DEF0018304MA - - Google Patents
Info
- Publication number
- DEF0018304MA DEF0018304MA DEF0018304MA DE F0018304M A DEF0018304M A DE F0018304MA DE F0018304M A DEF0018304M A DE F0018304MA
- Authority
- DE
- Germany
- Prior art keywords
- xylene
- acid
- hydrochloric acid
- chloro
- split
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Active
Links
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 claims description 18
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 claims description 10
- 238000005660 chlorination reaction Methods 0.000 claims description 10
- 238000000034 method Methods 0.000 claims description 7
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 7
- 125000000542 sulfonic acid group Chemical group 0.000 claims description 6
- 239000002253 acid Substances 0.000 claims description 5
- LZKSWEMNHCYYFD-UHFFFAOYSA-N 4,6-dimethylbenzene-1,3-disulfonic acid Chemical compound CC1=CC(C)=C(S(O)(=O)=O)C=C1S(O)(=O)=O LZKSWEMNHCYYFD-UHFFFAOYSA-N 0.000 claims description 4
- 239000005708 Sodium hypochlorite Substances 0.000 claims description 3
- 238000006243 chemical reaction Methods 0.000 claims description 3
- SUKJFIGYRHOWBL-UHFFFAOYSA-N sodium hypochlorite Chemical compound [Na+].Cl[O-] SUKJFIGYRHOWBL-UHFFFAOYSA-N 0.000 claims description 3
- 239000007795 chemical reaction product Substances 0.000 claims description 2
- BJPOCMIPFABCEO-UHFFFAOYSA-N 5-chloro-5,6-dimethylcyclohexa-1,3-diene Chemical group CC1C=CC=CC1(C)Cl BJPOCMIPFABCEO-UHFFFAOYSA-N 0.000 claims 1
- 238000010438 heat treatment Methods 0.000 claims 1
- 238000002360 preparation method Methods 0.000 claims 1
- 229910000859 α-Fe Inorganic materials 0.000 claims 1
- VDXLAYAQGYCQEO-UHFFFAOYSA-N 2-chloro-1,3-dimethylbenzene Chemical group CC1=CC=CC(C)=C1Cl VDXLAYAQGYCQEO-UHFFFAOYSA-N 0.000 description 9
- IVSZLXZYQVIEFR-UHFFFAOYSA-N m-xylene Chemical group CC1=CC=CC(C)=C1 IVSZLXZYQVIEFR-UHFFFAOYSA-N 0.000 description 9
- 238000003776 cleavage reaction Methods 0.000 description 6
- 230000007017 scission Effects 0.000 description 6
- 239000000243 solution Substances 0.000 description 6
- 239000000460 chlorine Substances 0.000 description 4
- 229910052801 chlorine Inorganic materials 0.000 description 4
- 239000000203 mixture Substances 0.000 description 4
- NNXMZFSCTRDIBY-UHFFFAOYSA-N (4-methylphenyl)methanedisulfonic acid Chemical compound CC1=CC=C(C(S(O)(=O)=O)S(O)(=O)=O)C=C1 NNXMZFSCTRDIBY-UHFFFAOYSA-N 0.000 description 3
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 3
- NVLHGZIXTRYOKT-UHFFFAOYSA-N 1-chloro-2,3-dimethylbenzene Chemical group CC1=CC=CC(Cl)=C1C NVLHGZIXTRYOKT-UHFFFAOYSA-N 0.000 description 2
- JZGJGLYZHPAEEN-UHFFFAOYSA-N CC1=CC(=CC=C1)C.[Cl] Chemical group CC1=CC(=CC=C1)C.[Cl] JZGJGLYZHPAEEN-UHFFFAOYSA-N 0.000 description 2
- NHYCGSASNAIGLD-UHFFFAOYSA-N Chlorine monoxide Chemical compound Cl[O] NHYCGSASNAIGLD-UHFFFAOYSA-N 0.000 description 2
- 238000004508 fractional distillation Methods 0.000 description 2
- QWPPOHNGKGFGJK-UHFFFAOYSA-N hypochlorous acid Chemical compound ClO QWPPOHNGKGFGJK-UHFFFAOYSA-N 0.000 description 2
- 239000000047 product Substances 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- 125000000020 sulfo group Chemical group O=S(=O)([*])O[H] 0.000 description 2
- UIEVCEQLNUHDIF-UHFFFAOYSA-N 1-chloro-2,4-dimethylbenzene Chemical group CC1=CC=C(Cl)C(C)=C1 UIEVCEQLNUHDIF-UHFFFAOYSA-N 0.000 description 1
