DEB0030736MA - - Google Patents
Info
- Publication number
- DEB0030736MA DEB0030736MA DEB0030736MA DE B0030736M A DEB0030736M A DE B0030736MA DE B0030736M A DEB0030736M A DE B0030736MA
- Authority
- DE
- Germany
- Prior art keywords
- cyanamide
- lead
- water
- pbcn
- dicyandiamide
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Active
Links
- XZMCDFZZKTWFGF-UHFFFAOYSA-N Cyanamide Chemical compound NC#N XZMCDFZZKTWFGF-UHFFFAOYSA-N 0.000 claims description 10
- QGBSISYHAICWAH-UHFFFAOYSA-N dicyandiamide Chemical compound NC(N)=NC#N QGBSISYHAICWAH-UHFFFAOYSA-N 0.000 claims description 9
- 238000006243 chemical reaction Methods 0.000 claims description 8
- XMYLSWOTJKUSHE-UHFFFAOYSA-N cyanamide;lead Chemical compound [Pb].NC#N XMYLSWOTJKUSHE-UHFFFAOYSA-N 0.000 claims description 8
- 238000000034 method Methods 0.000 claims description 6
- MFEVGQHCNVXMER-UHFFFAOYSA-L 1,3,2$l^{2}-dioxaplumbetan-4-one Chemical compound [Pb+2].[O-]C([O-])=O MFEVGQHCNVXMER-UHFFFAOYSA-L 0.000 claims description 5
- 229910000003 Lead carbonate Inorganic materials 0.000 claims description 5
- ATRRKUHOCOJYRX-UHFFFAOYSA-N Ammonium bicarbonate Chemical compound [NH4+].OC([O-])=O ATRRKUHOCOJYRX-UHFFFAOYSA-N 0.000 claims description 3
- 239000001099 ammonium carbonate Substances 0.000 claims description 3
- 235000012501 ammonium carbonate Nutrition 0.000 claims description 3
- 238000004519 manufacturing process Methods 0.000 claims description 3
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 13
- 230000007062 hydrolysis Effects 0.000 description 8
- 238000006460 hydrolysis reaction Methods 0.000 description 8
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 4
- 239000002244 precipitate Substances 0.000 description 4
- 239000000243 solution Substances 0.000 description 3
- MVXMNHYVCLMLDD-UHFFFAOYSA-N 4-methoxynaphthalene-1-carbaldehyde Chemical compound C1=CC=C2C(OC)=CC=C(C=O)C2=C1 MVXMNHYVCLMLDD-UHFFFAOYSA-N 0.000 description 2
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 2
- 229910021529 ammonia Inorganic materials 0.000 description 2
- 238000009835 boiling Methods 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- 239000000706 filtrate Substances 0.000 description 2
- 238000010438 heat treatment Methods 0.000 description 2
- HTUMBQDCCIXGCV-UHFFFAOYSA-N lead oxide Chemical compound [O-2].[Pb+2] HTUMBQDCCIXGCV-UHFFFAOYSA-N 0.000 description 2
- YEXPOXQUZXUXJW-UHFFFAOYSA-N lead(II) oxide Inorganic materials [Pb]=O YEXPOXQUZXUXJW-UHFFFAOYSA-N 0.000 description 2
- 238000010521 absorption reaction Methods 0.000 description 1
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 1
- 150000001342 alkaline earth metals Chemical class 0.000 description 1
- PRKQVKDSMLBJBJ-UHFFFAOYSA-N ammonium carbonate Chemical class N.N.OC(O)=O PRKQVKDSMLBJBJ-UHFFFAOYSA-N 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 239000001569 carbon dioxide Substances 0.000 description 1
- 229910002092 carbon dioxide Inorganic materials 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 150000001912 cyanamides Chemical class 0.000 description 1
- 238000006471 dimerization reaction Methods 0.000 description 1
- 238000010494 dissociation reaction Methods 0.000 description 1
- 230000005593 dissociations Effects 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 238000005562 fading Methods 0.000 description 1
