods 0.000 description 12
- 125000002568 propynyl group Chemical group [*]C#CC([H])([H])[H] 0.000 description 12
- HSFWRNGVRCDJHI-UHFFFAOYSA-N alpha-acetylene Natural products C#C HSFWRNGVRCDJHI-UHFFFAOYSA-N 0.000 description 11
- 125000002534 ethynyl group Chemical group [H]C#C* 0.000 description 11
- 239000000047 product Substances 0.000 description 11
- 238000001914 filtration Methods 0.000 description 10
- 125000004076 pyridyl group Chemical group 0.000 description 10
- 239000011734 sodium Substances 0.000 description 10
- 108091032973 (ribonucleotides)n+m Proteins 0.000 description 9
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 9
- 239000012043 crude product Substances 0.000 description 9
- 125000001412 tetrahydropyranyl group Chemical group 0.000 description 9
- ODYARUXXIJYYNA-UHFFFAOYSA-N 4-methylcyclohexane-1-carbonyl chloride Chemical compound CC1CCC(C(Cl)=O)CC1 ODYARUXXIJYYNA-UHFFFAOYSA-N 0.000 description 8
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 8
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical compound [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 8
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 description 8
- 239000012298 atmosphere Substances 0.000 description 8
- 239000002585 base Substances 0.000 description 8
- 239000000706 filtrate Substances 0.000 description 8
- 239000006260 foam Substances 0.000 description 8
- 239000012634 fragment Substances 0.000 description 8
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 8
- 150000002576 ketones Chemical class 0.000 description 8
- 239000012074 organic phase Substances 0.000 description 8
- 239000000843 powder Substances 0.000 description 8
- 239000012047 saturated solution Substances 0.000 description 8
- 238000003756 stirring Methods 0.000 description 8
- 239000000126 substance Substances 0.000 description 8
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 7
- 125000000094 2-phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 description 7
- 239000007788 liquid Substances 0.000 description 7
- ZCSHNCUQKCANBX-UHFFFAOYSA-N lithium diisopropylamide Chemical compound [Li+].CC(C)[N-]C(C)C ZCSHNCUQKCANBX-UHFFFAOYSA-N 0.000 description 7
- 239000013612 plasmid Substances 0.000 description 7
- 125000006239 protecting group Chemical group 0.000 description 7
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 6
- LCGLNKUTAGEVQW-UHFFFAOYSA-N Dimethyl ether Chemical compound COC LCGLNKUTAGEVQW-UHFFFAOYSA-N 0.000 description 6
- 229910017976 MgO 4 Inorganic materials 0.000 description 6
- PXIPVTKHYLBLMZ-UHFFFAOYSA-N Sodium azide Chemical compound [Na+].[N-]=[N+]=[N-] PXIPVTKHYLBLMZ-UHFFFAOYSA-N 0.000 description 6
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 6
- RJGHQTVXGKYATR-UHFFFAOYSA-L dibutyl(dichloro)stannane Chemical compound CCCC[Sn](Cl)(Cl)CCCC RJGHQTVXGKYATR-UHFFFAOYSA-L 0.000 description 6
- ZUOUZKKEUPVFJK-UHFFFAOYSA-N diphenyl Chemical compound C1=CC=CC=C1C1=CC=CC=C1 ZUOUZKKEUPVFJK-UHFFFAOYSA-N 0.000 description 6
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 description 6
- 239000003921 oil Substances 0.000 description 6
- CTSLXHKWHWQRSH-UHFFFAOYSA-N oxalyl chloride Chemical compound ClC(=O)C(Cl)=O CTSLXHKWHWQRSH-UHFFFAOYSA-N 0.000 description 6
- PARWUHTVGZSQPD-UHFFFAOYSA-N phenylsilane Chemical compound [SiH3]C1=CC=CC=C1 PARWUHTVGZSQPD-UHFFFAOYSA-N 0.000 description 6
- 238000002953 preparative HPLC Methods 0.000 description 6
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 6
- 235000017557 sodium bicarbonate Nutrition 0.000 description 6
- 229910000104 sodium hydride Inorganic materials 0.000 description 6
- 239000006188 syrup Substances 0.000 description 6
- 235000020357 syrup Nutrition 0.000 description 6
- 125000006374 C2-C10 alkenyl group Chemical group 0.000 description 5
- 108060001084 Luciferase Proteins 0.000 description 5
- 239000005089 Luciferase Substances 0.000 description 5
- 102000012479 Serine Proteases Human genes 0.000 description 5
- 108010022999 Serine Proteases Proteins 0.000 description 5
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 5
- 229940043279 diisopropylamine Drugs 0.000 description 5
- 239000000284 extract Substances 0.000 description 5
- 239000000825 pharmaceutical preparation Substances 0.000 description 5
- 125000003386 piperidinyl group Chemical group 0.000 description 5
- 239000012312 sodium hydride Substances 0.000 description 5
- 125000001544 thienyl group Chemical group 0.000 description 5
- 238000005406 washing Methods 0.000 description 5
- 125000006705 (C5-C7) cycloalkyl group Chemical group 0.000 description 4
- VKRKCBWIVLSRBJ-UHFFFAOYSA-N 1,4-dioxaspiro[4.5]decan-8-one Chemical compound C1CC(=O)CCC21OCCO2 VKRKCBWIVLSRBJ-UHFFFAOYSA-N 0.000 description 4
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 4
- QTDXSEZXAPHVBI-UHFFFAOYSA-N 4-methylcyclohexane-1-carboxylic acid Chemical compound CC1CCC(C(O)=O)CC1 QTDXSEZXAPHVBI-UHFFFAOYSA-N 0.000 description 4
- VSBSZSMJLXBCCV-SAABIXHNSA-N C1C[C@@H](C)CC[C@@H]1C(=O)N(C1=C(SC(=C1)C1CCC(C)(C)CC1)C(O)=O)C1COCOC1 Chemical compound C1C[C@@H](C)CC[C@@H]1C(=O)N(C1=C(SC(=C1)C1CCC(C)(C)CC1)C(O)=O)C1COCOC1 VSBSZSMJLXBCCV-SAABIXHNSA-N 0.000 description 4
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N EtOH Substances CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 4
- KDXKERNSBIXSRK-YFKPBYRVSA-N L-lysine Chemical compound NCCCC[C@H](N)C(O)=O KDXKERNSBIXSRK-YFKPBYRVSA-N 0.000 description 4
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 4
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 4
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 4
- WFDIJRYMOXRFFG-UHFFFAOYSA-N acetic acid anhydride Natural products CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 4
- 235000019270 ammonium chloride Nutrition 0.000 description 4
- 238000004458 analytical method Methods 0.000 description 4
- 125000004196 benzothienyl group Chemical group S1C(=CC2=C1C=CC=C2)* 0.000 description 4
- 230000005587 bubbling Effects 0.000 description 4
- FJDQFPXHSGXQBY-UHFFFAOYSA-L caesium carbonate Chemical compound [Cs+].[Cs+].[O-]C([O-])=O FJDQFPXHSGXQBY-UHFFFAOYSA-L 0.000 description 4
- 229910000024 caesium carbonate Inorganic materials 0.000 description 4
- 239000000969 carrier Substances 0.000 description 4
- 239000003153 chemical reaction reagent Substances 0.000 description 4
- 238000009833 condensation Methods 0.000 description 4
- 230000005494 condensation Effects 0.000 description 4
- 125000003678 cyclohexadienyl group Chemical group C1(=CC=CCC1)* 0.000 description 4
- 125000000640 cyclooctyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C([H])([H])C1([H])[H] 0.000 description 4
- 229940079593 drug Drugs 0.000 description 4
- 239000001257 hydrogen Substances 0.000 description 4
- 238000002347 injection Methods 0.000 description 4
- 239000007924 injection Substances 0.000 description 4
- 239000011159 matrix material Substances 0.000 description 4
- GFOIAINHMGKDME-UHFFFAOYSA-N methyl 5-(cyclohexen-1-yl)-3-[(4-hydroxycyclohexyl)-(4-methylcyclohexanecarbonyl)amino]thiophene-2-carboxylate Chemical compound COC(=O)C=1SC(C=2CCCCC=2)=CC=1N(C(=O)C1CCC(C)CC1)C1CCC(O)CC1 GFOIAINHMGKDME-UHFFFAOYSA-N 0.000 description 4
- 125000002950 monocyclic group Chemical group 0.000 description 4
- 230000010076 replication Effects 0.000 description 4
- 229910052938 sodium sulfate Inorganic materials 0.000 description 4
- 235000011152 sodium sulphate Nutrition 0.000 description 4
- 239000007921 spray Substances 0.000 description 4
- 239000000375 suspending agent Substances 0.000 description 4
- FPGGTKZVZWFYPV-UHFFFAOYSA-M tetrabutylammonium fluoride Chemical compound [F-].CCCC[N+](CCCC)(CCCC)CCCC FPGGTKZVZWFYPV-UHFFFAOYSA-M 0.000 description 4
- RNEQXUALSHFBCE-UHFFFAOYSA-N 3-[(4-hydroxycyclohexyl)-(4-methylcyclohexanecarbonyl)amino]-5-(4-oxocyclohexen-1-yl)thiophene-2-carboxylic acid Chemical compound C1CC(C)CCC1C(=O)N(C1=C(SC(=C1)C=1CCC(=O)CC=1)C(O)=O)C1CCC(O)CC1 RNEQXUALSHFBCE-UHFFFAOYSA-N 0.000 description 3
- CCFPXCANXFKCOE-UHFFFAOYSA-N 3-[(4-hydroxycyclohexyl)-(4-methylcyclohexanecarbonyl)amino]thiophene-2-carboxylic acid Chemical compound C1CC(C)CCC1C(=O)N(C1=C(SC=C1)C(O)=O)C1CCC(O)CC1 CCFPXCANXFKCOE-UHFFFAOYSA-N 0.000 description 3
- KHTGWQYWBVTUTI-UHFFFAOYSA-N 4-(1,2,4-triazol-1-yl)cyclohexan-1-one Chemical compound C1CC(=O)CCC1N1N=CN=C1 KHTGWQYWBVTUTI-UHFFFAOYSA-N 0.000 description 3
- JNFOVWRVUGBVAH-UHFFFAOYSA-N 8-methyl-1,4-dioxaspiro[4.5]decane-8-carbonitrile Chemical compound C1CC(C)(C#N)CCC21OCCO2 JNFOVWRVUGBVAH-UHFFFAOYSA-N 0.000 description 3
- VJZBGDJWIYJHCU-UHFFFAOYSA-N 9,12-dioxa-2,4-diazadispiro[4.2.4^{8}.2^{5}]tetradecane-1,3-dione Chemical compound N1C(=O)NC(=O)C11CCC2(OCCO2)CC1 VJZBGDJWIYJHCU-UHFFFAOYSA-N 0.000 description 3
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- YARFHYQWCPLHGK-VJVRBHMKSA-N C1C[C@@H](OC)CC[C@@H]1N(C1=C(SC(=C1)C1CCC(F)(F)CC1)C(O)=O)C(=O)[C@@H]1CC[C@@H](C)CC1 Chemical compound C1C[C@@H](OC)CC[C@@H]1N(C1=C(SC(=C1)C1CCC(F)(F)CC1)C(O)=O)C(=O)[C@@H]1CC[C@@H](C)CC1 YARFHYQWCPLHGK-VJVRBHMKSA-N 0.000 description 3
- QVBYCKAQILQSKF-KESTWPANSA-N C[C@H](CC1)CC[C@@H]1C(N(C1CC[N+](C)(C)CC1)C1=C(C([O-])=O)SC(C2=CCCCC2)=C1)=O Chemical compound C[C@H](CC1)CC[C@@H]1C(N(C1CC[N+](C)(C)CC1)C1=C(C([O-])=O)SC(C2=CCCCC2)=C1)=O QVBYCKAQILQSKF-KESTWPANSA-N 0.000 description 3
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 3
- 229940121759 Helicase inhibitor Drugs 0.000 description 3
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 3
- PGBFYLVIMDQYMS-UHFFFAOYSA-N Methyl thiophene-2-carboxylate Chemical compound COC(=O)C1=CC=CS1 PGBFYLVIMDQYMS-UHFFFAOYSA-N 0.000 description 3
- JGFZNNIVVJXRND-UHFFFAOYSA-N N,N-diisopropylethylamine Substances CCN(C(C)C)C(C)C JGFZNNIVVJXRND-UHFFFAOYSA-N 0.000 description 3
- 229940123066 Polymerase inhibitor Drugs 0.000 description 3
- RWRDLPDLKQPQOW-UHFFFAOYSA-N Pyrrolidine Chemical compound C1CCNC1 RWRDLPDLKQPQOW-UHFFFAOYSA-N 0.000 description 3
- 229940122055 Serine protease inhibitor Drugs 0.000 description 3
- 101710102218 Serine protease inhibitor Proteins 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- 150000007513 acids Chemical class 0.000 description 3
- 235000001014 amino acid Nutrition 0.000 description 3
- 150000001413 amino acids Chemical class 0.000 description 3
- 125000004202 aminomethyl group Chemical group [H]N([H])C([H])([H])* 0.000 description 3
- 239000008346 aqueous phase Substances 0.000 description 3
- 238000003556 assay Methods 0.000 description 3
- 125000000499 benzofuranyl group Chemical group O1C(=CC2=C1C=CC=C2)* 0.000 description 3
- 125000001164 benzothiazolyl group Chemical group S1C(=NC2=C1C=CC=C2)* 0.000 description 3
- 125000004541 benzoxazolyl group Chemical group O1C(=NC2=C1C=CC=C2)* 0.000 description 3
- 230000015572 biosynthetic process Effects 0.000 description 3
- 239000004305 biphenyl Substances 0.000 description 3
- 235000010290 biphenyl Nutrition 0.000 description 3
- 210000004369 blood Anatomy 0.000 description 3
- 239000008280 blood Substances 0.000 description 3
- 239000002775 capsule Substances 0.000 description 3
- 229910002092 carbon dioxide Inorganic materials 0.000 description 3
- 238000004113 cell culture Methods 0.000 description 3
- 239000006071 cream Substances 0.000 description 3
- 125000000522 cyclooctenyl group Chemical group C1(=CCCCCCC1)* 0.000 description 3
- 125000000058 cyclopentadienyl group Chemical group C1(=CC=CC1)* 0.000 description 3
- 239000002270 dispersing agent Substances 0.000 description 3
- 239000002552 dosage form Substances 0.000 description 3
- 239000000839 emulsion Substances 0.000 description 3
- ZSWFCLXCOIISFI-UHFFFAOYSA-N endo-cyclopentadiene Natural products C1C=CC=C1 ZSWFCLXCOIISFI-UHFFFAOYSA-N 0.000 description 3
- 238000009472 formulation Methods 0.000 description 3
- 125000002541 furyl group Chemical group 0.000 description 3
- 235000011187 glycerol Nutrition 0.000 description 3
- 125000001188 haloalkyl group Chemical group 0.000 description 3
- 208000006454 hepatitis Diseases 0.000 description 3
- 231100000283 hepatitis Toxicity 0.000 description 3
- 125000004404 heteroalkyl group Chemical group 0.000 description 3
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 3
- 125000001041 indolyl group Chemical group 0.000 description 3
- 238000001802 infusion Methods 0.000 description 3
- 238000001990 intravenous administration Methods 0.000 description 3
- 229910052744 lithium Inorganic materials 0.000 description 3
- 238000004519 manufacturing process Methods 0.000 description 3
- 239000000463 material Substances 0.000 description 3
- 239000002773 nucleotide Substances 0.000 description 3
- 125000003729 nucleotide group Chemical group 0.000 description 3
- 230000003287 optical effect Effects 0.000 description 3
- 125000004193 piperazinyl group Chemical group 0.000 description 3
- 125000003367 polycyclic group Chemical group 0.000 description 3
- 125000000168 pyrrolyl group Chemical group 0.000 description 3
- 125000002943 quinolinyl group Chemical group N1=C(C=CC2=CC=CC=C12)* 0.000 description 3
- 230000004044 response Effects 0.000 description 3
- 239000000758 substrate Substances 0.000 description 3
- 238000003786 synthesis reaction Methods 0.000 description 3
- 239000003826 tablet Substances 0.000 description 3
- 125000000335 thiazolyl group Chemical group 0.000 description 3
- 241000701447 unidentified baculovirus Species 0.000 description 3
- 238000001262 western blot Methods 0.000 description 3
- WSLDOOZREJYCGB-UHFFFAOYSA-N 1,2-Dichloroethane Chemical compound ClCCCl WSLDOOZREJYCGB-UHFFFAOYSA-N 0.000 description 2
- WDXCZWJQOFPQOS-UHFFFAOYSA-N 1,4-dioxaspiro[4.5]dec-7-en-8-ylboronic acid Chemical compound C1CC(B(O)O)=CCC21OCCO2 WDXCZWJQOFPQOS-UHFFFAOYSA-N 0.000 description 2
- WZWQNWWFCHNJON-UHFFFAOYSA-N 1,4-dioxaspiro[4.5]decane-8-carbonitrile Chemical compound C1CC(C#N)CCC21OCCO2 WZWQNWWFCHNJON-UHFFFAOYSA-N 0.000 description 2
