DE890847C - Halbleiter-UEbertragungsvorrichtung - Google Patents
Halbleiter-UEbertragungsvorrichtungInfo
- Publication number
- DE890847C DE890847C DEP44957A DEP0044957A DE890847C DE 890847 C DE890847 C DE 890847C DE P44957 A DEP44957 A DE P44957A DE P0044957 A DEP0044957 A DE P0044957A DE 890847 C DE890847 C DE 890847C
- Authority
- DE
- Germany
- Prior art keywords
- circle
- transmission device
- connection
- circuit
- thread
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 239000004065 semiconductor Substances 0.000 title claims description 66
- 230000005540 biological transmission Effects 0.000 title claims description 52
- 239000000463 material Substances 0.000 claims description 41
- 229910052732 germanium Inorganic materials 0.000 claims description 14
- GNPVGFCGXDBREM-UHFFFAOYSA-N germanium atom Chemical compound [Ge] GNPVGFCGXDBREM-UHFFFAOYSA-N 0.000 claims description 14
- 230000007423 decrease Effects 0.000 claims description 7
- 239000000969 carrier Substances 0.000 claims description 4
- 230000005684 electric field Effects 0.000 claims description 3
- 230000004888 barrier function Effects 0.000 claims description 2
- 230000037431 insertion Effects 0.000 claims 4
- 238000003780 insertion Methods 0.000 claims 4
- 238000005513 bias potential Methods 0.000 claims 1
- 230000005284 excitation Effects 0.000 claims 1
- 230000003111 delayed effect Effects 0.000 description 7
- 230000002441 reversible effect Effects 0.000 description 7
- 230000001965 increasing effect Effects 0.000 description 6
- 230000003321 amplification Effects 0.000 description 5
- 238000003199 nucleic acid amplification method Methods 0.000 description 5
- 230000002829 reductive effect Effects 0.000 description 5
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 description 4
- 230000001133 acceleration Effects 0.000 description 4
- 238000010438 heat treatment Methods 0.000 description 4
- 239000000155 melt Substances 0.000 description 4
- 230000033458 reproduction Effects 0.000 description 4
- 230000008054 signal transmission Effects 0.000 description 4
- 230000003313 weakening effect Effects 0.000 description 4
- 230000008859 change Effects 0.000 description 3
- 238000013461 design Methods 0.000 description 3
- 238000009792 diffusion process Methods 0.000 description 3
- 230000000694 effects Effects 0.000 description 3
- 239000012535 impurity Substances 0.000 description 3
- 238000000034 method Methods 0.000 description 3
- 229910052698 phosphorus Inorganic materials 0.000 description 3
- 230000009467 reduction Effects 0.000 description 3
- 229910052710 silicon Inorganic materials 0.000 description 3
- 239000010703 silicon Substances 0.000 description 3
- 238000012546 transfer Methods 0.000 description 3
- 230000007704 transition Effects 0.000 description 3
- ZOXJGFHDIHLPTG-UHFFFAOYSA-N Boron Chemical compound [B] ZOXJGFHDIHLPTG-UHFFFAOYSA-N 0.000 description 2
- 229910000906 Bronze Inorganic materials 0.000 description 2
- KRHYYFGTRYWZRS-UHFFFAOYSA-N Fluorane Chemical compound F KRHYYFGTRYWZRS-UHFFFAOYSA-N 0.000 description 2
- 229910052782 aluminium Inorganic materials 0.000 description 2
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 2
