DK168073B1 - Analogifremgangsmaade til fremstilling af imidazodiazepiner eller farmaceutisk acceptable syreadditionssalte deraf - Google Patents
Analogifremgangsmaade til fremstilling af imidazodiazepiner eller farmaceutisk acceptable syreadditionssalte deraf Download PDFInfo
- Publication number
- DK168073B1 DK168073B1 DK074282A DK74282A DK168073B1 DK 168073 B1 DK168073 B1 DK 168073B1 DK 074282 A DK074282 A DK 074282A DK 74282 A DK74282 A DK 74282A DK 168073 B1 DK168073 B1 DK 168073B1
- Authority
- DK
- Denmark
- Prior art keywords
- tert
- halogen
- group
- butyl
- hydrogen
- Prior art date
Links
- 150000001875 compounds Chemical class 0.000 claims description 85
- 238000000034 method Methods 0.000 claims description 46
- 229910052739 hydrogen Inorganic materials 0.000 claims description 42
- 239000001257 hydrogen Substances 0.000 claims description 42
- -1 dimethylene, trimethylene Chemical group 0.000 claims description 41
- 125000000217 alkyl group Chemical group 0.000 claims description 37
- 229910052736 halogen Inorganic materials 0.000 claims description 36
- 150000002367 halogens Chemical class 0.000 claims description 36
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 34
- 150000002431 hydrogen Chemical class 0.000 claims description 32
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 31
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 26
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 23
- 150000003839 salts Chemical class 0.000 claims description 22
- CFCNTIFLYGKEIO-UHFFFAOYSA-N 2-isocyanoacetic acid Chemical compound OC(=O)C[N+]#[C-] CFCNTIFLYGKEIO-UHFFFAOYSA-N 0.000 claims description 21
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 claims description 21
- 125000004414 alkyl thio group Chemical group 0.000 claims description 17
- 239000002253 acid Substances 0.000 claims description 16
- 125000004644 alkyl sulfinyl group Chemical group 0.000 claims description 15
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 claims description 15
- 125000003277 amino group Chemical group 0.000 claims description 14
- DCKVNWZUADLDEH-UHFFFAOYSA-N sec-butyl acetate Chemical compound CCC(C)OC(C)=O DCKVNWZUADLDEH-UHFFFAOYSA-N 0.000 claims description 14
- CEHKKWWXELBNPS-UHFFFAOYSA-N 1,4-benzodiazepine-1-carboxylic acid Chemical compound OC(=O)N1C=CN=CC2=CC=CC=C12 CEHKKWWXELBNPS-UHFFFAOYSA-N 0.000 claims description 13
- OFWFBJVJXBLXOP-UHFFFAOYSA-N 9h-pyrrolo[2,1-c][1,4]benzodiazepine-7-carboxylic acid Chemical compound C1=C2C=CC=CC2=NC=C2C(C(=O)O)=CCN21 OFWFBJVJXBLXOP-UHFFFAOYSA-N 0.000 claims description 11
- 229910052799 carbon Inorganic materials 0.000 claims description 11
- 150000001721 carbon Chemical group 0.000 claims description 11
- 150000001732 carboxylic acid derivatives Chemical class 0.000 claims description 11
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 10
- 125000004390 alkyl sulfonyl group Chemical group 0.000 claims description 10
- 125000005843 halogen group Chemical group 0.000 claims description 10
- 238000002360 preparation method Methods 0.000 claims description 10
- 125000006410 propenylene group Chemical group 0.000 claims description 7
- 125000003545 alkoxy group Chemical group 0.000 claims description 6
- CFMIOXCGQIHWJP-UHFFFAOYSA-N 1,2-benzodiazepine-1-carboxylic acid Chemical compound OC(=O)N1N=CC=CC2=CC=CC=C12 CFMIOXCGQIHWJP-UHFFFAOYSA-N 0.000 claims description 5
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 5
- 125000003258 trimethylene group Chemical group [H]C([H])([*:2])C([H])([H])C([H])([H])[*:1] 0.000 claims description 5
- GXGJIOMUZAGVEH-UHFFFAOYSA-N Chamazulene Chemical group CCC1=CC=C(C)C2=CC=C(C)C2=C1 GXGJIOMUZAGVEH-UHFFFAOYSA-N 0.000 claims description 3
- 125000004432 carbon atom Chemical group C* 0.000 claims description 3
- 230000002140 halogenating effect Effects 0.000 claims description 3
- BMGXAZCDDYTVFV-UHFFFAOYSA-N imidazo[4,5-c]diazepine Chemical class C1=CN=NC2=NC=NC2=C1 BMGXAZCDDYTVFV-UHFFFAOYSA-N 0.000 claims description 3
- XCYBPTQUEVZPFJ-ZDUSSCGKSA-N tert.butyl (s)-11,12,13,13a-tetrahydro-8-iodo-9-oxo-9h-imidazo[1,5-a]pyrrolo[2,1-c] [1,4]benzodiazepine-1-carboxylate Chemical compound O=C1C2=C(I)C=CC=C2N2C=NC(C(=O)OC(C)(C)C)=C2[C@@H]2CCCN21 XCYBPTQUEVZPFJ-ZDUSSCGKSA-N 0.000 claims description 3
- 101150042514 B1 gene Proteins 0.000 claims 1
- 125000000118 dimethyl group Chemical group [H]C([H])([H])* 0.000 claims 1
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 180
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 123
- 239000000243 solution Substances 0.000 description 92
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Chemical compound O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 79
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 72
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 64
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 60
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 58
- 150000002148 esters Chemical class 0.000 description 58
- 239000000052 vinegar Substances 0.000 description 57
- 235000021419 vinegar Nutrition 0.000 description 57
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 39
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 37
- 239000000203 mixture Substances 0.000 description 35
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 33
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 32
- 235000019341 magnesium sulphate Nutrition 0.000 description 32
- 238000003756 stirring Methods 0.000 description 30
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 29
- 239000011541 reaction mixture Substances 0.000 description 29
- 229960000583 acetic acid Drugs 0.000 description 28
- 239000000741 silica gel Substances 0.000 description 27
- 229910002027 silica gel Inorganic materials 0.000 description 27
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 26
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 25
- 238000001953 recrystallisation Methods 0.000 description 25
- 229910000104 sodium hydride Inorganic materials 0.000 description 25
- 239000012312 sodium hydride Substances 0.000 description 25
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 24
- 239000012043 crude product Substances 0.000 description 24
- 239000012362 glacial acetic acid Substances 0.000 description 24
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 23
- 235000011089 carbon dioxide Nutrition 0.000 description 22
- 229910052700 potassium Inorganic materials 0.000 description 22
- 239000011591 potassium Substances 0.000 description 22
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 21
- 239000004533 oil dispersion Substances 0.000 description 21
- 239000000284 extract Substances 0.000 description 20
- LGTLXDJOAJDFLR-UHFFFAOYSA-N diethyl chlorophosphate Chemical compound CCOP(Cl)(=O)OCC LGTLXDJOAJDFLR-UHFFFAOYSA-N 0.000 description 19
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 18
