DEE0007988MA - - Google Patents
Info
- Publication number
- DEE0007988MA DEE0007988MA DEE0007988MA DE E0007988M A DEE0007988M A DE E0007988MA DE E0007988M A DEE0007988M A DE E0007988MA
- Authority
- DE
- Germany
- Prior art keywords
- photographic material
- formula
- layer
- compound
- gelatin
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Active
Links
- 239000000463 material Substances 0.000 claims description 58
- 150000001875 compounds Chemical class 0.000 claims description 45
- 239000000839 emulsion Substances 0.000 claims description 21
- 108010010803 Gelatin Proteins 0.000 claims description 19
- 229920000159 gelatin Polymers 0.000 claims description 19
- 239000008273 gelatin Substances 0.000 claims description 19
- 235000019322 gelatine Nutrition 0.000 claims description 19
- 235000011852 gelatine desserts Nutrition 0.000 claims description 19
- 230000005855 radiation Effects 0.000 claims description 19
- 125000003118 aryl group Chemical group 0.000 claims description 9
- 150000001447 alkali salts Chemical class 0.000 claims description 8
- 229910052717 sulfur Inorganic materials 0.000 claims description 8
- 229910052709 silver Inorganic materials 0.000 claims description 7
- 239000004332 silver Substances 0.000 claims description 7
- 229910052708 sodium Inorganic materials 0.000 claims description 7
- BQCADISMDOOEFD-UHFFFAOYSA-N Silver Chemical compound [Ag] BQCADISMDOOEFD-UHFFFAOYSA-N 0.000 claims description 4
- 125000000217 alkyl group Chemical group 0.000 claims description 4
- 125000001841 imino group Chemical group [H]N=* 0.000 claims description 3
- 238000000034 method Methods 0.000 claims description 3
- 125000004430 oxygen atom Chemical group O* 0.000 claims description 3
- 125000004434 sulfur atom Chemical group 0.000 claims description 3
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims 3
- 238000001879 gelation Methods 0.000 claims 1
- 150000004820 halides Chemical class 0.000 claims 1
- ORTFAQDWJHRMNX-UHFFFAOYSA-M oxidooxomethyl Chemical compound [O-][C]=O ORTFAQDWJHRMNX-UHFFFAOYSA-M 0.000 claims 1
- 229910052760 oxygen Inorganic materials 0.000 claims 1
- 238000002360 preparation method Methods 0.000 claims 1
- -1 silver halide Chemical class 0.000 description 19
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 18
- 159000000000 sodium salts Chemical class 0.000 description 14
- 239000011734 sodium Substances 0.000 description 12
- 239000000243 solution Substances 0.000 description 12
- 239000000203 mixture Substances 0.000 description 11
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 10
- 238000004458 analytical method Methods 0.000 description 10
- 239000000047 product Substances 0.000 description 10
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 9
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 description 8
- 229910052739 hydrogen Inorganic materials 0.000 description 8
- 239000001257 hydrogen Substances 0.000 description 8
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 7
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 6
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 6
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 6
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 6
- 239000000975 dye Substances 0.000 description 6
- 150000002431 hydrogen Chemical group 0.000 description 6
- XAEFZNCEHLXOMS-UHFFFAOYSA-M potassium benzoate Chemical compound [K+].[O-]C(=O)C1=CC=CC=C1 XAEFZNCEHLXOMS-UHFFFAOYSA-M 0.000 description 6
