DE4110800C1 - - Google Patents
Info
- Publication number
- DE4110800C1 DE4110800C1 DE4110800A DE4110800A DE4110800C1 DE 4110800 C1 DE4110800 C1 DE 4110800C1 DE 4110800 A DE4110800 A DE 4110800A DE 4110800 A DE4110800 A DE 4110800A DE 4110800 C1 DE4110800 C1 DE 4110800C1
- Authority
- DE
- Germany
- Prior art keywords
- spring
- longitudinal
- longitudinal web
- leaf
- contact springs
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired - Lifetime
Links
- 238000003780 insertion Methods 0.000 claims description 13
- 230000037431 insertion Effects 0.000 claims description 13
- 210000000078 claw Anatomy 0.000 claims description 9
- 230000000712 assembly Effects 0.000 description 7
- 238000000429 assembly Methods 0.000 description 7
- 238000007789 sealing Methods 0.000 description 5
- 229910052782 aluminium Inorganic materials 0.000 description 3
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 3
- 229910052751 metal Inorganic materials 0.000 description 3
- 239000002184 metal Substances 0.000 description 3
- 229910000831 Steel Inorganic materials 0.000 description 1
- METKIMKYRPQLGS-UHFFFAOYSA-N atenolol Chemical compound CC(C)NCC(O)COC1=CC=C(CC(N)=O)C=C1 METKIMKYRPQLGS-UHFFFAOYSA-N 0.000 description 1
- 238000005452 bending Methods 0.000 description 1
- 230000009286 beneficial effect Effects 0.000 description 1
- 238000004140 cleaning Methods 0.000 description 1
- 230000001427 coherent effect Effects 0.000 description 1
- 239000004020 conductor Substances 0.000 description 1
- 238000010276 construction Methods 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 238000001125 extrusion Methods 0.000 description 1
- 238000009434 installation Methods 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 238000003825 pressing Methods 0.000 description 1
- 108090000623 proteins and genes Proteins 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 239000007779 soft material Substances 0.000 description 1
- 238000003892 spreading Methods 0.000 description 1
- 239000010959 steel Substances 0.000 description 1
- 210000002105 tongue Anatomy 0.000 description 1
Classifications
-
- H—ELECTRICITY
- H05—ELECTRIC TECHNIQUES NOT OTHERWISE PROVIDED FOR
- H05K—PRINTED CIRCUITS; CASINGS OR CONSTRUCTIONAL DETAILS OF ELECTRIC APPARATUS; MANUFACTURE OF ASSEMBLAGES OF ELECTRICAL COMPONENTS
- H05K9/00—Screening of apparatus or components against electric or magnetic fields
- H05K9/0007—Casings
- H05K9/0015—Gaskets or seals
- H05K9/0016—Gaskets or seals having a spring contact
Landscapes
- Engineering & Computer Science (AREA)
- Microelectronics & Electronic Packaging (AREA)
- Shielding Devices Or Components To Electric Or Magnetic Fields (AREA)
- Mounting Of Printed Circuit Boards And The Like (AREA)
- Casings For Electric Apparatus (AREA)
Priority Applications (5)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE4110800A DE4110800C1 (enExample) | 1991-04-04 | 1991-04-04 | |
| GB9206642A GB2254490B (en) | 1991-04-04 | 1992-03-26 | Insert assembly for HF-impermeable housings of electronic equipment |
| US07/861,581 US5233507A (en) | 1991-04-04 | 1992-04-01 | Modular unit for insertion into hf-tight housings for electronic equipment |