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 18
- BMTAFVWTTFSTOG-UHFFFAOYSA-N Butylate Chemical compound CCSC(=O)N(CC(C)C)CC(C)C BMTAFVWTTFSTOG-UHFFFAOYSA-N 0.000 description 15
- 239000000725 suspension Substances 0.000 description 14
- 238000009835 boiling Methods 0.000 description 13
- 239000002904 solvent Substances 0.000 description 13
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 12
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 12
- 238000001914 filtration Methods 0.000 description 12
- 238000006243 chemical reaction Methods 0.000 description 11
- ONIBWKKTOPOVIA-BYPYZUCNSA-N L-Proline Chemical compound OC(=O)[C@@H]1CCCN1 ONIBWKKTOPOVIA-BYPYZUCNSA-N 0.000 description 10
- 238000002844 melting Methods 0.000 description 10
- 230000008018 melting Effects 0.000 description 10
- 229930182821 L-proline Natural products 0.000 description 9
- 238000001816 cooling Methods 0.000 description 9
- 238000002425 crystallisation Methods 0.000 description 9
- 230000008025 crystallization Effects 0.000 description 9
- 229960002429 proline Drugs 0.000 description 9
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 9
- 239000002585 base Substances 0.000 description 8
- 238000002474 experimental method Methods 0.000 description 8
- 239000000463 material Substances 0.000 description 8
- 239000003921 oil Substances 0.000 description 8
- 235000019198 oils Nutrition 0.000 description 8
- 241000700159 Rattus Species 0.000 description 7
- 238000004587 chromatography analysis Methods 0.000 description 7
- 238000010992 reflux Methods 0.000 description 7
- 235000012976 tarts Nutrition 0.000 description 7
- NHQDETIJWKXCTC-UHFFFAOYSA-N 3-chloroperbenzoic acid Chemical compound OOC(=O)C1=CC=CC(Cl)=C1 NHQDETIJWKXCTC-UHFFFAOYSA-N 0.000 description 6
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 6
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 6
- 150000008064 anhydrides Chemical class 0.000 description 6
- PFKFTWBEEFSNDU-UHFFFAOYSA-N carbonyldiimidazole Chemical compound C1=CN=CN1C(=O)N1C=CN=C1 PFKFTWBEEFSNDU-UHFFFAOYSA-N 0.000 description 6
- 239000000969 carrier Substances 0.000 description 6
- 239000012954 diazonium Substances 0.000 description 6
- 230000035939 shock Effects 0.000 description 6
- 238000012360 testing method Methods 0.000 description 6
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 5
- RAXXELZNTBOGNW-UHFFFAOYSA-N 1H-imidazole Chemical compound C1=CNC=N1 RAXXELZNTBOGNW-UHFFFAOYSA-N 0.000 description 5
- 241001465754 Metazoa Species 0.000 description 5
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical class [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 5
- 239000000460 chlorine Substances 0.000 description 5
- 238000000354 decomposition reaction Methods 0.000 description 5
- 150000001989 diazonium salts Chemical class 0.000 description 5
- 239000003960 organic solvent Substances 0.000 description 5
- LPNYRYFBWFDTMA-UHFFFAOYSA-N potassium tert-butoxide Chemical compound [K+].CC(C)(C)[O-] LPNYRYFBWFDTMA-UHFFFAOYSA-N 0.000 description 5
- IADUEWIQBXOCDZ-VKHMYHEASA-N (S)-azetidine-2-carboxylic acid Chemical compound OC(=O)[C@@H]1CCN1 IADUEWIQBXOCDZ-VKHMYHEASA-N 0.000 description 4
- WSLDOOZREJYCGB-UHFFFAOYSA-N 1,2-Dichloroethane Chemical compound ClCCCl WSLDOOZREJYCGB-UHFFFAOYSA-N 0.000 description 4
- WXBBGXSCFXZZSI-UHFFFAOYSA-N 1h-imidazo[1,5-a][1,4]benzodiazepine-1-carboxylic acid Chemical compound N1=CC2=CC=CC=C2N2C(C(=O)O)N=CC2=C1 WXBBGXSCFXZZSI-UHFFFAOYSA-N 0.000 description 4
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 4
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 description 4
- PCLIMKBDDGJMGD-UHFFFAOYSA-N N-bromosuccinimide Chemical compound BrN1C(=O)CCC1=O PCLIMKBDDGJMGD-UHFFFAOYSA-N 0.000 description 4
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 4
- KFSLWBXXFJQRDL-UHFFFAOYSA-N Peracetic acid Chemical compound CC(=O)OO KFSLWBXXFJQRDL-UHFFFAOYSA-N 0.000 description 4
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 4
- DKGAVHZHDRPRBM-UHFFFAOYSA-N Tert-Butanol Chemical compound CC(C)(C)O DKGAVHZHDRPRBM-UHFFFAOYSA-N 0.000 description 4
- DTQVDTLACAAQTR-UHFFFAOYSA-N Trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 description 4
- 230000000949 anxiolytic effect Effects 0.000 description 4
- 235000019439 ethyl acetate Nutrition 0.000 description 4
- 239000007903 gelatin capsule Substances 0.000 description 4
- 150000008282 halocarbons Chemical class 0.000 description 4
- JXDYKVIHCLTXOP-UHFFFAOYSA-N isatin Chemical compound C1=CC=C2C(=O)C(=O)NC2=C1 JXDYKVIHCLTXOP-UHFFFAOYSA-N 0.000 description 4
- 125000002816 methylsulfanyl group Chemical group [H]C([H])([H])S[*] 0.000 description 4
- 239000007800 oxidant agent Substances 0.000 description 4
- 239000006187 pill Substances 0.000 description 4
- 229920005862 polyol Polymers 0.000 description 4
- 150000003077 polyols Chemical class 0.000 description 4
- LPXPTNMVRIOKMN-UHFFFAOYSA-M sodium nitrite Chemical compound [Na+].[O-]N=O LPXPTNMVRIOKMN-UHFFFAOYSA-M 0.000 description 4
- YSTHGGNWDJGAIK-VIFPVBQESA-N (6as)-1-chloro-6a,7,8,9-tetrahydro-5h-pyrrolo[2,1-c][1,4]benzodiazepine-6,11-dione Chemical compound N1C(=O)[C@@H]2CCCN2C(=O)C2=C1C=CC=C2Cl YSTHGGNWDJGAIK-VIFPVBQESA-N 0.000 description 3
- SWUGYKGLXFMLEN-UHFFFAOYSA-N 4-chloro-5-fluoro-1h-indole-2,3-dione Chemical compound FC1=CC=C2NC(=O)C(=O)C2=C1Cl SWUGYKGLXFMLEN-UHFFFAOYSA-N 0.000 description 3
- CKFAWBMSCAGKKE-UHFFFAOYSA-N 4-ethyl-1h-indole-2,3-dione Chemical compound CCC1=CC=CC2=C1C(=O)C(=O)N2 CKFAWBMSCAGKKE-UHFFFAOYSA-N 0.000 description 3
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 3
- QMMFVYPAHWMCMS-UHFFFAOYSA-N Dimethyl sulfide Chemical compound CSC QMMFVYPAHWMCMS-UHFFFAOYSA-N 0.000 description 3
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 description 3
- LSDPWZHWYPCBBB-UHFFFAOYSA-N Methanethiol Chemical compound SC LSDPWZHWYPCBBB-UHFFFAOYSA-N 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- 150000001450 anions Chemical class 0.000 description 3
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 3
- 229910052794 bromium Inorganic materials 0.000 description 3
- 150000001735 carboxylic acids Chemical class 0.000 description 3
- 239000003480 eluent Substances 0.000 description 3
- 150000002170 ethers Chemical class 0.000 description 3
- 238000010438 heat treatment Methods 0.000 description 3
- 239000005457 ice water Substances 0.000 description 3
- 229910052740 iodine Inorganic materials 0.000 description 3
- 239000007788 liquid Substances 0.000 description 3
- 239000000155 melt Substances 0.000 description 3
- 239000008188 pellet Substances 0.000 description 3
- 239000008194 pharmaceutical composition Substances 0.000 description 3
- 239000000047 product Substances 0.000 description 3
- 239000007858 starting material Substances 0.000 description 3
- 239000000126 substance Substances 0.000 description 3
