DE7304244U - Thermostatische mischarmatur - Google Patents
Thermostatische mischarmaturInfo
- Publication number
- DE7304244U DE7304244U DE19737304244U DE7304244U DE7304244U DE 7304244 U DE7304244 U DE 7304244U DE 19737304244 U DE19737304244 U DE 19737304244U DE 7304244 U DE7304244 U DE 7304244U DE 7304244 U DE7304244 U DE 7304244U
- Authority
- DE
- Germany
- Prior art keywords
- bowl
- passages
- hot
- cold
- fixed body
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 44
- 230000001105 regulatory effect Effects 0.000 claims description 7
- 238000006073 displacement reaction Methods 0.000 claims description 5
- 238000004891 communication Methods 0.000 claims description 3
- 238000000926 separation method Methods 0.000 claims description 3
- 238000009826 distribution Methods 0.000 claims description 2
- IJJWOSAXNHWBPR-HUBLWGQQSA-N 5-[(3as,4s,6ar)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]-n-(6-hydrazinyl-6-oxohexyl)pentanamide Chemical compound N1C(=O)N[C@@H]2[C@H](CCCCC(=O)NCCCCCC(=O)NN)SC[C@@H]21 IJJWOSAXNHWBPR-HUBLWGQQSA-N 0.000 claims 1
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical group [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 claims 1
- 238000003825 pressing Methods 0.000 description 6
- 238000009434 installation Methods 0.000 description 3
- 238000004519 manufacturing process Methods 0.000 description 3
- 238000005266 casting Methods 0.000 description 2
- 238000000034 method Methods 0.000 description 2
- 238000012545 processing Methods 0.000 description 2
- 125000006850 spacer group Chemical group 0.000 description 2
- 206010006895 Cachexia Diseases 0.000 description 1
- 238000009412 basement excavation Methods 0.000 description 1
- 230000001276 controlling effect Effects 0.000 description 1
- 238000004512 die casting Methods 0.000 description 1
- 239000012535 impurity Substances 0.000 description 1
- 238000009776 industrial production Methods 0.000 description 1
- 239000000203 mixture Substances 0.000 description 1
- 230000000149 penetrating effect Effects 0.000 description 1
- 238000012805 post-processing Methods 0.000 description 1
- 230000008439 repair process Effects 0.000 description 1
- 238000007789 sealing Methods 0.000 description 1
- 230000035939 shock Effects 0.000 description 1
- 238000004513 sizing Methods 0.000 description 1
- 208000016318 wasting Diseases 0.000 description 1
Classifications
-
- G—PHYSICS
- G05—CONTROLLING; REGULATING
- G05D—SYSTEMS FOR CONTROLLING OR REGULATING NON-ELECTRIC VARIABLES
- G05D23/00—Control of temperature
- G05D23/01—Control of temperature without auxiliary power
- G05D23/13—Control of temperature without auxiliary power by varying the mixing ratio of two fluids having different temperatures
- G05D23/1306—Control of temperature without auxiliary power by varying the mixing ratio of two fluids having different temperatures for liquids
- G05D23/132—Control of temperature without auxiliary power by varying the mixing ratio of two fluids having different temperatures for liquids with temperature sensing element
- G05D23/134—Control of temperature without auxiliary power by varying the mixing ratio of two fluids having different temperatures for liquids with temperature sensing element measuring the temperature of mixed fluid
