DEF0017426MA - - Google Patents
Info
- Publication number
- DEF0017426MA DEF0017426MA DEF0017426MA DE F0017426M A DEF0017426M A DE F0017426MA DE F0017426M A DEF0017426M A DE F0017426MA
- Authority
- DE
- Germany
- Prior art keywords
- reaction
- polyester
- groups
- linear
- end groups
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Active
Links
- 229920000728 polyester Polymers 0.000 claims description 19
- 238000006243 chemical reaction Methods 0.000 claims description 14
- 125000005442 diisocyanate group Chemical group 0.000 claims description 13
- 238000000034 method Methods 0.000 claims description 13
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 9
- 229920001281 polyalkylene Polymers 0.000 claims description 7
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 claims description 6
- 125000001033 ether group Chemical group 0.000 claims description 5
- 239000004033 plastic Substances 0.000 claims description 5
- 229920003023 plastic Polymers 0.000 claims description 5
- 125000004432 carbon atom Chemical group C* 0.000 claims description 3
- 125000004430 oxygen atom Chemical group O* 0.000 claims description 3
- 238000004519 manufacturing process Methods 0.000 claims description 2
- 150000002170 ethers Chemical class 0.000 claims 4
- 239000007795 chemical reaction product Substances 0.000 claims 2
- 239000000047 product Substances 0.000 claims 1
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical class OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 12
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 8
- 229920000570 polyether Polymers 0.000 description 7
- 150000002334 glycols Chemical class 0.000 description 6
- 239000002253 acid Substances 0.000 description 5
- 239000004721 Polyphenylene oxide Substances 0.000 description 4
- WNLRTRBMVRJNCN-UHFFFAOYSA-N adipic acid Chemical compound OC(=O)CCCCC(O)=O WNLRTRBMVRJNCN-UHFFFAOYSA-N 0.000 description 4
- WGCNASOHLSPBMP-UHFFFAOYSA-N hydroxyacetaldehyde Natural products OCC=O WGCNASOHLSPBMP-UHFFFAOYSA-N 0.000 description 4
- 239000000463 material Substances 0.000 description 4
- -1 quinite Chemical compound 0.000 description 4
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 4
- SBJCUZQNHOLYMD-UHFFFAOYSA-N 1,5-Naphthalene diisocyanate Chemical compound C1=CC=C2C(N=C=O)=CC=CC2=C1N=C=O SBJCUZQNHOLYMD-UHFFFAOYSA-N 0.000 description 3
- 230000001588 bifunctional effect Effects 0.000 description 3
- 150000001875 compounds Chemical class 0.000 description 3
- MTHSVFCYNBDYFN-UHFFFAOYSA-N diethylene glycol Chemical compound OCCOCCO MTHSVFCYNBDYFN-UHFFFAOYSA-N 0.000 description 3
- IQPQWNKOIGAROB-UHFFFAOYSA-N isocyanate group Chemical group [N-]=C=O IQPQWNKOIGAROB-UHFFFAOYSA-N 0.000 description 3
- 229920000642 polymer Polymers 0.000 description 3
- 238000006116 polymerization reaction Methods 0.000 description 3
- PUPZLCDOIYMWBV-UHFFFAOYSA-N (+/-)-1,3-Butanediol Chemical compound CC(O)CCO PUPZLCDOIYMWBV-UHFFFAOYSA-N 0.000 description 2
- 239000001361 adipic acid Substances 0.000 description 2
- 235000011037 adipic acid Nutrition 0.000 description 2
- 125000001931 aliphatic group Chemical group 0.000 description 2
- 229910052801 chlorine Inorganic materials 0.000 description 2
- 239000012948 isocyanate Substances 0.000 description 2
- 150000002513 isocyanates Chemical class 0.000 description 2
- 239000000155 melt Substances 0.000 description 2
- CXMXRPHRNRROMY-UHFFFAOYSA-N sebacic acid Chemical compound OC(=O)CCCCCCCCC(O)=O CXMXRPHRNRROMY-UHFFFAOYSA-N 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 2
- JOYRKODLDBILNP-UHFFFAOYSA-N urethane group Chemical group NC(=O)OCC JOYRKODLDBILNP-UHFFFAOYSA-N 0.000 description 2
- PCHXZXKMYCGVFA-UHFFFAOYSA-N 1,3-diazetidine-2,4-dione Chemical group O=C1NC(=O)N1 PCHXZXKMYCGVFA-UHFFFAOYSA-N 0.000 description 1
- UPMLOUAZCHDJJD-UHFFFAOYSA-N 4,4'-Diphenylmethane Diisocyanate Chemical compound C1=CC(N=C=O)=CC=C1CC1=CC=C(N=C=O)C=C1 UPMLOUAZCHDJJD-UHFFFAOYSA-N 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- 239000002202 Polyethylene glycol Substances 0.000 description 1
- 240000004808 Saccharomyces cerevisiae Species 0.000 description 1
- KDYFGRWQOYBRFD-UHFFFAOYSA-N Succinic acid Natural products OC(=O)CCC(O)=O KDYFGRWQOYBRFD-UHFFFAOYSA-N 0.000 description 1
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 1
- WETWJCDKMRHUPV-UHFFFAOYSA-N acetyl chloride Chemical compound CC(Cl)=O WETWJCDKMRHUPV-UHFFFAOYSA-N 0.000 description 1