- IADUEWIQBXOCDZ-UHFFFAOYSA-N (2S)-azetidine-2-carboxylic acid Natural products OC(=O)C1CCN1 IADUEWIQBXOCDZ-UHFFFAOYSA-N 0.000 description 2
- KWWNJLCCHNFMHQ-VIFPVBQESA-N (6S)-13-methyl-3,8-diazatricyclo[7.4.0.03,6]trideca-1(13),9,11-triene-2,7-dione Chemical compound N1C(=O)[C@@H]2CCN2C(=O)C2=C1C=CC=C2C KWWNJLCCHNFMHQ-VIFPVBQESA-N 0.000 description 2
- XUZFRZRFPRPIOS-NSHDSACASA-N (6as)-1-ethyl-6a,7,8,9-tetrahydro-5h-pyrrolo[2,1-c][1,4]benzodiazepine-6,11-dione Chemical compound N1C(=O)[C@@H]2CCCN2C(=O)C2=C1C=CC=C2CC XUZFRZRFPRPIOS-NSHDSACASA-N 0.000 description 2
- KAQVRMZUIMXCGF-VIFPVBQESA-N (6as)-1-iodo-6a,7,8,9-tetrahydro-5h-pyrrolo[2,1-c][1,4]benzodiazepine-6,11-dione Chemical compound N1C(=O)[C@@H]2CCCN2C(=O)C2=C1C=CC=C2I KAQVRMZUIMXCGF-VIFPVBQESA-N 0.000 description 2
- YTAIRMPRSJBCEZ-VIFPVBQESA-N (6as)-1-methoxy-6a,7,8,9-tetrahydro-5h-pyrrolo[2,1-c][1,4]benzodiazepine-6,11-dione Chemical compound N1C(=O)[C@@H]2CCCN2C(=O)C2=C1C=CC=C2OC YTAIRMPRSJBCEZ-VIFPVBQESA-N 0.000 description 2
- DKTYBWNZGMFDNC-JTQLQIEISA-N (6as)-1-methyl-6a,7,8,9-tetrahydro-5h-pyrrolo[2,1-c][1,4]benzodiazepine-6,11-dione Chemical compound N1C(=O)[C@@H]2CCCN2C(=O)C2=C1C=CC=C2C DKTYBWNZGMFDNC-JTQLQIEISA-N 0.000 description 2
- QHTTXSWWWSYDRY-UHFFFAOYSA-N 1h-thieno[3,2-d][1,3]oxazine-2,4-dione Chemical compound O=C1OC(=O)NC2=C1SC=C2 QHTTXSWWWSYDRY-UHFFFAOYSA-N 0.000 description 2
- KJJOMFXEFVEHPM-UHFFFAOYSA-N 3,9,13-triazatricyclo[8.4.0.03,7]tetradeca-1,5,7,9,11,13-hexaene-14-carboxylic acid Chemical compound C1C=CC2=CN=C3C=CN=C(C3=CN21)C(=O)O KJJOMFXEFVEHPM-UHFFFAOYSA-N 0.000 description 2
- XNELKMJTOVPAGQ-UHFFFAOYSA-N 3,9,14-triazatricyclo[8.4.0.03,7]tetradeca-1,4,6,8,10,12-hexaene-14-carboxylic acid Chemical compound C1=CN2C=C3C(=CC=CN3C(=O)O)N=CC2=C1 XNELKMJTOVPAGQ-UHFFFAOYSA-N 0.000 description 2
- YNJSNEKCXVFDKW-UHFFFAOYSA-N 3-(5-amino-1h-indol-3-yl)-2-azaniumylpropanoate Chemical compound C1=C(N)C=C2C(CC(N)C(O)=O)=CNC2=C1 YNJSNEKCXVFDKW-UHFFFAOYSA-N 0.000 description 2
- VHYFNPMBLIVWCW-UHFFFAOYSA-N 4-Dimethylaminopyridine Chemical compound CN(C)C1=CC=NC=C1 VHYFNPMBLIVWCW-UHFFFAOYSA-N 0.000 description 2
- AUKJOJKTRNIEAX-UHFFFAOYSA-N 5-chloro-6-fluoro-1h-3,1-benzoxazine-2,4-dione Chemical compound N1C(=O)OC(=O)C2=C(Cl)C(F)=CC=C21 AUKJOJKTRNIEAX-UHFFFAOYSA-N 0.000 description 2
- KYMCWXDAAGSYJE-UHFFFAOYSA-N 5-ethyl-1h-3,1-benzoxazine-2,4-dione Chemical compound N1C(=O)OC(=O)C2=C1C=CC=C2CC KYMCWXDAAGSYJE-UHFFFAOYSA-N 0.000 description 2
- 208000019901 Anxiety disease Diseases 0.000 description 2
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 2
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 2
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 2
- YNAVUWVOSKDBBP-UHFFFAOYSA-N Morpholine Chemical compound C1COCCN1 YNAVUWVOSKDBBP-UHFFFAOYSA-N 0.000 description 2
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 2
- JRNVZBWKYDBUCA-UHFFFAOYSA-N N-chlorosuccinimide Chemical compound ClN1C(=O)CCC1=O JRNVZBWKYDBUCA-UHFFFAOYSA-N 0.000 description 2
- JDZJPDNJPWRXGE-UHFFFAOYSA-N O1CCN(CC1)[ClH]P(=O)[ClH]N1CCOCC1 Chemical compound O1CCN(CC1)[ClH]P(=O)[ClH]N1CCOCC1 JDZJPDNJPWRXGE-UHFFFAOYSA-N 0.000 description 2
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical class [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 2
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 2
- 229910052783 alkali metal Inorganic materials 0.000 description 2
- 150000001412 amines Chemical class 0.000 description 2
- 239000002249 anxiolytic agent Substances 0.000 description 2
- 229940005530 anxiolytics Drugs 0.000 description 2
- 239000011230 binding agent Substances 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- 150000007942 carboxylates Chemical class 0.000 description 2
- 239000003054 catalyst Substances 0.000 description 2
- KXZJHVJKXJLBKO-UHFFFAOYSA-N chembl1408157 Chemical compound N=1C2=CC=CC=C2C(C(=O)O)=CC=1C1=CC=C(O)C=C1 KXZJHVJKXJLBKO-UHFFFAOYSA-N 0.000 description 2
- 229910052801 chlorine Inorganic materials 0.000 description 2
- 150000004292 cyclic ethers Chemical class 0.000 description 2
- 230000006806 disease prevention Effects 0.000 description 2
- 239000012153 distilled water Substances 0.000 description 2
- 239000008298 dragée Substances 0.000 description 2
- 230000032050 esterification Effects 0.000 description 2
- 238000005886 esterification reaction Methods 0.000 description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 2
- 239000003925 fat Substances 0.000 description 2
- 239000000706 filtrate Substances 0.000 description 2
- 238000002347 injection Methods 0.000 description 2
- 239000007924 injection Substances 0.000 description 2
- ZCSHNCUQKCANBX-UHFFFAOYSA-N lithium diisopropylamide Chemical compound [Li+].CC(C)[N-]C(C)C ZCSHNCUQKCANBX-UHFFFAOYSA-N 0.000 description 2
- HQEIPVHJHZTMDP-JEDNCBNOSA-N methyl (2s)-pyrrolidine-2-carboxylate;hydrochloride Chemical compound Cl.COC(=O)[C@@H]1CCCN1 HQEIPVHJHZTMDP-JEDNCBNOSA-N 0.000 description 2
- 125000006216 methylsulfinyl group Chemical group [H]C([H])([H])S(*)=O 0.000 description 2
- 125000004170 methylsulfonyl group Chemical group [H]C([H])([H])S(*)(=O)=O 0.000 description 2
- 125000000896 monocarboxylic acid group Chemical group 0.000 description 2
- CTSLXHKWHWQRSH-UHFFFAOYSA-N oxalyl chloride Chemical compound ClC(=O)C(Cl)=O CTSLXHKWHWQRSH-UHFFFAOYSA-N 0.000 description 2
- 230000003647 oxidation Effects 0.000 description 2
- 238000007254 oxidation reaction Methods 0.000 description 2
- 150000004965 peroxy acids Chemical class 0.000 description 2
- 230000003285 pharmacodynamic effect Effects 0.000 description 2
- 239000012071 phase Substances 0.000 description 2
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 2
- XHXFXVLFKHQFAL-UHFFFAOYSA-N phosphoryl trichloride Chemical compound ClP(Cl)(Cl)=O XHXFXVLFKHQFAL-UHFFFAOYSA-N 0.000 description 2
- 235000010482 polyoxyethylene sorbitan monooleate Nutrition 0.000 description 2
- 229920000053 polysorbate 80 Polymers 0.000 description 2
- 125000006239 protecting group Chemical group 0.000 description 2
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 2
- 229910052708 sodium Inorganic materials 0.000 description 2
- 239000011734 sodium Substances 0.000 description 2
- 235000010288 sodium nitrite Nutrition 0.000 description 2
- 239000007787 solid Substances 0.000 description 2
- 239000000829 suppository Substances 0.000 description 2
- 238000003786 synthesis reaction Methods 0.000 description 2
- LMBFAGIMSUYTBN-MPZNNTNKSA-N teixobactin Chemical compound C([C@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H](CCC(N)=O)C(=O)N[C@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H]1C(N[C@@H](C)C(=O)N[C@@H](C[C@@H]2NC(=N)NC2)C(=O)N[C@H](C(=O)O[C@H]1C)[C@@H](C)CC)=O)NC)C1=CC=CC=C1 LMBFAGIMSUYTBN-MPZNNTNKSA-N 0.000 description 2
- IQSYKHVFMYGJER-UHFFFAOYSA-N tert-butyl 2-isocyanoacetate Chemical compound CC(C)(C)OC(=O)C[N+]#[C-] IQSYKHVFMYGJER-UHFFFAOYSA-N 0.000 description 2
