DES0033758MA - - Google Patents
Info
- Publication number
- DES0033758MA DES0033758MA DES0033758MA DE S0033758M A DES0033758M A DE S0033758MA DE S0033758M A DES0033758M A DE S0033758MA
- Authority
- DE
- Germany
- Prior art keywords
- unsaturated organic
- organic compound
- compound
- fuel
- oil
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Active
Links
- 238000002485 combustion reaction Methods 0.000 claims description 28
- 238000000034 method Methods 0.000 claims description 19
- 239000000446 fuel Substances 0.000 claims description 16
- 150000002894 organic compounds Chemical class 0.000 claims description 16
- 150000001875 compounds Chemical class 0.000 claims description 6
- 230000001050 lubricating effect Effects 0.000 claims description 6
- HSFWRNGVRCDJHI-UHFFFAOYSA-N alpha-acetylene Natural products C#C HSFWRNGVRCDJHI-UHFFFAOYSA-N 0.000 claims description 5
- 238000006243 chemical reaction Methods 0.000 claims description 5
- 239000011241 protective layer Substances 0.000 claims description 5
- 239000000126 substance Substances 0.000 claims description 5
- 239000010410 layer Substances 0.000 claims description 4
- -1 polyethylene Polymers 0.000 claims description 4
- 239000003795 chemical substances by application Substances 0.000 claims description 3
- 125000002534 ethynyl group Chemical group [H]C#C* 0.000 claims description 3
- 150000002736 metal compounds Chemical class 0.000 claims description 3
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 claims description 2
- 239000005977 Ethylene Substances 0.000 claims description 2
- 239000004698 Polyethylene Substances 0.000 claims description 2
- 241000934878 Sterculia Species 0.000 claims description 2
- 235000021282 Sterculia Nutrition 0.000 claims description 2
- 230000002378 acidificating effect Effects 0.000 claims description 2
- 150000004702 methyl esters Chemical class 0.000 claims description 2
- 229920001197 polyacetylene Polymers 0.000 claims description 2
- 229920000573 polyethylene Polymers 0.000 claims description 2
- 150000004032 porphyrins Chemical class 0.000 claims description 2
- 229940059107 sterculia Drugs 0.000 claims description 2
- KAESVJOAVNADME-UHFFFAOYSA-N Pyrrole Chemical compound C=1C=CNC=1 KAESVJOAVNADME-UHFFFAOYSA-N 0.000 claims 2
- PLPFBVXTEJUIIT-UHFFFAOYSA-N 1,2-dimethylanthracene Chemical compound C1=CC=CC2=CC3=C(C)C(C)=CC=C3C=C21 PLPFBVXTEJUIIT-UHFFFAOYSA-N 0.000 claims 1
- TZLFWVPLPHJLSE-UHFFFAOYSA-N cyclopentane phenanthrene Chemical class C1CCCC1.C1=CC=C2C3=CC=CC=C3C=CC2=C1 TZLFWVPLPHJLSE-UHFFFAOYSA-N 0.000 claims 1
- 150000003233 pyrroles Chemical class 0.000 claims 1
- 239000003921 oil Substances 0.000 description 8
- 239000000654 additive Substances 0.000 description 5
- 238000005461 lubrication Methods 0.000 description 4
- 229920000642 polymer Polymers 0.000 description 4
- 230000015572 biosynthetic process Effects 0.000 description 3
- 239000010687 lubricating oil Substances 0.000 description 3
- 229910052751 metal Inorganic materials 0.000 description 3
- 239000002184 metal Substances 0.000 description 3
- 150000002739 metals Chemical class 0.000 description 3
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 2
- 230000000996 additive effect Effects 0.000 description 2
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- MRMOZBOQVYRSEM-UHFFFAOYSA-N tetraethyllead Chemical compound CC[Pb](CC)(CC)CC MRMOZBOQVYRSEM-UHFFFAOYSA-N 0.000 description 2
- VYZAMTAEIAYCRO-UHFFFAOYSA-N Chromium Chemical compound [Cr] VYZAMTAEIAYCRO-UHFFFAOYSA-N 0.000 description 1