- 239000012346 acetyl chloride Substances 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 125000002947 alkylene group Chemical group 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- KDYFGRWQOYBRFD-NUQCWPJISA-N butanedioic acid Chemical compound O[14C](=O)CC[14C](O)=O KDYFGRWQOYBRFD-NUQCWPJISA-N 0.000 description 1
- 239000004202 carbamide Substances 0.000 description 1
- 125000005521 carbonamide group Chemical group 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 239000000460 chlorine Substances 0.000 description 1
- 125000001309 chloro group Chemical group Cl* 0.000 description 1
- 125000004122 cyclic group Chemical group 0.000 description 1
- 230000018044 dehydration Effects 0.000 description 1
- 238000006297 dehydration reaction Methods 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 239000013013 elastic material Substances 0.000 description 1
- 125000004185 ester group Chemical group 0.000 description 1
- 125000000524 functional group Chemical group 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- 239000000203 mixture Substances 0.000 description 1
- 229920001223 polyethylene glycol Polymers 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 230000000717 retained effect Effects 0.000 description 1
- 238000007127 saponification reaction Methods 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- NVBFHJWHLNUMCV-UHFFFAOYSA-N sulfamide Chemical compound NS(N)(=O)=O NVBFHJWHLNUMCV-UHFFFAOYSA-N 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 1
Family
ID=
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1105156B (de) | Verfahren zur Herstellung von homogenen Formkoerpern und Schaumkoerpern | |
| DE1153900B (de) | Verfahren zur Herstellung von kautschukartigen thermoplastischen Polyurethanen | |
| DE1720843B2 (de) | Fuer den spritzguss geeignete polyurethane | |
| DE1100947B (de) | Verfahren zur Herstellung vernetzter elastomerer Polyurethane | |
| DE2645779B2 (de) | Verfahren zur Herstellung von emulgatorfreien, wäßrigen Polyurethandispersionen | |
| DE1694135A1 (de) | Verfahren zur Herstellung von vernetzten Kunststoffen | |
| DE2516970A1 (de) | Hochtemperaturbestaendige, thermoplastische polyurethanelastomere | |
| DE963104C (de) | Verfahren zur Herstellung hochmolekularer vernetzter Kunststoffe im wesentlichen aus linearen oder vorwiegend linearen, ueberwiegend Hydroxyl-Endgruppen enthaltenden Polyestern und organischen Diisocyanaten | |
| EP2247637A1 (de) | Thermoplastisches polyurethan mit verminderter belagsbildung | |
| DE831604C (de) | Verfahren zur Herstellung von Kunststoffen | |
| DE965359C (de) | Verfahren zur Herstellung vernetzter kautschukartiger Polykondensate aus diisocyanatmodifizierten Polyestern | |
| DE2442763B2 (de) | Verfahren zur Herstellung von thermoplastischen und elastischen Polyurethanen | |
| DE961573C (de) | Verfahren zur Herstellung von Schaumstoffen aus hydroxylgruppen- haltigen linearen oder verzweigten Polyaethern oder Polythioaethern und Polyisocyanaten | |
| DEF0017426MA (enrdf_load_stackoverflow) | ||
| DE2431032C2 (de) | Polymere Acetale, die Urethan-, Carbamid- und Amidgruppen enthalten, und Verfahren zu ihrer Herstellung | |
| DE896413C (de) | Verfahren zur Herstellung von hochmolekularen Kunststoffen vom Charakter eines vulkanisierten Kautschuks bzw. eines Leders | |
| DE1014740B (de) | Verfahren zur Herstellung von hochmolekularen vernetzten Kunststoffen | |
| DE2508783A1 (de) | Poly(esteramid) und zu diesem fuehrende lagerungsstabile masse | |
| DE962112C (de) | Verfahren zur Herstellung hochmolekularer, vernetzter Kunststoffe aus linearen oder vorwiegend linearen, groesstenteils aus aliphatischen Dicarbonsaeuren und Glykolen aufgebauten Polyestern, organischen Diisocyanaten und Glykolen | |
| DE1518464A1 (de) | Verfahren zur Herstellung von Polyisocyanatmassen | |
| DE102006048288A1 (de) | Polyesterpolyole, Verfahren zu ihrer Herstellung und ihre Verwendung | |
| DE959679C (de) | Verfahren zur Herstellung lagerfaehiger, mit Diisocyanaten zu kautschukelastischen Formkoerpern verarbeitbarer Kunststoffe aus Polyestern, Glykolen und Diisocyanaten | |
| DE1570599C3 (de) | Verfahren zur Herstellung hochmolekularer elastischer Polyurethane unter Formgebung. An9: Bayer AG, 5090 Leverkusen | |
| DEF0011665MA (enrdf_load_stackoverflow) | ||
| DE953115C (de) | Verfahren zur Herstellung hochmolekularer vernetzter Kunststoffe aus linearen oder vorwiegend linearen Polyestern, Diisocyanaten und Glykolen |