- G05D23/1346—Control of temperature without auxiliary power by varying the mixing ratio of two fluids having different temperatures for liquids with temperature sensing element measuring the temperature of mixed fluid with manual temperature setting means
- G05D23/1353—Control of temperature without auxiliary power by varying the mixing ratio of two fluids having different temperatures for liquids with temperature sensing element measuring the temperature of mixed fluid with manual temperature setting means combined with flow controlling means
Landscapes
- Physics & Mathematics (AREA)
- General Physics & Mathematics (AREA)
- Engineering & Computer Science (AREA)
- Automation & Control Theory (AREA)
- Temperature-Responsive Valves (AREA)
- Multiple-Way Valves (AREA)
- Domestic Plumbing Installations (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| IT67630/72A IT949212B (it) | 1972-02-29 | 1972-02-29 | Rubinetto miscelatore termostatico |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE7304244U true DE7304244U (de) | 1973-09-20 |
Family
ID=11304039
Family Applications (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19737304244U Expired DE7304244U (de) | 1972-02-29 | 1973-02-03 | Thermostatische mischarmatur |
| DE2305409A Withdrawn DE2305409A1 (de) | 1972-02-29 | 1973-02-03 | Thermostatische mischarmatur |
Family Applications After (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2305409A Withdrawn DE2305409A1 (de) | 1972-02-29 | 1973-02-03 | Thermostatische mischarmatur |
Country Status (14)
| Country | Link |
|---|---|
| US (1) | US3792812A (enExample) |
| AT (1) | AT325529B (enExample) |
| BE (1) | BE795982A (enExample) |
| CA (1) | CA975728A (enExample) |
| CH (1) | CH550953A (enExample) |
| DE (2) | DE7304244U (enExample) |
| DK (1) | DK143509C (enExample) |
| ES (1) | ES188759Y (enExample) |
| FR (1) | FR2174135B1 (enExample) |
| GB (1) | GB1388372A (enExample) |
| IT (1) | IT949212B (enExample) |
| NL (1) | NL7301492A (enExample) |
| NO (1) | NO135952C (enExample) |
| SE (1) | SE391793B (enExample) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2802803A1 (de) * | 1977-02-18 | 1978-08-24 | Lins Albert | Mischventilvorrichtung fuer kaltes und warmes wasser |
Families Citing this family (31)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB1441242A (en) * | 1972-11-10 | 1976-06-30 | Barking Brassware | Fluid mixing valves |
| GB1441243A (en) * | 1973-01-15 | 1976-06-30 | Barking Brassware | Mixer valves |
| IT999835B (it) * | 1973-11-28 | 1976-03-10 | Knapp Alfons | Dispositivo miscelatore termostati co perfezionato per impianti idrau lici |
| DE2614790A1 (de) * | 1976-04-06 | 1977-10-13 | Scheffer Kludi Armaturen | Badezimmermischbatterie mit thermostatischer temperaturregelung |
| US4185771A (en) * | 1977-02-18 | 1980-01-29 | Albert Lins | Water mixing valve with temperature regulation, temperature setting and volume control |
| DE7724834U1 (de) * | 1977-08-10 | 1977-11-17 | Braukmann Armaturen Ag, Rothrist (Schweiz) | Mischvorrichtung fuer kalt- und warmwasser, |
| SE422491B (sv) * | 1978-03-03 | 1982-03-08 | Vaergaarda Armaturfab Ab | Termostatstyrd blandare for tva vetskor |
| US4249695A (en) * | 1979-12-12 | 1981-02-10 | Emerson Electric Co. (H & H Prod. Div) | Thermally actuated modulating valve, and assemblies and systems utilizing the same for providing temperature controlled heated water |