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 1
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 1
- DHMQDGOQFOQNFH-UHFFFAOYSA-N Glycine Chemical class NCC(O)=O DHMQDGOQFOQNFH-UHFFFAOYSA-N 0.000 description 1
- 150000004075 acetic anhydrides Chemical class 0.000 description 1
- 238000001311 chemical methods and process Methods 0.000 description 1
- 229910052804 chromium Inorganic materials 0.000 description 1
- 239000011651 chromium Substances 0.000 description 1
- 239000010724 circulating oil Substances 0.000 description 1
- 229910017052 cobalt Inorganic materials 0.000 description 1
- 239000010941 cobalt Substances 0.000 description 1
- GUTLYIVDDKVIGB-UHFFFAOYSA-N cobalt atom Chemical compound [Co] GUTLYIVDDKVIGB-UHFFFAOYSA-N 0.000 description 1
- 239000000567 combustion gas Substances 0.000 description 1
- 229910052802 copper Inorganic materials 0.000 description 1
- 239000010949 copper Substances 0.000 description 1
- 239000006185 dispersion Substances 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 239000000314 lubricant Substances 0.000 description 1
- 229910052759 nickel Inorganic materials 0.000 description 1
- 239000003208 petroleum Substances 0.000 description 1
- 238000006116 polymerization reaction Methods 0.000 description 1
- 230000001172 regenerating effect Effects 0.000 description 1
Family
ID=
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| EP3420054B1 (de) | Kraftstoffadditiv zur reinigung eines verbrennungsmotors | |
| DE2342563C2 (de) | Schmiermittelzubereitung für Schiffsdieselmotoren | |
| DE2232099C3 (de) | Schmiermittelpräparate für Zweitaktmotoren | |
| DE2138569B2 (de) | Verwendung von Harnstoffderivaten als Zusatzstoffe für Schmieröle und Treibstoffe | |
| DE953127C (de) | Verfahren zum Aufbringen einer Schmierschicht auf die Zylinderlaufflaechen von Brennkraftmaschinen und Brennstoff zur Durchfuehrung des Verfahrens | |
| DE1288224B (de) | Mineralschmieroel | |
| DES0033758MA (enExample) | ||
| AT404596B (de) | Treibstoff für verbrennungsmotoren und verwendung von methylformiat | |
| EP0258426B1 (de) | Verfahren zur herstellung eines zusatzstoffes für schmiermittel sowie für wässrige heizmittel- und kraftstoffsysteme | |
| DE1594579B2 (de) | Schmieroel fuer die zylinderschmierung von motoren mit getrennter zylinder- und kurbelwellenschmierung | |
| DE1594477C3 (de) | Schmiermittel | |
| DE684821C (de) | Schmieroele | |
| DE1420930A1 (de) | Motorenbenzin | |
| DE2520971A1 (de) | Verfahren zum betrieb einer verbrennungsmaschine mit druckeinspritzung | |
| DE1101854B (de) | Motorenbenzin | |
| DE1964785A1 (de) | Kohlenwasserstoff-Kraftstoffzubereitungen | |
| DE2319430A1 (de) | Schmiermittel- und kraftstoffzubereitungen | |
| DE1053125B (de) | Schmieroelgemisch | |
| DE1220667B (de) | Verbleite Treibstoffe fuer Explosionsmotoren | |
| AT301983B (de) | Flüssige Zusammensetzung zur Beseitigung von Ablagerungen in den Brennkammern von Verbrennungsmotoren | |
| DE1236854B (de) | Kraftstoffe fuer Brennkraftmaschinen, insbesondere Vergasermaschinen | |
| DE1135604B (de) | Schmiermittel | |
| DE1120049B (de) | Bewegliches Schmiermittel fuer Verbrennungskraftmaschinen, die mit einem einen hohen Anteil an sauren Verbrennungsprodukten bildenden Treibstoff betrieben werden | |
| AT202249B (de) | Zusatzmittel für Motortreibstoffe | |
| DE1594579C3 (de) | Schmieröl für die Zylinderschmierung von Motoren mit getrennter Zylinder- und Kurbelwellenschmierung |