- 229910052785 arsenic Inorganic materials 0.000 description 2
- RQNWIZPPADIBDY-UHFFFAOYSA-N arsenic atom Chemical compound [As] RQNWIZPPADIBDY-UHFFFAOYSA-N 0.000 description 2
- 230000000903 blocking effect Effects 0.000 description 2
- 229910052796 boron Inorganic materials 0.000 description 2
- 239000010974 bronze Substances 0.000 description 2
- 238000000576 coating method Methods 0.000 description 2
- KUNSUQLRTQLHQQ-UHFFFAOYSA-N copper tin Chemical compound [Cu].[Sn] KUNSUQLRTQLHQQ-UHFFFAOYSA-N 0.000 description 2
- 238000010586 diagram Methods 0.000 description 2
- YBMRDBCBODYGJE-UHFFFAOYSA-N germanium dioxide Chemical compound O=[Ge]=O YBMRDBCBODYGJE-UHFFFAOYSA-N 0.000 description 2
- 239000001307 helium Substances 0.000 description 2
- 229910052734 helium Inorganic materials 0.000 description 2
- SWQJXJOGLNCZEY-UHFFFAOYSA-N helium atom Chemical compound [He] SWQJXJOGLNCZEY-UHFFFAOYSA-N 0.000 description 2
- 230000006872 improvement Effects 0.000 description 2
- 230000006698 induction Effects 0.000 description 2
- 230000001939 inductive effect Effects 0.000 description 2
- 239000011574 phosphorus Substances 0.000 description 2
- 230000008569 process Effects 0.000 description 2
- 238000010079 rubber tapping Methods 0.000 description 2
- WFKWXMTUELFFGS-UHFFFAOYSA-N tungsten Chemical compound [W] WFKWXMTUELFFGS-UHFFFAOYSA-N 0.000 description 2
- 229910052721 tungsten Inorganic materials 0.000 description 2
- 239000010937 tungsten Substances 0.000 description 2
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 1
- 238000013459 approach Methods 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 239000011248 coating agent Substances 0.000 description 1
- 150000001875 compounds Chemical class 0.000 description 1
- 238000010276 construction Methods 0.000 description 1
- XTVVROIMIGLXTD-UHFFFAOYSA-N copper(II) nitrate Chemical compound [Cu+2].[O-][N+]([O-])=O.[O-][N+]([O-])=O XTVVROIMIGLXTD-UHFFFAOYSA-N 0.000 description 1
- 230000003247 decreasing effect Effects 0.000 description 1
- 230000002950 deficient Effects 0.000 description 1
- 239000006185 dispersion Substances 0.000 description 1
- 239000000428 dust Substances 0.000 description 1
- 230000005611 electricity Effects 0.000 description 1
- 239000003623 enhancer Substances 0.000 description 1
- 229940119177 germanium dioxide Drugs 0.000 description 1
- 229910002804 graphite Inorganic materials 0.000 description 1
- 239000010439 graphite Substances 0.000 description 1
- 229910052739 hydrogen Inorganic materials 0.000 description 1
- 239000001257 hydrogen Substances 0.000 description 1
- 230000000977 initiatory effect Effects 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 230000005012 migration Effects 0.000 description 1
- 238000013508 migration Methods 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- 230000036651 mood Effects 0.000 description 1
- 230000007935 neutral effect Effects 0.000 description 1
- 229910017604 nitric acid Inorganic materials 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- 230000036961 partial effect Effects 0.000 description 1
- 229910052573 porcelain Inorganic materials 0.000 description 1
- 238000001556 precipitation Methods 0.000 description 1
- 230000004044 response Effects 0.000 description 1
