DEB0023472MA - - Google Patents
Info
- Publication number
- DEB0023472MA DEB0023472MA DEB0023472MA DE B0023472M A DEB0023472M A DE B0023472MA DE B0023472M A DEB0023472M A DE B0023472MA
- Authority
- DE
- Germany
- Prior art keywords
- ammonium
- mole
- hydantoin
- methionine
- reaction
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Active
Links
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 claims description 9
- 238000000034 method Methods 0.000 claims description 6
- SBKRXUMXMKBCLD-SCSAIBSYSA-N (R)-5-[2-(methylthio)ethyl]hydantoin Chemical compound CSCC[C@H]1NC(=O)NC1=O SBKRXUMXMKBCLD-SCSAIBSYSA-N 0.000 claims description 5
- ATRRKUHOCOJYRX-UHFFFAOYSA-N Ammonium bicarbonate Chemical compound [NH4+].OC([O-])=O ATRRKUHOCOJYRX-UHFFFAOYSA-N 0.000 claims description 5
- 239000001099 ammonium carbonate Substances 0.000 claims description 5
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 claims description 4
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 claims description 4
- XFXPMWWXUTWYJX-UHFFFAOYSA-N Cyanide Chemical compound N#[C-] XFXPMWWXUTWYJX-UHFFFAOYSA-N 0.000 claims description 3
- 235000012501 ammonium carbonate Nutrition 0.000 claims description 3
- 238000004519 manufacturing process Methods 0.000 claims description 3
- 229910000013 Ammonium bicarbonate Inorganic materials 0.000 claims description 2
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 claims description 2
- 229910021529 ammonia Inorganic materials 0.000 claims description 2
- 235000012538 ammonium bicarbonate Nutrition 0.000 claims description 2
- BVCZEBOGSOYJJT-UHFFFAOYSA-N ammonium carbamate Chemical compound [NH4+].NC([O-])=O BVCZEBOGSOYJJT-UHFFFAOYSA-N 0.000 claims description 2
- 239000001569 carbon dioxide Substances 0.000 claims description 2
- 229910002092 carbon dioxide Inorganic materials 0.000 claims description 2
- KXDHJXZQYSOELW-UHFFFAOYSA-N carbonic acid monoamide Natural products NC(O)=O KXDHJXZQYSOELW-UHFFFAOYSA-N 0.000 claims description 2
- 239000002904 solvent Substances 0.000 claims description 2
- CQSQMXIROIYTLO-UHFFFAOYSA-N 2-methylpropanethial Chemical compound CC(C)C=S CQSQMXIROIYTLO-UHFFFAOYSA-N 0.000 claims 1
- 241001508691 Martes zibellina Species 0.000 claims 1
- 125000002485 formyl group Chemical class [H]C(*)=O 0.000 claims 1
- 238000010792 warming Methods 0.000 claims 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 2
- 150000001299 aldehydes Chemical class 0.000 description 2
- 239000000203 mixture Substances 0.000 description 2
- 238000010992 reflux Methods 0.000 description 2
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 2
- CLUWOWRTHNNBBU-UHFFFAOYSA-N 3-methylthiopropanal Chemical compound CSCCC=O CLUWOWRTHNNBBU-UHFFFAOYSA-N 0.000 description 1
- FFEARJCKVFRZRR-BYPYZUCNSA-N L-methionine Chemical compound CSCC[C@H](N)C(O)=O FFEARJCKVFRZRR-BYPYZUCNSA-N 0.000 description 1
- -1 S-methylthiopropionaldehyde Chemical compound 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- KXZJHVJKXJLBKO-UHFFFAOYSA-N chembl1408157 Chemical compound N=1C2=CC=CC=C2C(C(=O)O)=CC=1C1=CC=C(O)C=C1 KXZJHVJKXJLBKO-UHFFFAOYSA-N 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 150000001875 compounds Chemical class 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 150000001469 hydantoins Chemical class 0.000 description 1
- 229930182817 methionine Natural products 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
- 230000001225 therapeutic effect Effects 0.000 description 1
Family
ID=
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1174769C2 (de) | Verfahren zur Herstellung von Polyenalkoholen | |
| DEB0023472MA (enrdf_load_stackoverflow) | ||
| EP0367010B1 (de) | Verfahren zur Herstellung von Cyclopropylamin | |
| DE578486C (de) | Herstellung von Hydrazin | |
| DE955061C (de) | Verfahren zur Hertellung von Methionin-hydantoin | |
| DE1817691C3 (de) | Verfahren zur Herstellung von Monoisopropylamin | |
| DE350051C (de) | Verfahren zur Aufarbeitung von Harnstoffschmelzen aus Kohlensaeureverbindungen des Ammoniaks | |
| AT122497B (de) | Verfahren zur Darstellung von Aldehydsulfoxylaten. | |
| DE659771C (de) | Verfahren zur Herstellung von Aminoacetonitril | |
| DE1906405C (de) | Verfahren zur Herstellung von Methio mn | |
| DE437409C (de) | Verfahren zur Herstellung von Phenylglycin und dessen Derivaten | |
| DE678541C (de) | Verfahren zur Herstellung komplexer, wasserloeslicher Goldverbindungen von Sulfhydrylgruppen enthaltenden albumoseartigen Keratinabbauprodukten | |
| DE528968C (de) | Verfahren zur Herstellung von Cyanwasserstoff durch Oxydation von Rhodanammonium mittels Salpetersaeure | |
| DE695997C (de) | Verfahren zur Herstellung von AEthylenglykol aus Dichloraethan | |
| DE165613C (enrdf_load_stackoverflow) | ||
| DE369370C (de) | Verfahren zur Herstellung von Ammoniumformiat aus Bariumcyanid | |
| DE389404C (de) | Verfahren zur Herstellung eines Abbauproduktes der Huminsaeuren des Torfes | |
| DE744688C (de) | Herstellung von Dinatriumarsenat | |
| DE867091C (de) | Verfahren zur Herstellung von Guanidinsalzen | |
| DE216121C (enrdf_load_stackoverflow) | ||
| DE1543916A1 (de) | Verfahren zur Herstellung von alpha-Aminosaeuren | |
| DE1919287A1 (de) | Verfahren zur Herstellung von Oxamid | |
| DEF0016528MA (enrdf_load_stackoverflow) | ||
| DE1196185B (de) | Verfahren zur Herstellung von N-tertiaer-Butylformamid | |
| CH133787A (de) | Verfahren zur Herstellung von a-Furfurylmerkaptan. |