| US4311271A (en) * | 1980-05-29 | 1982-01-19 | Naqvi Zargham H | Controller for maintaining a constant temperature of discharged liquid |
| DE3037674A1 (de) * | 1980-10-04 | 1982-05-13 | Wabco Steuerungstechnik GmbH & Co, 3000 Hannover | Anordnung und ausbildung von durchlaessen fuer druckmittel in zylindern |
| US4607788A (en) * | 1982-05-26 | 1986-08-26 | Meynell Valves Limited | Mixing valve |
| DK424782A (da) * | 1982-05-26 | 1983-11-27 | Meynell Valves | Termostatisk blandeventil |
| JPS59164470A (ja) * | 1983-03-04 | 1984-09-17 | Kitamura Gokin Seisakusho:Kk | サ−モスタツト式の湯水混合栓 |
| US4915295A (en) * | 1985-08-07 | 1990-04-10 | Masco Corporation Of Indiana | Thermostatic pressure balanced valve assembly |
| US4905732A (en) * | 1985-08-07 | 1990-03-06 | Masco Corporation Of Indiana | Modular pressure balanced valve assembly |
| DE3600130A1 (de) * | 1986-01-04 | 1987-07-09 | Danfoss As | Armatur fuer ein thermostatventil |
| FR2602502B1 (fr) * | 1986-08-11 | 1989-07-28 | Trubert Ets Rene | Perfectionnements aux dispositifs melangeurs thermostatiques, en particulier pour la distribution d'eau |
| SE507634C2 (sv) * | 1991-03-14 | 1998-06-29 | Masco Corp | Termostatiskt kontrollerade blandningsventil, speciellt av engreppstyp |
| US5356074A (en) * | 1993-11-05 | 1994-10-18 | Jacob Delafon | Thermostatic mixing device |
| TW407714U (en) * | 1994-12-21 | 2000-10-01 | Ntc Industry Co Ltd | Automatic mixing faucet |
| DE19711760C1 (de) * | 1997-03-21 | 1998-10-01 | Honeywell Ag | Thermostatischer Wassermischer |
| EP0947902A3 (en) * | 1998-04-04 | 2000-07-05 | Bristan Limited | Improvements in or relating to fluid flow control |
| US6079625A (en) * | 1998-09-04 | 2000-06-27 | Honeywell International, Inc. | Thermostatic mixing valve |
| ITMI20020430A1 (it) | 2002-03-01 | 2003-09-01 | O M B G S R L | Dispositivo termostatico per la miscelazione automatica di acqua calda e acqua fredda particolarmente per componenti igienico-sanitari |
| ITBS20020118U1 (it) * | 2002-11-07 | 2004-05-08 | Zipponi Rubinetterie Di Nember Oscar | Valvola miscelatrice termostatica allestita con corpo a cartuccia |
| US7744007B2 (en) * | 2004-11-01 | 2010-06-29 | Honeywell International Inc. | Thermostatic mixing valves and systems |
| US8733666B2 (en) * | 2008-11-18 | 2014-05-27 | Honeywell International Inc. | Thermostatic mixing valve with tamper resistant adjustment feature |
| US8074894B2 (en) * | 2008-11-18 | 2011-12-13 | Honeywell International Inc. | Secondary mixing valve hot port |
| US20110089249A1 (en) * | 2009-10-21 | 2011-04-21 | Honeywell International Inc. | Thermostatic mixing valve with pressure reducing element |
| IT1399765B1 (it) * | 2010-05-04 | 2013-05-03 | Garef Di Bacchetta Roger | Valvola termostatica con bilanciatore di pressione migliorata |
| DE102013019744B4 (de) * | 2013-11-27 | 2024-09-12 | Grohe Ag | Thermostatkartusche mit Drosselelement |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3036777A (en) * | 1956-09-27 | 1962-05-29 | American Radiator & Standard | Adjustable thermal mixing valve |
| GB1095924A (en) * | 1965-08-24 | 1967-12-20 | Richard Harding | Improvements in or relating to thermally controlled mixing valves |
-
1972
- 1972-02-29 IT IT67630/72A patent/IT949212B/it active
-
1973
- 1973-01-31 CH CH139273A patent/CH550953A/it not_active IP Right Cessation
- 1973-02-02 NL NL7301492A patent/NL7301492A/xx unknown