- 230000000284 resting effect Effects 0.000 description 1
- 230000000717 retained effect Effects 0.000 description 1
- 229910052703 rhodium Inorganic materials 0.000 description 1
- 239000010948 rhodium Substances 0.000 description 1
- MHOVAHRLVXNVSD-UHFFFAOYSA-N rhodium atom Chemical compound [Rh] MHOVAHRLVXNVSD-UHFFFAOYSA-N 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 229910010271 silicon carbide Inorganic materials 0.000 description 1
- 230000002123 temporal effect Effects 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- H—ELECTRICITY
- H03—ELECTRONIC CIRCUITRY
- H03F—AMPLIFIERS
- H03F3/00—Amplifiers with only discharge tubes or only semiconductor devices as amplifying elements
- H03F3/04—Amplifiers with only discharge tubes or only semiconductor devices as amplifying elements with semiconductor devices only
- H03F3/14—Amplifiers with only discharge tubes or only semiconductor devices as amplifying elements with semiconductor devices only with amplifying devices having more than three electrodes or more than two PN junctions
-
- H—ELECTRICITY
- H03—ELECTRONIC CIRCUITRY
- H03D—DEMODULATION OR TRANSFERENCE OF MODULATION FROM ONE CARRIER TO ANOTHER
- H03D7/00—Transference of modulation from one carrier to another, e.g. frequency-changing
- H03D7/12—Transference of modulation from one carrier to another, e.g. frequency-changing by means of semiconductor devices having more than two electrodes
-
- H—ELECTRICITY
- H03—ELECTRONIC CIRCUITRY
- H03F—AMPLIFIERS
- H03F3/00—Amplifiers with only discharge tubes or only semiconductor devices as amplifying elements
- H03F3/04—Amplifiers with only discharge tubes or only semiconductor devices as amplifying elements with semiconductor devices only
-
- H—ELECTRICITY
- H10—SEMICONDUCTOR DEVICES; ELECTRIC SOLID-STATE DEVICES NOT OTHERWISE PROVIDED FOR
- H10D—INORGANIC ELECTRIC SEMICONDUCTOR DEVICES
- H10D99/00—Subject matter not provided for in other groups of this subclass
Landscapes
- Engineering & Computer Science (AREA)
- Power Engineering (AREA)
- Junction Field-Effect Transistors (AREA)
- Bipolar Transistors (AREA)
- Electrodes Of Semiconductors (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US50897A US2502479A (en) | 1948-09-24 | 1948-09-24 | Semiconductor amplifier |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE890847C true DE890847C (de) | 1953-09-24 |
Family
ID=21968142
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DEP44957A Expired DE890847C (de) | 1948-09-24 | 1949-06-05 | Halbleiter-UEbertragungsvorrichtung |
Country Status (7)
| Country | Link |
|---|---|
| US (1) | US2502479A (en:Method) |
| BE (1) | BE490958A (en:Method) |
| CH (1) | CH282857A (en:Method) |
| DE (1) | DE890847C (en:Method) |
| FR (1) | FR990032A (en:Method) |
| GB (1) | GB700236A (en:Method) |
| NL (1) | NL79529C (en:Method) |
Cited By (15)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1034775B (de) * | 1956-08-02 | 1958-07-24 | Stanislas Teszner | Unipolartransistor mit einer Einschnuerung im mittleren Teil des Halbleiterstabes |
| DE1035776B (de) * | 1954-09-27 | 1958-08-07 | Ibm Deutschland | Transistor mit einem flachen Halbleiterkoerper und mehreren sperrfreien und sperrenden Elektroden |