- 239000005457 ice water Substances 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 150000002736 metal compounds Chemical class 0.000 description 1
- 229910044991 metal oxide Inorganic materials 0.000 description 1
- 150000004706 metal oxides Chemical class 0.000 description 1
- YPPFWRWCZNXINO-UHFFFAOYSA-N methyl 1-hydroxy-6-phenyl-4-(trifluoromethyl)indole-2-carboxylate Chemical compound C1=C2N(O)C(C(=O)OC)=CC2=C(C(F)(F)F)C=C1C1=CC=CC=C1 YPPFWRWCZNXINO-UHFFFAOYSA-N 0.000 description 1
- 238000006116 polymerization reaction Methods 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 238000001556 precipitation Methods 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 239000010802 sludge Substances 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 238000010626 work up procedure Methods 0.000 description 1
Family
ID=
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2343599A1 (de) | Verfahren zur technischen herstellung von niederen aminosaeuren | |
| DE2547998C3 (de) | Verfahren zur Herstellung von Ammoniumtetrafluoraluminat | |
| DE953253C (de) | Verfahren zur Herstellung von Cyanamid bzw. Dicyandiamid | |
| DE1593472A1 (de) | Verfahren zur Herstellung von Guanidinsalzen aus Cyanamid und Ammonsalzen bzw. in Ammonsalze ueberfuehrbare Substanzen | |
| DE1643238A1 (de) | Verfahren zur kontinuierlichen Herstellung von Alkalisalzen der Nitrilotriessigsaeure | |
| DE689191C (de) | Verfahren zur Herstellung von Aminoguanidinbicarbonat | |
| DE950911C (de) | Verfahren zur Herstellung von festen Polymerisationsprodukten der Blausaeure | |
| DE962967C (de) | Verfahren zur Herstellung von Guanaminen | |
| DE2435167A1 (de) | Verfahren zur gewinnung von guanidincarbonat aus verduennten, waessrigen loesungen | |
| CH420189A (de) | Verfahren zur Herstellung von Alkalisalzen der Nitrilotriessigsäure | |
| DE38282C (de) | Verfahren zur Darstellung von freier Phosphorsäure und Alkaliphosphaten aus Thomasschlacke und anderen basischen Phosphaten mittelst Oxalsäure und deren Alkalisalze unter Regeneration der letzteren in diesem Verfahren | |
| DE804805C (de) | Verarbeitung von technischem Kalkstickstoff auf Graphit, reines Calciumcarbonat bzw. reines -hydroxyd und Cyanamid bzw. Dicyandiamid | |
| DE216121C (enExample) | ||
| DE961626C (de) | Verfahren zur Herstellung von ªŠíñªŠ-Carbonyl-dilysin | |
| DE239309C (enExample) | ||
| DE1197092B (de) | Verfahren zur Herstellung von Alkalisalzen der Nitrilotriessigsaeure | |
| DE678541C (de) | Verfahren zur Herstellung komplexer, wasserloeslicher Goldverbindungen von Sulfhydrylgruppen enthaltenden albumoseartigen Keratinabbauprodukten | |
| DE1125418B (de) | Verfahren zur kontinuierlichen Herstellung von konzentrierten waessrigen Acetessigsaeureamidloesungen | |
| DE1668914A1 (de) | Verfahren zum Hydrolysieren von Aminonitrilen | |
| DE458437C (de) | Verfahren zur Herstellung von Guanidincarbonat | |
| AT164014B (de) | Verfahren zur Herstellung von aschefreien Aminokarbonsaüren aus Laktamen | |
| AT236988B (de) | Verfahren zur Herstellung von Ammoniumchlorid | |
| DE1949091A1 (de) | Verfahren zur Herstellung von Adenin | |
| DE1197897B (de) | Verfahren zur Herstellung von Alkalisalzen der Nitrilotriessigsaeure | |
| DE1125419B (de) | Verfahren zur Herstellung von 1, 3-Bis-(ªÏ-carboxyalkyl)-harnstoffen |