DES0041546MA - - Google Patents
Info
- Publication number
- DES0041546MA DES0041546MA DES0041546MA DE S0041546M A DES0041546M A DE S0041546MA DE S0041546M A DES0041546M A DE S0041546MA
- Authority
- DE
- Germany
- Prior art keywords
- same
- amino
- sulfonic acid
- oxynaph
- thalin
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Active
Links
- 239000000975 dye Substances 0.000 claims description 34
- 239000002253 acid Substances 0.000 claims description 20
- 125000000664 diazo group Chemical group [N-]=[N+]=[*] 0.000 claims description 18
- -1 aminomonoazo Chemical group 0.000 claims description 13
- 239000000203 mixture Substances 0.000 claims description 11
- 239000000835 fiber Substances 0.000 claims description 8
- 239000002184 metal Substances 0.000 claims description 7
- 229910052751 metal Inorganic materials 0.000 claims description 7
- 238000000034 method Methods 0.000 claims description 7
- 125000001424 substituent group Chemical group 0.000 claims description 5
- 239000000987 azo dye Substances 0.000 claims description 4
- 239000000126 substance Substances 0.000 claims description 4
- 150000008049 diazo compounds Chemical class 0.000 claims description 3
- 150000002790 naphthalenes Chemical class 0.000 claims description 3
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 2
- 125000000217 alkyl group Chemical group 0.000 claims description 2
- 125000003710 aryl alkyl group Chemical group 0.000 claims description 2
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 2
- 229910052739 hydrogen Inorganic materials 0.000 claims description 2
- 239000001257 hydrogen Substances 0.000 claims description 2
- 238000002360 preparation method Methods 0.000 claims description 2
- 125000003107 substituted aryl group Chemical group 0.000 claims description 2
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 7
- 150000007513 acids Chemical class 0.000 description 6
- 239000000243 solution Substances 0.000 description 6
- 229920000742 Cotton Polymers 0.000 description 4
- 239000004627 regenerated cellulose Substances 0.000 description 4
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- 230000008878 coupling Effects 0.000 description 3
- 238000010168 coupling process Methods 0.000 description 3
- 238000005859 coupling reaction Methods 0.000 description 3
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 2
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 2
- 241000530268 Lycaena heteronea Species 0.000 description 2
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 2
- 150000001448 anilines Chemical class 0.000 description 2
- 150000001875 compounds Chemical class 0.000 description 2
- 229910052802 copper Inorganic materials 0.000 description 2
- 239000010949 copper Substances 0.000 description 2
- 229910000365 copper sulfate Inorganic materials 0.000 description 2
- ARUVKPQLZAKDPS-UHFFFAOYSA-L copper(II) sulfate Chemical compound [Cu+2].[O-][S+2]([O-])([O-])[O-] ARUVKPQLZAKDPS-UHFFFAOYSA-L 0.000 description 2
- 238000006193 diazotization reaction Methods 0.000 description 2
- LPXPTNMVRIOKMN-UHFFFAOYSA-M sodium nitrite Chemical compound [Na+].[O-]N=O LPXPTNMVRIOKMN-UHFFFAOYSA-M 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- OOPUIVYOCKMTGG-UHFFFAOYSA-N 2-(2-amino-4-methylsulfonylphenoxy)acetic acid Chemical compound C(=O)(O)COC1=C(C=C(C=C1)S(=O)(=O)C)N OOPUIVYOCKMTGG-UHFFFAOYSA-N 0.000 description 1
- UJEHBAYGWFHLKV-UHFFFAOYSA-N 2-amino-5-methylsulfonylbenzoic acid Chemical compound CS(=O)(=O)C1=CC=C(N)C(C(O)=O)=C1 UJEHBAYGWFHLKV-UHFFFAOYSA-N 0.000 description 1
- 229920003043 Cellulose fiber Polymers 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical class [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 1
