DEC0006076MA - - Google Patents
Info
- Publication number
- DEC0006076MA DEC0006076MA DEC0006076MA DE C0006076M A DEC0006076M A DE C0006076MA DE C0006076M A DEC0006076M A DE C0006076MA
- Authority
- DE
- Germany
- Prior art keywords
- general formula
- benzene
- triisopropyl
- aminocarboxamides
- aminobenzene
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Active
Links
- VGCXGMAHQTYDJK-UHFFFAOYSA-N Chloroacetyl chloride Chemical compound ClCC(Cl)=O VGCXGMAHQTYDJK-UHFFFAOYSA-N 0.000 claims description 3
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical class NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 claims description 3
- 239000002253 acid Substances 0.000 claims description 3
- FQFPALKHIHTSNY-UHFFFAOYSA-N 2,4,6-tri(propan-2-yl)aniline Chemical compound CC(C)C1=CC(C(C)C)=C(N)C(C(C)C)=C1 FQFPALKHIHTSNY-UHFFFAOYSA-N 0.000 claims description 2
- 150000001875 compounds Chemical class 0.000 claims description 2
- 125000005842 heteroatom Chemical group 0.000 claims description 2
- 238000000034 method Methods 0.000 claims description 2
- 125000003277 amino group Chemical group 0.000 claims 1
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 15
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 9
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical class Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 5
- 239000013078 crystal Substances 0.000 description 4
- 239000000243 solution Substances 0.000 description 4
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- 230000003444 anaesthetic effect Effects 0.000 description 3
- 238000003756 stirring Methods 0.000 description 3
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 3
- VUMCUSHVMYIRMB-UHFFFAOYSA-N 1,3,5-tri(propan-2-yl)benzene Chemical compound CC(C)C1=CC(C(C)C)=CC(C(C)C)=C1 VUMCUSHVMYIRMB-UHFFFAOYSA-N 0.000 description 2
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 2
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 2
- ROSDSFDQCJNGOL-UHFFFAOYSA-N Dimethylamine Chemical compound CNC ROSDSFDQCJNGOL-UHFFFAOYSA-N 0.000 description 2
- HPNMFZURTQLUMO-UHFFFAOYSA-N diethylamine Chemical compound CCNCC HPNMFZURTQLUMO-UHFFFAOYSA-N 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 239000003589 local anesthetic agent Substances 0.000 description 2
- 238000002844 melting Methods 0.000 description 2
- 230000008018 melting Effects 0.000 description 2
- ODLMAHJVESYWTB-UHFFFAOYSA-N propylbenzene Chemical compound CCCC1=CC=CC=C1 ODLMAHJVESYWTB-UHFFFAOYSA-N 0.000 description 2
- 238000001953 recrystallisation Methods 0.000 description 2
- VZSRBBMJRBPUNF-UHFFFAOYSA-N 2-(2,3-dihydro-1H-inden-2-ylamino)-N-[3-oxo-3-(2,4,6,7-tetrahydrotriazolo[4,5-c]pyridin-5-yl)propyl]pyrimidine-5-carboxamide Chemical compound C1C(CC2=CC=CC=C12)NC1=NC=C(C=N1)C(=O)NCCC(N1CC2=C(CC1)NN=N2)=O VZSRBBMJRBPUNF-UHFFFAOYSA-N 0.000 description 1
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 description 1
- 229960000583 acetic acid Drugs 0.000 description 1
- -1 alkyl radicals Chemical class 0.000 description 1
- 229940040526 anhydrous sodium acetate Drugs 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- RBSPDPOMMJRYQE-UHFFFAOYSA-N benzene;nitric acid Chemical compound O[N+]([O-])=O.C1=CC=CC=C1 RBSPDPOMMJRYQE-UHFFFAOYSA-N 0.000 description 1
- 125000005265 dialkylamine group Chemical group 0.000 description 1
- HDITUCONWLWUJR-UHFFFAOYSA-N diethylazanium;chloride Chemical compound [Cl-].CC[NH2+]CC HDITUCONWLWUJR-UHFFFAOYSA-N 0.000 description 1
- 238000010790 dilution Methods 0.000 description 1
- 239000012895 dilution Substances 0.000 description 1
- IQDGSYLLQPDQDV-UHFFFAOYSA-N dimethylazanium;chloride Chemical compound Cl.CNC IQDGSYLLQPDQDV-UHFFFAOYSA-N 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 239000012362 glacial acetic acid Substances 0.000 description 1
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 1
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 1
- 229960005015 local anesthetics Drugs 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 239000000203 mixture Substances 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 231100000331 toxic Toxicity 0.000 description 1
- 230000002588 toxic effect Effects 0.000 description 1
Family
ID=
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE69707537T2 (de) | Verfahren zur Herstellung von 5-substituierten Tetrazolen | |
| DE842943C (de) | Verfahren zur Herstellung neuer Imidazoline | |
| DE1014551B (de) | Verfahren zur Herstellung von substituierten 4-Oxycumarinen | |
| DE1795344B2 (de) | Verfahren zur herstellung von 3-aminoisothiazolen | |
| DEC0006076MA (fr) | ||
| DE1518753A1 (de) | Verfahren zur Herstellung von Zimtsaeurederivaten | |
| DE2124907A1 (de) | 3 Amino 1,2,4 oxadiazole, Verfahren zu ihrer Herstellung und Arzneipraparate | |
| DE1545607A1 (de) | Verfahren zur Herstellung neuer 5-Nitrofuran-Derivate | |
| CH513180A (de) | Verfahren zur Herstellung antidiabetisch wirksamer Sulfonamide | |
| DE1906087A1 (de) | Oxodihydrobenzoxazinderivate und Verfahren zu ihrer Herstellung | |
| DE1670143C3 (fr) | ||
| DE963427C (de) | Verfahren zur Herstellung neuer anaesthetisch wirkender Aminocarbonsaeureamide | |
| DE1258412B (de) | Verfahren zur Herstellung von 5, 5-Bis-(p-hydroxyphenyl)-imidazolinonen-(4) und ihren Salzen | |
| DE2560602C2 (de) | Sauerstoffhaltige Diarylamidine | |
| DE1287584B (de) | Verfahren zur Herstellung von 2, 3-Dihydro-1, 4-benzoxazinderivaten | |
| DE2406972B2 (de) | Verfahren zur Herstellung von 5-Sulfamoylanthranilsäuren | |
| DE1018869B (de) | Verfahren zur Herstellung von Aminoalkylpurinderivaten | |
| DE1568302C (de) | Rhodaninderivate und Verfahren zu deren Herstellung | |
| DE1135478B (de) | Verfahren zur Herstellung von 3, 5-Dioxo-1, 2, 4-triazolidinen | |
| DE1088972B (de) | Verfahren zur Herstellung von ª†, ª†, ª†-Triphenylpropylaminen | |
| DE1165038B (de) | Verfahren zur Herstellung von antimikrobiell wirksamen Derivaten des Glycinamids | |
| DE848652C (de) | Verfahren zur Herstellung von 1-dialkylcarbaminyl-substituierten Piperazinen mit substituierter 4-Stellung | |
| DE723275C (de) | Verfahren zur Darstellung neuer Cyan- bzw. Rhodanverbindungen mit quartaerer Ammoniumgruppe | |
| AT228199B (de) | Verfahren zur Herstellung eines neuen Imidazolinderivates und seiner Salze | |
| DE2218248C3 (de) | Picolinsäure-dithiocarbamate |