DE69808771T2 - Ein verfahren zur herstellung von tetraaza makrocyclen - Google Patents
Ein verfahren zur herstellung von tetraaza makrocyclenInfo
- Publication number
- DE69808771T2 DE69808771T2 DE69808771T DE69808771T DE69808771T2 DE 69808771 T2 DE69808771 T2 DE 69808771T2 DE 69808771 T DE69808771 T DE 69808771T DE 69808771 T DE69808771 T DE 69808771T DE 69808771 T2 DE69808771 T2 DE 69808771T2
- Authority
- DE
- Germany
- Prior art keywords
- process according
- acid
- formula
- group
- compound
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired - Lifetime
Links
- 238000004519 manufacturing process Methods 0.000 title description 4
- 150000001875 compounds Chemical class 0.000 claims abstract description 69
- 238000000034 method Methods 0.000 claims abstract description 49
- 238000002360 preparation method Methods 0.000 claims abstract description 32
- 239000002168 alkylating agent Substances 0.000 claims description 31
- 229940100198 alkylating agent Drugs 0.000 claims description 31
- -1 phenylene, phenyleneoxy Chemical group 0.000 claims description 21
- 238000006243 chemical reaction Methods 0.000 claims description 20
- 238000005804 alkylation reaction Methods 0.000 claims description 15
- 239000002253 acid Substances 0.000 claims description 14
- 239000007864 aqueous solution Substances 0.000 claims description 13
- 229910052736 halogen Inorganic materials 0.000 claims description 12
- 150000002367 halogens Chemical group 0.000 claims description 11
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 claims description 10
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 10
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 claims description 9
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 claims description 9
- MONMFXREYOKQTI-UHFFFAOYSA-N 2-bromopropanoic acid Chemical compound CC(Br)C(O)=O MONMFXREYOKQTI-UHFFFAOYSA-N 0.000 claims description 8
- WBJINCZRORDGAQ-UHFFFAOYSA-N ethyl formate Chemical compound CCOC=O WBJINCZRORDGAQ-UHFFFAOYSA-N 0.000 claims description 8
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 8
- 239000003153 chemical reaction reagent Substances 0.000 claims description 7
- 230000007062 hydrolysis Effects 0.000 claims description 7
- 238000006460 hydrolysis reaction Methods 0.000 claims description 7
- 125000004430 oxygen atom Chemical group O* 0.000 claims description 7
- 125000004169 (C1-C6) alkyl group Chemical group 0.000 claims description 6
- SPSJFVXUOKRIGT-UHFFFAOYSA-N 2-[7-(carboxymethyl)-1,4,7,10-tetrazacyclododec-1-yl]acetic acid Chemical compound OC(=O)CN1CCNCCN(CC(O)=O)CCNCC1 SPSJFVXUOKRIGT-UHFFFAOYSA-N 0.000 claims description 6
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 claims description 6
- WDLRUFUQRNWCPK-UHFFFAOYSA-N Tetraxetan Chemical class OC(=O)CN1CCN(CC(O)=O)CCN(CC(O)=O)CCN(CC(O)=O)CC1 WDLRUFUQRNWCPK-UHFFFAOYSA-N 0.000 claims description 6
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 claims description 6
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 6
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 claims description 6
- 239000000758 substrate Substances 0.000 claims description 6
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical class [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 claims description 5
- 125000004185 ester group Chemical group 0.000 claims description 5
- 235000011121 sodium hydroxide Nutrition 0.000 claims description 5
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 claims description 4
- 150000001242 acetic acid derivatives Chemical class 0.000 claims description 4