| DE1035778B (de) * | 1955-05-20 | 1958-08-07 | Ibm Deutschland | Transistor mit einem Halbleitergrundkoerper von einem Leitungstypus und mit drei oder mehr pn-UEbergaengen und einer oder mehreren Spitzenelektroden |
| DE1035779B (de) * | 1955-05-25 | 1958-08-07 | Ibm Deutschland | Schalttransistor mit wenigstens zwei Kollektorelektroden |
| DE1042128B (de) * | 1955-11-12 | 1958-10-30 | Siemens Ag | Doppelbasistransistor zum Erzeugen von Schalt- oder Kippvorgaengen |
| DE1054584B (de) * | 1957-02-25 | 1959-04-09 | Deutsche Bundespost | Halbleiteranordnung zur wahlweisen Umschaltung eines Signals |
| DE1063279B (de) * | 1957-05-31 | 1959-08-13 | Ibm Deutschland | Halbleiteranordnung aus einem Halbleiterkoerper mit flaechenhaftem innerem pn-UEbergang und mit mehr als drei Elektroden |
| DE1067471B (de) * | 1953-12-31 | 1959-10-22 | Ibm Deutschland | Bistabile Verstaerkerschaltung mit einem Spitzentransistor, der eine gleichrichtende und eine nichtgleichrichtende Basiselektrode hat |
| DE1068384B (en:Method) * | 1959-11-05 | |||
| DE1069784B (de) * | 1957-04-27 | 1960-04-21 | Süddeutsche Telefon-Apparate-, Kabel- und Drahtwerke A.G., TEKADE, Nürnberg | Verfahren zur Herstellung einer sperrschichtfreien Elektrode auf dem Halbleiterkörper aus Germanium einer Halbleiteranordnung |
| DE1084382B (de) * | 1957-07-15 | 1960-06-30 | Raytheon Mfg Co | Halbleiteranordnung mit einem Halbleiterkoerper aus zwei Zonen entgegengesetzten Leitfaehigkeitstyps |
| DE1094884B (de) * | 1956-12-13 | 1960-12-15 | Philips Nv | Feldeffekt-Transistor mit einem Halbleiterkoerper aus zwei Zonen entgegengesetzten Leitfaehigkeitstyps und einer Nut zwischen den zwei ohmschen Elektroden und Verfahren zu seiner Herstellung |
| DE1098613B (de) * | 1958-05-15 | 1961-02-02 | Gen Electric | Thyratronaehnliche Halbleiteranordnung mit einem in Flussrichtung vorgespannten einkristallinen pin-Halbleiterkoerper |
| DE1132662B (de) * | 1957-12-28 | 1962-07-05 | Suisse Horlogerie | Flaechentransistor mit zwei ohmschen Steuerelektroden fuer den Emitter-Kollektor-Strom an der Basiszone |
| DE1197987B (de) * | 1960-01-26 | 1965-08-05 | Fuji Electric Co Ltd | Halbleiterbauelement mit Feldsteuerung fuer Schaltzwecke und Betriebsschaltungen |
Families Citing this family (78)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1070747B (en:Method) * | 1959-12-10 | |||
| NL84061C (en:Method) * | 1948-06-26 | |||
| BE490438A (en:Method) * | 1948-08-13 | |||
| BE491275A (en:Method) * | 1948-10-14 | |||
| US2770762A (en) * | 1949-04-01 | 1956-11-13 | Int Standard Electric Corp | Crystal triodes |
| US2609427A (en) * | 1949-05-31 | 1952-09-02 | Rca Corp | Three-electrode semiconductor device |
| US2606960A (en) * | 1949-06-01 | 1952-08-12 | Bell Telephone Labor Inc | Semiconductor translating device |
| US2632062A (en) * | 1949-06-15 | 1953-03-17 | Bell Telephone Labor Inc | Semiconductor transducer |
| US2634322A (en) * | 1949-07-16 | 1953-04-07 | Rca Corp | Contact for semiconductor devices |
| US2675509A (en) * | 1949-07-26 | 1954-04-13 | Rca Corp | High-frequency response semiconductor device |
| US2644914A (en) * | 1949-08-17 | 1953-07-07 | Bell Telephone Labor Inc | Multicontact semiconductor translating device |