| FR9204116A FR2675005B1 (fr) | 1991-04-04 | 1992-04-03 | Sous-ensemble a glisser en place dans des boitiers, impermeables aux hautes frequences, d'appareils electroniques. |
| JP4109067A JPH0697716B2 (ja) | 1991-04-04 | 1992-04-03 | 電子装置を高周波遮蔽ハウジングに差込むための組立体 |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE4110800A DE4110800C1 (enExample) | 1991-04-04 | 1991-04-04 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE4110800C1 true DE4110800C1 (enExample) | 1992-07-23 |
Family
ID=6428755
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE4110800A Expired - Lifetime DE4110800C1 (enExample) | 1991-04-04 | 1991-04-04 |
Country Status (5)
| Country | Link |
|---|---|
| US (1) | US5233507A (enExample) |
| JP (1) | JPH0697716B2 (enExample) |
| DE (1) | DE4110800C1 (enExample) |
| FR (1) | FR2675005B1 (enExample) |
| GB (1) | GB2254490B (enExample) |
Cited By (22)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR2693871A1 (fr) * | 1992-07-16 | 1994-01-21 | Schroff Gmbh | Porte-ensembles blindé vis-à-vis des hautes fréquences. |
| DE4311246C1 (de) * | 1993-04-06 | 1994-03-31 | Schroff Gmbh | Gehäuse für elektronische Geräte |
| DE9402714U1 (de) | 1993-08-30 | 1994-04-14 | Elma Electronic Ag, Wetzikon | Baugruppenträger mit Profilleisten und mit Deckplatten |
| DE4237447A1 (de) * | 1992-11-06 | 1994-05-11 | Licentia Gmbh | Baugruppenträger |
| DE29509102U1 (de) * | 1995-06-01 | 1996-07-04 | Siemens AG, 80333 München | Kontaktfederleiste zum Aufstecken auf Halteleisten, insbesondere an den Frontplatten der Baugruppen von abgeschirmten Baugruppenträgern |
| DE19544835C1 (de) * | 1995-12-01 | 1996-10-31 | Schroff Gmbh | Bauteil für HF-dichte Behältnisse |
| DE19546932C1 (de) * | 1995-12-15 | 1997-01-30 | Inovan Stroebe | Kontaktfeder zum Herstellen einer Hochfrequenz-Dichtigkeit |
| DE29604600U1 (de) * | 1996-03-12 | 1997-04-10 | Siemens AG, 80333 München | Abdeckvorrichtung mit niedriger Bauhöhe für elektromagnetisch abgeschirmte metallische Gehäuse |
| DE29610694U1 (de) * | 1996-06-18 | 1997-07-17 | Siemens AG, 80333 München | Baugruppenträger mit Mitteln zur Ableitung elektrostatischer Spannungen bei einsteckbaren Baugruppen |
| WO1997026690A1 (de) * | 1996-01-17 | 1997-07-24 | Rittal-Werk Rudolf Loh Gmbh & Co. Kg | Vorrichtung zum elektrisch leitenden verbinden einer in einem schaltschrank eingebauten montageplatte |
| WO1997026689A1 (de) * | 1996-01-18 | 1997-07-24 | Rittal-Werk Rudolf Loh Gmbh & Co. Kg | Vorrichtung zum elektrisch leitenden verbinden des rahmengestells oder des schrankkorpus eines schaltschrankes mit der türe |
| DE19644414C1 (de) * | 1996-10-25 | 1997-08-28 | Schroff Gmbh | Abgeschirmter Baugruppenträger |
| DE19644420C1 (de) * | 1996-10-25 | 1997-08-28 | Schroff Gmbh | Baugruppenträger |
| DE19611719A1 (de) * | 1996-03-25 | 1997-10-02 | Polyrack Elektronik Aufbausyst | Kontaktanordnung zum Herstellen einer Hochfrequenz-Dichtigkeit |
| DE29713620U1 (de) * | 1997-07-31 | 1997-10-16 | Siemens AG, 80333 München | Kontaktelement zur Schirmübertragung |
| DE29619565U1 (de) * | 1996-11-11 | 1997-12-18 | Siemens AG, 80333 München | Baugruppenträger für Leiterplatten mit abgeschirmter Front- und Rückseite |
| EP0723389A3 (de) * | 1995-01-19 | 1998-04-01 | Siemens Nixdorf Informationssysteme AG | Anschlussvorrichtung für Standard-Flachbaugruppen |