- 239000003513 alkali Substances 0.000 claims description 4
- 229910001854 alkali hydroxide Inorganic materials 0.000 claims description 4
- 229910001860 alkaline earth metal hydroxide Inorganic materials 0.000 claims description 4
- 125000000217 alkyl group Chemical group 0.000 claims description 4
- 229910052794 bromium Inorganic materials 0.000 claims description 4
- 238000010438 heat treatment Methods 0.000 claims description 4
- 229910052740 iodine Inorganic materials 0.000 claims description 4
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 claims description 4
- 125000002827 triflate group Chemical group FC(S(=O)(=O)O*)(F)F 0.000 claims description 4
- 125000003837 (C1-C20) alkyl group Chemical group 0.000 claims description 3
- YAQLSKVCTLCIIE-UHFFFAOYSA-N 2-bromobutyric acid Chemical compound CCC(Br)C(O)=O YAQLSKVCTLCIIE-UHFFFAOYSA-N 0.000 claims description 3
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 claims description 3
- FXHOOIRPVKKKFG-UHFFFAOYSA-N N,N-Dimethylacetamide Chemical compound CN(C)C(C)=O FXHOOIRPVKKKFG-UHFFFAOYSA-N 0.000 claims description 3
- 125000002252 acyl group Chemical group 0.000 claims description 3
- 125000004442 acylamino group Chemical group 0.000 claims description 3
- 125000003545 alkoxy group Chemical group 0.000 claims description 3
- 125000004453 alkoxycarbonyl group Chemical group 0.000 claims description 3
- 230000029936 alkylation Effects 0.000 claims description 3
- 125000004397 aminosulfonyl group Chemical group NS(=O)(=O)* 0.000 claims description 3
- 125000003118 aryl group Chemical group 0.000 claims description 3
- 229910052801 chlorine Inorganic materials 0.000 claims description 3
- 125000004122 cyclic group Chemical group 0.000 claims description 3
- 150000005690 diesters Chemical class 0.000 claims description 3
- 150000002148 esters Chemical class 0.000 claims description 3
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 3
- 125000002768 hydroxyalkyl group Chemical group 0.000 claims description 3
- KBWIIBVKXVUCIV-UHFFFAOYSA-N methyl 2-bromo-3-phenylmethoxypropanoate Chemical compound COC(=O)C(Br)COCC1=CC=CC=C1 KBWIIBVKXVUCIV-UHFFFAOYSA-N 0.000 claims description 3
- 235000011118 potassium hydroxide Nutrition 0.000 claims description 3
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 3
- 125000005490 tosylate group Chemical group 0.000 claims description 3
- 125000004178 (C1-C4) alkyl group Chemical group 0.000 claims description 2
- SECXISVLQFMRJM-UHFFFAOYSA-N N-Methylpyrrolidone Chemical compound CN1CCCC1=O SECXISVLQFMRJM-UHFFFAOYSA-N 0.000 claims description 2
- 230000002152 alkylating effect Effects 0.000 claims description 2
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 2
- 239000007810 chemical reaction solvent Substances 0.000 claims description 2
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 claims description 2
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 2
- 229910052708 sodium Inorganic materials 0.000 claims description 2
- 239000011734 sodium Substances 0.000 claims description 2
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 claims description 2
- IMFACGCPASFAPR-UHFFFAOYSA-N tributylamine Chemical compound CCCCN(CCCC)CCCC IMFACGCPASFAPR-UHFFFAOYSA-N 0.000 claims description 2
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 claims 3
- UAOMVDZJSHZZME-UHFFFAOYSA-N diisopropylamine Chemical compound CC(C)NC(C)C UAOMVDZJSHZZME-UHFFFAOYSA-N 0.000 claims 3
