DED0019535MA - - Google Patents
Info
- Publication number
- DED0019535MA DED0019535MA DED0019535MA DE D0019535M A DED0019535M A DE D0019535MA DE D0019535M A DED0019535M A DE D0019535MA
- Authority
- DE
- Germany
- Prior art keywords
- titanium
- carbon
- oxygen
- mixed crystal
- production
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Active
Links
- 229910052751 metal Inorganic materials 0.000 claims description 20
- 239000002184 metal Substances 0.000 claims description 20
- 239000010936 titanium Substances 0.000 claims description 18
- RTAQQCXQSZGOHL-UHFFFAOYSA-N Titanium Chemical compound [Ti] RTAQQCXQSZGOHL-UHFFFAOYSA-N 0.000 claims description 17
- 229910052719 titanium Inorganic materials 0.000 claims description 17
- 229910052799 carbon Inorganic materials 0.000 claims description 11
- 150000002739 metals Chemical class 0.000 claims description 11
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 claims description 10
- 239000013078 crystal Substances 0.000 claims description 10
- 238000000034 method Methods 0.000 claims description 8
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 6
- 239000001301 oxygen Substances 0.000 claims description 6
- 229910052760 oxygen Inorganic materials 0.000 claims description 6
- 238000004519 manufacturing process Methods 0.000 claims description 5
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 claims description 4
- 238000010438 heat treatment Methods 0.000 claims description 4
- FYLHIULETLYEFY-UHFFFAOYSA-N [C].[O].[Ti] Chemical compound [C].[O].[Ti] FYLHIULETLYEFY-UHFFFAOYSA-N 0.000 claims description 3
- 229910045601 alloy Inorganic materials 0.000 claims description 3
- 239000000956 alloy Substances 0.000 claims description 3
- 229910052756 noble gas Inorganic materials 0.000 claims description 3
- 229910002065 alloy metal Inorganic materials 0.000 claims description 2
- 229910002090 carbon oxide Inorganic materials 0.000 claims description 2
- 238000002844 melting Methods 0.000 claims description 2
- 230000008018 melting Effects 0.000 claims description 2
- 150000002835 noble gases Chemical class 0.000 claims description 2
- 229910001069 Ti alloy Inorganic materials 0.000 claims 2
- 230000008030 elimination Effects 0.000 claims 1
- 238000003379 elimination reaction Methods 0.000 claims 1
- 239000000126 substance Substances 0.000 claims 1
- GWEVSGVZZGPLCZ-UHFFFAOYSA-N Titan oxide Chemical compound O=[Ti]=O GWEVSGVZZGPLCZ-UHFFFAOYSA-N 0.000 description 9
- XKRFYHLGVUSROY-UHFFFAOYSA-N Argon Chemical compound [Ar] XKRFYHLGVUSROY-UHFFFAOYSA-N 0.000 description 4
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 4
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 4
- 238000006243 chemical reaction Methods 0.000 description 4
- 239000004408 titanium dioxide Substances 0.000 description 4
- 239000007789 gas Substances 0.000 description 3
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 2
- 229910052786 argon Inorganic materials 0.000 description 2
- 239000003638 chemical reducing agent Substances 0.000 description 2
- 229910017052 cobalt Inorganic materials 0.000 description 2
- 239000010941 cobalt Substances 0.000 description 2
- GUTLYIVDDKVIGB-UHFFFAOYSA-N cobalt atom Chemical compound [Co] GUTLYIVDDKVIGB-UHFFFAOYSA-N 0.000 description 2
- 239000001307 helium Substances 0.000 description 2
- 229910052734 helium Inorganic materials 0.000 description 2
- SWQJXJOGLNCZEY-UHFFFAOYSA-N helium atom Chemical compound [He] SWQJXJOGLNCZEY-UHFFFAOYSA-N 0.000 description 2
- 229910052749 magnesium Inorganic materials 0.000 description 2
- 239000011777 magnesium Substances 0.000 description 2
- 238000010309 melting process Methods 0.000 description 2