| DE29817537U1 (de) * | 1998-10-01 | 1999-11-18 | Siemens AG, 80333 München | Kontaktfederleiste zum Aufstecken auf eine Halteleiste, und Kontaktteil mit Kontaktfederleiste und Halteleiste, insbesondere Frontplatte einer Flachbaugruppe |
| US6038139A (en) * | 1996-06-18 | 2000-03-14 | Siemens Aktiengesellschaft | Mounting rack for plug-in electrical printed circuit board assemblies having means for damped dissipation of electrostatic potentials |
| WO2000021349A1 (de) * | 1998-10-01 | 2000-04-13 | Rittal Electronic Systems Gmbh & Co. Kg | Kontaktfederleiste zum aufstecken auf eine halteleiste, und kontaktteil mit kontaktfederleiste und halteleiste, insbesondere frontplatte einer flachbaugruppe |
| DE19644418C5 (de) * | 1996-10-25 | 2004-10-28 | Schroff Gmbh | Baugruppenträger |
| DE102006026477A1 (de) * | 2006-06-07 | 2007-12-13 | Siemens Ag | Massekontaktelement |
Families Citing this family (38)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US5356306A (en) * | 1991-05-07 | 1994-10-18 | The Dow Chemical Company | Metal conductor element |
| US5334798A (en) * | 1993-01-08 | 1994-08-02 | Allied-Signal Inc. | Interconnect cable with built-in shielding and method of use |
| US5920984A (en) * | 1993-12-10 | 1999-07-13 | Ericsson Ge Mobile Communications Inc. | Method for the suppression of electromagnetic interference in an electronic system |
| SE503484C2 (sv) * | 1994-04-11 | 1996-06-24 | Ericsson Telefon Ab L M | Kontaktfjäder |
| SE502998C2 (sv) * | 1994-06-10 | 1996-03-11 | Ericsson Telefon Ab L M | Elektriskt kopplingsdon samt kretskort |
| US5513996A (en) * | 1994-09-20 | 1996-05-07 | Motorola, Inc. | Clip and method therefor |
| SE503467C2 (sv) * | 1994-12-14 | 1996-06-17 | Ericsson Telefon Ab L M | Jordnings- och skärmningsanordning |
| WO1997023124A1 (en) * | 1995-12-21 | 1997-06-26 | Langford, David | Apparatus for sealing electromagnetic emission |
| DE19601458A1 (de) * | 1996-01-17 | 1997-07-24 | Loh Kg Rittal Werk | Vorrichtung zum elektrisch leitenden Verbinden einer in einen Schaltschrank eingebauten Montageplatte |
| DE29604599U1 (de) * | 1996-03-12 | 1997-04-10 | Siemens AG, 80333 München | Elektromagnetisch abgeschirmtes Gehäuse mit über eine Kontaktfederleiste verrastbaren metallischen Gehäuseteilen |
| US5770822A (en) * | 1996-08-19 | 1998-06-23 | Silicon Graphics, Inc. | Bulkhead gasket assembly |
| US5796594A (en) * | 1997-04-01 | 1998-08-18 | Ag Communication Systems Corporation | Interlocking circuit card faceplate for reduced EMI emissions |
| US5952608A (en) * | 1997-08-11 | 1999-09-14 | Kim; Sun-Ki | Finger strip for shielding electromagnetic wave and front panel assembly mounting the same |
| FI973541L (fi) * | 1997-08-28 | 1999-03-01 | Nokia Telecommunications Oy | Häiriönsuojajousi elektronisen välineen sähkömagneettiseksi suojaamiseksi |
| GB2331404B (en) * | 1997-11-12 | 2002-05-22 | Vero Electronics Ltd | Electrical contacts for housings |
| US6390320B2 (en) * | 1998-04-29 | 2002-05-21 | Cisco Technology, Inc. | Easily installable and removable electro-magnetic interference shielding faceplate |
| US6395976B1 (en) * | 1998-08-31 | 2002-05-28 | 3Com Corporation | Apparatus and method for aligning a circuit board assembly in an electronic chassis |
