DEF0015858MA - - Google Patents
Info
- Publication number
- DEF0015858MA DEF0015858MA DEF0015858MA DE F0015858M A DEF0015858M A DE F0015858MA DE F0015858M A DEF0015858M A DE F0015858MA
- Authority
- DE
- Germany
- Prior art keywords
- weight
- parts
- salts
- trichloromethylthiosulfonic
- perchloromethyl
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Active
Links
- -1 Trichloromethylthiosulfonic acid ester Chemical class 0.000 claims description 9
- 201000010099 disease Diseases 0.000 claims description 4
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 claims description 4
- 239000000417 fungicide Substances 0.000 claims description 2
- 125000003118 aryl group Chemical group 0.000 claims 1
- 235000002639 sodium chloride Nutrition 0.000 description 7
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 6
- 238000006243 chemical reaction Methods 0.000 description 5
- 150000001875 compounds Chemical class 0.000 description 4
- 150000003839 salts Chemical class 0.000 description 4
- 241000196324 Embryophyta Species 0.000 description 3
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 3
- 241000233622 Phytophthora infestans Species 0.000 description 3
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 3
- 229910052708 sodium Inorganic materials 0.000 description 3
- 239000011734 sodium Substances 0.000 description 3
- 241001459558 Monographella nivalis Species 0.000 description 2
- CJJYHFYSHOBFDR-UHFFFAOYSA-N OS(=O)(=S)C(Cl)(Cl)Cl Chemical class OS(=O)(=S)C(Cl)(Cl)Cl CJJYHFYSHOBFDR-UHFFFAOYSA-N 0.000 description 2
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 2
- 239000006227 byproduct Substances 0.000 description 2
- 239000011780 sodium chloride Substances 0.000 description 2
- 150000003455 sulfinic acids Chemical class 0.000 description 2
- 125000004189 3,4-dichlorophenyl group Chemical group [H]C1=C([H])C(Cl)=C(Cl)C([H])=C1* 0.000 description 1
- 241000223218 Fusarium Species 0.000 description 1
- 240000005979 Hordeum vulgare Species 0.000 description 1
- 235000007340 Hordeum vulgare Nutrition 0.000 description 1
- 208000031888 Mycoses Diseases 0.000 description 1
- 241000514371 Ustilago avenae Species 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 150000005840 aryl radicals Chemical class 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 235000013532 brandy Nutrition 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- NEHMKBQYUWJMIP-UHFFFAOYSA-N chloromethane Chemical compound ClC NEHMKBQYUWJMIP-UHFFFAOYSA-N 0.000 description 1
- UKJLNMAFNRKWGR-UHFFFAOYSA-N cyclohexatrienamine Chemical group NC1=CC=C=C[CH]1 UKJLNMAFNRKWGR-UHFFFAOYSA-N 0.000 description 1
- 239000003085 diluting agent Substances 0.000 description 1
- 230000000855 fungicidal effect Effects 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 125000003261 o-tolyl group Chemical group [H]C1=C([H])C(*)=C(C([H])=C1[H])C([H])([H])[H] 0.000 description 1
- 150000007530 organic bases Chemical class 0.000 description 1
- 125000000636 p-nitrophenyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)[N+]([O-])=O 0.000 description 1
- 125000001037 p-tolyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)C([H])([H])[H] 0.000 description 1
- 239000003973 paint Substances 0.000 description 1
- RYFZYYUIAZYQLC-UHFFFAOYSA-N perchloromethyl mercaptan Chemical compound ClSC(Cl)(Cl)Cl RYFZYYUIAZYQLC-UHFFFAOYSA-N 0.000 description 1
- 239000000575 pesticide Substances 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 239000007921 spray Substances 0.000 description 1
- BUUPQKDIAURBJP-UHFFFAOYSA-N sulfinic acid Chemical class OS=O BUUPQKDIAURBJP-UHFFFAOYSA-N 0.000 description 1
- XTHPWXDJESJLNJ-UHFFFAOYSA-N sulfurochloridic acid Chemical compound OS(Cl)(=O)=O XTHPWXDJESJLNJ-UHFFFAOYSA-N 0.000 description 1
- 150000003512 tertiary amines Chemical class 0.000 description 1
- 230000001988 toxicity Effects 0.000 description 1
- 231100000419 toxicity Toxicity 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 1
Family
ID=
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1695273B2 (de) | Pyrimidinylphosphorsaeureester, verfahren zu deren herstellung und diese enthaltende schaedlingsbekaempfungsmittel | |
| DEF0015858MA (enExample) | ||
| DE2108975B2 (de) | N-Acyl-Diurethane sowie diese enthaltendes herbizides Mittel | |
| DE1154089B (de) | Verfahren zur Herstellung N-substituierter Imino-halogen-kohlensaeurethioester | |
| EP0023976B1 (de) | N-Aryl-N'-acryloyl-ureide, Verfahren zu ihrer Herstellung sowie ihre Verwendung als Mikrobizide | |
| EP0044974B1 (de) | Verfahren zur Herstellung von 2-Aryloxy-2-halogenpropionsäureverbindungen | |
| DE2007864B2 (de) | Verfahren zur Herstellung von S-2-Alkyl-thioäthylestern von Thiophosphorsäuren, neue S-2-Alkyl-thioäthylester von Thiophosphorsäuren und diese enthaltende Schädlingsbekämpfungsmittel | |
| EP0467251B1 (de) | Verfahren zur Herstellung von N-Alkylsulfonylaminosulfonylharnstoffen | |
| DE1956234A1 (de) | Triazaadamantanderivate und Verfahren zu deren Herstellung | |
| DE1695272B2 (de) | In 5-stellung substituierte 2- amino-4-acyloxy- bzw. -acylmercapto- 6-methyl-pyrimidine | |
| CH488405A (de) | Schädlingsbekämpfungsmittel | |
| DE1121882B (de) | Schaedlingsbekaempfungsmittel mit insektizider und akarizider Wirkung | |
| DE1695272C3 (de) | In S-Stellung substituierte 2-Amino-4-acyloxy- bzw. -acylmercapto-6-methyl-pyrimidine | |
| DE1768130C3 (de) | lsocyan-diphenyl(-thio)-äther sowie Verfahren zu ihrer Herstellung und deren Verwendung zur Bekämpfung von Akariden | |
| US3850610A (en) | Herbicidal method | |
| DE1115516B (de) | Herbicide Mittel | |
| DE1192202B (de) | Verfahren zur Herstellung von (Thiono) Phosphor-(on, in)-saeureestern | |
| DE1800836C3 (de) | (Tetrachlorfluoräthylthio) - N phenylsulfonamide und diese enthaltende Mittel | |
| DE1126382B (de) | Verfahren zur Herstellung von Thiophosphorsaeureestern | |
| DE1178416B (de) | Verfahren zur Herstellung von Bis-dithiocarbaminsaeureester-Derivaten | |
| DE1140583B (de) | Verfahren zur Herstellung von o-[Bis-(2-chloraethyl)-amino]-phenyl-alanin | |
| AT226251B (de) | Verfahren zur Herstellung von neuen Thiophosphorsäureestern | |
| DE1203788B (de) | Verfahren zur Herstellung von Halogenalkyl- und Halogenalkenyl-sulfenyl-dicarbonsaeure-imiden | |
| DE2262189C3 (de) | Thionophosphoryl-thienyl-(2)-undfuryl-(2)-alpha-oximino-acetonitril-Verbindungen und diese Verbindungen enthaltende Pesticide | |
| AT264922B (de) | Schädlingsbekämpfungsmittel |