- FEWLNYSYJNLUOO-UHFFFAOYSA-N 1-Piperidinecarboxaldehyde Chemical compound O=CN1CCCCC1 FEWLNYSYJNLUOO-UHFFFAOYSA-N 0.000 description 2
- TVOYTVJWNZERGX-UHFFFAOYSA-N 2-[8-(nitromethyl)-1,4-dioxaspiro[4.5]decan-8-yl]acetic acid Chemical compound C1CC(CC(=O)O)(C[N+]([O-])=O)CCC21OCCO2 TVOYTVJWNZERGX-UHFFFAOYSA-N 0.000 description 2
- VDCZRVJPEUWFMI-UHFFFAOYSA-N 2-azaspiro[4.5]decane-3,8-dione Chemical compound C1NC(=O)CC21CCC(=O)CC2 VDCZRVJPEUWFMI-UHFFFAOYSA-N 0.000 description 2
- DGMOBVGABMBZSB-UHFFFAOYSA-N 2-methylpropanoyl chloride Chemical compound CC(C)C(Cl)=O DGMOBVGABMBZSB-UHFFFAOYSA-N 0.000 description 2
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 2
- BLNSUWQSBBAVMD-UHFFFAOYSA-N 3-[(4-methoxycyclohexyl)-(4-methylcyclohexanecarbonyl)amino]-5-(4-oxocyclohexyl)thiophene-2-carboxylic acid Chemical compound C1CC(OC)CCC1N(C1=C(SC(=C1)C1CCC(=O)CC1)C(O)=O)C(=O)C1CCC(C)CC1 BLNSUWQSBBAVMD-UHFFFAOYSA-N 0.000 description 2
- QODZHJFYKBFCAJ-UHFFFAOYSA-N 4-(triazol-1-yl)cyclohexan-1-one Chemical compound C1CC(=O)CCC1N1N=NC=C1 QODZHJFYKBFCAJ-UHFFFAOYSA-N 0.000 description 2
- DZZLGMLLNNTZKL-UHFFFAOYSA-N 4-phenoxycyclohexan-1-one Chemical compound C1CC(=O)CCC1OC1=CC=CC=C1 DZZLGMLLNNTZKL-UHFFFAOYSA-N 0.000 description 2
- OQJNOHVPDZQBCM-UHFFFAOYSA-N 5-(3-hydroxycyclohexen-1-yl)-3-[(4-methylcyclohexanecarbonyl)-[4-(oxan-2-yloxy)cyclohexyl]amino]thiophene-2-carboxylic acid Chemical compound C1CC(C)CCC1C(=O)N(C1=C(SC(=C1)C=1CCCC(O)C=1)C(O)=O)C1CCC(OC2OCCCC2)CC1 OQJNOHVPDZQBCM-UHFFFAOYSA-N 0.000 description 2
- QRKLHFIPRBGHGR-UHFFFAOYSA-N 5-(4,4-dimethylcyclohexen-1-yl)-3-[[4-(methoxymethoxy)cyclohexyl]-(4-methylcyclohexanecarbonyl)amino]thiophene-2-carboxylic acid Chemical compound C1CC(OCOC)CCC1N(C1=C(SC(=C1)C=1CCC(C)(C)CC=1)C(O)=O)C(=O)C1CCC(C)CC1 QRKLHFIPRBGHGR-UHFFFAOYSA-N 0.000 description 2
- QMPSPZPLWQPLNV-UHFFFAOYSA-N 5-(cyclohexen-1-yl)-3-[[1-(2,2-difluoroethyl)piperidin-4-yl]-(4-methylcyclohexanecarbonyl)amino]thiophene-2-carboxylic acid Chemical compound C1CC(C)CCC1C(=O)N(C1=C(SC(=C1)C=1CCCCC=1)C(O)=O)C1CCN(CC(F)F)CC1 QMPSPZPLWQPLNV-UHFFFAOYSA-N 0.000 description 2
- XEQYTVWTBFZWLU-UHFFFAOYSA-N 8-azido-1,4-dioxaspiro[4.5]decane Chemical compound C1CC(N=[N+]=[N-])CCC21OCCO2 XEQYTVWTBFZWLU-UHFFFAOYSA-N 0.000 description 2
- GTHRCIGLVKMIOM-UHFFFAOYSA-N 8-phenoxy-1,4-dioxaspiro[4.5]decane Chemical compound O1CCOC11CCC(OC=2C=CC=CC=2)CC1 GTHRCIGLVKMIOM-UHFFFAOYSA-N 0.000 description 2
- NUPNYQFGLIQQGM-UHFFFAOYSA-N 9,12-dioxa-3-azadispiro[4.2.4^{8}.2^{5}]tetradecan-2-one Chemical compound C1NC(=O)CC21CCC1(OCCO1)CC2 NUPNYQFGLIQQGM-UHFFFAOYSA-N 0.000 description 2
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical class N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 2
- ATRRKUHOCOJYRX-UHFFFAOYSA-N Ammonium bicarbonate Chemical compound [NH4+].OC([O-])=O ATRRKUHOCOJYRX-UHFFFAOYSA-N 0.000 description 2
- UUEBOGSQUVQIEE-YSXIEMCBSA-N C1C[C@@H](C)CC[C@@H]1C(=O)N(C1=C(SC(=C1)C1CCC(C)(C)CC1)C(O)=O)[C@@H]1CC[C@@H](F)CC1 Chemical compound C1C[C@@H](C)CC[C@@H]1C(=O)N(C1=C(SC(=C1)C1CCC(C)(C)CC1)C(O)=O)[C@@H]1CC[C@@H](F)CC1 UUEBOGSQUVQIEE-YSXIEMCBSA-N 0.000 description 2
- YIBUSNKWAYXYIB-YSXIEMCBSA-N C1C[C@@H](C)CC[C@@H]1C(=O)N(C1=C(SC(=C1)C1CCCCCC1)C(O)=O)[C@@H]1CC[C@@H](O)CC1 Chemical compound C1C[C@@H](C)CC[C@@H]1C(=O)N(C1=C(SC(=C1)C1CCCCCC1)C(O)=O)[C@@H]1CC[C@@H](O)CC1 YIBUSNKWAYXYIB-YSXIEMCBSA-N 0.000 description 2
- OZNMZONMPKBECR-GFKXMWDQSA-N C1C[C@@H](C)CC[C@@H]1C(=O)N(C1=C(SC(=C1)C=1CCCCC=1)C(O)=O)C1CCC2(C(N(C)C(=O)N2C)=O)CC1 Chemical compound C1C[C@@H](C)CC[C@@H]1C(=O)N(C1=C(SC(=C1)C=1CCCCC=1)C(O)=O)C1CCC2(C(N(C)C(=O)N2C)=O)CC1 OZNMZONMPKBECR-GFKXMWDQSA-N 0.000 description 2
- KCFLNRBBFVETGB-VJVRBHMKSA-N C1C[C@@H](C)CC[C@@H]1C(=O)N(C1=C(SC(=C1)C=1CCCCC=1)C(O)=O)[C@@H]1CC[C@@H](C=2NN=NN=2)CC1 Chemical compound C1C[C@@H](C)CC[C@@H]1C(=O)N(C1=C(SC(=C1)C=1CCCCC=1)C(O)=O)[C@@H]1CC[C@@H](C=2NN=NN=2)CC1 KCFLNRBBFVETGB-VJVRBHMKSA-N 0.000 description 2
- ARGZTWUXBRUFQC-GUJRETQESA-N C1C[C@@H](OCOCC)CC[C@@H]1N(C1=C(SC(=C1)C=1CCCCC=1)C(O)=O)C(=O)[C@@H]1CC[C@@H](C)CC1 Chemical compound C1C[C@@H](OCOCC)CC[C@@H]1N(C1=C(SC(=C1)C=1CCCCC=1)C(O)=O)C(=O)[C@@H]1CC[C@@H](C)CC1 ARGZTWUXBRUFQC-GUJRETQESA-N 0.000 description 2
- JIAZOZWJVJSOKM-KESTWPANSA-N COC(=O)C=1SC(C=2CCCCC=2)=CC=1N(C(=O)[C@@H]1CC[C@@H](C)CC1)C1CCN(CC(F)F)CC1 Chemical compound COC(=O)C=1SC(C=2CCCCC=2)=CC=1N(C(=O)[C@@H]1CC[C@@H](C)CC1)C1CCN(CC(F)F)CC1 JIAZOZWJVJSOKM-KESTWPANSA-N 0.000 description 2
- HCPWLJURHZATCV-UAPYVXQJSA-N COC(=O)C=1SC(C=2CCCCC=2)=CC=1N(C(=O)[C@@H]1CC[C@@H](C)CC1)C1CCNCC1 Chemical compound COC(=O)C=1SC(C=2CCCCC=2)=CC=1N(C(=O)[C@@H]1CC[C@@H](C)CC1)C1CCNCC1 HCPWLJURHZATCV-UAPYVXQJSA-N 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 2
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- XJUZRXYOEPSWMB-UHFFFAOYSA-N Chloromethyl methyl ether Chemical compound COCCl XJUZRXYOEPSWMB-UHFFFAOYSA-N 0.000 description 2
- 241000710777 Classical swine fever virus Species 0.000 description 2
- 108091026890 Coding region Proteins 0.000 description 2
- 108020004414 DNA Proteins 0.000 description 2
- 241000710831 Flavivirus Species 0.000 description 2
- 108010010803 Gelatin Proteins 0.000 description 2
- 235000010469 Glycine max Nutrition 0.000 description 2
- 241000711549 Hepacivirus C Species 0.000 description 2
- 241000238631 Hexapoda Species 0.000 description 2
- 235000019766 L-Lysine Nutrition 0.000 description 2
- 239000004472 Lysine Substances 0.000 description 2
- 241000124008 Mammalia Species 0.000 description 2
- MZRVEZGGRBJDDB-UHFFFAOYSA-N N-Butyllithium Chemical compound [Li]CCCC MZRVEZGGRBJDDB-UHFFFAOYSA-N 0.000 description 2
- 229930040373 Paraformaldehyde Natural products 0.000 description 2
- 102000035195 Peptidases Human genes 0.000 description 2
- 108091005804 Peptidases Proteins 0.000 description 2
- XBDQKXXYIPTUBI-UHFFFAOYSA-M Propionate Chemical compound CCC([O-])=O XBDQKXXYIPTUBI-UHFFFAOYSA-M 0.000 description 2
- 239000004365 Protease Substances 0.000 description 2
- 102000007056 Recombinant Fusion Proteins Human genes 0.000 description 2
- 108010008281 Recombinant Fusion Proteins Proteins 0.000 description 2
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 description 2
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 2
- 108010090804 Streptavidin Proteins 0.000 description 2
- 229930006000 Sucrose Natural products 0.000 description 2
- CZMRCDWAGMRECN-UGDNZRGBSA-N Sucrose Chemical compound O[C@H]1[C@H](O)[C@@H](CO)O[C@@]1(CO)O[C@@H]1[C@H](O)[C@@H](O)[C@H](O)[C@@H](CO)O1 CZMRCDWAGMRECN-UGDNZRGBSA-N 0.000 description 2
- OKJPEAGHQZHRQV-UHFFFAOYSA-N Triiodomethane Natural products IC(I)I OKJPEAGHQZHRQV-UHFFFAOYSA-N 0.000 description 2
- 229920004890 Triton X-100 Polymers 0.000 description 2
- 239000013504 Triton X-100 Substances 0.000 description 2
- 239000000443 aerosol Substances 0.000 description 2
- 125000003368 amide group Chemical group 0.000 description 2
- 239000001099 ammonium carbonate Substances 0.000 description 2
- 235000012501 ammonium carbonate Nutrition 0.000 description 2
- 125000003725 azepanyl group Chemical group 0.000 description 2
- QARVLSVVCXYDNA-UHFFFAOYSA-N bromobenzene Chemical compound BrC1=CC=CC=C1 QARVLSVVCXYDNA-UHFFFAOYSA-N 0.000 description 2
- 239000000872 buffer Substances 0.000 description 2
- KQIADDMXRMTWHZ-UHFFFAOYSA-N chloro-tri(propan-2-yl)silane Chemical compound CC(C)[Si](Cl)(C(C)C)C(C)C KQIADDMXRMTWHZ-UHFFFAOYSA-N 0.000 description 2
- 229940061627 chloromethyl methyl ether Drugs 0.000 description 2
- 239000012230 colorless oil Substances 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- JHIVVAPYMSGYDF-UHFFFAOYSA-N cyclohexanone Chemical compound O=C1CCCCC1 JHIVVAPYMSGYDF-UHFFFAOYSA-N 0.000 description 2
- XZWQKJXJNKYMAP-UHFFFAOYSA-N cyclohexen-1-ylboronic acid Chemical compound OB(O)C1=CCCCC1 XZWQKJXJNKYMAP-UHFFFAOYSA-N 0.000 description 2
- 238000011161 development Methods 0.000 description 2
- 239000003995 emulsifying agent Substances 0.000 description 2
- 230000002708 enhancing effect Effects 0.000 description 2
- 150000002148 esters Chemical class 0.000 description 2
- PQVSTLUFSYVLTO-UHFFFAOYSA-N ethyl n-ethoxycarbonylcarbamate Chemical compound CCOC(=O)NC(=O)OCC PQVSTLUFSYVLTO-UHFFFAOYSA-N 0.000 description 2
- 238000001704 evaporation Methods 0.000 description 2
- 230000008020 evaporation Effects 0.000 description 2
- 238000000605 extraction Methods 0.000 description 2
- WBJINCZRORDGAQ-UHFFFAOYSA-N formic acid ethyl ester Natural products CCOC=O WBJINCZRORDGAQ-UHFFFAOYSA-N 0.000 description 2
- 238000004108 freeze drying Methods 0.000 description 2
- 230000006870 function Effects 0.000 description 2
- 239000007789 gas Substances 0.000 description 2
- 239000008273 gelatin Substances 0.000 description 2
- 229920000159 gelatin Polymers 0.000 description 2
- 235000019322 gelatine Nutrition 0.000 description 2
- 235000011852 gelatine desserts Nutrition 0.000 description 2
- 239000001963 growth medium Substances 0.000 description 2
- 125000006038 hexenyl group Chemical group 0.000 description 2
- 239000012535 impurity Substances 0.000 description 2
- 239000004615 ingredient Substances 0.000 description 2
- 229940079322 interferon Drugs 0.000 description 2
- 230000000670 limiting effect Effects 0.000 description 2
- CDOSHBSSFJOMGT-UHFFFAOYSA-N linalool Chemical compound CC(C)=CCCC(C)(O)C=C CDOSHBSSFJOMGT-UHFFFAOYSA-N 0.000 description 2
- GLXDVVHUTZTUQK-UHFFFAOYSA-M lithium hydroxide monohydrate Substances [Li+].O.[OH-] GLXDVVHUTZTUQK-UHFFFAOYSA-M 0.000 description 2
- 229940040692 lithium hydroxide monohydrate Drugs 0.000 description 2
- 239000006210 lotion Substances 0.000 description 2
- 239000007937 lozenge Substances 0.000 description 2
- 238000005259 measurement Methods 0.000 description 2
- 229940098779 methanesulfonic acid Drugs 0.000 description 2
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 2
- KMTPLRIOOJYJQD-UHFFFAOYSA-N methyl 3-(1,4-dioxaspiro[4.5]decan-8-ylamino)thiophene-2-carboxylate Chemical compound S1C=CC(NC2CCC3(CC2)OCCO3)=C1C(=O)OC KMTPLRIOOJYJQD-UHFFFAOYSA-N 0.000 description 2
- JEMOHNKXRFEUDT-UHFFFAOYSA-N methyl 3-[(2-methylpropan-2-yl)oxycarbonylamino]thiophene-2-carboxylate Chemical compound COC(=O)C=1SC=CC=1NC(=O)OC(C)(C)C JEMOHNKXRFEUDT-UHFFFAOYSA-N 0.000 description 2
- XYRRRTDDQUCNQM-UHFFFAOYSA-N methyl 3-amino-5-(cyclohexen-1-yl)thiophene-2-carboxylate Chemical compound NC1=C(C(=O)OC)SC(C=2CCCCC=2)=C1 XYRRRTDDQUCNQM-UHFFFAOYSA-N 0.000 description 2
- RZYLOBBUEWSONL-UHFFFAOYSA-N methyl 3-amino-5-bromothiophene-2-carboxylate Chemical compound COC(=O)C=1SC(Br)=CC=1N RZYLOBBUEWSONL-UHFFFAOYSA-N 0.000 description 2
- JWGYYGHNONYRSO-UHFFFAOYSA-N methyl 5-bromo-3-(1,4-dioxaspiro[4.5]decan-8-ylamino)thiophene-2-carboxylate Chemical compound S1C(Br)=CC(NC2CCC3(CC2)OCCO3)=C1C(=O)OC JWGYYGHNONYRSO-UHFFFAOYSA-N 0.000 description 2
- 238000012986 modification Methods 0.000 description 2
- 230000004048 modification Effects 0.000 description 2
- 239000012452 mother liquor Substances 0.000 description 2
- 239000002777 nucleoside Substances 0.000 description 2
- 239000002674 ointment Substances 0.000 description 2
- 125000002971 oxazolyl group Chemical group 0.000 description 2
- KJIFKLIQANRMOU-UHFFFAOYSA-N oxidanium;4-methylbenzenesulfonate Chemical compound O.CC1=CC=C(S(O)(=O)=O)C=C1 KJIFKLIQANRMOU-UHFFFAOYSA-N 0.000 description 2
- 230000003647 oxidation Effects 0.000 description 2
- 238000007254 oxidation reaction Methods 0.000 description 2
- 229920002866 paraformaldehyde Polymers 0.000 description 2
- 239000002245 particle Substances 0.000 description 2
- 239000006072 paste Substances 0.000 description 2
- 239000012071 phase Substances 0.000 description 2
- NNFCIKHAZHQZJG-UHFFFAOYSA-N potassium cyanide Chemical compound [K+].N#[C-] NNFCIKHAZHQZJG-UHFFFAOYSA-N 0.000 description 2
- 239000002244 precipitate Substances 0.000 description 2
- 239000003755 preservative agent Substances 0.000 description 2
- 125000006513 pyridinyl methyl group Chemical group 0.000 description 2
- 238000007127 saponification reaction Methods 0.000 description 2
- 238000000926 separation method Methods 0.000 description 2
- 229910052708 sodium Inorganic materials 0.000 description 2
- 239000001632 sodium acetate Substances 0.000 description 2
- 235000017281 sodium acetate Nutrition 0.000 description 2
- DAEPDZWVDSPTHF-UHFFFAOYSA-M sodium pyruvate Chemical compound [Na+].CC(=O)C([O-])=O DAEPDZWVDSPTHF-UHFFFAOYSA-M 0.000 description 2
- 239000003381 stabilizer Substances 0.000 description 2
- UCSJYZPVAKXKNQ-HZYVHMACSA-N streptomycin Chemical compound CN[C@H]1[C@H](O)[C@@H](O)[C@H](CO)O[C@H]1O[C@@H]1[C@](C=O)(O)[C@H](C)O[C@H]1O[C@@H]1[C@@H](NC(N)=N)[C@H](O)[C@@H](NC(N)=N)[C@H](O)[C@H]1O UCSJYZPVAKXKNQ-HZYVHMACSA-N 0.000 description 2
- 239000005720 sucrose Substances 0.000 description 2
- 239000000829 suppository Substances 0.000 description 2
- 239000002562 thickening agent Substances 0.000 description 2
- 229930192474 thiophene Natural products 0.000 description 2
- QERYCTSHXKAMIS-UHFFFAOYSA-M thiophene-2-carboxylate Chemical compound [O-]C(=O)C1=CC=CS1 QERYCTSHXKAMIS-UHFFFAOYSA-M 0.000 description 2
- MGSRCZKZVOBKFT-UHFFFAOYSA-N thymol Chemical compound CC(C)C1=CC=C(C)C=C1O MGSRCZKZVOBKFT-UHFFFAOYSA-N 0.000 description 2
- 125000003944 tolyl group Chemical group 0.000 description 2
- 238000013519 translation Methods 0.000 description 2
- AQRLNPVMDITEJU-UHFFFAOYSA-N triethylsilane Chemical compound CC[SiH](CC)CC AQRLNPVMDITEJU-UHFFFAOYSA-N 0.000 description 2
- DCGLONGLPGISNX-UHFFFAOYSA-N trimethyl(prop-1-ynyl)silane Chemical compound CC#C[Si](C)(C)C DCGLONGLPGISNX-UHFFFAOYSA-N 0.000 description 2
- 230000029812 viral genome replication Effects 0.000 description 2
- NOOLISFMXDJSKH-UTLUCORTSA-N (+)-Neomenthol Chemical compound CC(C)[C@@H]1CC[C@@H](C)C[C@@H]1O NOOLISFMXDJSKH-UTLUCORTSA-N 0.000 description 1