| US2670441A (en) * | 1949-09-07 | 1954-02-23 | Bell Telephone Labor Inc | Alpha particle counter |
| US2618690A (en) * | 1949-10-06 | 1952-11-18 | Otmar M Stuetzer | Transconductor employing line type field controlled semiconductor |
| US2586080A (en) * | 1949-10-11 | 1952-02-19 | Bell Telephone Labor Inc | Semiconductive signal translating device |
| NL82014C (en:Method) * | 1949-11-30 | |||
| US2965820A (en) * | 1950-02-17 | 1960-12-20 | Rca Corp | High gain semi-conductor devices |
| US2666873A (en) * | 1950-04-21 | 1954-01-19 | Rca Corp | High current gain semiconductor device |
| NL159657B (nl) * | 1950-06-28 | Bayer Ag | Werkwijze ter bereiding van een n-hydroxyimidothiocarbon- zuurester. | |
| US2704792A (en) * | 1950-06-28 | 1955-03-22 | Rca Corp | Amplifier with adjustable peak frequency response |
| US2728034A (en) * | 1950-09-08 | 1955-12-20 | Rca Corp | Semi-conductor devices with opposite conductivity zones |
| BE505739A (en:Method) * | 1950-09-12 | |||
| US2950425A (en) * | 1950-09-14 | 1960-08-23 | Bell Telephone Labor Inc | Semiconductor signal translating devices |
| US2650311A (en) * | 1950-10-26 | 1953-08-25 | Purdue Research Foundation | Radiant energy detecting method and apparatus |
| US2691736A (en) * | 1950-12-27 | 1954-10-12 | Bell Telephone Labor Inc | Electrical translation device, including semiconductor |
| US2691076A (en) * | 1951-01-18 | 1954-10-05 | Rca Corp | Semiconductor signal translating system |
| US2701302A (en) * | 1951-03-29 | 1955-02-01 | Rca Corp | Semiconductor frequency converter |
| US2794863A (en) * | 1951-07-20 | 1957-06-04 | Bell Telephone Labor Inc | Semiconductor translating device and circuit |
| US2761020A (en) * | 1951-09-12 | 1956-08-28 | Bell Telephone Labor Inc | Frequency selective semiconductor circuit elements |
| US2757243A (en) * | 1951-09-17 | 1956-07-31 | Bell Telephone Labor Inc | Transistor circuits |
| US2736849A (en) * | 1951-12-31 | 1956-02-28 | Hazeltine Research Inc | Junction-type transistors |
| US2776381A (en) * | 1952-01-25 | 1957-01-01 | Bell Telephone Labor Inc | Multielectrode semiconductor circuit element |
| DE1006169B (de) * | 1952-02-07 | 1957-04-11 | Siemes & Halske Ag | Anordnung zur Umwandlung mechanischer in elektrische Schwingungen |
| US2693568A (en) * | 1952-03-05 | 1954-11-02 | Bell Telephone Labor Inc | Current and voltage regulation |
| NL176299B (nl) * | 1952-03-10 | Hydrotech Int Inc | Inrichting voor het losneembaar afsluiten van pijpleidingen. | |
| NL96818C (en:Method) * | 1952-03-14 | |||
| BE520777A (en:Method) * | 1952-06-19 | |||
| DE954624C (de) * | 1952-06-19 | 1956-12-20 | Western Electric Co | Hochfrequenz-Halbleiterverstaerker |
| DE1031893B (de) * | 1952-08-01 | 1958-06-12 | Standard Elektrik Ag | Verfahren zur aeusseren Formgebung von Halbleiteranordnungen, insbesondere fuer Gleichrichter- und Verstaerkerzwecke mit Halbleitern aus Germanium oder Silizium |
| NL182022B (nl) * | 1952-10-31 | Oval Eng Co Ltd | Stroommeter met positieve verplaatsing. | |
| DE1018917B (de) * | 1952-11-08 | 1957-11-07 | Dr Oskar Vierling | Schaltungsanordnung fuer einen Kleinstverstaerker mit Kristalltrioden, insbesondere Germaniumtrioden |