| US6283770B1 (en) * | 1998-12-11 | 2001-09-04 | Cisco Technology, Incc. | Minimal intrusion EMI shielding clip to maintain electrical contact between two parallel surfaces |
| DE29906262U1 (de) * | 1999-04-08 | 1999-07-15 | Hermann Stahl GmbH, 71723 Großbottwar | Federelement |
| US6115263A (en) * | 1999-04-09 | 2000-09-05 | 3Com Corporation | Panel having fingers adapted to retain printed circuit board modular device carrier assembly |
| US6282101B1 (en) * | 1999-05-11 | 2001-08-28 | Lucent Technologies Inc. | EMI/ESD shielding assembly for an electronic system |
| US6229715B1 (en) * | 1999-11-15 | 2001-05-08 | Lucent Technologies, Inc. | Circuit card guide assembly |
| TW486043U (en) | 2000-11-16 | 2002-05-01 | Delta Electronics Inc | Fast removable fan shield and mounting plate |
| US6607308B2 (en) | 2001-02-12 | 2003-08-19 | E20 Communications, Inc. | Fiber-optic modules with shielded housing/covers having mixed finger types |
| US6659655B2 (en) | 2001-02-12 | 2003-12-09 | E20 Communications, Inc. | Fiber-optic modules with housing/shielding |
| US6478170B1 (en) * | 2001-06-08 | 2002-11-12 | Terraworx, Inc. | EMC sealed joint and a faceplate for use therewith |
| DE10137746C1 (de) * | 2001-08-01 | 2002-10-10 | Schroff Gmbh | Frontteil für elektronische Steckbaugruppen |
| US6676137B2 (en) * | 2002-02-27 | 2004-01-13 | Hewlett-Packard Development Company, L.P. | Snap-on EMI gasket clip and method of sealing a computer chassis from EMI |
| US7619169B1 (en) | 2003-08-08 | 2009-11-17 | Cisco Technologies, Inc. | Method and apparatus for reducing electromagnetic radiated emissions from a chassis |
| US7238893B2 (en) * | 2003-09-22 | 2007-07-03 | Hewlett-Packard Development Company, L.P. | Expandable electromagnetic interference (EMI) gasket mechanism |
| US7054166B1 (en) * | 2003-12-03 | 2006-05-30 | Unisys Corporation | Apparatus and method for EMI shielding |
| US20050148230A1 (en) * | 2004-01-07 | 2005-07-07 | Flynn James D. | Coupling device that includes opposing pawls engagable into opposing pawl catches |
| US7506768B2 (en) * | 2004-10-15 | 2009-03-24 | American Power Conversion Corporation | Blanking panel for equipment rack or enclosure |
| US20070052100A1 (en) * | 2005-09-07 | 2007-03-08 | Nokia Corporation | Spring clip for a portable electronic device |
| US7507120B1 (en) | 2007-11-29 | 2009-03-24 | Tyco Electronics Corporation | Shielding element for an electrical connector module assembly |
| US7946854B2 (en) | 2009-07-21 | 2011-05-24 | Tyco Electronics Corporation | Electrical connector assembly having shield member |
| JP5557764B2 (ja) * | 2011-02-02 | 2014-07-23 | 三菱電機株式会社 | 電磁シールド構造 |
| US10455744B2 (en) | 2016-07-31 | 2019-10-22 | Ilone Grinberg | Extendible barrier |
Citations (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2247005B2 (de) * | 1972-09-25 | 1976-03-18 | Siemens AG, 1000 Berlin und 8000 München | Gegen hochfrequente elektromagnetische stoerstrahlung abgeschirmtes gehaeuse fuer elektrische geraete |
| US4631641A (en) * | 1985-07-18 | 1986-12-23 | Northern Telecom Limited | Electronic apparatus with electro-magnetic interference screening |
| DE3523770A1 (de) * | 1985-07-03 | 1987-01-08 | Bosch Gmbh Robert | Hochfrequenzdichtes gehaeuse |
