EA000868B1 - Производные пиридазин-3-она, их использование в качестве гербицидов и промежуточные соединения для их получения - Google Patents
Производные пиридазин-3-она, их использование в качестве гербицидов и промежуточные соединения для их получения Download PDFInfo
- Publication number
- EA000868B1 EA000868B1 EA199800219A EA199800219A EA000868B1 EA 000868 B1 EA000868 B1 EA 000868B1 EA 199800219 A EA199800219 A EA 199800219A EA 199800219 A EA199800219 A EA 199800219A EA 000868 B1 EA000868 B1 EA 000868B1
- Authority
- EA
- Eurasian Patent Office
- Prior art keywords
- compound
- alkyl
- compound according
- methyl
- fluoro
- Prior art date
Links
- 239000004009 herbicide Substances 0.000 title claims description 9
- 238000004519 manufacturing process Methods 0.000 title description 41
- AAILEWXSEQLMNI-UHFFFAOYSA-N 1h-pyridazin-6-one Chemical class OC1=CC=CN=N1 AAILEWXSEQLMNI-UHFFFAOYSA-N 0.000 title description 7
- 239000000543 intermediate Substances 0.000 title description 3
- 239000000460 chlorine Substances 0.000 claims abstract description 2121
- 150000001875 compounds Chemical class 0.000 claims abstract description 740
- -1 tetramethylene, pentamethylene Chemical group 0.000 claims abstract description 212
- 229910052801 chlorine Inorganic materials 0.000 claims abstract description 159
- 229910052739 hydrogen Inorganic materials 0.000 claims abstract description 149
- 239000000203 mixture Substances 0.000 claims abstract description 95
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims abstract description 72
- 239000001257 hydrogen Substances 0.000 claims abstract description 55
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 claims abstract description 51
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims abstract description 48
- 125000000171 (C1-C6) haloalkyl group Chemical group 0.000 claims abstract description 34
- 150000002431 hydrogen Chemical class 0.000 claims abstract description 34
- 125000006552 (C3-C8) cycloalkyl group Chemical group 0.000 claims abstract description 20
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims abstract description 20
- 125000004169 (C1-C6) alkyl group Chemical group 0.000 claims abstract description 19
- 229910052731 fluorine Inorganic materials 0.000 claims abstract description 18
- 230000002363 herbicidal effect Effects 0.000 claims abstract description 17
- 125000004183 alkoxy alkyl group Chemical group 0.000 claims abstract description 15
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims abstract description 15
- 229910052794 bromium Inorganic materials 0.000 claims abstract description 14
- 125000000000 cycloalkoxy group Chemical group 0.000 claims abstract description 13
- 125000003342 alkenyl group Chemical group 0.000 claims abstract description 12
- 125000003545 alkoxy group Chemical group 0.000 claims abstract description 12
- 125000006350 alkyl thio alkyl group Chemical group 0.000 claims abstract description 11
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 claims abstract description 10
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims abstract description 10
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 claims abstract description 9
- 229910052717 sulfur Inorganic materials 0.000 claims abstract description 9
- 125000000229 (C1-C4)alkoxy group Chemical group 0.000 claims abstract description 8
- 125000000304 alkynyl group Chemical group 0.000 claims abstract description 8
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims abstract description 8
- 125000001494 2-propynyl group Chemical group [H]C#CC([H])([H])* 0.000 claims abstract description 7
- 239000011737 fluorine Substances 0.000 claims abstract description 7
- 125000001153 fluoro group Chemical group F* 0.000 claims abstract description 7
- 125000001188 haloalkyl group Chemical group 0.000 claims abstract description 7
- 125000000262 haloalkenyl group Chemical group 0.000 claims abstract description 6
- 125000004737 (C1-C6) haloalkoxy group Chemical group 0.000 claims abstract description 5
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims abstract description 5
- 125000006643 (C2-C6) haloalkenyl group Chemical group 0.000 claims abstract description 4
- WNQQMUGXUZJLNA-UHFFFAOYSA-N 6-[5-methyl-6-oxo-4-(trifluoromethyl)pyridazin-1-yl]-4-prop-2-ynyl-1,4-benzoxazin-3-one Chemical compound O=C1C(C)=C(C(F)(F)F)C=NN1C1=CC=C(OCC(=O)N2CC#C)C2=C1 WNQQMUGXUZJLNA-UHFFFAOYSA-N 0.000 claims abstract description 4
- FFCYNCWJZSXCBJ-UHFFFAOYSA-N 7-fluoro-6-[5-methyl-6-oxo-4-(trifluoromethyl)pyridazin-1-yl]-4-prop-2-ynyl-1,4-benzoxazin-3-one Chemical compound O=C1C(C)=C(C(F)(F)F)C=NN1C(C(=C1)F)=CC2=C1OCC(=O)N2CC#C FFCYNCWJZSXCBJ-UHFFFAOYSA-N 0.000 claims abstract description 4
- MRRVJJIKKXMIKV-UHFFFAOYSA-N 7-fluoro-6-[6-oxo-4-(trifluoromethyl)pyridazin-1-yl]-4-prop-2-ynyl-1,4-benzoxazin-3-one Chemical compound FC1=CC=2OCC(=O)N(CC#C)C=2C=C1N1N=CC(C(F)(F)F)=CC1=O MRRVJJIKKXMIKV-UHFFFAOYSA-N 0.000 claims abstract description 4
- DNUAYCRATWAJQE-UHFFFAOYSA-N flufenpyr-ethyl Chemical compound C1=C(Cl)C(OCC(=O)OCC)=CC(N2C(C(C)=C(C=N2)C(F)(F)F)=O)=C1F DNUAYCRATWAJQE-UHFFFAOYSA-N 0.000 claims abstract description 4
- OJDDLXHXRXWWAD-UHFFFAOYSA-N n-[2-chloro-4-fluoro-5-[5-methyl-6-oxo-4-(trifluoromethyl)pyridazin-1-yl]phenyl]methanesulfonamide Chemical compound O=C1C(C)=C(C(F)(F)F)C=NN1C1=CC(NS(C)(=O)=O)=C(Cl)C=C1F OJDDLXHXRXWWAD-UHFFFAOYSA-N 0.000 claims abstract description 4
- IKOCYVRVLFSPLB-UHFFFAOYSA-N 1-chloro-n-[2-chloro-4-fluoro-5-[5-methyl-6-oxo-4-(trifluoromethyl)pyridazin-1-yl]phenyl]methanesulfonamide Chemical compound O=C1C(C)=C(C(F)(F)F)C=NN1C1=CC(NS(=O)(=O)CCl)=C(Cl)C=C1F IKOCYVRVLFSPLB-UHFFFAOYSA-N 0.000 claims abstract description 3
- YDBCYSBZYJVMSE-UHFFFAOYSA-N 2-(4-chloro-2-fluoro-5-methoxyphenyl)-4-methyl-5-(trifluoromethyl)pyridazin-3-one Chemical compound C1=C(Cl)C(OC)=CC(N2C(C(C)=C(C=N2)C(F)(F)F)=O)=C1F YDBCYSBZYJVMSE-UHFFFAOYSA-N 0.000 claims abstract description 3
- ITITUKHFDSNNPN-UHFFFAOYSA-N 2-(4-chloro-2-fluoro-5-prop-2-ynoxyphenyl)-4-methyl-5-(trifluoromethyl)pyridazin-3-one Chemical compound O=C1C(C)=C(C(F)(F)F)C=NN1C1=CC(OCC#C)=C(Cl)C=C1F ITITUKHFDSNNPN-UHFFFAOYSA-N 0.000 claims abstract description 3
- QNBPYGUJBHPYSX-UHFFFAOYSA-N 2-(4-chloro-5-ethoxy-2-fluorophenyl)-4-methyl-5-(trifluoromethyl)pyridazin-3-one Chemical compound C1=C(Cl)C(OCC)=CC(N2C(C(C)=C(C=N2)C(F)(F)F)=O)=C1F QNBPYGUJBHPYSX-UHFFFAOYSA-N 0.000 claims abstract description 3
- VLFKPTVCRZZCKB-UHFFFAOYSA-N 6-[6-oxo-4-(trifluoromethyl)pyridazin-1-yl]-4-prop-2-ynyl-1,4-benzoxazin-3-one Chemical compound O=C1C=C(C(F)(F)F)C=NN1C1=CC=C(OCC(=O)N2CC#C)C2=C1 VLFKPTVCRZZCKB-UHFFFAOYSA-N 0.000 claims abstract description 3
- 125000003601 C2-C6 alkynyl group Chemical group 0.000 claims abstract description 3
- 125000004356 hydroxy functional group Chemical group O* 0.000 claims abstract 4
- 125000004178 (C1-C4) alkyl group Chemical group 0.000 claims abstract 3
- 238000000034 method Methods 0.000 claims description 145
- SNOOUWRIMMFWNE-UHFFFAOYSA-M sodium;6-[(3,4,5-trimethoxybenzoyl)amino]hexanoate Chemical compound [Na+].COC1=CC(C(=O)NCCCCCC([O-])=O)=CC(OC)=C1OC SNOOUWRIMMFWNE-UHFFFAOYSA-M 0.000 claims description 119
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 claims description 42
- 241000196324 Embryophyta Species 0.000 claims description 22
- 125000000217 alkyl group Chemical group 0.000 claims description 18
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims description 17
- ABRVLXLNVJHDRQ-UHFFFAOYSA-N [2-pyridin-3-yl-6-(trifluoromethyl)pyridin-4-yl]methanamine Chemical compound FC(C1=CC(=CC(=N1)C=1C=NC=CC=1)CN)(F)F ABRVLXLNVJHDRQ-UHFFFAOYSA-N 0.000 claims description 14
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 claims description 13
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 12
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 10
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 10
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 8
- 229940125904 compound 1 Drugs 0.000 claims description 7
- WCEVCASYBVMSFT-UHFFFAOYSA-N 2-(4-chloro-2-fluoro-5-propan-2-yloxyphenyl)-4-methyl-5-(trifluoromethyl)pyridazin-3-one Chemical compound C1=C(Cl)C(OC(C)C)=CC(N2C(C(C)=C(C=N2)C(F)(F)F)=O)=C1F WCEVCASYBVMSFT-UHFFFAOYSA-N 0.000 claims description 5
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 claims description 5
- 239000003085 diluting agent Substances 0.000 claims description 4
- SVTHRHINHUGYKP-UHFFFAOYSA-N 2-(4-chloro-2-fluoro-5-prop-2-ynoxyphenyl)-6-methyl-5-(trifluoromethyl)pyridazin-3-one Chemical compound O=C1C=C(C(F)(F)F)C(C)=NN1C1=CC(OCC#C)=C(Cl)C=C1F SVTHRHINHUGYKP-UHFFFAOYSA-N 0.000 claims description 2
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 claims description 2
- 241001553014 Myrsine salicina Species 0.000 claims 1
- 229940125782 compound 2 Drugs 0.000 claims 1
- 125000004438 haloalkoxy group Chemical group 0.000 claims 1
- LCPDWSOZIOUXRV-UHFFFAOYSA-N phenoxyacetic acid Chemical compound OC(=O)COC1=CC=CC=C1 LCPDWSOZIOUXRV-UHFFFAOYSA-N 0.000 claims 1
- 125000000232 haloalkynyl group Chemical group 0.000 abstract description 7
- 125000006273 (C1-C3) alkyl group Chemical group 0.000 abstract description 6
- 229910052727 yttrium Inorganic materials 0.000 abstract description 6
- 229910052757 nitrogen Inorganic materials 0.000 abstract description 5
- 125000004191 (C1-C6) alkoxy group Chemical group 0.000 abstract description 4
- 125000001309 chloro group Chemical group Cl* 0.000 abstract description 4
- 229910052760 oxygen Inorganic materials 0.000 abstract description 4
- 125000000882 C2-C6 alkenyl group Chemical group 0.000 abstract description 3
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 abstract description 3
- 239000001301 oxygen Substances 0.000 abstract description 3
- 125000000951 phenoxy group Chemical group [H]C1=C([H])C([H])=C(O*)C([H])=C1[H] 0.000 abstract description 3
- SDYVGRMZVZXRLF-UHFFFAOYSA-N n-[2-chloro-5-[5-methyl-6-oxo-4-(trifluoromethyl)pyridazin-1-yl]phenyl]methanesulfonamide Chemical compound O=C1C(C)=C(C(F)(F)F)C=NN1C1=CC=C(Cl)C(NS(C)(=O)=O)=C1 SDYVGRMZVZXRLF-UHFFFAOYSA-N 0.000 abstract description 2
- WELSOTUULOAPGB-UHFFFAOYSA-N butyl 2-[2-chloro-4-fluoro-5-[5-methyl-6-oxo-4-(trifluoromethyl)pyridazin-1-yl]phenoxy]acetate Chemical compound C1=C(Cl)C(OCC(=O)OCCCC)=CC(N2C(C(C)=C(C=N2)C(F)(F)F)=O)=C1F WELSOTUULOAPGB-UHFFFAOYSA-N 0.000 abstract 1
- XLECNOUWVCRNDG-UHFFFAOYSA-N cyclopentyl 2-[2-chloro-4-fluoro-5-[5-methyl-6-oxo-4-(trifluoromethyl)pyridazin-1-yl]phenoxy]acetate Chemical compound O=C1C(C)=C(C(F)(F)F)C=NN1C1=CC(OCC(=O)OC2CCCC2)=C(Cl)C=C1F XLECNOUWVCRNDG-UHFFFAOYSA-N 0.000 abstract 1
- HGORGQOIDQDKHR-UHFFFAOYSA-N ethyl 2-[2-chloro-4-fluoro-5-[5-methyl-6-oxo-4-(trifluoromethyl)pyridazin-1-yl]anilino]propanoate Chemical compound C1=C(Cl)C(NC(C)C(=O)OCC)=CC(N2C(C(C)=C(C=N2)C(F)(F)F)=O)=C1F HGORGQOIDQDKHR-UHFFFAOYSA-N 0.000 abstract 1
- MLHPBNMCCIGPDW-UHFFFAOYSA-N ethyl 2-[2-chloro-4-fluoro-5-[5-methyl-6-oxo-4-(trifluoromethyl)pyridazin-1-yl]phenyl]sulfanylpropanoate Chemical compound C1=C(Cl)C(SC(C)C(=O)OCC)=CC(N2C(C(C)=C(C=N2)C(F)(F)F)=O)=C1F MLHPBNMCCIGPDW-UHFFFAOYSA-N 0.000 abstract 1
- LKFUYYMDJULTGR-UHFFFAOYSA-N ethyl 2-[2-chloro-4-fluoro-5-[6-oxo-4-(trifluoromethyl)pyridazin-1-yl]anilino]propanoate Chemical compound C1=C(Cl)C(NC(C)C(=O)OCC)=CC(N2C(C=C(C=N2)C(F)(F)F)=O)=C1F LKFUYYMDJULTGR-UHFFFAOYSA-N 0.000 abstract 1
- JIHWLERBJVJRCD-UHFFFAOYSA-N ethyl 2-[2-chloro-4-fluoro-5-[6-oxo-4-(trifluoromethyl)pyridazin-1-yl]phenoxy]propanoate Chemical compound C1=C(Cl)C(OC(C)C(=O)OCC)=CC(N2C(C=C(C=N2)C(F)(F)F)=O)=C1F JIHWLERBJVJRCD-UHFFFAOYSA-N 0.000 abstract 1
- PSLWANZSOGEEOJ-UHFFFAOYSA-N ethyl 2-[2-chloro-4-fluoro-5-[6-oxo-4-(trifluoromethyl)pyridazin-1-yl]phenyl]sulfanylpropanoate Chemical compound C1=C(Cl)C(SC(C)C(=O)OCC)=CC(N2C(C=C(C=N2)C(F)(F)F)=O)=C1F PSLWANZSOGEEOJ-UHFFFAOYSA-N 0.000 abstract 1
- JZMNTTXWHZXZDA-UHFFFAOYSA-N ethyl 2-chloro-4-fluoro-5-[5-methyl-6-oxo-4-(trifluoromethyl)pyridazin-1-yl]benzoate Chemical compound C1=C(Cl)C(C(=O)OCC)=CC(N2C(C(C)=C(C=N2)C(F)(F)F)=O)=C1F JZMNTTXWHZXZDA-UHFFFAOYSA-N 0.000 abstract 1
- ZOLFBKLQURXAQP-UHFFFAOYSA-N ethyl 2-chloro-5-[5-methyl-6-oxo-4-(trifluoromethyl)pyridazin-1-yl]benzoate Chemical compound C1=C(Cl)C(C(=O)OCC)=CC(N2C(C(C)=C(C=N2)C(F)(F)F)=O)=C1 ZOLFBKLQURXAQP-UHFFFAOYSA-N 0.000 abstract 1
- CBOIHMRHGLHBPB-UHFFFAOYSA-N hydroxymethyl Chemical compound O[CH2] CBOIHMRHGLHBPB-UHFFFAOYSA-N 0.000 abstract 1
- BBQJWOXCHTZUOM-UHFFFAOYSA-N methyl 2-[2-chloro-4-fluoro-5-[5-methyl-6-oxo-4-(trifluoromethyl)pyridazin-1-yl]phenoxy]propanoate Chemical compound C1=C(Cl)C(OC(C)C(=O)OC)=CC(N2C(C(C)=C(C=N2)C(F)(F)F)=O)=C1F BBQJWOXCHTZUOM-UHFFFAOYSA-N 0.000 abstract 1
- DCVMWEWUJDGBEY-UHFFFAOYSA-N methyl 2-[2-chloro-4-fluoro-5-[5-methyl-6-oxo-4-(trifluoromethyl)pyridazin-1-yl]phenyl]sulfanylpropanoate Chemical compound C1=C(Cl)C(SC(C)C(=O)OC)=CC(N2C(C(C)=C(C=N2)C(F)(F)F)=O)=C1F DCVMWEWUJDGBEY-UHFFFAOYSA-N 0.000 abstract 1
- MIJUUACGHJLQQX-UHFFFAOYSA-N methyl 2-[2-chloro-4-fluoro-5-[6-oxo-4-(trifluoromethyl)pyridazin-1-yl]phenyl]sulfanylpropanoate Chemical compound C1=C(Cl)C(SC(C)C(=O)OC)=CC(N2C(C=C(C=N2)C(F)(F)F)=O)=C1F MIJUUACGHJLQQX-UHFFFAOYSA-N 0.000 abstract 1
- HELKDYHYAGGBDY-UHFFFAOYSA-N methyl 2-chloro-4-fluoro-5-[5-methyl-6-oxo-4-(trifluoromethyl)pyridazin-1-yl]benzoate Chemical compound C1=C(Cl)C(C(=O)OC)=CC(N2C(C(C)=C(C=N2)C(F)(F)F)=O)=C1F HELKDYHYAGGBDY-UHFFFAOYSA-N 0.000 abstract 1
- KQSPTZJXFSGPIP-UHFFFAOYSA-N o-ethyl 2-[2-chloro-4-fluoro-5-[5-methyl-6-oxo-4-(trifluoromethyl)pyridazin-1-yl]phenyl]ethanethioate Chemical compound C1=C(Cl)C(CC(=S)OCC)=CC(N2C(C(C)=C(C=N2)C(F)(F)F)=O)=C1F KQSPTZJXFSGPIP-UHFFFAOYSA-N 0.000 abstract 1
