DK141249B - Analogifremgangsmåde til fremstilling af 8-azapurin-6-on-derivater eller salte deraf. - Google Patents
Analogifremgangsmåde til fremstilling af 8-azapurin-6-on-derivater eller salte deraf. Download PDFInfo
- Publication number
- DK141249B DK141249B DK596371AA DK596371A DK141249B DK 141249 B DK141249 B DK 141249B DK 596371A A DK596371A A DK 596371AA DK 596371 A DK596371 A DK 596371A DK 141249 B DK141249 B DK 141249B
- Authority
- DK
- Denmark
- Prior art keywords
- aza
- purin
- carbon atoms
- amino
- group
- Prior art date
Links
- 150000003839 salts Chemical class 0.000 title claims description 22
- WTVSOESDARPVQO-UHFFFAOYSA-N triazolo[4,5-d]pyrimidin-7-one Chemical class O=C1N=CN=C2N=NN=C12 WTVSOESDARPVQO-UHFFFAOYSA-N 0.000 title claims description 13
- 238000004519 manufacturing process Methods 0.000 title claims description 3
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 claims description 79
- -1 aralkoxy Chemical group 0.000 claims description 67
- 125000004432 carbon atom Chemical group C* 0.000 claims description 43
- 150000001875 compounds Chemical class 0.000 claims description 37
- 125000000217 alkyl group Chemical group 0.000 claims description 32
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 25
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 claims description 23
- 125000003545 alkoxy group Chemical group 0.000 claims description 21
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 21
- 238000000034 method Methods 0.000 claims description 19
- 125000001624 naphthyl group Chemical group 0.000 claims description 18
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 16
- 125000001424 substituent group Chemical group 0.000 claims description 15
- 239000002253 acid Substances 0.000 claims description 14
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 claims description 11
- 125000005843 halogen group Chemical group 0.000 claims description 11
- 229910052708 sodium Inorganic materials 0.000 claims description 10
- 239000011734 sodium Substances 0.000 claims description 10
- 239000002904 solvent Substances 0.000 claims description 10
- 125000004390 alkyl sulfonyl group Chemical group 0.000 claims description 9
- 239000002585 base Substances 0.000 claims description 9
- 239000003054 catalyst Substances 0.000 claims description 8
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 8
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 8
- MNKBSXULTGYFFR-UHFFFAOYSA-N 5-amino-2h-triazole-4-carboxamide Chemical compound NC(=O)C1=NNN=C1N MNKBSXULTGYFFR-UHFFFAOYSA-N 0.000 claims description 7
- 125000001589 carboacyl group Chemical group 0.000 claims description 7
- 229910052799 carbon Inorganic materials 0.000 claims description 7
- 125000003302 alkenyloxy group Chemical group 0.000 claims description 6
- 125000004414 alkyl thio group Chemical group 0.000 claims description 6
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 6
- 238000010438 heat treatment Methods 0.000 claims description 6
- 125000004663 dialkyl amino group Chemical group 0.000 claims description 5
- 229910052783 alkali metal Inorganic materials 0.000 claims description 4
- 125000003342 alkenyl group Chemical group 0.000 claims description 4
- 125000003282 alkyl amino group Chemical group 0.000 claims description 4
- 125000000304 alkynyl group Chemical group 0.000 claims description 4
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 4
- 125000003884 phenylalkyl group Chemical group 0.000 claims description 4
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 4
- 125000005083 alkoxyalkoxy group Chemical group 0.000 claims description 3
- 125000005133 alkynyloxy group Chemical group 0.000 claims description 3
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 3
- 238000005984 hydrogenation reaction Methods 0.000 claims description 3
- 125000002768 hydroxyalkyl group Chemical group 0.000 claims description 3
- 125000000951 phenoxy group Chemical group [H]C1=C([H])C([H])=C(O*)C([H])=C1[H] 0.000 claims description 3
- 239000002841 Lewis acid Substances 0.000 claims description 2
- 125000002252 acyl group Chemical group 0.000 claims description 2
- 125000004453 alkoxycarbonyl group Chemical group 0.000 claims description 2
- 125000003277 amino group Chemical group 0.000 claims description 2
- 150000001450 anions Chemical class 0.000 claims description 2
- 125000000623 heterocyclic group Chemical group 0.000 claims description 2
- 150000007517 lewis acids Chemical class 0.000 claims description 2
- 229910052757 nitrogen Inorganic materials 0.000 claims description 2
- 239000003960 organic solvent Substances 0.000 claims description 2
- 150000003852 triazoles Chemical group 0.000 claims description 2
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 87
- 239000000243 solution Substances 0.000 description 84
- 239000007787 solid Substances 0.000 description 83
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 81
- 239000000203 mixture Substances 0.000 description 74
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 69
- 238000000354 decomposition reaction Methods 0.000 description 69
- LPXPTNMVRIOKMN-UHFFFAOYSA-M sodium nitrite Chemical compound [Na+].[O-]N=O LPXPTNMVRIOKMN-UHFFFAOYSA-M 0.000 description 46
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 39
- HEMHJVSKTPXQMS-UHFFFAOYSA-M sodium hydroxide Inorganic materials [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 38
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 27
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 27
- 239000000706 filtrate Substances 0.000 description 24
- 238000003756 stirring Methods 0.000 description 24
- 235000010288 sodium nitrite Nutrition 0.000 description 23
- VHRJWFYYZGIPIN-UHFFFAOYSA-N 5-(2-methoxyphenyl)triazolo[4,5-d]pyrimidin-7-one Chemical compound COC1=CC=CC=C1C1=NC(=O)C2=NN=NC2=N1 VHRJWFYYZGIPIN-UHFFFAOYSA-N 0.000 description 21
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 21
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 21
- 238000010992 reflux Methods 0.000 description 21
- 239000007858 starting material Substances 0.000 description 21
- 229960000583 acetic acid Drugs 0.000 description 18
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 16
- MWOJQSAVGFVBLR-UHFFFAOYSA-N 5-phenyltriazolo[4,5-d]pyrimidin-7-one Chemical compound N1=C2N=NN=C2C(=O)N=C1C1=CC=CC=C1 MWOJQSAVGFVBLR-UHFFFAOYSA-N 0.000 description 15
- 239000012362 glacial acetic acid Substances 0.000 description 15
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonium chloride Substances [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 13
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 12
- 235000011114 ammonium hydroxide Nutrition 0.000 description 12
- 239000003610 charcoal Substances 0.000 description 12
- 238000002360 preparation method Methods 0.000 description 11
- 239000000284 extract Substances 0.000 description 10
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 9
- 238000009835 boiling Methods 0.000 description 9
- 230000008569 process Effects 0.000 description 9
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 8
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 8
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 8
- 238000001816 cooling Methods 0.000 description 8
- 239000000047 product Substances 0.000 description 8
- UYLWKSJTHLRFBX-UHFFFAOYSA-N purin-6-one Chemical compound O=C1N=CN=C2N=CN=C12 UYLWKSJTHLRFBX-UHFFFAOYSA-N 0.000 description 8
- 238000001953 recrystallisation Methods 0.000 description 8
- GSEJCLTVZPLZKY-UHFFFAOYSA-N Triethanolamine Chemical compound OCCN(CCO)CCO GSEJCLTVZPLZKY-UHFFFAOYSA-N 0.000 description 7
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 7
- 238000002425 crystallisation Methods 0.000 description 7
- 230000008025 crystallization Effects 0.000 description 7
- 239000000463 material Substances 0.000 description 7
- 239000002244 precipitate Substances 0.000 description 7
- 239000011541 reaction mixture Substances 0.000 description 7
- QAOWNCQODCNURD-UHFFFAOYSA-N sulfuric acid Substances OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 7
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 6
- PIICEJLVQHRZGT-UHFFFAOYSA-N Ethylenediamine Chemical compound NCCN PIICEJLVQHRZGT-UHFFFAOYSA-N 0.000 description 6
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 6
- OIRDTQYFTABQOQ-KQYNXXCUSA-N adenosine Chemical compound C1=NC=2C(N)=NC=NC=2N1[C@@H]1O[C@H](CO)[C@@H](O)[C@H]1O OIRDTQYFTABQOQ-KQYNXXCUSA-N 0.000 description 6