- CYPYTURSJDMMMP-WVCUSYJESA-N (1e,4e)-1,5-diphenylpenta-1,4-dien-3-one;palladium Chemical compound [Pd].[Pd].C=1C=CC=CC=1\C=C\C(=O)\C=C\C1=CC=CC=C1.C=1C=CC=CC=1\C=C\C(=O)\C=C\C1=CC=CC=C1.C=1C=CC=CC=1\C=C\C(=O)\C=C\C1=CC=CC=C1 CYPYTURSJDMMMP-WVCUSYJESA-N 0.000 description 1
- RRKODOZNUZCUBN-CCAGOZQPSA-N (1z,3z)-cycloocta-1,3-diene Chemical compound C1CC\C=C/C=C\C1 RRKODOZNUZCUBN-CCAGOZQPSA-N 0.000 description 1
- 239000001490 (3R)-3,7-dimethylocta-1,6-dien-3-ol Substances 0.000 description 1
- PCXQRRQONBYBHO-UHFFFAOYSA-N (4-phenoxycyclohexen-1-yl) trifluoromethanesulfonate Chemical compound C1CC(OS(=O)(=O)C(F)(F)F)=CCC1OC1=CC=CC=C1 PCXQRRQONBYBHO-UHFFFAOYSA-N 0.000 description 1
- 125000006650 (C2-C4) alkynyl group Chemical group 0.000 description 1
- 125000006376 (C3-C10) cycloalkyl group Chemical group 0.000 description 1
- 125000006272 (C3-C7) cycloalkyl group Chemical group 0.000 description 1
- CDOSHBSSFJOMGT-JTQLQIEISA-N (R)-linalool Natural products CC(C)=CCC[C@@](C)(O)C=C CDOSHBSSFJOMGT-JTQLQIEISA-N 0.000 description 1
- 230000006269 (delayed) early viral mRNA transcription Effects 0.000 description 1
- 102000040650 (ribonucleotides)n+m Human genes 0.000 description 1
- VMFCTZUYOILUMY-UHFFFAOYSA-N 1,1-difluoro-2-iodoethane Chemical compound FC(F)CI VMFCTZUYOILUMY-UHFFFAOYSA-N 0.000 description 1
- OSQAYXCDJAOMDA-UHFFFAOYSA-N 1,2,5,6,8,8a-hexahydroindolizine-3,7-dione Chemical compound C1C(=O)CCN2C(=O)CCC21 OSQAYXCDJAOMDA-UHFFFAOYSA-N 0.000 description 1
- DDMOUSALMHHKOS-UHFFFAOYSA-N 1,2-dichloro-1,1,2,2-tetrafluoroethane Chemical compound FC(F)(Cl)C(F)(F)Cl DDMOUSALMHHKOS-UHFFFAOYSA-N 0.000 description 1
- SZVHDRLVQJXQBT-UHFFFAOYSA-N 1,3-dimethoxypropan-2-one Chemical compound COCC(=O)COC SZVHDRLVQJXQBT-UHFFFAOYSA-N 0.000 description 1
- HKQTYQDNCKMNHZ-UHFFFAOYSA-N 1,4-dioxaspiro[4.5]decan-8-ol Chemical compound C1CC(O)CCC21OCCO2 HKQTYQDNCKMNHZ-UHFFFAOYSA-N 0.000 description 1
- FTXBKFXPNSRBDW-UHFFFAOYSA-N 1-(1,4-dioxaspiro[4.5]decan-8-yl)-1,2,4-triazole Chemical compound O1CCOC11CCC(N2N=CN=C2)CC1 FTXBKFXPNSRBDW-UHFFFAOYSA-N 0.000 description 1
- VDNFJEDSFOJTFV-UHFFFAOYSA-N 1-(1,4-dioxaspiro[4.5]decan-8-yl)triazole Chemical compound O1CCOC11CCC(N2N=NC=C2)CC1 VDNFJEDSFOJTFV-UHFFFAOYSA-N 0.000 description 1
- IWUCXVSUMQZMFG-RGDLXGNYSA-N 1-[(2s,3s,4r,5s)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1,2,4-triazole-3-carboxamide Chemical compound N1=C(C(=O)N)N=CN1[C@@H]1[C@@H](O)[C@@H](O)[C@H](CO)O1 IWUCXVSUMQZMFG-RGDLXGNYSA-N 0.000 description 1
- 239000001074 1-methoxy-4-[(E)-prop-1-enyl]benzene Substances 0.000 description 1
- DDSBNJVJUCCGNO-UHFFFAOYSA-N 1-methyl-4-oxocyclohexane-1-carbonitrile Chemical compound N#CC1(C)CCC(=O)CC1 DDSBNJVJUCCGNO-UHFFFAOYSA-N 0.000 description 1
- 125000004484 1-methylpiperidin-4-yl group Chemical group CN1CCC(CC1)* 0.000 description 1
- QWENRTYMTSOGBR-UHFFFAOYSA-N 1H-1,2,3-Triazole Chemical compound C=1C=NNN=1 QWENRTYMTSOGBR-UHFFFAOYSA-N 0.000 description 1
- YBYIRNPNPLQARY-UHFFFAOYSA-N 1H-indene Natural products C1=CC=C2CC=CC2=C1 YBYIRNPNPLQARY-UHFFFAOYSA-N 0.000 description 1
- IIEQJSIHKZXTHY-UHFFFAOYSA-N 2,2-dimethylpropanoyloxymethoxymethyl 2,2-dimethylpropanoate Chemical compound CC(C)(C)C(=O)OCOCOC(=O)C(C)(C)C IIEQJSIHKZXTHY-UHFFFAOYSA-N 0.000 description 1
- QVDOCNRIQLYHGK-UHFFFAOYSA-N 2,4-dimethyl-9,12-dioxa-2,4-diazadispiro[4.2.4^{8}.2^{5}]tetradecan-3-one Chemical compound CN1C(=O)N(C)CC11CCC2(OCCO2)CC1 QVDOCNRIQLYHGK-UHFFFAOYSA-N 0.000 description 1
- BIVITDRRVUSHJW-UHFFFAOYSA-N 2-(1,4-dioxaspiro[4.5]decan-8-ylidene)acetic acid Chemical compound C1CC(=CC(=O)O)CCC21OCCO2 BIVITDRRVUSHJW-UHFFFAOYSA-N 0.000 description 1
- POQLVOYRGNFGRM-UHFFFAOYSA-N 2-Tetradecanone Chemical compound CCCCCCCCCCCCC(C)=O POQLVOYRGNFGRM-UHFFFAOYSA-N 0.000 description 1
- KJJPLEZQSCZCKE-UHFFFAOYSA-N 2-aminopropane-1,3-diol Chemical compound OCC(N)CO KJJPLEZQSCZCKE-UHFFFAOYSA-N 0.000 description 1
- UOCKAJKVYAPUAJ-UHFFFAOYSA-N 2-pyrrolidin-1-yl-1H-azepine Chemical compound C1CCCN1C1=CC=CC=CN1 UOCKAJKVYAPUAJ-UHFFFAOYSA-N 0.000 description 1
- AGIJRRREJXSQJR-UHFFFAOYSA-N 2h-thiazine Chemical compound N1SC=CC=C1 AGIJRRREJXSQJR-UHFFFAOYSA-N 0.000 description 1
- KHCXGFNZZRXOND-UHFFFAOYSA-N 3-(bromomethyl)pyridine Chemical compound BrCC1=CC=CN=C1 KHCXGFNZZRXOND-UHFFFAOYSA-N 0.000 description 1
- AKXYKVHNZQCHMF-UHFFFAOYSA-N 3-amino-4-methylthiophene-2-carboxylic acid Chemical compound CC1=CSC(C(O)=O)=C1N AKXYKVHNZQCHMF-UHFFFAOYSA-N 0.000 description 1
- PDZFCYUQPCIRNP-UHFFFAOYSA-N 3-amino-5-(cyclohexen-1-yl)thiophene-2-carboxylic acid Chemical compound C1(=CCCCC1)C1=CC(=C(S1)C(=O)O)N PDZFCYUQPCIRNP-UHFFFAOYSA-N 0.000 description 1
- VECHSBHMUYHDPV-UHFFFAOYSA-N 3-amino-5-bromo-4-methylthiophene-2-carboxylic acid Chemical compound CC=1C(=C(SC=1Br)C(=O)O)N VECHSBHMUYHDPV-UHFFFAOYSA-N 0.000 description 1
- OQEBBZSWEGYTPG-UHFFFAOYSA-N 3-aminobutanoic acid Chemical compound CC(N)CC(O)=O OQEBBZSWEGYTPG-UHFFFAOYSA-N 0.000 description 1
- AJKDUJRRWLQXHM-UHFFFAOYSA-N 3-bromocyclohexene Chemical compound BrC1CCCC=C1 AJKDUJRRWLQXHM-UHFFFAOYSA-N 0.000 description 1
- 125000006201 3-phenylpropyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- WHGMHGPIJZTKTI-UHFFFAOYSA-N 3h-1,2-benzodithiole Chemical compound C1=CC=C2CSSC2=C1 WHGMHGPIJZTKTI-UHFFFAOYSA-N 0.000 description 1
- ZOLNSECVOZFNLU-UHFFFAOYSA-N 3h-1,2-benzoxathiole Chemical compound C1=CC=C2CSOC2=C1 ZOLNSECVOZFNLU-UHFFFAOYSA-N 0.000 description 1
- PXQMSTLNSHMSJB-UHFFFAOYSA-N 4,4-dimethylcyclohexan-1-one Chemical compound CC1(C)CCC(=O)CC1 PXQMSTLNSHMSJB-UHFFFAOYSA-N 0.000 description 1
- JLAKCHGEEBPDQI-UHFFFAOYSA-N 4-(4-fluorobenzyl)piperidine Chemical compound C1=CC(F)=CC=C1CC1CCNCC1 JLAKCHGEEBPDQI-UHFFFAOYSA-N 0.000 description 1
- VMWOMVJNSSRZCP-UHFFFAOYSA-N 4-chloro-1,1-dimethylcyclohexane Chemical compound CC1(C)CCC(Cl)CC1 VMWOMVJNSSRZCP-UHFFFAOYSA-N 0.000 description 1
- NSPMIYGKQJPBQR-UHFFFAOYSA-N 4H-1,2,4-triazole Chemical compound C=1N=CNN=1 NSPMIYGKQJPBQR-UHFFFAOYSA-N 0.000 description 1
- VBLAAESAMSKCOO-UHFFFAOYSA-N 5-(1,2,4-triazol-1-yl)heptan-2-one Chemical compound CC(=O)CCC(CC)N1C=NC=N1 VBLAAESAMSKCOO-UHFFFAOYSA-N 0.000 description 1
- LNYKGELUODVSNS-UHFFFAOYSA-N 5-(cyclohexen-1-yl)-3-[(4-methoxycyclohexyl)-(4-methylcyclohexanecarbonyl)amino]thiophene-2-carboxylic acid Chemical compound C1CC(OC)CCC1N(C1=C(SC(=C1)C=1CCCCC=1)C(O)=O)C(=O)C1CCC(C)CC1 LNYKGELUODVSNS-UHFFFAOYSA-N 0.000 description 1
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical group [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- HBAQYPYDRFILMT-UHFFFAOYSA-N 8-[3-(1-cyclopropylpyrazol-4-yl)-1H-pyrazolo[4,3-d]pyrimidin-5-yl]-3-methyl-3,8-diazabicyclo[3.2.1]octan-2-one Chemical class C1(CC1)N1N=CC(=C1)C1=NNC2=C1N=C(N=C2)N1C2C(N(CC1CC2)C)=O HBAQYPYDRFILMT-UHFFFAOYSA-N 0.000 description 1
- AMQIRCLQGYEIQA-UHFFFAOYSA-N 9,12-dioxa-2,4-diazadispiro[4.2.4^{8}.2^{5}]tetradecan-3-one Chemical compound N1C(=O)NCC11CCC2(OCCO2)CC1 AMQIRCLQGYEIQA-UHFFFAOYSA-N 0.000 description 1
- 244000215068 Acacia senegal Species 0.000 description 1
- 102100036475 Alanine aminotransferase 1 Human genes 0.000 description 1
- 108010082126 Alanine transaminase Proteins 0.000 description 1
- 208000002109 Argyria Diseases 0.000 description 1
- KZMGYPLQYOPHEL-UHFFFAOYSA-N Boron trifluoride etherate Chemical compound FB(F)F.CCOCC KZMGYPLQYOPHEL-UHFFFAOYSA-N 0.000 description 1
- 241000283690 Bos taurus Species 0.000 description 1
- 108091003079 Bovine Serum Albumin Proteins 0.000 description 1
- 241000710780 Bovine viral diarrhea virus 1 Species 0.000 description 1
- LIILLHPREYYFSJ-HAQNSBGRSA-N BrC1=CC(=C(S1)C(=O)O)N(C(=O)[C@@H]1CC[C@H](CC1)C)C1COC(OC1)(C)C Chemical compound BrC1=CC(=C(S1)C(=O)O)N(C(=O)[C@@H]1CC[C@H](CC1)C)C1COC(OC1)(C)C LIILLHPREYYFSJ-HAQNSBGRSA-N 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical group [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- COVZYZSDYWQREU-UHFFFAOYSA-N Busulfan Chemical compound CS(=O)(=O)OCCCCOS(C)(=O)=O COVZYZSDYWQREU-UHFFFAOYSA-N 0.000 description 1
- XSKWKTVUQVYCKD-MUVNWNFZSA-N C1C(=NOCC)CCC(C=2SC(=C(N([C@@H]3CC[C@@H](O)CC3)C(=O)[C@@H]3CC[C@@H](C)CC3)C=2)C(O)=O)=C1 Chemical compound C1C(=NOCC)CCC(C=2SC(=C(N([C@@H]3CC[C@@H](O)CC3)C(=O)[C@@H]3CC[C@@H](C)CC3)C=2)C(O)=O)=C1 XSKWKTVUQVYCKD-MUVNWNFZSA-N 0.000 description 1
- KVIIFMHSHSIEHH-OSHZUIANSA-N C1C[C@@H](C)CC[C@@H]1C(=O)N(C1=C(SC(=C1)C1CCC(=O)CC1)C(O)=O)[C@@H]1CC[C@@H](O)CC1 Chemical compound C1C[C@@H](C)CC[C@@H]1C(=O)N(C1=C(SC(=C1)C1CCC(=O)CC1)C(O)=O)[C@@H]1CC[C@@H](O)CC1 KVIIFMHSHSIEHH-OSHZUIANSA-N 0.000 description 1
- VCJJWZOMFHUKMX-VJVRBHMKSA-N C1C[C@@H](C)CC[C@@H]1C(=O)N(C1=C(SC(=C1)C1CCCCC1)C(O)=O)[C@@H]1CC[C@@H](O)CC1 Chemical compound C1C[C@@H](C)CC[C@@H]1C(=O)N(C1=C(SC(=C1)C1CCCCC1)C(O)=O)[C@@H]1CC[C@@H](O)CC1 VCJJWZOMFHUKMX-VJVRBHMKSA-N 0.000 description 1
- KEFGYEBMBUZYLK-QEYNBREGSA-N C1C[C@@H](C)CC[C@@H]1C(=O)N(C1=C(SC(=C1)C=1C2CCC(C2)C=1)C(O)=O)[C@@H]1CC[C@@H](O)CC1 Chemical compound C1C[C@@H](C)CC[C@@H]1C(=O)N(C1=C(SC(=C1)C=1C2CCC(C2)C=1)C(O)=O)[C@@H]1CC[C@@H](O)CC1 KEFGYEBMBUZYLK-QEYNBREGSA-N 0.000 description 1
- UFAKXAOJOPWWCD-GUJRETQESA-N C1C[C@@H](C)CC[C@@H]1C(=O)N(C1=C(SC(=C1)C=1CCC(C)(C)CC=1)C(O)=O)[C@@H]1CC[C@@H](N2N=CN=C2)CC1 Chemical compound C1C[C@@H](C)CC[C@@H]1C(=O)N(C1=C(SC(=C1)C=1CCC(C)(C)CC=1)C(O)=O)[C@@H]1CC[C@@H](N2N=CN=C2)CC1 UFAKXAOJOPWWCD-GUJRETQESA-N 0.000 description 1
- BWSQKLRZLXODAO-BOIGYYLYSA-N C1C[C@@H](C)CC[C@@H]1C(=O)N(C1=C(SC(=C1)C=1CCC(CC=1)=NOCC=1C=CC=CC=1)C(O)=O)[C@@H]1CC[C@@H](O)CC1 Chemical compound C1C[C@@H](C)CC[C@@H]1C(=O)N(C1=C(SC(=C1)C=1CCC(CC=1)=NOCC=1C=CC=CC=1)C(O)=O)[C@@H]1CC[C@@H](O)CC1 BWSQKLRZLXODAO-BOIGYYLYSA-N 0.000 description 1
- JVSQRBKXYYHNAL-CUUIZVKISA-N C1C[C@@H](C)CC[C@@H]1C(=O)N(C1=C(SC(=C1)C=1CCC(CC=1)OC=1C=CC=CC=1)C(O)=O)[C@@H]1CC[C@@H](O)CC1 Chemical compound C1C[C@@H](C)CC[C@@H]1C(=O)N(C1=C(SC(=C1)C=1CCC(CC=1)OC=1C=CC=CC=1)C(O)=O)[C@@H]1CC[C@@H](O)CC1 JVSQRBKXYYHNAL-CUUIZVKISA-N 0.000 description 1
- DHZRKGZVOWHWSR-YSXIEMCBSA-N C1C[C@@H](C)CC[C@@H]1C(=O)N(C1=C(SC(=C1)C=1CCC2(CC=1)OCCO2)C(O)=O)[C@@H]1CC[C@@H](O)CC1 Chemical class C1C[C@@H](C)CC[C@@H]1C(=O)N(C1=C(SC(=C1)C=1CCC2(CC=1)OCCO2)C(O)=O)[C@@H]1CC[C@@H](O)CC1 DHZRKGZVOWHWSR-YSXIEMCBSA-N 0.000 description 1
- USXOSXKMNUPPNO-JOSYPBKRSA-N C1C[C@@H](C)CC[C@@H]1C(=O)N(C1=C(SC(=C1)C=1CCC2CCCCC2C=1)C(O)=O)[C@@H]1CC[C@@H](O)CC1 Chemical compound C1C[C@@H](C)CC[C@@H]1C(=O)N(C1=C(SC(=C1)C=1CCC2CCCCC2C=1)C(O)=O)[C@@H]1CC[C@@H](O)CC1 USXOSXKMNUPPNO-JOSYPBKRSA-N 0.000 description 1
- YWEUSNUNKANIKM-AFARHQOCSA-N C1C[C@@H](C)CC[C@@H]1C(=O)N(C1=C(SC(=C1)C=1CCCCC=1)C(=O)OCOC(=O)C(C)(C)C)C1CCN(C)CC1 Chemical compound C1C[C@@H](C)CC[C@@H]1C(=O)N(C1=C(SC(=C1)C=1CCCCC=1)C(=O)OCOC(=O)C(C)(C)C)C1CCN(C)CC1 YWEUSNUNKANIKM-AFARHQOCSA-N 0.000 description 1
- QMKHTEOIBBSGKN-WHLIJDCNSA-N C1C[C@@H](C)CC[C@@H]1C(=O)N(C1=C(SC(=C1)C=1CCCCC=1)C(O)=O)C1CC(C2)CCC2C1 Chemical compound C1C[C@@H](C)CC[C@@H]1C(=O)N(C1=C(SC(=C1)C=1CCCCC=1)C(O)=O)C1CC(C2)CCC2C1 QMKHTEOIBBSGKN-WHLIJDCNSA-N 0.000 description 1
- SATLBJQBKFNRNL-VYUAXZJKSA-N C1C[C@@H](C)CC[C@@H]1C(=O)N(C1=C(SC(=C1)C=1CCCCC=1)C(O)=O)[C@@H]1CC[C@@H](C#N)CC1 Chemical compound C1C[C@@H](C)CC[C@@H]1C(=O)N(C1=C(SC(=C1)C=1CCCCC=1)C(O)=O)[C@@H]1CC[C@@H](C#N)CC1 SATLBJQBKFNRNL-VYUAXZJKSA-N 0.000 description 1
- CVBAQFSUNUPYPG-GUJRETQESA-N C1C[C@@H](C)CC[C@@H]1C(=O)N(C1=C(SC(=C1)C=1CCCCC=1)C(O)=O)[C@@H]1CC[C@@H](C(C)(C)C)CC1 Chemical compound C1C[C@@H](C)CC[C@@H]1C(=O)N(C1=C(SC(=C1)C=1CCCCC=1)C(O)=O)[C@@H]1CC[C@@H](C(C)(C)C)CC1 CVBAQFSUNUPYPG-GUJRETQESA-N 0.000 description 1
- CVBAQFSUNUPYPG-FORLXOICSA-N C1C[C@@H](C)CC[C@@H]1C(=O)N(C1=C(SC(=C1)C=1CCCCC=1)C(O)=O)[C@@H]1CC[C@H](C(C)(C)C)CC1 Chemical compound C1C[C@@H](C)CC[C@@H]1C(=O)N(C1=C(SC(=C1)C=1CCCCC=1)C(O)=O)[C@@H]1CC[C@H](C(C)(C)C)CC1 CVBAQFSUNUPYPG-FORLXOICSA-N 0.000 description 1
- AHQGMPPSKUDUDL-IXXJFMHHSA-N C1C[C@@H](C)CC[C@@H]1C(=O)N(C1=C(SC(=C1)C=1CCCCC=1)C(O)=O)[C@H]1CC[C@@H](F)CC1 Chemical compound C1C[C@@H](C)CC[C@@H]1C(=O)N(C1=C(SC(=C1)C=1CCCCC=1)C(O)=O)[C@H]1CC[C@@H](F)CC1 AHQGMPPSKUDUDL-IXXJFMHHSA-N 0.000 description 1
- JYVDRDYGGXJIDJ-KESTWPANSA-N C1C[C@@H](C)CC[C@@H]1C(=O)N(C1=C(SC(=C1)C=1CCCCCC=1)C(O)=O)C1CCCCC1 Chemical compound C1C[C@@H](C)CC[C@@H]1C(=O)N(C1=C(SC(=C1)C=1CCCCCC=1)C(O)=O)C1CCCCC1 JYVDRDYGGXJIDJ-KESTWPANSA-N 0.000 description 1
- XEKVZZSSIVDXMJ-KESTWPANSA-N C1C[C@@H](C)CC[C@@H]1C(=O)N(C1=C(SC=C1C=1CCCCC=1)C(O)=O)C1CCN(CCF)CC1 Chemical compound C1C[C@@H](C)CC[C@@H]1C(=O)N(C1=C(SC=C1C=1CCCCC=1)C(O)=O)C1CCN(CCF)CC1 XEKVZZSSIVDXMJ-KESTWPANSA-N 0.000 description 1
- VNDXSTNPMCDMEN-SAABIXHNSA-N C1C[C@@H](C)CC[C@@H]1C(=O)N(C=1C=C2OCOC2=CC=1)C1=C(C(O)=O)SC(C=2CCCCC=2)=C1 Chemical compound C1C[C@@H](C)CC[C@@H]1C(=O)N(C=1C=C2OCOC2=CC=1)C1=C(C(O)=O)SC(C=2CCCCC=2)=C1 VNDXSTNPMCDMEN-SAABIXHNSA-N 0.000 description 1
- ZLRJZXOWDZQFFV-JOLHVKOESA-N C1C[C@@H](COC)CC[C@@H]1N(C1=C(SC(=C1)C=1CCCCC=1)C(O)=O)C(=O)[C@@H]1CC[C@@H](C)CC1 Chemical compound C1C[C@@H](COC)CC[C@@H]1N(C1=C(SC(=C1)C=1CCCCC=1)C(O)=O)C(=O)[C@@H]1CC[C@@H](C)CC1 ZLRJZXOWDZQFFV-JOLHVKOESA-N 0.000 description 1
- ZLRJZXOWDZQFFV-HUBIGZFNSA-N C1C[C@@H](COC)CC[C@H]1N(C1=C(SC(=C1)C=1CCCCC=1)C(O)=O)C(=O)[C@@H]1CC[C@@H](C)CC1 Chemical compound C1C[C@@H](COC)CC[C@H]1N(C1=C(SC(=C1)C=1CCCCC=1)C(O)=O)C(=O)[C@@H]1CC[C@@H](C)CC1 ZLRJZXOWDZQFFV-HUBIGZFNSA-N 0.000 description 1
- KMYHCFYNQQPOHB-GUJRETQESA-N C1C[C@@H](OC)CC[C@@H]1N(C1=C(SC(=C1)C1CCC(C)(C)CC1)C(=O)OC)C(=O)[C@@H]1CC[C@@H](C)CC1 Chemical compound C1C[C@@H](OC)CC[C@@H]1N(C1=C(SC(=C1)C1CCC(C)(C)CC1)C(=O)OC)C(=O)[C@@H]1CC[C@@H](C)CC1 KMYHCFYNQQPOHB-GUJRETQESA-N 0.000 description 1
- GQOLEXCMAPABGR-YSXIEMCBSA-N C1C[C@@H](OC)CC[C@@H]1N(C1=C(SC(=C1)C1CCCCC1)C(O)=O)C(=O)[C@@H]1CC[C@@H](C)CC1 Chemical compound C1C[C@@H](OC)CC[C@@H]1N(C1=C(SC(=C1)C1CCCCC1)C(O)=O)C(=O)[C@@H]1CC[C@@H](C)CC1 GQOLEXCMAPABGR-YSXIEMCBSA-N 0.000 description 1