- ZMYKFBHYOLLFGY-UHFFFAOYSA-N o-ethyl 2-[2-chloro-4-fluoro-5-[6-oxo-4-(trifluoromethyl)pyridazin-1-yl]phenyl]ethanethioate Chemical compound C1=C(Cl)C(CC(=S)OCC)=CC(N2C(C=C(C=N2)C(F)(F)F)=O)=C1F ZMYKFBHYOLLFGY-UHFFFAOYSA-N 0.000 abstract 1
- LEMMKKTZWJMOKH-UHFFFAOYSA-N o-methyl 2-[2-chloro-4-fluoro-5-[5-methyl-6-oxo-4-(trifluoromethyl)pyridazin-1-yl]phenyl]ethanethioate Chemical compound C1=C(Cl)C(CC(=S)OC)=CC(N2C(C(C)=C(C=N2)C(F)(F)F)=O)=C1F LEMMKKTZWJMOKH-UHFFFAOYSA-N 0.000 abstract 1
- IWXJFPHUVPHZRR-UHFFFAOYSA-N o-methyl 2-[2-chloro-4-fluoro-5-[6-oxo-4-(trifluoromethyl)pyridazin-1-yl]phenyl]ethanethioate Chemical compound C1=C(Cl)C(CC(=S)OC)=CC(N2C(C=C(C=N2)C(F)(F)F)=O)=C1F IWXJFPHUVPHZRR-UHFFFAOYSA-N 0.000 abstract 1
- ZCOLWSMPACXDQF-UHFFFAOYSA-N pentyl 2-[2-chloro-4-fluoro-5-[5-methyl-6-oxo-4-(trifluoromethyl)pyridazin-1-yl]phenoxy]acetate Chemical compound C1=C(Cl)C(OCC(=O)OCCCCC)=CC(N2C(C(C)=C(C=N2)C(F)(F)F)=O)=C1F ZCOLWSMPACXDQF-UHFFFAOYSA-N 0.000 abstract 1
- DFPQZWUBPZEEJR-UHFFFAOYSA-N propan-2-yl 2-[2-chloro-4-fluoro-5-[5-methyl-6-oxo-4-(trifluoromethyl)pyridazin-1-yl]phenoxy]acetate Chemical compound C1=C(Cl)C(OCC(=O)OC(C)C)=CC(N2C(C(C)=C(C=N2)C(F)(F)F)=O)=C1F DFPQZWUBPZEEJR-UHFFFAOYSA-N 0.000 abstract 1
- FLCDQNKVYFHBMM-UHFFFAOYSA-N propan-2-yl 2-[2-chloro-4-fluoro-5-[6-oxo-4-(trifluoromethyl)pyridazin-1-yl]phenyl]sulfanylpropanoate Chemical compound C1=C(Cl)C(SC(C)C(=O)OC(C)C)=CC(N2C(C=C(C=N2)C(F)(F)F)=O)=C1F FLCDQNKVYFHBMM-UHFFFAOYSA-N 0.000 abstract 1
- LYJQRYKYUYGBMB-UHFFFAOYSA-N propan-2-yl 2-chloro-5-[5-methyl-6-oxo-4-(trifluoromethyl)pyridazin-1-yl]benzoate Chemical compound C1=C(Cl)C(C(=O)OC(C)C)=CC(N2C(C(C)=C(C=N2)C(F)(F)F)=O)=C1 LYJQRYKYUYGBMB-UHFFFAOYSA-N 0.000 abstract 1
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 144
- 238000006243 chemical reaction Methods 0.000 description 122
- 239000002904 solvent Substances 0.000 description 116
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 106
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 96
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 77
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 76
- 229910052799 carbon Inorganic materials 0.000 description 72
- 239000011541 reaction mixture Substances 0.000 description 71
- 238000002360 preparation method Methods 0.000 description 63
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 57
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 55
- ZMXDDKWLCZADIW-UHFFFAOYSA-N dimethylformamide Substances CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 55
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 52
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 51
- 239000002585 base Substances 0.000 description 49
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 48
- 239000000243 solution Substances 0.000 description 44
- 239000013078 crystal Substances 0.000 description 43
- 239000013256 coordination polymer Substances 0.000 description 41
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 40
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 38
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 34
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 33
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Substances [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 32
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 30
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 30
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 30
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 26
- 238000004440 column chromatography Methods 0.000 description 26
- 239000002253 acid Substances 0.000 description 25
- 229910002091 carbon monoxide Inorganic materials 0.000 description 25
- 238000001914 filtration Methods 0.000 description 25
- 238000010992 reflux Methods 0.000 description 25
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 24
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 24
- 238000001816 cooling Methods 0.000 description 23
- 230000035484 reaction time Effects 0.000 description 23
- XTHFKEDIFFGKHM-UHFFFAOYSA-N Dimethoxyethane Chemical compound COCCOC XTHFKEDIFFGKHM-UHFFFAOYSA-N 0.000 description 22
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 21
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 20
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 20
- 102100040996 Cochlin Human genes 0.000 description 20
- 101000748988 Homo sapiens Cochlin Proteins 0.000 description 20
- JGFZNNIVVJXRND-UHFFFAOYSA-N N,N-Diisopropylethylamine (DIPEA) Chemical compound CCN(C(C)C)C(C)C JGFZNNIVVJXRND-UHFFFAOYSA-N 0.000 description 20
- IMNFDUFMRHMDMM-UHFFFAOYSA-N N-Heptane Chemical compound CCCCCCC IMNFDUFMRHMDMM-UHFFFAOYSA-N 0.000 description 20
- 239000011259 mixed solution Substances 0.000 description 20
- RGSFGYAAUTVSQA-UHFFFAOYSA-N pentamethylene Natural products C1CCCC1 RGSFGYAAUTVSQA-UHFFFAOYSA-N 0.000 description 20
- 125000004817 pentamethylene group Chemical group [H]C([H])([*:2])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[*:1] 0.000 description 20
- LPXPTNMVRIOKMN-UHFFFAOYSA-M sodium nitrite Chemical compound [Na+].[O-]N=O LPXPTNMVRIOKMN-UHFFFAOYSA-M 0.000 description 20
- 125000000383 tetramethylene group Chemical group [H]C([H])([*:1])C([H])([H])C([H])([H])C([H])([H])[*:2] 0.000 description 20
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 description 19
- 239000001632 sodium acetate Substances 0.000 description 19
- 235000017281 sodium acetate Nutrition 0.000 description 19
- DLFVBJFMPXGRIB-UHFFFAOYSA-N Acetamide Chemical compound CC(N)=O DLFVBJFMPXGRIB-UHFFFAOYSA-N 0.000 description 18
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 18
- ZHNUHDYFZUAESO-UHFFFAOYSA-N Formamide Chemical compound NC=O ZHNUHDYFZUAESO-UHFFFAOYSA-N 0.000 description 18
- SJRJJKPEHAURKC-UHFFFAOYSA-N N-Methylmorpholine Chemical compound CN1CCOCC1 SJRJJKPEHAURKC-UHFFFAOYSA-N 0.000 description 18
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 18
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 18
- 239000010410 layer Substances 0.000 description 18
- LQNUZADURLCDLV-UHFFFAOYSA-N nitrobenzene Chemical compound [O-][N+](=O)C1=CC=CC=C1 LQNUZADURLCDLV-UHFFFAOYSA-N 0.000 description 18
- 235000011054 acetic acid Nutrition 0.000 description 17
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 16
- 229910000027 potassium carbonate Inorganic materials 0.000 description 16
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 15
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 15
- 239000003795 chemical substances by application Substances 0.000 description 15
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 15
- 238000010898 silica gel chromatography Methods 0.000 description 14
- 125000001424 substituent group Chemical group 0.000 description 14
- HEPPAPZASXFWTB-UHFFFAOYSA-N 3,3-dibromo-1,1,1-trifluoropropan-2-one Chemical compound FC(F)(F)C(=O)C(Br)Br HEPPAPZASXFWTB-UHFFFAOYSA-N 0.000 description 13
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 13
- 239000003960 organic solvent Substances 0.000 description 13
- 239000000047 product Substances 0.000 description 13
- 239000000741 silica gel Substances 0.000 description 13
- 229910002027 silica gel Inorganic materials 0.000 description 13
- 229960001866 silicon dioxide Drugs 0.000 description 13
- 239000008096 xylene Substances 0.000 description 13
- 101100167365 Caenorhabditis elegans cha-1 gene Proteins 0.000 description 12
- JHIVVAPYMSGYDF-UHFFFAOYSA-N cyclohexanone Chemical compound O=C1CCCCC1 JHIVVAPYMSGYDF-UHFFFAOYSA-N 0.000 description 12
- 238000000605 extraction Methods 0.000 description 12
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 12
- 235000019341 magnesium sulphate Nutrition 0.000 description 12
- 238000001953 recrystallisation Methods 0.000 description 12
- ZAFNJMIOTHYJRJ-UHFFFAOYSA-N Diisopropyl ether Chemical compound CC(C)OC(C)C ZAFNJMIOTHYJRJ-UHFFFAOYSA-N 0.000 description 11
- DBNJSZYFWVVQBO-UHFFFAOYSA-N SOOS Chemical compound SOOS DBNJSZYFWVVQBO-UHFFFAOYSA-N 0.000 description 11
- 150000001408 amides Chemical class 0.000 description 11
- 239000003153 chemical reaction reagent Substances 0.000 description 11
- 150000002148 esters Chemical class 0.000 description 11
- 150000002170 ethers Chemical class 0.000 description 11
- 238000000746 purification Methods 0.000 description 11
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 10
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 10
- 150000001338 aliphatic hydrocarbons Chemical class 0.000 description 10
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 10
- 239000003054 catalyst Substances 0.000 description 10
- 125000002485 formyl group Chemical group [H]C(*)=O 0.000 description 10
- HJOVHMDZYOCNQW-UHFFFAOYSA-N isophorone Chemical compound CC1=CC(=O)CC(C)(C)C1 HJOVHMDZYOCNQW-UHFFFAOYSA-N 0.000 description 10
- 239000003208 petroleum Substances 0.000 description 10
- 235000010288 sodium nitrite Nutrition 0.000 description 10
- HXJUTPCZVOIRIF-UHFFFAOYSA-N sulfolane Chemical compound O=S1(=O)CCCC1 HXJUTPCZVOIRIF-UHFFFAOYSA-N 0.000 description 10
- 150000003464 sulfur compounds Chemical class 0.000 description 10
- 150000003512 tertiary amines Chemical class 0.000 description 10
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 10
- 101100149737 Caenorhabditis elegans sng-1 gene Proteins 0.000 description 9
- ZPUCINDJVBIVPJ-LJISPDSOSA-N cocaine Chemical compound O([C@H]1C[C@@H]2CC[C@@H](N2C)[C@H]1C(=O)OC)C(=O)C1=CC=CC=C1 ZPUCINDJVBIVPJ-LJISPDSOSA-N 0.000 description 9
- 239000012954 diazonium Substances 0.000 description 9
- JSEMUSFPVZYRSG-UHFFFAOYSA-N ethyl 3-(triphenyl-$l^{5}-phosphanylidene)propanoate Chemical compound C=1C=CC=CC=1P(C=1C=CC=CC=1)(=CCC(=O)OCC)C1=CC=CC=C1 JSEMUSFPVZYRSG-UHFFFAOYSA-N 0.000 description 9
- 238000009472 formulation Methods 0.000 description 9
- 150000008282 halocarbons Chemical class 0.000 description 9
- 150000007529 inorganic bases Chemical class 0.000 description 9
- 150000002828 nitro derivatives Chemical class 0.000 description 9
- 150000007530 organic bases Chemical class 0.000 description 9
- OCJBOOLMMGQPQU-UHFFFAOYSA-N 1,4-dichlorobenzene Chemical compound ClC1=CC=C(Cl)C=C1 OCJBOOLMMGQPQU-UHFFFAOYSA-N 0.000 description 8
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 8
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 8
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 8
- 150000001298 alcohols Chemical class 0.000 description 8
- 238000004587 chromatography analysis Methods 0.000 description 8
- 229940117389 dichlorobenzene Drugs 0.000 description 8
- 150000002576 ketones Chemical class 0.000 description 8
- LYGJENNIWJXYER-UHFFFAOYSA-N nitromethane Chemical compound C[N+]([O-])=O LYGJENNIWJXYER-UHFFFAOYSA-N 0.000 description 8
- 239000012312 sodium hydride Substances 0.000 description 8
- 229910000104 sodium hydride Inorganic materials 0.000 description 8
- 238000003756 stirring Methods 0.000 description 8
- IIHPVYJPDKJYOU-UHFFFAOYSA-N triphenylcarbethoxymethylenephosphorane Chemical compound C=1C=CC=CC=1P(C=1C=CC=CC=1)(=CC(=O)OCC)C1=CC=CC=C1 IIHPVYJPDKJYOU-UHFFFAOYSA-N 0.000 description 8
- 244000052363 Cynodon dactylon Species 0.000 description 7
- JLTDJTHDQAWBAV-UHFFFAOYSA-N N,N-dimethylaniline Chemical compound CN(C)C1=CC=CC=C1 JLTDJTHDQAWBAV-UHFFFAOYSA-N 0.000 description 7
- 239000003480 eluent Substances 0.000 description 7
- 125000004184 methoxymethyl group Chemical group [H]C([H])([H])OC([H])([H])* 0.000 description 7
- 150000002826 nitrites Chemical class 0.000 description 7
- 239000011780 sodium chloride Substances 0.000 description 7
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 6
- DKPFZGUDAPQIHT-UHFFFAOYSA-N Butyl acetate Natural products CCCCOC(C)=O DKPFZGUDAPQIHT-UHFFFAOYSA-N 0.000 description 6
- OIFBSDVPJOWBCH-UHFFFAOYSA-N Diethyl carbonate Chemical compound CCOC(=O)OCC OIFBSDVPJOWBCH-UHFFFAOYSA-N 0.000 description 6
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 6
- XBDQKXXYIPTUBI-UHFFFAOYSA-M Propionate Chemical compound CCC([O-])=O XBDQKXXYIPTUBI-UHFFFAOYSA-M 0.000 description 6
- 239000004480 active ingredient Substances 0.000 description 6
- 239000007864 aqueous solution Substances 0.000 description 6
- 150000001989 diazonium salts Chemical class 0.000 description 6
- GGSUCNLOZRCGPQ-UHFFFAOYSA-N diethylaniline Chemical compound CCN(CC)C1=CC=CC=C1 GGSUCNLOZRCGPQ-UHFFFAOYSA-N 0.000 description 6
- XBDQKXXYIPTUBI-UHFFFAOYSA-N dimethylselenoniopropionate Natural products CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 6
- WBJINCZRORDGAQ-UHFFFAOYSA-N formic acid ethyl ester Natural products CCOC=O WBJINCZRORDGAQ-UHFFFAOYSA-N 0.000 description 6
- 229910021473 hassium Inorganic materials 0.000 description 6
- 238000010438 heat treatment Methods 0.000 description 6
- FUZZWVXGSFPDMH-UHFFFAOYSA-N hexanoic acid Chemical compound CCCCCC(O)=O FUZZWVXGSFPDMH-UHFFFAOYSA-N 0.000 description 6
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 6
- LRDFRRGEGBBSRN-UHFFFAOYSA-N isobutyronitrile Chemical compound CC(C)C#N LRDFRRGEGBBSRN-UHFFFAOYSA-N 0.000 description 6
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 6
- 230000000802 nitrating effect Effects 0.000 description 6
- 229910017604 nitric acid Inorganic materials 0.000 description 6
- 150000002825 nitriles Chemical class 0.000 description 6
- NLKNQRATVPKPDG-UHFFFAOYSA-M potassium iodide Chemical compound [K+].[I-] NLKNQRATVPKPDG-UHFFFAOYSA-M 0.000 description 6
- 239000012047 saturated solution Substances 0.000 description 6
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 6
- SCYULBFZEHDVBN-UHFFFAOYSA-N 1,1-Dichloroethane Chemical compound CC(Cl)Cl SCYULBFZEHDVBN-UHFFFAOYSA-N 0.000 description 5
- 240000006394 Sorghum bicolor Species 0.000 description 5