| US2754455A (en) * | 1952-11-29 | 1956-07-10 | Rca Corp | Power Transistors |
| DE966276C (de) * | 1953-03-01 | 1957-07-18 | Siemens Ag | Halbleiteranordnung mit wenigstens zwei Steuerelektroden oder Steuerelektrodengruppenfuer elektronische Abtast- oder Schaltanordnungen |
| US2769926A (en) * | 1953-03-09 | 1956-11-06 | Gen Electric | Non-linear resistance device |
| US2849342A (en) * | 1953-03-17 | 1958-08-26 | Rca Corp | Semiconductor devices and method of making them |
| US2795744A (en) * | 1953-06-12 | 1957-06-11 | Bell Telephone Labor Inc | Semiconductor signal translating devices |
| US2907934A (en) * | 1953-08-12 | 1959-10-06 | Gen Electric | Non-linear resistance device |
| GB805292A (en) * | 1953-12-02 | 1958-12-03 | Philco Corp | Semiconductor devices |
| US2829992A (en) * | 1954-02-02 | 1958-04-08 | Hughes Aircraft Co | Fused junction semiconductor devices and method of making same |
| GB767311A (en) * | 1954-03-08 | 1957-01-30 | Gen Electric Co Ltd | Improvements in or relating to semiconductor devices |
| US2931958A (en) * | 1954-05-03 | 1960-04-05 | Nat Res Dev | Semi-conductor devices |
| US2805347A (en) * | 1954-05-27 | 1957-09-03 | Bell Telephone Labor Inc | Semiconductive devices |
| US2802117A (en) * | 1954-05-27 | 1957-08-06 | Gen Electric | Semi-conductor network |
| BE539001A (en:Method) * | 1954-06-15 | |||
| US2780752A (en) * | 1954-06-16 | 1957-02-05 | Gen Electric | Semi-conductor network |
| US2770761A (en) * | 1954-12-16 | 1956-11-13 | Bell Telephone Labor Inc | Semiconductor translators containing enclosed active junctions |
| US2937289A (en) * | 1954-09-03 | 1960-05-17 | Gen Electric | Digital to analogue converter |
| US2926296A (en) * | 1954-10-27 | 1960-02-23 | Honeywell Regulator Co | Transistor inverter |
| US2894152A (en) * | 1955-05-16 | 1959-07-07 | Ibm | Crystal diode with improved recovery time |
| DE1039649C2 (de) * | 1956-02-13 | 1959-03-19 | Siemens Ag | Fadenhalbleiteranordnung mit zwei sperrfreien Basiselektroden verschiedenen Potentials und mindestens einer als Emitter dienenden sperrenden Elektrode |
| US2863070A (en) * | 1956-03-21 | 1958-12-02 | Gen Electric | Double-base diode gated amplifier |
| DE1045550B (de) * | 1956-09-03 | 1958-12-04 | Siemens Ag | Fadenhalbleiteranordnung mit zwei sperrfreien Basiselektroden und mindestens einer Emitterelektrode mit stetiger oder stufenweiser Zunahme der Feldstaerke |
| US2913541A (en) * | 1956-11-20 | 1959-11-17 | Gen Electric | Semiconductor wave filter |
| BE572049A (en:Method) * | 1957-12-03 | 1900-01-01 | ||
| US3022472A (en) * | 1958-01-22 | 1962-02-20 | Bell Telephone Labor Inc | Variable equalizer employing semiconductive element |
| US3025342A (en) * | 1958-08-04 | 1962-03-13 | Gen Dynamics Corp | System for generating waveforms utilizing drift of carriers |
| NL245195A (en:Method) * | 1958-12-11 | |||
| US3138721A (en) * | 1959-05-06 | 1964-06-23 | Texas Instruments Inc | Miniature semiconductor network diode and gate |
| US2989713A (en) * | 1959-05-11 | 1961-06-20 | Bell Telephone Labor Inc | Semiconductor resistance element |
| US3230428A (en) * | 1960-05-02 | 1966-01-18 | Texas Instruments Inc | Field-effect transistor configuration |
| NL130953C (en:Method) * | 1960-09-15 | |||
