DE964203C - Photographisches Kontaktverfahren zur Erzeugung mehrfarbiger Bilder - Google Patents
Photographisches Kontaktverfahren zur Erzeugung mehrfarbiger BilderInfo
- Publication number
- DE964203C DE964203C DEE8407A DEE0008407A DE964203C DE 964203 C DE964203 C DE 964203C DE E8407 A DEE8407 A DE E8407A DE E0008407 A DEE0008407 A DE E0008407A DE 964203 C DE964203 C DE 964203C
- Authority
- DE
- Germany
- Prior art keywords
- diffusing
- emulsion layers
- silver
- developer
- dye
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 238000000034 method Methods 0.000 title claims description 47
- 239000000839 emulsion Substances 0.000 claims description 74
- 239000000975 dye Substances 0.000 claims description 70
- 239000000463 material Substances 0.000 claims description 55
- 229910052709 silver Inorganic materials 0.000 claims description 32
- 239000004332 silver Substances 0.000 claims description 32
- BQCADISMDOOEFD-UHFFFAOYSA-N Silver Chemical compound [Ag] BQCADISMDOOEFD-UHFFFAOYSA-N 0.000 claims description 29
- 108010010803 Gelatin Proteins 0.000 claims description 18
- 229920000159 gelatin Polymers 0.000 claims description 18
- 239000008273 gelatin Substances 0.000 claims description 18
- 235000019322 gelatine Nutrition 0.000 claims description 18
- 235000011852 gelatine desserts Nutrition 0.000 claims description 18
- 229910052736 halogen Inorganic materials 0.000 claims description 17
- 150000002367 halogens Chemical class 0.000 claims description 16
- 150000003839 salts Chemical class 0.000 claims description 14
- -1 aromatic halogenated silver Chemical class 0.000 claims description 10
- 238000004040 coloring Methods 0.000 claims description 9
- 150000001875 compounds Chemical class 0.000 claims description 9
- 230000002378 acidificating effect Effects 0.000 claims description 8
- 230000003647 oxidation Effects 0.000 claims description 8
- 238000007254 oxidation reaction Methods 0.000 claims description 8
- 239000000126 substance Substances 0.000 claims description 8
- 238000009792 diffusion process Methods 0.000 claims description 7
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 7
- 125000003277 amino group Chemical group 0.000 claims description 6
- 125000003396 thiol group Chemical group [H]S* 0.000 claims description 5
- 125000003118 aryl group Chemical group 0.000 claims description 4
- 125000001841 imino group Chemical class [H]N=* 0.000 claims description 4
- 230000003595 spectral effect Effects 0.000 claims description 3
- 150000004056 anthraquinones Chemical class 0.000 claims description 2
- 239000003086 colorant Substances 0.000 claims description 2
- 238000010168 coupling process Methods 0.000 claims description 2
- OARRHUQTFTUEOS-UHFFFAOYSA-N safranin Chemical compound [Cl-].C=12C=C(N)C(C)=CC2=NC2=CC(C)=C(N)C=C2[N+]=1C1=CC=CC=C1 OARRHUQTFTUEOS-UHFFFAOYSA-N 0.000 claims description 2
- 238000010521 absorption reaction Methods 0.000 claims 3
- 238000001429 visible spectrum Methods 0.000 claims 2
- PYKYMHQGRFAEBM-UHFFFAOYSA-N anthraquinone Natural products CCC(=O)c1c(O)c2C(=O)C3C(C=CC=C3O)C(=O)c2cc1CC(=O)OC PYKYMHQGRFAEBM-UHFFFAOYSA-N 0.000 claims 1
- 229940106943 azor Drugs 0.000 claims 1
- 230000008878 coupling Effects 0.000 claims 1
- 238000005859 coupling reaction Methods 0.000 claims 1
- 239000000243 solution Substances 0.000 description 40
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 12
- 239000006185 dispersion Substances 0.000 description 11
- 230000033458 reproduction Effects 0.000 description 10
- 239000000203 mixture Substances 0.000 description 9
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 8