- 244000062793 Sorghum vulgare Species 0.000 description 5
- AZFNGPAYDKGCRB-XCPIVNJJSA-M [(1s,2s)-2-amino-1,2-diphenylethyl]-(4-methylphenyl)sulfonylazanide;chlororuthenium(1+);1-methyl-4-propan-2-ylbenzene Chemical compound [Ru+]Cl.CC(C)C1=CC=C(C)C=C1.C1=CC(C)=CC=C1S(=O)(=O)[N-][C@@H](C=1C=CC=CC=1)[C@@H](N)C1=CC=CC=C1 AZFNGPAYDKGCRB-XCPIVNJJSA-M 0.000 description 5
- 230000002378 acidificating effect Effects 0.000 description 5
- 235000014113 dietary fatty acids Nutrition 0.000 description 5
- 125000005745 ethoxymethyl group Chemical group [H]C([H])([H])C([H])([H])OC([H])([H])* 0.000 description 5
- 239000000194 fatty acid Substances 0.000 description 5
- 229930195729 fatty acid Natural products 0.000 description 5
- 125000004029 hydroxymethyl group Chemical group [H]OC([H])([H])* 0.000 description 5
- 239000005457 ice water Substances 0.000 description 5
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 5
- 235000019713 millet Nutrition 0.000 description 5
- 239000012044 organic layer Substances 0.000 description 5
- 239000004304 potassium nitrite Substances 0.000 description 5
- 235000010289 potassium nitrite Nutrition 0.000 description 5
- 239000000126 substance Substances 0.000 description 5
- 239000004094 surface-active agent Substances 0.000 description 5
- 238000003786 synthesis reaction Methods 0.000 description 5
- BWKMZSWXJIVRQF-UHFFFAOYSA-N (4-bromo-2-fluoro-5-propan-2-yloxyphenyl)hydrazine;hydrochloride Chemical compound Cl.CC(C)OC1=CC(NN)=C(F)C=C1Br BWKMZSWXJIVRQF-UHFFFAOYSA-N 0.000 description 4
- 125000006021 1-methyl-2-propenyl group Chemical group 0.000 description 4
- 238000005160 1H NMR spectroscopy Methods 0.000 description 4
- 125000001340 2-chloroethyl group Chemical group [H]C([H])(Cl)C([H])([H])* 0.000 description 4
- 101150026868 CHS1 gene Proteins 0.000 description 4
- 235000010469 Glycine max Nutrition 0.000 description 4
- 244000068988 Glycine max Species 0.000 description 4
- 241000219146 Gossypium Species 0.000 description 4
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 4
- NTIZESTWPVYFNL-UHFFFAOYSA-N Methyl isobutyl ketone Chemical compound CC(C)CC(C)=O NTIZESTWPVYFNL-UHFFFAOYSA-N 0.000 description 4
- UIHCLUNTQKBZGK-UHFFFAOYSA-N Methyl isobutyl ketone Natural products CCC(C)C(C)=O UIHCLUNTQKBZGK-UHFFFAOYSA-N 0.000 description 4
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 4
- 241000209117 Panicum Species 0.000 description 4
- 235000006443 Panicum miliaceum subsp. miliaceum Nutrition 0.000 description 4
- 235000009037 Panicum miliaceum subsp. ruderale Nutrition 0.000 description 4
- 229920003171 Poly (ethylene oxide) Polymers 0.000 description 4
- CSPPKDPQLUUTND-NBVRZTHBSA-N Sethoxydim Chemical compound CCO\N=C(/CCC)C1=C(O)CC(CC(C)SCC)CC1=O CSPPKDPQLUUTND-NBVRZTHBSA-N 0.000 description 4
- 235000011684 Sorghum saccharatum Nutrition 0.000 description 4
- 229910021626 Tin(II) chloride Inorganic materials 0.000 description 4
- 240000008042 Zea mays Species 0.000 description 4
- 229910052783 alkali metal Inorganic materials 0.000 description 4
- 125000006364 carbonyl oxy methylene group Chemical group [H]C([H])([*:2])OC([*:1])=O 0.000 description 4
- 125000005708 carbonyloxy group Chemical group [*:2]OC([*:1])=O 0.000 description 4
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 4
- 125000002057 carboxymethyl group Chemical group [H]OC(=O)C([H])([H])[*] 0.000 description 4
- 230000003197 catalytic effect Effects 0.000 description 4
- 125000004218 chloromethyl group Chemical group [H]C([H])(Cl)* 0.000 description 4
- ORTQZVOHEJQUHG-UHFFFAOYSA-L copper(II) chloride Chemical compound Cl[Cu]Cl ORTQZVOHEJQUHG-UHFFFAOYSA-L 0.000 description 4
- 150000004665 fatty acids Chemical class 0.000 description 4
- 229910052736 halogen Inorganic materials 0.000 description 4
- 150000002367 halogens Chemical class 0.000 description 4
- 125000001972 isopentyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])C([H])([H])* 0.000 description 4
- 125000000740 n-pentyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 4
- NROKBHXJSPEDAR-UHFFFAOYSA-M potassium fluoride Chemical compound [F-].[K+] NROKBHXJSPEDAR-UHFFFAOYSA-M 0.000 description 4
- 239000000843 powder Substances 0.000 description 4
- 239000002244 precipitate Substances 0.000 description 4
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 4
- 235000017557 sodium bicarbonate Nutrition 0.000 description 4
- 229910000029 sodium carbonate Inorganic materials 0.000 description 4
- 239000002689 soil Substances 0.000 description 4
- 235000011150 stannous chloride Nutrition 0.000 description 4
- 239000007858 starting material Substances 0.000 description 4
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 4
- 238000003971 tillage Methods 0.000 description 4
- AXZWODMDQAVCJE-UHFFFAOYSA-L tin(II) chloride (anhydrous) Chemical compound [Cl-].[Cl-].[Sn+2] AXZWODMDQAVCJE-UHFFFAOYSA-L 0.000 description 4
- ILROLYQPRYHHFG-UHFFFAOYSA-N 1-$l^{1}-oxidanylprop-2-en-1-one Chemical group [O]C(=O)C=C ILROLYQPRYHHFG-UHFFFAOYSA-N 0.000 description 3
- NMJCSTNQFYPVOR-VHONOUADSA-N 1-oleoyl-2-stearoyl-sn-glycero-3-phosphocholine Chemical compound CCCCCCCCCCCCCCCCCC(=O)O[C@@H](COP([O-])(=O)OCC[N+](C)(C)C)COC(=O)CCCCCCC\C=C/CCCCCCCC NMJCSTNQFYPVOR-VHONOUADSA-N 0.000 description 3
- 125000004206 2,2,2-trifluoroethyl group Chemical group [H]C([H])(*)C(F)(F)F 0.000 description 3
- FALCMQXTWHPRIH-UHFFFAOYSA-N 2,3-dichloroprop-1-ene Chemical compound ClCC(Cl)=C FALCMQXTWHPRIH-UHFFFAOYSA-N 0.000 description 3
- 125000000069 2-butynyl group Chemical group [H]C([H])([H])C#CC([H])([H])* 0.000 description 3
- KINBDNXONZDECY-UHFFFAOYSA-N 3-[(4-bromo-2-fluoro-5-propan-2-yloxyphenyl)hydrazinylidene]-1,1,1-trifluoropropan-2-one Chemical compound CC(C)OC1=CC(NN=CC(=O)C(F)(F)F)=C(F)C=C1Br KINBDNXONZDECY-UHFFFAOYSA-N 0.000 description 3
- 125000004975 3-butenyl group Chemical group C(CC=C)* 0.000 description 3
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 3
- QCQCHGYLTSGIGX-GHXANHINSA-N 4-[[(3ar,5ar,5br,7ar,9s,11ar,11br,13as)-5a,5b,8,8,11a-pentamethyl-3a-[(5-methylpyridine-3-carbonyl)amino]-2-oxo-1-propan-2-yl-4,5,6,7,7a,9,10,11,11b,12,13,13a-dodecahydro-3h-cyclopenta[a]chrysen-9-yl]oxy]-2,2-dimethyl-4-oxobutanoic acid Chemical compound N([C@@]12CC[C@@]3(C)[C@]4(C)CC[C@H]5C(C)(C)[C@@H](OC(=O)CC(C)(C)C(O)=O)CC[C@]5(C)[C@H]4CC[C@@H]3C1=C(C(C2)=O)C(C)C)C(=O)C1=CN=CC(C)=C1 QCQCHGYLTSGIGX-GHXANHINSA-N 0.000 description 3
- TVEXGJYMHHTVKP-UHFFFAOYSA-N 6-oxabicyclo[3.2.1]oct-3-en-7-one Chemical compound C1C2C(=O)OC1C=CC2 TVEXGJYMHHTVKP-UHFFFAOYSA-N 0.000 description 3
- 229920000742 Cotton Polymers 0.000 description 3
- WMFOQBRAJBCJND-UHFFFAOYSA-M Lithium hydroxide Chemical compound [Li+].[OH-] WMFOQBRAJBCJND-UHFFFAOYSA-M 0.000 description 3
- 101001066818 Neosartorya fumigata (strain ATCC MYA-4609 / Af293 / CBS 101355 / FGSC A1100) Protostadienol synthase helA Proteins 0.000 description 3
- 240000007594 Oryza sativa Species 0.000 description 3
- 235000007164 Oryza sativa Nutrition 0.000 description 3
- 231100000674 Phytotoxicity Toxicity 0.000 description 3
- 241000209504 Poaceae Species 0.000 description 3
- 150000007513 acids Chemical class 0.000 description 3
- 150000001448 anilines Chemical class 0.000 description 3
- 229910052796 boron Inorganic materials 0.000 description 3
- 125000005997 bromomethyl group Chemical group 0.000 description 3
- 125000004775 chlorodifluoromethyl group Chemical group FC(F)(Cl)* 0.000 description 3
- MZZBPDKVEFVLFF-UHFFFAOYSA-N cyanazine Chemical compound CCNC1=NC(Cl)=NC(NC(C)(C)C#N)=N1 MZZBPDKVEFVLFF-UHFFFAOYSA-N 0.000 description 3
- IJGRMHOSHXDMSA-UHFFFAOYSA-O diazynium Chemical compound [NH+]#N IJGRMHOSHXDMSA-UHFFFAOYSA-O 0.000 description 3
- OKPWTGIENAOYKH-UHFFFAOYSA-N ethyl 3-(2-chloro-5-hydrazinylphenyl)prop-2-enoate Chemical compound CCOC(=O)C=CC1=CC(NN)=CC=C1Cl OKPWTGIENAOYKH-UHFFFAOYSA-N 0.000 description 3
- 230000009969 flowable effect Effects 0.000 description 3
- 235000019253 formic acid Nutrition 0.000 description 3
- 239000008187 granular material Substances 0.000 description 3
- 238000003306 harvesting Methods 0.000 description 3
- 230000035800 maturation Effects 0.000 description 3
- 125000004092 methylthiomethyl group Chemical group [H]C([H])([H])SC([H])([H])* 0.000 description 3
- GQPLMRYTRLFLPF-UHFFFAOYSA-N nitrous oxide Inorganic materials [O-][N+]#N GQPLMRYTRLFLPF-UHFFFAOYSA-N 0.000 description 3
- 238000005191 phase separation Methods 0.000 description 3
- 229920000728 polyester Polymers 0.000 description 3
- 235000019260 propionic acid Nutrition 0.000 description 3
- IUVKMZGDUIUOCP-BTNSXGMBSA-N quinbolone Chemical compound O([C@H]1CC[C@H]2[C@H]3[C@@H]([C@]4(C=CC(=O)C=C4CC3)C)CC[C@@]21C)C1=CCCC1 IUVKMZGDUIUOCP-BTNSXGMBSA-N 0.000 description 3
- 150000003839 salts Chemical class 0.000 description 3
- 239000011734 sodium Substances 0.000 description 3
- 229910052708 sodium Inorganic materials 0.000 description 3
- SZXAJDQTPWYNBN-NWBUNABESA-M sodium;4-methoxycarbonyl-5,5-dimethyl-3-oxo-2-[(e)-n-prop-2-enoxy-c-propylcarbonimidoyl]cyclohexen-1-olate Chemical compound [Na+].C=CCO\N=C(/CCC)C1=C([O-])CC(C)(C)C(C(=O)OC)C1=O SZXAJDQTPWYNBN-NWBUNABESA-M 0.000 description 3
- 239000007787 solid Substances 0.000 description 3
- 150000003467 sulfuric acid derivatives Chemical class 0.000 description 3
- 125000003866 trichloromethyl group Chemical group ClC(Cl)(Cl)* 0.000 description 3
- 238000005406 washing Methods 0.000 description 3
- LMKZMBSIQOEOLE-UHFFFAOYSA-N (2,4-dichloro-5-propan-2-yloxyphenyl)hydrazine;hydrochloride Chemical compound Cl.CC(C)OC1=CC(NN)=C(Cl)C=C1Cl LMKZMBSIQOEOLE-UHFFFAOYSA-N 0.000 description 2
- BIGOKEKYTMKJGO-UHFFFAOYSA-N (2-bromo-4-fluoro-5-nitrophenyl) methyl carbonate Chemical compound COC(=O)OC1=CC([N+]([O-])=O)=C(F)C=C1Br BIGOKEKYTMKJGO-UHFFFAOYSA-N 0.000 description 2
- UHVMWCUMBLQKKZ-UHFFFAOYSA-N (2-bromo-4-fluorophenyl) methyl carbonate Chemical compound COC(=O)OC1=CC=C(F)C=C1Br UHVMWCUMBLQKKZ-UHFFFAOYSA-N 0.000 description 2
- KEQGZUUPPQEDPF-UHFFFAOYSA-N 1,3-dichloro-5,5-dimethylimidazolidine-2,4-dione Chemical compound CC1(C)N(Cl)C(=O)N(Cl)C1=O KEQGZUUPPQEDPF-UHFFFAOYSA-N 0.000 description 2
- KCPOCSCWAUGONQ-UHFFFAOYSA-N 1-bromo-5-fluoro-4-nitro-2-propan-2-yloxybenzene Chemical compound CC(C)OC1=CC([N+]([O-])=O)=C(F)C=C1Br KCPOCSCWAUGONQ-UHFFFAOYSA-N 0.000 description 2
- 125000006083 1-bromoethyl group Chemical group 0.000 description 2
- QPUYECUOLPXSFR-UHFFFAOYSA-N 1-methylnaphthalene Chemical compound C1=CC=C2C(C)=CC=CC2=C1 QPUYECUOLPXSFR-UHFFFAOYSA-N 0.000 description 2
- FGRBYDKOBBBPOI-UHFFFAOYSA-N 10,10-dioxo-2-[4-(N-phenylanilino)phenyl]thioxanthen-9-one Chemical compound O=C1c2ccccc2S(=O)(=O)c2ccc(cc12)-c1ccc(cc1)N(c1ccccc1)c1ccccc1 FGRBYDKOBBBPOI-UHFFFAOYSA-N 0.000 description 2
- MEKOFIRRDATTAG-UHFFFAOYSA-N 2,2,5,8-tetramethyl-3,4-dihydrochromen-6-ol Chemical compound C1CC(C)(C)OC2=C1C(C)=C(O)C=C2C MEKOFIRRDATTAG-UHFFFAOYSA-N 0.000 description 2
- ATCRIUVQKHMXSH-UHFFFAOYSA-N 2,4-dichlorobenzoic acid Chemical compound OC(=O)C1=CC=C(Cl)C=C1Cl ATCRIUVQKHMXSH-UHFFFAOYSA-N 0.000 description 2
- 125000004974 2-butenyl group Chemical group C(C=CC)* 0.000 description 2
- 125000000143 2-carboxyethyl group Chemical group [H]OC(=O)C([H])([H])C([H])([H])* 0.000 description 2
- YGYLXTVFBCMNDP-UHFFFAOYSA-N 2-chloro-4-fluoro-5-hydrazinylphenol;hydrochloride Chemical compound Cl.NNC1=CC(O)=C(Cl)C=C1F YGYLXTVFBCMNDP-UHFFFAOYSA-N 0.000 description 2
- SYZKAFCPWNFONG-UHFFFAOYSA-N 2-chloro-4-fluoro-5-nitrobenzoic acid Chemical compound OC(=O)C1=CC([N+]([O-])=O)=C(F)C=C1Cl SYZKAFCPWNFONG-UHFFFAOYSA-N 0.000 description 2
- 125000006031 2-methyl-3-butenyl group Chemical group 0.000 description 2
- PGSQEGOEFZQFIB-UHFFFAOYSA-N 3,3-dibromo-1,1,1-trifluorobutan-2-one Chemical compound CC(Br)(Br)C(=O)C(F)(F)F PGSQEGOEFZQFIB-UHFFFAOYSA-N 0.000 description 2
- AZIAAIPOSLHEPE-UHFFFAOYSA-N 3-[(4-chloro-2-fluoro-5-propan-2-yloxyphenyl)hydrazinylidene]-1,1,1-trifluoropropan-2-one Chemical compound CC(C)OC1=CC(NN=CC(=O)C(F)(F)F)=C(F)C=C1Cl AZIAAIPOSLHEPE-UHFFFAOYSA-N 0.000 description 2
- JBFNMKKUAQJXEN-UHFFFAOYSA-N 3-[(4-chlorophenyl)hydrazinylidene]-1,1,1-trifluoropropan-2-one Chemical compound FC(F)(F)C(=O)C=NNC1=CC=C(Cl)C=C1 JBFNMKKUAQJXEN-UHFFFAOYSA-N 0.000 description 2
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 2
- VHYFNPMBLIVWCW-UHFFFAOYSA-N 4-Dimethylaminopyridine Chemical compound CN(C)C1=CC=NC=C1 VHYFNPMBLIVWCW-UHFFFAOYSA-N 0.000 description 2
- SHJSTFBEFVMIQN-UHFFFAOYSA-N 4-bromo-2-fluoro-5-propan-2-yloxyaniline Chemical compound CC(C)OC1=CC(N)=C(F)C=C1Br SHJSTFBEFVMIQN-UHFFFAOYSA-N 0.000 description 2
- ZHYGDAWQOFQYAK-UHFFFAOYSA-N 7-fluoro-6-hydrazinyl-4-prop-2-ynyl-1,4-benzoxazin-3-one Chemical compound C#CCN1C(=O)COC2=C1C=C(NN)C(F)=C2 ZHYGDAWQOFQYAK-UHFFFAOYSA-N 0.000 description 2
- 241000219317 Amaranthaceae Species 0.000 description 2
- 244000105624 Arachis hypogaea Species 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- 235000007320 Avena fatua Nutrition 0.000 description 2
- 244000024671 Brassica kaber Species 0.000 description 2
- UGFAIRIUMAVXCW-UHFFFAOYSA-N Carbon monoxide Chemical compound [O+]#[C-] UGFAIRIUMAVXCW-UHFFFAOYSA-N 0.000 description 2
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 2
- 244000223760 Cinnamomum zeylanicum Species 0.000 description 2
- 241000207782 Convolvulaceae Species 0.000 description 2
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 2
- 229910021589 Copper(I) bromide Inorganic materials 0.000 description 2
- 229910021592 Copper(II) chloride Inorganic materials 0.000 description 2
- 241000234646 Cyperaceae Species 0.000 description 2
- 239000005504 Dicamba Substances 0.000 description 2
- 240000003826 Eichhornia crassipes Species 0.000 description 2
- 241000202844 Eriophorum Species 0.000 description 2