- 229910052759 nickel Inorganic materials 0.000 description 2
- 229910052757 nitrogen Inorganic materials 0.000 description 2
- 239000006104 solid solution Substances 0.000 description 2
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 230000000996 additive effect Effects 0.000 description 1
- 238000005275 alloying Methods 0.000 description 1
- 238000000137 annealing Methods 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- 150000001721 carbon Chemical class 0.000 description 1
- 125000004432 carbon atom Chemical group C* 0.000 description 1
- 229910002092 carbon dioxide Inorganic materials 0.000 description 1
- 239000001569 carbon dioxide Substances 0.000 description 1
- 238000010891 electric arc Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 229910052744 lithium Inorganic materials 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 229910001092 metal group alloy Inorganic materials 0.000 description 1
- 239000000203 mixture Substances 0.000 description 1
- 125000004430 oxygen atom Chemical group O* 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- OGIDPMRJRNCKJF-UHFFFAOYSA-N titanium oxide Inorganic materials [Ti]=O OGIDPMRJRNCKJF-UHFFFAOYSA-N 0.000 description 1
- 238000009489 vacuum treatment Methods 0.000 description 1
Family
ID=
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE3017782A1 (de) | Verfahren zur herstellung von sinterfaehigen legierungspulvern auf der basis von titan | |
| DED0019535MA (enrdf_load_stackoverflow) | ||
| DE961761C (de) | Verfahren zur Herstellung von Titanmetall | |
| DE1483292C3 (de) | Verfahren zur weitgehenden Verhinderung der Wasserstoffversprödung von sauerstoffhaltigem, insbesondere zähgepoltem oder dispersionsgehärtetem Kupfer oder einer solchen Kupferlegierung | |
| DE2909290C2 (de) | Verfahren zur pulvermetallurgischen Herstellung eines supraleitenden Faserverbundmaterials | |
| DE2506566A1 (de) | Verfahren zur herstellung von magnesium | |
| DE2365054C3 (de) | Verfahren zur Herstellung einer Chrom enthaltenden Legierung mit sehr niedrigen Gehalten an Stickstoff und Kohlenstoff | |
| EP0343378A1 (de) | Verfahren zum Herstellen von Metallen aus der Gruppe Titan, Zirkonium, Chrom, Samarium und Neodym aus ihren Oxiden | |
| DE1950260C3 (de) | Verwendung einer gesinterten Molybdän-Bor-Legierung | |
| AT18611B (de) | Verfahren zur Herstellung homogener Körper aus Tantalmetall oder anderen schwer schmelzbaren Metallen. | |
| DE1583750A1 (de) | Verfahren zum Sintern von kolloidalen Metallteilchen | |
| DE1957073C (de) | Gesinterte Wolframlegierung | |
| DE1950242A1 (de) | Nickellegierung | |
| DE1758100A1 (de) | Herstellung von Tantal- und Niob-Legierungen durch Koreduktion von Oxidgemischen | |
| DE917034C (de) | Verfahren zur Abspaltung des Sauerstoffs, Schwefels oder der Halogene aus oxydischen, sulfidischen oder Halogen-Verbindungen schwer reduzierbarer Metalle | |
| DE973241C (de) | Verfahren zur Reduktion von Titan- oder Zirkonoxyden, insbesondere fuer die Herstellung von Titan- oder Zirkonlegierungen | |
| DE3810336A1 (de) | Aushaertbare nickellegierung | |
| CH528598A (de) | Verfahren zur Herstellung von Legierungen oder Gemischen des Tantals oder Niobs | |
| AT26468B (de) | Verfahren zur Herstellung elektrischer Glühkörper. | |
| DE950032C (de) | Verfahren zur Reduktion von Zirkonverbindungen und seine Anwendung | |
| DE2340766C3 (de) | Verfahren zur Herstellung von Kupfer-Nickel-Legierungen | |
| DEM0026522MA (enrdf_load_stackoverflow) | ||
| DE4121919A1 (de) | Verfahren zur herstellung von gereinigten tantaldraehten | |
| AT217720B (de) | Verfahren zur Herstellung von Metallegierungen | |
| DE484287C (de) | Verfahren zur Herstellung von Metallen mit Ausnahme des Eisens und des Zinns |