| DE3604860A1 (de) * | 1986-02-15 | 1987-08-20 | Licentia Gmbh | Anordnung zur hochfrequenzdichten abschirmung der frontplatte eines geraete-einschubs |
| DE8803544U1 (de) * | 1988-03-16 | 1988-07-07 | Standard Elektrik Lorenz Ag, 7000 Stuttgart | Baugruppenträger mit abgeschirmten Steckbaugruppen |
Family Cites Families (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE133555C (enExample) * | ||||
| US2844644A (en) * | 1956-12-20 | 1958-07-22 | Gen Electric | Detachable spring contact device |
| US3627900A (en) * | 1969-12-08 | 1971-12-14 | Cornell Dubilier Electric | Ground clamp |
| FR2589215B1 (fr) * | 1985-10-29 | 1989-05-05 | Thomson Csf | Joint electrique entre parois conductrices, orthogonales, independantes |
| GB8625648D0 (en) * | 1986-10-27 | 1986-11-26 | Gen Electric Co Plc | Housing arrangements |
| US4872212A (en) * | 1987-05-15 | 1989-10-03 | Eip Microwave, Inc. | Microwave main frame |
| US4866213A (en) * | 1988-02-08 | 1989-09-12 | Pawling Corporation | End clip for mesh-clad RFI/EMI shielding strips and shielding strip assembly including same |
| ES2051924T3 (es) * | 1989-06-09 | 1994-07-01 | Siemens Ag | Dispositivo de blindaje para un grupo constructivo electrico. |
| US5029254A (en) * | 1990-03-23 | 1991-07-02 | Instrument Specialties Company, Inc. | Clip mounted electromagnetic shielding device |
-
1991
- 1991-04-04 DE DE4110800A patent/DE4110800C1/de not_active Expired - Lifetime
-
1992
- 1992-03-26 GB GB9206642A patent/GB2254490B/en not_active Expired - Fee Related
- 1992-04-01 US US07/861,581 patent/US5233507A/en not_active Expired - Lifetime
- 1992-04-03 JP JP4109067A patent/JPH0697716B2/ja not_active Expired - Fee Related
- 1992-04-03 FR FR9204116A patent/FR2675005B1/fr not_active Expired - Fee Related
Patent Citations (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2247005B2 (de) * | 1972-09-25 | 1976-03-18 | Siemens AG, 1000 Berlin und 8000 München | Gegen hochfrequente elektromagnetische stoerstrahlung abgeschirmtes gehaeuse fuer elektrische geraete |
| DE3523770A1 (de) * | 1985-07-03 | 1987-01-08 | Bosch Gmbh Robert | Hochfrequenzdichtes gehaeuse |
| US4631641A (en) * | 1985-07-18 | 1986-12-23 | Northern Telecom Limited | Electronic apparatus with electro-magnetic interference screening |
| DE3604860A1 (de) * | 1986-02-15 | 1987-08-20 | Licentia Gmbh | Anordnung zur hochfrequenzdichten abschirmung der frontplatte eines geraete-einschubs |
| DE8803544U1 (de) * | 1988-03-16 | 1988-07-07 | Standard Elektrik Lorenz Ag, 7000 Stuttgart | Baugruppenträger mit abgeschirmten Steckbaugruppen |
Cited By (31)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR2693871A1 (fr) * | 1992-07-16 | 1994-01-21 | Schroff Gmbh | Porte-ensembles blindé vis-à-vis des hautes fréquences. |
| DE4237447A1 (de) * | 1992-11-06 | 1994-05-11 | Licentia Gmbh | Baugruppenträger |
| US5585599A (en) * | 1993-04-06 | 1996-12-17 | Schwenk; Hans-Martin | Housing for electronic devices |
| DE4311246C1 (de) * | 1993-04-06 | 1994-03-31 | Schroff Gmbh | Gehäuse für elektronische Geräte |
| FR2703873A1 (fr) * | 1993-04-06 | 1994-10-14 | Schroff Gmbh | Armoire pour appareils électroniques. |