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 6
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 6
- 238000006243 chemical reaction Methods 0.000 description 6
- 229910052751 metal Inorganic materials 0.000 description 6
- 239000002184 metal Substances 0.000 description 6
- LUMLZKVIXLWTCI-NSCUHMNNSA-N (e)-2,3-dichloro-4-oxobut-2-enoic acid Chemical compound OC(=O)C(\Cl)=C(/Cl)C=O LUMLZKVIXLWTCI-NSCUHMNNSA-N 0.000 description 5
- CBCKQZAAMUWICA-UHFFFAOYSA-N 1,4-phenylenediamine Chemical compound NC1=CC=C(N)C=C1 CBCKQZAAMUWICA-UHFFFAOYSA-N 0.000 description 5
- 229910021607 Silver chloride Inorganic materials 0.000 description 5
- ZAKLKBFCSHJIRI-UHFFFAOYSA-N mucochloric acid Natural products OC1OC(=O)C(Cl)=C1Cl ZAKLKBFCSHJIRI-UHFFFAOYSA-N 0.000 description 5
- IOLCXVTUBQKXJR-UHFFFAOYSA-M potassium bromide Inorganic materials [K+].[Br-] IOLCXVTUBQKXJR-UHFFFAOYSA-M 0.000 description 5
- 239000000047 product Substances 0.000 description 5
- 239000001397 quillaja saponaria molina bark Substances 0.000 description 5
- 229930182490 saponin Natural products 0.000 description 5
- 150000007949 saponins Chemical class 0.000 description 5
- HKZLPVFGJNLROG-UHFFFAOYSA-M silver monochloride Chemical compound [Cl-].[Ag+] HKZLPVFGJNLROG-UHFFFAOYSA-M 0.000 description 5
- GGCZERPQGJTIQP-UHFFFAOYSA-N sodium;9,10-dioxoanthracene-2-sulfonic acid Chemical compound [Na+].C1=CC=C2C(=O)C3=CC(S(=O)(=O)O)=CC=C3C(=O)C2=C1 GGCZERPQGJTIQP-UHFFFAOYSA-N 0.000 description 5
- 239000003513 alkali Substances 0.000 description 4
- 239000003795 chemical substances by application Substances 0.000 description 4
- 230000000694 effects Effects 0.000 description 4
- WQGWDDDVZFFDIG-UHFFFAOYSA-N pyrogallol Chemical compound OC1=CC=CC(O)=C1O WQGWDDDVZFFDIG-UHFFFAOYSA-N 0.000 description 4
- 230000035945 sensitivity Effects 0.000 description 4
- GEHJYWRUCIMESM-UHFFFAOYSA-L sodium sulfite Chemical compound [Na+].[Na+].[O-]S([O-])=O GEHJYWRUCIMESM-UHFFFAOYSA-L 0.000 description 4
- 238000003756 stirring Methods 0.000 description 4
- WVDDGKGOMKODPV-UHFFFAOYSA-N Benzyl alcohol Chemical compound OCC1=CC=CC=C1 WVDDGKGOMKODPV-UHFFFAOYSA-N 0.000 description 3
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 3
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 3
- 229960000583 acetic acid Drugs 0.000 description 3
- 239000002253 acid Substances 0.000 description 3
- 150000003931 anilides Chemical class 0.000 description 3
- QVQLCTNNEUAWMS-UHFFFAOYSA-N barium oxide Chemical compound [Ba]=O QVQLCTNNEUAWMS-UHFFFAOYSA-N 0.000 description 3
- 229910001864 baryta Inorganic materials 0.000 description 3
- 235000019441 ethanol Nutrition 0.000 description 3
- 239000007800 oxidant agent Substances 0.000 description 3
- 239000004848 polyfunctional curative Substances 0.000 description 3
- 238000000926 separation method Methods 0.000 description 3
- 239000000080 wetting agent Substances 0.000 description 3
- CIWBSHSKHKDKBQ-JLAZNSOCSA-N Ascorbic acid Chemical compound OC[C@H](O)[C@H]1OC(=O)C(O)=C1O CIWBSHSKHKDKBQ-JLAZNSOCSA-N 0.000 description 2
- CIWBSHSKHKDKBQ-DUZGATOHSA-N D-isoascorbic acid Chemical compound OC[C@@H](O)[C@H]1OC(=O)C(O)=C1O CIWBSHSKHKDKBQ-DUZGATOHSA-N 0.000 description 2
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 description 2
- QIGBRXMKCJKVMJ-UHFFFAOYSA-N Hydroquinone Chemical compound OC1=CC=C(O)C=C1 QIGBRXMKCJKVMJ-UHFFFAOYSA-N 0.000 description 2
- 239000002250 absorbent Substances 0.000 description 2
- 230000002745 absorbent Effects 0.000 description 2
- 239000012670 alkaline solution Substances 0.000 description 2
- 238000004061 bleaching Methods 0.000 description 2