- 230000002860 competitive effect Effects 0.000 description 1
- 239000012043 crude product Substances 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- 239000012895 dilution Substances 0.000 description 1
- 238000010790 dilution Methods 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 238000005194 fractionation Methods 0.000 description 1
- 238000009776 industrial production Methods 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- -1 m-xylene sulfonic acid monochloro-m-xylene Chemical group 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 159000000000 sodium salts Chemical class 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 238000006467 substitution reaction Methods 0.000 description 1
- 150000003460 sulfonic acids Chemical class 0.000 description 1
- FZUJWWOKDIGOKH-UHFFFAOYSA-N sulfuric acid hydrochloride Chemical compound Cl.OS(O)(=O)=O FZUJWWOKDIGOKH-UHFFFAOYSA-N 0.000 description 1
Family
ID=
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DEF0018304MA (enrdf_load_stackoverflow) | ||
| DE965228C (de) | Verfahren zur Herstellung von 2-Chlor-m-xylol durch Chlorieren von m-Xylol-4, 6-disulfonsaeure | |
| DE491220C (de) | Verfahren zur Herstellung von Chlorierungsprodukten aus 1, 3-Dimethylbenzol-4-sulfonsaeure | |
| DE2856567C3 (de) | Verfahren zur Kristallisation von 3-Nitro-naphthalin-1,5-disulfonsäuredimagnesiumsalz | |
| DE1279672B (de) | Verfahren zur Herstellung von 2, 3, 5-Trichlor-, 2, 3, 5, 6-Tetrachlor-4-methylbenzolsulfonsaeure und deren Gemischen bzw. entsprechender Salze | |
| DE1175690B (de) | Verfahren zur Herstellung von 4-Chlor-2-methylphenol | |
| AT253488B (de) | Verfahren zur Herstellung von 2-Methyl-4-chlorphenoxyalkansäuren | |
| DE1232944B (de) | Verfahren zur Herstellung von meso-2, 3-Dibrombernsteinsaeure | |
| AT52965B (de) | Verfahren zur Gewinnung von reinem Chlor-m-kresol (1:3:6) aus Gemischen der Isomeren. | |
| DE2509481C3 (de) | Verfahren zur Herstellung von N-Acetylsalicylamid | |
| AT162942B (de) | Verfahren zur Herstellung von Hexachlorcyclohexan | |
| DE1240057B (de) | Verfahren zur Herstellung von 1, 2, 3, 4-Tetra-chlorbutan | |
| DE1217947B (de) | Verfahren zur Herstellung von 2, 3-Dichlorbutadien-(1, 3) | |
| EP0691323A1 (de) | Verfahren zur Herstellung von 3,5-Dihydroxy-4-brombenzoesäure | |
| DE1222049B (de) | Verfahren zur Herstellung von 1, 2, 5, 6, 9, 10-Hexabromcyclododecan | |
| DE1793350C3 (de) | Verfahren zur Herstellung von alkylsubstituierten Glutarsäuren | |
| EP0457725A2 (de) | Verfahren zur Herstellung von 2,3-Dibrompropionylchlorid | |
| DE846545C (de) | Verfahren zur Herstellung von halogenhaltigen ª‡,ª‡-Diarylalkanen | |
| DE1028129B (de) | Verfahren zur Herstellung von N-disubstituierten Sulfamidsaeurechloriden | |
| DE672371C (de) | Verfahren zur Herstellung von aromatischen Aminen, welche die Trifluormethylgruppe enthalten | |
| DE3440486A1 (de) | Verfahren zur herstellung von 2-hydroxy-carbazol l-carbonsaeure | |
| CH620903A5 (enrdf_load_stackoverflow) | ||
| DE2852159A1 (de) | Verfahren zur herstellung von amidosulfonsaeuren | |
| DE1254141B (de) | Verfahren zur Herstellung von alpha-Chlor- oder alpha-Bromderivaten gesaettigter aliphatischer Mono- oder Dicarbonsaeuren | |
| DE1618981B1 (de) | Verfahren zur Herstellung von niederen Alkylestern der 4-Phenyl-3-oxobutan-1-carbonsäure |