- PLKLWFKXGPNNGY-UHFFFAOYSA-N C1(=CC=CC=C1)N1C(S(C([CH-]1)=CC1=C(C=CC=C1)S(=O)(=O)O)=O)=NC1=CC=CC=C1 Chemical compound C1(=CC=CC=C1)N1C(S(C([CH-]1)=CC1=C(C=CC=C1)S(=O)(=O)O)=O)=NC1=CC=CC=C1 PLKLWFKXGPNNGY-UHFFFAOYSA-N 0.000 description 5
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 5
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 5
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 5
- 238000009835 boiling Methods 0.000 description 5
- 229910052799 carbon Inorganic materials 0.000 description 5
- 229910052757 nitrogen Inorganic materials 0.000 description 5
- 230000002035 prolonged effect Effects 0.000 description 5
- 239000011593 sulfur Substances 0.000 description 5
- MUMZWSRFNYNJBD-UHFFFAOYSA-N 1-oxo-N,3-diphenyl-4H-1,3-thiazol-4-id-2-imine Chemical compound C1(=CC=CC=C1)N1C(S(C=[C-]1)=O)=NC1=CC=CC=C1 MUMZWSRFNYNJBD-UHFFFAOYSA-N 0.000 description 4
- 238000003287 bathing Methods 0.000 description 4
- 238000002844 melting Methods 0.000 description 4
- 230000008018 melting Effects 0.000 description 4
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 3
- SMEGJBVQLJJKKX-HOTMZDKISA-N [(2R,3S,4S,5R,6R)-5-acetyloxy-3,4,6-trihydroxyoxan-2-yl]methyl acetate Chemical compound CC(=O)OC[C@@H]1[C@H]([C@@H]([C@H]([C@@H](O1)O)OC(=O)C)O)O SMEGJBVQLJJKKX-HOTMZDKISA-N 0.000 description 3
- 229940081735 acetylcellulose Drugs 0.000 description 3
- 229920002678 cellulose Polymers 0.000 description 3
- 229920002301 cellulose acetate Polymers 0.000 description 3
- 229910052736 halogen Inorganic materials 0.000 description 3
- 150000002367 halogens Chemical class 0.000 description 3
- 230000009931 harmful effect Effects 0.000 description 3
- 239000011541 reaction mixture Substances 0.000 description 3
- 238000010992 reflux Methods 0.000 description 3
- 239000007787 solid Substances 0.000 description 3
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 2
- ZQDPYAPUFMILTB-UHFFFAOYSA-N 5-benzylidene-3-ethyl-2-sulfanylidene-1,3-thiazolidin-4-one Chemical compound O=C1N(CC)C(=S)SC1=CC1=CC=CC=C1 ZQDPYAPUFMILTB-UHFFFAOYSA-N 0.000 description 2
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 2
- UNZMMWYDLPYNAI-UHFFFAOYSA-N C1(=CC=CC=C1)N1C(S(C([CH-]1)=CC1=CC(=CC=C1)NC(C1=CC(=CC=C1)S(=O)(=O)O)=O)=O)=NC1=CC=CC=C1 Chemical compound C1(=CC=CC=C1)N1C(S(C([CH-]1)=CC1=CC(=CC=C1)NC(C1=CC(=CC=C1)S(=O)(=O)O)=O)=O)=NC1=CC=CC=C1 UNZMMWYDLPYNAI-UHFFFAOYSA-N 0.000 description 2
- QUJSBIPVPLQQFP-UHFFFAOYSA-N COC1=C(C=C(C=C2[CH-]N(C(S2=O)=NC2=CC=CC=C2)C2=CC=CC=C2)C=C1)S(=O)(=O)O Chemical compound COC1=C(C=C(C=C2[CH-]N(C(S2=O)=NC2=CC=CC=C2)C2=CC=CC=C2)C=C1)S(=O)(=O)O QUJSBIPVPLQQFP-UHFFFAOYSA-N 0.000 description 2
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 2
- XKNOKEMBAQHBAL-UHFFFAOYSA-N NC=1C=C(C=C2[CH-]N(C(S2=O)=NC2=CC=CC=C2)C2=CC=CC=C2)C=CC=1 Chemical compound NC=1C=C(C=C2[CH-]N(C(S2=O)=NC2=CC=CC=C2)C2=CC=CC=C2)C=CC=1 XKNOKEMBAQHBAL-UHFFFAOYSA-N 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- PLCGBVOPMBUJQB-UHFFFAOYSA-N [N+](=O)([O-])C=1C=C(C=C2[CH-]N(C(S2=O)=NC2=CC=CC=C2)C2=CC=CC=C2)C=CC=1 Chemical compound [N+](=O)([O-])C=1C=C(C=C2[CH-]N(C(S2=O)=NC2=CC=CC=C2)C2=CC=CC=C2)C=CC=1 PLCGBVOPMBUJQB-UHFFFAOYSA-N 0.000 description 2
- 239000002250 absorbent Substances 0.000 description 2
- 230000002745 absorbent Effects 0.000 description 2
- 238000010521 absorption reaction Methods 0.000 description 2
- 230000001476 alcoholic effect Effects 0.000 description 2
- 239000003513 alkali Substances 0.000 description 2
- 239000007864 aqueous solution Substances 0.000 description 2
