DEF0012926MA - - Google Patents
Info
- Publication number
- DEF0012926MA DEF0012926MA DEF0012926MA DE F0012926M A DEF0012926M A DE F0012926MA DE F0012926M A DEF0012926M A DE F0012926MA
- Authority
- DE
- Germany
- Prior art keywords
- sulfur trioxide
- bypassing
- water
- relaxed
- aqueous phase
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Active
Links
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 claims description 12
- AKEJUJNQAAGONA-UHFFFAOYSA-N sulfur trioxide Chemical compound O=S(=O)=O AKEJUJNQAAGONA-UHFFFAOYSA-N 0.000 claims description 10
- 229910021529 ammonia Inorganic materials 0.000 claims description 6
- 239000000203 mixture Substances 0.000 claims description 6
- 150000003839 salts Chemical class 0.000 claims description 6
- BZSXEZOLBIJVQK-UHFFFAOYSA-N 2-methylsulfonylbenzoic acid Chemical compound CS(=O)(=O)C1=CC=CC=C1C(O)=O BZSXEZOLBIJVQK-UHFFFAOYSA-N 0.000 claims description 4
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 4
- 239000000460 chlorine Substances 0.000 claims description 4
- 229910052801 chlorine Inorganic materials 0.000 claims description 4
- 239000008346 aqueous phase Substances 0.000 claims description 3
- 239000003921 oil Substances 0.000 claims description 3
- 239000011541 reaction mixture Substances 0.000 claims description 2
- 239000003795 chemical substances by application Substances 0.000 claims 1
- 150000001804 chlorine Chemical class 0.000 claims 1
- XTEGARKTQYYJKE-UHFFFAOYSA-M Chlorate Chemical compound [O-]Cl(=O)=O XTEGARKTQYYJKE-UHFFFAOYSA-M 0.000 description 5
- 239000000047 product Substances 0.000 description 5
- GEHMBYLTCISYNY-UHFFFAOYSA-N Ammonium sulfamate Chemical compound [NH4+].NS([O-])(=O)=O GEHMBYLTCISYNY-UHFFFAOYSA-N 0.000 description 3
- IIACRCGMVDHOTQ-UHFFFAOYSA-N sulfamic acid Chemical class NS(O)(=O)=O IIACRCGMVDHOTQ-UHFFFAOYSA-N 0.000 description 3
- OVSKIKFHRZPJSS-UHFFFAOYSA-N 2,4-D Chemical compound OC(=O)COC1=CC=C(Cl)C=C1Cl OVSKIKFHRZPJSS-UHFFFAOYSA-N 0.000 description 2
- 150000001408 amides Chemical class 0.000 description 2
- 150000003863 ammonium salts Chemical class 0.000 description 2
- 239000007795 chemical reaction product Substances 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- ZZECXNVRWUIJSW-UHFFFAOYSA-N 1,2-dioctylbenzene Chemical compound CCCCCCCCC1=CC=CC=C1CCCCCCCC ZZECXNVRWUIJSW-UHFFFAOYSA-N 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- 241000196324 Embryophyta Species 0.000 description 1
- 208000010201 Exanthema Diseases 0.000 description 1
- 239000004606 Fillers/Extenders Substances 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 1
- SAQSTQBVENFSKT-UHFFFAOYSA-M TCA-sodium Chemical compound [Na+].[O-]C(=O)C(Cl)(Cl)Cl SAQSTQBVENFSKT-UHFFFAOYSA-M 0.000 description 1
- BFNBIHQBYMNNAN-UHFFFAOYSA-N ammonium sulfate Chemical compound N.N.OS(O)(=O)=O BFNBIHQBYMNNAN-UHFFFAOYSA-N 0.000 description 1
- 229910052921 ammonium sulfate Inorganic materials 0.000 description 1
- 235000011130 ammonium sulphate Nutrition 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- 238000006243 chemical reaction Methods 0.000 description 1
- 239000012084 conversion product Substances 0.000 description 1
- 239000000975 dye Substances 0.000 description 1
- 201000005884 exanthem Diseases 0.000 description 1
- 230000002363 herbicidal effect Effects 0.000 description 1
- 239000012535 impurity Substances 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- 230000002035 prolonged effect Effects 0.000 description 1
- 206010037844 rash Diseases 0.000 description 1
- 239000011833 salt mixture Substances 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- FDRCDNZGSXJAFP-UHFFFAOYSA-M sodium chloroacetate Chemical compound [Na+].[O-]C(=O)CCl FDRCDNZGSXJAFP-UHFFFAOYSA-M 0.000 description 1
- -1 sodium trichlorobutyric acid Chemical compound 0.000 description 1
- 239000012265 solid product Substances 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- NVBFHJWHLNUMCV-UHFFFAOYSA-N sulfamide Chemical compound NS(N)(=O)=O NVBFHJWHLNUMCV-UHFFFAOYSA-N 0.000 description 1
- VKHQYTLHHOQKSC-UHFFFAOYSA-N sulfosulfamic acid Chemical compound OS(=O)(=O)NS(O)(=O)=O VKHQYTLHHOQKSC-UHFFFAOYSA-N 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 1
- 239000000080 wetting agent Substances 0.000 description 1
Family
ID=
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1013302B (de) | Mittel zum voruebergehenden Sterilisieren von landwirtschaftlichen Kulturboeden | |
| DE955375C (de) | Streufaehig bleibende Unkrautbekaempfungsmittel, insbesondere baumwurzeltoetende Mittel | |
| DEF0012926MA (enExample) | ||
| EP1298998A1 (de) | Präparat mit fungizider wirkung | |
| DE934104C (de) | Fluessiges Spritzmittel zur Behandlung von Pflanzen und zur Verbesserung, Aktivierung und zum Gesunderhalten von Boeden | |
| DE2217896A1 (de) | Mittel zur regulierung des pflanzenwachstums | |
| DE708060C (de) | Duengemittel | |
| AT329925B (de) | Systemisch wirkende fungizide | |
| DE665145C (de) | Verfahren zur Herstellung von Stickstoffduengemitteln | |
| DE421331C (de) | Herstellung eines haltbaren Mischduengers aus Calciumnitrat | |
| US2218787A (en) | Herbicide | |
| AT32615B (de) | Verfahren zur Herstellung eines eine Quecksilberemulsion bildenden Insekten-vertilgungsmittels. | |
| DE700969C (de) | Erhoehung der Wirksamkeit von Desinfektionsmitteln | |
| DE207726C (enExample) | ||
| DE596881C (de) | Unkrautvertilgungsmittel | |
| DD259123A1 (de) | Mittel zur erhoehung der toleranz von nutzpflanzen gegenueber stressbedingungen | |
| DE2163062C3 (de) | Mittel zum Frischhalten von Schnittblumen | |
| DE564609C (de) | Verfahren zur UEberfuehrung anorganischer, arzneilich wirkender Stoffe in eine fuer den tierischen Organismus leichter assimilierbare Form | |
| DE671162C (de) | Raupenbekaempfungsmittel | |
| DE564840C (de) | Kolloidales, arsenhaltiges Pflanzenschutzmittel | |
| AT33937B (de) | Mittel zur Vertilgung von Schädlichen Insekten auf Pflanzen. | |
| DE723027C (de) | UEber die Wurzel zugefuehrtes Pflanzenschutzmittel | |
| DE266809C (enExample) | ||
| DE107920C (enExample) | ||
| AT125175B (de) | Mittel zur Bodenbehandlung. |