- COSFOXLUNFUJIP-JOLHVKOESA-N C1C[C@@H](OC)CC[C@@H]1N(C1=C(SC(=C1)C=1CC(C)(C)CCC=1)C(O)=O)C(=O)[C@@H]1CC[C@@H](C)CC1 Chemical compound C1C[C@@H](OC)CC[C@@H]1N(C1=C(SC(=C1)C=1CC(C)(C)CCC=1)C(O)=O)C(=O)[C@@H]1CC[C@@H](C)CC1 COSFOXLUNFUJIP-JOLHVKOESA-N 0.000 description 1
- MPHNLRLRWAYJHT-GUJRETQESA-N C1C[C@@H](OCOC)CC[C@@H]1N(C1=C(SC(=C1)C1CCC(C)(C)CC1)C(O)=O)C(=O)[C@@H]1CC[C@@H](C)CC1 Chemical compound C1C[C@@H](OCOC)CC[C@@H]1N(C1=C(SC(=C1)C1CCC(C)(C)CC1)C(O)=O)C(=O)[C@@H]1CC[C@@H](C)CC1 MPHNLRLRWAYJHT-GUJRETQESA-N 0.000 description 1
- OVTIYPJPKHHYCK-RPCDJPHFSA-N CC(C)C(=O)NC1CCC(CC1)N(C(=O)[C@H]1CC[C@H](C)CC1)c1cc(sc1C(O)=O)C1=CCCCC1 Chemical class CC(C)C(=O)NC1CCC(CC1)N(C(=O)[C@H]1CC[C@H](C)CC1)c1cc(sc1C(O)=O)C1=CCCCC1 OVTIYPJPKHHYCK-RPCDJPHFSA-N 0.000 description 1
- QLNGJSGLNHZLTP-UHFFFAOYSA-N CCCC(=O)NC1CCC(CC1)N(C2=C(SC(=C2)C3=CCCCC3)C(=O)O)C(=O)C4CCC(CC4)C Chemical compound CCCC(=O)NC1CCC(CC1)N(C2=C(SC(=C2)C3=CCCCC3)C(=O)O)C(=O)C4CCC(CC4)C QLNGJSGLNHZLTP-UHFFFAOYSA-N 0.000 description 1
- OLLBRPWLJACADW-UHFFFAOYSA-N CCCCCCCC(CC)OS(C)(=O)=O Chemical compound CCCCCCCC(CC)OS(C)(=O)=O OLLBRPWLJACADW-UHFFFAOYSA-N 0.000 description 1
- NRSKLCCINAQQQL-UHFFFAOYSA-N CCN(CC)S.F.F.F Chemical compound CCN(CC)S.F.F.F NRSKLCCINAQQQL-UHFFFAOYSA-N 0.000 description 1
- PRJPAKLDRJCJFQ-GVRPRLBFSA-N COC(=O)C=1SC(C=2CCC(C)(C)CC=2)=CC=1N(C(CO[Si](C(C)C)(C(C)C)C(C)C)CO[Si](C(C)C)(C(C)C)C(C)C)C(=O)[C@H]1CC[C@H](C)CC1 Chemical compound COC(=O)C=1SC(C=2CCC(C)(C)CC=2)=CC=1N(C(CO[Si](C(C)C)(C(C)C)C(C)C)CO[Si](C(C)C)(C(C)C)C(C)C)C(=O)[C@H]1CC[C@H](C)CC1 PRJPAKLDRJCJFQ-GVRPRLBFSA-N 0.000 description 1
- SCTGGEQFOGRINW-RPCDJPHFSA-N COC(=O)C=1SC(C=2CCCCC=2)=CC=1N(C(=O)[C@@H]1CC[C@@H](C)CC1)C(CC1)CCC1N1C=NC=N1 Chemical compound COC(=O)C=1SC(C=2CCCCC=2)=CC=1N(C(=O)[C@@H]1CC[C@@H](C)CC1)C(CC1)CCC1N1C=NC=N1 SCTGGEQFOGRINW-RPCDJPHFSA-N 0.000 description 1
- MRYMMWAGVKALOS-AQYVVDRMSA-N COC(=O)C=1SC(C=2CCCCC=2)=CC=1N(C(=O)[C@@H]1CC[C@@H](C)CC1)C(CC1)CCN1C1=NC=CC=N1 Chemical compound COC(=O)C=1SC(C=2CCCCC=2)=CC=1N(C(=O)[C@@H]1CC[C@@H](C)CC1)C(CC1)CCN1C1=NC=CC=N1 MRYMMWAGVKALOS-AQYVVDRMSA-N 0.000 description 1
- DATGYICDXPCPFN-GARHLSDISA-N COCO[C@@H]1CC[C@H](CC1)N(C(=O)[C@@H]1CC[C@H](CC1)C)C1=C(SC=C1)C(=O)O Chemical compound COCO[C@@H]1CC[C@H](CC1)N(C(=O)[C@@H]1CC[C@H](CC1)C)C1=C(SC=C1)C(=O)O DATGYICDXPCPFN-GARHLSDISA-N 0.000 description 1
- MYUJTVLROYBVEP-JOCQHMNTSA-N C[C@@H]1CC[C@H](CC1)C(=O)N(C1=C(SC=C1)C(=O)O)C1CCNCC1 Chemical compound C[C@@H]1CC[C@H](CC1)C(=O)N(C1=C(SC=C1)C(=O)O)C1CCNCC1 MYUJTVLROYBVEP-JOCQHMNTSA-N 0.000 description 1
- QTDXSEZXAPHVBI-LJGSYFOKSA-N C[C@H]1CC[C@H](C(O)=O)CC1 Chemical compound C[C@H]1CC[C@H](C(O)=O)CC1 QTDXSEZXAPHVBI-LJGSYFOKSA-N 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- 101710132601 Capsid protein Proteins 0.000 description 1
- WTEVQBCEXWBHNA-UHFFFAOYSA-N Citral Natural products CC(C)=CCCC(C)=CC=O WTEVQBCEXWBHNA-UHFFFAOYSA-N 0.000 description 1
- OSCRSGVQXQCKKP-FMMATFHQSA-N Cl.C[C@H]1CC[C@@H](CC1)C(=O)N([C@H]1CC[C@@H](CC1)n1cncn1)c1cc(sc1C(O)=O)C1=CCCCC1 Chemical compound Cl.C[C@H]1CC[C@@H](CC1)C(=O)N([C@H]1CC[C@@H](CC1)n1cncn1)c1cc(sc1C(O)=O)C1=CCCCC1 OSCRSGVQXQCKKP-FMMATFHQSA-N 0.000 description 1
- 208000035473 Communicable disease Diseases 0.000 description 1
- IGXWBGJHJZYPQS-SSDOTTSWSA-N D-Luciferin Chemical compound OC(=O)[C@H]1CSC(C=2SC3=CC=C(O)C=C3N=2)=N1 IGXWBGJHJZYPQS-SSDOTTSWSA-N 0.000 description 1
- NOOLISFMXDJSKH-UHFFFAOYSA-N DL-menthol Natural products CC(C)C1CCC(C)CC1O NOOLISFMXDJSKH-UHFFFAOYSA-N 0.000 description 1
- CYCGRDQQIOGCKX-UHFFFAOYSA-N Dehydro-luciferin Natural products OC(=O)C1=CSC(C=2SC3=CC(O)=CC=C3N=2)=N1 CYCGRDQQIOGCKX-UHFFFAOYSA-N 0.000 description 1
- 208000001490 Dengue Diseases 0.000 description 1
- 206010012310 Dengue fever Diseases 0.000 description 1
- 206010012735 Diarrhoea Diseases 0.000 description 1
- 239000004338 Dichlorodifluoromethane Substances 0.000 description 1
- BUDQDWGNQVEFAC-UHFFFAOYSA-N Dihydropyran Chemical compound C1COC=CC1 BUDQDWGNQVEFAC-UHFFFAOYSA-N 0.000 description 1
- 102000004190 Enzymes Human genes 0.000 description 1
- 108090000790 Enzymes Proteins 0.000 description 1
- 108090000331 Firefly luciferases Proteins 0.000 description 1
- BJGNCJDXODQBOB-UHFFFAOYSA-N Fivefly Luciferin Natural products OC(=O)C1CSC(C=2SC3=CC(O)=CC=C3N=2)=N1 BJGNCJDXODQBOB-UHFFFAOYSA-N 0.000 description 1
- 244000068988 Glycine max Species 0.000 description 1
- 102000003886 Glycoproteins Human genes 0.000 description 1
- 108090000288 Glycoproteins Proteins 0.000 description 1
- 229920000084 Gum arabic Polymers 0.000 description 1
- 208000031220 Hemophilia Diseases 0.000 description 1
- 208000009292 Hemophilia A Diseases 0.000 description 1
- HTTJABKRGRZYRN-UHFFFAOYSA-N Heparin Chemical compound OC1C(NC(=O)C)C(O)OC(COS(O)(=O)=O)C1OC1C(OS(O)(=O)=O)C(O)C(OC2C(C(OS(O)(=O)=O)C(OC3C(C(O)C(O)C(O3)C(O)=O)OS(O)(=O)=O)C(CO)O2)NS(O)(=O)=O)C(C(O)=O)O1 HTTJABKRGRZYRN-UHFFFAOYSA-N 0.000 description 1
- 206010019799 Hepatitis viral Diseases 0.000 description 1
- 101000959820 Homo sapiens Interferon alpha-1/13 Proteins 0.000 description 1
- 101000868422 Homo sapiens Sushi, nidogen and EGF-like domain-containing protein 1 Proteins 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- 102100040019 Interferon alpha-1/13 Human genes 0.000 description 1
- 102100040018 Interferon alpha-2 Human genes 0.000 description 1
- 108010079944 Interferon-alpha2b Proteins 0.000 description 1
- 108010029660 Intrinsically Disordered Proteins Proteins 0.000 description 1
- 241000710842 Japanese encephalitis virus Species 0.000 description 1
- ODKSFYDXXFIFQN-BYPYZUCNSA-N L-arginine Chemical compound OC(=O)[C@@H](N)CCCN=C(N)N ODKSFYDXXFIFQN-BYPYZUCNSA-N 0.000 description 1
- 229930064664 L-arginine Natural products 0.000 description 1
- 235000014852 L-arginine Nutrition 0.000 description 1
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 1
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 1
- DDWFXDSYGUXRAY-UHFFFAOYSA-N Luciferin Natural products CCc1c(C)c(CC2NC(=O)C(=C2C=C)C)[nH]c1Cc3[nH]c4C(=C5/NC(CC(=O)O)C(C)C5CC(=O)O)CC(=O)c4c3C DDWFXDSYGUXRAY-UHFFFAOYSA-N 0.000 description 1
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 1
- 239000012359 Methanesulfonyl chloride Substances 0.000 description 1
- PPNFNPIBVRLCFC-MLRKGSHFSA-N N1([C@H]2CC[C@@H](CC2)N(C=2C=C(SC=2C(=O)OC)C2CCC(C)(C)CC2)C(=O)[C@@H]2CC[C@@H](C)CC2)C=CN=N1 Chemical compound N1([C@H]2CC[C@@H](CC2)N(C=2C=C(SC=2C(=O)OC)C2CCC(C)(C)CC2)C(=O)[C@@H]2CC[C@@H](C)CC2)C=CN=N1 PPNFNPIBVRLCFC-MLRKGSHFSA-N 0.000 description 1
- 229930193140 Neomycin Natural products 0.000 description 1
- 241000283973 Oryctolagus cuniculus Species 0.000 description 1
- 238000012408 PCR amplification Methods 0.000 description 1
- 229930182555 Penicillin Natural products 0.000 description 1
- JGSARLDLIJGVTE-MBNYWOFBSA-N Penicillin G Chemical compound N([C@H]1[C@H]2SC([C@@H](N2C1=O)C(O)=O)(C)C)C(=O)CC1=CC=CC=C1 JGSARLDLIJGVTE-MBNYWOFBSA-N 0.000 description 1
- BELBBZDIHDAJOR-UHFFFAOYSA-N Phenolsulfonephthalein Chemical compound C1=CC(O)=CC=C1C1(C=2C=CC(O)=CC=2)C2=CC=CC=C2S(=O)(=O)O1 BELBBZDIHDAJOR-UHFFFAOYSA-N 0.000 description 1
- 239000004952 Polyamide Substances 0.000 description 1
- 108010076039 Polyproteins Proteins 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- WTKZEGDFNFYCGP-UHFFFAOYSA-N Pyrazole Chemical compound C=1C=NNC=1 WTKZEGDFNFYCGP-UHFFFAOYSA-N 0.000 description 1
- 239000007868 Raney catalyst Substances 0.000 description 1
- NPXOKRUENSOPAO-UHFFFAOYSA-N Raney nickel Chemical compound [Al].[Ni] NPXOKRUENSOPAO-UHFFFAOYSA-N 0.000 description 1
- 229910000564 Raney nickel Inorganic materials 0.000 description 1
- 229920002684 Sepharose Polymers 0.000 description 1
- DBMJMQXJHONAFJ-UHFFFAOYSA-M Sodium laurylsulphate Chemical compound [Na+].CCCCCCCCCCCCOS([O-])(=O)=O DBMJMQXJHONAFJ-UHFFFAOYSA-M 0.000 description 1
- 229920002472 Starch Polymers 0.000 description 1
- 108091081024 Start codon Proteins 0.000 description 1
- 102100032853 Sushi, nidogen and EGF-like domain-containing protein 1 Human genes 0.000 description 1
- 108020005038 Terminator Codon Proteins 0.000 description 1
- FZWLAAWBMGSTSO-UHFFFAOYSA-N Thiazole Chemical compound C1=CSC=N1 FZWLAAWBMGSTSO-UHFFFAOYSA-N 0.000 description 1
- AVRWEULSKHQETA-UHFFFAOYSA-N Thiophene-2 Chemical compound S1C=2CCCCCC=2C(C(=O)OC)=C1NC(=O)C1=C(F)C(F)=C(F)C(F)=C1F AVRWEULSKHQETA-UHFFFAOYSA-N 0.000 description 1
- 239000005844 Thymol Substances 0.000 description 1
- 229920001615 Tragacanth Polymers 0.000 description 1
- 108020000999 Viral RNA Proteins 0.000 description 1
- 241000710772 Yellow fever virus Species 0.000 description 1
- JBPUGFODGPKTDW-SFHVURJKSA-N [(3s)-oxolan-3-yl] n-[[3-[[3-methoxy-4-(1,3-oxazol-5-yl)phenyl]carbamoylamino]phenyl]methyl]carbamate Chemical compound C=1C=C(C=2OC=NC=2)C(OC)=CC=1NC(=O)NC(C=1)=CC=CC=1CNC(=O)O[C@H]1CCOC1 JBPUGFODGPKTDW-SFHVURJKSA-N 0.000 description 1
- WFIHKLWVLPBMIQ-UHFFFAOYSA-N [1,3]thiazolo[5,4-b]pyridine Chemical compound C1=CN=C2SC=NC2=C1 WFIHKLWVLPBMIQ-UHFFFAOYSA-N 0.000 description 1
- UCAVIHWWIOYPML-UHFFFAOYSA-N [1-(1,4-dioxaspiro[4.5]decan-8-yl)triazol-4-yl]-trimethylsilane Chemical compound N1=NC([Si](C)(C)C)=CN1C1CCC2(OCCO2)CC1 UCAVIHWWIOYPML-UHFFFAOYSA-N 0.000 description 1
- HLLIYDVPIGSIJX-AFFTWYSYSA-N [Cl-].CC(C)OC(=O)OCOC(=O)C=1SC(C=2CCCCC=2)=CC=1N(C(=O)[C@@H]1CC[C@@H](C)CC1)C1CC[NH+](C)CC1 Chemical compound [Cl-].CC(C)OC(=O)OCOC(=O)C=1SC(C=2CCCCC=2)=CC=1N(C(=O)[C@@H]1CC[C@@H](C)CC1)C1CC[NH+](C)CC1 HLLIYDVPIGSIJX-AFFTWYSYSA-N 0.000 description 1
- KBXDAFWYJGKGSE-UHFFFAOYSA-N [Li].CC1(C)[SiH2][SiH]=NC(C)(C)C1(C)C Chemical compound [Li].CC1(C)[SiH2][SiH]=NC(C)(C)C1(C)C KBXDAFWYJGKGSE-UHFFFAOYSA-N 0.000 description 1
- 239000000205 acacia gum Substances 0.000 description 1
- 235000010489 acacia gum Nutrition 0.000 description 1
- 239000003929 acidic solution Substances 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 239000002671 adjuvant Substances 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 1
- 150000001342 alkaline earth metals Chemical class 0.000 description 1
- 230000029936 alkylation Effects 0.000 description 1
- 238000005804 alkylation reaction Methods 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- HSMPSHPWCOOUJH-UHFFFAOYSA-N anilinyl Chemical group [NH]C1=CC=CC=C1 HSMPSHPWCOOUJH-UHFFFAOYSA-N 0.000 description 1
- 125000005428 anthryl group Chemical group [H]C1=C([H])C([H])=C2C([H])=C3C(*)=C([H])C([H])=C([H])C3=C([H])C2=C1[H] 0.000 description 1
- 239000012223 aqueous fraction Substances 0.000 description 1
- 239000008135 aqueous vehicle Substances 0.000 description 1
- 239000000305 astragalus gummifer gum Substances 0.000 description 1
- XRWSZZJLZRKHHD-WVWIJVSJSA-N asunaprevir Chemical compound O=C([C@@H]1C[C@H](CN1C(=O)[C@@H](NC(=O)OC(C)(C)C)C(C)(C)C)OC1=NC=C(C2=CC=C(Cl)C=C21)OC)N[C@]1(C(=O)NS(=O)(=O)C2CC2)C[C@H]1C=C XRWSZZJLZRKHHD-WVWIJVSJSA-N 0.000 description 1
- 125000002393 azetidinyl group Chemical group 0.000 description 1
- 230000001580 bacterial effect Effects 0.000 description 1
- RFRXIWQYSOIBDI-UHFFFAOYSA-N benzarone Chemical compound CCC=1OC2=CC=CC=C2C=1C(=O)C1=CC=C(O)C=C1 RFRXIWQYSOIBDI-UHFFFAOYSA-N 0.000 description 1
- 150000008107 benzenesulfonic acids Chemical class 0.000 description 1
- 125000003785 benzimidazolyl group Chemical group N1=C(NC2=C1C=CC=C2)* 0.000 description 1
- 125000004604 benzisothiazolyl group Chemical group S1N=C(C2=C1C=CC=C2)* 0.000 description 1
- 125000002047 benzodioxolyl group Chemical group O1OC(C2=C1C=CC=C2)* 0.000 description 1
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid group Chemical group C(C1=CC=CC=C1)(=O)O WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 1
- 125000004619 benzopyranyl group Chemical group O1C(C=CC2=C1C=CC=C2)* 0.000 description 1
- 125000004622 benzoxazinyl group Chemical group O1NC(=CC2=C1C=CC=C2)* 0.000 description 1
- BVCRERJDOOBZOH-UHFFFAOYSA-N bicyclo[2.2.1]heptanyl Chemical group C1C[C+]2CC[C-]1C2 BVCRERJDOOBZOH-UHFFFAOYSA-N 0.000 description 1
- MUALRAIOVNYAIW-UHFFFAOYSA-N binap Chemical group C1=CC=CC=C1P(C=1C(=C2C=CC=CC2=CC=1)C=1C2=CC=CC=C2C=CC=1P(C=1C=CC=CC=1)C=1C=CC=CC=1)C1=CC=CC=C1 MUALRAIOVNYAIW-UHFFFAOYSA-N 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- 230000036765 blood level Effects 0.000 description 1
- 230000037396 body weight Effects 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- ZADPBFCGQRWHPN-UHFFFAOYSA-N boronic acid Chemical compound OBO ZADPBFCGQRWHPN-UHFFFAOYSA-N 0.000 description 1
- 125000005620 boronic acid group Chemical class 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- 125000000480 butynyl group Chemical group [*]C#CC([H])([H])C([H])([H])[H] 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- 125000003739 carbamimidoyl group Chemical group C(N)(=N)* 0.000 description 1
- 125000002837 carbocyclic group Chemical group 0.000 description 1
- 239000001569 carbon dioxide Substances 0.000 description 1
- 229960004424 carbon dioxide Drugs 0.000 description 1
- 229910002091 carbon monoxide Inorganic materials 0.000 description 1
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 1
- RECUKUPTGUEGMW-UHFFFAOYSA-N carvacrol Chemical compound CC(C)C1=CC=C(C)C(O)=C1 RECUKUPTGUEGMW-UHFFFAOYSA-N 0.000 description 1
- HHTWOMMSBMNRKP-UHFFFAOYSA-N carvacrol Natural products CC(=C)C1=CC=C(C)C(O)=C1 HHTWOMMSBMNRKP-UHFFFAOYSA-N 0.000 description 1
- 235000007746 carvacrol Nutrition 0.000 description 1
- 230000003197 catalytic effect Effects 0.000 description 1
- 239000006143 cell culture medium Substances 0.000 description 1
- 239000013592 cell lysate Substances 0.000 description 1
- 230000001413 cellular effect Effects 0.000 description 1
- 238000005119 centrifugation Methods 0.000 description 1
- OGEBRHQLRGFBNV-RZDIXWSQSA-N chembl2036808 Chemical compound C12=NC(NCCCC)=NC=C2C(C=2C=CC(F)=CC=2)=NN1C[C@H]1CC[C@H](N)CC1 OGEBRHQLRGFBNV-RZDIXWSQSA-N 0.000 description 1