- HUMNYLRZRPPJDN-UHFFFAOYSA-N benzaldehyde Chemical compound O=CC1=CC=CC=C1 HUMNYLRZRPPJDN-UHFFFAOYSA-N 0.000 description 2
- 239000003795 chemical substances by application Substances 0.000 description 2
- 239000000460 chlorine Substances 0.000 description 2
- 238000009833 condensation Methods 0.000 description 2
- 230000005494 condensation Effects 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 239000000706 filtrate Substances 0.000 description 2
- 125000000040 m-tolyl group Chemical group [H]C1=C([H])C(*)=C([H])C(=C1[H])C([H])([H])[H] 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- OJURWUUOVGOHJZ-UHFFFAOYSA-N methyl 2-[(2-acetyloxyphenyl)methyl-[2-[(2-acetyloxyphenyl)methyl-(2-methoxy-2-oxoethyl)amino]ethyl]amino]acetate Chemical compound C=1C=CC=C(OC(C)=O)C=1CN(CC(=O)OC)CCN(CC(=O)OC)CC1=CC=CC=C1OC(C)=O OJURWUUOVGOHJZ-UHFFFAOYSA-N 0.000 description 2
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 2
- 239000000843 powder Substances 0.000 description 2
- 230000001681 protective effect Effects 0.000 description 2
- 230000003595 spectral effect Effects 0.000 description 2
- 229920003002 synthetic resin Polymers 0.000 description 2
- 239000000057 synthetic resin Substances 0.000 description 2
- 238000001429 visible spectrum Methods 0.000 description 2
- 238000004383 yellowing Methods 0.000 description 2
- HQEPZWYPQQKFLU-UHFFFAOYSA-N (2,6-dihydroxyphenyl)-phenylmethanone Chemical class OC1=CC=CC(O)=C1C(=O)C1=CC=CC=C1 HQEPZWYPQQKFLU-UHFFFAOYSA-N 0.000 description 1
- RYVVCDVZVDRHMR-UHFFFAOYSA-N 1-(1,2-dihydroacenaphthylen-1-yl)ethanone Chemical compound C1=CC(C(C(=O)C)C2)=C3C2=CC=CC3=C1 RYVVCDVZVDRHMR-UHFFFAOYSA-N 0.000 description 1
- 125000004182 2-chlorophenyl group Chemical group [H]C1=C([H])C(Cl)=C(*)C([H])=C1[H] 0.000 description 1
- SHHKMWMIKILKQW-UHFFFAOYSA-N 2-formylbenzenesulfonic acid Chemical compound OS(=O)(=O)C1=CC=CC=C1C=O SHHKMWMIKILKQW-UHFFFAOYSA-N 0.000 description 1
- 125000004179 3-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C(Cl)=C1[H] 0.000 description 1
- XWEBTVZIZWEJOO-UHFFFAOYSA-N 3-chlorosulfonylbenzoyl chloride Chemical compound ClC(=O)C1=CC=CC(S(Cl)(=O)=O)=C1 XWEBTVZIZWEJOO-UHFFFAOYSA-N 0.000 description 1
- ZETIVVHRRQLWFW-UHFFFAOYSA-N 3-nitrobenzaldehyde Chemical compound [O-][N+](=O)C1=CC=CC(C=O)=C1 ZETIVVHRRQLWFW-UHFFFAOYSA-N 0.000 description 1
- PMIUILRAQPDLPQ-UHFFFAOYSA-N 4-(2,4-dihydroxybenzoyl)benzenesulfonic acid Chemical compound OC1=CC(O)=C(C=C1)C(=O)C1=CC=C(C=C1)S(O)(=O)=O PMIUILRAQPDLPQ-UHFFFAOYSA-N 0.000 description 1
- PXSCNCMWGXHYFD-UHFFFAOYSA-N 5-benzylidene-3-methyl-1,3-thiazolidine-2,4-dione Chemical compound O=C1N(C)C(=O)SC1=CC1=CC=CC=C1 PXSCNCMWGXHYFD-UHFFFAOYSA-N 0.000 description 1
- CXANNMZOMWEXTN-UHFFFAOYSA-N 5-formyl-2-methoxybenzenesulfonic acid Chemical compound COC1=CC=C(C=O)C=C1S(O)(=O)=O CXANNMZOMWEXTN-UHFFFAOYSA-N 0.000 description 1
- YQAPMWNHESXBDL-UHFFFAOYSA-N C(C1=CC=CC=C1)=C1[CH-]N(C(S1=O)=NC1=CC=C(C=C1)C)CC Chemical compound C(C1=CC=CC=C1)=C1[CH-]N(C(S1=O)=NC1=CC=C(C=C1)C)CC YQAPMWNHESXBDL-UHFFFAOYSA-N 0.000 description 1
- JTTJXMVNCZODHK-UHFFFAOYSA-N C(C1=CC=CC=C1)=C1[CH-]N(C(S1=O)=NC1=CC=CC=C1)C1=CC=CC=C1 Chemical compound C(C1=CC=CC=C1)=C1[CH-]N(C(S1=O)=NC1=CC=CC=C1)C1=CC=CC=C1 JTTJXMVNCZODHK-UHFFFAOYSA-N 0.000 description 1
- CWOJMTKJRDDBNR-UHFFFAOYSA-N C(C1=CC=CC=C1)=C1[CH-]N(C(S1=O)=NC1=CC=CC=C1)CC Chemical compound C(C1=CC=CC=C1)=C1[CH-]N(C(S1=O)=NC1=CC=CC=C1)CC CWOJMTKJRDDBNR-UHFFFAOYSA-N 0.000 description 1