- XQHJYKMAQDGRIW-UHFFFAOYSA-N 2-(benzenesulfonyloxy)-4-(benzenesulfonyloxymethyl)-3-nitrobenzenesulfonic acid Chemical compound C1=CC=C(C=C1)S(=O)(=O)OCC2=C(C(=C(C=C2)S(=O)(=O)O)OS(=O)(=O)C3=CC=CC=C3)[N+](=O)[O-] XQHJYKMAQDGRIW-UHFFFAOYSA-N 0.000 claims 1
- XBDQKXXYIPTUBI-UHFFFAOYSA-N Propionic acid Chemical compound CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 claims 1
- 150000001649 bromium compounds Chemical group 0.000 claims 1
- 229940043279 diisopropylamine Drugs 0.000 claims 1
- 125000000542 sulfonic acid group Chemical group 0.000 claims 1
- 239000000047 product Substances 0.000 description 20
- 150000002678 macrocyclic compounds Chemical class 0.000 description 11
- HEMHJVSKTPXQMS-UHFFFAOYSA-M sodium hydroxide Inorganic materials [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 11
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 10
- QBPPRVHXOZRESW-UHFFFAOYSA-N 1,4,7,10-tetraazacyclododecane Chemical compound C1CNCCNCCNCCN1 QBPPRVHXOZRESW-UHFFFAOYSA-N 0.000 description 9
- 238000001644 13C nuclear magnetic resonance spectroscopy Methods 0.000 description 8
- 238000005160 1H NMR spectroscopy Methods 0.000 description 8
- 238000001228 spectrum Methods 0.000 description 8
- 238000003786 synthesis reaction Methods 0.000 description 8
- 230000015572 biosynthetic process Effects 0.000 description 7
- 239000000243 solution Substances 0.000 description 7
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 6
- JGFZNNIVVJXRND-UHFFFAOYSA-N N,N-Diisopropylethylamine (DIPEA) Chemical compound CCN(C(C)C)C(C)C JGFZNNIVVJXRND-UHFFFAOYSA-N 0.000 description 6
- 239000000203 mixture Substances 0.000 description 5
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 4
- 239000002872 contrast media Substances 0.000 description 4
- 238000004128 high performance liquid chromatography Methods 0.000 description 4
- 238000002595 magnetic resonance imaging Methods 0.000 description 4
- 230000009257 reactivity Effects 0.000 description 4
- 239000007787 solid Substances 0.000 description 4
- 239000000543 intermediate Substances 0.000 description 3
- 239000011347 resin Substances 0.000 description 3
- 229920005989 resin Polymers 0.000 description 3
- VKJQJNVYWGDEQN-UHFFFAOYSA-N 2-bromo-3-phenylmethoxypropanoic acid Chemical compound OC(=O)C(Br)COCC1=CC=CC=C1 VKJQJNVYWGDEQN-UHFFFAOYSA-N 0.000 description 2
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 2
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- 238000010828 elution Methods 0.000 description 2
- RYHQMKVRYNEBNJ-BMWGJIJESA-K gadoterate meglumine Chemical compound [Gd+3].CNC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO.OC(=O)CN1CCN(CC([O-])=O)CCN(CC([O-])=O)CCN(CC([O-])=O)CC1 RYHQMKVRYNEBNJ-BMWGJIJESA-K 0.000 description 2
- 238000005342 ion exchange Methods 0.000 description 2
- 229910021645 metal ion Inorganic materials 0.000 description 2
- 230000020477 pH reduction Effects 0.000 description 2
- 230000005298 paramagnetic effect Effects 0.000 description 2
- 150000003839 salts Chemical class 0.000 description 2
- 239000007858 starting material Substances 0.000 description 2
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 2
- VILCJCGEZXAXTO-UHFFFAOYSA-N 2,2,2-tetramine Chemical compound NCCNCCNCCN VILCJCGEZXAXTO-UHFFFAOYSA-N 0.000 description 1
- QEYBMJSQGBIRHS-UHFFFAOYSA-N 2-chloro-3-phenylmethoxypropanoic acid Chemical compound OC(=O)C(Cl)COCC1=CC=CC=C1 QEYBMJSQGBIRHS-UHFFFAOYSA-N 0.000 description 1
- OZGUGVRKYBSDBN-UHFFFAOYSA-N 3-phenylmethoxypropanoic acid Chemical class OC(=O)CCOCC1=CC=CC=C1 OZGUGVRKYBSDBN-UHFFFAOYSA-N 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-M Bisulfite Chemical group OS([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-M 0.000 description 1