- ANVQELVNTWIGHE-UHFFFAOYSA-N 5-(2-phenylmethoxyphenyl)triazolo[4,5-d]pyrimidin-7-one Chemical compound N1=C2N=NN=C2C(=O)N=C1C1=CC=CC=C1OCC1=CC=CC=C1 ANVQELVNTWIGHE-UHFFFAOYSA-N 0.000 description 5
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 5
- 238000006243 chemical reaction Methods 0.000 description 5
- 239000007788 liquid Substances 0.000 description 5
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 5
- 159000000000 sodium salts Chemical class 0.000 description 5
- 239000000725 suspension Substances 0.000 description 5
- 239000008096 xylene Substances 0.000 description 5
- AVNDDWQAXMEFCI-UHFFFAOYSA-N 3-carbamoyl-4-propoxybenzenesulfonyl chloride Chemical compound CCCOC1=CC=C(S(Cl)(=O)=O)C=C1C(N)=O AVNDDWQAXMEFCI-UHFFFAOYSA-N 0.000 description 4
- HGJHBQQHWLMRNX-UHFFFAOYSA-N 5-[2,5-bis(phenylmethoxy)phenyl]triazolo[4,5-d]pyrimidin-7-one Chemical compound N1=C2N=NN=C2C(=O)N=C1C(C(=CC=1)OCC=2C=CC=CC=2)=CC=1OCC1=CC=CC=C1 HGJHBQQHWLMRNX-UHFFFAOYSA-N 0.000 description 4
- 239000002126 C01EB10 - Adenosine Substances 0.000 description 4
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 4
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 4
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 4
- DKGAVHZHDRPRBM-UHFFFAOYSA-N Tert-Butanol Chemical compound CC(C)(C)O DKGAVHZHDRPRBM-UHFFFAOYSA-N 0.000 description 4
- 229960005305 adenosine Drugs 0.000 description 4
- 239000013566 allergen Substances 0.000 description 4
- 229910021529 ammonia Inorganic materials 0.000 description 4
- 229940095074 cyclic amp Drugs 0.000 description 4
- ZBCBWPMODOFKDW-UHFFFAOYSA-N diethanolamine Chemical compound OCCNCCO ZBCBWPMODOFKDW-UHFFFAOYSA-N 0.000 description 4
- 229910052739 hydrogen Inorganic materials 0.000 description 4
- 239000001257 hydrogen Substances 0.000 description 4
- 239000005457 ice water Substances 0.000 description 4
- 238000002329 infrared spectrum Methods 0.000 description 4
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 4
- 235000019341 magnesium sulphate Nutrition 0.000 description 4
- NUJOXMJBOLGQSY-UHFFFAOYSA-N manganese dioxide Chemical compound O=[Mn]=O NUJOXMJBOLGQSY-UHFFFAOYSA-N 0.000 description 4
- 239000003208 petroleum Substances 0.000 description 4
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 4
- 235000017557 sodium bicarbonate Nutrition 0.000 description 4
- GEHJYWRUCIMESM-UHFFFAOYSA-L sodium sulfite Chemical compound [Na+].[Na+].[O-]S([O-])=O GEHJYWRUCIMESM-UHFFFAOYSA-L 0.000 description 4
- 238000010186 staining Methods 0.000 description 4
- LKHLKWMQRMFFND-UHFFFAOYSA-N 2-propoxy-5-propylsulfonylbenzamide Chemical compound CCCOC1=CC=C(S(=O)(=O)CCC)C=C1C(N)=O LKHLKWMQRMFFND-UHFFFAOYSA-N 0.000 description 3
- UDZGWFXTLPDNOE-UHFFFAOYSA-N 2-propoxy-5-sulfanylbenzamide Chemical compound CCCOC1=CC=C(S)C=C1C(N)=O UDZGWFXTLPDNOE-UHFFFAOYSA-N 0.000 description 3
- JEBYWVVQIFAIOO-UHFFFAOYSA-N 3-(7-oxotriazolo[4,5-d]pyrimidin-5-yl)-4-propoxybenzoic acid Chemical compound CCCOC1=CC=C(C(O)=O)C=C1C1=NC(=O)C2=NN=NC2=N1 JEBYWVVQIFAIOO-UHFFFAOYSA-N 0.000 description 3
- PWPBUPJKWFLSMO-UHFFFAOYSA-N 5-(2-butoxyphenyl)triazolo[4,5-d]pyrimidin-7-one Chemical compound CCCCOC1=CC=CC=C1C1=NC(=O)C2=NN=NC2=N1 PWPBUPJKWFLSMO-UHFFFAOYSA-N 0.000 description 3
- VELQNVSWBVCSCN-UHFFFAOYSA-N 5-(2-methoxy-5-nitrophenyl)triazolo[4,5-d]pyrimidin-7-one Chemical compound COC1=CC=C([N+]([O-])=O)C=C1C1=NC(=O)C2=NN=NC2=N1 VELQNVSWBVCSCN-UHFFFAOYSA-N 0.000 description 3
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 3
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 3
- WMFOQBRAJBCJND-UHFFFAOYSA-M Lithium hydroxide Chemical compound [Li+].[OH-] WMFOQBRAJBCJND-UHFFFAOYSA-M 0.000 description 3
- REYJJPSVUYRZGE-UHFFFAOYSA-N Octadecylamine Chemical compound CCCCCCCCCCCCCCCCCCN REYJJPSVUYRZGE-UHFFFAOYSA-N 0.000 description 3
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 3
- 241000700159 Rattus Species 0.000 description 3
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 3
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 3
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 description 3
- 230000000172 allergic effect Effects 0.000 description 3
- 235000019270 ammonium chloride Nutrition 0.000 description 3
- 125000004429 atom Chemical group 0.000 description 3
- 208000010668 atopic eczema Diseases 0.000 description 3
- 125000000051 benzyloxy group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])O* 0.000 description 3
- 239000012043 crude product Substances 0.000 description 3
- 239000013078 crystal Substances 0.000 description 3
- 229940043237 diethanolamine Drugs 0.000 description 3
- 238000004821 distillation Methods 0.000 description 3
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 3
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 3
- 239000010410 layer Substances 0.000 description 3
- 210000004072 lung Anatomy 0.000 description 3
- 230000000144 pharmacologic effect Effects 0.000 description 3
- 239000012286 potassium permanganate Substances 0.000 description 3
- 229910052938 sodium sulfate Inorganic materials 0.000 description 3
- 235000011152 sodium sulphate Nutrition 0.000 description 3
- 239000012258 stirred mixture Substances 0.000 description 3
- CYNYIHKIEHGYOZ-UHFFFAOYSA-N 1-bromopropane Chemical compound CCCBr CYNYIHKIEHGYOZ-UHFFFAOYSA-N 0.000 description 2
- FPZWZCWUIYYYBU-UHFFFAOYSA-N 2-(2-ethoxyethoxy)ethyl acetate Chemical group CCOCCOCCOC(C)=O FPZWZCWUIYYYBU-UHFFFAOYSA-N 0.000 description 2
- NAMYKGVDVNBCFQ-UHFFFAOYSA-N 2-bromopropane Chemical compound CC(C)Br NAMYKGVDVNBCFQ-UHFFFAOYSA-N 0.000 description 2
- ZNQVEEAIQZEUHB-UHFFFAOYSA-N 2-ethoxyethanol Chemical compound CCOCCO ZNQVEEAIQZEUHB-UHFFFAOYSA-N 0.000 description 2
- 229940093475 2-ethoxyethanol Drugs 0.000 description 2
- 102000004008 5'-Nucleotidase Human genes 0.000 description 2
- NULGGFASZUWAAE-UHFFFAOYSA-N 5,6-diamino-2-(2-methoxyphenyl)-1h-pyrimidin-4-one Chemical compound COC1=CC=CC=C1C1=NC(N)=C(N)C(=O)N1 NULGGFASZUWAAE-UHFFFAOYSA-N 0.000 description 2
- OYYKCZZSAPKLBT-UHFFFAOYSA-N 5,6-diamino-2-(2-phenylethyl)-1h-pyrimidin-4-one Chemical compound N1C(=O)C(N)=C(N)N=C1CCC1=CC=CC=C1 OYYKCZZSAPKLBT-UHFFFAOYSA-N 0.000 description 2
- PCTJKIKGJMXSIT-UHFFFAOYSA-N 5,6-diamino-2-(5-propan-2-ylsulfonyl-2-propoxyphenyl)-1h-pyrimidin-4-one Chemical compound CCCOC1=CC=C(S(=O)(=O)C(C)C)C=C1C1=NC(N)=C(N)C(=O)N1 PCTJKIKGJMXSIT-UHFFFAOYSA-N 0.000 description 2
- HBLHROZXCJTNFO-UHFFFAOYSA-N 5,6-diamino-2-cyclohexyl-1h-pyrimidin-4-one Chemical compound N1C(=O)C(N)=C(N)N=C1C1CCCCC1 HBLHROZXCJTNFO-UHFFFAOYSA-N 0.000 description 2
- PSWVDOCXVLXVRS-UHFFFAOYSA-N 5,6-diamino-2-phenyl-1h-pyrimidin-4-one Chemical compound O=C1C(N)=C(N)NC(C=2C=CC=CC=2)=N1 PSWVDOCXVLXVRS-UHFFFAOYSA-N 0.000 description 2
- RNJULGUJQRUZJD-UHFFFAOYSA-N 5-(2,4-dimethoxyphenyl)triazolo[4,5-d]pyrimidin-7-one Chemical compound COC1=CC(OC)=CC=C1C1=NC(=O)C2=NN=NC2=N1 RNJULGUJQRUZJD-UHFFFAOYSA-N 0.000 description 2
- DXZVDNHSSHOFGB-UHFFFAOYSA-N 5-(2,5-dimethoxyphenyl)triazolo[4,5-d]pyrimidin-7-one Chemical compound COC1=CC=C(OC)C(C=2N=C3N=NN=C3C(=O)N=2)=C1 DXZVDNHSSHOFGB-UHFFFAOYSA-N 0.000 description 2
- SHCZZBSPOOZDPL-UHFFFAOYSA-N 5-(2-butan-2-yloxyphenyl)triazolo[4,5-d]pyrimidin-7-one Chemical compound CCC(C)OC1=C(C=CC=C1)C1=NC(=O)C2=NN=NC2=N1 SHCZZBSPOOZDPL-UHFFFAOYSA-N 0.000 description 2
- IMHAYSZIKLICHY-UHFFFAOYSA-N 5-(2-ethoxyethyl)triazolo[4,5-d]pyrimidin-7-one Chemical compound CCOCCC1=NC(=O)C2=NN=NC2=N1 IMHAYSZIKLICHY-UHFFFAOYSA-N 0.000 description 2
- GQIGKBHFSSGGFO-UHFFFAOYSA-N 5-(2-ethoxyphenyl)triazolo[4,5-d]pyrimidin-7-one Chemical compound CCOC1=CC=CC=C1C1=NC(=O)C2=NN=NC2=N1 GQIGKBHFSSGGFO-UHFFFAOYSA-N 0.000 description 2
- PKDPJVYJIUBURL-UHFFFAOYSA-N 5-(2-hexoxyphenyl)triazolo[4,5-d]pyrimidin-7-one Chemical compound CCCCCCOC1=CC=CC=C1C1=NC(=O)C2=NN=NC2=N1 PKDPJVYJIUBURL-UHFFFAOYSA-N 0.000 description 2
- UPPGAMMFVWCVSV-UHFFFAOYSA-N 5-(2-methoxy-5-methylphenyl)triazolo[4,5-d]pyrimidin-7-one Chemical compound COC1=CC=C(C)C=C1C1=NC(=O)C2=NN=NC2=N1 UPPGAMMFVWCVSV-UHFFFAOYSA-N 0.000 description 2
- CBYCXBJBENTNBG-UHFFFAOYSA-N 5-(2-methylpropylsulfonyl)-2-propoxybenzamide Chemical compound CCCOC1=CC=C(S(=O)(=O)CC(C)C)C=C1C(N)=O CBYCXBJBENTNBG-UHFFFAOYSA-N 0.000 description 2
- XNLQSWKOFFQRKX-UHFFFAOYSA-N 5-(2-methylpropylsulfonyl)-2-propoxybenzenecarboximidamide Chemical compound CCCOC1=CC=C(S(=O)(=O)CC(C)C)C=C1C(N)=N XNLQSWKOFFQRKX-UHFFFAOYSA-N 0.000 description 2
- MEBHOUPXBFVBDX-UHFFFAOYSA-N 5-(2-pentoxyphenyl)triazolo[4,5-d]pyrimidin-7-one Chemical compound CCCCCOC1=CC=CC=C1C1=NC(=O)C2=NN=NC2=N1 MEBHOUPXBFVBDX-UHFFFAOYSA-N 0.000 description 2
