DES0048395MA - - Google Patents
Info
- Publication number
- DES0048395MA DES0048395MA DES0048395MA DE S0048395M A DES0048395M A DE S0048395MA DE S0048395M A DES0048395M A DE S0048395MA
- Authority
- DE
- Germany
- Prior art keywords
- iron
- lubricating oil
- lubricant
- knock
- engine
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Active
Links
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 claims description 19
- 229910052742 iron Inorganic materials 0.000 claims description 13
- 239000000314 lubricant Substances 0.000 claims description 12
- 239000010687 lubricating oil Substances 0.000 claims description 12
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 claims description 4
- 150000001875 compounds Chemical class 0.000 claims description 4
- 238000002485 combustion reaction Methods 0.000 claims description 3
- 150000002902 organometallic compounds Chemical class 0.000 claims description 3
- KJTLSVCANCCWHF-UHFFFAOYSA-N Ruthenium Chemical compound [Ru] KJTLSVCANCCWHF-UHFFFAOYSA-N 0.000 claims description 2
- 239000010688 mineral lubricating oil Substances 0.000 claims description 2
- 229910052759 nickel Inorganic materials 0.000 claims description 2
- 229910052762 osmium Inorganic materials 0.000 claims description 2
- SYQBFIAQOQZEGI-UHFFFAOYSA-N osmium atom Chemical compound [Os] SYQBFIAQOQZEGI-UHFFFAOYSA-N 0.000 claims description 2
- 229910052707 ruthenium Inorganic materials 0.000 claims description 2
- 239000000203 mixture Substances 0.000 description 9
- -1 carbalkoxy Chemical group 0.000 description 6
- 239000006079 antiknock agent Substances 0.000 description 5
- 239000000446 fuel Substances 0.000 description 4
- 239000003921 oil Substances 0.000 description 4
- MRMOZBOQVYRSEM-UHFFFAOYSA-N tetraethyllead Chemical compound CC[Pb](CC)(CC)CC MRMOZBOQVYRSEM-UHFFFAOYSA-N 0.000 description 4
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- 239000000654 additive Substances 0.000 description 3
- TVMXDCGIABBOFY-UHFFFAOYSA-N octane Chemical compound CCCCCCCC TVMXDCGIABBOFY-UHFFFAOYSA-N 0.000 description 3
- 125000000217 alkyl group Chemical group 0.000 description 2
- VSCWAEJMTAWNJL-UHFFFAOYSA-K aluminium trichloride Chemical compound Cl[Al](Cl)Cl VSCWAEJMTAWNJL-UHFFFAOYSA-K 0.000 description 2
- 235000014113 dietary fatty acids Nutrition 0.000 description 2
- 229930195729 fatty acid Natural products 0.000 description 2
- 239000000194 fatty acid Substances 0.000 description 2
- 150000004665 fatty acids Chemical class 0.000 description 2
- 229910052500 inorganic mineral Inorganic materials 0.000 description 2
- 239000011707 mineral Substances 0.000 description 2
- CDAWCLOXVUBKRW-UHFFFAOYSA-N 2-aminophenol Chemical class NC1=CC=CC=C1O CDAWCLOXVUBKRW-UHFFFAOYSA-N 0.000 description 1
- YIFQRSXKSLXXLI-UHFFFAOYSA-N C(CCC)C1(C=CC=C1)[Fe]C1(C=CC=C1)CCCC Chemical compound C(CCC)C1(C=CC=C1)[Fe]C1(C=CC=C1)CCCC YIFQRSXKSLXXLI-UHFFFAOYSA-N 0.000 description 1
- HPYIUKIBUJFXII-UHFFFAOYSA-N Cyclopentadienyl radical Chemical class [CH]1C=CC=C1 HPYIUKIBUJFXII-UHFFFAOYSA-N 0.000 description 1
- 238000005727 Friedel-Crafts reaction Methods 0.000 description 1
- 229930194542 Keto Natural products 0.000 description 1
- OFOBLEOULBTSOW-UHFFFAOYSA-N Malonic acid Chemical compound OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 1
- WWFAYDPSCPMIFU-UHFFFAOYSA-N N[S+](C#N)O[S+](C#N)N Chemical compound N[S+](C#N)O[S+](C#N)N WWFAYDPSCPMIFU-UHFFFAOYSA-N 0.000 description 1
- WETWJCDKMRHUPV-UHFFFAOYSA-N acetyl chloride Chemical compound CC(Cl)=O WETWJCDKMRHUPV-UHFFFAOYSA-N 0.000 description 1
- 239000012346 acetyl chloride Substances 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 125000002252 acyl group Chemical group 0.000 description 1
- 230000000996 additive effect Effects 0.000 description 1