| US3260900A (en) * | 1961-04-27 | 1966-07-12 | Merck & Co Inc | Temperature compensating barrier layer semiconductor |
| BE624959A (en:Method) * | 1961-11-20 | |||
| FR1376515A (fr) * | 1963-05-14 | 1964-10-31 | Comp Generale Electricite | Dispositif de blocage-déblocage à fonctionnement symétrique |
| DE1245425B (de) * | 1965-06-23 | 1967-07-27 | Telefunken Patent | Elektromechanischer Wandler mit mechanisch empfindlichem Halbleiterbauelement |
| US20050205891A1 (en) * | 2004-03-18 | 2005-09-22 | Holm-Kennedy James W | Distributed channel bipolar devices and architectures |
| WO2012003506A2 (en) | 2010-07-02 | 2012-01-05 | Nuvotronics, Llc | Three-dimensional microstructures |
| US9065163B1 (en) | 2011-12-23 | 2015-06-23 | Nuvotronics, Llc | High frequency power combiner/divider |
| US8952752B1 (en) | 2012-12-12 | 2015-02-10 | Nuvotronics, Llc | Smart power combiner |
-
0
- BE BE490958D patent/BE490958A/xx unknown
- NL NL79529D patent/NL79529C/xx active
-
1948
- 1948-09-24 US US50897A patent/US2502479A/en not_active Expired - Lifetime
-
1949
- 1949-06-05 DE DEP44957A patent/DE890847C/de not_active Expired
- 1949-07-02 FR FR990032D patent/FR990032A/fr not_active Expired
- 1949-07-19 CH CH282857D patent/CH282857A/de unknown
- 1949-09-23 GB GB24486/49A patent/GB700236A/en not_active Expired
Non-Patent Citations (1)
| Title |
|---|
| None * |
Cited By (16)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1068384B (en:Method) * | 1959-11-05 | |||
| DE1067471B (de) * | 1953-12-31 | 1959-10-22 | Ibm Deutschland | Bistabile Verstaerkerschaltung mit einem Spitzentransistor, der eine gleichrichtende und eine nichtgleichrichtende Basiselektrode hat |
| DE1055692B (de) * | 1954-09-27 | 1959-04-23 | Ibm Deutschland | Transistor mit einem flachen Koerper aus halbleitendem Material mit mehreren sperrfreien und sperrenden Elektroden |
| DE1035776B (de) * | 1954-09-27 | 1958-08-07 | Ibm Deutschland | Transistor mit einem flachen Halbleiterkoerper und mehreren sperrfreien und sperrenden Elektroden |
| DE1035778B (de) * | 1955-05-20 | 1958-08-07 | Ibm Deutschland | Transistor mit einem Halbleitergrundkoerper von einem Leitungstypus und mit drei oder mehr pn-UEbergaengen und einer oder mehreren Spitzenelektroden |
| DE1035779B (de) * | 1955-05-25 | 1958-08-07 | Ibm Deutschland | Schalttransistor mit wenigstens zwei Kollektorelektroden |
| DE1042128B (de) * | 1955-11-12 | 1958-10-30 | Siemens Ag | Doppelbasistransistor zum Erzeugen von Schalt- oder Kippvorgaengen |
| DE1034775B (de) * | 1956-08-02 | 1958-07-24 | Stanislas Teszner | Unipolartransistor mit einer Einschnuerung im mittleren Teil des Halbleiterstabes |
| DE1094884B (de) * | 1956-12-13 | 1960-12-15 | Philips Nv | Feldeffekt-Transistor mit einem Halbleiterkoerper aus zwei Zonen entgegengesetzten Leitfaehigkeitstyps und einer Nut zwischen den zwei ohmschen Elektroden und Verfahren zu seiner Herstellung |
| DE1054584B (de) * | 1957-02-25 | 1959-04-09 | Deutsche Bundespost | Halbleiteranordnung zur wahlweisen Umschaltung eines Signals |
| DE1069784B (de) * | 1957-04-27 | 1960-04-21 | Süddeutsche Telefon-Apparate-, Kabel- und Drahtwerke A.G., TEKADE, Nürnberg | Verfahren zur Herstellung einer sperrschichtfreien Elektrode auf dem Halbleiterkörper aus Germanium einer Halbleiteranordnung |