- BOZZUNZUZLESCX-UHFFFAOYSA-N 5-(2-propan-2-yloxyphenyl)triazolo[4,5-d]pyrimidin-7-one Chemical compound CC(C)OC1=CC=CC=C1C1=NC(=O)C2=NN=NC2=N1 BOZZUNZUZLESCX-UHFFFAOYSA-N 0.000 description 2
- KFMVHONQQFRNNH-UHFFFAOYSA-N 5-(2-propoxyphenyl)triazolo[4,5-d]pyrimidin-7-one Chemical compound CCCOC1=CC=CC=C1C1=NC(=O)C2=NN=NC2=N1 KFMVHONQQFRNNH-UHFFFAOYSA-N 0.000 description 2
- DAGLZXPXIQDQCP-UHFFFAOYSA-N 5-(5-methyl-2-propoxyphenyl)triazolo[4,5-d]pyrimidin-7-one Chemical compound CCCOC1=CC=C(C)C=C1C1=NC(=O)C2=NN=NC2=N1 DAGLZXPXIQDQCP-UHFFFAOYSA-N 0.000 description 2
- MTNYAAPEHLZVSZ-UHFFFAOYSA-N 5-(5-tert-butyl-2-methoxyphenyl)triazolo[4,5-d]pyrimidin-7-one Chemical compound COC1=CC=C(C(C)(C)C)C=C1C1=NC(=O)C2=NN=NC2=N1 MTNYAAPEHLZVSZ-UHFFFAOYSA-N 0.000 description 2
- BNZSTHUFEQJMRA-UHFFFAOYSA-N 5-[2-(3-methylbutoxy)phenyl]triazolo[4,5-d]pyrimidin-7-one Chemical compound CC(C)CCOC1=CC=CC=C1C1=NC(=O)C2=NN=NC2=N1 BNZSTHUFEQJMRA-UHFFFAOYSA-N 0.000 description 2
- NRJQTEGWPUKVLQ-UHFFFAOYSA-N 5-[2-methoxy-5-(trifluoromethyl)phenyl]triazolo[4,5-d]pyrimidin-7-one Chemical compound COC1=CC=C(C(F)(F)F)C=C1C1=NC(=O)C2=NN=NC2=N1 NRJQTEGWPUKVLQ-UHFFFAOYSA-N 0.000 description 2
- VYQDZXUCSMWCEX-UHFFFAOYSA-N 5-[3-(trifluoromethyl)phenyl]triazolo[4,5-d]pyrimidin-7-one Chemical compound FC(F)(F)C1=CC=CC(C=2N=C3N=NN=C3C(=O)N=2)=C1 VYQDZXUCSMWCEX-UHFFFAOYSA-N 0.000 description 2
- ZOPPLXRQIFXZLU-UHFFFAOYSA-N 5-methylsulfonyl-2-propoxybenzamide Chemical compound CCCOC1=CC=C(S(C)(=O)=O)C=C1C(N)=O ZOPPLXRQIFXZLU-UHFFFAOYSA-N 0.000 description 2
- ZVFWNAPRFVTXDA-UHFFFAOYSA-N 5-propan-2-ylsulfonyl-2-propoxybenzamide Chemical compound CCCOC1=CC=C(S(=O)(=O)C(C)C)C=C1C(N)=O ZVFWNAPRFVTXDA-UHFFFAOYSA-N 0.000 description 2
- QYGIKWZEVPFSOT-UHFFFAOYSA-N 5-propan-2-yltriazolo[4,5-d]pyrimidin-7-one Chemical compound CC(C)C1=NC(=O)C2=NN=NC2=N1 QYGIKWZEVPFSOT-UHFFFAOYSA-N 0.000 description 2
- WPJLCZDDAFKTLC-UHFFFAOYSA-N 6-amino-2-[5-(2-methylpropylsulfonyl)-2-propoxyphenyl]-5-nitroso-1h-pyrimidin-4-one Chemical compound CCCOC1=CC=C(S(=O)(=O)CC(C)C)C=C1C1=NC(N)=C(N=O)C(=O)N1 WPJLCZDDAFKTLC-UHFFFAOYSA-N 0.000 description 2
- MUQZLEQADPGCHM-UHFFFAOYSA-N 6-amino-5-nitroso-2-(2-propoxy-5-propylsulfonylphenyl)-1h-pyrimidin-4-one Chemical compound CCCOC1=CC=C(S(=O)(=O)CCC)C=C1C1=NC(N)=C(N=O)C(=O)N1 MUQZLEQADPGCHM-UHFFFAOYSA-N 0.000 description 2
- KZMGYPLQYOPHEL-UHFFFAOYSA-N Boron trifluoride etherate Chemical compound FB(F)F.CCOCC KZMGYPLQYOPHEL-UHFFFAOYSA-N 0.000 description 2
- COXVTLYNGOIATD-HVMBLDELSA-N CC1=C(C=CC(=C1)C1=CC(C)=C(C=C1)\N=N\C1=C(O)C2=C(N)C(=CC(=C2C=C1)S(O)(=O)=O)S(O)(=O)=O)\N=N\C1=CC=C2C(=CC(=C(N)C2=C1O)S(O)(=O)=O)S(O)(=O)=O Chemical compound CC1=C(C=CC(=C1)C1=CC(C)=C(C=C1)\N=N\C1=C(O)C2=C(N)C(=CC(=C2C=C1)S(O)(=O)=O)S(O)(=O)=O)\N=N\C1=CC=C2C(=CC(=C(N)C2=C1O)S(O)(=O)=O)S(O)(=O)=O COXVTLYNGOIATD-HVMBLDELSA-N 0.000 description 2
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 2
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 2
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 description 2
- 239000005909 Kieselgur Substances 0.000 description 2
- 241001465754 Metazoa Species 0.000 description 2
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 2
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 2
- WCUXLLCKKVVCTQ-UHFFFAOYSA-M Potassium chloride Chemical compound [Cl-].[K+] WCUXLLCKKVVCTQ-UHFFFAOYSA-M 0.000 description 2
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 2
- AZFNGPAYDKGCRB-XCPIVNJJSA-M [(1s,2s)-2-amino-1,2-diphenylethyl]-(4-methylphenyl)sulfonylazanide;chlororuthenium(1+);1-methyl-4-propan-2-ylbenzene Chemical compound [Ru+]Cl.CC(C)C1=CC=C(C)C=C1.C1=CC(C)=CC=C1S(=O)(=O)[N-][C@@H](C=1C=CC=CC=1)[C@@H](N)C1=CC=CC=C1 AZFNGPAYDKGCRB-XCPIVNJJSA-M 0.000 description 2
- 150000001335 aliphatic alkanes Chemical class 0.000 description 2
- 239000000908 ammonium hydroxide Substances 0.000 description 2
- 229940040526 anhydrous sodium acetate Drugs 0.000 description 2
- 239000007864 aqueous solution Substances 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- 239000001045 blue dye Substances 0.000 description 2
- 230000037396 body weight Effects 0.000 description 2
- WTEOIRVLGSZEPR-UHFFFAOYSA-N boron trifluoride Chemical compound FB(F)F WTEOIRVLGSZEPR-UHFFFAOYSA-N 0.000 description 2
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 2
- 229910052794 bromium Inorganic materials 0.000 description 2
- NRLUTQOYJUHOOC-UHFFFAOYSA-N butyl 3-(7-oxotriazolo[4,5-d]pyrimidin-5-yl)-4-propoxybenzoate Chemical compound CCCCOC(=O)C1=CC=C(OCCC)C(C=2N=C3N=NN=C3C(=O)N=2)=C1 NRLUTQOYJUHOOC-UHFFFAOYSA-N 0.000 description 2
- 238000009903 catalytic hydrogenation reaction Methods 0.000 description 2
- 150000001768 cations Chemical class 0.000 description 2
- 239000003153 chemical reaction reagent Substances 0.000 description 2
- 239000000460 chlorine Substances 0.000 description 2
- 229910052801 chlorine Inorganic materials 0.000 description 2
- 125000001309 chloro group Chemical group Cl* 0.000 description 2
- NEHMKBQYUWJMIP-UHFFFAOYSA-N chloromethane Chemical compound ClC NEHMKBQYUWJMIP-UHFFFAOYSA-N 0.000 description 2
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 2
- HPNMFZURTQLUMO-UHFFFAOYSA-N diethylamine Chemical compound CCNCC HPNMFZURTQLUMO-UHFFFAOYSA-N 0.000 description 2
- 229920001971 elastomer Polymers 0.000 description 2
- 238000006911 enzymatic reaction Methods 0.000 description 2
- 229960003699 evans blue Drugs 0.000 description 2
- 229910052731 fluorine Inorganic materials 0.000 description 2
- 239000011737 fluorine Substances 0.000 description 2
- 125000001153 fluoro group Chemical group F* 0.000 description 2
- 229910000042 hydrogen bromide Inorganic materials 0.000 description 2
- 230000007062 hydrolysis Effects 0.000 description 2
- 238000006460 hydrolysis reaction Methods 0.000 description 2
- 238000002347 injection Methods 0.000 description 2
- 239000007924 injection Substances 0.000 description 2
- 239000011872 intimate mixture Substances 0.000 description 2
- 239000000155 melt Substances 0.000 description 2
- 230000008018 melting Effects 0.000 description 2
- 238000002844 melting Methods 0.000 description 2
- 210000001589 microsome Anatomy 0.000 description 2
- 239000012044 organic layer Substances 0.000 description 2
- KJIFKLIQANRMOU-UHFFFAOYSA-N oxidanium;4-methylbenzenesulfonate Chemical compound O.CC1=CC=C(S(O)(=O)=O)C=C1 KJIFKLIQANRMOU-UHFFFAOYSA-N 0.000 description 2
- 125000002071 phenylalkoxy group Chemical group 0.000 description 2
- 229920001467 poly(styrenesulfonates) Polymers 0.000 description 2
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 2
- 239000004304 potassium nitrite Substances 0.000 description 2
- 235000010289 potassium nitrite Nutrition 0.000 description 2
- 108010043671 prostatic acid phosphatase Proteins 0.000 description 2
- 238000000746 purification Methods 0.000 description 2
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 2
- 230000009467 reduction Effects 0.000 description 2
- 208000023504 respiratory system disease Diseases 0.000 description 2
- 229910000029 sodium carbonate Inorganic materials 0.000 description 2
- JVBXVOWTABLYPX-UHFFFAOYSA-L sodium dithionite Chemical compound [Na+].[Na+].[O-]S(=O)S([O-])=O JVBXVOWTABLYPX-UHFFFAOYSA-L 0.000 description 2
- 235000010265 sodium sulphite Nutrition 0.000 description 2
- 238000001179 sorption measurement Methods 0.000 description 2
- 238000003786 synthesis reaction Methods 0.000 description 2
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 2
- ITMCEJHCFYSIIV-UHFFFAOYSA-N triflic acid Chemical compound OS(=O)(=O)C(F)(F)F ITMCEJHCFYSIIV-UHFFFAOYSA-N 0.000 description 2
- 238000005406 washing Methods 0.000 description 2
- 229910052725 zinc Inorganic materials 0.000 description 2
- 239000011701 zinc Substances 0.000 description 2
- JWZZKOKVBUJMES-UHFFFAOYSA-N (+-)-Isoprenaline Chemical compound CC(C)NCC(O)C1=CC=C(O)C(O)=C1 JWZZKOKVBUJMES-UHFFFAOYSA-N 0.000 description 1
- NWUYHJFMYQTDRP-UHFFFAOYSA-N 1,2-bis(ethenyl)benzene;1-ethenyl-2-ethylbenzene;styrene Chemical compound C=CC1=CC=CC=C1.CCC1=CC=CC=C1C=C.C=CC1=CC=CC=C1C=C NWUYHJFMYQTDRP-UHFFFAOYSA-N 0.000 description 1
- KEQGZUUPPQEDPF-UHFFFAOYSA-N 1,3-dichloro-5,5-dimethylimidazolidine-2,4-dione Chemical compound CC1(C)N(Cl)C(=O)N(Cl)C1=O KEQGZUUPPQEDPF-UHFFFAOYSA-N 0.000 description 1
- BTUGGGLMQBJCBN-UHFFFAOYSA-N 1-iodo-2-methylpropane Chemical compound CC(C)CI BTUGGGLMQBJCBN-UHFFFAOYSA-N 0.000 description 1
- 125000001637 1-naphthyl group Chemical group [H]C1=C([H])C([H])=C2C(*)=C([H])C([H])=C([H])C2=C1[H] 0.000 description 1