- 238000004296 chiral HPLC Methods 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 125000001309 chloro group Chemical group Cl* 0.000 description 1
- 125000004775 chlorodifluoromethyl group Chemical group FC(F)(Cl)* 0.000 description 1
- 125000002603 chloroethyl group Chemical group [H]C([*])([H])C([H])([H])Cl 0.000 description 1
- 125000004773 chlorofluoromethyl group Chemical group [H]C(F)(Cl)* 0.000 description 1
- GGRHYQCXXYLUTL-UHFFFAOYSA-N chloromethyl 2,2-dimethylpropanoate Chemical compound CC(C)(C)C(=O)OCCl GGRHYQCXXYLUTL-UHFFFAOYSA-N 0.000 description 1
- 125000004218 chloromethyl group Chemical group [H]C([H])(Cl)* 0.000 description 1
- OEYIOHPDSNJKLS-UHFFFAOYSA-N choline Chemical compound C[N+](C)(C)CCO OEYIOHPDSNJKLS-UHFFFAOYSA-N 0.000 description 1
- 229960001231 choline Drugs 0.000 description 1
- 238000011097 chromatography purification Methods 0.000 description 1
- 229940043350 citral Drugs 0.000 description 1
- 238000010367 cloning Methods 0.000 description 1
- 229940110456 cocoa butter Drugs 0.000 description 1
- 235000019868 cocoa butter Nutrition 0.000 description 1
- 239000003086 colorant Substances 0.000 description 1
- 230000000295 complement effect Effects 0.000 description 1
- 239000002299 complementary DNA Substances 0.000 description 1
- 229940125773 compound 10 Drugs 0.000 description 1
- 229940125782 compound 2 Drugs 0.000 description 1
- 229940125961 compound 24 Drugs 0.000 description 1
- 229940126214 compound 3 Drugs 0.000 description 1
- DOBRDRYODQBAMW-UHFFFAOYSA-N copper(i) cyanide Chemical compound [Cu+].N#[C-] DOBRDRYODQBAMW-UHFFFAOYSA-N 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- FWFSEYBSWVRWGL-UHFFFAOYSA-N cyclohex-2-enone Chemical compound O=C1CCCC=C1 FWFSEYBSWVRWGL-UHFFFAOYSA-N 0.000 description 1
- XDRVAZAFNWDVOE-UHFFFAOYSA-N cyclohexylboronic acid Chemical compound OB(O)C1CCCCC1 XDRVAZAFNWDVOE-UHFFFAOYSA-N 0.000 description 1
- 230000003247 decreasing effect Effects 0.000 description 1
- 208000025729 dengue disease Diseases 0.000 description 1
- 230000001419 dependent effect Effects 0.000 description 1
- 239000003599 detergent Substances 0.000 description 1
- PXBRQCKWGAHEHS-UHFFFAOYSA-N dichlorodifluoromethane Chemical compound FC(F)(Cl)Cl PXBRQCKWGAHEHS-UHFFFAOYSA-N 0.000 description 1
- 235000019404 dichlorodifluoromethane Nutrition 0.000 description 1
- 229940042935 dichlorodifluoromethane Drugs 0.000 description 1
- 125000006003 dichloroethyl group Chemical group 0.000 description 1
- 125000004772 dichloromethyl group Chemical group [H]C(Cl)(Cl)* 0.000 description 1
- 125000004188 dichlorophenyl group Chemical group 0.000 description 1
- 229940087091 dichlorotetrafluoroethane Drugs 0.000 description 1
- 125000006001 difluoroethyl group Chemical group 0.000 description 1
- 125000001028 difluoromethyl group Chemical group [H]C(F)(F)* 0.000 description 1
- 238000010790 dilution Methods 0.000 description 1
- 239000012895 dilution Substances 0.000 description 1
- ZZVUWRFHKOJYTH-UHFFFAOYSA-N diphenhydramine Chemical group C=1C=CC=CC=1C(OCCN(C)C)C1=CC=CC=C1 ZZVUWRFHKOJYTH-UHFFFAOYSA-N 0.000 description 1
- CXQRZKIIGJLWPJ-UHFFFAOYSA-N diphenylphosphane;1-naphthalen-1-ylnaphthalene Chemical group C=1C=CC=CC=1PC1=CC=CC=C1.C1=CC=C2C(C=3C4=CC=CC=C4C=CC=3)=CC=CC2=C1 CXQRZKIIGJLWPJ-UHFFFAOYSA-N 0.000 description 1
- LOKCTEFSRHRXRJ-UHFFFAOYSA-I dipotassium trisodium dihydrogen phosphate hydrogen phosphate dichloride Chemical compound P(=O)(O)(O)[O-].[K+].P(=O)(O)([O-])[O-].[Na+].[Na+].[Cl-].[K+].[Cl-].[Na+] LOKCTEFSRHRXRJ-UHFFFAOYSA-I 0.000 description 1
- 201000010099 disease Diseases 0.000 description 1
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 1
- 231100000673 dose–response relationship Toxicity 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 241001493065 dsRNA viruses Species 0.000 description 1
- 239000008157 edible vegetable oil Substances 0.000 description 1
- 238000001493 electron microscopy Methods 0.000 description 1
- 238000002330 electrospray ionisation mass spectrometry Methods 0.000 description 1
- 239000012149 elution buffer Substances 0.000 description 1
- 239000003623 enhancer Substances 0.000 description 1
- 230000002255 enzymatic effect Effects 0.000 description 1
- 230000009088 enzymatic function Effects 0.000 description 1
- 238000006911 enzymatic reaction Methods 0.000 description 1
- 210000002615 epidermis Anatomy 0.000 description 1
- 125000004185 ester group Chemical group 0.000 description 1
- ZKQFHRVKCYFVCN-UHFFFAOYSA-N ethoxyethane;hexane Chemical compound CCOCC.CCCCCC ZKQFHRVKCYFVCN-UHFFFAOYSA-N 0.000 description 1
- 239000002024 ethyl acetate extract Substances 0.000 description 1
- OAYLNYINCPYISS-UHFFFAOYSA-N ethyl acetate;hexane Chemical compound CCCCCC.CCOC(C)=O OAYLNYINCPYISS-UHFFFAOYSA-N 0.000 description 1
- 125000004494 ethyl ester group Chemical group 0.000 description 1
- 125000005469 ethylenyl group Chemical group 0.000 description 1
- 238000011156 evaluation Methods 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 239000012894 fetal calf serum Substances 0.000 description 1
- 239000000945 filler Substances 0.000 description 1
- 238000003818 flash chromatography Methods 0.000 description 1
- 229910052731 fluorine Inorganic materials 0.000 description 1
- 125000001153 fluoro group Chemical group F* 0.000 description 1
- 125000003784 fluoroethyl group Chemical group [H]C([H])(F)C([H])([H])* 0.000 description 1
- 125000004216 fluoromethyl group Chemical group [H]C([H])(F)* 0.000 description 1
- 239000000499 gel Substances 0.000 description 1
- 238000001502 gel electrophoresis Methods 0.000 description 1
- 239000003349 gelling agent Substances 0.000 description 1
- WTEVQBCEXWBHNA-JXMROGBWSA-N geranial Chemical compound CC(C)=CCC\C(C)=C\C=O WTEVQBCEXWBHNA-JXMROGBWSA-N 0.000 description 1
- ZDXPYRJPNDTMRX-UHFFFAOYSA-N glutamine Natural products OC(=O)C(N)CCC(N)=O ZDXPYRJPNDTMRX-UHFFFAOYSA-N 0.000 description 1
- 239000008187 granular material Substances 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 230000005802 health problem Effects 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 229960002897 heparin Drugs 0.000 description 1
- 229920000669 heparin Polymers 0.000 description 1
- 230000002440 hepatic effect Effects 0.000 description 1
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000005980 hexynyl group Chemical group 0.000 description 1
- 150000004677 hydrates Chemical class 0.000 description 1
- 229940042795 hydrazides for tuberculosis treatment Drugs 0.000 description 1
- 150000002430 hydrocarbons Chemical group 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- 125000004857 imidazopyridinyl group Chemical group N1C(=NC2=C1C=CC=N2)* 0.000 description 1
- 210000000987 immune system Anatomy 0.000 description 1
- 239000002955 immunomodulating agent Substances 0.000 description 1
- 238000011534 incubation Methods 0.000 description 1
- 125000003453 indazolyl group Chemical group N1N=C(C2=C1C=CC=C2)* 0.000 description 1
- 125000003454 indenyl group Chemical group C1(C=CC2=CC=CC=C12)* 0.000 description 1
- 125000003387 indolinyl group Chemical group N1(CCC2=CC=CC=C12)* 0.000 description 1
- 125000003406 indolizinyl group Chemical group C=1(C=CN2C=CC=CC12)* 0.000 description 1
- 238000007918 intramuscular administration Methods 0.000 description 1
- 238000010253 intravenous injection Methods 0.000 description 1
- HVTICUPFWKNHNG-UHFFFAOYSA-N iodoethane Chemical compound CCI HVTICUPFWKNHNG-UHFFFAOYSA-N 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- 125000001977 isobenzofuranyl group Chemical group C=1(OC=C2C=CC=CC12)* 0.000 description 1
- WYXXLXHHWYNKJF-UHFFFAOYSA-N isocarvacrol Natural products CC(C)C1=CC=C(O)C(C)=C1 WYXXLXHHWYNKJF-UHFFFAOYSA-N 0.000 description 1
- 125000004491 isohexyl group Chemical group C(CCC(C)C)* 0.000 description 1
- 125000004594 isoindolinyl group Chemical group C1(NCC2=CC=CC=C12)* 0.000 description 1
- 238000002955 isolation Methods 0.000 description 1
- 125000001972 isopentyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000000555 isopropenyl group Chemical group [H]\C([H])=C(\*)C([H])([H])[H] 0.000 description 1
- 125000002183 isoquinolinyl group Chemical group C1(=NC=CC2=CC=CC=C12)* 0.000 description 1
- ZLVXBBHTMQJRSX-VMGNSXQWSA-N jdtic Chemical compound C1([C@]2(C)CCN(C[C@@H]2C)C[C@H](C(C)C)NC(=O)[C@@H]2NCC3=CC(O)=CC=C3C2)=CC=CC(O)=C1 ZLVXBBHTMQJRSX-VMGNSXQWSA-N 0.000 description 1
- 239000008101 lactose Substances 0.000 description 1
- 229930007744 linalool Natural products 0.000 description 1
- 238000004811 liquid chromatography Methods 0.000 description 1
- 239000012280 lithium aluminium hydride Substances 0.000 description 1
- 229910003002 lithium salt Inorganic materials 0.000 description 1
- 159000000002 lithium salts Chemical group 0.000 description 1
- 239000000314 lubricant Substances 0.000 description 1
- 238000003468 luciferase reporter gene assay Methods 0.000 description 1
- 239000012139 lysis buffer Substances 0.000 description 1
- 239000011777 magnesium Substances 0.000 description 1
- 229910052749 magnesium Inorganic materials 0.000 description 1
- WWOYCMCZTZTIGU-UHFFFAOYSA-L magnesium;2-carboxybenzenecarboperoxoate;hexahydrate Chemical compound O.O.O.O.O.O.[Mg+2].OOC(=O)C1=CC=CC=C1C([O-])=O.OOC(=O)C1=CC=CC=C1C([O-])=O WWOYCMCZTZTIGU-UHFFFAOYSA-L 0.000 description 1
- 238000004949 mass spectrometry Methods 0.000 description 1
- 210000004779 membrane envelope Anatomy 0.000 description 1
- 229940041616 menthol Drugs 0.000 description 1
- COTNUBDHGSIOTA-UHFFFAOYSA-N meoh methanol Chemical compound OC.OC COTNUBDHGSIOTA-UHFFFAOYSA-N 0.000 description 1
- 229950003168 merimepodib Drugs 0.000 description 1
- QARBMVPHQWIHKH-UHFFFAOYSA-N methanesulfonyl chloride Chemical compound CS(Cl)(=O)=O QARBMVPHQWIHKH-UHFFFAOYSA-N 0.000 description 1
- OGJDZVITLCFAII-UHFFFAOYSA-N methyl 2-(1,4-dioxaspiro[4.5]decan-8-ylidene)acetate Chemical compound C1CC(=CC(=O)OC)CCC21OCCO2 OGJDZVITLCFAII-UHFFFAOYSA-N 0.000 description 1
- NTNUDYROPUKXNA-UHFFFAOYSA-N methyl 2-(triphenyl-$l^{5}-phosphanylidene)acetate Chemical compound C=1C=CC=CC=1P(C=1C=CC=CC=1)(=CC(=O)OC)C1=CC=CC=C1 NTNUDYROPUKXNA-UHFFFAOYSA-N 0.000 description 1
- CKHQMNWVACYRCJ-UHFFFAOYSA-N methyl 3-[(4-azidocyclohexyl)-(4-methylcyclohexanecarbonyl)amino]-5-(4,4-dimethylcyclohexyl)thiophene-2-carboxylate Chemical compound COC(=O)C=1SC(C2CCC(C)(C)CC2)=CC=1N(C(=O)C1CCC(C)CC1)C1CCC(N=[N+]=[N-])CC1 CKHQMNWVACYRCJ-UHFFFAOYSA-N 0.000 description 1
- BQQHXIZCAPCAQE-UHFFFAOYSA-N methyl 3-amino-5-(4,4-dimethylcyclohexen-1-yl)thiophene-2-carboxylate Chemical compound NC1=C(C(=O)OC)SC(C=2CCC(C)(C)CC=2)=C1 BQQHXIZCAPCAQE-UHFFFAOYSA-N 0.000 description 1
- TWEQNZZOOFKOER-UHFFFAOYSA-N methyl 3-aminothiophene-2-carboxylate Chemical compound COC(=O)C=1SC=CC=1N TWEQNZZOOFKOER-UHFFFAOYSA-N 0.000 description 1
- UEARGZRWCIVDOO-UHFFFAOYSA-N methyl 3-anilino-5-(cyclohexen-1-yl)thiophene-2-carboxylate Chemical compound COC(=O)C=1SC(C=2CCCCC=2)=CC=1NC1=CC=CC=C1 UEARGZRWCIVDOO-UHFFFAOYSA-N 0.000 description 1
- NKMNDFXAMGNIMF-UHFFFAOYSA-N methyl 3-bromo-5-(4,4-dimethylcyclohexen-1-yl)thiophene-2-carboxylate Chemical compound BrC1=C(C(=O)OC)SC(C=2CCC(C)(C)CC=2)=C1 NKMNDFXAMGNIMF-UHFFFAOYSA-N 0.000 description 1
- PEGSJNCGPSIJOX-UHFFFAOYSA-N methyl 3-bromothiophene-2-carboxylate Chemical compound COC(=O)C=1SC=CC=1Br PEGSJNCGPSIJOX-UHFFFAOYSA-N 0.000 description 1
- RDMQJIFPUUUVAS-UHFFFAOYSA-N methyl 5-(1-hydroxycyclohexyl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]thiophene-2-carboxylate Chemical compound CC(C)(C)OC(=O)NC1=C(C(=O)OC)SC(C2(O)CCCCC2)=C1 RDMQJIFPUUUVAS-UHFFFAOYSA-N 0.000 description 1
- LIXSQKKNCMTAOV-UHFFFAOYSA-N methyl 5-(2,6-difluorocyclohexen-1-yl)-3-[(4-methoxycyclohexyl)-(4-methylcyclohexanecarbonyl)amino]thiophene-2-carboxylate Chemical compound C1CC(OC)CCC1N(C1=C(SC(=C1)C=1C(CCCC=1F)F)C(=O)OC)C(=O)C1CCC(C)CC1 LIXSQKKNCMTAOV-UHFFFAOYSA-N 0.000 description 1
- SWVLETVKMGFLHZ-UHFFFAOYSA-N methyl 5-(4,4-dimethylcyclohexyl)-3-[1,3-dioxan-5-yl-(4-methylcyclohexanecarbonyl)amino]thiophene-2-carboxylate Chemical compound COC(=O)C=1SC(C2CCC(C)(C)CC2)=CC=1N(C(=O)C1CCC(C)CC1)C1COCOC1 SWVLETVKMGFLHZ-UHFFFAOYSA-N 0.000 description 1
- OSUVFWFEGCZXCD-UHFFFAOYSA-N methyl 5-(cyclohexen-1-yl)-3-[(4-methoxycyclohexyl)-(4-methylcyclohexanecarbonyl)amino]thiophene-2-carboxylate Chemical compound C1CC(OC)CCC1N(C1=C(SC(=C1)C=1CCCCC=1)C(=O)OC)C(=O)C1CCC(C)CC1 OSUVFWFEGCZXCD-UHFFFAOYSA-N 0.000 description 1
- WUDQZNWCZNXVSM-UHFFFAOYSA-N methyl 5-(cyclohexen-1-yl)-3-[1,3-dioxan-5-yl-(4-methylcyclohexanecarbonyl)amino]thiophene-2-carboxylate Chemical compound COC(=O)C=1SC(C=2CCCCC=2)=CC=1N(C(=O)C1CCC(C)CC1)C1COCOC1 WUDQZNWCZNXVSM-UHFFFAOYSA-N 0.000 description 1
- CKAFQCCNBSOGEI-UHFFFAOYSA-N methyl 5-(cyclohexen-1-yl)-3-[[4-(methoxymethoxy)cyclohexyl]-(4-methylcyclohexanecarbonyl)amino]thiophene-2-carboxylate Chemical compound C1CC(OCOC)CCC1N(C1=C(SC(=C1)C=1CCCCC=1)C(=O)OC)C(=O)C1CCC(C)CC1 CKAFQCCNBSOGEI-UHFFFAOYSA-N 0.000 description 1
- AEJSNRFCXSRZNH-UHFFFAOYSA-N methyl 5-bromo-3-[(2,4-dioxo-1,3-diazaspiro[4.5]decan-8-yl)-(4-methylcyclohexanecarbonyl)amino]thiophene-2-carboxylate Chemical compound S1C(Br)=CC(N(C2CCC3(CC2)C(NC(=O)N3)=O)C(=O)C2CCC(C)CC2)=C1C(=O)OC AEJSNRFCXSRZNH-UHFFFAOYSA-N 0.000 description 1
- VONOFJWOVOTLIO-UHFFFAOYSA-N methyl 5-bromo-3-[(4-fluorocyclohexyl)-(4-methylcyclohexanecarbonyl)amino]thiophene-2-carboxylate Chemical compound S1C(Br)=CC(N(C2CCC(F)CC2)C(=O)C2CCC(C)CC2)=C1C(=O)OC VONOFJWOVOTLIO-UHFFFAOYSA-N 0.000 description 1
- MXZRZTHTXZXYIZ-UHFFFAOYSA-N methyl 5-bromo-3-[(4-hydroxycyclohexyl)-(4-methylcyclohexanecarbonyl)amino]thiophene-2-carboxylate Chemical compound S1C(Br)=CC(N(C2CCC(O)CC2)C(=O)C2CCC(C)CC2)=C1C(=O)OC MXZRZTHTXZXYIZ-UHFFFAOYSA-N 0.000 description 1