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 2
- 239000005558 Fluroxypyr Substances 0.000 description 2
- 235000014820 Galium aparine Nutrition 0.000 description 2
- 240000005702 Galium aparine Species 0.000 description 2
- 241000287828 Gallus gallus Species 0.000 description 2
- 244000020551 Helianthus annuus Species 0.000 description 2
- 235000003222 Helianthus annuus Nutrition 0.000 description 2
- 240000005979 Hordeum vulgare Species 0.000 description 2
- 235000007340 Hordeum vulgare Nutrition 0.000 description 2
- 229920001732 Lignosulfonate Polymers 0.000 description 2
- 239000012359 Methanesulfonyl chloride Substances 0.000 description 2
- 240000000178 Monochoria vaginalis Species 0.000 description 2
- 238000005481 NMR spectroscopy Methods 0.000 description 2
- 101100274389 Neurospora crassa (strain ATCC 24698 / 74-OR23-1A / CBS 708.71 / DSM 1257 / FGSC 987) chz-1 gene Proteins 0.000 description 2
- 239000005586 Nicosulfuron Substances 0.000 description 2
- KFSLWBXXFJQRDL-UHFFFAOYSA-N Peracetic acid Chemical compound CC(=O)OO KFSLWBXXFJQRDL-UHFFFAOYSA-N 0.000 description 2
- 241000013557 Plantaginaceae Species 0.000 description 2
- 244000292693 Poa annua Species 0.000 description 2
- GPGLBXMQFQQXDV-UHFFFAOYSA-N Primisulfuron Chemical compound OC(=O)C1=CC=CC=C1S(=O)(=O)NC(=O)NC1=NC(OC(F)F)=CC(OC(F)F)=N1 GPGLBXMQFQQXDV-UHFFFAOYSA-N 0.000 description 2
- SMWDFEZZVXVKRB-UHFFFAOYSA-N Quinoline Chemical compound N1=CC=CC2=CC=CC=C21 SMWDFEZZVXVKRB-UHFFFAOYSA-N 0.000 description 2
- UIIMBOGNXHQVGW-DEQYMQKBSA-M Sodium bicarbonate-14C Chemical compound [Na+].O[14C]([O-])=O UIIMBOGNXHQVGW-DEQYMQKBSA-M 0.000 description 2
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 2
- 235000002594 Solanum nigrum Nutrition 0.000 description 2
- 241000209140 Triticum Species 0.000 description 2
- 235000021307 Triticum Nutrition 0.000 description 2
- 244000098338 Triticum aestivum Species 0.000 description 2
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 2
- 241000208041 Veronica Species 0.000 description 2
- 235000004031 Viola x wittrockiana Nutrition 0.000 description 2
- 235000007244 Zea mays Nutrition 0.000 description 2
- 235000005824 Zea mays ssp. parviglumis Nutrition 0.000 description 2
- 235000002017 Zea mays subsp mays Nutrition 0.000 description 2
- 150000001241 acetals Chemical group 0.000 description 2
- 239000002671 adjuvant Substances 0.000 description 2
- 150000001299 aldehydes Chemical group 0.000 description 2
- 229910000288 alkali metal carbonate Inorganic materials 0.000 description 2
- 150000008041 alkali metal carbonates Chemical class 0.000 description 2
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 2
- 150000001342 alkaline earth metals Chemical class 0.000 description 2
- 125000005081 alkoxyalkoxyalkyl group Chemical group 0.000 description 2
- 239000012298 atmosphere Substances 0.000 description 2
- MXWJVTOOROXGIU-UHFFFAOYSA-N atrazine Chemical compound CCNC1=NC(Cl)=NC(NC(C)C)=N1 MXWJVTOOROXGIU-UHFFFAOYSA-N 0.000 description 2
- 239000012752 auxiliary agent Substances 0.000 description 2
- ILAHWRKJUDSMFH-UHFFFAOYSA-N boron tribromide Chemical compound BrB(Br)Br ILAHWRKJUDSMFH-UHFFFAOYSA-N 0.000 description 2
- 210000004556 brain Anatomy 0.000 description 2
- 125000004744 butyloxycarbonyl group Chemical group 0.000 description 2
- 125000003917 carbamoyl group Chemical group [H]N([H])C(*)=O 0.000 description 2
- 125000006355 carbonyl methylene group Chemical group [H]C([H])([*:2])C([*:1])=O 0.000 description 2
- 239000000969 carrier Substances 0.000 description 2
- ITVPBBDAZKBMRP-UHFFFAOYSA-N chloro-dioxido-oxo-$l^{5}-phosphane;hydron Chemical compound OP(O)(Cl)=O ITVPBBDAZKBMRP-UHFFFAOYSA-N 0.000 description 2
- XTHPWXDJESJLNJ-UHFFFAOYSA-N chlorosulfonic acid Substances OS(Cl)(=O)=O XTHPWXDJESJLNJ-UHFFFAOYSA-N 0.000 description 2
- 235000017803 cinnamon Nutrition 0.000 description 2
- 239000004927 clay Substances 0.000 description 2
- NKNDPYCGAZPOFS-UHFFFAOYSA-M copper(i) bromide Chemical compound Br[Cu] NKNDPYCGAZPOFS-UHFFFAOYSA-M 0.000 description 2
- QTMDXZNDVAMKGV-UHFFFAOYSA-L copper(ii) bromide Chemical compound [Cu+2].[Br-].[Br-] QTMDXZNDVAMKGV-UHFFFAOYSA-L 0.000 description 2
- 235000005822 corn Nutrition 0.000 description 2
- 125000001995 cyclobutyl group Chemical group [H]C1([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 2
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 2
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 description 2
- 239000002274 desiccant Substances 0.000 description 2
- IWEDIXLBFLAXBO-UHFFFAOYSA-N dicamba Chemical compound COC1=C(Cl)C=CC(Cl)=C1C(O)=O IWEDIXLBFLAXBO-UHFFFAOYSA-N 0.000 description 2
- 125000004772 dichloromethyl group Chemical group [H]C(Cl)(Cl)* 0.000 description 2
- 125000001028 difluoromethyl group Chemical group [H]C(F)(F)* 0.000 description 2
- 238000010790 dilution Methods 0.000 description 2
- 239000012895 dilution Substances 0.000 description 2
- 238000009826 distribution Methods 0.000 description 2
- 239000004495 emulsifiable concentrate Substances 0.000 description 2
- 239000000839 emulsion Substances 0.000 description 2
- 125000003754 ethoxycarbonyl group Chemical group C(=O)(OCC)* 0.000 description 2
- 125000005448 ethoxyethyl group Chemical group [H]C([H])([H])C([H])([H])OC([H])([H])C([H])([H])* 0.000 description 2
- NJSFEYZOXLZMNV-UHFFFAOYSA-N ethyl 2-chloro-4-fluoro-5-hydrazinylbenzoate Chemical compound CCOC(=O)C1=CC(NN)=C(F)C=C1Cl NJSFEYZOXLZMNV-UHFFFAOYSA-N 0.000 description 2
- FVIMBXSLEYZVIC-UHFFFAOYSA-N ethyl 2-chloro-4-fluoro-5-hydrazinylbenzoate;hydrochloride Chemical compound Cl.CCOC(=O)C1=CC(NN)=C(F)C=C1Cl FVIMBXSLEYZVIC-UHFFFAOYSA-N 0.000 description 2
- XHFJXQUWCLIYML-UHFFFAOYSA-N ethyl 2-chloro-4-fluoro-5-nitrobenzoate Chemical compound CCOC(=O)C1=CC([N+]([O-])=O)=C(F)C=C1Cl XHFJXQUWCLIYML-UHFFFAOYSA-N 0.000 description 2
- ZSPZAOASMCGAES-UHFFFAOYSA-N ethyl 5-amino-2-chloro-4-fluorobenzoate Chemical compound CCOC(=O)C1=CC(N)=C(F)C=C1Cl ZSPZAOASMCGAES-UHFFFAOYSA-N 0.000 description 2
- PQJJJMRNHATNKG-UHFFFAOYSA-N ethyl bromoacetate Chemical compound CCOC(=O)CBr PQJJJMRNHATNKG-UHFFFAOYSA-N 0.000 description 2
- PQVSTLUFSYVLTO-UHFFFAOYSA-N ethyl n-ethoxycarbonylcarbamate Chemical compound CCOC(=O)NC(=O)OCC PQVSTLUFSYVLTO-UHFFFAOYSA-N 0.000 description 2
- 239000000706 filtrate Substances 0.000 description 2
- MEFQWPUMEMWTJP-UHFFFAOYSA-N fluroxypyr Chemical compound NC1=C(Cl)C(F)=NC(OCC(O)=O)=C1Cl MEFQWPUMEMWTJP-UHFFFAOYSA-N 0.000 description 2
- 239000012458 free base Substances 0.000 description 2
- 150000007857 hydrazones Chemical class 0.000 description 2
- 229910000042 hydrogen bromide Inorganic materials 0.000 description 2
- 230000007062 hydrolysis Effects 0.000 description 2
- 238000006460 hydrolysis reaction Methods 0.000 description 2
- 125000005929 isobutyloxycarbonyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])OC(*)=O 0.000 description 2
- 125000005928 isopropyloxycarbonyl group Chemical group [H]C([H])([H])C([H])(OC(*)=O)C([H])([H])[H] 0.000 description 2
- 239000007788 liquid Substances 0.000 description 2
- GLXDVVHUTZTUQK-UHFFFAOYSA-M lithium hydroxide monohydrate Substances [Li+].O.[OH-] GLXDVVHUTZTUQK-UHFFFAOYSA-M 0.000 description 2
- 229940040692 lithium hydroxide monohydrate Drugs 0.000 description 2
- QARBMVPHQWIHKH-UHFFFAOYSA-N methanesulfonyl chloride Chemical compound CS(Cl)(=O)=O QARBMVPHQWIHKH-UHFFFAOYSA-N 0.000 description 2
- 125000001160 methoxycarbonyl group Chemical group [H]C([H])([H])OC(*)=O 0.000 description 2
- RTCOGUMHFFWOJV-UHFFFAOYSA-N nicosulfuron Chemical compound COC1=CC(OC)=NC(NC(=O)NS(=O)(=O)C=2C(=CC=CN=2)C(=O)N(C)C)=N1 RTCOGUMHFFWOJV-UHFFFAOYSA-N 0.000 description 2
- 239000003921 oil Substances 0.000 description 2
- 235000019198 oils Nutrition 0.000 description 2
- 150000007524 organic acids Chemical class 0.000 description 2
- 235000005985 organic acids Nutrition 0.000 description 2
- 239000005416 organic matter Substances 0.000 description 2
- FIKAKWIAUPDISJ-UHFFFAOYSA-L paraquat dichloride Chemical compound [Cl-].[Cl-].C1=C[N+](C)=CC=C1C1=CC=[N+](C)C=C1 FIKAKWIAUPDISJ-UHFFFAOYSA-L 0.000 description 2
- 125000006340 pentafluoro ethyl group Chemical group FC(F)(F)C(F)(F)* 0.000 description 2
- 150000004965 peroxy acids Chemical class 0.000 description 2
- XNGIFLGASWRNHJ-UHFFFAOYSA-N phthalic acid Chemical compound OC(=O)C1=CC=CC=C1C(O)=O XNGIFLGASWRNHJ-UHFFFAOYSA-N 0.000 description 2
- SCVFZCLFOSHCOH-UHFFFAOYSA-M potassium acetate Chemical compound [K+].CC([O-])=O SCVFZCLFOSHCOH-UHFFFAOYSA-M 0.000 description 2
- 239000011698 potassium fluoride Substances 0.000 description 2
- 235000003270 potassium fluoride Nutrition 0.000 description 2
- ZNNZYHKDIALBAK-UHFFFAOYSA-M potassium thiocyanate Chemical compound [K+].[S-]C#N ZNNZYHKDIALBAK-UHFFFAOYSA-M 0.000 description 2
- 229940116357 potassium thiocyanate Drugs 0.000 description 2
- 125000001844 prenyl group Chemical group [H]C([*])([H])C([H])=C(C([H])([H])[H])C([H])([H])[H] 0.000 description 2
- YORCIIVHUBAYBQ-UHFFFAOYSA-N propargyl bromide Chemical compound BrCC#C YORCIIVHUBAYBQ-UHFFFAOYSA-N 0.000 description 2
- 125000004742 propyloxycarbonyl group Chemical group 0.000 description 2
- 235000009566 rice Nutrition 0.000 description 2
- 238000007363 ring formation reaction Methods 0.000 description 2
- VGTPCRGMBIAPIM-UHFFFAOYSA-M sodium thiocyanate Chemical compound [Na+].[S-]C#N VGTPCRGMBIAPIM-UHFFFAOYSA-M 0.000 description 2
- 239000003549 soybean oil Substances 0.000 description 2
- 235000012424 soybean oil Nutrition 0.000 description 2
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 2
- 235000015112 vegetable and seed oil Nutrition 0.000 description 2
- 239000008158 vegetable oil Substances 0.000 description 2
- 239000004562 water dispersible granule Substances 0.000 description 2
- VTVSBTRQHFFZAM-UHFFFAOYSA-N (4-chloro-2-fluoro-5-propan-2-yloxyphenyl)hydrazine Chemical compound CC(C)OC1=CC(NN)=C(F)C=C1Cl VTVSBTRQHFFZAM-UHFFFAOYSA-N 0.000 description 1
- 125000006527 (C1-C5) alkyl group Chemical group 0.000 description 1
- 125000004916 (C1-C6) alkylcarbonyl group Chemical group 0.000 description 1
- QBVHMPFSDVNFAY-UHFFFAOYSA-N 1,1,1-trifluorobutan-2-one Chemical compound CCC(=O)C(F)(F)F QBVHMPFSDVNFAY-UHFFFAOYSA-N 0.000 description 1
- FHUDAMLDXFJHJE-UHFFFAOYSA-N 1,1,1-trifluoropropan-2-one Chemical compound CC(=O)C(F)(F)F FHUDAMLDXFJHJE-UHFFFAOYSA-N 0.000 description 1
- GNPWYHFXSMINJQ-UHFFFAOYSA-N 1,2-dimethyl-3-(1-phenylethyl)benzene Chemical compound C=1C=CC(C)=C(C)C=1C(C)C1=CC=CC=C1 GNPWYHFXSMINJQ-UHFFFAOYSA-N 0.000 description 1
- YIWGJFPJRAEKMK-UHFFFAOYSA-N 1-(2H-benzotriazol-5-yl)-3-methyl-8-[2-[[3-(trifluoromethoxy)phenyl]methylamino]pyrimidine-5-carbonyl]-1,3,8-triazaspiro[4.5]decane-2,4-dione Chemical compound CN1C(=O)N(c2ccc3n[nH]nc3c2)C2(CCN(CC2)C(=O)c2cnc(NCc3cccc(OC(F)(F)F)c3)nc2)C1=O YIWGJFPJRAEKMK-UHFFFAOYSA-N 0.000 description 1
- ZMESHQOXZMOOQQ-UHFFFAOYSA-N 1-(naphthalen-1-ylmethyl)naphthalene Chemical compound C1=CC=C2C(CC=3C4=CC=CC=C4C=CC=3)=CC=CC2=C1 ZMESHQOXZMOOQQ-UHFFFAOYSA-N 0.000 description 1
- IANQTJSKSUMEQM-UHFFFAOYSA-N 1-benzofuran Chemical group C1=CC=C2OC=CC2=C1 IANQTJSKSUMEQM-UHFFFAOYSA-N 0.000 description 1
- 125000001478 1-chloroethyl group Chemical group [H]C([H])([H])C([H])(Cl)* 0.000 description 1
- 125000004066 1-hydroxyethyl group Chemical group [H]OC([H])([*])C([H])([H])[H] 0.000 description 1
- JQCSUVJDBHJKNG-UHFFFAOYSA-N 1-methoxy-ethyl Chemical group C[CH]OC JQCSUVJDBHJKNG-UHFFFAOYSA-N 0.000 description 1
- 125000006017 1-propenyl group Chemical group 0.000 description 1
- KNGWEAQJZJKFLI-UHFFFAOYSA-N 2,2-dimethyl-4h-1,3-benzodioxine-6-carbaldehyde Chemical compound O=CC1=CC=C2OC(C)(C)OCC2=C1 KNGWEAQJZJKFLI-UHFFFAOYSA-N 0.000 description 1
- HBEDSQVIWPRPAY-UHFFFAOYSA-N 2,3-dihydrobenzofuran Chemical group C1=CC=C2OCCC2=C1 HBEDSQVIWPRPAY-UHFFFAOYSA-N 0.000 description 1
- 239000005631 2,4-Dichlorophenoxyacetic acid Substances 0.000 description 1
- HFZWRUODUSTPEG-UHFFFAOYSA-N 2,4-dichlorophenol Chemical compound OC1=CC=C(Cl)C=C1Cl HFZWRUODUSTPEG-UHFFFAOYSA-N 0.000 description 1
- BDQWWOHKFDSADC-UHFFFAOYSA-N 2-(2,4-dichloro-3-methylphenoxy)-n-phenylpropanamide Chemical compound C=1C=CC=CC=1NC(=O)C(C)OC1=CC=C(Cl)C(C)=C1Cl BDQWWOHKFDSADC-UHFFFAOYSA-N 0.000 description 1
- WLOJRZDLJOHLKF-UHFFFAOYSA-N 2-(4-bromo-2-fluoro-5-propan-2-yloxyphenyl)-4-methyl-5-(trifluoromethyl)pyridazin-3-one Chemical compound C1=C(Br)C(OC(C)C)=CC(N2C(C(C)=C(C=N2)C(F)(F)F)=O)=C1F WLOJRZDLJOHLKF-UHFFFAOYSA-N 0.000 description 1
- HGPUYHLTYDTYLG-UHFFFAOYSA-N 2-(4-bromo-2-fluoro-5-propan-2-yloxyphenyl)-5-(trifluoromethyl)pyridazin-3-one Chemical compound C1=C(Br)C(OC(C)C)=CC(N2C(C=C(C=N2)C(F)(F)F)=O)=C1F HGPUYHLTYDTYLG-UHFFFAOYSA-N 0.000 description 1
- INGLCBNUVJMQKR-UHFFFAOYSA-N 2-(4-chloro-2-fluoro-5-hydroxyphenyl)-4-methyl-5-(trifluoromethyl)pyridazin-3-one Chemical compound O=C1C(C)=C(C(F)(F)F)C=NN1C1=CC(O)=C(Cl)C=C1F INGLCBNUVJMQKR-UHFFFAOYSA-N 0.000 description 1
- CDLISDYKXJMCMS-UHFFFAOYSA-N 2-(4-chloro-2-fluoro-5-propan-2-yloxyphenyl)-4-methyl-5-(trifluoromethyl)-1h-pyridazine Chemical compound C1=C(Cl)C(OC(C)C)=CC(N2C=C(C)C(=CN2)C(F)(F)F)=C1F CDLISDYKXJMCMS-UHFFFAOYSA-N 0.000 description 1
- WNTGYJSOUMFZEP-UHFFFAOYSA-N 2-(4-chloro-2-methylphenoxy)propanoic acid Chemical compound OC(=O)C(C)OC1=CC=C(Cl)C=C1C WNTGYJSOUMFZEP-UHFFFAOYSA-N 0.000 description 1
- SHQPKACXJMCATH-UHFFFAOYSA-N 2-(4-chlorophenyl)-5-(trifluoromethyl)pyridazin-3-one Chemical compound O=C1C=C(C(F)(F)F)C=NN1C1=CC=C(Cl)C=C1 SHQPKACXJMCATH-UHFFFAOYSA-N 0.000 description 1
- NUPJIGQFXCQJBK-UHFFFAOYSA-N 2-(4-isopropyl-4-methyl-5-oxo-4,5-dihydro-1H-imidazol-2-yl)-5-(methoxymethyl)nicotinic acid Chemical compound OC(=O)C1=CC(COC)=CN=C1C1=NC(C)(C(C)C)C(=O)N1 NUPJIGQFXCQJBK-UHFFFAOYSA-N 0.000 description 1