- CNRNYORZJGVOSY-UHFFFAOYSA-N 2,5-diphenyl-1,3-oxazole Chemical compound C=1N=C(C=2C=CC=CC=2)OC=1C1=CC=CC=C1 CNRNYORZJGVOSY-UHFFFAOYSA-N 0.000 description 1
- GHQRNWCBBBALFR-UHFFFAOYSA-N 2-(2-fluorophenyl)-1H-pyrimidin-6-one Chemical compound FC1=C(C=CC=C1)C=1NC(C=CN=1)=O GHQRNWCBBBALFR-UHFFFAOYSA-N 0.000 description 1
- 125000004182 2-chlorophenyl group Chemical group [H]C1=C([H])C(Cl)=C(*)C([H])=C1[H] 0.000 description 1
- 239000001763 2-hydroxyethyl(trimethyl)azanium Substances 0.000 description 1
- 125000004204 2-methoxyphenyl group Chemical group [H]C1=C([H])C(*)=C(OC([H])([H])[H])C([H])=C1[H] 0.000 description 1
- AHIMOHXTPNWNAI-UHFFFAOYSA-N 2-propoxy-5-propylsulfonylbenzenecarboximidamide;hydrochloride Chemical compound Cl.CCCOC1=CC=C(S(=O)(=O)CCC)C=C1C(N)=N AHIMOHXTPNWNAI-UHFFFAOYSA-N 0.000 description 1
- FAVIQMSTEFBUJX-UHFFFAOYSA-N 2-propoxybenzamide Chemical compound CCCOC1=CC=CC=C1C(N)=O FAVIQMSTEFBUJX-UHFFFAOYSA-N 0.000 description 1
- RGIPZYBGETZBFO-UHFFFAOYSA-N 2-propylsulfonylbenzamide Chemical compound CCCS(=O)(=O)C1=CC=CC=C1C(N)=O RGIPZYBGETZBFO-UHFFFAOYSA-N 0.000 description 1
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 1
- 125000004207 3-methoxyphenyl group Chemical group [H]C1=C([H])C(*)=C([H])C(OC([H])([H])[H])=C1[H] 0.000 description 1
- GHIBSJFUHQQTDH-UHFFFAOYSA-N 4,5-diamino-2-(1,1-diphenylethyl)-1H-pyrimidin-6-one Chemical compound C=1C=CC=CC=1C(C=1NC(=O)C(N)=C(N)N=1)(C)C1=CC=CC=C1 GHIBSJFUHQQTDH-UHFFFAOYSA-N 0.000 description 1
- MYGFLVNHSSAKGD-UHFFFAOYSA-N 4,5-diamino-2-(2-butan-2-yloxyphenyl)-1H-pyrimidin-6-one Chemical compound CCC(C)OC1=CC=CC=C1C1=NC(N)=C(N)C(=O)N1 MYGFLVNHSSAKGD-UHFFFAOYSA-N 0.000 description 1
- QCKZSFAHMGYLCD-UHFFFAOYSA-N 4,5-diamino-2-(2-butylsulfonylphenyl)-1H-pyrimidin-6-one Chemical compound CCCCS(=O)(=O)C1=CC=CC=C1C1=NC(N)=C(N)C(=O)N1 QCKZSFAHMGYLCD-UHFFFAOYSA-N 0.000 description 1
- OLAICWPSCVLBFX-UHFFFAOYSA-N 4,5-diamino-2-(2-methoxy-3-methylphenyl)-1H-pyrimidin-6-one Chemical compound COC1=C(C)C=CC=C1C1=NC(N)=C(N)C(=O)N1 OLAICWPSCVLBFX-UHFFFAOYSA-N 0.000 description 1
- XJPFGTMLSXBMMS-UHFFFAOYSA-N 4,5-diamino-2-(2-methoxy-4-phenylmethoxyphenyl)-1H-pyrimidin-6-one Chemical compound C=1C=C(C=2NC(=O)C(N)=C(N)N=2)C(OC)=CC=1OCC1=CC=CC=C1 XJPFGTMLSXBMMS-UHFFFAOYSA-N 0.000 description 1
- SHKJIZZBMVRABX-UHFFFAOYSA-N 4,5-diamino-2-(2-methoxy-5-methylphenyl)-1H-pyrimidin-6-one Chemical compound COC1=CC=C(C)C=C1C1=NC(N)=C(N)C(=O)N1 SHKJIZZBMVRABX-UHFFFAOYSA-N 0.000 description 1
- GHAMBVIBUWCSJE-UHFFFAOYSA-N 4,5-diamino-2-(2-phenylmethoxyphenyl)-1H-pyrimidin-6-one Chemical compound N1C(=O)C(N)=C(N)N=C1C1=CC=CC=C1OCC1=CC=CC=C1 GHAMBVIBUWCSJE-UHFFFAOYSA-N 0.000 description 1
- DABARHSYABIUGQ-UHFFFAOYSA-N 4,5-diamino-2-(2-propan-2-yloxyphenyl)-1H-pyrimidin-6-one Chemical compound CC(C)OC1=CC=CC=C1C1=NC(N)=C(N)C(=O)N1 DABARHSYABIUGQ-UHFFFAOYSA-N 0.000 description 1
- NUFNHLJQZYDWOA-UHFFFAOYSA-N 4,5-diamino-2-(4-benzylphenyl)-1H-pyrimidin-6-one Chemical compound N1C(=O)C(N)=C(N)N=C1C(C=C1)=CC=C1CC1=CC=CC=C1 NUFNHLJQZYDWOA-UHFFFAOYSA-N 0.000 description 1
- CTARVCDFAZIIOF-UHFFFAOYSA-N 4,5-diamino-2-(4-chlorophenyl)-1H-pyrimidin-6-one Chemical compound N1C(=O)C(N)=C(N)N=C1C1=CC=C(Cl)C=C1 CTARVCDFAZIIOF-UHFFFAOYSA-N 0.000 description 1
- RPSHYHFCBIHBTQ-UHFFFAOYSA-N 4,5-diamino-2-(4-hexoxyphenyl)-1H-pyrimidin-6-one Chemical compound C1=CC(OCCCCCC)=CC=C1C1=NC(N)=C(N)C(=O)N1 RPSHYHFCBIHBTQ-UHFFFAOYSA-N 0.000 description 1
- RTZNDVBALHUPNY-UHFFFAOYSA-N 4,5-diamino-2-(4-methoxyphenyl)-1H-pyrimidin-6-one Chemical compound C1=CC(OC)=CC=C1C1=NC(N)=C(N)C(=O)N1 RTZNDVBALHUPNY-UHFFFAOYSA-N 0.000 description 1
- YMEPAVTXBVEQCG-UHFFFAOYSA-N 4,5-diamino-2-[2,5-bis(phenylmethoxy)phenyl]-1H-pyrimidin-6-one Chemical compound N1C(=O)C(N)=C(N)N=C1C1=CC(OCC=2C=CC=CC=2)=CC=C1OCC1=CC=CC=C1 YMEPAVTXBVEQCG-UHFFFAOYSA-N 0.000 description 1
- WBTGIYZUSMJKFS-UHFFFAOYSA-N 4,5-diamino-2-[2-methoxy-5-(trifluoromethyl)phenyl]-1H-pyrimidin-6-one Chemical compound COC1=CC=C(C(F)(F)F)C=C1C1=NC(N)=C(N)C(=O)N1 WBTGIYZUSMJKFS-UHFFFAOYSA-N 0.000 description 1
- MGIDJOQVLGLMPF-UHFFFAOYSA-N 4,5-diamino-2-[3-(trifluoromethyl)phenyl]-1H-pyrimidin-6-one Chemical compound N1C(=O)C(N)=C(N)N=C1C1=CC=CC(C(F)(F)F)=C1 MGIDJOQVLGLMPF-UHFFFAOYSA-N 0.000 description 1
- DOXCHIKUNBKRPU-UHFFFAOYSA-N 4,5-diamino-2-butyl-1H-pyrimidin-6-one Chemical compound CCCCC1=NC(N)=C(N)C(=O)N1 DOXCHIKUNBKRPU-UHFFFAOYSA-N 0.000 description 1
- RFNLJUXHKIRHPZ-UHFFFAOYSA-N 4,5-diamino-2-naphthalen-1-yl-1H-pyrimidin-6-one Chemical compound N1C(=O)C(N)=C(N)N=C1C1=CC=CC2=CC=CC=C12 RFNLJUXHKIRHPZ-UHFFFAOYSA-N 0.000 description 1
- IBOLPQCWZNWINP-UHFFFAOYSA-N 4,5-diamino-2-naphthalen-2-yl-1H-pyrimidin-6-one Chemical compound N1C(=O)C(N)=C(N)N=C1C1=CC=C(C=CC=C2)C2=C1 IBOLPQCWZNWINP-UHFFFAOYSA-N 0.000 description 1
- 125000004203 4-hydroxyphenyl group Chemical group [H]OC1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- FRIDYJADHWULRP-UHFFFAOYSA-N 5,6-diamino-2-(2-propoxy-5-propylsulfonylphenyl)-1h-pyrimidin-4-one Chemical compound CCCOC1=CC=C(S(=O)(=O)CCC)C=C1C1=NC(N)=C(N)C(=O)N1 FRIDYJADHWULRP-UHFFFAOYSA-N 0.000 description 1
- YLVZOEKLCUJRSK-UHFFFAOYSA-N 5,6-diamino-2-(2-propoxyphenyl)-1h-pyrimidin-4-one Chemical compound CCCOC1=CC=CC=C1C1=NC(N)=C(N)C(=O)N1 YLVZOEKLCUJRSK-UHFFFAOYSA-N 0.000 description 1
- LOKASWVKOWKDGY-UHFFFAOYSA-N 5,6-diamino-2-(5-methyl-2-propoxyphenyl)-1h-pyrimidin-4-one Chemical compound CCCOC1=CC=C(C)C=C1C1=NC(N)=C(N)C(=O)N1 LOKASWVKOWKDGY-UHFFFAOYSA-N 0.000 description 1
- VRZHPPHPPDUATB-UHFFFAOYSA-N 5,6-diamino-2-(5-methylsulfonyl-2-propoxyphenyl)-1h-pyrimidin-4-one Chemical compound CCCOC1=CC=C(S(C)(=O)=O)C=C1C1=NC(N)=C(N)C(=O)N1 VRZHPPHPPDUATB-UHFFFAOYSA-N 0.000 description 1
- WINSOTNVYPBJLF-UHFFFAOYSA-N 5,6-diamino-2-benzyl-1h-pyrimidin-4-one Chemical compound N1C(=O)C(N)=C(N)N=C1CC1=CC=CC=C1 WINSOTNVYPBJLF-UHFFFAOYSA-N 0.000 description 1
- IJLVNMMEVNOQCL-UHFFFAOYSA-N 5,6-diamino-2-propan-2-yl-1h-pyrimidin-4-one Chemical compound CC(C)C1=NC(N)=C(N)C(=O)N1 IJLVNMMEVNOQCL-UHFFFAOYSA-N 0.000 description 1
- AAMJZVJAVZNTSI-UHFFFAOYSA-N 5-(2,3-dimethoxyphenyl)triazolo[4,5-d]pyrimidin-7-one Chemical compound COC1=CC=CC(C=2N=C3N=NN=C3C(=O)N=2)=C1OC AAMJZVJAVZNTSI-UHFFFAOYSA-N 0.000 description 1
- QNRWNAVZKQDJTE-UHFFFAOYSA-N 5-(2,6-dimethoxyphenyl)triazolo[4,5-d]pyrimidin-7-one Chemical compound COC1=CC=CC(OC)=C1C1=NC(=O)C2=NN=NC2=N1 QNRWNAVZKQDJTE-UHFFFAOYSA-N 0.000 description 1
- GXASFSAHVIHLSO-UHFFFAOYSA-N 5-(2-bromophenyl)triazolo[4,5-d]pyrimidin-7-one Chemical compound BrC1=CC=CC=C1C1=NC(=O)C2=NN=NC2=N1 GXASFSAHVIHLSO-UHFFFAOYSA-N 0.000 description 1
- VAJISNABCYHYGY-UHFFFAOYSA-N 5-(2-butylsulfonylphenyl)triazolo[4,5-d]pyrimidin-7-one Chemical compound CCCCS(=O)(=O)C1=CC=CC=C1C1=NC(=O)C2=NN=NC2=N1 VAJISNABCYHYGY-UHFFFAOYSA-N 0.000 description 1
- JUCYPRBNXCSZRD-UHFFFAOYSA-N 5-(2-chlorophenyl)triazolo[4,5-d]pyrimidin-7-one Chemical compound ClC1=CC=CC=C1C1=NC(=O)C2=NN=NC2=N1 JUCYPRBNXCSZRD-UHFFFAOYSA-N 0.000 description 1
- KWSOXDITLBEMFQ-UHFFFAOYSA-N 5-(2-decoxyphenyl)triazolo[4,5-d]pyrimidin-7-one Chemical compound CCCCCCCCCCOC1=CC=CC=C1C1=NC(=O)C2=NN=NC2=N1 KWSOXDITLBEMFQ-UHFFFAOYSA-N 0.000 description 1
- XSDKEBZNQQEAQN-UHFFFAOYSA-N 5-(2-fluorophenyl)triazolo[4,5-d]pyrimidin-7-one Chemical compound FC1=CC=CC=C1C1=NC(=O)C2=NN=NC2=N1 XSDKEBZNQQEAQN-UHFFFAOYSA-N 0.000 description 1
- QKGHPSBOLQMKOM-UHFFFAOYSA-N 5-(2-hydroxyphenyl)triazolo[4,5-d]pyrimidin-7-one Chemical compound OC1=CC=CC=C1C1=NC(=O)C2=NN=NC2=N1 QKGHPSBOLQMKOM-UHFFFAOYSA-N 0.000 description 1
- XJUUFRZICJZOCE-UHFFFAOYSA-N 5-(2-methoxy-3,5-dimethylphenyl)triazolo[4,5-d]pyrimidin-7-one Chemical compound COC1=C(C)C=C(C)C=C1C1=NC(=O)C2=NN=NC2=N1 XJUUFRZICJZOCE-UHFFFAOYSA-N 0.000 description 1
- VRINTRHQFRRYKN-UHFFFAOYSA-N 5-(2-methoxy-3-methylphenyl)triazolo[4,5-d]pyrimidin-7-one Chemical compound COC1=C(C)C=CC=C1C1=NC(=O)C2=NN=NC2=N1 VRINTRHQFRRYKN-UHFFFAOYSA-N 0.000 description 1
- GVUFTDKXGFOTCG-UHFFFAOYSA-N 5-(2-methoxy-4-phenylmethoxyphenyl)triazolo[4,5-d]pyrimidin-7-one Chemical compound C=1C=C(C=2N=C3N=NN=C3C(=O)N=2)C(OC)=CC=1OCC1=CC=CC=C1 GVUFTDKXGFOTCG-UHFFFAOYSA-N 0.000 description 1
- RDHOJNWAICNYIB-UHFFFAOYSA-N 5-(2-methoxy-5-phenylmethoxyphenyl)triazolo[4,5-d]pyrimidin-7-one Chemical compound C1=C(C=2N=C3N=NN=C3C(=O)N=2)C(OC)=CC=C1OCC1=CC=CC=C1 RDHOJNWAICNYIB-UHFFFAOYSA-N 0.000 description 1
- LFAPFMRQWXGYQQ-UHFFFAOYSA-N 5-(2-methoxyphenyl)triazolo[4,5-d]pyrimidin-7-one hydrate Chemical compound O.COC1=CC=CC=C1C1=NC(=O)C2=NN=NC2=N1 LFAPFMRQWXGYQQ-UHFFFAOYSA-N 0.000 description 1