- IOGXOCVLYRDXLW-UHFFFAOYSA-N tert-butyl nitrite Chemical compound CC(C)(C)ON=O IOGXOCVLYRDXLW-UHFFFAOYSA-N 0.000 description 2
- 239000012414 tert-butyl nitrite Substances 0.000 description 2
- 150000003512 tertiary amines Chemical class 0.000 description 2
- CIHOLLKRGTVIJN-UHFFFAOYSA-N tert‐butyl hydroperoxide Chemical compound CC(C)(C)OO CIHOLLKRGTVIJN-UHFFFAOYSA-N 0.000 description 2
- 125000003396 thiol group Chemical group [H]S* 0.000 description 2
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 2
- 235000015112 vegetable and seed oil Nutrition 0.000 description 2
- 239000008158 vegetable oil Substances 0.000 description 2
- 239000001993 wax Substances 0.000 description 2
- YFTGBEBPZFFJFE-UHFFFAOYSA-N (2-methoxycarbonylthiophen-3-yl)azanium;chloride Chemical compound Cl.COC(=O)C=1SC=CC=1N YFTGBEBPZFFJFE-UHFFFAOYSA-N 0.000 description 1
- JFTPRWXVKPGDNL-NSHDSACASA-N (6aS)-2-fluoro-7,8,9,11-tetrahydro-6aH-pyrrolo[2,1-c][1,4]benzodiazepine Chemical compound FC=1C=CC2=C(CN3[C@H](C=N2)CCC3)C=1 JFTPRWXVKPGDNL-NSHDSACASA-N 0.000 description 1
- HPEGTNADRVIHAZ-VIFPVBQESA-N (6as)-1-bromo-6a,7,8,9-tetrahydro-5h-pyrrolo[2,1-c][1,4]benzodiazepine-6,11-dione Chemical compound N1C(=O)[C@@H]2CCCN2C(=O)C2=C1C=CC=C2Br HPEGTNADRVIHAZ-VIFPVBQESA-N 0.000 description 1
- GZJLZUWAPLRVMM-QMMMGPOBSA-N (6as)-1-chloro-2-fluoro-6a,7,8,9-tetrahydro-5h-pyrrolo[2,1-c][1,4]benzodiazepine-6,11-dione Chemical compound N1C(=O)[C@@H]2CCCN2C(=O)C2=C(Cl)C(F)=CC=C21 GZJLZUWAPLRVMM-QMMMGPOBSA-N 0.000 description 1
- LZXRUUCZTVLIMC-VIFPVBQESA-N (6as)-1-chloro-6a,7-dihydro-5h-pyrrolo[2,1-c][1,4]benzodiazepine-6,11-dione Chemical compound N1C(=O)[C@@H]2CC=CN2C(=O)C2=C1C=CC=C2Cl LZXRUUCZTVLIMC-VIFPVBQESA-N 0.000 description 1
- AUNHJVGFQWTEOA-JTQLQIEISA-N (6as)-2-chloro-6a,7,8,9-tetrahydro-5h-pyrrolo[2,1-c][1,4]benzodiazepine-6,11-dione Chemical compound N1C(=O)[C@@H]2CCCN2C(=O)C2=CC(Cl)=CC=C21 AUNHJVGFQWTEOA-JTQLQIEISA-N 0.000 description 1
- HHKBSIGLNSVUGZ-JTQLQIEISA-N (6as)-2-nitro-6a,7,8,9-tetrahydro-5h-pyrrolo[2,1-c][1,4]benzodiazepine-6,11-dione Chemical compound N1C(=O)[C@@H]2CCCN2C(=O)C2=CC([N+](=O)[O-])=CC=C21 HHKBSIGLNSVUGZ-JTQLQIEISA-N 0.000 description 1
- HVZHKZPYZIWNJK-MUWHJKNJSA-N (6as,8r)-1-chloro-8-hydroxy-6a,7,8,9-tetrahydro-5h-pyrrolo[2,1-c][1,4]benzodiazepine-6,11-dione Chemical compound O=C1C2=C(Cl)C=CC=C2NC(=O)[C@@H]2C[C@@H](O)CN21 HVZHKZPYZIWNJK-MUWHJKNJSA-N 0.000 description 1
- QWRVVILRVGLEIG-VIFPVBQESA-N (7S)-3,9,13-triazatricyclo[8.4.0.03,7]tetradeca-1(10),11,13-triene-2,8-dione Chemical compound O=C1NC2=CC=NC=C2C(=O)N2CCC[C@@H]12 QWRVVILRVGLEIG-VIFPVBQESA-N 0.000 description 1
- SZAWMNAZUPHMRV-ZDUSSCGKSA-N (s)-1-[(8-chloro-11,12,13,13a-tetrahydro-9-oxo-9h-imidazo[1,5-a]pyrrolo[2,1-c][1,4]benzodiazepin-1-yl)carbonyl]imidazole Chemical compound C1([C@@H]2CCCN2C(=O)C2=C(N1C=N1)C=CC=C2Cl)=C1C(=O)N1C=CN=C1 SZAWMNAZUPHMRV-ZDUSSCGKSA-N 0.000 description 1
- ZTKUOTBNYZPDLU-QMMMGPOBSA-N (s)-5-chloro-1,10a-dihydro-azeto[2,1-c][1,4]benzodiazepine-4,10-(2h,9h)-dione Chemical compound N1C(=O)[C@@H]2CCN2C(=O)C2=C1C=CC=C2Cl ZTKUOTBNYZPDLU-QMMMGPOBSA-N 0.000 description 1
- IKIIAUFQTXNPHL-UHFFFAOYSA-N 12-oxo-2,4,11-triazatetracyclo[11.4.0.02,6.07,11]heptadeca-1(17),3,5,7,9,13,15-heptaene-5-carboxylic acid Chemical compound O=C1N2C(C=3N(C4=C1C=CC=C4)C=NC3C(=O)O)=CC=C2 IKIIAUFQTXNPHL-UHFFFAOYSA-N 0.000 description 1
- KDEHJYYKZZWMFA-UHFFFAOYSA-N 1H-1,4-benzodiazepin-2-yl methanesulfonate Chemical compound CS(=O)(=O)OC=1NC2=C(C=NC=1)C=CC=C2 KDEHJYYKZZWMFA-UHFFFAOYSA-N 0.000 description 1
- SVUOLADPCWQTTE-UHFFFAOYSA-N 1h-1,2-benzodiazepine Chemical compound N1N=CC=CC2=CC=CC=C12 SVUOLADPCWQTTE-UHFFFAOYSA-N 0.000 description 1
- BGWXTSKOBMAJMO-UHFFFAOYSA-N 2,6-dichloro-3,5-bis(trifluoromethyl)pyridine Chemical compound FC(F)(F)C1=CC(C(F)(F)F)=C(Cl)N=C1Cl BGWXTSKOBMAJMO-UHFFFAOYSA-N 0.000 description 1
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 1
- BOOMHTFCWOJWFO-UHFFFAOYSA-N 3-aminopyridine-2-carboxylic acid Chemical compound NC1=CC=CN=C1C(O)=O BOOMHTFCWOJWFO-UHFFFAOYSA-N 0.000 description 1
- CQSJDKGNONPQOQ-UHFFFAOYSA-N 3-aminothiophene-2-carboxylic acid Chemical compound NC=1C=CSC=1C(O)=O CQSJDKGNONPQOQ-UHFFFAOYSA-N 0.000 description 1
- YSEMCVGMNUUNRK-UHFFFAOYSA-N 3-chloro-4-fluoroaniline Chemical compound NC1=CC=C(F)C(Cl)=C1 YSEMCVGMNUUNRK-UHFFFAOYSA-N 0.000 description 1
- AMKPQMFZCBTTAT-UHFFFAOYSA-N 3-ethylaniline Chemical compound CCC1=CC=CC(N)=C1 AMKPQMFZCBTTAT-UHFFFAOYSA-N 0.000 description 1
- IASBMUIXBJNMDW-UHFFFAOYSA-N 4-aminonicotinic acid Chemical compound NC1=CC=NC=C1C(O)=O IASBMUIXBJNMDW-UHFFFAOYSA-N 0.000 description 1
- MRKMPLMCSFKCRQ-UHFFFAOYSA-N 5-(trifluoromethyl)-1h-3,1-benzoxazine-2,4-dione Chemical compound N1C(=O)OC(=O)C2=C1C=CC=C2C(F)(F)F MRKMPLMCSFKCRQ-UHFFFAOYSA-N 0.000 description 1
- YELXVMUMHRDCKE-UHFFFAOYSA-N 5-bromo-1h-3,1-benzoxazine-2,4-dione Chemical compound N1C(=O)OC(=O)C2=C1C=CC=C2Br YELXVMUMHRDCKE-UHFFFAOYSA-N 0.000 description 1
- KJBDXWPWJNDBOS-UHFFFAOYSA-N 5-methyl-1h-3,1-benzoxazine-2,4-dione Chemical compound N1C(=O)OC(=O)C2=C1C=CC=C2C KJBDXWPWJNDBOS-UHFFFAOYSA-N 0.000 description 1
- NBFABZHUOJWSDM-UHFFFAOYSA-N 5h-pyrrolo[1,2-a][1,4]diazepine Chemical compound C1C=CN=CC2=CC=CN12 NBFABZHUOJWSDM-UHFFFAOYSA-N 0.000 description 1
- JHQFCSRQZPCIHR-UHFFFAOYSA-N 6-iodo-1h-3,1-benzoxazine-2,4-dione Chemical compound N1C(=O)OC(=O)C2=CC(I)=CC=C21 JHQFCSRQZPCIHR-UHFFFAOYSA-N 0.000 description 1
- WWUBAHSWMPFIQZ-UHFFFAOYSA-N 6-nitro-1h-3,1-benzoxazine-2,4-dione Chemical compound N1C(=O)OC(=O)C2=CC([N+](=O)[O-])=CC=C21 WWUBAHSWMPFIQZ-UHFFFAOYSA-N 0.000 description 1
- RECMDCAOXWIWCB-UHFFFAOYSA-N 6a,7,8,9-tetrahydro-6h-pyrido[3,2-e]pyrrolo[1,2-a][1,4]diazepine-6,11(5h)-dione Chemical compound O=C1NC2=CC=CN=C2C(=O)N2CCCC12 RECMDCAOXWIWCB-UHFFFAOYSA-N 0.000 description 1
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- RZVAJINKPMORJF-UHFFFAOYSA-N Acetaminophen Chemical compound CC(=O)NC1=CC=C(O)C=C1 RZVAJINKPMORJF-UHFFFAOYSA-N 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 1
- ZJKTUNPAOPSBPR-UHFFFAOYSA-N C1C2=CC=CC=C2N2C=NC(C(=O)O)=C2C2=CC=CN21 Chemical compound C1C2=CC=CC=C2N2C=NC(C(=O)O)=C2C2=CC=CN21 ZJKTUNPAOPSBPR-UHFFFAOYSA-N 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- 206010010904 Convulsion Diseases 0.000 description 1
- 229920002261 Corn starch Polymers 0.000 description 1
- XFXPMWWXUTWYJX-UHFFFAOYSA-N Cyanide Chemical compound N#[C-] XFXPMWWXUTWYJX-UHFFFAOYSA-N 0.000 description 1
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 1
- WQZGKKKJIJFFOK-GASJEMHNSA-N Glucose Natural products OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-GASJEMHNSA-N 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical class Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 1
- PMMYEEVYMWASQN-DMTCNVIQSA-N Hydroxyproline Chemical compound O[C@H]1CN[C@H](C(O)=O)C1 PMMYEEVYMWASQN-DMTCNVIQSA-N 0.000 description 1
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 1