- LBLYYCQCTBFVLH-UHFFFAOYSA-N 2-Methylbenzenesulfonic acid Chemical compound CC1=CC=CC=C1S(O)(=O)=O LBLYYCQCTBFVLH-UHFFFAOYSA-N 0.000 description 1
- ZBMRKNMTMPPMMK-UHFFFAOYSA-N 2-amino-4-[hydroxy(methyl)phosphoryl]butanoic acid;azane Chemical compound [NH4+].CP(O)(=O)CCC(N)C([O-])=O ZBMRKNMTMPPMMK-UHFFFAOYSA-N 0.000 description 1
- NVNFKCCUJKPLLT-UHFFFAOYSA-N 2-bromo-4-fluoro-5-nitrophenol Chemical compound OC1=CC([N+]([O-])=O)=C(F)C=C1Br NVNFKCCUJKPLLT-UHFFFAOYSA-N 0.000 description 1
- MEYRABVEYCFHHB-UHFFFAOYSA-N 2-bromo-4-fluorophenol Chemical compound OC1=CC=C(F)C=C1Br MEYRABVEYCFHHB-UHFFFAOYSA-N 0.000 description 1
- 125000005999 2-bromoethyl group Chemical group 0.000 description 1
- YHKBGVDUSSWOAB-UHFFFAOYSA-N 2-chloro-3-{2-chloro-5-[4-(difluoromethyl)-3-methyl-5-oxo-4,5-dihydro-1H-1,2,4-triazol-1-yl]-4-fluorophenyl}propanoic acid Chemical compound O=C1N(C(F)F)C(C)=NN1C1=CC(CC(Cl)C(O)=O)=C(Cl)C=C1F YHKBGVDUSSWOAB-UHFFFAOYSA-N 0.000 description 1
- ANQYXSGAZZIKEO-UHFFFAOYSA-N 2-chloro-4-fluoro-5-hydrazinylphenol Chemical compound NNC1=CC(O)=C(Cl)C=C1F ANQYXSGAZZIKEO-UHFFFAOYSA-N 0.000 description 1
- GRPWQLDSGNZEQE-UHFFFAOYSA-N 2-chloro-4-fluorobenzoic acid Chemical compound OC(=O)C1=CC=C(F)C=C1Cl GRPWQLDSGNZEQE-UHFFFAOYSA-N 0.000 description 1
- JLYFCTQDENRSOL-UHFFFAOYSA-N 2-chloro-N-(2,4-dimethylthiophen-3-yl)-N-(1-methoxypropan-2-yl)acetamide Chemical compound COCC(C)N(C(=O)CCl)C=1C(C)=CSC=1C JLYFCTQDENRSOL-UHFFFAOYSA-N 0.000 description 1
- WVQBLGZPHOPPFO-UHFFFAOYSA-N 2-chloro-N-(2-ethyl-6-methylphenyl)-N-(1-methoxypropan-2-yl)acetamide Chemical compound CCC1=CC=CC(C)=C1N(C(C)COC)C(=O)CCl WVQBLGZPHOPPFO-UHFFFAOYSA-N 0.000 description 1
- 125000001731 2-cyanoethyl group Chemical group [H]C([H])(*)C([H])([H])C#N 0.000 description 1
- ZNQVEEAIQZEUHB-UHFFFAOYSA-N 2-ethoxyethanol Chemical compound CCOCCO ZNQVEEAIQZEUHB-UHFFFAOYSA-N 0.000 description 1
- 229940093475 2-ethoxyethanol Drugs 0.000 description 1
- 125000006022 2-methyl-2-propenyl group Chemical group 0.000 description 1
- CNQOORHYEKAWRC-UHFFFAOYSA-N 3,3,3-trifluoro-2-oxopropanal Chemical compound FC(F)(F)C(=O)C=O CNQOORHYEKAWRC-UHFFFAOYSA-N 0.000 description 1
- UPMXNNIRAGDFEH-UHFFFAOYSA-N 3,5-dibromo-4-hydroxybenzonitrile Chemical compound OC1=C(Br)C=C(C#N)C=C1Br UPMXNNIRAGDFEH-UHFFFAOYSA-N 0.000 description 1
- NVLPQIPTCCLBEU-UHFFFAOYSA-N 3-(Methylthio)-1-propene Chemical compound CSCC=C NVLPQIPTCCLBEU-UHFFFAOYSA-N 0.000 description 1
- FMMCSIPNDXCXLM-UHFFFAOYSA-N 3-[(2,4-dichloro-5-propan-2-yloxyphenyl)hydrazinylidene]-1,1,1-trifluoropropan-2-one Chemical compound CC(C)OC1=CC(NN=CC(=O)C(F)(F)F)=C(Cl)C=C1Cl FMMCSIPNDXCXLM-UHFFFAOYSA-N 0.000 description 1
- LDMVMQNCZKQVOI-UHFFFAOYSA-N 3-[(4-chloro-2-fluoro-5-hydroxyphenyl)hydrazinylidene]-1,1,1-trifluoropropan-2-one Chemical compound OC1=CC(NN=CC(=O)C(F)(F)F)=C(F)C=C1Cl LDMVMQNCZKQVOI-UHFFFAOYSA-N 0.000 description 1
- USEGQJLHQSTGHW-UHFFFAOYSA-N 3-bromo-2-methylprop-1-ene Chemical compound CC(=C)CBr USEGQJLHQSTGHW-UHFFFAOYSA-N 0.000 description 1
- XWGPCCBTAOCUME-UHFFFAOYSA-N 3-butan-2-yl-6-fluoro-5-hydrazinyl-1,3-benzothiazol-2-one Chemical compound NNC1=C(F)C=C2SC(=O)N(C(C)CC)C2=C1 XWGPCCBTAOCUME-UHFFFAOYSA-N 0.000 description 1
- NHQDETIJWKXCTC-UHFFFAOYSA-N 3-chloroperbenzoic acid Chemical compound OOC(=O)C1=CC=CC(Cl)=C1 NHQDETIJWKXCTC-UHFFFAOYSA-N 0.000 description 1
- LIQBKSIZAXKCPA-UHFFFAOYSA-N 4,4,4-trifluoro-3-oxobutanoic acid Chemical compound OC(=O)CC(=O)C(F)(F)F LIQBKSIZAXKCPA-UHFFFAOYSA-N 0.000 description 1
- 125000001205 4-bromo-2-butynyl group Chemical group [H]C([H])(Br)C#CC([H])([H])* 0.000 description 1
- GEGKRSHJWVPCPA-UHFFFAOYSA-N 4-chloro-2-fluoro-5-propan-2-yloxyaniline Chemical compound CC(C)OC1=CC(N)=C(F)C=C1Cl GEGKRSHJWVPCPA-UHFFFAOYSA-N 0.000 description 1
- AFZLCOLNTRPSIF-UHFFFAOYSA-N 5-amino-2-chloro-4-fluorophenol Chemical compound NC1=CC(O)=C(Cl)C=C1F AFZLCOLNTRPSIF-UHFFFAOYSA-N 0.000 description 1
- TXJXMLFKIADIDZ-UHFFFAOYSA-N 5-amino-2-chloro-5-fluorocyclohexa-1,3-dien-1-ol Chemical compound NC1(F)CC(O)=C(Cl)C=C1 TXJXMLFKIADIDZ-UHFFFAOYSA-N 0.000 description 1
- XQAYIRQBVHIFPG-UHFFFAOYSA-N 6-hydrazinyl-4-prop-2-ynyl-1,4-benzoxazin-3-one Chemical compound O1CC(=O)N(CC#C)C2=CC(NN)=CC=C21 XQAYIRQBVHIFPG-UHFFFAOYSA-N 0.000 description 1
- QUSCZDWJDSGMHQ-UHFFFAOYSA-N 7-fluoro-4-prop-2-ynyl-6-[2-(4,4,4-trifluoro-3-oxobutan-2-ylidene)hydrazinyl]-1,4-benzoxazin-3-one Chemical compound C#CCN1C(=O)COC2=C1C=C(NN=C(C)C(=O)C(F)(F)F)C(F)=C2 QUSCZDWJDSGMHQ-UHFFFAOYSA-N 0.000 description 1
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- 241000219144 Abutilon Species 0.000 description 1
- 244000215068 Acacia senegal Species 0.000 description 1
- VTNQPKFIQCLBDU-UHFFFAOYSA-N Acetochlor Chemical compound CCOCN(C(=O)CCl)C1=C(C)C=CC=C1CC VTNQPKFIQCLBDU-UHFFFAOYSA-N 0.000 description 1
- 241000509537 Alisma canaliculatum Species 0.000 description 1
- 241000209514 Alismataceae Species 0.000 description 1
- 239000005995 Aluminium silicate Substances 0.000 description 1
- 235000009328 Amaranthus caudatus Nutrition 0.000 description 1
- 240000001592 Amaranthus caudatus Species 0.000 description 1
- 244000300297 Amaranthus hybridus Species 0.000 description 1
- 235000013479 Amaranthus retroflexus Nutrition 0.000 description 1
- 244000237956 Amaranthus retroflexus Species 0.000 description 1
- 235000009051 Ambrosia paniculata var. peruviana Nutrition 0.000 description 1
- 244000121264 Ammannia multiflora Species 0.000 description 1
- 101100327398 Anopheles gambiae CecA gene Proteins 0.000 description 1
- 241000208173 Apiaceae Species 0.000 description 1
- 241000208327 Apocynaceae Species 0.000 description 1
- 235000010777 Arachis hypogaea Nutrition 0.000 description 1
- 235000003097 Artemisia absinthium Nutrition 0.000 description 1
- 235000017731 Artemisia dracunculus ssp. dracunculus Nutrition 0.000 description 1
- 235000017519 Artemisia princeps Nutrition 0.000 description 1
- 244000065027 Artemisia princeps Species 0.000 description 1
- 235000003261 Artemisia vulgaris Nutrition 0.000 description 1
- 240000006891 Artemisia vulgaris Species 0.000 description 1
- 235000002470 Asclepias syriaca Nutrition 0.000 description 1
- 244000000594 Asclepias syriaca Species 0.000 description 1
- 241000208838 Asteraceae Species 0.000 description 1
- 241000209764 Avena fatua Species 0.000 description 1
- 244000075850 Avena orientalis Species 0.000 description 1
- 239000005469 Azimsulfuron Substances 0.000 description 1
- 239000005472 Bensulfuron methyl Substances 0.000 description 1
- 235000021533 Beta vulgaris Nutrition 0.000 description 1
- 241000335053 Beta vulgaris Species 0.000 description 1
- 241000219310 Beta vulgaris subsp. vulgaris Species 0.000 description 1
- 239000005484 Bifenox Substances 0.000 description 1
- 240000004183 Bongardia chrysogonum Species 0.000 description 1
- 241001072256 Boraginaceae Species 0.000 description 1
- 235000008427 Brassica arvensis Nutrition 0.000 description 1
- 235000005637 Brassica campestris Nutrition 0.000 description 1
- 235000014750 Brassica kaber Nutrition 0.000 description 1
- 244000178924 Brassica napobrassica Species 0.000 description 1
- 235000011297 Brassica napobrassica Nutrition 0.000 description 1
- 240000002791 Brassica napus Species 0.000 description 1
- 235000011293 Brassica napus Nutrition 0.000 description 1
- 235000010149 Brassica rapa subsp chinensis Nutrition 0.000 description 1
- 235000010570 Brassica rapa var. rapa Nutrition 0.000 description 1
- 235000004977 Brassica sinapistrum Nutrition 0.000 description 1
- 239000005489 Bromoxynil Substances 0.000 description 1
- 241001148727 Bromus tectorum Species 0.000 description 1
- BMTAFVWTTFSTOG-UHFFFAOYSA-N Butylate Chemical compound CCSC(=O)N(CC(C)C)CC(C)C BMTAFVWTTFSTOG-UHFFFAOYSA-N 0.000 description 1
- 125000006577 C1-C6 hydroxyalkyl group Chemical group 0.000 description 1
- GAWIXWVDTYZWAW-UHFFFAOYSA-N C[CH]O Chemical group C[CH]O GAWIXWVDTYZWAW-UHFFFAOYSA-N 0.000 description 1
- 101100532679 Caenorhabditis elegans scc-1 gene Proteins 0.000 description 1
- 229910021532 Calcite Inorganic materials 0.000 description 1
- 235000011305 Capsella bursa pastoris Nutrition 0.000 description 1
- 240000008867 Capsella bursa-pastoris Species 0.000 description 1
- 229920002134 Carboxymethyl cellulose Polymers 0.000 description 1
- 241000219321 Caryophyllaceae Species 0.000 description 1
- 244000277285 Cassia obtusifolia Species 0.000 description 1
- 235000006719 Cassia obtusifolia Nutrition 0.000 description 1
- 101100059601 Ceratitis capitata CEC1 gene Proteins 0.000 description 1
- 240000006122 Chenopodium album Species 0.000 description 1
- 235000009344 Chenopodium album Nutrition 0.000 description 1
- 239000005494 Chlorotoluron Substances 0.000 description 1
- 244000037364 Cinnamomum aromaticum Species 0.000 description 1
- 235000014489 Cinnamomum aromaticum Nutrition 0.000 description 1
- SUNREPXETARMJC-UHFFFAOYSA-N Cl.ClC1=C(C(=O)O)C=C(C(=C1)Cl)NN Chemical compound Cl.ClC1=C(C(=O)O)C=C(C(=C1)Cl)NN SUNREPXETARMJC-UHFFFAOYSA-N 0.000 description 1
- 239000005497 Clethodim Substances 0.000 description 1
- 241000233838 Commelina Species 0.000 description 1
- 241000233839 Commelina communis Species 0.000 description 1
- 241000233833 Commelinaceae Species 0.000 description 1
- 244000074881 Conyza canadensis Species 0.000 description 1
- 235000004385 Conyza canadensis Nutrition 0.000 description 1
- 229910021590 Copper(II) bromide Inorganic materials 0.000 description 1
- 244000285774 Cyperus esculentus Species 0.000 description 1
- 235000005853 Cyperus esculentus Nutrition 0.000 description 1
- 244000285790 Cyperus iria Species 0.000 description 1
- 235000016854 Cyperus rotundus Nutrition 0.000 description 1
- 244000075634 Cyperus rotundus Species 0.000 description 1
- 241000208296 Datura Species 0.000 description 1
- 240000008853 Datura stramonium Species 0.000 description 1
- 241000522190 Desmodium Species 0.000 description 1
- 244000262903 Desmodium tortuosum Species 0.000 description 1
- LBGPXIPGGRQBJW-UHFFFAOYSA-N Difenzoquat Chemical compound C[N+]=1N(C)C(C=2C=CC=CC=2)=CC=1C1=CC=CC=C1 LBGPXIPGGRQBJW-UHFFFAOYSA-N 0.000 description 1
- 244000152970 Digitaria sanguinalis Species 0.000 description 1
- 235000010823 Digitaria sanguinalis Nutrition 0.000 description 1
- 239000005630 Diquat Substances 0.000 description 1
- YUBJPYNSGLJZPQ-UHFFFAOYSA-N Dithiopyr Chemical compound CSC(=O)C1=C(C(F)F)N=C(C(F)(F)F)C(C(=O)SC)=C1CC(C)C YUBJPYNSGLJZPQ-UHFFFAOYSA-N 0.000 description 1
- GUVLYNGULCJVDO-UHFFFAOYSA-N EPTC Chemical compound CCCN(CCC)C(=O)SCC GUVLYNGULCJVDO-UHFFFAOYSA-N 0.000 description 1
- 244000058871 Echinochloa crus-galli Species 0.000 description 1
- 241000192040 Echinochloa phyllopogon Species 0.000 description 1
- 241000563967 Elatinaceae Species 0.000 description 1
- 244000283628 Elatine triandra Species 0.000 description 1
- 241000759199 Eleocharis acicularis Species 0.000 description 1
- 241000759118 Eleocharis kuroguwai Species 0.000 description 1
- 235000014716 Eleusine indica Nutrition 0.000 description 1
- 244000025670 Eleusine indica Species 0.000 description 1
- 241000195952 Equisetaceae Species 0.000 description 1
- 241000195950 Equisetum arvense Species 0.000 description 1
- 239000005768 Equisetum arvense L. Substances 0.000 description 1
- 241000195955 Equisetum hyemale Species 0.000 description 1
- 240000006890 Erythroxylum coca Species 0.000 description 1
- JIGUQPWFLRLWPJ-UHFFFAOYSA-N Ethyl acrylate Chemical compound CCOC(=O)C=C JIGUQPWFLRLWPJ-UHFFFAOYSA-N 0.000 description 1
- 241000221079 Euphorbia <genus> Species 0.000 description 1
- 244000192024 Euphorbia helioscopia Species 0.000 description 1
- 235000012043 Euphorbia helioscopia Nutrition 0.000 description 1
- 241001599881 Euphorbia maculata Species 0.000 description 1
- 241000220485 Fabaceae Species 0.000 description 1
- 241001289540 Fallopia convolvulus Species 0.000 description 1
- AOQMRUTZEYVDIL-UHFFFAOYSA-N Flupoxam Chemical compound C=1C=C(Cl)C(COCC(F)(F)C(F)(F)F)=CC=1N1N=C(C(=O)N)N=C1C1=CC=CC=C1 AOQMRUTZEYVDIL-UHFFFAOYSA-N 0.000 description 1
- 239000005562 Glyphosate Substances 0.000 description 1
- 235000009438 Gossypium Nutrition 0.000 description 1
- 229920000084 Gum arabic Polymers 0.000 description 1
- LXKOADMMGWXPJQ-UHFFFAOYSA-N Halosulfuron Chemical compound COC1=CC(OC)=NC(NC(=O)NS(=O)(=O)C=2N(N=C(Cl)C=2C(O)=O)C)=N1 LXKOADMMGWXPJQ-UHFFFAOYSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- 239000005566 Imazamox Substances 0.000 description 1
- XVOKUMIPKHGGTN-UHFFFAOYSA-N Imazethapyr Chemical compound OC(=O)C1=CC(CC)=CN=C1C1=NC(C)(C(C)C)C(=O)N1 XVOKUMIPKHGGTN-UHFFFAOYSA-N 0.000 description 1
- 241000207783 Ipomoea Species 0.000 description 1
- 235000021506 Ipomoea Nutrition 0.000 description 1
- 239000005570 Isoxaben Substances 0.000 description 1
- 241001533590 Junonia Species 0.000 description 1
- 239000005909 Kieselgur Substances 0.000 description 1
- 241000207923 Lamiaceae Species 0.000 description 1
- 235000009198 Lamium amplexicaule Nutrition 0.000 description 1
- 244000303225 Lamium amplexicaule Species 0.000 description 1
- 235000009193 Lamium purpureum Nutrition 0.000 description 1
- 240000006503 Lamium purpureum Species 0.000 description 1
- 240000004428 Lindernia procumbens Species 0.000 description 1
- HBBGRARXTFLTSG-UHFFFAOYSA-N Lithium ion Chemical compound [Li+] HBBGRARXTFLTSG-UHFFFAOYSA-N 0.000 description 1
- 241000219991 Lythraceae Species 0.000 description 1
- SUSRORUBZHMPCO-UHFFFAOYSA-N MC-4379 Chemical compound C1=C([N+]([O-])=O)C(C(=O)OC)=CC(OC=2C(=CC(Cl)=CC=2)Cl)=C1 SUSRORUBZHMPCO-UHFFFAOYSA-N 0.000 description 1
- 241000813323 Maize streak Reunion virus Species 0.000 description 1
