DE750047C - Sekundaeremissionsfaehige Elektrode - Google Patents
Sekundaeremissionsfaehige ElektrodeInfo
- Publication number
- DE750047C DE750047C DER101443D DER0101443D DE750047C DE 750047 C DE750047 C DE 750047C DE R101443 D DER101443 D DE R101443D DE R0101443 D DER0101443 D DE R0101443D DE 750047 C DE750047 C DE 750047C
- Authority
- DE
- Germany
- Prior art keywords
- layer
- borate
- alkaline earth
- electrode
- alkali metal
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- BTBUEUYNUDRHOZ-UHFFFAOYSA-N Borate Chemical compound [O-]B([O-])[O-] BTBUEUYNUDRHOZ-UHFFFAOYSA-N 0.000 claims description 13
- 150000001340 alkali metals Chemical class 0.000 claims description 7
- 239000011248 coating agent Substances 0.000 claims description 7
- 238000000576 coating method Methods 0.000 claims description 7
- 229910052783 alkali metal Inorganic materials 0.000 claims description 6
- 229910000272 alkali metal oxide Inorganic materials 0.000 claims description 6
- 239000010953 base metal Substances 0.000 claims description 3
- 150000001642 boronic acid derivatives Chemical class 0.000 claims description 3
- 239000000203 mixture Substances 0.000 claims description 3
- 238000010276 construction Methods 0.000 claims description 2
- 238000000034 method Methods 0.000 claims 1
- 239000010410 layer Substances 0.000 description 18
- 239000002585 base Substances 0.000 description 8
- 229910052792 caesium Inorganic materials 0.000 description 7
- TVFDJXOCXUVLDH-UHFFFAOYSA-N caesium atom Chemical compound [Cs] TVFDJXOCXUVLDH-UHFFFAOYSA-N 0.000 description 7
- 229910052751 metal Inorganic materials 0.000 description 5
- 239000002184 metal Substances 0.000 description 5
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 4
- 229910052782 aluminium Inorganic materials 0.000 description 4
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 4
- BQCADISMDOOEFD-UHFFFAOYSA-N Silver Chemical compound [Ag] BQCADISMDOOEFD-UHFFFAOYSA-N 0.000 description 3
- 238000010438 heat treatment Methods 0.000 description 3
- 229910052709 silver Inorganic materials 0.000 description 3
- 239000004332 silver Substances 0.000 description 3
- KOPBYBDAPCDYFK-UHFFFAOYSA-N caesium oxide Chemical compound [O-2].[Cs+].[Cs+] KOPBYBDAPCDYFK-UHFFFAOYSA-N 0.000 description 2
- 229910001942 caesium oxide Inorganic materials 0.000 description 2
- 229910052759 nickel Inorganic materials 0.000 description 2
- NDVLTYZPCACLMA-UHFFFAOYSA-N silver oxide Chemical compound [O-2].[Ag+].[Ag+] NDVLTYZPCACLMA-UHFFFAOYSA-N 0.000 description 2
- 239000000758 substrate Substances 0.000 description 2
- -1 B. cesium oxide Chemical class 0.000 description 1
- 101100004288 Caenorhabditis elegans best-9 gene Proteins 0.000 description 1
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 1
- MYMOFIZGZYHOMD-UHFFFAOYSA-N Dioxygen Chemical compound O=O MYMOFIZGZYHOMD-UHFFFAOYSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- 239000000956 alloy Substances 0.000 description 1
- 229910045601 alloy Inorganic materials 0.000 description 1
- 230000002547 anomalous effect Effects 0.000 description 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
- 229910052788 barium Inorganic materials 0.000 description 1
- DSAJWYNOEDNPEQ-UHFFFAOYSA-N barium atom Chemical compound [Ba] DSAJWYNOEDNPEQ-UHFFFAOYSA-N 0.000 description 1
- 238000006243 chemical reaction Methods 0.000 description 1
- 230000001427 coherent effect Effects 0.000 description 1