- BZLVMXJERCGZMT-UHFFFAOYSA-N Methyl tert-butyl ether Chemical compound COC(C)(C)C BZLVMXJERCGZMT-UHFFFAOYSA-N 0.000 description 1
- 241000699670 Mus sp. Species 0.000 description 1
- FXHOOIRPVKKKFG-UHFFFAOYSA-N N,N-Dimethylacetamide Chemical compound CN(C)C(C)=O FXHOOIRPVKKKFG-UHFFFAOYSA-N 0.000 description 1
- IOVCWXUNBOPUCH-UHFFFAOYSA-M Nitrite anion Chemical compound [O-]N=O IOVCWXUNBOPUCH-UHFFFAOYSA-M 0.000 description 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
- YGYAWVDWMABLBF-UHFFFAOYSA-N Phosgene Chemical compound ClC(Cl)=O YGYAWVDWMABLBF-UHFFFAOYSA-N 0.000 description 1
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 1
- 235000021355 Stearic acid Nutrition 0.000 description 1
- CZMRCDWAGMRECN-UGDNZRGBSA-N Sucrose Chemical compound O[C@H]1[C@H](O)[C@@H](CO)O[C@@]1(CO)O[C@@H]1[C@H](O)[C@@H](O)[C@H](O)[C@@H](CO)O1 CZMRCDWAGMRECN-UGDNZRGBSA-N 0.000 description 1
- 229930006000 Sucrose Natural products 0.000 description 1
- 230000007059 acute toxicity Effects 0.000 description 1
- 231100000403 acute toxicity Toxicity 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 229910000102 alkali metal hydride Inorganic materials 0.000 description 1
- 150000008046 alkali metal hydrides Chemical class 0.000 description 1
- 229940024606 amino acid Drugs 0.000 description 1
- 150000001413 amino acids Chemical class 0.000 description 1
- 238000010171 animal model Methods 0.000 description 1
- 230000001773 anti-convulsant effect Effects 0.000 description 1
- 239000001961 anticonvulsive agent Substances 0.000 description 1
- 229960003965 antiepileptics Drugs 0.000 description 1
- 239000003963 antioxidant agent Substances 0.000 description 1
- 230000036506 anxiety Effects 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 1
- 125000004659 aryl alkyl thio group Chemical group 0.000 description 1
- 229940049706 benzodiazepine Drugs 0.000 description 1
- LWUDDYHYYNNIQI-ZDUSSCGKSA-N bretazenil Chemical compound O=C1C2=C(Br)C=CC=C2N2C=NC(C(=O)OC(C)(C)C)=C2[C@@H]2CCCN21 LWUDDYHYYNNIQI-ZDUSSCGKSA-N 0.000 description 1
- 239000000872 buffer Substances 0.000 description 1
- 239000001569 carbon dioxide Substances 0.000 description 1
- 229910002092 carbon dioxide Inorganic materials 0.000 description 1
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 1
- 150000001244 carboxylic acid anhydrides Chemical class 0.000 description 1
- 230000003197 catalytic effect Effects 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 229960004782 chlordiazepoxide Drugs 0.000 description 1
- ANTSCNMPPGJYLG-UHFFFAOYSA-N chlordiazepoxide Chemical compound O=N=1CC(NC)=NC2=CC=C(Cl)C=C2C=1C1=CC=CC=C1 ANTSCNMPPGJYLG-UHFFFAOYSA-N 0.000 description 1
- 239000002026 chloroform extract Substances 0.000 description 1
- 238000003776 cleavage reaction Methods 0.000 description 1
- 239000003245 coal Substances 0.000 description 1
- 238000000576 coating method Methods 0.000 description 1
- 239000003086 colorant Substances 0.000 description 1
- 230000036461 convulsion Effects 0.000 description 1
- 229910000365 copper sulfate Inorganic materials 0.000 description 1
- ARUVKPQLZAKDPS-UHFFFAOYSA-L copper(II) sulfate Chemical compound [Cu+2].[O-][S+2]([O-])([O-])[O-] ARUVKPQLZAKDPS-UHFFFAOYSA-L 0.000 description 1
- 239000008120 corn starch Substances 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 239000006185 dispersion Substances 0.000 description 1
- 229940079593 drug Drugs 0.000 description 1
- 239000003814 drug Substances 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 230000008030 elimination Effects 0.000 description 1
- 238000003379 elimination reaction Methods 0.000 description 1
- 239000003995 emulsifying agent Substances 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- 125000004185 ester group Chemical group 0.000 description 1
- 125000006125 ethylsulfonyl group Chemical group 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 239000011737 fluorine Substances 0.000 description 1
- 229910052731 fluorine Inorganic materials 0.000 description 1
- 150000002222 fluorine compounds Chemical class 0.000 description 1
- 235000003599 food sweetener Nutrition 0.000 description 1
- 239000008103 glucose Substances 0.000 description 1
- 229940093915 gynecological organic acid Drugs 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 230000026030 halogenation Effects 0.000 description 1
- 238000005658 halogenation reaction Methods 0.000 description 1
- 125000000623 heterocyclic group Chemical group 0.000 description 1
- GNOIPBMMFNIUFM-UHFFFAOYSA-N hexamethylphosphoric triamide Chemical compound CN(C)P(=O)(N(C)C)N(C)C GNOIPBMMFNIUFM-UHFFFAOYSA-N 0.000 description 1
- 150000002430 hydrocarbons Chemical group 0.000 description 1
- 150000003840 hydrochlorides Chemical class 0.000 description 1
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- 239000012442 inert solvent Substances 0.000 description 1
- 229960004903 invert sugar Drugs 0.000 description 1
- 150000004694 iodide salts Chemical class 0.000 description 1
- PNDPGZBMCMUPRI-UHFFFAOYSA-N iodine Chemical compound II PNDPGZBMCMUPRI-UHFFFAOYSA-N 0.000 description 1
- 239000011630 iodine Substances 0.000 description 1
- 150000002497 iodine compounds Chemical class 0.000 description 1
- 238000002955 isolation Methods 0.000 description 1
- 125000003253 isopropoxy group Chemical group [H]C([H])([H])C([H])(O*)C([H])([H])[H] 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 239000004922 lacquer Substances 0.000 description 1
- 239000008101 lactose Substances 0.000 description 1
- AFRJJFRNGGLMDW-UHFFFAOYSA-N lithium amide Chemical compound [Li+].[NH2-] AFRJJFRNGGLMDW-UHFFFAOYSA-N 0.000 description 1
- LLCOIQRNSJBFSN-UHFFFAOYSA-N methane;sulfurochloridic acid Chemical compound C.OS(Cl)(=O)=O LLCOIQRNSJBFSN-UHFFFAOYSA-N 0.000 description 1
- AFVFQIVMOAPDHO-UHFFFAOYSA-M methanesulfonate group Chemical class CS(=O)(=O)[O-] AFVFQIVMOAPDHO-UHFFFAOYSA-M 0.000 description 1
- 125000005948 methanesulfonyloxy group Chemical group 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- VBTQNRFWXBXZQR-UHFFFAOYSA-N n-bromoacetamide Chemical compound CC(=O)NBr VBTQNRFWXBXZQR-UHFFFAOYSA-N 0.000 description 1
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- HSPSCWZIJWKZKD-UHFFFAOYSA-N n-chloroacetamide Chemical compound CC(=O)NCl HSPSCWZIJWKZKD-UHFFFAOYSA-N 0.000 description 1
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- 125000004433 nitrogen atom Chemical group N* 0.000 description 1
- QIQXTHQIDYTFRH-UHFFFAOYSA-N octadecanoic acid Chemical compound CCCCCCCCCCCCCCCCCC(O)=O QIQXTHQIDYTFRH-UHFFFAOYSA-N 0.000 description 1
- OQCDKBAXFALNLD-UHFFFAOYSA-N octadecanoic acid Natural products CCCCCCCC(C)CCCCCCCCC(O)=O OQCDKBAXFALNLD-UHFFFAOYSA-N 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 239000012074 organic phase Substances 0.000 description 1
- 230000003204 osmotic effect Effects 0.000 description 1
- 150000003891 oxalate salts Chemical class 0.000 description 1