- 229910021592 Copper(II) chloride Inorganic materials 0.000 description 1
- 229910052688 Gadolinium Inorganic materials 0.000 description 1
- 238000010268 HPLC based assay Methods 0.000 description 1
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 1
- LFVGISIMTYGQHF-UHFFFAOYSA-N ammonium dihydrogen phosphate Chemical compound [NH4+].OP(O)([O-])=O LFVGISIMTYGQHF-UHFFFAOYSA-N 0.000 description 1
- 150000001449 anionic compounds Chemical class 0.000 description 1
- 238000013459 approach Methods 0.000 description 1
- 239000000010 aprotic solvent Substances 0.000 description 1
- 239000008346 aqueous phase Substances 0.000 description 1
- 239000012298 atmosphere Substances 0.000 description 1
- 239000003637 basic solution Substances 0.000 description 1
- 239000002738 chelating agent Substances 0.000 description 1
- 150000001805 chlorine compounds Chemical class 0.000 description 1
- YSPZOYMEWUTYDA-UHFFFAOYSA-N cis-glyoxal-cyclen Chemical group C1CN2CCN(CC3)C2C2N3CCN21 YSPZOYMEWUTYDA-UHFFFAOYSA-N 0.000 description 1
- 238000010668 complexation reaction Methods 0.000 description 1
- ORTQZVOHEJQUHG-UHFFFAOYSA-L copper(II) chloride Chemical compound Cl[Cu]Cl ORTQZVOHEJQUHG-UHFFFAOYSA-L 0.000 description 1
- 239000012043 crude product Substances 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- 239000008367 deionised water Substances 0.000 description 1
- 229910021641 deionized water Inorganic materials 0.000 description 1
- 238000001514 detection method Methods 0.000 description 1
- 238000003745 diagnosis Methods 0.000 description 1
- 239000003480 eluent Substances 0.000 description 1
- 230000007613 environmental effect Effects 0.000 description 1
- UIWYJDYFSGRHKR-UHFFFAOYSA-N gadolinium atom Chemical compound [Gd] UIWYJDYFSGRHKR-UHFFFAOYSA-N 0.000 description 1
- XLYOFNOQVPJJNP-ZSJDYOACSA-N heavy water Substances [2H]O[2H] XLYOFNOQVPJJNP-ZSJDYOACSA-N 0.000 description 1
- 230000003301 hydrolyzing effect Effects 0.000 description 1
- 229910001412 inorganic anion Inorganic materials 0.000 description 1
- 229960003194 meglumine Drugs 0.000 description 1
- NIQQIJXGUZVEBB-UHFFFAOYSA-N methanol;propan-2-one Chemical compound OC.CC(C)=O NIQQIJXGUZVEBB-UHFFFAOYSA-N 0.000 description 1
- 150000007530 organic bases Chemical class 0.000 description 1
- 230000001590 oxidative effect Effects 0.000 description 1
- 239000012071 phase Substances 0.000 description 1
- 235000011007 phosphoric acid Nutrition 0.000 description 1
- 125000003367 polycyclic group Chemical group 0.000 description 1
- 229920000642 polymer Polymers 0.000 description 1
- 239000002243 precursor Substances 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 125000002088 tosyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1C([H])([H])[H])S(*)(=O)=O 0.000 description 1
- 230000009466 transformation Effects 0.000 description 1
- 239000002699 waste material Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D257/00—Heterocyclic compounds containing rings having four nitrogen atoms as the only ring hetero atoms
- C07D257/02—Heterocyclic compounds containing rings having four nitrogen atoms as the only ring hetero atoms not condensed with other rings
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
- Nitrogen And Oxygen Or Sulfur-Condensed Heterocyclic Ring Systems (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
- Cephalosporin Compounds (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| IT97MI001765A IT1293777B1 (it) | 1997-07-25 | 1997-07-25 | Processo per la preparazione di tetraazamacrocicli |