- 229910052802 copper Inorganic materials 0.000 description 1
- 239000010949 copper Substances 0.000 description 1
- 238000010894 electron beam technology Methods 0.000 description 1
- 230000002349 favourable effect Effects 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 230000003647 oxidation Effects 0.000 description 1
- 238000007254 oxidation reaction Methods 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- 239000001301 oxygen Substances 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 230000002787 reinforcement Effects 0.000 description 1
- 229910052701 rubidium Inorganic materials 0.000 description 1
- IGLNJRXAVVLDKE-UHFFFAOYSA-N rubidium atom Chemical compound [Rb] IGLNJRXAVVLDKE-UHFFFAOYSA-N 0.000 description 1
- 229910001923 silver oxide Inorganic materials 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 229910052712 strontium Inorganic materials 0.000 description 1
- CIOAGBVUUVVLOB-UHFFFAOYSA-N strontium atom Chemical compound [Sr] CIOAGBVUUVVLOB-UHFFFAOYSA-N 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 239000002344 surface layer Substances 0.000 description 1
- VLCLHFYFMCKBRP-UHFFFAOYSA-N tricalcium;diborate Chemical compound [Ca+2].[Ca+2].[Ca+2].[O-]B([O-])[O-].[O-]B([O-])[O-] VLCLHFYFMCKBRP-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- H—ELECTRICITY
- H01—ELECTRIC ELEMENTS
- H01J—ELECTRIC DISCHARGE TUBES OR DISCHARGE LAMPS
- H01J1/00—Details of electrodes, of magnetic control means, of screens, or of the mounting or spacing thereof, common to two or more basic types of discharge tubes or lamps
- H01J1/02—Main electrodes
- H01J1/32—Secondary-electron-emitting electrodes
Landscapes
- Discharge Lamp (AREA)
- Solid Thermionic Cathode (AREA)
- Gas-Filled Discharge Tubes (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US123203A US2147669A (en) | 1937-01-30 | 1937-01-30 | Secondary electron emitting electrode |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE750047C true DE750047C (de) | 1944-12-11 |
Family
ID=22407273
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DER101443D Expired DE750047C (de) | 1937-01-30 | 1938-02-01 | Sekundaeremissionsfaehige Elektrode |
Country Status (6)
| Country | Link |
|---|---|
| US (1) | US2147669A (enExample) |
| BE (1) | BE426040A (enExample) |
| CH (1) | CH204059A (enExample) |
| DE (1) | DE750047C (enExample) |
| GB (1) | GB491287A (enExample) |
| NL (1) | NL51148C (enExample) |
Families Citing this family (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2428289A (en) * | 1942-11-07 | 1947-09-30 | Charles Schiffman | Electron tube coating |
| US2443324A (en) * | 1942-11-07 | 1948-06-15 | Charles Schiffman | Electronic tube |
| US2527981A (en) * | 1945-08-23 | 1950-10-31 | Bramley Jenny | Secondary-electron emission |
| US2639963A (en) * | 1948-04-05 | 1953-05-26 | Sylvania Electric Prod | Secondary emitter and method of manufacture |
| US2530946A (en) * | 1949-04-02 | 1950-11-21 | Bell Telephone Labor Inc | Secondary electron emitter |
| US2846338A (en) * | 1954-08-03 | 1958-08-05 | William G Shepherd | Secondary electron emitter |
| US4047999A (en) * | 1974-09-19 | 1977-09-13 | Francis John Salgo | Method of making a mobile ion film memory |
Citations (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR666222A (fr) * | 1927-12-14 | 1929-09-28 | Thomson Houston Comp Francaise | Perfectionnements apportés aux tubes à décharge électronique |