- 241000219071 Malvaceae Species 0.000 description 1
- 235000003990 Monochoria hastata Nutrition 0.000 description 1
- 241001442135 Myosotis arvensis Species 0.000 description 1
- 240000001307 Myosotis scorpioides Species 0.000 description 1
- SECXISVLQFMRJM-UHFFFAOYSA-N N-Methylpyrrolidone Chemical compound CN1CCCC1=O SECXISVLQFMRJM-UHFFFAOYSA-N 0.000 description 1
- MKYBYDHXWVHEJW-UHFFFAOYSA-N N-[1-oxo-1-(2,4,6,7-tetrahydrotriazolo[4,5-c]pyridin-5-yl)propan-2-yl]-2-[[3-(trifluoromethoxy)phenyl]methylamino]pyrimidine-5-carboxamide Chemical compound O=C(C(C)NC(=O)C=1C=NC(=NC=1)NCC1=CC(=CC=C1)OC(F)(F)F)N1CC2=C(CC1)NN=N2 MKYBYDHXWVHEJW-UHFFFAOYSA-N 0.000 description 1
- NIPNSKYNPDTRPC-UHFFFAOYSA-N N-[2-oxo-2-(2,4,6,7-tetrahydrotriazolo[4,5-c]pyridin-5-yl)ethyl]-2-[[3-(trifluoromethoxy)phenyl]methylamino]pyrimidine-5-carboxamide Chemical compound O=C(CNC(=O)C=1C=NC(=NC=1)NCC1=CC(=CC=C1)OC(F)(F)F)N1CC2=C(CC1)NN=N2 NIPNSKYNPDTRPC-UHFFFAOYSA-N 0.000 description 1
- AFCARXCZXQIEQB-UHFFFAOYSA-N N-[3-oxo-3-(2,4,6,7-tetrahydrotriazolo[4,5-c]pyridin-5-yl)propyl]-2-[[3-(trifluoromethoxy)phenyl]methylamino]pyrimidine-5-carboxamide Chemical compound O=C(CCNC(=O)C=1C=NC(=NC=1)NCC1=CC(=CC=C1)OC(F)(F)F)N1CC2=C(CC1)NN=N2 AFCARXCZXQIEQB-UHFFFAOYSA-N 0.000 description 1
- 235000000365 Oenanthe javanica Nutrition 0.000 description 1
- 240000008881 Oenanthe javanica Species 0.000 description 1
- 241000508727 Oloptum miliaceum Species 0.000 description 1
- 101000642811 Oryza sativa subsp. indica Soluble starch synthase 1, chloroplastic/amyloplastic Proteins 0.000 description 1
- 239000005588 Oxadiazon Substances 0.000 description 1
- CHNUNORXWHYHNE-UHFFFAOYSA-N Oxadiazon Chemical compound C1=C(Cl)C(OC(C)C)=CC(N2C(OC(=N2)C(C)(C)C)=O)=C1Cl CHNUNORXWHYHNE-UHFFFAOYSA-N 0.000 description 1
- 239000005589 Oxasulfuron Substances 0.000 description 1
- 229910019142 PO4 Inorganic materials 0.000 description 1
- 235000011999 Panicum crusgalli Nutrition 0.000 description 1
- 241001668545 Pascopyrum Species 0.000 description 1
- 241000673220 Passiflora tetrandra Species 0.000 description 1
- 101150003085 Pdcl gene Proteins 0.000 description 1
- 240000006928 Persicaria lapathifolia Species 0.000 description 1
- UNLYSVIDNRIVFJ-UHFFFAOYSA-N Piperophos Chemical compound CCCOP(=S)(OCCC)SCC(=O)N1CCCCC1C UNLYSVIDNRIVFJ-UHFFFAOYSA-N 0.000 description 1
- 241000219050 Polygonaceae Species 0.000 description 1
- 241000205407 Polygonum Species 0.000 description 1
- 229920001214 Polysorbate 60 Polymers 0.000 description 1
- 239000004372 Polyvinyl alcohol Substances 0.000 description 1
- 241000757039 Pontederiaceae Species 0.000 description 1
- 241000219295 Portulaca Species 0.000 description 1
- 235000001855 Portulaca oleracea Nutrition 0.000 description 1
- 244000234609 Portulaca oleracea Species 0.000 description 1
- 241000219304 Portulacaceae Species 0.000 description 1
- 241000877993 Potamogeton distinctus Species 0.000 description 1
- 241000756999 Potamogetonaceae Species 0.000 description 1
- YLPGTOIOYRQOHV-UHFFFAOYSA-N Pretilachlor Chemical compound CCCOCCN(C(=O)CCl)C1=C(CC)C=CC=C1CC YLPGTOIOYRQOHV-UHFFFAOYSA-N 0.000 description 1
- 239000005604 Prosulfuron Substances 0.000 description 1
- LTUNNEGNEKBSEH-UHFFFAOYSA-N Prosulfuron Chemical compound COC1=NC(C)=NC(NC(=O)NS(=O)(=O)C=2C(=CC=CC=2)CCC(F)(F)F)=N1 LTUNNEGNEKBSEH-UHFFFAOYSA-N 0.000 description 1
- BGNQYGRXEXDAIQ-UHFFFAOYSA-N Pyrazosulfuron-ethyl Chemical group C1=NN(C)C(S(=O)(=O)NC(=O)NC=2N=C(OC)C=C(OC)N=2)=C1C(=O)OCC BGNQYGRXEXDAIQ-UHFFFAOYSA-N 0.000 description 1
- 239000005606 Pyridate Substances 0.000 description 1
- JTZCTMAVMHRNTR-UHFFFAOYSA-N Pyridate Chemical compound CCCCCCCCSC(=O)OC1=CC(Cl)=NN=C1C1=CC=CC=C1 JTZCTMAVMHRNTR-UHFFFAOYSA-N 0.000 description 1
- CNILNQMBAHKMFS-UHFFFAOYSA-M Pyrithiobac-sodium Chemical compound [Na+].COC1=CC(OC)=NC(SC=2C(=C(Cl)C=CC=2)C([O-])=O)=N1 CNILNQMBAHKMFS-UHFFFAOYSA-M 0.000 description 1
- 244000286177 Raphanus raphanistrum Species 0.000 description 1
- 235000000241 Raphanus raphanistrum Nutrition 0.000 description 1
- 235000000245 Raphanus raphanistrum subsp raphanistrum Nutrition 0.000 description 1
- 244000088415 Raphanus sativus Species 0.000 description 1
- 235000011380 Raphanus sativus Nutrition 0.000 description 1
- 239000005616 Rimsulfuron Substances 0.000 description 1
- 241001303601 Rosacea Species 0.000 description 1
- 241000341978 Rotala Species 0.000 description 1
- 244000155504 Rotala indica Species 0.000 description 1
- 241001107098 Rubiaceae Species 0.000 description 1
- 241001408202 Sagittaria pygmaea Species 0.000 description 1
- 240000009132 Sagittaria sagittifolia Species 0.000 description 1
- 244000085269 Scirpus juncoides Species 0.000 description 1
- 241001529553 Scoparia <angiosperm> Species 0.000 description 1
- 244000275012 Sesbania cannabina Species 0.000 description 1
- 241000533293 Sesbania emerus Species 0.000 description 1
- 235000017016 Setaria faberi Nutrition 0.000 description 1
- 241001355178 Setaria faberi Species 0.000 description 1
- 240000003461 Setaria viridis Species 0.000 description 1
- 235000002248 Setaria viridis Nutrition 0.000 description 1
- 240000006410 Sida spinosa Species 0.000 description 1
- 241000208292 Solanaceae Species 0.000 description 1
- 244000061457 Solanum nigrum Species 0.000 description 1
- 240000002307 Solanum ptychanthum Species 0.000 description 1
- 235000002595 Solanum tuberosum Nutrition 0.000 description 1
- 244000061456 Solanum tuberosum Species 0.000 description 1
- 235000003621 Solidago canadensis var scabra Nutrition 0.000 description 1
- 240000003774 Solidago canadensis var. scabra Species 0.000 description 1
- 235000000914 Solidago virgaurea Nutrition 0.000 description 1
- 235000007230 Sorghum bicolor Nutrition 0.000 description 1
- 240000002439 Sorghum halepense Species 0.000 description 1
- 240000006694 Stellaria media Species 0.000 description 1
- 101100073357 Streptomyces halstedii sch2 gene Proteins 0.000 description 1
- 235000021536 Sugar beet Nutrition 0.000 description 1
- ULUAUXLGCMPNKK-UHFFFAOYSA-N Sulfobutanedioic acid Chemical class OC(=O)CC(C(O)=O)S(O)(=O)=O ULUAUXLGCMPNKK-UHFFFAOYSA-N 0.000 description 1
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 1
- 235000019486 Sunflower oil Nutrition 0.000 description 1
- 244000152045 Themeda triandra Species 0.000 description 1
- 239000005625 Tri-allate Substances 0.000 description 1
- MWBPRDONLNQCFV-UHFFFAOYSA-N Tri-allate Chemical compound CC(C)N(C(C)C)C(=O)SCC(Cl)=C(Cl)Cl MWBPRDONLNQCFV-UHFFFAOYSA-N 0.000 description 1
- 239000005627 Triclopyr Substances 0.000 description 1
- 244000042324 Trifolium repens Species 0.000 description 1
- 235000010729 Trifolium repens Nutrition 0.000 description 1
- 241001278381 Trifolium stoloniferum Species 0.000 description 1
- 235000005373 Uvularia sessilifolia Nutrition 0.000 description 1
- 241001166549 Veronica hederifolia Species 0.000 description 1
- 241000990144 Veronica persica Species 0.000 description 1
- 241000394440 Viola arvensis Species 0.000 description 1
- 244000059558 Viola cucullata Species 0.000 description 1
- 235000013954 Viola cucullata Nutrition 0.000 description 1
- 235000002254 Viola papilionacea Nutrition 0.000 description 1
- 244000047670 Viola x wittrockiana Species 0.000 description 1
- 241001106476 Violaceae Species 0.000 description 1
- 239000000205 acacia gum Substances 0.000 description 1
- 235000010489 acacia gum Nutrition 0.000 description 1
- 230000000895 acaricidal effect Effects 0.000 description 1
- 239000000642 acaricide Substances 0.000 description 1
- DHKHKXVYLBGOIT-UHFFFAOYSA-N acetaldehyde Diethyl Acetal Natural products CCOC(C)OCC DHKHKXVYLBGOIT-UHFFFAOYSA-N 0.000 description 1
- 239000003929 acidic solution Substances 0.000 description 1
- NUFNQYOELLVIPL-UHFFFAOYSA-N acifluorfen Chemical compound C1=C([N+]([O-])=O)C(C(=O)O)=CC(OC=2C(=CC(=CC=2)C(F)(F)F)Cl)=C1 NUFNQYOELLVIPL-UHFFFAOYSA-N 0.000 description 1
- 206010000496 acne Diseases 0.000 description 1
- XCSGPAVHZFQHGE-UHFFFAOYSA-N alachlor Chemical compound CCC1=CC=CC(CC)=C1N(COC)C(=O)CCl XCSGPAVHZFQHGE-UHFFFAOYSA-N 0.000 description 1
- 235000010443 alginic acid Nutrition 0.000 description 1
- 229920000615 alginic acid Polymers 0.000 description 1
- 229910000102 alkali metal hydride Inorganic materials 0.000 description 1
- 150000008046 alkali metal hydrides Chemical class 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 125000003302 alkenyloxy group Chemical group 0.000 description 1
- 125000004453 alkoxycarbonyl group Chemical group 0.000 description 1
- 150000001346 alkyl aryl ethers Chemical class 0.000 description 1
- 150000008055 alkyl aryl sulfonates Chemical class 0.000 description 1
- 150000004996 alkyl benzenes Chemical class 0.000 description 1
- 150000005215 alkyl ethers Chemical class 0.000 description 1
- 150000008051 alkyl sulfates Chemical class 0.000 description 1
- 229940045714 alkyl sulfonate alkylating agent Drugs 0.000 description 1
- 150000008052 alkyl sulfonates Chemical class 0.000 description 1
- 125000005133 alkynyloxy group Chemical group 0.000 description 1
- HSFWRNGVRCDJHI-UHFFFAOYSA-N alpha-acetylene Natural products C#C HSFWRNGVRCDJHI-UHFFFAOYSA-N 0.000 description 1
- 235000012211 aluminium silicate Nutrition 0.000 description 1
- 235000012735 amaranth Nutrition 0.000 description 1
- 239000004178 amaranth Substances 0.000 description 1
- BFNBIHQBYMNNAN-UHFFFAOYSA-N ammonium sulfate Chemical compound N.N.OS(O)(=O)=O BFNBIHQBYMNNAN-UHFFFAOYSA-N 0.000 description 1
- 229910052921 ammonium sulfate Inorganic materials 0.000 description 1
- 235000011130 ammonium sulphate Nutrition 0.000 description 1
- 125000000129 anionic group Chemical group 0.000 description 1
- 239000001138 artemisia absinthium Substances 0.000 description 1
- 229960000892 attapulgite Drugs 0.000 description 1
- 208000014347 autosomal dominant hyaline body myopathy Diseases 0.000 description 1
- MAHPNPYYQAIOJN-UHFFFAOYSA-N azimsulfuron Chemical compound COC1=CC(OC)=NC(NC(=O)NS(=O)(=O)C=2N(N=CC=2C2=NN(C)N=N2)C)=N1 MAHPNPYYQAIOJN-UHFFFAOYSA-N 0.000 description 1
- RQPZNWPYLFFXCP-UHFFFAOYSA-L barium dihydroxide Chemical compound [OH-].[OH-].[Ba+2] RQPZNWPYLFFXCP-UHFFFAOYSA-L 0.000 description 1
- 229910001863 barium hydroxide Inorganic materials 0.000 description 1
- XMQFTWRPUQYINF-UHFFFAOYSA-N bensulfuron-methyl Chemical group COC(=O)C1=CC=CC=C1CS(=O)(=O)NC(=O)NC1=NC(OC)=CC(OC)=N1 XMQFTWRPUQYINF-UHFFFAOYSA-N 0.000 description 1
- ZOMSMJKLGFBRBS-UHFFFAOYSA-N bentazone Chemical compound C1=CC=C2NS(=O)(=O)N(C(C)C)C(=O)C2=C1 ZOMSMJKLGFBRBS-UHFFFAOYSA-N 0.000 description 1
- 239000000440 bentonite Substances 0.000 description 1
- 229910000278 bentonite Inorganic materials 0.000 description 1
- SVPXDRXYRYOSEX-UHFFFAOYSA-N bentoquatam Chemical compound O.O=[Si]=O.O=[Al]O[Al]=O SVPXDRXYRYOSEX-UHFFFAOYSA-N 0.000 description 1
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 1
- FFBHFFJDDLITSX-UHFFFAOYSA-N benzyl N-[2-hydroxy-4-(3-oxomorpholin-4-yl)phenyl]carbamate Chemical compound OC1=C(NC(=O)OCC2=CC=CC=C2)C=CC(=C1)N1CCOCC1=O FFBHFFJDDLITSX-UHFFFAOYSA-N 0.000 description 1
- 229920001400 block copolymer Polymers 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 244000309464 bull Species 0.000 description 1
- HKPHPIREJKHECO-UHFFFAOYSA-N butachlor Chemical compound CCCCOCN(C(=O)CCl)C1=C(CC)C=CC=C1CC HKPHPIREJKHECO-UHFFFAOYSA-N 0.000 description 1
- VAIZTNZGPYBOGF-UHFFFAOYSA-N butyl 2-(4-{[5-(trifluoromethyl)pyridin-2-yl]oxy}phenoxy)propanoate Chemical group C1=CC(OC(C)C(=O)OCCCC)=CC=C1OC1=CC=C(C(F)(F)F)C=N1 VAIZTNZGPYBOGF-UHFFFAOYSA-N 0.000 description 1
- HFEJHAAIJZXXRE-UHFFFAOYSA-N cafenstrole Chemical compound CCN(CC)C(=O)N1C=NC(S(=O)(=O)C=2C(=CC(C)=CC=2C)C)=N1 HFEJHAAIJZXXRE-UHFFFAOYSA-N 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- 239000004202 carbamide Substances 0.000 description 1
- 150000001768 cations Chemical class 0.000 description 1
- 239000007810 chemical reaction solvent Substances 0.000 description 1
- 125000002603 chloroethyl group Chemical group [H]C([*])([H])C([H])([H])Cl 0.000 description 1
- KQDDQXNVESLJNO-UHFFFAOYSA-N chloromethanesulfonyl chloride Chemical compound ClCS(Cl)(=O)=O KQDDQXNVESLJNO-UHFFFAOYSA-N 0.000 description 1
- CRQQGFGUEAVUIL-UHFFFAOYSA-N chlorothalonil Chemical compound ClC1=C(Cl)C(C#N)=C(Cl)C(C#N)=C1Cl CRQQGFGUEAVUIL-UHFFFAOYSA-N 0.000 description 1
- JXCGFZXSOMJFOA-UHFFFAOYSA-N chlorotoluron Chemical compound CN(C)C(=O)NC1=CC=C(C)C(Cl)=C1 JXCGFZXSOMJFOA-UHFFFAOYSA-N 0.000 description 1
- VJYIFXVZLXQVHO-UHFFFAOYSA-N chlorsulfuron Chemical compound COC1=NC(C)=NC(NC(=O)NS(=O)(=O)C=2C(=CC=CC=2)Cl)=N1 VJYIFXVZLXQVHO-UHFFFAOYSA-N 0.000 description 1
- 229940114081 cinnamate Drugs 0.000 description 1
- 238000004140 cleaning Methods 0.000 description 1
- SILSDTWXNBZOGF-JWGBMQLESA-N clethodim Chemical compound CCSC(C)CC1CC(O)=C(C(CC)=NOC\C=C\Cl)C(=O)C1 SILSDTWXNBZOGF-JWGBMQLESA-N 0.000 description 1
- 235000008957 cocaer Nutrition 0.000 description 1
- 239000012141 concentrate Substances 0.000 description 1
- 238000007796 conventional method Methods 0.000 description 1
- 239000010949 copper Substances 0.000 description 1
- 229910052802 copper Inorganic materials 0.000 description 1
- 150000001879 copper Chemical class 0.000 description 1
- 235000012343 cottonseed oil Nutrition 0.000 description 1
- 239000002385 cottonseed oil Substances 0.000 description 1
- 239000012043 crude product Substances 0.000 description 1
- 125000004851 cyclopentylmethyl group Chemical group C1(CCCC1)C* 0.000 description 1
- 238000006114 decarboxylation reaction Methods 0.000 description 1
- 239000002837 defoliant Substances 0.000 description 1
- 230000018044 dehydration Effects 0.000 description 1