- 125000003342 alkenyl group Chemical group 0.000 description 1
- 125000002877 alkyl aryl group Chemical group 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 239000002518 antifoaming agent Substances 0.000 description 1
- 239000003963 antioxidant agent Substances 0.000 description 1
- 150000004982 aromatic amines Chemical class 0.000 description 1
- 150000001491 aromatic compounds Chemical class 0.000 description 1
- 125000003710 aryl alkyl group Chemical group 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 238000005260 corrosion Methods 0.000 description 1
- 230000007797 corrosion Effects 0.000 description 1
- 125000004093 cyano group Chemical group *C#N 0.000 description 1
- 125000000753 cycloalkyl group Chemical group 0.000 description 1
- 239000003599 detergent Substances 0.000 description 1
- ZSWFCLXCOIISFI-UHFFFAOYSA-N endo-cyclopentadiene Natural products C1C=CC=C1 ZSWFCLXCOIISFI-UHFFFAOYSA-N 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 150000002430 hydrocarbons Chemical group 0.000 description 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 1
- 239000003112 inhibitor Substances 0.000 description 1
- 125000000468 ketone group Chemical group 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 238000000034 method Methods 0.000 description 1
- 230000003647 oxidation Effects 0.000 description 1
- 238000007254 oxidation reaction Methods 0.000 description 1
- 150000002989 phenols Chemical class 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- 238000006467 substitution reaction Methods 0.000 description 1
- 235000011044 succinic acid Nutrition 0.000 description 1
- 150000003444 succinic acids Chemical class 0.000 description 1
- 150000005846 sugar alcohols Polymers 0.000 description 1
- 125000000542 sulfonic acid group Chemical group 0.000 description 1
- 150000003568 thioethers Chemical class 0.000 description 1
Family
ID=
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1444904C3 (de) | Schmiermittelgemisch | |
| DE1232688B (de) | Schmieroel fuer Verbrennungskraftmaschinen | |
| DE908175C (de) | Verfahren zur Verbesserung von Mineraloelen | |
| DE2327546A1 (de) | Verfahren zur schmierung von zweitakt- und drehkolbenmotoren | |
| DE1594355A1 (de) | Mit Wasser waschbares alkalisches Schmiermittel | |
| DE3327859A1 (de) | Schmieroelzusammensetzungen | |
| DE2650580C2 (enrdf_load_stackoverflow) | ||
| DE2413145A1 (de) | Korrosionsbestaendige organische zusammensetzungen | |
| DE961916C (de) | Schmiermittel fuer Kurbelgehaeuse von Verbrennungskraftmaschinen | |
| DE1444892B1 (de) | Schmieroel | |
| DE942585C (de) | Schmieroel | |
| DE1594432A1 (de) | Kohlenwasserstoffgemische | |
| DE1058187B (de) | Schmiermittel | |
| DE3534442A1 (de) | Schmieroelzusammensetzung | |
| DE2342685A1 (de) | Organische massen mit korrosionsinhibierenden eigenschaften | |
| DE2044480C3 (de) | Derivate der 2-Hydroxybenzol-1,3-dicarbonsäure, Verfahren zu ihrer Herstellung und ihre Verwendung als Rostschutzmittel in Schmierstoffen, Kraft- und Brennstoffen | |
| DE69102191T2 (de) | Benzotriazolderivate enthaltende Schmiermittelzusammensetzungen. | |
| DE1288224B (de) | Mineralschmieroel | |
| DES0048395MA (enrdf_load_stackoverflow) | ||
| US2742432A (en) | Mineral oil lubricating compositions | |
| US2940933A (en) | Mineral oil antioxidant | |
| DE60310412T2 (de) | Synergistische kombination von zusätzen mit hoher belastungskapazität und korroionsinhibitoren für schmiermittelzusammensetzungen | |
| DE2307151A1 (de) | Neue zusammensetzung und ihre verwendung als schmieroel-additiv | |
| DE2140683A1 (de) | Synthetisches Grundmaterial fur Schmiermittel und funktionell Fluide | |
| DE2242637A1 (de) | Oxydationsbestaendige schiermittelzusammensetzungen |