- AEUYJDKVWZCXNR-UHFFFAOYSA-N C1(=CC=CC=C1)N1C(S(C([CH-]1)=CC=1C(O)=CC=CC=1)=O)=NC1=CC=CC=C1 Chemical compound C1(=CC=CC=C1)N1C(S(C([CH-]1)=CC=1C(O)=CC=CC=1)=O)=NC1=CC=CC=C1 AEUYJDKVWZCXNR-UHFFFAOYSA-N 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- VTZWSOKXAGDHGG-UHFFFAOYSA-N ClC1=C(C=C2[CH-]N(C(S2=O)=NC2=CC=CC=C2)C2=CC=CC=C2)C=CC=C1 Chemical compound ClC1=C(C=C2[CH-]N(C(S2=O)=NC2=CC=CC=C2)C2=CC=CC=C2)C=CC=C1 VTZWSOKXAGDHGG-UHFFFAOYSA-N 0.000 description 1
- SNBRUTUSNJUOGS-UHFFFAOYSA-N ClS(=O)(=O)C=1C=C(C(=O)NC=2C=C(C=C3[CH-]N(C(S3=O)=NC3=CC=CC=C3)C3=CC=CC=C3)C=CC=2)C=CC=1 Chemical compound ClS(=O)(=O)C=1C=C(C(=O)NC=2C=C(C=C3[CH-]N(C(S3=O)=NC3=CC=CC=C3)C3=CC=CC=C3)C=CC=2)C=CC=1 SNBRUTUSNJUOGS-UHFFFAOYSA-N 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 1
- GGMWFBWHKKQYEX-UHFFFAOYSA-N O=S(C([C-]=[NH+]1)=CC2=CC=CC=C2)C1=NC1=CC=CC=C1 Chemical compound O=S(C([C-]=[NH+]1)=CC2=CC=CC=C2)C1=NC1=CC=CC=C1 GGMWFBWHKKQYEX-UHFFFAOYSA-N 0.000 description 1
- 229910000564 Raney nickel Inorganic materials 0.000 description 1
- NPXOKRUENSOPAO-UHFFFAOYSA-N Raney nickel Chemical compound [Al].[Ni] NPXOKRUENSOPAO-UHFFFAOYSA-N 0.000 description 1
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 description 1
- 125000002777 acetyl group Chemical class [H]C([H])([H])C(*)=O 0.000 description 1
- 230000002411 adverse Effects 0.000 description 1
- 150000001299 aldehydes Chemical class 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- 238000004061 bleaching Methods 0.000 description 1
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 1
- 239000001913 cellulose Substances 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 239000000470 constituent Substances 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 230000008878 coupling Effects 0.000 description 1
- 238000010168 coupling process Methods 0.000 description 1
- 238000005859 coupling reaction Methods 0.000 description 1
- 239000006071 cream Substances 0.000 description 1
- 239000012043 crude product Substances 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- 238000002845 discoloration Methods 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 238000005562 fading Methods 0.000 description 1
- SLGWESQGEUXWJQ-UHFFFAOYSA-N formaldehyde;phenol Chemical compound O=C.OC1=CC=CC=C1 SLGWESQGEUXWJQ-UHFFFAOYSA-N 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 1
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 1
- 238000005984 hydrogenation reaction Methods 0.000 description 1
- 239000005457 ice water Substances 0.000 description 1
- 239000003701 inert diluent Substances 0.000 description 1
- 239000012442 inert solvent Substances 0.000 description 1
- 239000002198 insoluble material Substances 0.000 description 1
- 239000003456 ion exchange resin Substances 0.000 description 1
- 229920003303 ion-exchange polymer Polymers 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 230000002045 lasting effect Effects 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 230000003647 oxidation Effects 0.000 description 1
- 238000007254 oxidation reaction Methods 0.000 description 1
- 125000003854 p-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Cl 0.000 description 1
- 125000001037 p-tolyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)C([H])([H])[H] 0.000 description 1
- QNGNSVIICDLXHT-UHFFFAOYSA-N para-ethylbenzaldehyde Natural products CCC1=CC=C(C=O)C=C1 QNGNSVIICDLXHT-UHFFFAOYSA-N 0.000 description 1
- 229920001568 phenolic resin Polymers 0.000 description 1