- 230000001590 oxidative effect Effects 0.000 description 1
- 125000004430 oxygen atom Chemical group O* 0.000 description 1
- 229910052763 palladium Inorganic materials 0.000 description 1
- 239000000825 pharmaceutical preparation Substances 0.000 description 1
- 210000003800 pharynx Anatomy 0.000 description 1
- 125000005328 phosphinyl group Chemical group [PH2](=O)* 0.000 description 1
- 229960005235 piperonyl butoxide Drugs 0.000 description 1
- 239000000244 polyoxyethylene sorbitan monooleate Substances 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 239000003755 preservative agent Substances 0.000 description 1
- SBYHFKPVCBCYGV-UHFFFAOYSA-N quinuclidine Chemical compound C1CC2CCN1CC2 SBYHFKPVCBCYGV-UHFFFAOYSA-N 0.000 description 1
- 239000000523 sample Substances 0.000 description 1
- 229930195734 saturated hydrocarbon Natural products 0.000 description 1
- 230000007017 scission Effects 0.000 description 1
- 125000002914 sec-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 239000000377 silicon dioxide Substances 0.000 description 1
- QDRKDTQENPPHOJ-UHFFFAOYSA-N sodium ethoxide Chemical compound [Na+].CC[O-] QDRKDTQENPPHOJ-UHFFFAOYSA-N 0.000 description 1
- 159000000000 sodium salts Chemical class 0.000 description 1
- 239000003381 stabilizer Substances 0.000 description 1
- 239000008117 stearic acid Substances 0.000 description 1
- 239000005720 sucrose Substances 0.000 description 1
- 125000001174 sulfone group Chemical group 0.000 description 1
- 125000000542 sulfonic acid group Chemical group 0.000 description 1
- 125000003375 sulfoxide group Chemical group 0.000 description 1
- 229910052717 sulfur Inorganic materials 0.000 description 1
- 125000004434 sulfur atom Chemical group 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-N sulfuric acid Substances OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 1
- 150000003467 sulfuric acid derivatives Chemical class 0.000 description 1
- 239000003765 sweetening agent Substances 0.000 description 1
- 239000006188 syrup Substances 0.000 description 1
- 235000020357 syrup Nutrition 0.000 description 1
- XRKUMJSBSIOYDE-AWEZNQCLSA-N t-butyl (s)-7-amino-11,12,13,13a-tetrahydro-9-oxo-9h-imidazo[1,5-a]pyrrolo[2,1-c][1,4]benzodiazepine-1-carboxylate Chemical compound O=C1C2=CC(N)=CC=C2N2C=NC(C(=O)OC(C)(C)C)=C2[C@@H]2CCCN21 XRKUMJSBSIOYDE-AWEZNQCLSA-N 0.000 description 1
- ALIPPSZCAOOVCT-LBPRGKRZSA-N t-butyl (s)-7-amino-8-bromo-11,12,13,13a-tetrahydro-9-oxo-9h-imidazo[1,5-a]pyrrolo[2,1-c][1,4]benzodiazepine-1-carboxylate Chemical compound O=C1C2=C(Br)C(N)=CC=C2N2C=NC(C(=O)OC(C)(C)C)=C2[C@@H]2CCCN21 ALIPPSZCAOOVCT-LBPRGKRZSA-N 0.000 description 1
- 239000003826 tablet Substances 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- WNNMAVYBIDQVON-ZDUSSCGKSA-N tert-butyl (7S)-12-oxo-14-(trifluoromethyl)-2,4,11-triazatetracyclo[11.4.0.02,6.07,11]heptadeca-1(17),3,5,13,15-pentaene-5-carboxylate Chemical compound C([C@H]1C=2N3C=NC=2C(=O)OC(C)(C)C)CCN1C(=O)C1=C3C=CC=C1C(F)(F)F WNNMAVYBIDQVON-ZDUSSCGKSA-N 0.000 description 1
- RABMNWTVQXGRIZ-AWEZNQCLSA-N tert-butyl (7S)-13-ethyl-11-oxo-2,4,10-triazatetracyclo[10.4.0.02,6.07,10]hexadeca-1(16),3,5,12,14-pentaene-5-carboxylate Chemical compound O=C1N2CC[C@H]2C2=C(C(=O)OC(C)(C)C)N=CN2C2=C1C(CC)=CC=C2 RABMNWTVQXGRIZ-AWEZNQCLSA-N 0.000 description 1
- NPRHJHZWJXUBAC-ZDUSSCGKSA-N tert-butyl (7S)-14-chloro-12-oxo-2,4,11-triazatetracyclo[11.4.0.02,6.07,11]heptadeca-1(17),3,5,13,15-pentaene-5-carboxylate Chemical compound O=C1C2=C(Cl)C=CC=C2N2C=NC(C(=O)OC(C)(C)C)=C2[C@@H]2CCCN21 NPRHJHZWJXUBAC-ZDUSSCGKSA-N 0.000 description 1
- WMOVHXAZOJBABW-UHFFFAOYSA-N tert-butyl acetate Chemical compound CC(=O)OC(C)(C)C WMOVHXAZOJBABW-UHFFFAOYSA-N 0.000 description 1
- ZKLMHDHPWGLFHO-UHFFFAOYSA-N tert.butyl 8-chloro-11,13a-dihydro-9-oxo-9h-imidazo[1,5-a]pyrrolo[2,1-c][1,4]benzodiazepine-1-carboxylate Chemical compound O=C1C2=C(Cl)C=CC=C2N2C=NC(C(=O)OC(C)(C)C)=C2C2C=CCN21 ZKLMHDHPWGLFHO-UHFFFAOYSA-N 0.000 description 1
- 150000003571 thiolactams Chemical class 0.000 description 1
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical class CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 1
- 230000001988 toxicity Effects 0.000 description 1
- 231100000419 toxicity Toxicity 0.000 description 1
- 239000002966 varnish Substances 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
- 239000000080 wetting agent Substances 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D265/00—Heterocyclic compounds containing six-membered rings having one nitrogen atom and one oxygen atom as the only ring hetero atoms
- C07D265/04—1,3-Oxazines; Hydrogenated 1,3-oxazines
- C07D265/12—1,3-Oxazines; Hydrogenated 1,3-oxazines condensed with carbocyclic rings or ring systems
- C07D265/14—1,3-Oxazines; Hydrogenated 1,3-oxazines condensed with carbocyclic rings or ring systems condensed with one six-membered ring
- C07D265/24—1,3-Oxazines; Hydrogenated 1,3-oxazines condensed with carbocyclic rings or ring systems condensed with one six-membered ring with hetero atoms directly attached in positions 2 and 4
- C07D265/26—Two oxygen atoms, e.g. isatoic anhydride
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D209/00—Heterocyclic compounds containing five-membered rings, condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D209/02—Heterocyclic compounds containing five-membered rings, condensed with other rings, with one nitrogen atom as the only ring hetero atom condensed with one carbocyclic ring
- C07D209/04—Indoles; Hydrogenated indoles
- C07D209/30—Indoles; Hydrogenated indoles with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, directly attached to carbon atoms of the hetero ring
- C07D209/32—Oxygen atoms
- C07D209/38—Oxygen atoms in positions 2 and 3, e.g. isatin
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D471/00—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, at least one ring being a six-membered ring with one nitrogen atom, not provided for by groups C07D451/00 - C07D463/00
- C07D471/12—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, at least one ring being a six-membered ring with one nitrogen atom, not provided for by groups C07D451/00 - C07D463/00 in which the condensed system contains three hetero rings
- C07D471/14—Ortho-condensed systems
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D487/00—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, not provided for by groups C07D451/00 - C07D477/00
- C07D487/02—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, not provided for by groups C07D451/00 - C07D477/00 in which the condensed system contains two hetero rings
- C07D487/04—Ortho-condensed systems
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D487/00—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, not provided for by groups C07D451/00 - C07D477/00