- YCIMNLLNPGFGHC-UHFFFAOYSA-N catechol Chemical compound OC1=CC=CC=C1O YCIMNLLNPGFGHC-UHFFFAOYSA-N 0.000 description 2
- 230000000295 complement effect Effects 0.000 description 2
- 239000000834 fixative Substances 0.000 description 2
- 229910001385 heavy metal Inorganic materials 0.000 description 2
- 150000002391 heterocyclic compounds Chemical class 0.000 description 2
- CBEQRNSPHCCXSH-UHFFFAOYSA-N iodine monobromide Chemical compound IBr CBEQRNSPHCCXSH-UHFFFAOYSA-N 0.000 description 2
- 229940079877 pyrogallol Drugs 0.000 description 2
- 239000001488 sodium phosphate Substances 0.000 description 2
- 235000010265 sodium sulphite Nutrition 0.000 description 2
- 239000002904 solvent Substances 0.000 description 2
- 238000001228 spectrum Methods 0.000 description 2
- DHCDFWKWKRSZHF-UHFFFAOYSA-L thiosulfate(2-) Chemical compound [O-]S([S-])(=O)=O DHCDFWKWKRSZHF-UHFFFAOYSA-L 0.000 description 2
- RYFMWSXOAZQYPI-UHFFFAOYSA-K trisodium phosphate Chemical compound [Na+].[Na+].[Na+].[O-]P([O-])([O-])=O RYFMWSXOAZQYPI-UHFFFAOYSA-K 0.000 description 2
- 229910000406 trisodium phosphate Inorganic materials 0.000 description 2
- 235000019801 trisodium phosphate Nutrition 0.000 description 2
- CMGDVUCDZOBDNL-UHFFFAOYSA-N 4-methyl-2h-benzotriazole Chemical compound CC1=CC=CC2=NNN=C12 CMGDVUCDZOBDNL-UHFFFAOYSA-N 0.000 description 1
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 1
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 1
- RDFLLVCQYHQOBU-GPGGJFNDSA-O Cyanin Natural products O([C@H]1[C@H](O)[C@H](O)[C@H](O)[C@H](CO)O1)c1c(-c2cc(O)c(O)cc2)[o+]c2c(c(O[C@H]3[C@H](O)[C@@H](O)[C@H](O)[C@H](CO)O3)cc(O)c2)c1 RDFLLVCQYHQOBU-GPGGJFNDSA-O 0.000 description 1
- XYDJGBOFUHOSKN-UHFFFAOYSA-N N-(6-benzoyl-1H-indazol-3-yl)acetamide Chemical compound C(C1=CC=CC=C1)(=O)C1=CC=C2C(=NNC2=C1)NC(=O)C XYDJGBOFUHOSKN-UHFFFAOYSA-N 0.000 description 1
- 206010070834 Sensitisation Diseases 0.000 description 1
- DWAQJAXMDSEUJJ-UHFFFAOYSA-M Sodium bisulfite Chemical compound [Na+].OS([O-])=O DWAQJAXMDSEUJJ-UHFFFAOYSA-M 0.000 description 1
- 125000003282 alkyl amino group Chemical group 0.000 description 1
- 239000000908 ammonium hydroxide Substances 0.000 description 1
- 150000001450 anions Chemical class 0.000 description 1
- 235000010323 ascorbic acid Nutrition 0.000 description 1
- 229960005070 ascorbic acid Drugs 0.000 description 1
- 239000011668 ascorbic acid Substances 0.000 description 1
- WDIHJSXYQDMJHN-UHFFFAOYSA-L barium chloride Chemical compound [Cl-].[Cl-].[Ba+2] WDIHJSXYQDMJHN-UHFFFAOYSA-L 0.000 description 1
- 229910001626 barium chloride Inorganic materials 0.000 description 1
- 159000000009 barium salts Chemical class 0.000 description 1
- 235000019445 benzyl alcohol Nutrition 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 238000005266 casting Methods 0.000 description 1
- 241001233037 catfish Species 0.000 description 1
- 150000001768 cations Chemical class 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 239000000084 colloidal system Substances 0.000 description 1
- RDFLLVCQYHQOBU-ZOTFFYTFSA-O cyanin Chemical compound O[C@@H]1[C@@H](O)[C@H](O)[C@@H](CO)O[C@H]1OC(C(=[O+]C1=CC(O)=C2)C=3C=C(O)C(O)=CC=3)=CC1=C2O[C@H]1[C@H](O)[C@@H](O)[C@H](O)[C@@H](CO)O1 RDFLLVCQYHQOBU-ZOTFFYTFSA-O 0.000 description 1
- 239000012954 diazonium Substances 0.000 description 1
- 150000001989 diazonium salts Chemical class 0.000 description 1
- MQRJBSHKWOFOGF-UHFFFAOYSA-L disodium;carbonate;hydrate Chemical compound O.[Na+].[Na+].[O-]C([O-])=O MQRJBSHKWOFOGF-UHFFFAOYSA-L 0.000 description 1
- 239000012153 distilled water Substances 0.000 description 1