- 238000006297 dehydration reaction Methods 0.000 description 1
- HPNMFZURTQLUMO-UHFFFAOYSA-N diethylamine Chemical compound CCNCC HPNMFZURTQLUMO-UHFFFAOYSA-N 0.000 description 1
- BWUPSGJXXPATLU-UHFFFAOYSA-N dimepiperate Chemical compound C=1C=CC=CC=1C(C)(C)SC(=O)N1CCCCC1 BWUPSGJXXPATLU-UHFFFAOYSA-N 0.000 description 1
- LRCFXGAMWKDGLA-UHFFFAOYSA-N dioxosilane;hydrate Chemical compound O.O=[Si]=O LRCFXGAMWKDGLA-UHFFFAOYSA-N 0.000 description 1
- SYJFEGQWDCRVNX-UHFFFAOYSA-N diquat Chemical compound C1=CC=[N+]2CC[N+]3=CC=CC=C3C2=C1 SYJFEGQWDCRVNX-UHFFFAOYSA-N 0.000 description 1
- SDIXRDNYIMOKSG-UHFFFAOYSA-L disodium methyl arsenate Chemical compound [Na+].[Na+].C[As]([O-])([O-])=O SDIXRDNYIMOKSG-UHFFFAOYSA-L 0.000 description 1
- 239000006185 dispersion Substances 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 235000013399 edible fruits Nutrition 0.000 description 1
- 238000004945 emulsification Methods 0.000 description 1
- CCGKOQOJPYTBIH-UHFFFAOYSA-N ethenone Chemical compound C=C=O CCGKOQOJPYTBIH-UHFFFAOYSA-N 0.000 description 1
- NTKMWARNSPVJKT-UHFFFAOYSA-N ethyl 2,4-dichloro-5-hydrazinylbenzoate Chemical compound CCOC(=O)C1=CC(NN)=C(Cl)C=C1Cl NTKMWARNSPVJKT-UHFFFAOYSA-N 0.000 description 1
- ARFLASKVLJTEJD-UHFFFAOYSA-N ethyl 2-bromopropanoate Chemical compound CCOC(=O)C(C)Br ARFLASKVLJTEJD-UHFFFAOYSA-N 0.000 description 1
- 125000006260 ethylaminocarbonyl group Chemical group [H]N(C(*)=O)C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000004672 ethylcarbonyl group Chemical group [H]C([H])([H])C([H])([H])C(*)=O 0.000 description 1
- 125000002534 ethynyl group Chemical group [H]C#C* 0.000 description 1
- 239000003337 fertilizer Substances 0.000 description 1
- 239000013020 final formulation Substances 0.000 description 1
- OMRRUNXAWXNVFW-UHFFFAOYSA-N fluoridochlorine Chemical compound ClF OMRRUNXAWXNVFW-UHFFFAOYSA-N 0.000 description 1
- 125000004216 fluoromethyl group Chemical group [H]C([H])(F)* 0.000 description 1
- 239000000417 fungicide Substances 0.000 description 1
- XDDAORKBJWWYJS-UHFFFAOYSA-N glyphosate Chemical compound OC(=O)CNCP(O)(O)=O XDDAORKBJWWYJS-UHFFFAOYSA-N 0.000 description 1
- 229940097068 glyphosate Drugs 0.000 description 1
- 230000002140 halogenating effect Effects 0.000 description 1
- 125000000717 hydrazino group Chemical group [H]N([*])N([H])[H] 0.000 description 1
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 1
- 238000005984 hydrogenation reaction Methods 0.000 description 1
- 230000003301 hydrolyzing effect Effects 0.000 description 1
- 125000002768 hydroxyalkyl group Chemical group 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- 239000002917 insecticide Substances 0.000 description 1
- 238000003402 intramolecular cyclocondensation reaction Methods 0.000 description 1
- 239000011630 iodine Substances 0.000 description 1
- 229910052740 iodine Inorganic materials 0.000 description 1
- PNDPGZBMCMUPRI-UHFFFAOYSA-N iodine Chemical compound II PNDPGZBMCMUPRI-UHFFFAOYSA-N 0.000 description 1
- NRXQIUSYPAHGNM-UHFFFAOYSA-N ioxynil Chemical compound OC1=C(I)C=C(C#N)C=C1I NRXQIUSYPAHGNM-UHFFFAOYSA-N 0.000 description 1
- 229910052742 iron Inorganic materials 0.000 description 1
- 238000003973 irrigation Methods 0.000 description 1
- 230000002262 irrigation Effects 0.000 description 1
- QPPQHRDVPBTVEV-UHFFFAOYSA-N isopropyl dihydrogen phosphate Chemical compound CC(C)OP(O)(O)=O QPPQHRDVPBTVEV-UHFFFAOYSA-N 0.000 description 1
- FMKOJHQHASLBPH-UHFFFAOYSA-N isopropyl iodide Chemical compound CC(C)I FMKOJHQHASLBPH-UHFFFAOYSA-N 0.000 description 1
- PUIYMUZLKQOUOZ-UHFFFAOYSA-N isoproturon Chemical compound CC(C)C1=CC=C(NC(=O)N(C)C)C=C1 PUIYMUZLKQOUOZ-UHFFFAOYSA-N 0.000 description 1
- PMHURSZHKKJGBM-UHFFFAOYSA-N isoxaben Chemical compound O1N=C(C(C)(CC)CC)C=C1NC(=O)C1=C(OC)C=CC=C1OC PMHURSZHKKJGBM-UHFFFAOYSA-N 0.000 description 1
- NLYAJNPCOHFWQQ-UHFFFAOYSA-N kaolin Chemical compound O.O.O=[Al]O[Si](=O)O[Si](=O)O[Al]=O NLYAJNPCOHFWQQ-UHFFFAOYSA-N 0.000 description 1
- 229940006487 lithium cation Drugs 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- XIGAUIHYSDTJHW-UHFFFAOYSA-N mefenacet Chemical compound N=1C2=CC=CC=C2SC=1OCC(=O)N(C)C1=CC=CC=C1 XIGAUIHYSDTJHW-UHFFFAOYSA-N 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 1
- BACHBFVBHLGWSL-UHFFFAOYSA-N methyl 2-[4-(2,4-dichlorophenoxy)phenoxy]propanoate Chemical group C1=CC(OC(C)C(=O)OC)=CC=C1OC1=CC=C(Cl)C=C1Cl BACHBFVBHLGWSL-UHFFFAOYSA-N 0.000 description 1
- XMJHPCRAQCTCFT-UHFFFAOYSA-N methyl chloroformate Chemical compound COC(Cl)=O XMJHPCRAQCTCFT-UHFFFAOYSA-N 0.000 description 1
- 125000004458 methylaminocarbonyl group Chemical group [H]N(C(*)=O)C([H])([H])[H] 0.000 description 1
- 125000004674 methylcarbonyl group Chemical group CC(=O)* 0.000 description 1
- 125000004372 methylthioethyl group Chemical group [H]C([H])([H])SC([H])([H])C([H])([H])* 0.000 description 1
- 235000010755 mineral Nutrition 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- 239000002480 mineral oil Substances 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- 239000012046 mixed solvent Substances 0.000 description 1
- DEDOPGXGGQYYMW-UHFFFAOYSA-N molinate Chemical compound CCSC(=O)N1CCCCCC1 DEDOPGXGGQYYMW-UHFFFAOYSA-N 0.000 description 1
- JITOKQVGRJSHHA-UHFFFAOYSA-M monosodium methyl arsenate Chemical compound [Na+].C[As](O)([O-])=O JITOKQVGRJSHHA-UHFFFAOYSA-M 0.000 description 1
- 239000010705 motor oil Substances 0.000 description 1
- AJFDBNQQDYLMJN-UHFFFAOYSA-N n,n-diethylacetamide Chemical compound CCN(CC)C(C)=O AJFDBNQQDYLMJN-UHFFFAOYSA-N 0.000 description 1
- 230000001069 nematicidal effect Effects 0.000 description 1
- 239000005645 nematicide Substances 0.000 description 1
- 125000006501 nitrophenyl group Chemical group 0.000 description 1
- 239000004533 oil dispersion Substances 0.000 description 1
- IOXAXYHXMLCCJJ-UHFFFAOYSA-N oxetan-3-yl 2-[(4,6-dimethylpyrimidin-2-yl)carbamoylsulfamoyl]benzoate Chemical compound CC1=CC(C)=NC(NC(=O)NS(=O)(=O)C=2C(=CC=CC=2)C(=O)OC2COC2)=N1 IOXAXYHXMLCCJJ-UHFFFAOYSA-N 0.000 description 1
- 125000000636 p-nitrophenyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)[N+]([O-])=O 0.000 description 1
- 229910052625 palygorskite Inorganic materials 0.000 description 1
- 210000000496 pancreas Anatomy 0.000 description 1
- 235000020232 peanut Nutrition 0.000 description 1
- SAOZOMQLKLWJAN-UHFFFAOYSA-N pentyl 2-chloroacetate Chemical compound CCCCCOC(=O)CCl SAOZOMQLKLWJAN-UHFFFAOYSA-N 0.000 description 1
- PNJWIWWMYCMZRO-UHFFFAOYSA-N pent‐4‐en‐2‐one Natural products CC(=O)CC=C PNJWIWWMYCMZRO-UHFFFAOYSA-N 0.000 description 1
- 235000021317 phosphate Nutrition 0.000 description 1
- 239000005648 plant growth regulator Substances 0.000 description 1
- 229920002503 polyoxyethylene-polyoxypropylene Polymers 0.000 description 1
- 229920002451 polyvinyl alcohol Polymers 0.000 description 1
- 235000019422 polyvinyl alcohol Nutrition 0.000 description 1
- 235000011056 potassium acetate Nutrition 0.000 description 1
- 229910000105 potassium hydride Inorganic materials 0.000 description 1
- NTTOTNSKUYCDAV-UHFFFAOYSA-N potassium hydride Chemical compound [KH] NTTOTNSKUYCDAV-UHFFFAOYSA-N 0.000 description 1
- 235000012015 potatoes Nutrition 0.000 description 1
- MFOUDYKPLGXPGO-UHFFFAOYSA-N propachlor Chemical compound ClCC(=O)N(C(C)C)C1=CC=CC=C1 MFOUDYKPLGXPGO-UHFFFAOYSA-N 0.000 description 1
- LFULEKSKNZEWOE-UHFFFAOYSA-N propanil Chemical compound CCC(=O)NC1=CC=C(Cl)C(Cl)=C1 LFULEKSKNZEWOE-UHFFFAOYSA-N 0.000 description 1
- 125000005767 propoxymethyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])[#8]C([H])([H])* 0.000 description 1
- 108090000623 proteins and genes Proteins 0.000 description 1
- ZLIBICFPKPWGIZ-UHFFFAOYSA-N pyrimethanil Chemical compound CC1=CC(C)=NC(NC=2C=CC=CC=2)=N1 ZLIBICFPKPWGIZ-UHFFFAOYSA-N 0.000 description 1
- BACHBFVBHLGWSL-JTQLQIEISA-N rac-diclofop methyl Natural products C1=CC(O[C@@H](C)C(=O)OC)=CC=C1OC1=CC=C(Cl)C=C1Cl BACHBFVBHLGWSL-JTQLQIEISA-N 0.000 description 1
- 229920005989 resin Polymers 0.000 description 1
- 239000011347 resin Substances 0.000 description 1
- MEFOUWRMVYJCQC-UHFFFAOYSA-N rimsulfuron Chemical compound CCS(=O)(=O)C1=CC=CN=C1S(=O)(=O)NC(=O)NC1=NC(OC)=CC(OC)=N1 MEFOUWRMVYJCQC-UHFFFAOYSA-N 0.000 description 1
- 230000005070 ripening Effects 0.000 description 1
- 201000004700 rosacea Diseases 0.000 description 1
- 229960004029 silicic acid Drugs 0.000 description 1
- 238000009331 sowing Methods 0.000 description 1
- 241000894007 species Species 0.000 description 1
- KDYFGRWQOYBRFD-UHFFFAOYSA-N succinic acid Chemical compound OC(=O)CCC(O)=O KDYFGRWQOYBRFD-UHFFFAOYSA-N 0.000 description 1
- ZDXMLEQEMNLCQG-UHFFFAOYSA-N sulfometuron methyl Chemical group COC(=O)C1=CC=CC=C1S(=O)(=O)NC(=O)NC1=NC(C)=CC(C)=N1 ZDXMLEQEMNLCQG-UHFFFAOYSA-N 0.000 description 1
- 239000011593 sulfur Substances 0.000 description 1
- 239000002600 sunflower oil Substances 0.000 description 1
- 239000002344 surface layer Substances 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- IOGXOCVLYRDXLW-UHFFFAOYSA-N tert-butyl nitrite Chemical compound CC(C)(C)ON=O IOGXOCVLYRDXLW-UHFFFAOYSA-N 0.000 description 1
- 239000012414 tert-butyl nitrite Substances 0.000 description 1
- 238000012360 testing method Methods 0.000 description 1
- HWCKGOZZJDHMNC-UHFFFAOYSA-M tetraethylammonium bromide Chemical group [Br-].CC[N+](CC)(CC)CC HWCKGOZZJDHMNC-UHFFFAOYSA-M 0.000 description 1
- LOQQVLXUKHKNIA-UHFFFAOYSA-N thifensulfuron Chemical compound COC1=NC(C)=NC(NC(=O)NS(=O)(=O)C2=C(SC=C2)C(O)=O)=N1 LOQQVLXUKHKNIA-UHFFFAOYSA-N 0.000 description 1
- 244000082735 tidal marsh flat sedge Species 0.000 description 1
- WBYWAXJHAXSJNI-VOTSOKGWSA-M trans-cinnamate Chemical compound [O-]C(=O)\C=C\C1=CC=CC=C1 WBYWAXJHAXSJNI-VOTSOKGWSA-M 0.000 description 1
- 229910052723 transition metal Inorganic materials 0.000 description 1
- 150000003624 transition metals Chemical class 0.000 description 1
- XOPFESVZMSQIKC-UHFFFAOYSA-N triasulfuron Chemical compound COC1=NC(C)=NC(NC(=O)NS(=O)(=O)C=2C(=CC=CC=2)OCCCl)=N1 XOPFESVZMSQIKC-UHFFFAOYSA-N 0.000 description 1
- YMXOXAPKZDWXLY-QWRGUYRKSA-N tribenuron methyl Chemical group COC(=O)[C@H]1CCCC[C@@H]1S(=O)(=O)NC(=O)N(C)C1=NC(C)=NC(OC)=N1 YMXOXAPKZDWXLY-QWRGUYRKSA-N 0.000 description 1
- REEQLXCGVXDJSQ-UHFFFAOYSA-N trichlopyr Chemical compound OC(=O)COC1=NC(Cl)=C(Cl)C=C1Cl REEQLXCGVXDJSQ-UHFFFAOYSA-N 0.000 description 1
- GGUBFICZYGKNTD-UHFFFAOYSA-N triethyl phosphonoacetate Chemical compound CCOC(=O)CP(=O)(OCC)OCC GGUBFICZYGKNTD-UHFFFAOYSA-N 0.000 description 1
- ITMCEJHCFYSIIV-UHFFFAOYSA-N triflic acid Chemical compound OS(=O)(=O)C(F)(F)F ITMCEJHCFYSIIV-UHFFFAOYSA-N 0.000 description 1
- 125000005951 trifluoromethanesulfonyloxy group Chemical group 0.000 description 1
- IMEVJVISCHQJRM-UHFFFAOYSA-N triflusulfuron-methyl Chemical group COC(=O)C1=CC=CC(C)=C1S(=O)(=O)NC(=O)NC1=NC(OCC(F)(F)F)=NC(N(C)C)=N1 IMEVJVISCHQJRM-UHFFFAOYSA-N 0.000 description 1
- 235000013311 vegetables Nutrition 0.000 description 1
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 1
- 229920002554 vinyl polymer Polymers 0.000 description 1
- 238000010792 warming Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D403/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, not provided for by group C07D401/00
- C07D403/02—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, not provided for by group C07D401/00 containing two hetero rings
- C07D403/04—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, not provided for by group C07D401/00 containing two hetero rings directly linked by a ring-member-to-ring-member bond
-
- A—HUMAN NECESSITIES
- A01—AGRICULTURE; FORESTRY; ANIMAL HUSBANDRY; HUNTING; TRAPPING; FISHING
- A01N—PRESERVATION OF BODIES OF HUMANS OR ANIMALS OR PLANTS OR PARTS THEREOF; BIOCIDES, e.g. AS DISINFECTANTS, AS PESTICIDES OR AS HERBICIDES; PEST REPELLANTS OR ATTRACTANTS; PLANT GROWTH REGULATORS
- A01N43/00—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds
- A01N43/48—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds having rings with two nitrogen atoms as the only ring hetero atoms
- A01N43/58—1,2-Diazines; Hydrogenated 1,2-diazines
-
- A—HUMAN NECESSITIES
- A01—AGRICULTURE; FORESTRY; ANIMAL HUSBANDRY; HUNTING; TRAPPING; FISHING
- A01N—PRESERVATION OF BODIES OF HUMANS OR ANIMALS OR PLANTS OR PARTS THEREOF; BIOCIDES, e.g. AS DISINFECTANTS, AS PESTICIDES OR AS HERBICIDES; PEST REPELLANTS OR ATTRACTANTS; PLANT GROWTH REGULATORS
- A01N43/00—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds
- A01N43/72—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds having rings with nitrogen atoms and oxygen or sulfur atoms as ring hetero atoms
- A01N43/84—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds having rings with nitrogen atoms and oxygen or sulfur atoms as ring hetero atoms six-membered rings with one nitrogen atom and either one oxygen atom or one sulfur atom in positions 1,4
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C251/00—Compounds containing nitrogen atoms doubly-bound to a carbon skeleton
- C07C251/72—Hydrazones
- C07C251/74—Hydrazones having doubly-bound carbon atoms of hydrazone groups bound to hydrogen atoms or to acyclic carbon atoms
- C07C251/76—Hydrazones having doubly-bound carbon atoms of hydrazone groups bound to hydrogen atoms or to acyclic carbon atoms to carbon atoms of a saturated carbon skeleton
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D237/00—Heterocyclic compounds containing 1,2-diazine or hydrogenated 1,2-diazine rings
- C07D237/02—Heterocyclic compounds containing 1,2-diazine or hydrogenated 1,2-diazine rings not condensed with other rings
- C07D237/06—Heterocyclic compounds containing 1,2-diazine or hydrogenated 1,2-diazine rings not condensed with other rings having three double bonds between ring members or between ring members and non-ring members