- 125000000738 acetamido group Chemical group [H]C([H])([H])C(=O)N([H])[*] 0.000 description 1
- 229910021529 ammonia Inorganic materials 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 125000000751 azo group Chemical group [*]N=N[*] 0.000 description 1
- 230000000740 bleeding effect Effects 0.000 description 1
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 125000001309 chloro group Chemical group Cl* 0.000 description 1
- 238000004040 coloring Methods 0.000 description 1
- 230000009918 complex formation Effects 0.000 description 1
- 150000004699 copper complex Chemical class 0.000 description 1
- 238000004043 dyeing Methods 0.000 description 1
- 239000004744 fabric Substances 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 238000001465 metallisation Methods 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 229910052759 nickel Inorganic materials 0.000 description 1
- LGQLOGILCSXPEA-UHFFFAOYSA-L nickel sulfate Chemical compound [Ni+2].[O-]S([O-])(=O)=O LGQLOGILCSXPEA-UHFFFAOYSA-L 0.000 description 1
- 229910000363 nickel(II) sulfate Inorganic materials 0.000 description 1
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 1
- 238000007747 plating Methods 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 238000009958 sewing Methods 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- 235000010288 sodium nitrite Nutrition 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-N sulfuric acid Substances OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
Family
ID=
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1644366B1 (de) | Verfahren zur Herstellung von metallhaltigen wasserloeslichen Pyrimidinreaktiv-Azofarbstoffen | |
| DES0041546MA (enExample) | ||
| DE1644162C3 (de) | Ein wasserlöslicher Pyrazolon-monoazofarbstoff und Verfahren zu dessen Herstellung | |
| DE1225319B (de) | Verfahren zur Herstellung von Azofarbstoffen | |
| DE957150C (de) | Verfahren zur Herstellung von Disazofarbstoffen | |
| DE1419837C3 (de) | Reaktive Monoazokupferkomplexfarbstoffe, Verfahren zu ihrer Herstellung und ihre Verwendung | |
| DE1001783C2 (de) | Verfahren zur Herstellung kupferhaltiger Azofarbstoffe | |
| DE870147C (de) | Verfahren zur Herstellung von Dis- und Polyazofarbstoffen | |
| DE2017873C3 (de) | Blaue Diazofarbstoffe | |
| DE850041C (de) | Verfahren zur Herstellung neuer Disazofarbstoffe | |
| DE853188C (de) | Verfahren zur Herstellung von Mono-, Dis- oder Polyazofarbstoffen | |
| CH515315A (de) | Verfahren zur Herstellung von faserreaktiven, schwermetallhaltigen Formazanfarbstoffen | |
| DE1544500B2 (de) | Metallhaltige disazoreaktivfarbstoffe und verfahren zu deren herstellung | |
| DE951527C (de) | Verfahren zur Herstellung von metallisierbaren Disazofarbstoffen | |
| DE964975C (de) | Verfahren zur Herstellung von Monoazofarbstoffen | |
| DE852724C (de) | Verfahren zur Herstellung neuer Disazofarbstoffe | |
| DE849287C (de) | Verfahren zur Herstellung von Trisazofarbstoffen | |
| DE961202C (de) | Verfahren zur Herstellung von Disazofarbstoffen | |
| AT162618B (de) | Verfahren zur Herstellung neuer Tetrakisazofarbstoffe | |
| DE842098C (de) | Verfahren zur Herstellung von metallisierbaren Dis- oder Polyazofarbstoffen der Dipyrazolonreihe | |
| AT165077B (de) | Verfahren zur Herstellung neuer Trisazofarbstoffe | |
| DE925850C (de) | Verfahren zur Herstellung neuer Disazofarbstoffe | |
| CH637151A5 (de) | Neue azofarbstoffe und deren verwendung. | |
| DE1010213B (de) | Verfahren zur Herstellung von Monoazofarbstoffen und ihren Metallkomplexverbindungen | |
| DE1005214B (de) | Verfahren zur Herstellung von Trisazofarbstoffen und deren komplexen Metallverbindungen |