- SVQDIBDRCYBDIN-UHFFFAOYSA-N methyl 5-bromo-3-[(4-methylcyclohexanecarbonyl)-(4-oxocyclohexyl)amino]thiophene-2-carboxylate Chemical compound S1C(Br)=CC(N(C2CCC(=O)CC2)C(=O)C2CCC(C)CC2)=C1C(=O)OC SVQDIBDRCYBDIN-UHFFFAOYSA-N 0.000 description 1
- QRHBBGITAUTBKO-UHFFFAOYSA-N methyl 5-bromo-3-[1,3-dioxan-5-yl-(4-methylcyclohexanecarbonyl)amino]thiophene-2-carboxylate Chemical compound S1C(Br)=CC(N(C2COCOC2)C(=O)C2CCC(C)CC2)=C1C(=O)OC QRHBBGITAUTBKO-UHFFFAOYSA-N 0.000 description 1
- JOCAMKMEAASVJQ-UHFFFAOYSA-N methyl 5-bromo-3-[1,4-dioxaspiro[4.5]decan-8-yl-(4-methylcyclohexanecarbonyl)amino]thiophene-2-carboxylate Chemical compound S1C(Br)=CC(N(C2CCC3(CC2)OCCO3)C(=O)C2CCC(C)CC2)=C1C(=O)OC JOCAMKMEAASVJQ-UHFFFAOYSA-N 0.000 description 1
- YMZBNCXRVMHBHA-UHFFFAOYSA-N methyl 5-cyclohex-2-en-1-yl-3-[(4-hydroxycyclohexyl)-(4-methylcyclohexanecarbonyl)amino]thiophene-2-carboxylate Chemical compound COC(=O)C=1SC(C2C=CCCC2)=CC=1N(C(=O)C1CCC(C)CC1)C1CCC(O)CC1 YMZBNCXRVMHBHA-UHFFFAOYSA-N 0.000 description 1
- UODPHKFUTYRNDZ-UHFFFAOYSA-N methyl 5-cyclohex-2-en-1-yl-3-[(4-methylcyclohexanecarbonyl)-(4-oxocyclohexyl)amino]thiophene-2-carboxylate Chemical compound COC(=O)C=1SC(C2C=CCCC2)=CC=1N(C(=O)C1CCC(C)CC1)C1CCC(=O)CC1 UODPHKFUTYRNDZ-UHFFFAOYSA-N 0.000 description 1
- 125000004492 methyl ester group Chemical group 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 125000004573 morpholin-4-yl group Chemical group N1(CCOCC1)* 0.000 description 1
- XMWFMEYDRNJSOO-UHFFFAOYSA-N morpholine-4-carbonyl chloride Chemical compound ClC(=O)N1CCOCC1 XMWFMEYDRNJSOO-UHFFFAOYSA-N 0.000 description 1
- 125000002757 morpholinyl group Chemical group 0.000 description 1
- 238000000465 moulding Methods 0.000 description 1
- 239000002324 mouth wash Substances 0.000 description 1
- 230000035772 mutation Effects 0.000 description 1
- 125000004923 naphthylmethyl group Chemical group C1(=CC=CC2=CC=CC=C12)C* 0.000 description 1
- 125000004593 naphthyridinyl group Chemical group N1=C(C=CC2=CC=CN=C12)* 0.000 description 1
- 239000006199 nebulizer Substances 0.000 description 1
- 125000005244 neohexyl group Chemical group [H]C([H])([H])C(C([H])([H])[H])(C([H])([H])[H])C([H])([H])C([H])([H])* 0.000 description 1
- 229960004927 neomycin Drugs 0.000 description 1
- LYGJENNIWJXYER-UHFFFAOYSA-N nitromethane Chemical compound C[N+]([O-])=O LYGJENNIWJXYER-UHFFFAOYSA-N 0.000 description 1
- 239000002687 nonaqueous vehicle Substances 0.000 description 1
- 150000003833 nucleoside derivatives Chemical class 0.000 description 1
- 125000003835 nucleoside group Chemical group 0.000 description 1
- HYDZPXNVHXJHBG-UHFFFAOYSA-N o-benzylhydroxylamine;hydron;chloride Chemical compound Cl.NOCC1=CC=CC=C1 HYDZPXNVHXJHBG-UHFFFAOYSA-N 0.000 description 1
- AQFWNELGMODZGC-UHFFFAOYSA-N o-ethylhydroxylamine Chemical compound CCON AQFWNELGMODZGC-UHFFFAOYSA-N 0.000 description 1
- NUXCOKIYARRTDC-UHFFFAOYSA-N o-ethylhydroxylamine;hydron;chloride Chemical compound Cl.CCON NUXCOKIYARRTDC-UHFFFAOYSA-N 0.000 description 1
- 125000004365 octenyl group Chemical group C(=CCCCCCC)* 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- AICOOMRHRUFYCM-ZRRPKQBOSA-N oxazine, 1 Chemical compound C([C@@H]1[C@H](C(C[C@]2(C)[C@@H]([C@H](C)N(C)C)[C@H](O)C[C@]21C)=O)CC1=CC2)C[C@H]1[C@@]1(C)[C@H]2N=C(C(C)C)OC1 AICOOMRHRUFYCM-ZRRPKQBOSA-N 0.000 description 1
- 230000020477 pH reduction Effects 0.000 description 1
- 229910052763 palladium Inorganic materials 0.000 description 1
- 238000007911 parenteral administration Methods 0.000 description 1
- 230000036961 partial effect Effects 0.000 description 1
- 229940049954 penicillin Drugs 0.000 description 1
- 125000002255 pentenyl group Chemical group C(=CCCC)* 0.000 description 1
- 125000005981 pentynyl group Chemical group 0.000 description 1
- 230000000737 periodic effect Effects 0.000 description 1
- 125000005561 phenanthryl group Chemical group 0.000 description 1
- 229960003531 phenolsulfonphthalein Drugs 0.000 description 1
- 239000002953 phosphate buffered saline Substances 0.000 description 1
- 239000002504 physiological saline solution Substances 0.000 description 1
- 125000005936 piperidyl group Chemical group 0.000 description 1
- 230000036470 plasma concentration Effects 0.000 description 1
- 238000005498 polishing Methods 0.000 description 1
- 229920002647 polyamide Polymers 0.000 description 1
- 235000021395 porridge Nutrition 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- XAEFZNCEHLXOMS-UHFFFAOYSA-M potassium benzoate Chemical group [K+].[O-]C(=O)C1=CC=CC=C1 XAEFZNCEHLXOMS-UHFFFAOYSA-M 0.000 description 1
- CHKVPAROMQMJNQ-UHFFFAOYSA-M potassium bisulfate Chemical compound [K+].OS([O-])(=O)=O CHKVPAROMQMJNQ-UHFFFAOYSA-M 0.000 description 1
- 229910000343 potassium bisulfate Inorganic materials 0.000 description 1
- VZOPRCCTKLAGPN-ZFJVMAEJSA-L potassium;sodium;(2r,3r)-2,3-dihydroxybutanedioate;tetrahydrate Chemical class O.O.O.O.[Na+].[K+].[O-]C(=O)[C@H](O)[C@@H](O)C([O-])=O VZOPRCCTKLAGPN-ZFJVMAEJSA-L 0.000 description 1
- 230000002335 preservative effect Effects 0.000 description 1
- 230000008569 process Effects 0.000 description 1
- 238000012545 processing Methods 0.000 description 1
- 230000002062 proliferating effect Effects 0.000 description 1
- 230000002035 prolonged effect Effects 0.000 description 1
- VVWRJUBEIPHGQF-UHFFFAOYSA-N propan-2-yl n-propan-2-yloxycarbonyliminocarbamate Chemical compound CC(C)OC(=O)N=NC(=O)OC(C)C VVWRJUBEIPHGQF-UHFFFAOYSA-N 0.000 description 1
- 239000003380 propellant Substances 0.000 description 1
- 230000000069 prophylactic effect Effects 0.000 description 1
- 125000000561 purinyl group Chemical group N1=C(N=C2N=CNC2=C1)* 0.000 description 1
- ZDYVRSLAEXCVBX-UHFFFAOYSA-N pyridinium p-toluenesulfonate Chemical compound C1=CC=[NH+]C=C1.CC1=CC=C(S([O-])(=O)=O)C=C1 ZDYVRSLAEXCVBX-UHFFFAOYSA-N 0.000 description 1
- 125000000719 pyrrolidinyl group Chemical group 0.000 description 1
- 125000002294 quinazolinyl group Chemical group N1=C(N=CC2=CC=CC=C12)* 0.000 description 1
- 238000006268 reductive amination reaction Methods 0.000 description 1
- 238000000611 regression analysis Methods 0.000 description 1
- 239000012266 salt solution Substances 0.000 description 1
- 238000012216 screening Methods 0.000 description 1
- 125000002914 sec-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 210000002966 serum Anatomy 0.000 description 1
- 150000003385 sodium Chemical class 0.000 description 1
- 239000012279 sodium borohydride Substances 0.000 description 1
- 229910000033 sodium borohydride Inorganic materials 0.000 description 1
- 229940054269 sodium pyruvate Drugs 0.000 description 1
- 159000000000 sodium salts Chemical group 0.000 description 1
- 125000003003 spiro group Chemical group 0.000 description 1
- 230000000087 stabilizing effect Effects 0.000 description 1
- 239000008107 starch Substances 0.000 description 1
- 235000019698 starch Nutrition 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 229960005322 streptomycin Drugs 0.000 description 1
- 238000007920 subcutaneous administration Methods 0.000 description 1
- 125000005420 sulfonamido group Chemical group S(=O)(=O)(N*)* 0.000 description 1
- 150000003463 sulfur Chemical class 0.000 description 1
- 125000004434 sulfur atom Chemical group 0.000 description 1
- 239000006228 supernatant Substances 0.000 description 1
- 238000001308 synthesis method Methods 0.000 description 1
- NHKZSTHOYNWEEZ-AFCXAGJDSA-N taribavirin Chemical compound N1=C(C(=N)N)N=CN1[C@H]1[C@H](O)[C@H](O)[C@@H](CO)O1 NHKZSTHOYNWEEZ-AFCXAGJDSA-N 0.000 description 1
- 229950006081 taribavirin Drugs 0.000 description 1
- 229960002935 telaprevir Drugs 0.000 description 1
- BBAWEDCPNXPBQM-GDEBMMAJSA-N telaprevir Chemical compound N([C@H](C(=O)N[C@H](C(=O)N1C[C@@H]2CCC[C@@H]2[C@H]1C(=O)N[C@@H](CCC)C(=O)C(=O)NC1CC1)C(C)(C)C)C1CCCCC1)C(=O)C1=CN=CC=N1 BBAWEDCPNXPBQM-GDEBMMAJSA-N 0.000 description 1
- 108010017101 telaprevir Proteins 0.000 description 1
- GFNMJSGQSWLTOR-UHFFFAOYSA-N tert-butyl 4-[[5-(cyclohexen-1-yl)-2-methoxycarbonylthiophen-3-yl]-(4-methylcyclohexanecarbonyl)amino]piperidine-1-carboxylate Chemical compound COC(=O)C=1SC(C=2CCCCC=2)=CC=1N(C(=O)C1CCC(C)CC1)C1CCN(C(=O)OC(C)(C)C)CC1 GFNMJSGQSWLTOR-UHFFFAOYSA-N 0.000 description 1
- 125000001973 tert-pentyl group Chemical group [H]C([H])([H])C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 238000012360 testing method Methods 0.000 description 1
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 1
- WHRNULOCNSKMGB-UHFFFAOYSA-N tetrahydrofuran thf Chemical compound C1CCOC1.C1CCOC1 WHRNULOCNSKMGB-UHFFFAOYSA-N 0.000 description 1
- 125000004632 tetrahydrothiopyranyl group Chemical group S1C(CCCC1)* 0.000 description 1
- 125000005247 tetrazinyl group Chemical group N1=NN=NC(=C1)* 0.000 description 1
- 125000003831 tetrazolyl group Chemical group 0.000 description 1
- 229940124597 therapeutic agent Drugs 0.000 description 1
- 230000001225 therapeutic effect Effects 0.000 description 1
- 238000002560 therapeutic procedure Methods 0.000 description 1
- 125000004525 thiadiazinyl group Chemical group S1NN=C(C=C1)* 0.000 description 1
- 125000001113 thiadiazolyl group Chemical group 0.000 description 1
- 230000008719 thickening Effects 0.000 description 1
- 125000004588 thienopyridyl group Chemical group S1C(=CC2=C1C=CC=N2)* 0.000 description 1
- 125000004587 thienothienyl group Chemical group S1C(=CC2=C1C=CS2)* 0.000 description 1
- BMWZMDDFCPGUSM-UHFFFAOYSA-N thiophene-2-carboxylic acid;hydrochloride Chemical compound Cl.OC(=O)C1=CC=CS1 BMWZMDDFCPGUSM-UHFFFAOYSA-N 0.000 description 1
- 150000003577 thiophenes Chemical class 0.000 description 1
- 229960000790 thymol Drugs 0.000 description 1
- 229910052718 tin Inorganic materials 0.000 description 1
- 238000011200 topical administration Methods 0.000 description 1
- 230000000699 topical effect Effects 0.000 description 1
- 125000004306 triazinyl group Chemical group 0.000 description 1
- 125000001425 triazolyl group Chemical group 0.000 description 1
- CMHHITPYCHHOGT-UHFFFAOYSA-N tributylborane Chemical compound CCCCB(CCCC)CCCC CMHHITPYCHHOGT-UHFFFAOYSA-N 0.000 description 1
- 125000006000 trichloroethyl group Chemical group 0.000 description 1
- CYRMSUTZVYGINF-UHFFFAOYSA-N trichlorofluoromethane Chemical compound FC(Cl)(Cl)Cl CYRMSUTZVYGINF-UHFFFAOYSA-N 0.000 description 1
- 229940029284 trichlorofluoromethane Drugs 0.000 description 1
- 125000003866 trichloromethyl group Chemical group ClC(Cl)(Cl)* 0.000 description 1
- 125000004205 trifluoroethyl group Chemical group [H]C([H])(*)C(F)(F)F 0.000 description 1
- 125000000876 trifluoromethoxy group Chemical group FC(F)(F)O* 0.000 description 1
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 description 1
- CWMFRHBXRUITQE-UHFFFAOYSA-N trimethylsilylacetylene Chemical group C[Si](C)(C)C#C CWMFRHBXRUITQE-UHFFFAOYSA-N 0.000 description 1
- LENZDBCJOHFCAS-UHFFFAOYSA-N tris Chemical compound OCC(N)(CO)CO LENZDBCJOHFCAS-UHFFFAOYSA-N 0.000 description 1
- 125000002221 trityl group Chemical group [H]C1=C([H])C([H])=C([H])C([H])=C1C([*])(C1=C(C(=C(C(=C1[H])[H])[H])[H])[H])C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 1
- 229960000281 trometamol Drugs 0.000 description 1
- 238000002604 ultrasonography Methods 0.000 description 1
- 239000003981 vehicle Substances 0.000 description 1
- 201000001862 viral hepatitis Diseases 0.000 description 1
- 230000006514 viral protein processing Effects 0.000 description 1
- 239000000080 wetting agent Substances 0.000 description 1
- 229940051021 yellow-fever virus Drugs 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D333/00—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom
- C07D333/02—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings
- C07D333/04—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings not substituted on the ring sulphur atom
- C07D333/26—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings not substituted on the ring sulphur atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D333/38—Carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals
- C07D333/40—Thiophene-2-carboxylic acid
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D471/00—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, at least one ring being a six-membered ring with one nitrogen atom, not provided for by groups C07D451/00 - C07D463/00
- C07D471/02—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, at least one ring being a six-membered ring with one nitrogen atom, not provided for by groups C07D451/00 - C07D463/00 in which the condensed system contains two hetero rings
- C07D471/04—Ortho-condensed systems
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K31/00—Medicinal preparations containing organic active ingredients
- A61K31/33—Heterocyclic compounds
- A61K31/38—Heterocyclic compounds having sulfur as a ring hetero atom
- A61K31/381—Heterocyclic compounds having sulfur as a ring hetero atom having five-membered rings
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P1/00—Drugs for disorders of the alimentary tract or the digestive system
- A61P1/16—Drugs for disorders of the alimentary tract or the digestive system for liver or gallbladder disorders, e.g. hepatoprotective agents, cholagogues, litholytics
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P31/00—Antiinfectives, i.e. antibiotics, antiseptics, chemotherapeutics
- A61P31/12—Antivirals
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P31/00—Antiinfectives, i.e. antibiotics, antiseptics, chemotherapeutics
- A61P31/12—Antivirals
- A61P31/14—Antivirals for RNA viruses
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P37/00—Drugs for immunological or allergic disorders
- A61P37/02—Immunomodulators
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P37/00—Drugs for immunological or allergic disorders
- A61P37/02—Immunomodulators
- A61P37/04—Immunostimulants
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P43/00—Drugs for specific purposes, not provided for in groups A61P1/00-A61P41/00