- ZYZFMJGDCIVIJY-UHFFFAOYSA-N 5-(2-methylphenyl)triazolo[4,5-d]pyrimidin-7-one Chemical compound CC1=CC=CC=C1C1=NC(=O)C2=NN=NC2=N1 ZYZFMJGDCIVIJY-UHFFFAOYSA-N 0.000 description 1
- SWDZHSXPDWMYLI-UHFFFAOYSA-N 5-(2-methylpropyl)triazolo[4,5-d]pyrimidin-7-one Chemical compound CC(C)CC1=NC(=O)C2=NN=NC2=N1 SWDZHSXPDWMYLI-UHFFFAOYSA-N 0.000 description 1
- VQSCDOKZSDMVMC-UHFFFAOYSA-N 5-(2-methylsulfanylphenyl)triazolo[4,5-d]pyrimidin-7-one hydrate Chemical compound O.CSC1=CC=CC=C1C1=NC(=O)C2=NN=NC2=N1 VQSCDOKZSDMVMC-UHFFFAOYSA-N 0.000 description 1
- BZWLPQKGZUOIQG-UHFFFAOYSA-N 5-(2-phenoxyphenyl)triazolo[4,5-d]pyrimidin-7-one Chemical compound N1=C2N=NN=C2C(=O)N=C1C1=CC=CC=C1OC1=CC=CC=C1 BZWLPQKGZUOIQG-UHFFFAOYSA-N 0.000 description 1
- HXNYDVLPVUWHCY-UHFFFAOYSA-N 5-(2-phenylethyl)triazolo[4,5-d]pyrimidin-7-one Chemical compound N1=C2N=NN=C2C(=O)N=C1CCC1=CC=CC=C1 HXNYDVLPVUWHCY-UHFFFAOYSA-N 0.000 description 1
- ICOBPEKMKRABAM-UHFFFAOYSA-N 5-(2-propoxy-5-propylsulfonylphenyl)triazolo[4,5-d]pyrimidin-7-one Chemical compound CCCOC1=CC=C(S(=O)(=O)CCC)C=C1C1=NC(=O)C2=NN=NC2=N1 ICOBPEKMKRABAM-UHFFFAOYSA-N 0.000 description 1
- CVFVVGZXYIUNNP-UHFFFAOYSA-N 5-(3,4-dimethoxyphenyl)triazolo[4,5-d]pyrimidin-7-one Chemical compound C1=C(OC)C(OC)=CC=C1C1=NC(=O)C2=NN=NC2=N1 CVFVVGZXYIUNNP-UHFFFAOYSA-N 0.000 description 1
- PXPLPQULSFVSFZ-UHFFFAOYSA-N 5-(3,5-dichloro-2-methoxyphenyl)triazolo[4,5-d]pyrimidin-7-one Chemical compound COC1=C(Cl)C=C(Cl)C=C1C1=NC(=O)C2=NN=NC2=N1 PXPLPQULSFVSFZ-UHFFFAOYSA-N 0.000 description 1
- ROHSPRNEXGAFBJ-UHFFFAOYSA-N 5-(3,5-dimethoxyphenyl)triazolo[4,5-d]pyrimidin-7-one Chemical compound COC1=CC(OC)=CC(C=2N=C3N=NN=C3C(=O)N=2)=C1 ROHSPRNEXGAFBJ-UHFFFAOYSA-N 0.000 description 1
- PZOHRQSLBIZCED-UHFFFAOYSA-N 5-(3-benzylphenyl)triazolo[4,5-d]pyrimidin-7-one Chemical compound N1=C2N=NN=C2C(=O)N=C1C(C=1)=CC=CC=1CC1=CC=CC=C1 PZOHRQSLBIZCED-UHFFFAOYSA-N 0.000 description 1
- RGYJMMACWDLASD-UHFFFAOYSA-N 5-(3-hexoxyphenyl)triazolo[4,5-d]pyrimidin-7-one Chemical compound CCCCCCOC1=CC=CC(C=2N=C3N=NN=C3C(=O)N=2)=C1 RGYJMMACWDLASD-UHFFFAOYSA-N 0.000 description 1
- XMQUQHXJQVRGQP-UHFFFAOYSA-N 5-(3-methoxyphenyl)triazolo[4,5-d]pyrimidin-7-one Chemical compound COC1=CC=CC(C=2N=C3N=NN=C3C(=O)N=2)=C1 XMQUQHXJQVRGQP-UHFFFAOYSA-N 0.000 description 1
- VONIKQIEZNTXQD-UHFFFAOYSA-N 5-(3-methylphenyl)triazolo[4,5-d]pyrimidin-7-one Chemical compound CC1=CC=CC(C=2N=C3N=NN=C3C(=O)N=2)=C1 VONIKQIEZNTXQD-UHFFFAOYSA-N 0.000 description 1
- SWBHRENAWYYJIH-UHFFFAOYSA-N 5-(3-methylsulfanylphenyl)triazolo[4,5-d]pyrimidin-7-one Chemical compound CSC1=CC=CC(C=2N=C3N=NN=C3C(=O)N=2)=C1 SWBHRENAWYYJIH-UHFFFAOYSA-N 0.000 description 1
- FIGHAPNCJWVCEV-UHFFFAOYSA-N 5-(3-nitrophenyl)triazolo[4,5-d]pyrimidin-7-one hydrate Chemical compound O.[O-][N+](=O)C1=CC=CC(C=2N=C3N=NN=C3C(=O)N=2)=C1 FIGHAPNCJWVCEV-UHFFFAOYSA-N 0.000 description 1
- NEKFIQREWWTWJO-UHFFFAOYSA-N 5-(4-benzylphenyl)triazolo[4,5-d]pyrimidin-7-one Chemical compound N1=C2N=NN=C2C(=O)N=C1C(C=C1)=CC=C1CC1=CC=CC=C1 NEKFIQREWWTWJO-UHFFFAOYSA-N 0.000 description 1
- WJLXNHZJQAPZBJ-UHFFFAOYSA-N 5-(4-chlorophenyl)triazolo[4,5-d]pyrimidin-7-one Chemical compound C1=CC(Cl)=CC=C1C1=NC(=O)C2=NN=NC2=N1 WJLXNHZJQAPZBJ-UHFFFAOYSA-N 0.000 description 1
- AJIMOKCYNVKDGA-UHFFFAOYSA-N 5-(4-methoxyphenyl)triazolo[4,5-d]pyrimidin-7-one Chemical compound C1=CC(OC)=CC=C1C1=NC(=O)C2=NN=NC2=N1 AJIMOKCYNVKDGA-UHFFFAOYSA-N 0.000 description 1
- PXPOBMUXXDTEFB-UHFFFAOYSA-N 5-(4-methylphenyl)triazolo[4,5-d]pyrimidin-7-one Chemical compound C1=CC(C)=CC=C1C1=NC(=O)C2=NN=NC2=N1 PXPOBMUXXDTEFB-UHFFFAOYSA-N 0.000 description 1
- RYSFNHHSIDIUJW-UHFFFAOYSA-N 5-(4-methylsulfonylphenyl)triazolo[4,5-d]pyrimidin-7-one Chemical compound C1=CC(S(=O)(=O)C)=CC=C1C1=NC(=O)C2=NN=NC2=N1 RYSFNHHSIDIUJW-UHFFFAOYSA-N 0.000 description 1
- QGZWOWFPTHJDNM-UHFFFAOYSA-N 5-(5-amino-2-methoxyphenyl)triazolo[4,5-d]pyrimidin-7-one Chemical compound COC1=CC=C(N)C=C1C1=NC(=O)C2=NN=NC2=N1 QGZWOWFPTHJDNM-UHFFFAOYSA-N 0.000 description 1
- YFTDUHOUVFBQAF-UHFFFAOYSA-N 5-(5-hydroxy-2-methoxyphenyl)triazolo[4,5-d]pyrimidin-7-one Chemical compound COC1=CC=C(O)C=C1C1=NC(=O)C2=NN=NC2=N1 YFTDUHOUVFBQAF-UHFFFAOYSA-N 0.000 description 1
- UIKHSFLWZYZIIJ-UHFFFAOYSA-N 5-(5-propan-2-ylsulfonyl-2-propoxyphenyl)triazolo[4,5-d]pyrimidin-7-one Chemical compound CCCOC1=CC=C(S(=O)(=O)C(C)C)C=C1C1=NC(=O)C2=NN=NC2=N1 UIKHSFLWZYZIIJ-UHFFFAOYSA-N 0.000 description 1
- UWTGMGNRGHESJY-UHFFFAOYSA-N 5-[2-(dimethylamino)phenyl]triazolo[4,5-d]pyrimidin-7-one Chemical compound CN(C)C1=CC=CC=C1C1=NC(=O)C2=NN=NC2=N1 UWTGMGNRGHESJY-UHFFFAOYSA-N 0.000 description 1
- CCISISMZMIJREF-UHFFFAOYSA-N 5-[3-(dimethylamino)phenyl]triazolo[4,5-d]pyrimidin-7-one Chemical compound CN(C)C1=CC=CC(C=2N=C3N=NN=C3C(=O)N=2)=C1 CCISISMZMIJREF-UHFFFAOYSA-N 0.000 description 1
- ZCTNOJWLLOKGAX-UHFFFAOYSA-N 5-[5-(2-methylpropylsulfonyl)-2-propoxyphenyl]triazolo[4,5-d]pyrimidin-7-one Chemical compound CCCOC1=CC=C(S(=O)(=O)CC(C)C)C=C1C1=NC(=O)C2=NN=NC2=N1 ZCTNOJWLLOKGAX-UHFFFAOYSA-N 0.000 description 1
- KPCGULIEMKLEBX-UHFFFAOYSA-N 5-benzamido-2h-triazole-4-carboxamide Chemical compound N1=NNC(NC(=O)C=2C=CC=CC=2)=C1C(=O)N KPCGULIEMKLEBX-UHFFFAOYSA-N 0.000 description 1
- IBCWNFDXEYSWIZ-UHFFFAOYSA-N 5-benzyltriazolo[4,5-d]pyrimidin-7-one Chemical compound N1=C2N=NN=C2C(=O)N=C1CC1=CC=CC=C1 IBCWNFDXEYSWIZ-UHFFFAOYSA-N 0.000 description 1
- LENNQSBLWNGOHY-UHFFFAOYSA-N 5-benzyltriazolo[4,5-d]pyrimidin-7-one hydrate Chemical compound O.N1=C2N=NN=C2C(=O)N=C1CC1=CC=CC=C1 LENNQSBLWNGOHY-UHFFFAOYSA-N 0.000 description 1
- ZOJANISRCXSBAS-UHFFFAOYSA-N 5-butyltriazolo[4,5-d]pyrimidin-7-one Chemical compound CCCCC1=NC(=O)C2=NN=NC2=N1 ZOJANISRCXSBAS-UHFFFAOYSA-N 0.000 description 1
- IMUXMXJKQKXLJH-UHFFFAOYSA-N 5-methylsulfonyl-2-propoxybenzenecarboximidamide;hydrochloride Chemical compound Cl.CCCOC1=CC=C(S(C)(=O)=O)C=C1C(N)=N IMUXMXJKQKXLJH-UHFFFAOYSA-N 0.000 description 1
- NMKCPHBUSXRAIU-UHFFFAOYSA-N 5-phenyl-2h-triazolo[4,5-d]pyrimidin-7-amine Chemical compound N=1C=2N=NNC=2C(N)=NC=1C1=CC=CC=C1 NMKCPHBUSXRAIU-UHFFFAOYSA-N 0.000 description 1
- MHYSAGQHGFLLKT-UHFFFAOYSA-N 5-propan-2-ylsulfonyl-2-propoxybenzenecarboximidamide;hydrochloride Chemical compound Cl.CCCOC1=CC=C(S(=O)(=O)C(C)C)C=C1C(N)=N MHYSAGQHGFLLKT-UHFFFAOYSA-N 0.000 description 1
- QBYDIOPLRPEBEO-UHFFFAOYSA-N 5-tert-butylsulfanyl-2-propoxybenzamide Chemical compound CCCOC1=CC=C(SC(C)(C)C)C=C1C(N)=O QBYDIOPLRPEBEO-UHFFFAOYSA-N 0.000 description 1
- GKPIEGXBYOSIGL-UHFFFAOYSA-N 6-amino-2-(2-decoxyphenyl)-5-nitroso-1h-pyrimidin-4-one Chemical compound CCCCCCCCCCOC1=CC=CC=C1C1=NC(N)=C(N=O)C(=O)N1 GKPIEGXBYOSIGL-UHFFFAOYSA-N 0.000 description 1
- UFCPFZSULMTEHV-UHFFFAOYSA-N 6-amino-2-(5-methylsulfonyl-2-propoxyphenyl)-5-nitroso-1h-pyrimidin-4-one Chemical compound CCCOC1=CC=C(S(C)(=O)=O)C=C1C1=NC(N)=C(N=O)C(=O)N1 UFCPFZSULMTEHV-UHFFFAOYSA-N 0.000 description 1
- UTUWLVJPMZPGEA-UHFFFAOYSA-N 6-amino-2-(5-tert-butylsulfanyl-2-propoxyphenyl)-5-nitroso-1h-pyrimidin-4-one Chemical compound CCCOC1=CC=C(SC(C)(C)C)C=C1C1=NC(=O)C(N=O)=C(N)N1 UTUWLVJPMZPGEA-UHFFFAOYSA-N 0.000 description 1
- GJWFDMZJHVPFBM-UHFFFAOYSA-N 6-amino-5-nitroso-2-(5-propan-2-ylsulfonyl-2-propoxyphenyl)-1h-pyrimidin-4-one Chemical compound CCCOC1=CC=C(S(=O)(=O)C(C)C)C=C1C1=NC(N)=C(N=O)C(=O)N1 GJWFDMZJHVPFBM-UHFFFAOYSA-N 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- 229910015900 BF3 Inorganic materials 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical compound OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 description 1
- JGLMVXWAHNTPRF-CMDGGOBGSA-N CCN1N=C(C)C=C1C(=O)NC1=NC2=CC(=CC(OC)=C2N1C\C=C\CN1C(NC(=O)C2=CC(C)=NN2CC)=NC2=CC(=CC(OCCCN3CCOCC3)=C12)C(N)=O)C(N)=O Chemical compound CCN1N=C(C)C=C1C(=O)NC1=NC2=CC(=CC(OC)=C2N1C\C=C\CN1C(NC(=O)C2=CC(C)=NN2CC)=NC2=CC(=CC(OCCCN3CCOCC3)=C12)C(N)=O)C(N)=O JGLMVXWAHNTPRF-CMDGGOBGSA-N 0.000 description 1
- CAPNTXXLWOXDHZ-UHFFFAOYSA-N COCCC1=NC(C2=NN=NC2=N1)=O Chemical compound COCCC1=NC(C2=NN=NC2=N1)=O CAPNTXXLWOXDHZ-UHFFFAOYSA-N 0.000 description 1
- UXVMQQNJUSDDNG-UHFFFAOYSA-L Calcium chloride Chemical compound [Cl-].[Cl-].[Ca+2] UXVMQQNJUSDDNG-UHFFFAOYSA-L 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 1
- 235000019743 Choline chloride Nutrition 0.000 description 1
- 239000004381 Choline salt Substances 0.000 description 1
- UDMBCSSLTHHNCD-UHFFFAOYSA-N Coenzym Q(11) Natural products C1=NC=2C(N)=NC=NC=2N1C1OC(COP(O)(O)=O)C(O)C1O UDMBCSSLTHHNCD-UHFFFAOYSA-N 0.000 description 1
- IVOMOUWHDPKRLL-KQYNXXCUSA-N Cyclic adenosine monophosphate Chemical compound C([C@H]1O2)OP(O)(=O)O[C@H]1[C@@H](O)[C@@H]2N1C(N=CN=C2N)=C2N=C1 IVOMOUWHDPKRLL-KQYNXXCUSA-N 0.000 description 1
