DEA0019910MA - - Google Patents
Info
- Publication number
- DEA0019910MA DEA0019910MA DEA0019910MA DE A0019910M A DEA0019910M A DE A0019910MA DE A0019910M A DEA0019910M A DE A0019910MA
- Authority
- DE
- Germany
- Prior art keywords
- developer
- methylaminophenol
- aminopyrazoline
- aryl
- developers
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Active
Links
- 239000000126 substance Substances 0.000 claims description 6
- 239000012670 alkaline solution Substances 0.000 claims description 4
- 150000005840 aryl radicals Chemical class 0.000 claims description 4
- 125000001424 substituent group Chemical group 0.000 claims description 3
- 125000000217 alkyl group Chemical group 0.000 claims description 2
- 125000004181 carboxyalkyl group Chemical group 0.000 claims description 2
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 2
- -1 oxalkyl Chemical group 0.000 claims description 2
- 125000004964 sulfoalkyl group Chemical group 0.000 claims description 2
- QIGBRXMKCJKVMJ-UHFFFAOYSA-N Hydroquinone Chemical compound OC1=CC=C(O)C=C1 QIGBRXMKCJKVMJ-UHFFFAOYSA-N 0.000 description 18
- ZFIQGRISGKSVAG-UHFFFAOYSA-N 4-methylaminophenol Chemical compound CNC1=CC=C(O)C=C1 ZFIQGRISGKSVAG-UHFFFAOYSA-N 0.000 description 16
- IOLCXVTUBQKXJR-UHFFFAOYSA-M potassium bromide Chemical compound [K+].[Br-] IOLCXVTUBQKXJR-UHFFFAOYSA-M 0.000 description 12
- VOZKAJLKRJDJLL-UHFFFAOYSA-N 2,4-diaminotoluene Chemical compound CC1=CC=C(N)C=C1N VOZKAJLKRJDJLL-UHFFFAOYSA-N 0.000 description 8
- 239000000203 mixture Substances 0.000 description 8
- GEHJYWRUCIMESM-UHFFFAOYSA-L sodium sulfite Chemical compound [Na+].[Na+].[O-]S([O-])=O GEHJYWRUCIMESM-UHFFFAOYSA-L 0.000 description 8
- 238000011161 development Methods 0.000 description 7
- 230000018109 developmental process Effects 0.000 description 7
- 239000000243 solution Substances 0.000 description 7
- 230000000694 effects Effects 0.000 description 6
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 5
- ADZWSOLPGZMUMY-UHFFFAOYSA-M silver bromide Chemical compound [Ag]Br ADZWSOLPGZMUMY-UHFFFAOYSA-M 0.000 description 5
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 5
- 150000001875 compounds Chemical class 0.000 description 4
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 4
- 239000011734 sodium Substances 0.000 description 4
- 235000010265 sodium sulphite Nutrition 0.000 description 4
- 241001479434 Agfa Species 0.000 description 3
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- ZYDVNTYVDVZMKF-UHFFFAOYSA-N [Cl].[Ag] Chemical compound [Cl].[Ag] ZYDVNTYVDVZMKF-UHFFFAOYSA-N 0.000 description 3
- QRUDEWIWKLJBPS-UHFFFAOYSA-N benzotriazole Chemical compound C1=CC=C2N[N][N]C2=C1 QRUDEWIWKLJBPS-UHFFFAOYSA-N 0.000 description 3
- 239000012964 benzotriazole Substances 0.000 description 3
- 239000000460 chlorine Substances 0.000 description 3
- 229910052801 chlorine Inorganic materials 0.000 description 3
- 229910052709 silver Inorganic materials 0.000 description 3
- 239000004332 silver Substances 0.000 description 3
- BQCADISMDOOEFD-UHFFFAOYSA-N Silver Chemical compound [Ag] BQCADISMDOOEFD-UHFFFAOYSA-N 0.000 description 2
- YCIMNLLNPGFGHC-UHFFFAOYSA-N catechol Chemical compound OC1=CC=CC=C1O YCIMNLLNPGFGHC-UHFFFAOYSA-N 0.000 description 2
- 239000012458 free base Substances 0.000 description 2
- 239000000463 material Substances 0.000 description 2
- 229910000027 potassium carbonate Inorganic materials 0.000 description 2
- WZCQRUWWHSTZEM-UHFFFAOYSA-N 1,3-phenylenediamine Chemical compound NC1=CC=CC(N)=C1 WZCQRUWWHSTZEM-UHFFFAOYSA-N 0.000 description 1
- YFGBQHOOROIVKG-UHFFFAOYSA-N 2-[[2-[[2-[[2-[[2-amino-3-(4-hydroxyphenyl)propanoyl]amino]acetyl]amino]acetyl]amino]-3-phenylpropanoyl]amino]-4-methylsulfanylbutanoic acid Chemical compound C=1C=C(O)C=CC=1CC(N)C(=O)NCC(=O)NCC(=O)NC(C(=O)NC(CCSC)C(O)=O)CC1=CC=CC=C1 YFGBQHOOROIVKG-UHFFFAOYSA-N 0.000 description 1
- NLHHRLWOUZZQLW-UHFFFAOYSA-N Acrylonitrile Chemical compound C=CC#N NLHHRLWOUZZQLW-UHFFFAOYSA-N 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-M Bisulfite Chemical compound OS([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-M 0.000 description 1