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D333/00—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom
- C07D333/02—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings
- C07D333/04—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings not substituted on the ring sulphur atom
- C07D333/26—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings not substituted on the ring sulphur atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D333/38—Carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D409/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having sulfur atoms as the only ring hetero atoms
- C07D409/02—Heterocyclic compounds containing two or more hetero rings, at least one ring having sulfur atoms as the only ring hetero atoms containing two hetero rings
- C07D409/04—Heterocyclic compounds containing two or more hetero rings, at least one ring having sulfur atoms as the only ring hetero atoms containing two hetero rings directly linked by a ring-member-to-ring-member bond
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D409/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having sulfur atoms as the only ring hetero atoms
- C07D409/02—Heterocyclic compounds containing two or more hetero rings, at least one ring having sulfur atoms as the only ring hetero atoms containing two hetero rings
- C07D409/12—Heterocyclic compounds containing two or more hetero rings, at least one ring having sulfur atoms as the only ring hetero atoms containing two hetero rings linked by a chain containing hetero atoms as chain links
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D409/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having sulfur atoms as the only ring hetero atoms
- C07D409/14—Heterocyclic compounds containing two or more hetero rings, at least one ring having sulfur atoms as the only ring hetero atoms containing three or more hetero rings
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Life Sciences & Earth Sciences (AREA)
- Veterinary Medicine (AREA)
- Public Health (AREA)
- General Health & Medical Sciences (AREA)
- Animal Behavior & Ethology (AREA)
- Pharmacology & Pharmacy (AREA)
- Medicinal Chemistry (AREA)
- Chemical Kinetics & Catalysis (AREA)
- General Chemical & Material Sciences (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Immunology (AREA)
- Bioinformatics & Cheminformatics (AREA)
- Engineering & Computer Science (AREA)
- Virology (AREA)
- Communicable Diseases (AREA)
- Oncology (AREA)
- Molecular Biology (AREA)
- Gastroenterology & Hepatology (AREA)
- Epidemiology (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
- Heterocyclic Compounds Containing Sulfur Atoms (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
- Medicines That Contain Protein Lipid Enzymes And Other Medicines (AREA)
- Thiazole And Isothizaole Compounds (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US68048205P | 2005-05-13 | 2005-05-13 | |
| PCT/CA2006/000786 WO2006119646A1 (en) | 2005-05-13 | 2006-05-15 | Compounds and methods for the treatment or prevention of flavivirus infections |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| EA200702493A1 EA200702493A1 (ru) | 2008-04-28 |
| EA016071B1 true EA016071B1 (ru) | 2012-01-30 |
Family
ID=37396165
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| EA200702493A EA016071B1 (ru) | 2005-05-13 | 2006-05-15 | Соединения и способы лечения или предотвращения флавивирусных инфекций |
Country Status (16)
| Country | Link |
|---|---|
| US (3) | US7569600B2 (enExample) |
| EP (3) | EP2543664A1 (enExample) |
| JP (1) | JP5030947B2 (enExample) |
| KR (1) | KR20080016597A (enExample) |
| CN (2) | CN102718744A (enExample) |
| AP (1) | AP2007004245A0 (enExample) |
| AU (1) | AU2006246227B2 (enExample) |
| BR (1) | BRPI0610283A2 (enExample) |
| CA (1) | CA2607359C (enExample) |
| EA (1) | EA016071B1 (enExample) |
| ES (1) | ES2415742T3 (enExample) |
| MX (1) | MX2007014117A (enExample) |
| NZ (1) | NZ563909A (enExample) |
| SG (1) | SG161315A1 (enExample) |
| WO (1) | WO2006119646A1 (enExample) |
| ZA (1) | ZA200709727B (enExample) |
Families Citing this family (45)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US8329924B2 (en) * | 2001-06-11 | 2012-12-11 | Vertex Pharmaceuticals (Canada) Incorporated | Compounds and methods for the treatment or prevention of Flavivirus infections |
| US6881741B2 (en) * | 2001-06-11 | 2005-04-19 | Virochem Pharma Inc. | Compounds and methods for the treatment or prevention of Flavivirus infections |
| WO2006119646A1 (en) * | 2005-05-13 | 2006-11-16 | Virochem Pharma Inc. | Compounds and methods for the treatment or prevention of flavivirus infections |
| JP5290186B2 (ja) | 2006-11-15 | 2013-09-18 | ヴァイロケム ファーマ インコーポレイテッド | フラビウイルス感染症の治療または予防用のチオフェン類似体 |
| JP2010521457A (ja) * | 2007-03-12 | 2010-06-24 | メルク・シャープ・エンド・ドーム・コーポレイション | 単環式アニリドスピロラクタムcgrp受容体アンタゴニスト |
| PL2308514T3 (pl) | 2007-03-23 | 2013-11-29 | To Bbb Holding B V | Koniugaty do ukierunkowanego dostarczania leku poprzez barierę krew-mózg |
| EP2142215B1 (en) | 2007-05-04 | 2012-03-07 | Vertex Pharmceuticals Incorporated | Combination therapy for the treatment of hcv infection |
| CA2688194A1 (en) | 2007-05-23 | 2008-12-04 | Siga Technologies, Inc. | Antiviral drugs for treatment or prevention of dengue infection |
| GB0712393D0 (en) * | 2007-06-26 | 2007-08-01 | Smithkline Beecham Corp | Compounds |
| CN101903351B (zh) | 2007-12-19 | 2014-09-10 | 贝林格尔.英格海姆国际有限公司 | 病毒聚合酶抑制剂 |
| US20110212986A1 (en) * | 2008-08-21 | 2011-09-01 | Health Research, Inc. | Anti-flavivirus therapeutic |
| JP2012514605A (ja) | 2009-01-07 | 2012-06-28 | サイネクシス,インコーポレーテッド | Hcvおよびhiv感染の治療への使用におけるシクロスポリン誘導体 |
| JP5327744B2 (ja) * | 2009-03-13 | 2013-10-30 | 国立大学法人 鹿児島大学 | ジフェニルメタン誘導体を有効成分とする抗ウイルス剤 |
| AU2010276441B2 (en) * | 2009-07-21 | 2015-07-02 | Gilead Sciences, Inc. | Inhibitors of Flaviviridae viruses |
| WO2011031669A1 (en) | 2009-09-09 | 2011-03-17 | Gilead Sciences, Inc. | Inhibitors of flaviviridae viruses |
| EP2477982A4 (en) | 2009-09-16 | 2013-04-03 | Calcimedica Inc | COMPOUNDS THAT MODULATE INTRACELLULAR CALCIUM |
| EP2504329A1 (en) | 2009-11-25 | 2012-10-03 | Vertex Pharmaceuticals Incorporated | 5-alkynyl-thiophene-2-carboxylic acid derivatives and their use for the treatment or prevention of flavivirus infections |
| US8524764B2 (en) | 2010-01-15 | 2013-09-03 | Gilead Sciences, Inc. | Inhibitors of Flaviviridae viruses |
| MX2012008211A (es) * | 2010-01-15 | 2012-08-08 | Gilead Sciences Inc | Inhibidores de virus flaviviridae. |
| WO2012006060A1 (en) | 2010-06-28 | 2012-01-12 | Vertex Pharmaceuticals Incorporated | Compounds and methods for the treatment or prevention of flavivirus infections |
| EP2585447A2 (en) | 2010-06-28 | 2013-05-01 | Vertex Pharmaceuticals Incorporated | Compounds and methods for the treatment or prevention of flavivirus infections |
| EP2606041A2 (en) | 2010-08-17 | 2013-06-26 | Vertex Pharmaceuticals Incorporated | Compounds and methods for the treatment or prevention of flaviviridae viral infections |
| US8771665B2 (en) | 2010-12-17 | 2014-07-08 | Cocrystal Discovery, Inc. | Inhibitors of hepatitis C virus polymerase |
| US20130203706A1 (en) * | 2011-06-28 | 2013-08-08 | Vertex Pharmaceuticals Incorporated | Compounds and methods for the treatment or prevention of flavivirus infections |
| PT2734515E (pt) | 2011-07-13 | 2016-03-11 | Gilead Sciences Inc | Derivados de ácido tiofen-2-carboxílico úteis como inibidores de vírus flaviviridae |
| CN103059042B (zh) * | 2011-10-18 | 2015-10-07 | 银杏树药业(苏州)有限公司 | 噻吩类衍生物及其在药学中的用途 |
| US8466159B2 (en) | 2011-10-21 | 2013-06-18 | Abbvie Inc. | Methods for treating HCV |
| DE202012012955U1 (de) | 2011-10-21 | 2014-07-14 | Abbvie Inc. | Eine Kombination aus mindestens zwei direkt wirkenden antiviralen Wirkstoffen (DAAs) für die Verwendung zur Behandlung von HCV |
| EP2583677A3 (en) | 2011-10-21 | 2013-07-03 | Abbvie Inc. | Methods for treating HCV comprising at least two direct acting antiviral agent, ribavirin but not interferon. |
| US8492386B2 (en) | 2011-10-21 | 2013-07-23 | Abbvie Inc. | Methods for treating HCV |
| CN103087052A (zh) * | 2011-10-31 | 2013-05-08 | 上海壹志医药科技有限公司 | 噻吩衍生物及其药物用途 |
| WO2014055142A1 (en) | 2012-06-20 | 2014-04-10 | Cocrystal Discovery, Inc. | Inhibitors of hepatitis c virus polymerase |
| US8927741B2 (en) | 2012-08-17 | 2015-01-06 | Gilead Sciences, Inc. | Synthesis of an antiviral compound |
| US8841340B2 (en) | 2012-08-17 | 2014-09-23 | Gilead Sciences, Inc. | Solid forms of an antiviral compound |
| US8759544B2 (en) | 2012-08-17 | 2014-06-24 | Gilead Sciences, Inc. | Synthesis of an antiviral compound |
| TWI731854B (zh) | 2015-03-23 | 2021-07-01 | 美商共結晶製藥公司 | C型肝炎病毒聚合酶之抑制劑 |
| EA201892448A1 (ru) | 2016-04-28 | 2019-06-28 | Эмори Юниверсити | Алкинсодержащие нуклеотидные и нуклеозидные терапевтические композиции и связанные с ними способы применения |
| CN106467477A (zh) * | 2016-08-26 | 2017-03-01 | 天津雅奥科技发展有限公司 | 一种合成化合物(1‑环丙基‑1‑氰基‑4‑环己酮)的新方法 |
| KR20210018806A (ko) | 2018-05-09 | 2021-02-18 | 코크리스탈 파마, 아이엔씨. | Hcv의 치료를 위한 병용 요법 |
| AU2019291488B2 (en) | 2018-06-19 | 2022-02-24 | Novartis Ag | N-substituted tetrahydrothienopyridine derivatives and uses thereof |
| CN110592172B (zh) * | 2019-10-29 | 2021-05-28 | 华中农业大学 | 利用CRISPR/Cas9敲除文库技术筛选JEV抗性基因的方法与靶点 |
| CN111518015A (zh) * | 2020-05-20 | 2020-08-11 | 上海合全药物研发有限公司 | 一种叔丁基-8-氧亚基-2-氮杂螺[4.5]癸烷-2-甲酸基酯的制备方法 |
| CN113861176B (zh) * | 2021-09-28 | 2023-11-03 | 北京凯因格领生物技术有限公司 | 一种黄病毒抑制剂 |
| EP4282862A1 (en) * | 2022-05-25 | 2023-11-29 | Irbm S.P.A. | Flavivirus inhibitors |
| AU2024284676A1 (en) * | 2023-06-05 | 2026-01-08 | Celloram Inc. | Inhibitors of fatty acid binding proteins (fabps), methods of use and methods of making |
Citations (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| WO1998049162A1 (en) * | 1997-04-28 | 1998-11-05 | Texas Biotechnology Corporation | Sulfonamides for treatment of endothelin-mediated disorders |
Family Cites Families (91)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3076817A (en) * | 1963-02-05 | New j-amino-thiophene-z | ||
| DE1055007B (de) | 1957-08-29 | 1959-04-16 | Dr Hans Fiesselmann | Verfahren zur Herstellung von 3-Aminothiophen-2-carbonsaeureestern und den entsprechenden freien Carbonsaeuren |
| US3470151A (en) | 1966-05-17 | 1969-09-30 | Beecham Group Ltd | Furyl- and thienyl-penicillins and salts thereof |
| AU518216B2 (en) * | 1977-09-06 | 1981-09-17 | Hafslund Nycomed Pharma Aktiengesellschaft | Thienothiazine derivatives |
| GB8627698D0 (en) | 1986-11-20 | 1986-12-17 | Boots Co Plc | Therapeutic agents |
| US4962101A (en) | 1989-08-21 | 1990-10-09 | Merck & Co., Inc. | 2-(Heterocyclylalkyl)phenyl carbapenem antibacterial agents |
| JPH0748360A (ja) | 1993-05-31 | 1995-02-21 | Yoshitomi Pharmaceut Ind Ltd | ビフェニルテトラゾール誘導体 |
| KR100509388B1 (ko) | 1996-10-18 | 2005-08-23 | 버텍스 파마슈티칼스 인코포레이티드 | 세린 프로테아제, 특히 간염 c 바이러스 ns3 프로테아제의 저해제 |
| JP4000608B2 (ja) * | 1996-11-07 | 2007-10-31 | トヨタ自動車株式会社 | 水素製造充填装置および電気自動車 |
| TW523506B (en) * | 1996-12-18 | 2003-03-11 | Ono Pharmaceutical Co | Sulfonamide or carbamide derivatives and drugs containing the same as active ingredients |
| US6117911A (en) * | 1997-04-11 | 2000-09-12 | Neorx Corporation | Compounds and therapies for the prevention of vascular and non-vascular pathologies |
| US5783705A (en) * | 1997-04-28 | 1998-07-21 | Texas Biotechnology Corporation | Process of preparing alkali metal salys of hydrophobic sulfonamides |
| DE69826695T2 (de) | 1997-05-23 | 2006-02-02 | Bayer Pharmaceuticals Corp., West Haven | Arylharnstoffderivate zur behandlung von inflammatorischen oder immunomodulatorischen erkrankungen |
| DK0986382T3 (da) | 1997-05-23 | 2008-10-20 | Bayer Pharmaceuticals Corp | RAF-kinasehæmmere |
| US6187799B1 (en) * | 1997-05-23 | 2001-02-13 | Onyx Pharmaceuticals | Inhibition of raf kinase activity using aryl ureas |
| ES2234144T3 (es) | 1997-08-11 | 2005-06-16 | Boehringer Ingelheim (Canada) Ltd. | Analogos de peptidos inhibidores de la hepatitis c. |
| WO1999007733A2 (en) | 1997-08-11 | 1999-02-18 | Boehringer Ingelheim (Canada) Ltd. | Hepatitis c inhibitor peptides |
| DE69903992T2 (de) * | 1998-04-15 | 2003-08-21 | Pfizer Products Inc., Groton | Heterocyclische Carboxamide |
| EP0960882A1 (en) * | 1998-05-19 | 1999-12-01 | Hoechst Marion Roussel Deutschland GmbH | Thienyl substituted acylguanidines as inhibitors of bone resorption and vitronectin receptor antagonists |
| US6858223B2 (en) * | 1998-06-23 | 2005-02-22 | Altana Pharma Ag | Compositions comprising phenylaminothiophenacetic acid derivatives for the treatment of acute or adult respiratory distress syndrome (ARDS) and infant respiratory distress syndrome (IRDS) |
| ATE253061T1 (de) * | 1998-06-29 | 2003-11-15 | Iaf Biochem Int | Zur behandlung von krebs nützliche thiophen- und furan-2,5-dicarboxamide |
| WO2000006529A1 (en) | 1998-07-27 | 2000-02-10 | Istituto Di Ricerche Di Biologia Molecolare P Angeletti S.P.A. | Diketoacid-derivatives as inhibitors of polymerases |
| US6323180B1 (en) | 1998-08-10 | 2001-11-27 | Boehringer Ingelheim (Canada) Ltd | Hepatitis C inhibitor tri-peptides |
| AR022061A1 (es) | 1998-08-10 | 2002-09-04 | Boehringer Ingelheim Ca Ltd | Peptidos inhibidores de la hepatitis c, una composicion farmaceutica que los contiene, el uso de los mismos para preparar una composicion farmaceutica, el uso de un producto intermedio para la preparacion de estos peptidos y un procedimiento para la preparacion de un peptido analogo de los mismos. |
| HUP0103622A3 (en) | 1998-08-20 | 2003-01-28 | Agouron Pharmaceuticals Inc La | Non-peptide gnrh agents, methods and intermediates for their preparation and medicaments containing them |