- 238000005538 encapsulation Methods 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- PUSKHXMZPOMNTQ-UHFFFAOYSA-N ethyl 2,1,3-benzoselenadiazole-5-carboxylate Chemical compound CCOC(=O)C1=CC=C2N=[Se]=NC2=C1 PUSKHXMZPOMNTQ-UHFFFAOYSA-N 0.000 description 1
- 230000001747 exhibiting effect Effects 0.000 description 1
- 239000004744 fabric Substances 0.000 description 1
- 239000012362 glacial acetic acid Substances 0.000 description 1
- 235000011187 glycerol Nutrition 0.000 description 1
- TVHALOSDPLTTSR-UHFFFAOYSA-H hexasodium;[oxido-[oxido(phosphonatooxy)phosphoryl]oxyphosphoryl] phosphate Chemical compound [Na+].[Na+].[Na+].[Na+].[Na+].[Na+].[O-]P([O-])(=O)OP([O-])(=O)OP([O-])(=O)OP([O-])([O-])=O TVHALOSDPLTTSR-UHFFFAOYSA-H 0.000 description 1
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 1
- JEIPFZHSYJVQDO-UHFFFAOYSA-N iron(III) oxide Inorganic materials O=[Fe]O[Fe]=O JEIPFZHSYJVQDO-UHFFFAOYSA-N 0.000 description 1
- 229910021645 metal ion Inorganic materials 0.000 description 1
- 125000001570 methylene group Chemical group [H]C([H])([*:1])[*:2] 0.000 description 1
- AJDUTMFFZHIJEM-UHFFFAOYSA-N n-(9,10-dioxoanthracen-1-yl)-4-[4-[[4-[4-[(9,10-dioxoanthracen-1-yl)carbamoyl]phenyl]phenyl]diazenyl]phenyl]benzamide Chemical compound O=C1C2=CC=CC=C2C(=O)C2=C1C=CC=C2NC(=O)C(C=C1)=CC=C1C(C=C1)=CC=C1N=NC(C=C1)=CC=C1C(C=C1)=CC=C1C(=O)NC1=CC=CC2=C1C(=O)C1=CC=CC=C1C2=O AJDUTMFFZHIJEM-UHFFFAOYSA-N 0.000 description 1
- 230000001590 oxidative effect Effects 0.000 description 1
- 238000005554 pickling Methods 0.000 description 1
- 229920002717 polyvinylpyridine Polymers 0.000 description 1
- 238000001556 precipitation Methods 0.000 description 1
- 239000001047 purple dye Substances 0.000 description 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
- SOUHUMACVWVDME-UHFFFAOYSA-N safranin O Chemical compound [Cl-].C12=CC(N)=CC=C2N=C2C=CC(N)=CC2=[N+]1C1=CC=CC=C1 SOUHUMACVWVDME-UHFFFAOYSA-N 0.000 description 1
- 230000008313 sensitization Effects 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 229940076133 sodium carbonate monohydrate Drugs 0.000 description 1
- 235000010267 sodium hydrogen sulphite Nutrition 0.000 description 1
- AKHNMLFCWUSKQB-UHFFFAOYSA-L sodium thiosulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=S AKHNMLFCWUSKQB-UHFFFAOYSA-L 0.000 description 1
- 235000019345 sodium thiosulphate Nutrition 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- PXQLVRUNWNTZOS-UHFFFAOYSA-N sulfanyl Chemical class [SH] PXQLVRUNWNTZOS-UHFFFAOYSA-N 0.000 description 1
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 1
- 229920002554 vinyl polymer Polymers 0.000 description 1
- 239000001043 yellow dye Substances 0.000 description 1
Classifications
-
- G—PHYSICS
- G03—PHOTOGRAPHY; CINEMATOGRAPHY; ANALOGOUS TECHNIQUES USING WAVES OTHER THAN OPTICAL WAVES; ELECTROGRAPHY; HOLOGRAPHY
- G03C—PHOTOSENSITIVE MATERIALS FOR PHOTOGRAPHIC PURPOSES; PHOTOGRAPHIC PROCESSES, e.g. CINE, X-RAY, COLOUR, STEREO-PHOTOGRAPHIC PROCESSES; AUXILIARY PROCESSES IN PHOTOGRAPHY
- G03C8/00—Diffusion transfer processes or agents therefor; Photosensitive materials for such processes
- G03C8/02—Photosensitive materials characterised by the image-forming section
- G03C8/08—Photosensitive materials characterised by the image-forming section the substances transferred by diffusion consisting of organic compounds
Landscapes
- Physics & Mathematics (AREA)
- General Physics & Mathematics (AREA)
- Silver Salt Photography Or Processing Solution Therefor (AREA)