| DE9402714U1 (de) | 1993-08-30 | 1994-04-14 | Elma Electronic Ag, Wetzikon | Baugruppenträger mit Profilleisten und mit Deckplatten |
| EP0723389A3 (de) * | 1995-01-19 | 1998-04-01 | Siemens Nixdorf Informationssysteme AG | Anschlussvorrichtung für Standard-Flachbaugruppen |
| US5885118A (en) * | 1995-06-01 | 1999-03-23 | Siemens Aktiengesellschaft | Contact spring strip for plugging onto holding strips, in particular at the front panel of modules in shielded module carriers |
| EP0746193A1 (de) * | 1995-06-01 | 1996-12-04 | Siemens Aktiengesellschaft | Kontaktfederleiste zum Aufstecken auf Halteleisten insbesondere an den Frontplatten der Baugruppen von abgeschirmten Baugruppenträgern |
| DE29509102U1 (de) * | 1995-06-01 | 1996-07-04 | Siemens AG, 80333 München | Kontaktfederleiste zum Aufstecken auf Halteleisten, insbesondere an den Frontplatten der Baugruppen von abgeschirmten Baugruppenträgern |
| DE19544835C1 (de) * | 1995-12-01 | 1996-10-31 | Schroff Gmbh | Bauteil für HF-dichte Behältnisse |
| DE19546932C1 (de) * | 1995-12-15 | 1997-01-30 | Inovan Stroebe | Kontaktfeder zum Herstellen einer Hochfrequenz-Dichtigkeit |
| WO1997026690A1 (de) * | 1996-01-17 | 1997-07-24 | Rittal-Werk Rudolf Loh Gmbh & Co. Kg | Vorrichtung zum elektrisch leitenden verbinden einer in einem schaltschrank eingebauten montageplatte |
| WO1997026689A1 (de) * | 1996-01-18 | 1997-07-24 | Rittal-Werk Rudolf Loh Gmbh & Co. Kg | Vorrichtung zum elektrisch leitenden verbinden des rahmengestells oder des schrankkorpus eines schaltschrankes mit der türe |
| DE29604600U1 (de) * | 1996-03-12 | 1997-04-10 | Siemens AG, 80333 München | Abdeckvorrichtung mit niedriger Bauhöhe für elektromagnetisch abgeschirmte metallische Gehäuse |
| DE19611719A1 (de) * | 1996-03-25 | 1997-10-02 | Polyrack Elektronik Aufbausyst | Kontaktanordnung zum Herstellen einer Hochfrequenz-Dichtigkeit |
| DE19611719C2 (de) * | 1996-03-25 | 1999-07-08 | Polyrack Elektronik Aufbausyst | Kontaktanordnung zum Herstellen einer Hochfrequenz-Dichtigkeit |
| DE29610694U1 (de) * | 1996-06-18 | 1997-07-17 | Siemens AG, 80333 München | Baugruppenträger mit Mitteln zur Ableitung elektrostatischer Spannungen bei einsteckbaren Baugruppen |
| US6038139A (en) * | 1996-06-18 | 2000-03-14 | Siemens Aktiengesellschaft | Mounting rack for plug-in electrical printed circuit board assemblies having means for damped dissipation of electrostatic potentials |
| US5930120A (en) * | 1996-10-25 | 1999-07-27 | Schroff Gmbh | Shielded module support structure |
| EP0838989A3 (de) * | 1996-10-25 | 1998-06-17 | Schroff GmbH | Abgeschirmter Baugruppenträger |
| DE19644420C1 (de) * | 1996-10-25 | 1997-08-28 | Schroff Gmbh | Baugruppenträger |
| DE19644414C1 (de) * | 1996-10-25 | 1997-08-28 | Schroff Gmbh | Abgeschirmter Baugruppenträger |
| DE19644418C5 (de) * | 1996-10-25 | 2004-10-28 | Schroff Gmbh | Baugruppenträger |
| DE29619565U1 (de) * | 1996-11-11 | 1997-12-18 | Siemens AG, 80333 München | Baugruppenträger für Leiterplatten mit abgeschirmter Front- und Rückseite |
| DE29713620U1 (de) * | 1997-07-31 | 1997-10-16 | Siemens AG, 80333 München | Kontaktelement zur Schirmübertragung |
| DE29817537U1 (de) * | 1998-10-01 | 1999-11-18 | Siemens AG, 80333 München | Kontaktfederleiste zum Aufstecken auf eine Halteleiste, und Kontaktteil mit Kontaktfederleiste und Halteleiste, insbesondere Frontplatte einer Flachbaugruppe |