| PCT/EP1998/004385 WO1999005128A1 (en) | 1997-07-25 | 1998-07-15 | A process for the preparation of tetraazamacrocycles |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE69808771D1 DE69808771D1 (de) | 2002-11-21 |
| DE69808771T2 true DE69808771T2 (de) | 2003-07-24 |
Family
ID=11377625
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE69808771T Expired - Lifetime DE69808771T2 (de) | 1997-07-25 | 1998-07-15 | Ein verfahren zur herstellung von tetraaza makrocyclen |
Country Status (10)
| Country | Link |
|---|---|
| US (1) | US5922862A (enExample) |
| EP (1) | EP0998466B1 (enExample) |
| JP (1) | JP4563517B2 (enExample) |
| AT (1) | ATE226198T1 (enExample) |
| AU (1) | AU8631698A (enExample) |
| DE (1) | DE69808771T2 (enExample) |
| ES (1) | ES2185196T3 (enExample) |
| IN (1) | IN187760B (enExample) |
| IT (1) | IT1293777B1 (enExample) |
| WO (1) | WO1999005128A1 (enExample) |
Families Citing this family (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| IT1297035B1 (it) | 1997-12-30 | 1999-08-03 | Bracco Spa | Derivati dell'acido 1,4,7,10-tetraazaciclododecan-1,4-diacetico |
| DE10135356C1 (de) * | 2001-07-20 | 2003-04-17 | Schering Ag | Makrocyclische Metallkomplexe und deren Verwendung zur Herstellung von Konjugaten mit Biomolekülen |
| KR100757977B1 (ko) * | 2001-09-29 | 2007-09-11 | 다이킨 고교 가부시키가이샤 | 모터제어방법 및 이들의 장치 |
| JP5032926B2 (ja) * | 2007-09-14 | 2012-09-26 | パナソニック株式会社 | 有機el点灯装置及び照明器具 |
| US8865129B2 (en) * | 2011-05-05 | 2014-10-21 | New York University | Lanthanoid complex capsule and particle contrast agents, methods of making and using thereof |
| WO2013076743A2 (en) * | 2011-11-25 | 2013-05-30 | Biophore India Pharmaceuticals Pvt. Ltd. | Process for the purification of polyaminocarboxylates |
| US9458117B2 (en) | 2013-01-28 | 2016-10-04 | Agfa Healthcare Nv | Process for producing 1,4,7,10-tetraazacyclododecane-1,4,7,10-tetraacetic acid and complexes thereof |
| CN105939994B (zh) * | 2014-02-06 | 2018-05-29 | T2医药有限责任公司 | 纯化1,4,7,10-四氮杂环十二烷-1,4,7,10-四乙酸的方法 |
| CN108264491B (zh) * | 2016-12-30 | 2022-09-16 | 威智医药有限公司 | 1,4,7,10-四氮杂环十二烷-1,4,7,10-四乙酸的制备方法 |
| CN115916761B (zh) | 2020-06-10 | 2025-08-12 | 贾斯特萨影象独资有限公司 | 利用高纯度四西坦(dota)制取钆特酸葡甲胺的方法及其在制备可注射盖仑制剂中的应用 |
Family Cites Families (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US5316757A (en) * | 1984-10-18 | 1994-05-31 | Board Of Regents, The University Of Texas System | Synthesis of polyazamacrocycles with more than one type of side-chain chelating groups |
| DE3772785D1 (de) * | 1986-01-23 | 1991-10-17 | Squibb & Sons Inc | 1-substituiertes-4,7,10-triscarboxymethyl-1,4,7,10-tetraazacyclododecan und analoga. |
| IT1224416B (it) * | 1987-12-24 | 1990-10-04 | Bracco Ind Chimica Spa | Chelanti macrociclici e loro chelati |
| US5756065A (en) * | 1988-06-24 | 1998-05-26 | The Dow Chemical Company | Macrocyclic tetraazacyclododecane conjugates and their use as diagnostic and therapeutic agents |
| DE4318369C1 (de) * | 1993-05-28 | 1995-02-09 | Schering Ag | Verwendung von makrocyclischen Metallkomplexen als Temperatursonden |
| EP0730616B1 (en) * | 1993-11-26 | 2003-02-05 | Dow Global Technologies Inc. | Process for preparing polyazamacrocycles |
| GB9504922D0 (en) * | 1995-03-10 | 1995-04-26 | Nycomed As | Process |
| IT1284046B1 (it) * | 1996-06-21 | 1998-05-08 | Bracco Spa | Processo per la preparazione di tetraazamacrocicli |
-
1997
- 1997-07-25 IT IT97MI001765A patent/IT1293777B1/it active IP Right Grant
-
1998
- 1998-07-15 JP JP50926299A patent/JP4563517B2/ja not_active Expired - Lifetime
- 1998-07-15 WO PCT/EP1998/004385 patent/WO1999005128A1/en not_active Ceased
