DEB0032101MA - - Google Patents
Info
- Publication number
- DEB0032101MA DEB0032101MA DEB0032101MA DE B0032101M A DEB0032101M A DE B0032101MA DE B0032101M A DEB0032101M A DE B0032101MA
- Authority
- DE
- Germany
- Prior art keywords
- alkali
- film evaporator
- carbon dioxide
- phenolates
- parts
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Active
Links
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 claims description 26
- 239000010409 thin film Substances 0.000 claims description 16
- 239000001569 carbon dioxide Substances 0.000 claims description 13
- 229910002092 carbon dioxide Inorganic materials 0.000 claims description 13
- 239000002253 acid Substances 0.000 claims description 12
- 239000003513 alkali Substances 0.000 claims description 10
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 claims description 9
- 238000000034 method Methods 0.000 claims description 9
- 229940031826 phenolate Drugs 0.000 claims description 9
- ISWSIDIOOBJBQZ-UHFFFAOYSA-M phenolate Chemical compound [O-]C1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-M 0.000 claims description 8
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 8
- 150000004707 phenolate Chemical class 0.000 claims description 7
- 150000002989 phenols Chemical class 0.000 claims description 6
- 150000007513 acids Chemical class 0.000 claims description 5
- 150000001447 alkali salts Chemical class 0.000 claims description 5
- 125000003118 aryl group Chemical group 0.000 claims description 5
- 238000006243 chemical reaction Methods 0.000 claims description 5
- 238000004519 manufacturing process Methods 0.000 claims description 4
- 229910052783 alkali metal Inorganic materials 0.000 claims description 3
- -1 alkali metal salts Chemical class 0.000 claims description 3
- 230000021523 carboxylation Effects 0.000 claims description 2
- 238000006473 carboxylation reaction Methods 0.000 claims description 2
- 239000011541 reaction mixture Substances 0.000 claims description 2
- 206010000210 abortion Diseases 0.000 claims 1
- 231100000176 abortion Toxicity 0.000 claims 1
- HEMHJVSKTPXQMS-UHFFFAOYSA-M sodium hydroxide Inorganic materials [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 14
- 239000000047 product Substances 0.000 description 9
- 159000000000 sodium salts Chemical class 0.000 description 5
- CWLKGDAVCFYWJK-UHFFFAOYSA-N 3-aminophenol Chemical compound NC1=CC=CC(O)=C1 CWLKGDAVCFYWJK-UHFFFAOYSA-N 0.000 description 4
- 239000007795 chemical reaction product Substances 0.000 description 4
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- 238000001704 evaporation Methods 0.000 description 3
- 230000008020 evaporation Effects 0.000 description 3
- 229940018563 3-aminophenol Drugs 0.000 description 2
- 238000009833 condensation Methods 0.000 description 2
- 230000005494 condensation Effects 0.000 description 2
- 238000010438 heat treatment Methods 0.000 description 2
- YGSDEFSMJLZEOE-UHFFFAOYSA-N salicylic acid Chemical compound OC(=O)C1=CC=CC=C1O YGSDEFSMJLZEOE-UHFFFAOYSA-N 0.000 description 2
- KJCVRFUGPWSIIH-UHFFFAOYSA-N 1-naphthol Chemical compound C1=CC=C2C(O)=CC=CC2=C1 KJCVRFUGPWSIIH-UHFFFAOYSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-N carbonic acid Chemical compound OC(O)=O BVKZGUZCCUSVTD-UHFFFAOYSA-N 0.000 description 1
- 239000003245 coal Substances 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- QSHDDOUJBYECFT-UHFFFAOYSA-N mercury Chemical compound [Hg] QSHDDOUJBYECFT-UHFFFAOYSA-N 0.000 description 1
- 229910052753 mercury Inorganic materials 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- 239000004570 mortar (masonry) Substances 0.000 description 1
- KJCVRFUGPWSIIH-UHFFFAOYSA-M naphthalen-1-olate Chemical compound C1=CC=C2C([O-])=CC=CC2=C1 KJCVRFUGPWSIIH-UHFFFAOYSA-M 0.000 description 1
- FJKROLUGYXJWQN-UHFFFAOYSA-N papa-hydroxy-benzoic acid Natural products OC(=O)C1=CC=C(O)C=C1 FJKROLUGYXJWQN-UHFFFAOYSA-N 0.000 description 1
- 230000009257 reactivity Effects 0.000 description 1
- 229960004889 salicylic acid Drugs 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 238000006467 substitution reaction Methods 0.000 description 1
- 238000010626 work up procedure Methods 0.000 description 1
Family
ID=
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US2733252A (en) | Salts of fatty acid esters of lactylic | |
| EP0000493B1 (de) | Verfahren zur Herstellung von 1-Amino-8-naphthol-3,6-disulfonsäure (H-Säure). | |
| DEB0032101MA (Direct) | ||
| DE2233940A1 (de) | Verfahren zur herstellung wasserfreier loesungen von alkaliarylaten und zur abtrennung dieser arylate von alkalisulfit | |
| CH628618A5 (de) | Verfahren zur herstellung von hochreinem s-carboxymethyl-l-cystein. | |
| US2493733A (en) | Preparation of 2,2,6,6-tetramethylolcyclohexanol | |
| DE817758C (de) | Verfahren zur Herstellung des Dinatriumsalzes der 2-Oxynaphthalin-1-carbonsaeure | |
| DE2207177A1 (de) | Verfahren zur herstellung von perfluorcarbonsaeuren und deren fluoride | |
| DE2237750C2 (de) | Verfahren zur Herstellung von Brenzcatechin | |
| DE862751C (de) | Verfahren zur Herstellung von Salicylsaeurederivaten | |
| DE2647094C3 (Direct) | ||
| DE633083C (de) | Verfahren zur Darstellung von aromatischen Verbindungen | |
| DE601822C (de) | Verfahren zur Darstellung von AEthern der Acetylenreihe | |
| DE436443C (de) | Verfahren zur Darstellung einer Oxypyridincarbonsaeure | |
| DE945926C (de) | Verfahren zur Herstellung von ªŠ-Acetyl-lysin | |
| AT163637B (de) | Verfahren zur Herstellung von 2,4-Dichlorphenoxyverbindungen | |
| DE921626C (de) | Verfahren zur Herstellung von Xanthen-9-carbonsaeure | |
| DE890798C (de) | Verfahren zur Herstellung von Phenolkondensationsprodukten | |
| DE952634C (de) | Verfahren zur Herstellung von Verbindungen der Pyridinreihe | |
| DE941372C (de) | Verfahren zur Herstellung von kern-mono-acylierten Phloroglucinen | |
| DE1768930C3 (de) | Verfahren zur Herstellung von Cyclopent-2-enyl-phenolen | |
| DE547026C (de) | Verfahren zur Darstellung von Propenylbrenzkatechinmonomethylaethern | |
| DE1179948B (de) | Verfahren zur Herstellung von 4, 4'-Dihydroxy-diphenylsulfon | |
| DE864254C (de) | Verfahren zur Herstellung von Reduktinsaeure | |
| DE1094254B (de) | Verfahren zur Herstellung von cycloaliphatischen Oxycarbonsaeuren bzw. deren Salzen |