- 1973-02-03 DE DE19737304244U patent/DE7304244U/de not_active Expired
- 1973-02-03 DE DE2305409A patent/DE2305409A1/de not_active Withdrawn
- 1973-02-06 US US00330037A patent/US3792812A/en not_active Expired - Lifetime
- 1973-02-07 GB GB590773A patent/GB1388372A/en not_active Expired
- 1973-02-08 CA CA163,188A patent/CA975728A/en not_active Expired
- 1973-02-15 ES ES1973188759U patent/ES188759Y/es not_active Expired
- 1973-02-15 SE SE7302116A patent/SE391793B/xx unknown
- 1973-02-21 DK DK91373A patent/DK143509C/da active
- 1973-02-26 AT AT168173A patent/AT325529B/de not_active IP Right Cessation
- 1973-02-27 NO NO788/73A patent/NO135952C/no unknown
- 1973-02-27 BE BE2052555A patent/BE795982A/xx unknown
- 1973-02-28 FR FR7307061A patent/FR2174135B1/fr not_active Expired
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2802803A1 (de) * | 1977-02-18 | 1978-08-24 | Lins Albert | Mischventilvorrichtung fuer kaltes und warmes wasser |
Also Published As
| Publication number | Publication date |
|---|---|
| SE391793B (sv) | 1977-02-28 |
| ES188759U (es) | 1974-02-16 |
| NO135952C (enExample) | 1977-06-29 |
| DE2305409A1 (de) | 1973-09-20 |
| NO135952B (enExample) | 1977-03-21 |
| DK143509C (da) | 1982-02-22 |
| CH550953A (it) | 1974-06-28 |
| IT949212B (it) | 1973-06-11 |
| NL7301492A (enExample) | 1973-08-31 |
| DK143509B (da) | 1981-08-31 |
| BE795982A (fr) | 1973-06-18 |
| GB1388372A (en) | 1975-03-26 |
| CA975728A (en) | 1975-10-07 |
| FR2174135B1 (enExample) | 1978-09-29 |
| US3792812A (en) | 1974-02-19 |
| ES188759Y (es) | 1974-09-16 |
| FR2174135A1 (enExample) | 1973-10-12 |
| AT325529B (de) | 1975-10-27 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE7304244U (de) | Thermostatische mischarmatur | |
| DE2439583C3 (de) | Schieber für hohe Drucke | |
| DE2305458A1 (de) | Thermostatische mischvorrichtung fuer hydraulische anlagen | |
| DE69215661T2 (de) | Mischventil-regeleinheit | |
| DE112014001168T5 (de) | Thermostatkartusche für die Regulierung von zu mischendem warmen und kalten Fluid | |
| DE4308994C1 (de) | Sanitäres Mischventil | |
| DE69419222T2 (de) | Mischbatterie | |
| DE69609580T2 (de) | Nicht verkalkender Thermostatmischer | |
| DE1600946A1 (de) | Eingriffsmischbatterie | |
| DE102015221504A1 (de) | Mischbatterie zum Mischen von zwei Wasserströmen unterschiedlicher Temperatur | |
| DE102005023757B4 (de) | Mischbatterie für Kalt- und Heißwasser | |
| DE2517355C2 (de) | Thermostatisch gesteuerte Mischbatterie für sanitäre Anlagen | |
| DE1923453C3 (de) | Wasserleitungsventil | |
| DE69311043T2 (de) | Zusammengesetztes Gehäuse für Sanitärventile | |
| DE202017002477U1 (de) | Druckausgleichsregler | |
| DE2509754C2 (de) | Armatur für Heißwasserbereiter | |
| DE2516359A1 (de) | Mischeinheit zum regeln der temperatur des wasserflusses | |
| EP3822420B1 (de) | Wasserhahn mit mischbatterie und anschlusssystem,zur verwendung als hochdruck- oder niederdruckarmatur | |
| DE2155452A1 (de) | Regelventil | |
| DE2212956C3 (de) | Mischventil zum Steuern des Mischungsverhältnisses und der Durchflußmenge einer Flüssigkeit | |
| DE2841206A1 (de) | Thermostatventil | |
| DE202017001847U1 (de) | Druckausgleichsregler | |
| DE2225743C3 (de) | Mischbatterie für Warm- und Kaltwasser | |
| DE3319118A1 (de) | Mischventil | |
| DE2946357A1 (de) | Regelarmatur fuer einrohrheizungen |