- Color Printing (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US332728A US2756142A (en) | 1953-01-22 | 1953-01-22 | Photographic color reproduction process |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE964203C true DE964203C (de) | 1957-05-16 |
Family
ID=23299608
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DEE8407A Expired DE964203C (de) | 1953-01-22 | 1954-01-13 | Photographisches Kontaktverfahren zur Erzeugung mehrfarbiger Bilder |
Country Status (5)
| Country | Link |
|---|---|
| US (1) | US2756142A (OSRAM) |
| BE (1) | BE525871A (OSRAM) |
| DE (1) | DE964203C (OSRAM) |
| FR (1) | FR1103424A (OSRAM) |
| GB (1) | GB746686A (OSRAM) |
Families Citing this family (24)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2968554A (en) * | 1954-08-09 | 1961-01-17 | Polaroid Corp | Photographic transfer processes for forming multicolor dye images and photographic products for carrying out the same |
| NL103316C (OSRAM) * | 1956-02-13 | 1900-01-01 | ||
| NL105020C (OSRAM) * | 1956-03-22 | |||
| US3019124A (en) * | 1956-04-12 | 1962-01-30 | Polaroid Corp | Multicolor photosensitive film and process of making the same |
| US3087817A (en) * | 1956-10-03 | 1963-04-30 | Polaroid Corp | Process and product for forming color images from complete dyes |
| NL226020A (OSRAM) * | 1957-04-24 | |||
| US2940849A (en) * | 1957-07-10 | 1960-06-14 | Eastman Kodak Co | Planographic dye transfer process |
| US2983606A (en) * | 1958-07-14 | 1961-05-09 | Polaroid Corp | Processes and products for forming photographic images in color |
| US3065074A (en) * | 1958-08-20 | 1962-11-20 | Polaroid Corp | 1,4-benzoquinone oxidizing agents for color transfer processes |
| US3230083A (en) * | 1959-04-02 | 1966-01-18 | Polaroid Corp | Photographic processes and products |
| BE589419A (OSRAM) * | 1959-04-06 | |||
| US3230084A (en) * | 1959-05-18 | 1966-01-18 | Polaroid Corp | Novel photographic products and processes |
| US3185567A (en) * | 1959-07-06 | 1965-05-25 | Polaroid Corp | Photographic color process and product |
| US3188209A (en) * | 1959-12-01 | 1965-06-08 | Polaroid Corp | Diffusion transfer color processes |
| BE603747A (OSRAM) * | 1960-05-13 | |||
| BE614376A (OSRAM) * | 1961-02-27 | |||
| US3077400A (en) * | 1962-04-26 | 1963-02-12 | Polaroid Corp | Color diffusion transfer using gelatinsilver halide emulsions containing cellulose ethers |
| US3230082A (en) * | 1962-05-14 | 1966-01-18 | Polaroid Corp | Color processes and products |
| US3245791A (en) * | 1964-09-21 | 1966-04-12 | Polaroid Corp | Photographic transfer process and composition |
| US3320062A (en) * | 1963-07-30 | 1967-05-16 | Polaroid Corp | Photographic processes comprising stepwise control of dye developer diffusibility in alkali |
| US3295973A (en) * | 1965-11-03 | 1967-01-03 | Polaroid Corp | Novel photographic products and processes |
| US5118594A (en) * | 1989-06-16 | 1992-06-02 | Eastman Kodak Company | Photographic elements containing removable couplers |
| US5051343A (en) * | 1989-06-16 | 1991-09-24 | Eastman Kodak Company | Photographic elements containing removable couplers |
| US6054257A (en) * | 1998-01-29 | 2000-04-25 | Eastman Kodak Company | Photographic element containing particular coupler and inhibitor releasing coupler |
Citations (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB634169A (en) * | 1942-12-05 | 1950-03-15 | Gevaert Photo Prod Nv | Improvements in or relating to the production of corrected photographic colour-component |
Family Cites Families (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US1191034A (en) * | 1914-08-31 | 1916-07-11 | Julius Rheinberg | Color photography and color-printing. |