| DE19846627C1 (de) * | 1998-10-01 | 2000-01-05 | Siemens Ag | Kontaktfederleiste zum Aufstecken auf eine Halteleiste |
| WO2000021349A1 (de) * | 1998-10-01 | 2000-04-13 | Rittal Electronic Systems Gmbh & Co. Kg | Kontaktfederleiste zum aufstecken auf eine halteleiste, und kontaktteil mit kontaktfederleiste und halteleiste, insbesondere frontplatte einer flachbaugruppe |
| US6500012B1 (en) | 1998-10-01 | 2002-12-31 | Rittal Electronic System Gmbh & Co. Kg | Contact spring strip for attaching to a holding strip and contact part with a contact spring strip and a holding strip, especially a front panel of a printed circuit module |
| DE102006026477A1 (de) * | 2006-06-07 | 2007-12-13 | Siemens Ag | Massekontaktelement |
Also Published As
| Publication number | Publication date |
|---|---|
| JPH05183287A (ja) | 1993-07-23 |
| GB9206642D0 (en) | 1992-05-06 |
| GB2254490A (en) | 1992-10-07 |
| FR2675005A1 (fr) | 1992-10-09 |
| US5233507A (en) | 1993-08-03 |
| FR2675005B1 (fr) | 1994-06-03 |
| GB2254490B (en) | 1994-10-26 |
| JPH0697716B2 (ja) | 1994-11-30 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE4110800C1 (enExample) | ||
| DE4223322C1 (enExample) | ||
| DE19544835C1 (de) | Bauteil für HF-dichte Behältnisse | |
| DE2732912A1 (de) | Elektrisches verbindungsteil | |
| DE4241876A1 (enExample) | ||
| DE1948925A1 (de) | Anordnung zum Verbinden von gedruckten Schaltungen | |
| EP0829191A1 (de) | Kontaktfederleiste zum aufstecken auf halteleisten insbesondere an den frontplatten der baugruppen von abgeschirmten baugruppenträgern | |
| EP0937317B1 (de) | Baugruppenträger für leiterplatten mit mittelquerschienen | |
| DE6607038U (de) | Anschlussanordnung fuer gedruckte schaltungsplatten | |
| DE19644420C1 (de) | Baugruppenträger | |
| DE9209519U1 (de) | HF-dichter Baugruppenträger | |
| DE8803544U1 (de) | Baugruppenträger mit abgeschirmten Steckbaugruppen | |
| DE19644417C1 (de) | Abgeschirmter Baugruppenträger | |
| DE19644414C1 (de) | Abgeschirmter Baugruppenträger | |
| EP0937375B1 (de) | Abgeschirmter baugruppenträger für elektrische flachbaugruppen | |
| EP0921594B1 (de) | Steckverbindungseinrichtung | |
| DE9104045U1 (de) | Baugruppe zum Einschub in HF-dichte Gehäuse elektronischer Geräte | |
| DE29618628U1 (de) | Abgeschirmter Baugruppenträger | |
| CH688907A5 (de) | Baugruppentraeger mit Profilleisten und mit Deckplatten. | |
| DE8205425U1 (de) | Kontaktvorrichtung zwischen gegeneinander beweglichen Gehäuseteilen von hochfrequenzdicht abgeschirmten Kabinen oder Räumen | |
| DE3231161C2 (enExample) | ||
| DE4336072C2 (de) | Baugruppenträger | |
| DE9010410U1 (de) | Baugruppenträger | |
| DE4241907A1 (enExample) | ||
| DE29618629U1 (de) | Baugruppenträger |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8100 | Publication of the examined application without publication of unexamined application | ||
| D1 | Grant (no unexamined application published) patent law 81 | ||
| 8364 | No opposition during term of opposition | ||
| 8327 | Change in the person/name/address of the patent owner |
Owner name: SCHROFF GMBH, 75334 STRAUBENHARDT, DE |
|
| 8339 | Ceased/non-payment of the annual fee |