- C07D237/10—Heterocyclic compounds containing 1,2-diazine or hydrogenated 1,2-diazine rings not condensed with other rings having three double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D237/14—Oxygen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D405/00—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom
- C07D405/02—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom containing two hetero rings
- C07D405/04—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom containing two hetero rings directly linked by a ring-member-to-ring-member bond
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D413/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and oxygen atoms as the only ring hetero atoms
- C07D413/02—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and oxygen atoms as the only ring hetero atoms containing two hetero rings
- C07D413/04—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and oxygen atoms as the only ring hetero atoms containing two hetero rings directly linked by a ring-member-to-ring-member bond
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D417/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for by group C07D415/00
- C07D417/02—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for by group C07D415/00 containing two hetero rings
- C07D417/04—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for by group C07D415/00 containing two hetero rings directly linked by a ring-member-to-ring-member bond
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Life Sciences & Earth Sciences (AREA)
- Agronomy & Crop Science (AREA)
- Pest Control & Pesticides (AREA)
- Plant Pathology (AREA)
- Health & Medical Sciences (AREA)
- Engineering & Computer Science (AREA)
- Dentistry (AREA)
- General Health & Medical Sciences (AREA)
- Wood Science & Technology (AREA)
- Zoology (AREA)
- Environmental Sciences (AREA)
- Plural Heterocyclic Compounds (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
Applications Claiming Priority (4)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP23609895 | 1995-08-21 | ||
| JP6023296 | 1996-02-21 | ||
| JP10461896 | 1996-04-01 | ||
| PCT/JP1996/002311 WO1997007104A1 (en) | 1995-08-21 | 1996-08-19 | Pyridazin-3-one derivatives, their use, and intermediates for their production |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| EA199800219A1 EA199800219A1 (ru) | 1998-10-29 |
| EA000868B1 true EA000868B1 (ru) | 2000-06-26 |
Family
ID=27297120
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| EA199800219A EA000868B1 (ru) | 1995-08-21 | 1996-08-19 | Производные пиридазин-3-она, их использование в качестве гербицидов и промежуточные соединения для их получения |
Country Status (26)
| Country | Link |
|---|---|
| US (4) | US6090753A (enExample) |
| EP (1) | EP0850227B1 (enExample) |
| KR (1) | KR100510028B1 (enExample) |
| CN (2) | CN1252066C (enExample) |
| AR (1) | AR003325A1 (enExample) |
| AT (1) | ATE383344T1 (enExample) |
| BG (1) | BG102326A (enExample) |
| BR (1) | BR9609908A (enExample) |
| CA (1) | CA2230199C (enExample) |
| CO (1) | CO4750760A1 (enExample) |
| CZ (1) | CZ25698A3 (enExample) |
| DE (1) | DE69637405T2 (enExample) |
| EA (1) | EA000868B1 (enExample) |
| ES (1) | ES2300107T3 (enExample) |
| HU (1) | HUP9802304A3 (enExample) |
| IL (1) | IL123162A (enExample) |
| MX (1) | MX9801353A (enExample) |
| NO (1) | NO980720L (enExample) |
| NZ (1) | NZ315400A (enExample) |
| PL (1) | PL325062A1 (enExample) |
| RO (1) | RO117915B1 (enExample) |
| SK (1) | SK22198A3 (enExample) |
| TR (2) | TR200102127T2 (enExample) |
| TW (1) | TW332202B (enExample) |
| UA (1) | UA49844C2 (enExample) |
| WO (1) | WO1997007104A1 (enExample) |
Families Citing this family (35)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE19520613A1 (de) * | 1995-06-06 | 1996-12-12 | Bayer Ag | Phenylpyridazinone |
| AR009380A1 (es) * | 1996-10-21 | 2000-04-12 | Sumitomo Chemical Co | Proceso de preparacion de un derivado de piridazin-3-ona, util como herbicida, acido carboxilico de utilizacion en el mismo, sal de este ultimo y proceso para preparar dicho acido carboxilico |
| JP4788698B2 (ja) * | 1996-10-21 | 2011-10-05 | 住友化学株式会社 | カルボン酸誘導体、その製造法及びそれを用いるピリダジン−3−オン誘導体の製造法 |
| ZA978995B (en) * | 1996-10-21 | 1998-08-25 | Sumitomo Chemical Co | Production of pyridazine herbicide |
| EP0967873A1 (en) * | 1997-02-17 | 2000-01-05 | Sumitomo Chemical Company Limited | Herbicidal composition |
| US6121194A (en) * | 1997-02-17 | 2000-09-19 | Sumitomo Chemical Company, Limited | Herbicidal composition |
| CN1165234C (zh) * | 1997-02-17 | 2004-09-08 | 住友化学工业株式会社 | 除草组合物 |
| EP0967872A1 (en) * | 1997-02-17 | 2000-01-05 | Sumitomo Chemical Company Limited | Herbicidal composition |
| US6147030A (en) * | 1997-02-18 | 2000-11-14 | Sumitomo Chemical Company, Limited | Herbicidal composition |
| IL123339A0 (en) * | 1997-02-19 | 1998-09-24 | Sumitomo Chemical Co | Pyridazin-3-one derivatives and their use |
| IL123340A0 (en) * | 1997-02-20 | 1998-09-24 | Sumitomo Chemical Co | Pyridazin-3-one derivatives and their use |
| IL135045A0 (en) | 1997-09-17 | 2001-05-20 | Basf Ag | Substituted 2-phenyl-3(2h)-pyridazinones |
| CN1680274A (zh) | 1997-10-27 | 2005-10-12 | Isk美国有限公司 | 取代的苯化合物、它们的制备方法和含它们的除草剂和脱叶剂组合物 |
| JP4211081B2 (ja) * | 1998-03-19 | 2009-01-21 | 住友化学株式会社 | 4−シアノピリダジン−3−オン誘導体 |
| US6187920B1 (en) | 1998-03-26 | 2001-02-13 | Sumitomo Chemical Co., Ltd. | Pyridazinone derivatives |
| KR20010042411A (ko) * | 1998-04-09 | 2001-05-25 | 빌프리더 하이더 | 치환된 페닐 피리다지논 |
| EP0963978A1 (en) * | 1998-06-11 | 1999-12-15 | Sumitomo Chemical Company, Limited | 6-Alkoxycarbonylpyridazin-3-one compounds and their use as intermediates in the preparation of pyridazin-3-one herbicides |
| JP4154760B2 (ja) * | 1998-08-05 | 2008-09-24 | 住友化学株式会社 | 除草剤組成物 |
| JP2000063215A (ja) * | 1998-08-12 | 2000-02-29 | Sumitomo Chem Co Ltd | 除草剤組成物 |
| JP2000063216A (ja) * | 1998-08-12 | 2000-02-29 | Sumitomo Chem Co Ltd | 除草剤組成物 |
| JP4200559B2 (ja) | 1998-10-23 | 2008-12-24 | 住友化学株式会社 | 除草剤組成物 |
| DE19937500A1 (de) * | 1999-08-09 | 2001-02-15 | Bayer Ag | Substituierte Heterocyclylbenzofurane |
| AU2001262197A1 (en) * | 2000-04-14 | 2001-10-30 | Basf Aktiengesellschaft | 2-phenyl-2h-pyridazine-3-ones |
| EP1272475A1 (de) * | 2000-04-14 | 2003-01-08 | Basf Aktiengesellschaft | 2-phenyl-2h-pyridazin-3-one |
| EP2052612A1 (de) | 2007-10-24 | 2009-04-29 | Bayer CropScience AG | Herbizid-Kombination |
| DE102008037629A1 (de) | 2008-08-14 | 2010-02-18 | Bayer Cropscience Ag | Herbizid-Kombination mit Dimethoxytriazinyl-substituierten Difluormethansulfonylaniliden |
| CN104447385A (zh) | 2009-06-19 | 2015-03-25 | 巴斯夫欧洲公司 | 除草的苯并噁嗪酮类 |
| FR2949643B1 (fr) * | 2009-09-08 | 2012-09-28 | Fonds De Dev Des Filieres Des Oleagineux Et Proteagineux Fidop | Utilisation d'ethers de glycerol comme activateurs des effets herbicides d'une substance herbicide |
| US8669208B2 (en) | 2010-10-01 | 2014-03-11 | Basf Se | Herbicidal benzoxazinones |
| WO2012080239A1 (en) | 2010-12-15 | 2012-06-21 | Basf Se | Herbicidal compositions |
| EP3281524A1 (en) | 2016-08-09 | 2018-02-14 | Basf Se | Method for controlling ppo resistant weeds |
| TWI785022B (zh) * | 2017-03-28 | 2022-12-01 | 美商富曼西公司 | 新穎噠嗪酮類除草劑 |
| AU2018373436C1 (en) | 2017-11-23 | 2023-10-19 | Basf Se | Herbicidal pyridylethers |
| CN110050794A (zh) * | 2019-04-29 | 2019-07-26 | 广西化工研究院有限公司 | 一种除草剂组合物及其制备方法和应用 |
| CN118235774A (zh) * | 2024-02-20 | 2024-06-25 | 河南省农业科学院植物保护研究所 | 一种含异丙隆的用于防除芝麻田杂草的除草剂 |
Family Cites Families (13)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE29123C (de) | FARBWERKE VORM. Meister, Lucius & Brüning in Höchst a. M | Verfahren zur Darstellung alkylirter Hydroderivate der Oxymethylchinoline und deren Methyl- resp. Aetbyläther | ||
| CH373919A (de) * | 1959-02-02 | 1963-12-15 | Ciba Geigy | Verfahren zum Bekämpfen von Unkräutern |
| NL288407A (enExample) * | 1960-09-09 | |||
| US3641098A (en) * | 1967-09-26 | 1972-02-08 | Bayer Ag | Cyano substituted phenylhydrazones of 1 2-dicarbonyl compounds |
| DE2706700A1 (de) * | 1977-02-17 | 1978-08-24 | Consortium Elektrochem Ind | Verfahren zur herstellung von pyridazin-3-on-verbindungen, neue pyridazin-3-one und deren verwendung |
| DE2808193A1 (de) * | 1978-02-25 | 1979-09-06 | Basf Ag | Pyridazon-verbindungen |
| DE3013267A1 (de) * | 1980-04-05 | 1981-10-15 | Basf Ag, 6700 Ludwigshafen | Substituierte pyridazone, verfahren zu ihrer herstellung, diese enthaltende herbizide und ihre anwendung als herbizide |
| IL61273A (en) * | 1979-10-24 | 1984-02-29 | Basf Ag | Preparation of anilines and certain novel anilines |
| DE4343528A1 (de) * | 1993-12-16 | 1995-06-22 | Schering Ag | Zweifach heterocyclisch substituierte Benzole und Pyridine, Verfahren zu ihrer Herstellung und ihre Verwendung als Schädlingsbekämpfungsmittel |
| DE19520613A1 (de) * | 1995-06-06 | 1996-12-12 | Bayer Ag | Phenylpyridazinone |
| AR009380A1 (es) * | 1996-10-21 | 2000-04-12 | Sumitomo Chemical Co | Proceso de preparacion de un derivado de piridazin-3-ona, util como herbicida, acido carboxilico de utilizacion en el mismo, sal de este ultimo y proceso para preparar dicho acido carboxilico |
| DE19754348A1 (de) * | 1996-12-11 | 1998-06-18 | Ciba Geigy Ag | Neue Herbizide |
| US6294503B1 (en) * | 1998-12-03 | 2001-09-25 | Ishihara Sangyo Kaisha, Ltd. | Fused heterocycle compounds, process for their preparation, and herbicidal compositions containing them |
-
1996
- 1996-08-19 TR TR2001/02127T patent/TR200102127T2/xx unknown
- 1996-08-19 WO PCT/JP1996/002311 patent/WO1997007104A1/en not_active Ceased
- 1996-08-19 CZ CZ98256A patent/CZ25698A3/cs unknown
- 1996-08-19 CN CNB031425011A patent/CN1252066C/zh not_active Expired - Lifetime
- 1996-08-19 KR KR10-1998-0701256A patent/KR100510028B1/ko not_active Expired - Fee Related
- 1996-08-19 US US09/011,269 patent/US6090753A/en not_active Expired - Lifetime
- 1996-08-19 PL PL96325062A patent/PL325062A1/xx unknown
- 1996-08-19 UA UA98031420A patent/UA49844C2/uk unknown
- 1996-08-19 BR BR9609908A patent/BR9609908A/pt not_active IP Right Cessation
- 1996-08-19 CA CA002230199A patent/CA2230199C/en not_active Expired - Lifetime
- 1996-08-19 NZ NZ315400A patent/NZ315400A/xx unknown
- 1996-08-19 TR TR1998/00290T patent/TR199800290T2/xx unknown
- 1996-08-19 ES ES96927192T patent/ES2300107T3/es not_active Expired - Lifetime
- 1996-08-19 DE DE69637405T patent/DE69637405T2/de not_active Expired - Lifetime
- 1996-08-19 RO RO98-00298A patent/RO117915B1/ro unknown
- 1996-08-19 IL IL12316296A patent/IL123162A/xx not_active IP Right Cessation
- 1996-08-19 EP EP96927192A patent/EP0850227B1/en not_active Expired - Lifetime
- 1996-08-19 AT AT96927192T patent/ATE383344T1/de not_active IP Right Cessation
- 1996-08-19 CN CN96197700A patent/CN1117083C/zh not_active Expired - Lifetime
- 1996-08-19 SK SK221-98A patent/SK22198A3/sk unknown
- 1996-08-19 HU HU9802304A patent/HUP9802304A3/hu unknown
- 1996-08-19 EA EA199800219A patent/EA000868B1/ru not_active IP Right Cessation
- 1996-08-20 TW TW085110140A patent/TW332202B/zh not_active IP Right Cessation
- 1996-08-21 AR ARP960104072A patent/AR003325A1/es active IP Right Grant
- 1996-08-21 CO CO96044163A patent/CO4750760A1/es unknown
-
1998
- 1998-02-18 MX MX9801353A patent/MX9801353A/es unknown
- 1998-02-20 NO NO980720A patent/NO980720L/no not_active Application Discontinuation
- 1998-03-13 BG BG102326A patent/BG102326A/bg unknown
-
2000
- 2000-03-07 US US09/521,200 patent/US6348628B1/en not_active Expired - Lifetime
-
2002
- 2002-01-07 US US10/036,528 patent/US6482773B1/en not_active Expired - Fee Related
- 2002-10-03 US US10/263,168 patent/US6703503B2/en not_active Expired - Fee Related
Also Published As
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US6348628B1 (en) | Pyridazin-3-one derivatives, their use, and intermediates for their production | |
| TW508354B (en) | Dithiolan derivatives | |
| CZ288498B6 (en) | N-substituted, 2-phenyl, 2-piperazinylalkyl- or 2-piperidinylalkyloxazolidine and thiazolidine derivatives exhibiting antagonistic activity against tachykinin receptor, their preparation and use | |
| US7294625B2 (en) | Pyrazole compounds | |
| US20070031514A1 (en) | Use of isoindolinone derivatives as insecticides | |
| US20170096402A1 (en) | 5-(hetero)arylpyridazinones and their use as herbicides | |
| US20050032858A1 (en) | Novel heterocyclic compound and anti-inflamatory agent | |
| JPH11269170A (ja) | ジチオラン誘導体 | |
| TW200409757A (en) | 1-aralkyl-N-(3-quinolyl)-1-cyclohexancarboxamide derivatives | |
| US6242634B1 (en) | Pyrimidin-4-one derivatives, their use, intermediates for their production, and processes for producing these intermediates | |
| US6869913B1 (en) | Pyridazin-3-one derivatives, their use and intermediates for their production | |
| US5616579A (en) | Anti-ulcer pyridyloxy derivatives, their preparation and uses | |
| JP2004256525A (ja) | N−[1−置換−2−(アリールアミノ)エチル]アミド誘導体 | |
| EP3145918B1 (de) | 2-(hetero)aryl-pyridazinone und ihre verwendung als herbizide | |
| AU2024265331A1 (en) | 1,4-cineole derivative and intermediate thereof, herbicide containing said derivative as active ingredient, method for using herbicide, and method for preparing agrochemical composition | |
| JP2002128762A (ja) | 新規フェナントリジノン誘導体 |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MM4A | Lapse of a eurasian patent due to non-payment of renewal fees within the time limit in the following designated state(s) |
Designated state(s): AM AZ BY KZ KG MD TJ TM |
|
| MM4A | Lapse of a eurasian patent due to non-payment of renewal fees within the time limit in the following designated state(s) |
Designated state(s): RU |