| DE19903398A1 (de) | 1999-01-29 | 2000-08-10 | Hassan Jomaa | Verwendung von Thiadiazolderivaten zur prophylaktischen und therapeutischen Behandlung von Infektionen |
| ATE278674T1 (de) * | 1999-03-12 | 2004-10-15 | Boehringer Ingelheim Pharma | Heterocyklischer harnstoff und verwandte verbindungen als entzündungshemmende mittel |
| UA74546C2 (en) | 1999-04-06 | 2006-01-16 | Boehringer Ingelheim Ca Ltd | Macrocyclic peptides having activity relative to hepatitis c virus, a pharmaceutical composition and use of the pharmaceutical composition |
| JP2001010957A (ja) | 1999-04-28 | 2001-01-16 | Sankyo Co Ltd | 肝障害の予防または抑制剤 |
| DE19920247A1 (de) | 1999-05-03 | 2000-11-16 | Hassan Jomaa | Arzneimittel mit einem Gehalt an Verbindungen mit einem Stickstoff-Sauerstoff-Heterocyclus als Wirkstoff und ihre Verwendung |
| HN2000000051A (es) * | 1999-05-19 | 2001-02-02 | Pfizer Prod Inc | Derivados heterociclicos utiles como agentes anticancerosos |
| CA2385972A1 (en) * | 1999-10-01 | 2001-04-12 | Haruhisa Ogita | Novel diarylamide derivatives and use thereof as medicines |
| BR0015909A (pt) * | 1999-11-29 | 2002-08-06 | Novartis Ag | N-heteroaril alfa-alcoximino-carboxamidas pesticidas |
| NZ514403A (en) | 1999-12-27 | 2002-10-25 | Japan Tobacco Inc | Fused-ring compounds and use thereof as drugs |
| DE10002424A1 (de) * | 2000-01-20 | 2001-07-26 | Siemens Ag | Di(het)arylaminothiophen-Derivate |
| WO2001085172A1 (en) | 2000-05-10 | 2001-11-15 | Smithkline Beecham Corporation | Novel anti-infectives |
| MY164523A (en) | 2000-05-23 | 2017-12-29 | Univ Degli Studi Cagliari | Methods and compositions for treating hepatitis c virus |
| US6414013B1 (en) * | 2000-06-19 | 2002-07-02 | Pharmacia & Upjohn S.P.A. | Thiophene compounds, process for preparing the same, and pharmaceutical compositions containing the same background of the invention |
| GB0017676D0 (en) | 2000-07-19 | 2000-09-06 | Angeletti P Ist Richerche Bio | Inhibitors of viral polymerase |
| SV2003000617A (es) | 2000-08-31 | 2003-01-13 | Lilly Co Eli | Inhibidores de la proteasa peptidomimetica ref. x-14912m |
| AU2002213048A1 (en) | 2000-10-05 | 2002-04-15 | Smith Kline Beecham Corporation | Phosphate transport inhibitors |
| US7105565B2 (en) | 2000-11-08 | 2006-09-12 | Syngenta Crop Protection, Inc. | Pyrrolcarboxamides and pyrrolcarbothioamides and their agrochemical uses |
| DE60119968T2 (de) | 2000-11-20 | 2007-01-18 | Bristol-Myers Squibb Co. | Hepatitis c tripeptid inhibitoren |
| US6892279B2 (en) * | 2000-11-30 | 2005-05-10 | Mosaid Technologies Incorporated | Method and apparatus for accelerating retrieval of data from a memory system with cache by reducing latency |
| DE10061876A1 (de) * | 2000-12-12 | 2002-06-20 | Aventis Pharma Gmbh | Arylierte Furan- und Thiophencarbonsäureamide, Verfahren zu ihrer Herstellung, ihre Verwendung als Medikament sowie sie enthaltende pharmazeutische Zubereitungen |
| SK286630B6 (sk) | 2001-01-22 | 2009-02-05 | Merck & Co., Inc. | Nukleozidové deriváty, farmaceutický prostriedok s ich obsahom a ich použitie |
| WO2002069903A2 (en) | 2001-03-06 | 2002-09-12 | Biocryst Pharmaceuticals, Inc. | Nucleosides, preparation thereof and use as inhibitors of rna viral polymerases |
| US6734207B2 (en) * | 2001-04-20 | 2004-05-11 | Parker Hughes Institute | Cytotoxic compounds |
| EP1256628A3 (en) | 2001-05-10 | 2003-03-19 | Agouron Pharmaceuticals, Inc. | Hepatitis c virus (hcv) ns5b rna polymerase and mutants thereof |
| US6713638B2 (en) * | 2001-05-18 | 2004-03-30 | Joel M. Linden | 2-amino-3-aroyl-4,5 alkylthiophenes: agonist allosteric enhancers at human A1 adenosine receptors |
| AR036081A1 (es) | 2001-06-07 | 2004-08-11 | Smithkline Beecham Corp | Compuesto de 1,2-dihidroquinolina, su uso para preparar una composicion farmaceutica, metodos para prepararlo y compuestos del acido 2-aminobenzoico n-alquilado de utilidad como intermediarios en dichos metodos |
| WO2002100846A1 (en) | 2001-06-11 | 2002-12-19 | Shire Biochem Inc. | Compounds and methods for the treatment or prevention of flavivirus infections |
| US6881741B2 (en) | 2001-06-11 | 2005-04-19 | Virochem Pharma Inc. | Compounds and methods for the treatment or prevention of Flavivirus infections |
| AR035543A1 (es) | 2001-06-26 | 2004-06-16 | Japan Tobacco Inc | Agente terapeutico para la hepatitis c que comprende un compuesto de anillo condensado, compuesto de anillo condensado, composicion farmaceutica que lo comprende, compuestos de benzimidazol, tiazol y bifenilo utiles como intermediarios para producir dichos compuestos, uso del compuesto de anillo con |
| SE0102617D0 (sv) * | 2001-07-25 | 2001-07-25 | Astrazeneca Ab | Novel compounds |
| EP2335700A1 (en) | 2001-07-25 | 2011-06-22 | Boehringer Ingelheim (Canada) Ltd. | Hepatitis C virus polymerase inhibitors with a heterobicylic structure |
| WO2003026587A2 (en) | 2001-09-26 | 2003-04-03 | Bristol-Myers Squibb Company | Compounds useful for treating hepatitus c virus |
| EP1448545B1 (en) * | 2001-10-04 | 2008-11-19 | Smithkline Beecham Corporation | Nf-kb inhibitors |
| US7241796B2 (en) | 2001-10-24 | 2007-07-10 | Vertex Pharmaceuticals Inc. | Inhibitors of serine proteases, particularly HCV NS3-NS4A protease |
| TWI281916B (en) * | 2001-10-25 | 2007-06-01 | Lilly Co Eli | Antitumor compounds and methods |
| AU2002352443A1 (en) * | 2001-12-21 | 2003-07-15 | Consejo Superior De Investigaciones Cientificas | Compounds and their therapeutic use related to the phosphorylating activity of the enzyme gsk-3 |
| US6835745B2 (en) * | 2002-01-15 | 2004-12-28 | Wyeth | Phenyl substituted thiophenes as estrogenic agents |
| DE10203122A1 (de) | 2002-01-25 | 2003-07-31 | Gruenenthal Gmbh | Verfahren zur Herstellung von substituierten Acrylsäureestern bzw. deren Einsatz zur Herstellung von substituierten gamma-Aminosäuren |
| KR20040099425A (ko) | 2002-04-11 | 2004-11-26 | 버텍스 파마슈티칼스 인코포레이티드 | 세린 프로테아제, 특히 c형 간염 바이러스 ns3-ns4프로테아제의 억제제 |
| US20040063658A1 (en) | 2002-05-06 | 2004-04-01 | Roberts Christopher Don | Nucleoside derivatives for treating hepatitis C virus infection |
| US7138530B2 (en) * | 2002-05-28 | 2006-11-21 | 3-Dimensional Pharmaceuticals, Inc. | Thiophene amidines, compositions thereof, and methods of treating complement-mediated diseases and conditions |
| US7179836B2 (en) * | 2002-09-20 | 2007-02-20 | Smithkline Beecham Corporation | Chemical compounds |
| MXPA05006196A (es) | 2002-12-10 | 2006-01-27 | Virochem Pharma Inc | Compuestos y metodos para el tratamiento o prevencion de infecciones por flavivirus. |
| US20040192707A1 (en) | 2002-12-10 | 2004-09-30 | Laval Chan Chun Kong | Compounds and methods for the treatment or prevention of Flavivirus infections |
| KR101058696B1 (ko) | 2002-12-10 | 2011-08-22 | 바이로켐 파마 인코포레이티드 | 후라비바이러스 감염의 치료 또는 예방을 위한 화합물과방법 |
| US7098241B2 (en) * | 2002-12-16 | 2006-08-29 | Hoffmann-La Roche Inc. | Thiophene hydroxamic acid derivatives |
| WO2004092161A1 (en) | 2003-04-11 | 2004-10-28 | Vertex Pharmaceuticals Incorporated | Inhibitors of serine proteases, particularly hcv ns3-ns4a protease |
| JP2006526011A (ja) | 2003-04-11 | 2006-11-16 | バーテックス ファーマシューティカルズ インコーポレイテッド | セリンプロテアーゼ(特に、hcvns3−ns4aプロテアーゼ)のインヒビター |
| US20050113566A1 (en) | 2003-04-25 | 2005-05-26 | Player Mark R. | Inhibitors of C-FMS kinase |
| WO2004103960A2 (en) | 2003-05-16 | 2004-12-02 | Ambit Biosciences Corporation | Compounds and uses thereof |
| US7345046B2 (en) | 2003-05-30 | 2008-03-18 | Chiron Corporation | Heteroaryl-fused pyrimidinyl compounds as anticancer agents |
| CN1852920B (zh) | 2003-07-18 | 2010-12-15 | 沃泰克斯药物股份有限公司 | 丝氨酸蛋白酶抑制剂、特别是hcv ns3-ns4a蛋白酶抑制剂 |
| TWI359147B (en) | 2003-09-05 | 2012-03-01 | Vertex Pharma | Inhibitors of serine proteases, particularly hcv n |
| EP1664091A1 (en) | 2003-09-18 | 2006-06-07 | Vertex Pharmaceuticals Incorporated | Inhibitors of serine proteases, particularly hcv ns3-ns4a protease |
| GB0324653D0 (en) | 2003-10-22 | 2003-11-26 | Syngenta Participations Ag | Fungicides |
| DE10359791A1 (de) * | 2003-12-19 | 2005-07-21 | Bayer Healthcare Ag | Substituierte Thiophene |
| CN1938332B (zh) | 2004-02-04 | 2011-10-19 | 沃泰克斯药物股份有限公司 | 丝氨酸蛋白酶、特别是hcv ns3-ns4a蛋白酶的抑制剂 |
| WO2006093518A2 (en) | 2004-06-25 | 2006-09-08 | Apath, Llc | Thienyl compounds for treating virus-related conditions |
| WO2006019831A1 (en) | 2004-07-14 | 2006-02-23 | Ptc Therapeutics, Inc. | Methods for treating hepatitis c |
| FR2873692B1 (fr) | 2004-07-29 | 2006-12-01 | Univ Claude Bernard Lyon | COMPOSITIONS CONTENANT, EN ASSOCIATION AVEC UN AGENT ANTIMICROBIEN, UN COMPOSE THIOPHENIQUE OU BENZOTHIOPHENIQUE DE FORMULE(I)PRESENTANT UNE ACTIVITE INHIBITRICE DE POMPE NorA |
| RU2007116265A (ru) | 2004-10-01 | 2008-11-10 | Вертекс Фармасьютикалз Инкорпорейтед (Us) | Ингибирование протеазы ns3-ns4a вируса hcv |
| DE102005028077A1 (de) | 2004-12-22 | 2006-07-13 | Aicuris Gmbh & Co. Kg | Alkinyl-substituierte Thiophene |
| DE102004061746A1 (de) | 2004-12-22 | 2006-07-06 | Bayer Healthcare Ag | Alkinyl-substituierte Thiophene |
| WO2006119646A1 (en) * | 2005-05-13 | 2006-11-16 | Virochem Pharma Inc. | Compounds and methods for the treatment or prevention of flavivirus infections |
| JP2006334109A (ja) | 2005-06-01 | 2006-12-14 | Matsushita Electric Works Ltd | ヘアセット装置 |
| JP5290186B2 (ja) | 2006-11-15 | 2013-09-18 | ヴァイロケム ファーマ インコーポレイテッド | フラビウイルス感染症の治療または予防用のチオフェン類似体 |
-
2006
- 2006-05-15 WO PCT/CA2006/000786 patent/WO2006119646A1/en not_active Ceased
- 2006-05-15 SG SG201002905-6A patent/SG161315A1/en unknown
- 2006-05-15 EP EP12004696A patent/EP2543664A1/en not_active Withdrawn
- 2006-05-15 CN CN2012101163717A patent/CN102718744A/zh active Pending
- 2006-05-15 NZ NZ563909A patent/NZ563909A/en not_active IP Right Cessation
- 2006-05-15 CN CN2006800248617A patent/CN101218224B/zh not_active Expired - Fee Related
- 2006-05-15 CA CA2607359A patent/CA2607359C/en not_active Expired - Fee Related
- 2006-05-15 EA EA200702493A patent/EA016071B1/ru not_active IP Right Cessation
- 2006-05-15 AU AU2006246227A patent/AU2006246227B2/en not_active Ceased
- 2006-05-15 AP AP2007004245A patent/AP2007004245A0/xx unknown
- 2006-05-15 EP EP06741500A patent/EP1879879B1/en active Active
- 2006-05-15 KR KR1020077028215A patent/KR20080016597A/ko not_active Ceased
- 2006-05-15 BR BRPI0610283-2A patent/BRPI0610283A2/pt not_active IP Right Cessation
- 2006-05-15 JP JP2008510379A patent/JP5030947B2/ja not_active Expired - Fee Related
- 2006-05-15 MX MX2007014117A patent/MX2007014117A/es active IP Right Grant
- 2006-05-15 EP EP12004718.8A patent/EP2546246A3/en not_active Withdrawn
- 2006-05-15 ES ES06741500T patent/ES2415742T3/es active Active
- 2006-05-15 US US11/433,749 patent/US7569600B2/en not_active Expired - Fee Related
-
2007
- 2007-11-12 ZA ZA200709727A patent/ZA200709727B/xx unknown
-
2009
- 2009-07-24 US US12/508,893 patent/US8158675B2/en not_active Expired - Fee Related
-
2012
- 2012-03-09 US US13/416,565 patent/US8674118B2/en not_active Expired - Fee Related
Patent Citations (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| WO1998049162A1 (en) * | 1997-04-28 | 1998-11-05 | Texas Biotechnology Corporation | Sulfonamides for treatment of endothelin-mediated disorders |
| CA2496680A1 (en) * | 1997-04-28 | 1998-11-05 | Encysive Pharmaceuticals Inc. | Sulfonamide compounds and salts for treatment of endothelin-mediated disorders |
Also Published As
| Publication number | Publication date |
|---|---|
| JP5030947B2 (ja) | 2012-09-19 |
| US8674118B2 (en) | 2014-03-18 |
| AU2006246227A1 (en) | 2006-11-16 |
| AU2006246227B2 (en) | 2011-04-28 |
| ES2415742T3 (es) | 2013-07-26 |
| EP2546246A2 (en) | 2013-01-16 |
| EP1879879A4 (en) | 2010-03-10 |
| EP1879879B1 (en) | 2013-03-27 |
| MX2007014117A (es) | 2008-02-05 |
| EP2543664A1 (en) | 2013-01-09 |
| CN102718744A (zh) | 2012-10-10 |
| CA2607359C (en) | 2011-08-09 |
| ZA200709727B (en) | 2008-11-26 |
| US7569600B2 (en) | 2009-08-04 |
| EA200702493A1 (ru) | 2008-04-28 |
| AP2007004245A0 (en) | 2007-12-31 |
| BRPI0610283A2 (pt) | 2010-10-19 |
| US20120164103A1 (en) | 2012-06-28 |
| SG161315A1 (en) | 2010-05-27 |
| HK1112910A1 (en) | 2008-09-19 |
| CA2607359A1 (en) | 2006-11-16 |
| EP2546246A3 (en) | 2013-04-24 |
| WO2006119646A1 (en) | 2006-11-16 |
| NZ563909A (en) | 2011-10-28 |
| CN101218224A (zh) | 2008-07-09 |
| CN101218224B (zh) | 2013-05-08 |
| JP2008540463A (ja) | 2008-11-20 |
| KR20080016597A (ko) | 2008-02-21 |
| EP1879879A1 (en) | 2008-01-23 |
| US20060276533A1 (en) | 2006-12-07 |
| US20100093775A1 (en) | 2010-04-15 |
| US8158675B2 (en) | 2012-04-17 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| EA016071B1 (ru) | Соединения и способы лечения или предотвращения флавивирусных инфекций | |
| US10765676B2 (en) | Trk-inhibiting compound | |
| EP2297133B1 (en) | 1, 2 disubstituted heterocyclic compounds | |
| JP5290186B2 (ja) | フラビウイルス感染症の治療または予防用のチオフェン類似体 | |
| CA2508990C (en) | Compounds and methods for the treatment or prevention of flavivirus infections | |
| KR101058696B1 (ko) | 후라비바이러스 감염의 치료 또는 예방을 위한 화합물과방법 | |
| BRPI0314344B1 (pt) | composto 2,3-diidro-6-nitroimidazo[2,1-b]oxazol, composição farmacêutica compreendendo o mesmo e método para produzir um composto | |
| EP3807261B1 (en) | Pyridinyl pyrazoles as modulators of roryt | |
| JP2013512247A (ja) | フラビウイルス感染症の治療または予防のための5−アルキニル−チオフェン−2−カルボン酸誘導体およびそれらの使用 | |
| JP2007530516A (ja) | 抗ウイルス剤として有用な4−カルボキシピラゾール誘導体 | |
| AU2011205048B2 (en) | Compounds and methods for the treatment or prevention of flavivirus infections | |
| HK1112910B (en) | Compounds and methods for the treatment or prevention of flavivirus infections | |
| HK1177453A (en) | Compounds and methods for the treatment or prevention of flavivirus infections |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MM4A | Lapse of a eurasian patent due to non-payment of renewal fees within the time limit in the following designated state(s) |
Designated state(s): AM AZ BY KZ KG MD TJ TM RU |