- 101000909851 Mycobacterium tuberculosis (strain ATCC 25618 / H37Rv) cAMP/cGMP dual specificity phosphodiesterase Rv0805 Proteins 0.000 description 1
- 241001126260 Nippostrongylus Species 0.000 description 1
- 241001126259 Nippostrongylus brasiliensis Species 0.000 description 1
- VINMEUDLBYWUEP-UHFFFAOYSA-N OC1=CC=C(O)C(C=2N=C3N=NN=C3C(=O)N=2)=C1 Chemical compound OC1=CC=C(O)C(C=2N=C3N=NN=C3C(=O)N=2)=C1 VINMEUDLBYWUEP-UHFFFAOYSA-N 0.000 description 1
- 229910019142 PO4 Inorganic materials 0.000 description 1
- 208000030852 Parasitic disease Diseases 0.000 description 1
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 description 1
- YZCKVEUIGOORGS-NJFSPNSNSA-N Tritium Chemical compound [3H] YZCKVEUIGOORGS-NJFSPNSNSA-N 0.000 description 1
- IVOMOUWHDPKRLL-UHFFFAOYSA-N UNPD107823 Natural products O1C2COP(O)(=O)OC2C(O)C1N1C(N=CN=C2N)=C2N=C1 IVOMOUWHDPKRLL-UHFFFAOYSA-N 0.000 description 1
- 230000009471 action Effects 0.000 description 1
- 239000013543 active substance Substances 0.000 description 1
- UDMBCSSLTHHNCD-KQYNXXCUSA-N adenosine 5'-monophosphate Chemical compound C1=NC=2C(N)=NC=NC=2N1[C@@H]1O[C@H](COP(O)(O)=O)[C@@H](O)[C@H]1O UDMBCSSLTHHNCD-KQYNXXCUSA-N 0.000 description 1
- 229950006790 adenosine phosphate Drugs 0.000 description 1
- 150000004703 alkoxides Chemical class 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- CBTVGIZVANVGBH-UHFFFAOYSA-N aminomethyl propanol Chemical compound CC(C)(N)CO CBTVGIZVANVGBH-UHFFFAOYSA-N 0.000 description 1
- 150000003863 ammonium salts Chemical class 0.000 description 1
- 230000002052 anaphylactic effect Effects 0.000 description 1
- 239000003957 anion exchange resin Substances 0.000 description 1
- 239000000427 antigen Substances 0.000 description 1
- 102000036639 antigens Human genes 0.000 description 1
- 108091007433 antigens Proteins 0.000 description 1
- 239000007900 aqueous suspension Substances 0.000 description 1
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- 208000006673 asthma Diseases 0.000 description 1
- 230000009286 beneficial effect Effects 0.000 description 1
- 150000003936 benzamides Chemical class 0.000 description 1
- LZCZIHQBSCVGRD-UHFFFAOYSA-N benzenecarboximidamide;hydron;chloride Chemical compound [Cl-].NC(=[NH2+])C1=CC=CC=C1 LZCZIHQBSCVGRD-UHFFFAOYSA-N 0.000 description 1
- 238000010876 biochemical test Methods 0.000 description 1
- 239000012267 brine Substances 0.000 description 1
- 125000001246 bromo group Chemical group Br* 0.000 description 1
- 239000000872 buffer Substances 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000001110 calcium chloride Substances 0.000 description 1
- 229910001628 calcium chloride Inorganic materials 0.000 description 1
- 230000004856 capillary permeability Effects 0.000 description 1
- 150000001721 carbon Chemical group 0.000 description 1
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 1
- 210000004027 cell Anatomy 0.000 description 1
- 238000005119 centrifugation Methods 0.000 description 1
- 239000002026 chloroform extract Substances 0.000 description 1
- XTHPWXDJESJLNJ-UHFFFAOYSA-N chlorosulfonic acid Substances OS(Cl)(=O)=O XTHPWXDJESJLNJ-UHFFFAOYSA-N 0.000 description 1
- OEYIOHPDSNJKLS-UHFFFAOYSA-N choline Chemical compound C[N+](C)(C)CCO OEYIOHPDSNJKLS-UHFFFAOYSA-N 0.000 description 1
- 229960001231 choline Drugs 0.000 description 1
- SGMZJAMFUVOLNK-UHFFFAOYSA-M choline chloride Chemical compound [Cl-].C[N+](C)(C)CCO SGMZJAMFUVOLNK-UHFFFAOYSA-M 0.000 description 1
- 229960003178 choline chloride Drugs 0.000 description 1
- 235000019417 choline salt Nutrition 0.000 description 1
- 238000004587 chromatography analysis Methods 0.000 description 1
- 239000006071 cream Substances 0.000 description 1
- 238000004042 decolorization Methods 0.000 description 1
- 150000005332 diethylamines Chemical class 0.000 description 1
- 238000010790 dilution Methods 0.000 description 1
- 239000012895 dilution Substances 0.000 description 1
- 238000004090 dissolution Methods 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 239000000469 ethanolic extract Substances 0.000 description 1
- HHFAWKCIHAUFRX-UHFFFAOYSA-N ethoxide Chemical compound CC[O-] HHFAWKCIHAUFRX-UHFFFAOYSA-N 0.000 description 1
- QVKYKCTYAJLSGV-UHFFFAOYSA-N ethyl 3-(7-oxotriazolo[4,5-d]pyrimidin-5-yl)-4-propoxybenzoate Chemical compound CCCOC1=CC=C(C(=O)OCC)C=C1C1=NC(=O)C2=NN=NC2=N1 QVKYKCTYAJLSGV-UHFFFAOYSA-N 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 150000002431 hydrogen Chemical class 0.000 description 1
- 125000004029 hydroxymethyl group Chemical group [H]OC([H])([H])* 0.000 description 1
- 239000012535 impurity Substances 0.000 description 1
- 208000030603 inherited susceptibility to asthma Diseases 0.000 description 1
- 230000002401 inhibitory effect Effects 0.000 description 1
- 230000005764 inhibitory process Effects 0.000 description 1
- 239000002198 insoluble material Substances 0.000 description 1
- 230000003993 interaction Effects 0.000 description 1
- 238000010253 intravenous injection Methods 0.000 description 1
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 1
- 239000003456 ion exchange resin Substances 0.000 description 1
- 229920003303 ion-exchange polymer Polymers 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 229940098779 methanesulfonic acid Drugs 0.000 description 1
- KNMBCOOQWYCQDI-UHFFFAOYSA-N methyl 3-(7-oxotriazolo[4,5-d]pyrimidin-5-yl)-4-propoxybenzoate Chemical compound CCCOC1=CC=C(C(=O)OC)C=C1C1=NC(=O)C2=NN=NC2=N1 KNMBCOOQWYCQDI-UHFFFAOYSA-N 0.000 description 1
- 229940050176 methyl chloride Drugs 0.000 description 1
- MBXNQZHITVCSLJ-UHFFFAOYSA-N methyl fluorosulfonate Chemical compound COS(F)(=O)=O MBXNQZHITVCSLJ-UHFFFAOYSA-N 0.000 description 1
- 230000003228 microsomal effect Effects 0.000 description 1
- 150000004682 monohydrates Chemical class 0.000 description 1
- VVROUDYLOMXUMM-UHFFFAOYSA-N n'-methylbenzenecarboximidamide;hydrochloride Chemical compound Cl.CNC(=N)C1=CC=CC=C1 VVROUDYLOMXUMM-UHFFFAOYSA-N 0.000 description 1
- 125000006501 nitrophenyl group Chemical group 0.000 description 1
- 150000002832 nitroso derivatives Chemical class 0.000 description 1
- 229920002113 octoxynol Polymers 0.000 description 1
- 230000003287 optical effect Effects 0.000 description 1
- MUMZUERVLWJKNR-UHFFFAOYSA-N oxoplatinum Chemical compound [Pt]=O MUMZUERVLWJKNR-UHFFFAOYSA-N 0.000 description 1
- 125000004430 oxygen atom Chemical group O* 0.000 description 1
- 230000020477 pH reduction Effects 0.000 description 1
- 239000003973 paint Substances 0.000 description 1
- 239000008188 pellet Substances 0.000 description 1
- 125000003170 phenylsulfonyl group Chemical group C1(=CC=CC=C1)S(=O)(=O)* 0.000 description 1
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 1
- 239000010452 phosphate Substances 0.000 description 1
- 229910052698 phosphorus Inorganic materials 0.000 description 1
- 239000011574 phosphorus Substances 0.000 description 1
- 229910001392 phosphorus oxide Inorganic materials 0.000 description 1
- 229910003446 platinum oxide Inorganic materials 0.000 description 1
- 229940113115 polyethylene glycol 200 Drugs 0.000 description 1
- 229910000027 potassium carbonate Inorganic materials 0.000 description 1
- 239000001103 potassium chloride Substances 0.000 description 1
- 235000011164 potassium chloride Nutrition 0.000 description 1
- BDAWXSQJJCIFIK-UHFFFAOYSA-N potassium methoxide Chemical compound [K+].[O-]C BDAWXSQJJCIFIK-UHFFFAOYSA-N 0.000 description 1
- 159000000001 potassium salts Chemical class 0.000 description 1
- 125000006239 protecting group Chemical group 0.000 description 1
- 150000003248 quinolines Chemical class 0.000 description 1
- 230000002285 radioactive effect Effects 0.000 description 1
- 239000012429 reaction media Substances 0.000 description 1
- 238000007363 ring formation reaction Methods 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 239000012047 saturated solution Substances 0.000 description 1
- 238000003345 scintillation counting Methods 0.000 description 1
- 239000000741 silica gel Substances 0.000 description 1
- 229910002027 silica gel Inorganic materials 0.000 description 1
- 238000005245 sintering Methods 0.000 description 1
- 238000002791 soaking Methods 0.000 description 1
- 239000001632 sodium acetate Substances 0.000 description 1
- 235000017281 sodium acetate Nutrition 0.000 description 1
- QDRKDTQENPPHOJ-UHFFFAOYSA-N sodium ethoxide Chemical compound [Na+].CC[O-] QDRKDTQENPPHOJ-UHFFFAOYSA-N 0.000 description 1
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 1