| DE1063279B (de) * | 1957-05-31 | 1959-08-13 | Ibm Deutschland | Halbleiteranordnung aus einem Halbleiterkoerper mit flaechenhaftem innerem pn-UEbergang und mit mehr als drei Elektroden |
| DE1084382B (de) * | 1957-07-15 | 1960-06-30 | Raytheon Mfg Co | Halbleiteranordnung mit einem Halbleiterkoerper aus zwei Zonen entgegengesetzten Leitfaehigkeitstyps |
| DE1132662B (de) * | 1957-12-28 | 1962-07-05 | Suisse Horlogerie | Flaechentransistor mit zwei ohmschen Steuerelektroden fuer den Emitter-Kollektor-Strom an der Basiszone |
| DE1098613B (de) * | 1958-05-15 | 1961-02-02 | Gen Electric | Thyratronaehnliche Halbleiteranordnung mit einem in Flussrichtung vorgespannten einkristallinen pin-Halbleiterkoerper |
| DE1197987B (de) * | 1960-01-26 | 1965-08-05 | Fuji Electric Co Ltd | Halbleiterbauelement mit Feldsteuerung fuer Schaltzwecke und Betriebsschaltungen |
Also Published As
| Publication number | Publication date |
|---|---|
| FR990032A (fr) | 1951-09-17 |
| BE490958A (en:Method) | |
| US2502479A (en) | 1950-04-04 |
| CH282857A (de) | 1952-05-15 |
| NL79529C (en:Method) | |
| GB700236A (en) | 1953-11-25 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE890847C (de) | Halbleiter-UEbertragungsvorrichtung | |
| DE966492C (de) | Elektrisch steuerbares Schaltelement aus Halbleitermaterial | |
| DE1024119B (de) | Bistabile Gedaechtniseinrichtung mit einem halbleitenden Koerper | |
| DE889809C (de) | Halbleiter-Signaluebertragungseinrichtung | |
| CH222371A (de) | Elektrische Entladungsröhre. | |
| DE1045548B (de) | Verfahren zur Herstellung eines elektrischen Halbleiterkristallgleichrichters mit negativen Widerstandseigenschaften, insbesondere zur Erzeugung von Schwingungen | |
| DE1162488B (de) | Halbleiterbauelement mit zwei Elektroden an einer Zone und Verfahren zum Betrieb | |
| DE943964C (de) | Halbleiter-Signaluebertragungseinrichtung | |
| DE965726C (de) | Wanderfeldroehre | |
| DE1212221B (de) | Halbleiterbauelement mit einem scheibenfoermigen Halbleiterkoerper und zwei sperrfreien Basiselektroden | |
| DE2458735C2 (de) | Transistor mit einem hohen Stromverstärkungsfaktor bei kleinen Kollektorströmen | |
| DE1591085C3 (de) | Halbleiterbauelement zur Schwingungserzeugung | |
| DE2209979C3 (de) | Halbleiterbauelement | |
| DE2528351C3 (de) | Wanderfeldröhre | |
| DE1171992C2 (de) | Transistor mit Dotierung der Basiszone | |
| DE1936746A1 (de) | Halbleiterresonanzkreis | |
| DE2355427C3 (de) | Vorrichtung zur Verstärkung elektrischer Wellen | |
| DE2108180C3 (de) | Schaltung zum Betrieb eines richtungs abhangigen Laufwellenverstarkers und Laufwellenverstarker fur diese Schaltung | |
| DE1944147A1 (de) | Halbleiterbauelement zur Verstaerkung von Mikrowellen | |
| DE2157129A1 (de) | Einstellbare Verzögerungsleitung für elektrische Hochfrequenzwellen | |
| DE2555881C3 (de) | Ladungsgekoppeltes Halbleiterbauelement | |
| DE1616292A1 (de) | Gunn-Effekt Vorrichtung | |
| DE1216356B (de) | Selbsthaltender Magnetkernschalter | |
| DE1215815B (de) | Mikrominiaturisierte elektronische Schaltungsanordnung | |
| DE1954451C3 (de) | Strahlerzeugersystem für Katodenstrahlröhren |