| FR807669A (fr) * | 1935-06-25 | 1937-01-19 | Rca Corp | Amplificateurs émetteurs d'électrons secondaires en cascade |
-
0
- BE BE426040D patent/BE426040A/xx unknown
- NL NL51148D patent/NL51148C/xx active
-
1937
- 1937-01-30 US US123203A patent/US2147669A/en not_active Expired - Lifetime
-
1938
- 1938-01-07 GB GB578/38A patent/GB491287A/en not_active Expired
- 1938-01-28 CH CH204059D patent/CH204059A/de unknown
- 1938-02-01 DE DER101443D patent/DE750047C/de not_active Expired
Patent Citations (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR666222A (fr) * | 1927-12-14 | 1929-09-28 | Thomson Houston Comp Francaise | Perfectionnements apportés aux tubes à décharge électronique |
| FR807669A (fr) * | 1935-06-25 | 1937-01-19 | Rca Corp | Amplificateurs émetteurs d'électrons secondaires en cascade |
Also Published As
| Publication number | Publication date |
|---|---|
| CH204059A (de) | 1939-04-15 |
| GB491287A (en) | 1938-08-30 |
| US2147669A (en) | 1939-02-21 |
| BE426040A (enExample) | |
| NL51148C (enExample) |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE750047C (de) | Sekundaeremissionsfaehige Elektrode | |
| DE2326957C2 (de) | Alkalimetalldampfgenerator zur Herstellung von Oberflächen für Photoemission oder Sekundärelektronenemission | |
| DE2309530A1 (de) | Tafellichtstrahler | |
| DE2642763C2 (de) | Pyroelektrisches Vidikon | |
| DE803919C (de) | Verfahren zur Herstellung einer Kathode einer elektrischen Entladungsroehre | |
| DE864133C (de) | Elektronenoptischer Bildverstaerker | |
| DE565464C (de) | Elektrische Entladungsroehre | |
| DE934002C (de) | Strahlenaustrittsfenster fuer Roentgenroehren, Elektronenroehren und andere elektrische Entladungsgefaesse | |
| AT151600B (de) | Photoelektrische Zelle. | |
| DE744768C (de) | Verfahren zum Aufdampfen von Metallen auf mehrere im gleichen Gefaess befindliche, verschieden zu behandelnde Photo- und/oder Sekundaeremissionselektroden und Anordnung zu seiner Durchfuehrung | |
| DE1035795B (de) | Sekundaeremissionselektrode und Verfahren zu ihrer Herstellung | |
| DE756219C (de) | Elektrische Entladungsroehre mit einer an der Oberflaeche eine sekundaeremittierendeSchicht aufweisenden Elektrode | |
| DE1094375B (de) | Vorratskathode fuer Kathodenstrahlroehren, bei welcher der aktive Stoff aus einer geschlossenen Kammer durch die Poren eines Sinterkoerpers an die Kathodenoberflaeche gelangt | |
| CH155923A (de) | Photoelektrische Zelle. | |
| DE656524C (de) | Photoelektrische Zelle mit aeusserem lichtelektrischem Effekt | |
| DE1564532B2 (de) | Photoelektrische Rohre und Verfahren zur Herstellung derselben | |
| DE737996C (de) | Elektrische Entladungsroehre mit einem eine Sekundaeremissionselektrode enthaltenden Elektrodensystem | |
| DE763972C (de) | Lichtempfindliche Schicht, welche nach dem im Patent 713401 beschriebenen Verfahren hergestellt wird | |
| DE750000C (de) | Verfahren zur Herstellung einer Schicht von hoher Sekundaeremissionsfaehigkeit | |
| DE512263C (de) | Verfahren zur Herstellung von Kathoden fuer Elektronenroehren | |
| DE1193567B (de) | Thermionischer Wandler | |
| AT143754B (de) | Elektrische Entladungsröhre mit einer Kathode und einem oder mehreren Gitten. | |
| DE908889C (de) | Elektronenroehre | |
| AT146436B (de) | Fluoreszenzschirm. | |
| DE1115851B (de) | In eine Vakuumroehre eingeschlossenes elektronenoptisches Abbildungssystem |