- 230000007928 solubilization Effects 0.000 description 1
- 238000005063 solubilization Methods 0.000 description 1
- 241000894007 species Species 0.000 description 1
- 238000001228 spectrum Methods 0.000 description 1
- HXJUTPCZVOIRIF-UHFFFAOYSA-N sulfolane Chemical compound O=S1(=O)CCCC1 HXJUTPCZVOIRIF-UHFFFAOYSA-N 0.000 description 1
- 239000006228 supernatant Substances 0.000 description 1
- 238000003419 tautomerization reaction Methods 0.000 description 1
- VSAISIQCTGDGPU-UHFFFAOYSA-N tetraphosphorus hexaoxide Chemical compound O1P(O2)OP3OP1OP2O3 VSAISIQCTGDGPU-UHFFFAOYSA-N 0.000 description 1
- 238000011287 therapeutic dose Methods 0.000 description 1
- 125000003944 tolyl group Chemical group 0.000 description 1
- LENZDBCJOHFCAS-UHFFFAOYSA-N tris Chemical compound OCC(N)(CO)CO LENZDBCJOHFCAS-UHFFFAOYSA-N 0.000 description 1
- DRDCQJADRSJFFD-UHFFFAOYSA-N tris-hydroxymethyl-methyl-ammonium Chemical compound OC[N+](C)(CO)CO DRDCQJADRSJFFD-UHFFFAOYSA-N 0.000 description 1
- 229910052722 tritium Inorganic materials 0.000 description 1
- 229960004418 trolamine Drugs 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D239/00—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings
- C07D239/02—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings
- C07D239/24—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings having three or more double bonds between ring members or between ring members and non-ring members
- C07D239/28—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings having three or more double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, directly attached to ring carbon atoms
- C07D239/46—Two or more oxygen, sulphur or nitrogen atoms
- C07D239/47—One nitrogen atom and one oxygen or sulfur atom, e.g. cytosine
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D239/00—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings
- C07D239/02—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings
- C07D239/24—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings having three or more double bonds between ring members or between ring members and non-ring members
- C07D239/28—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings having three or more double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, directly attached to ring carbon atoms
- C07D239/46—Two or more oxygen, sulphur or nitrogen atoms
- C07D239/48—Two nitrogen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D317/00—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms
- C07D317/08—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms having the hetero atoms in positions 1 and 3
- C07D317/44—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms having the hetero atoms in positions 1 and 3 ortho- or peri-condensed with carbocyclic rings or ring systems
- C07D317/46—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms having the hetero atoms in positions 1 and 3 ortho- or peri-condensed with carbocyclic rings or ring systems condensed with one six-membered ring
- C07D317/48—Methylenedioxybenzenes or hydrogenated methylenedioxybenzenes, unsubstituted on the hetero ring
- C07D317/62—Methylenedioxybenzenes or hydrogenated methylenedioxybenzenes, unsubstituted on the hetero ring with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to atoms of the carbocyclic ring
- C07D317/68—Carbon atoms having three bonds to hetero atoms with at the most one bond to halogen
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D487/00—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, not provided for by groups C07D451/00 - C07D477/00
- C07D487/02—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, not provided for by groups C07D451/00 - C07D477/00 in which the condensed system contains two hetero rings
- C07D487/04—Ortho-condensed systems
-
- Y—GENERAL TAGGING OF NEW TECHNOLOGICAL DEVELOPMENTS; GENERAL TAGGING OF CROSS-SECTIONAL TECHNOLOGIES SPANNING OVER SEVERAL SECTIONS OF THE IPC; TECHNICAL SUBJECTS COVERED BY FORMER USPC CROSS-REFERENCE ART COLLECTIONS [XRACs] AND DIGESTS
- Y02—TECHNOLOGIES OR APPLICATIONS FOR MITIGATION OR ADAPTATION AGAINST CLIMATE CHANGE
- Y02P—CLIMATE CHANGE MITIGATION TECHNOLOGIES IN THE PRODUCTION OR PROCESSING OF GOODS
- Y02P20/00—Technologies relating to chemical industry
- Y02P20/50—Improvements relating to the production of bulk chemicals
- Y02P20/55—Design of synthesis routes, e.g. reducing the use of auxiliary or protecting groups
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (8)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB5955270 | 1970-12-15 | ||
| GB5955670 | 1970-12-15 | ||
| GB5955670 | 1970-12-15 | ||
| GB5955270 | 1970-12-15 | ||
| GB4975671A GB1338235A (en) | 1970-12-15 | 1971-10-26 | Azapurinones |
| GB4975671 | 1971-10-26 | ||
| GB5345771 | 1971-11-17 | ||
| GB5345771 | 1971-11-17 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DK141249B true DK141249B (da) | 1980-02-11 |
| DK141249C DK141249C (enExample) | 1980-08-04 |
Family
ID=27449009
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DK596371AA DK141249B (da) | 1970-12-15 | 1971-12-06 | Analogifremgangsmåde til fremstilling af 8-azapurin-6-on-derivater eller salte deraf. |
Country Status (25)
| Country | Link |
|---|---|
| US (1) | US3987160A (enExample) |
| JP (1) | JPS5310599B1 (enExample) |
| AR (4) | AR192602A1 (enExample) |
| AT (4) | AT317211B (enExample) |
| AU (1) | AU458277B2 (enExample) |
| BE (1) | BE776683A (enExample) |
| BG (3) | BG20805A3 (enExample) |
| CH (5) | CH555351A (enExample) |
| DD (1) | DD95007A5 (enExample) |
| DE (1) | DE2162096A1 (enExample) |
| DK (1) | DK141249B (enExample) |
| FI (1) | FI53457C (enExample) |
| FR (1) | FR2118078B1 (enExample) |
| GB (1) | GB1338235A (enExample) |
| HK (1) | HK42177A (enExample) |
| HU (1) | HU165079B (enExample) |
| IE (1) | IE35897B1 (enExample) |
| IL (1) | IL38364A (enExample) |
| IS (1) | IS1099B6 (enExample) |
| LU (1) | LU64457A1 (enExample) |
| NL (1) | NL174943C (enExample) |
| NO (1) | NO134257C (enExample) |
| OA (1) | OA03930A (enExample) |
| SE (1) | SE393381B (enExample) |
| ZM (1) | ZM18971A1 (enExample) |
Families Citing this family (43)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB1493685A (en) * | 1970-12-15 | 1977-11-30 | May & Baker Ltd | 8-azapurinones |
| BE792648A (fr) * | 1971-12-13 | 1973-06-12 | May & Baker Ltd | Derives de l'isoquinoleine |
| FR2406638A1 (fr) * | 1977-10-21 | 1979-05-18 | May & Baker Ltd | Nouvelles aza-8 purinones-6, leur preparation et les compositions pharmaceutiques les contenant |
| EP0007727B1 (en) * | 1978-07-24 | 1983-11-30 | Beecham Group Plc | Benzopyranotriazoles, preparation of these compounds and pharmaceutical composition containing them |
| JPS60226887A (ja) * | 1984-04-25 | 1985-11-12 | Dai Ichi Seiyaku Co Ltd | トリアゾロピリミジン誘導体 |
| CA1303037C (en) * | 1987-02-02 | 1992-06-09 | Smith Kline & French Laboratories Limited | Purinone derivatives as bronchodilators vasodilators and anti-allergic agents |
| DE3873812D1 (de) * | 1987-04-07 | 1992-09-24 | Ciba Geigy Ag | 3h-1,2,3-triazolo(4,5-d)pyrimidine. |
| US5204353A (en) * | 1987-04-07 | 1993-04-20 | Ciba-Geigy Corporation | 3-benzyl-3H-1,2,3-triazolo[4,5-d]pyrimidines, compositions thereof, and method of treating epilepsy therewith |
| FR2618073B1 (fr) * | 1987-07-16 | 1990-09-07 | Pf Medicament | Comprimes de type a matrice hydrophile a base de salbutamol et leur procede de preparation |
| GB8817651D0 (en) * | 1988-07-25 | 1988-09-01 | Smith Kline French Lab | Chemical compounds |
| DE4211239C2 (de) * | 1992-04-03 | 1995-11-16 | Max Planck Gesellschaft | Arzneimittel gegen Herz-Kreislauf-Erkrankungen |
| GB9213623D0 (en) * | 1992-06-26 | 1992-08-12 | Pfizer Ltd | Therapeutic agents |
| US5734053A (en) * | 1992-06-26 | 1998-03-31 | Pfizer Inc | Purinone antianginal agents |
| GB9311920D0 (en) | 1993-06-09 | 1993-07-28 | Pfizer Ltd | Therapeutic agents |
| US6818229B1 (en) | 1993-09-20 | 2004-11-16 | Kos Pharmaceuticals, Inc. | Intermediate release nicotinic acid compositions for treating hyperlipidemia |
| US6129930A (en) * | 1993-09-20 | 2000-10-10 | Bova; David J. | Methods and sustained release nicotinic acid compositions for treating hyperlipidemia at night |
| US6676967B1 (en) | 1993-09-20 | 2004-01-13 | Kos Pharmaceuticals, Inc. | Methods for reducing flushing in individuals being treated with nicotinic acid for hyperlipidemia |
| US6080428A (en) * | 1993-09-20 | 2000-06-27 | Bova; David J. | Nicotinic acid compositions for treating hyperlipidemia and related methods therefor |