- C07D487/12—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, not provided for by groups C07D451/00 - C07D477/00 in which the condensed system contains three hetero rings
- C07D487/14—Ortho-condensed systems
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D495/00—Heterocyclic compounds containing in the condensed system at least one hetero ring having sulfur atoms as the only ring hetero atoms
- C07D495/02—Heterocyclic compounds containing in the condensed system at least one hetero ring having sulfur atoms as the only ring hetero atoms in which the condensed system contains two hetero rings
- C07D495/04—Ortho-condensed systems
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D495/00—Heterocyclic compounds containing in the condensed system at least one hetero ring having sulfur atoms as the only ring hetero atoms
- C07D495/12—Heterocyclic compounds containing in the condensed system at least one hetero ring having sulfur atoms as the only ring hetero atoms in which the condensed system contains three hetero rings
- C07D495/14—Ortho-condensed systems
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
Applications Claiming Priority (12)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH133981 | 1981-02-27 | ||
| CH133881 | 1981-02-27 | ||
| CH134181 | 1981-02-27 | ||
| CH134281 | 1981-02-27 | ||
| CH133881 | 1981-02-27 | ||
| CH133981 | 1981-02-27 | ||
| CH134281 | 1981-02-27 | ||
| CH134181 | 1981-02-27 | ||
| CH367581 | 1981-06-04 | ||
| CH367581 | 1981-06-04 | ||
| CH793481 | 1981-12-11 | ||
| CH793481 | 1981-12-11 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DK74282A DK74282A (da) | 1982-08-28 |
| DK168073B1 true DK168073B1 (da) | 1994-01-31 |
Family
ID=27543637
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DK074282A DK168073B1 (da) | 1981-02-27 | 1982-02-19 | Analogifremgangsmaade til fremstilling af imidazodiazepiner eller farmaceutisk acceptable syreadditionssalte deraf |
Country Status (19)
| Country | Link |
|---|---|
| US (1) | US4353827A (cs) |
| EP (1) | EP0059391B1 (cs) |
| KR (1) | KR890002624B1 (cs) |
| AU (1) | AU551891B2 (cs) |
| BR (1) | BR8201024A (cs) |
| CA (1) | CA1185602A (cs) |
| CS (1) | CS247064B2 (cs) |
| DE (1) | DE3263633D1 (cs) |
| DK (1) | DK168073B1 (cs) |
| FI (1) | FI73430C (cs) |
| HK (1) | HK23288A (cs) |
| IE (1) | IE52543B1 (cs) |
| IL (1) | IL65056A0 (cs) |
| MC (1) | MC1442A1 (cs) |
| NO (1) | NO157620C (cs) |
| NZ (1) | NZ199793A (cs) |
| PH (1) | PH19881A (cs) |
| PT (1) | PT74504B (cs) |
| YU (1) | YU45860B (cs) |
Families Citing this family (52)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| MC1528A1 (fr) * | 1982-07-21 | 1984-04-13 | Hoffmann La Roche | Imidazobenzodiazepines |
| IL74070A (en) * | 1984-01-19 | 1988-12-30 | Hoffmann La Roche | Imidazodiazepine derivatives,their manufacture and pharmaceutical compositions containing them |
| DK174086D0 (da) * | 1986-04-16 | 1986-04-16 | Ferrosan As | Nye benzodiazepinderivater samt fremgangsmaade til fremstilling af samme |
| CA1327008C (en) * | 1988-01-15 | 1994-02-15 | Walter Merz | Anti-psychotic imidazobenzodiazepine |
| CA1312825C (en) * | 1988-01-27 | 1993-01-19 | F. Hoffmann-La Roche Ag | Prevention or interruption of panic states with an imidazobenzodiazepine |
| CA2015336A1 (en) * | 1989-05-19 | 1990-11-19 | F. Hoffmann-La Roche Ag | Imidazodiazepines for the treatment of neurological symptoms |
| CA2055308A1 (en) * | 1990-11-29 | 1992-05-30 | Roman Amrein | Imidazobenzodiazepine for the treatment of sleep disorders |
| JO2259B1 (en) * | 1999-05-12 | 2004-10-07 | اف. هوفمان- لاروش أيه جي | Method for the manufacture of diazapine derivatives |
| US7678818B2 (en) * | 2006-02-07 | 2010-03-16 | Hoffmann-La Roche Inc. | Anthranilamide and 2-amino-heteroarene-carboxamide compounds |
| KR101589314B1 (ko) | 2007-08-20 | 2016-01-28 | 에보텍 인터내셔널 게엠베하 | 수면 장애의 치료 |
| US20090054412A1 (en) * | 2007-08-20 | 2009-02-26 | John Alan Kemp | Treatment of Sleep Disorders |
| KR101671360B1 (ko) | 2010-04-15 | 2016-11-01 | 시애틀 지네틱스, 인크. | 표적화된 피롤로벤조디아제핀 접합체 |
| MX368648B (es) | 2010-04-15 | 2019-10-09 | Seattle Genetics Inc | Pirrolobenzodiazepinas usadas para tratar enfermedades proliferativas. |
| EA027971B1 (ru) | 2011-09-20 | 2017-09-29 | Медимьюн Лимитед | Пирролбензодиазепины |
| CA2850264C (en) | 2011-10-14 | 2019-11-05 | Spirogen Sarl | Pyrrolobenzodiazepines |
| WO2013055993A1 (en) | 2011-10-14 | 2013-04-18 | Seattle Genetics, Inc. | Pyrrolobenzodiazepines and targeted conjugates |
| US9526798B2 (en) | 2011-10-14 | 2016-12-27 | Seattle Genetics, Inc. | Pyrrolobenzodiazepines and targeted conjugates |
| BR112014008888A2 (pt) | 2011-10-14 | 2017-04-18 | Seattle Genetics Inc | pirrolobenzodiazepinas |
| CN103374000B (zh) * | 2012-04-13 | 2015-11-11 | 中国科学院广州生物医药与健康研究院 | 嘧啶并二氮杂卓类化合物及其药用组合物和应用 |
| BR112015008173A2 (pt) | 2012-10-12 | 2017-11-28 | Adc Therapeutics Sarl | conjugados de pirrolobenzodiazepina-anticorpo anti-psma |
| US10695433B2 (en) | 2012-10-12 | 2020-06-30 | Medimmune Limited | Pyrrolobenzodiazepine-antibody conjugates |
| DK2766048T3 (en) | 2012-10-12 | 2015-03-02 | Spirogen Sarl | PYRROLOBENZODIAZEPINS AND CONJUGATES THEREOF |
| CA2885305C (en) | 2012-10-12 | 2019-11-12 | Spirogen Sarl | Synthesis and intermediates of pyrrolobenzodiazepine derivatives for conjugation |
| RS56520B1 (sr) | 2012-10-12 | 2018-02-28 | Adc Therapeutics Sa | Pirolobenzodiazepin-anti-cd22 konjugati antitela |
| LT2906298T (lt) | 2012-10-12 | 2018-12-27 | Adc Therapeutics Sa | Pirolbenzodiazepino-antikūno konjugatai |
| WO2014057114A1 (en) | 2012-10-12 | 2014-04-17 | Adc Therapeutics Sàrl | Pyrrolobenzodiazepine-anti-psma antibody conjugates |
| NZ707543A (en) | 2012-10-12 | 2018-09-28 | Adc Therapeutics Sa | Pyrrolobenzodiazepine-antibody conjugates |
| EP3470086B1 (en) | 2012-10-12 | 2020-11-25 | Medimmune Limited | Pyrrolobenzodiazepines and conjugates thereof |
| GB201317981D0 (en) | 2013-10-11 | 2013-11-27 | Spirogen Sarl | Pyrrolobenzodiazepines and conjugates thereof |
| GB201317982D0 (en) | 2013-10-11 | 2013-11-27 | Spirogen Sarl | Pyrrolobenzodiazepines and conjugates thereof |
| EP3054983B1 (en) | 2013-10-11 | 2019-03-20 | Medimmune Limited | Pyrrolobenzodiazepine-antibody conjugates |
| WO2015052534A1 (en) | 2013-10-11 | 2015-04-16 | Spirogen Sàrl | Pyrrolobenzodiazepine-antibody conjugates |
| US9956299B2 (en) | 2013-10-11 | 2018-05-01 | Medimmune Limited | Pyrrolobenzodiazepine—antibody conjugates |
| GB201416112D0 (en) | 2014-09-12 | 2014-10-29 | Medimmune Ltd | Pyrrolobenzodiazepines and conjugates thereof |
| AU2015352545B2 (en) | 2014-11-25 | 2020-10-15 | Adc Therapeutics Sa | Pyrrolobenzodiazepine-antibody conjugates |
| GB201506411D0 (en) | 2015-04-15 | 2015-05-27 | Bergenbio As | Humanized anti-axl antibodies |
| GB201506402D0 (en) | 2015-04-15 | 2015-05-27 | Berkel Patricius H C Van And Howard Philip W | Site-specific antibody-drug conjugates |
| GB201601431D0 (en) | 2016-01-26 | 2016-03-09 | Medimmune Ltd | Pyrrolobenzodiazepines |