| US2464798A (en) * | 1944-05-03 | 1949-03-22 | Gen Aniline & Film Corp | Color correction of multicolor negative film by integral masking images |
| US2456955A (en) * | 1944-06-02 | 1948-12-21 | Eastman Kodak Co | Photographic processes and lightsensitive elements therefor |
| US2647049A (en) * | 1947-02-25 | 1953-07-28 | Polaroid Corp | Photographic element for color photography and a process of producing multicolor pictures |
| US2559643A (en) * | 1948-02-19 | 1951-07-10 | Polaroid Corp | Photographic product and process |
-
0
- BE BE525871D patent/BE525871A/xx unknown
-
1953
- 1953-01-22 US US332728A patent/US2756142A/en not_active Expired - Lifetime
-
1954
- 1954-01-13 DE DEE8407A patent/DE964203C/de not_active Expired
- 1954-01-19 FR FR1103424D patent/FR1103424A/fr not_active Expired
- 1954-01-21 GB GB1786/54A patent/GB746686A/en not_active Expired
Patent Citations (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB634169A (en) * | 1942-12-05 | 1950-03-15 | Gevaert Photo Prod Nv | Improvements in or relating to the production of corrected photographic colour-component |
Also Published As
| Publication number | Publication date |
|---|---|
| BE525871A (OSRAM) | |
| FR1103424A (fr) | 1955-11-03 |
| GB746686A (en) | 1956-03-21 |
| US2756142A (en) | 1956-07-24 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE964203C (de) | Photographisches Kontaktverfahren zur Erzeugung mehrfarbiger Bilder | |
| DE764572C (de) | Verfahren zur Herstellung von Bildern mit Hilfe von Halogensilber | |
| DE1547700A1 (de) | Verwendung von Schiff'schen Basen zur Entwicklung von belichtetem,photographischem Material | |
| DE1522374C2 (de) | Verfahren zur Herstellung eines direktpositiven photographischen Bildes | |
| DE1246406B (de) | Farbphotographisches Direkt-Positivverfahren | |
| DE1182064B (de) | Verfahren zur Herstellung von positiven mehrfarbigen photographischen Bildern nach dem Farbdiffusionsverfahren | |
| DE1547759B1 (de) | Silberfarbbleichverfahren | |
| DE1547806A1 (de) | Farbdiffusionsuebertragungsverfahren | |
| DE1202638B (de) | Photographisches Entwicklungsverfahren zur Herstellung von Farbbildern nach dem Farbentwicklungsverfahren | |
| DE1547673C3 (de) | Verfahren zur Herstellung von blaugrünen maskierten Bildern auf photographischem Wege | |
| DE1002198B (de) | Verfahren zur Herstellung von farbenphotographischen Bildern | |
| EP0023888B1 (de) | Verfahren zur Herstellung maskierter positiver Farbbilder nach dem Silberfarbbleichverfahren sowie das photographische Silberfarbbleichmaterial hierfür | |
| DE1951327A1 (de) | Photographisches negatives Material und Farbdiffusionsuebertragungsverfahren | |
| DE859711C (de) | Verfahren zur direkten Herstellung von positiven photographischen Bildern | |
| DEE0008407MA (OSRAM) | ||
| DE1547995A1 (de) | Fotografisches Verfahren | |
| DE2238052A1 (de) | Photographisches bilduebertragungsverfahren sowie photographische filmeinheit zur durchfuehrung des verfahrens | |
| DE1101954B (de) | Farbphotographisches Diffusions-uebertragungsverfahren und zugehoeriges photographisches Material | |
| DE2349451A1 (de) | Farbdiffusionsuebertragungsverfahren | |
| DE2362372A1 (de) | Photographisches farbdiffusionsuebertragungsverfahren | |
| DE895101C (de) | Verfahren zur Herstellung seitenrichtiger positiver Kopien | |
| DE965614C (de) | Verfahren zur Herstellung mehrfarbiger photographischer Bilder | |
| DE1547806C (de) | Farbdiffusionsverfahren | |
| EP0016732A1 (de) | Verfahren zur Herstellung photographischer Abbildungen und geeignetes photographisches Material | |
| DE932345C (de) | Verfahren zum farbigen Entwickeln photographischer, aus Metall bestehender Bilder |