| US6746691B2 (en) | 1993-09-20 | 2004-06-08 | Kos Pharmaceuticals, Inc. | Intermediate release nicotinic acid compositions for treating hyperlipidemia having unique biopharmaceutical characteristics |
| US20080045573A1 (en) * | 1993-09-20 | 2008-02-21 | Bova David J | Methods and Sustained Release Nicotinic Acid Compositions for Treating Hyperlipidemia |
| GB9404485D0 (en) * | 1994-03-09 | 1994-04-20 | Cancer Res Campaign Tech | Benzamide analogues |
| CA2395558C (en) | 1997-11-12 | 2007-07-17 | Bayer Aktiengesellschaft | Intermediates for 2-phenyl substituted imidazotriazinones as phosphodiesterase inhibitors |
| DE19838705A1 (de) | 1998-08-26 | 2000-03-02 | Bayer Ag | Neue Dihydro-(1,2,3)-triazolo-[4,5-d]pyrimidin-7-one |
| IT1318674B1 (it) * | 2000-08-08 | 2003-08-27 | Nicox Sa | Faramaci per l'incontinenza. |
| DE10232113A1 (de) | 2002-07-16 | 2004-01-29 | Bayer Ag | Vardenafil Hydrochlorid Trihydrat enthaltende Arzneimittel |
| US7772188B2 (en) | 2003-01-28 | 2010-08-10 | Ironwood Pharmaceuticals, Inc. | Methods and compositions for the treatment of gastrointestinal disorders |
| DE102005009240A1 (de) | 2005-03-01 | 2006-09-07 | Bayer Healthcare Ag | Arzneiformen mit verbesserten pharmakokinetischen Eigenschaften |
| MX354786B (es) | 2007-06-04 | 2018-03-21 | Synergy Pharmaceuticals Inc | Agonistas de guanilato ciclasa utiles para el tratamiento de trastornos gastrointestinales, inflamacion, cancer y otros trastornos. |
| US8969514B2 (en) | 2007-06-04 | 2015-03-03 | Synergy Pharmaceuticals, Inc. | Agonists of guanylate cyclase useful for the treatment of hypercholesterolemia, atherosclerosis, coronary heart disease, gallstone, obesity and other cardiovascular diseases |
| ES2522968T3 (es) | 2008-06-04 | 2014-11-19 | Synergy Pharmaceuticals Inc. | Agonistas de guanilato ciclasa útiles para el tratamiento de trastornos gastrointestinales, inflamación, cáncer y otros trastornos |
| AU2009270833B2 (en) | 2008-07-16 | 2015-02-19 | Bausch Health Ireland Limited | Agonists of guanylate cyclase useful for the treatment of gastrointestinal, inflammation, cancer and other disorders |
| US9616097B2 (en) | 2010-09-15 | 2017-04-11 | Synergy Pharmaceuticals, Inc. | Formulations of guanylate cyclase C agonists and methods of use |
| DK2681236T3 (en) | 2011-03-01 | 2018-04-16 | Synergy Pharmaceuticals Inc | PROCEDURE FOR MANUFACTURING GUANYLATE CYCLASE-C-AGONISTS |
| WO2014131024A2 (en) | 2013-02-25 | 2014-08-28 | Synergy Pharmaceuticals Inc. | Agonists of guanylate cyclase and their uses |
| AU2014235209B2 (en) | 2013-03-15 | 2018-06-14 | Bausch Health Ireland Limited | Guanylate cyclase receptor agonists combined with other drugs |
| AU2014235215A1 (en) | 2013-03-15 | 2015-10-01 | Synergy Pharmaceuticals Inc. | Agonists of guanylate cyclase and their uses |
| BR112015030326A2 (pt) | 2013-06-05 | 2017-08-29 | Synergy Pharmaceuticals Inc | Agonistas ultrapuros de guanilato ciclase c, método de fabricar e usar os mesmos |
| AU2014305843B2 (en) | 2013-08-09 | 2019-08-29 | Ardelyx, Inc. | Compounds and methods for inhibiting phosphate transport |
| MX2019006938A (es) | 2016-12-14 | 2019-09-06 | Respira Therapeutics Inc | Metodos y composiciones para trataminto de hipertension pulmonar y otros trastornos del pulmon. |
| TWI845600B (zh) | 2019-01-24 | 2024-06-21 | 美商普羅米修斯生物科學股份有限公司 | Gpr35調節劑 |
| EP4706758A3 (en) | 2019-05-21 | 2026-05-06 | Ardelyx, Inc. | Methods for inhibiting phosphate transport |
| EP4185379A4 (en) * | 2020-07-23 | 2023-11-22 | Prometheus Biosciences, Inc. | Therapeutic agents targeting gpr35 |
| WO2023205463A1 (en) | 2022-04-22 | 2023-10-26 | Vertex Pharmaceuticals Incorporated | Heteroaryl compounds for the treatment of pain |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2407204A (en) * | 1944-07-22 | 1946-09-03 | American Cyanamid Co | Triazolo (d) pyrimidines and methods of preparing the same |
| US2993039A (en) * | 1959-11-06 | 1961-07-18 | Upjohn Co | Preparing nu-glycosides of aldose and ketose sugars |
-
1971
- 1971-10-26 GB GB4975671A patent/GB1338235A/en not_active Expired
- 1971-12-06 DK DK596371AA patent/DK141249B/da not_active IP Right Cessation
- 1971-12-14 ZM ZM189/71A patent/ZM18971A1/xx unknown
- 1971-12-14 NL NLAANVRAGE7117142,A patent/NL174943C/xx not_active IP Right Cessation
- 1971-12-14 LU LU64457D patent/LU64457A1/xx unknown
- 1971-12-14 JP JP10078571A patent/JPS5310599B1/ja active Pending
- 1971-12-14 IL IL38364A patent/IL38364A/xx unknown
- 1971-12-14 CH CH1823271A patent/CH555351A/fr not_active IP Right Cessation
- 1971-12-14 DD DD159572A patent/DD95007A5/xx unknown
- 1971-12-14 CH CH1853772A patent/CH556860A/xx not_active IP Right Cessation
- 1971-12-14 BE BE776683A patent/BE776683A/xx not_active IP Right Cessation
- 1971-12-14 AU AU36867/71A patent/AU458277B2/en not_active Expired
- 1971-12-14 DE DE19712162096 patent/DE2162096A1/de active Granted
- 1971-12-14 OA OA54440A patent/OA03930A/xx unknown
- 1971-12-14 FI FI3560/71A patent/FI53457C/fi active
- 1971-12-14 NO NO4614/71A patent/NO134257C/no unknown
- 1971-12-14 IE IE1583/71A patent/IE35897B1/xx unknown
- 1971-12-14 SE SE7116090A patent/SE393381B/xx unknown
- 1971-12-14 FR FR7144869A patent/FR2118078B1/fr not_active Expired
- 1971-12-14 HU HUMA2296A patent/HU165079B/hu unknown
- 1971-12-14 CH CH1853872A patent/CH546779A/fr not_active IP Right Cessation
- 1971-12-14 IS IS2047A patent/IS1099B6/is unknown
- 1971-12-14 CH CH1853672A patent/CH550814A/fr not_active IP Right Cessation
- 1971-12-14 CH CH222574A patent/CH552610A/fr not_active IP Right Cessation
- 1971-12-15 AT AT272373A patent/AT317211B/de not_active IP Right Cessation
- 1971-12-15 BG BG019250A patent/BG20805A3/xx unknown
- 1971-12-15 AT AT272273A patent/AT319235B/de not_active IP Right Cessation
- 1971-12-15 AT AT272473A patent/AT315839B/de not_active IP Right Cessation
- 1971-12-15 AT AT1075671A patent/AT315838B/de not_active IP Right Cessation
- 1971-12-15 BG BG020380A patent/BG20807A3/xx unknown
- 1971-12-15 BG BG020379A patent/BG20806A3/xx unknown
- 1971-12-15 AR AR239632A patent/AR192602A1/es active
-
1972
- 1972-12-06 AR AR245508A patent/AR199467A1/es active
- 1972-12-06 AR AR245509A patent/AR199468A1/es active
- 1972-12-06 AR AR245510A patent/AR192689A1/es active
-
1973
- 1973-05-29 US US05/364,425 patent/US3987160A/en not_active Expired - Lifetime
-
1977
- 1977-08-11 HK HK421/77A patent/HK42177A/xx unknown
Also Published As
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DK141249B (da) | Analogifremgangsmåde til fremstilling af 8-azapurin-6-on-derivater eller salte deraf. | |
| Robins | Potential purine antagonists. I. Synthesis of some 4, 6-substituted pyrazolo [3, 4-d] pyrimidines1 | |
| EP0553202B1 (en) | Process for the preparation of imidazo[4,5-c]quinolin-4-amines | |
| Wu et al. | ‘One-pot’nitro reduction–cyclisation solid phase route to benzimidazoles | |
| US4113731A (en) | Fused isoquinoline derivatives | |
| DK142498B (da) | Analogifremgangsmåde til fremstilling af benzopyridoazepinderivater. | |
| JPS61158984A (ja) | 新規ピロロ―ベンゾイミダゾール | |
| US3963736A (en) | Preparation of 1-(lower alkyl)-1,4-dihydro-7-methyl-4-oxo-1,8-naphthyridine-3-carboxylic acids | |
| SU416946A3 (ru) | СПОСОБ ПОЛУЧЕНИЯ 1-БЕНЗОТИЕНО-[2,3-йг]-ПИРИМИДИНОВ | |
| CA1187874A (en) | Preparation of 1-substituted-2-amino-benzimidazoles | |
| DK142766B (da) | Analogifremgangsmåde til fremstilling af terapeutisk virksomme 8-azapurin-6-on-derivater. | |
| SU1151205A3 (ru) | Способ получени 2-амино-4,6-диметоксипиримидина | |
| US1939025A (en) | Aromatic amino-sulpho chlorides, substituted in the amino-group | |
| US3350397A (en) | 4-amino-1-alkyl-6-(5-nitro-2-furyl)-1h-pyrazolo [3, 4-d] pyrimidines | |
| GB2089792A (en) | Substituted benzopyranotriazoles | |
| SU648102A3 (ru) | Способ получени производных нафтиридинов или их солей | |
| EP3004065A1 (en) | Method for producing pyridazine compound | |
| US2904554A (en) | Phthalides | |
| AU2013280925A1 (en) | Production of N-substituted sulfoximine pyridine N-oxides | |
| Goldberg | 120. Synthesis of derivatives of taurinamide | |
| US3247224A (en) | 6h-[b, f] [1, 4, 5] dibenzo-oxathiazepins | |
| SU952847A1 (ru) | Способ получени 9-замещенных 2,3-дигидроимидазо /1,2-а/ бензимидазола или их солей | |
| US2535635A (en) | Substituted pyrimidines and preparation of the same | |
| US1073380A (en) | N-halogenalkyl-c c-dialkylbarbituric acids and preparation of the same. | |
| SU554811A3 (ru) | Способ получени метилсульфонильных производных |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PBP | Patent lapsed |