- XBDQKXXYIPTUBI-UHFFFAOYSA-N Propionic acid Substances CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-N Sulfurous acid Chemical compound OS(O)=O LSNNMFCWUKXFEE-UHFFFAOYSA-N 0.000 description 1
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 1
- BDKZHNJTLHOSDW-UHFFFAOYSA-N [Na].CC(O)=O Chemical compound [Na].CC(O)=O BDKZHNJTLHOSDW-UHFFFAOYSA-N 0.000 description 1
- 239000003929 acidic solution Substances 0.000 description 1
- 239000012190 activator Substances 0.000 description 1
- 150000004982 aromatic amines Chemical class 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- 230000009286 beneficial effect Effects 0.000 description 1
- LAABTJXWUKMZIV-UHFFFAOYSA-N benzene-1,4-diol;4-(methylamino)phenol Chemical compound OC1=CC=C(O)C=C1.CNC1=CC=C(O)C=C1 LAABTJXWUKMZIV-UHFFFAOYSA-N 0.000 description 1
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 1
- 230000003197 catalytic effect Effects 0.000 description 1
- 238000006243 chemical reaction Methods 0.000 description 1
- 238000010586 diagram Methods 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- 238000011156 evaluation Methods 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 229910052736 halogen Inorganic materials 0.000 description 1
- 150000002367 halogens Chemical class 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 238000000034 method Methods 0.000 description 1
- 230000003647 oxidation Effects 0.000 description 1
- 238000007254 oxidation reaction Methods 0.000 description 1
- 230000008929 regeneration Effects 0.000 description 1
- 238000011069 regeneration method Methods 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
Family
ID=
Similar Documents
Publication | Publication Date | Title |
---|---|---|
DE3315589C2 (enrdf_load_html_response) | ||
DE1255484B (de) | Lichtempfindliches photographisches Material mit mindestens einer lichtempfindlichen Silbersalzemulsionsschicht | |
DE945606C (de) | Photographischer Entwickler | |
DE1772123C2 (de) | Verfahren zur Entwicklung silberhalogenidhaltiger Aufzeichnungsmaterialien | |
DE2009056C2 (de) | Verwendung von Anhydrodihydrohexosereductonen zum Entwickeln photographischer Aufzeichnungsmaterialien | |
DEA0019910MA (enrdf_load_html_response) | ||
DE3022925A1 (de) | Verfahren zur erzeugung kontrastreicher silberbilder und dabei verwendetes lichtempfindliches photographisches silberhalogenid-aufzeichnungsmaterial | |
DE1924723A1 (de) | Farbbleichzubereitung fuer das photographische Silberfarbbleichverfahren | |
DE2112728C3 (de) | Farbphotographisches Aufzeichnungsmaterial | |
DE2047474A1 (de) | Fotografische Entwicklungsmethode | |
DE1269483B (de) | Verwendung von Pyrazinen als Farbbleichkatalysatoren fuer das Silberfarbbleichverfahren | |
DE1253049B (de) | Waessriger Schwarz-Weiss-Entwickler fuer die photographische Umkehrverarbeitung farbphotographischer Materialien | |
DE1921054C3 (de) | Photographischer Fixierentwickler | |
DE1906296C3 (de) | Silbersalzdiffusionsverfahren | |
DE2052694A1 (de) | Fotografisches Entwicklungsverfahren | |
DE1962744A1 (de) | Verfahren zur Stabilisierung und Klarhaltung fotografischer Materialien | |
DE2744356A1 (de) | Photographisches umkehrverfahren ohne zweitbelichtung | |
DE1177003B (de) | Chemisch mit Alkylenoxydkondensaten sensibilisiertes photographisches Material | |
DE1173796B (de) | Photographische Silberhalogenidemulsion und photographisches, eine solche Emulsion enthaltendes Material | |
DE1163672B (de) | Photographisches, eine stabilisatorhaltige sensibilisierte Silberhalogenidemulsionsschicht enthaltendes Material | |
DE2153633A1 (de) | Verfahren zum Entwickeln eines lichtempfindlichen Silberhalogenidmaterials | |
DE1924534A1 (de) | Photographisches Kopiermaterial mit einem Gehalt eines Antibronzierungsmittels | |
DE1955232C3 (de) | Direktpositives photographisches Aufzei chnungsmatenal | |
DE1942680A1 (de) | Photographisches Entwicklungsverfahren | |
DE1198200B (de) | Lichtempfindliches photographisches Material |