| GB201602359D0 (en) | 2016-02-10 | 2016-03-23 | Medimmune Ltd | Pyrrolobenzodiazepine Conjugates |
| GB201602356D0 (en) | 2016-02-10 | 2016-03-23 | Medimmune Ltd | Pyrrolobenzodiazepine Conjugates |
| GB201607478D0 (en) | 2016-04-29 | 2016-06-15 | Medimmune Ltd | Pyrrolobenzodiazepine Conjugates |
| GB201617466D0 (en) | 2016-10-14 | 2016-11-30 | Medimmune Ltd | Pyrrolobenzodiazepine conjugates |
| KR102181375B1 (ko) | 2017-02-08 | 2020-11-25 | 에이디씨 테라퓨틱스 에스에이 | 피롤로벤조디아제핀-항체 컨주게이트 |
| GB201702031D0 (en) | 2017-02-08 | 2017-03-22 | Medlmmune Ltd | Pyrrolobenzodiazepine-antibody conjugates |
| HUE059828T2 (hu) | 2017-04-18 | 2023-01-28 | Medimmune Ltd | Pirrolobenzodiazepin konjugátumok |
| BR112019021880A2 (pt) | 2017-04-20 | 2020-06-02 | Adc Therapeutics Sa | Terapia de combinação com conjugado anticorpo anti-axl-droga |
| MX2019015042A (es) | 2017-06-14 | 2020-08-06 | Adc Therapeutics Sa | Regimen de dosificacion. |
| RS62928B1 (sr) | 2017-08-18 | 2022-03-31 | Medimmune Ltd | Konjugati pirolobenzodiazepina |
| GB201803342D0 (en) | 2018-03-01 | 2018-04-18 | Medimmune Ltd | Methods |
| GB201806022D0 (en) | 2018-04-12 | 2018-05-30 | Medimmune Ltd | Pyrrolobenzodiazepines and conjugates thereof |
| BR112021018260A2 (pt) | 2019-03-15 | 2021-11-23 | Medimmune Ltd | Dímeros de azetidobenzodiazepina e conjugados compreendendo-os para uso no tratamento de câncer |
| WO2021113492A1 (en) * | 2019-12-06 | 2021-06-10 | Schrödinger, Inc. | Cyclic compounds and methods of using same |
Family Cites Families (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3933794A (en) * | 1971-08-04 | 1976-01-20 | The Upjohn Company | 2-(2-Alkynylamino)-3H-1,4-benzodiazepines |
| GB1600600A (en) * | 1977-03-10 | 1981-10-21 | Diamond Shamrock Chem | Plasticiser compositions for use with synthetic resin polymers |
| US4118386A (en) * | 1977-04-04 | 1978-10-03 | Hoffmann-La Roche Inc. | Synthesis of imidazo[1,5-a]diazepine-3-carboxylates |
| CA1143728A (en) * | 1979-10-04 | 1983-03-29 | Max Gerecke | Imidazodiazepine derivatives |
-
1982
- 1982-01-21 CA CA000394685A patent/CA1185602A/en not_active Expired
- 1982-02-10 PH PH26851A patent/PH19881A/en unknown
- 1982-02-17 CS CS821081A patent/CS247064B2/cs unknown
- 1982-02-18 US US06/349,801 patent/US4353827A/en not_active Expired - Lifetime
- 1982-02-19 DE DE8282101273T patent/DE3263633D1/de not_active Expired
- 1982-02-19 DK DK074282A patent/DK168073B1/da not_active IP Right Cessation
- 1982-02-19 EP EP82101273A patent/EP0059391B1/de not_active Expired
- 1982-02-19 IL IL65056A patent/IL65056A0/xx not_active IP Right Cessation
- 1982-02-22 AU AU80669/82A patent/AU551891B2/en not_active Expired
- 1982-02-22 NZ NZ199793A patent/NZ199793A/en unknown
- 1982-02-25 FI FI820647A patent/FI73430C/fi not_active IP Right Cessation
- 1982-02-25 MC MC821577A patent/MC1442A1/xx unknown
- 1982-02-26 YU YU43682A patent/YU45860B/sh unknown
- 1982-02-26 BR BR8201024A patent/BR8201024A/pt unknown
- 1982-02-26 IE IE421/82A patent/IE52543B1/en not_active IP Right Cessation
- 1982-02-26 PT PT74504A patent/PT74504B/pt unknown
- 1982-02-26 KR KR8200862A patent/KR890002624B1/ko not_active Expired
- 1982-02-26 NO NO820622A patent/NO157620C/no unknown
-
1988
- 1988-03-30 HK HK232/88A patent/HK23288A/xx not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| AU551891B2 (en) | 1986-05-15 |
| FI820647L (fi) | 1982-08-28 |
| PT74504A (en) | 1982-03-01 |
| KR890002624B1 (ko) | 1989-07-20 |
| PT74504B (en) | 1984-11-26 |
| DK74282A (da) | 1982-08-28 |
| NO157620B (no) | 1988-01-11 |
| FI73430C (fi) | 1987-10-09 |
| HK23288A (en) | 1988-04-08 |
| KR830009105A (ko) | 1983-12-17 |
| YU43682A (en) | 1988-08-31 |
| AU8066982A (en) | 1982-09-02 |
| YU45860B (sh) | 1992-09-07 |
| PH19881A (en) | 1986-08-13 |
| BR8201024A (pt) | 1983-01-04 |
| US4353827A (en) | 1982-10-12 |
| IE820421L (en) | 1982-08-27 |
| IE52543B1 (en) | 1987-12-09 |
| NO157620C (no) | 1988-04-20 |
| CS247064B2 (en) | 1986-11-13 |
| DE3263633D1 (en) | 1985-06-13 |
| EP0059391A1 (de) | 1982-09-08 |
| MC1442A1 (fr) | 1982-12-06 |
| NZ199793A (en) | 1985-08-30 |
| EP0059391B1 (de) | 1985-05-08 |
| CA1185602A (en) | 1985-04-16 |
| IL65056A0 (en) | 1982-04-30 |
| FI73430B (fi) | 1987-06-30 |
| NO820622L (no) | 1982-08-30 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DK168073B1 (da) | Analogifremgangsmaade til fremstilling af imidazodiazepiner eller farmaceutisk acceptable syreadditionssalte deraf | |
| KR900003496B1 (ko) | 티에닐 축합 피라졸 유도체의 제조방법 | |
| US4062848A (en) | Tetracyclic compounds | |
| FI103574B (fi) | Menetelmä terapeuttisesti käyttökelpoisten, N-substituoitujen kinoliin i- ja kinnoliinijohdannaisten valmistamiseksi | |
| JPH0354105B2 (cs) | ||
| HU218950B (hu) | Kondenzált imidazo-piridin-származékok, az ezeket tartalmazó gyógyszerkészítmények és eljárás előállításukra | |
| CS274456B2 (en) | Method of new tetrazepines production | |
| CA2258885A1 (en) | Tricyclic benzazepine vasopressin antagonists | |
| WO1993004047A1 (en) | Quinazoline derivatives as inhibitors of hiv reverse transcriptase | |
| US20110152242A1 (en) | 2,3-Substituted Fused Pyrimidin -4 (3H)-Ones as VR1 Antagonists | |
| CA2104883A1 (fr) | Derives d'acide thienyl ou pyrrolyl carboxyliques, leur preparation et medicaments les contenant | |
| KR920003980B1 (ko) | 축합 디아제핀온의 제조방법 | |
| EP0222576A2 (en) | Heterocyclic oxophthalazinyl acetic acids | |
| SK33995A3 (en) | Imidazodiazepines | |
| NO884174L (no) | Framgangsmaate for fremstilling av terapeutisk aktive tricykliske amidinoderivater. | |
| CZ20012502A3 (cs) | Funkcionalizované heterocykly jako modulátory chemokinových receptorů | |
| DK164704B (da) | 3,6-disubstituerede triazolo-oe3,4-aaa-ftalazinderivater, fremgangsmaade til fremstilling deraf, udgangsforbindelse til anvendelse i fremgangsmaaden samt anvendelse af og farmaceutisk praeparat indeholdende forbindelserne | |
| NO845252L (no) | Analogifremgangsmaate for fremstilling av terapeutisk aktive 2-fenyl-imidazol-derivater | |
| NO153430B (no) | Analogifremgangsmaate til fremstilling av nye terapeutisk virksomme 2-fenyl eller -pyridyl-pyrazolo(4,3-c)kinolin-3(1 og 5h)-on forbindelser. | |
| JPS59130882A (ja) | 複素環縮合ピラゾロ〔3,4−d〕ピリジン−3−オン | |
| US5149702A (en) | Cycloheptenopyridine derivatives, process for preparation thereof and antiulcer agents containing the same | |
| GB1594867A (en) | Benzodiazepine derivatives | |
| NO832633L (no) | Imidazobenzodiazepiner | |
| NO140671B (no) | Analogifremgangsmaate for fremstilling av terapeutisk aktive diazepiner | |
| Huckle et al. | 4-Amino-2, 3, 4, 5-tetrahydro-1-benzoxepin-5-ols, 4-amino-2, 3, 4, 5-tetrahydro-1-benzothiepin-5-ols, and related compounds |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| AHS | Application shelved for other reasons than non-payment | ||
| AHB | Application shelved due to non-payment | ||
| B1 | Patent granted (law 1993) | ||
| PUP | Patent expired |