- 229920002689 polyvinyl acetate Polymers 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 230000001376 precipitating effect Effects 0.000 description 1
- 238000003672 processing method Methods 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 238000004080 punching Methods 0.000 description 1
- 150000003220 pyrenes Chemical class 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 230000035945 sensitivity Effects 0.000 description 1
- 239000001632 sodium acetate Substances 0.000 description 1
- 235000017281 sodium acetate Nutrition 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 238000001228 spectrum Methods 0.000 description 1
- 238000010186 staining Methods 0.000 description 1
- 238000003860 storage Methods 0.000 description 1
- 125000000020 sulfo group Chemical group O=S(=O)([*])O[H] 0.000 description 1
- 230000037072 sun protection Effects 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 229920002554 vinyl polymer Polymers 0.000 description 1
Family
ID=
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2207468C2 (de) | Farbphotographisches Aufzeichnungsmaterial | |
| DE964654C (de) | Photographisches Material mit einer ultraviolettabsorbierenden Schicht | |
| DE1597572B2 (de) | Farbphotographische Silberhalogenidemulsion | |
| DE2453217C2 (de) | Photographisches Aufzeichnungsmaterial | |
| EP0011051A2 (de) | Farbphotographisches Aufzeichnungsmaterial, Verfahren zu seiner Stabilisierung und Herstellung photographischer Farbbilder | |
| DE969374C (de) | Gegen Einwirkung der ultravioletten Strahlung geschuetztes photographisches Material mit einer Ultraviolett absorbierenden Schicht | |
| DE2541267A1 (de) | Photographisches aufzeichnungsmaterial | |
| DE1597482B2 (de) | Lichtempfindliches photographisches aufzeichnungsmaterial mit lichthofschutz- oder filterfarbstoffen | |
| DE2318807C2 (de) | Farbphotographisches Aufzeichnungsmaterial und Farbentwickler zum Entwickeln desselben | |
| DE2713022A1 (de) | Photographische halogensilberemulsion und photographisches lichtempfindliches material | |
| DE968641C (de) | Verfahren zur Herstellung von farbwertkorrigierten Farbenteilbildern in farbenphotographischen Halogensilberemulsionen | |
| DE2050998A1 (de) | Farbphotographisches lichtempfindliches Material, das einen neuen gelbbildenden Kuppler enthalt | |
| DE2515771A1 (de) | Verfahren zur erzeugung eines farbphotographischen bildes | |
| DE1802730A1 (de) | Farbenphotographische lichtempfindliche Materialien | |
| DE2804148C2 (de) | Benzothia-thiacyanin-Betaine und diese enthaltende Silberhalogenidemulsionen | |
| DE2263171A1 (de) | Photographische, einen phenolischen farbkuppler fuer die erzeugung eines blaugruenen bildfarbstoffes enthaltende silberhalogenidemulsion | |
| DE2834310A1 (de) | Farbphotographisches lichtempfindliches material | |
| DE2151098A1 (de) | Farbphotographische Materialien,die ein Ultraviolettabsorbiermittel enthalten | |
| DE1019171B (de) | Verfahren zur Herstellung von direktpositivem lichtempfindlichem Material | |
| DE1547831A1 (de) | Farbenphotographische Materialien | |
| DE2731954A1 (de) | Lichtempfindliches farbphotographisches material | |
| DE2259746A1 (de) | Neues oxonol-farbstoffe enthaltendes photographisches material | |
| DE2163811A1 (de) | Verfahren zur Herstellung von Cyanbildern | |
| DEE0007988MA (OSRAM) | ||
| DE968112C (de) | Gegen Einwirkung der ultravioletten Strahlung geschuetztes photographisches, insbesondere farbenphotographisches Material |