- 1998-07-15 EP EP98937571A patent/EP0998466B1/en not_active Expired - Lifetime
- 1998-07-15 DE DE69808771T patent/DE69808771T2/de not_active Expired - Lifetime
- 1998-07-15 AU AU86316/98A patent/AU8631698A/en not_active Abandoned
- 1998-07-15 AT AT98937571T patent/ATE226198T1/de not_active IP Right Cessation
- 1998-07-15 ES ES98937571T patent/ES2185196T3/es not_active Expired - Lifetime
- 1998-07-23 IN IN1645MA1998 patent/IN187760B/en unknown
- 1998-07-23 US US09/121,674 patent/US5922862A/en not_active Expired - Lifetime
Also Published As
| Publication number | Publication date |
|---|---|
| ES2185196T3 (es) | 2003-04-16 |
| ATE226198T1 (de) | 2002-11-15 |
| IT1293777B1 (it) | 1999-03-10 |
| WO1999005128A1 (en) | 1999-02-04 |
| IN187760B (enExample) | 2002-06-15 |
| DE69808771D1 (de) | 2002-11-21 |
| EP0998466A1 (en) | 2000-05-10 |
| JP4563517B2 (ja) | 2010-10-13 |
| AU8631698A (en) | 1999-02-16 |
| JP2002509546A (ja) | 2002-03-26 |
| US5922862A (en) | 1999-07-13 |
| EP0998466B1 (en) | 2002-10-16 |
| ITMI971765A1 (it) | 1999-01-25 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US5880281A (en) | Process for the preparation of tetraazamacrocycles | |
| DE69823662T2 (de) | 1,4,7,10-tetraazabicyclo(8.2.2)tetradecan-2-on, verfahren zu ihrer herstellung und ihrer verwendung für die herstellung von tetraazamacrocyclen | |
| DE2258278C2 (de) | Verfahren zur Herstellung von Cephalosporin- und Penicillinderivaten | |
| DE2451480C2 (enExample) | ||
| DE69808771T2 (de) | Ein verfahren zur herstellung von tetraaza makrocyclen | |
| DE69909611T2 (de) | Reagenz zum nachweis von singulett-sauerstoff | |
| DE69808086T2 (de) | Ein verfahren zur herstellung von 1,4,7,10-tetraazacyclododecan-1,4,7-triessigsäure und deren derivaten | |
| DE69830931T2 (de) | Verfahren zur Herstellung von 1,4,7,10-Tetraazadodecan-1,4-Diessigsäurederivaten | |
| DE2147023A1 (de) | Verfahren zur herstellung von 1htetrazol-verbindungen | |
| DE2141616C3 (de) | Oxazole- und Oxazine eckige Klammer auf 3,2-c eckige Klammer zu chinazolinone, Verfahren zu ihrer Herstellung und diese Verbindungen enthaltende Arzneimittel | |
| CH660483A5 (de) | Verfahren zur herstellung von cimetidin und seiner n-benzylderivate. | |
| DE69837219T2 (de) | 1,4,7,10-tetraazacyclododecan-1,4-diessigsäure | |
| DE2841644C2 (enExample) | ||
| EP1007507B1 (de) | Verfahren zur herstellung von 2-cyanoindan-1-onen | |
| EP0063349B1 (de) | 5-Acyloxy-4 (5H)-oxazolonium-Salze, Verfahren zu ihrer Herstellung und ihre Verwendung als Zwischenprodukte zur Synthese von herbizid wirksamen Triazinonen | |
| DE69427978T2 (de) | Zwischenprodukt zur verwendung in der synthese und verfahren zur herstellung eines aminopiperazinderivates | |
| DE60014330T2 (de) | Verfahren zur herstellung von 1,4,7,10-tetraazacyclododecan | |
| AT382875B (de) | Verfahren zur herstellung neuer cephalosporanderivate | |
| DE69913133T2 (de) | Verfahren zur herstellung von aceclofenac | |
| CH621336A5 (enExample) | ||
| DE2340409C2 (enExample) | ||
| DE3231449A1 (de) | Imidazolderivate und verfahren zu ihrer herstellung | |
| DE69111340T2 (de) | Mono-N,N-dimethyl-4-aminopyridinium sn Glycerol-3-phosphat, seine Herstellung und Verwendung bei der Herstellung von Phosphatidsäuren. | |
| DE69703716T2 (de) | Aromatische Verbindung und seine pharmazeutische Zusammensetzung | |
| EP0033476B1 (de) | Verfahren zur Herstellung von 4-Amino-6-tert.-butyl-3-methylthio-1,2,4-triazin-5(4H)-on |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8364 | No opposition during term of opposition |