DE3882732T2 - Indol, Benzofuran, Benzothiophen enthaltende, Lipoxygenase hemmende Verbindungen. - Google Patents
Indol, Benzofuran, Benzothiophen enthaltende, Lipoxygenase hemmende Verbindungen.Info
- Publication number
- DE3882732T2 DE3882732T2 DE88101386T DE3882732T DE3882732T2 DE 3882732 T2 DE3882732 T2 DE 3882732T2 DE 88101386 T DE88101386 T DE 88101386T DE 3882732 T DE3882732 T DE 3882732T DE 3882732 T2 DE3882732 T2 DE 3882732T2
- Authority
- DE
- Germany
- Prior art keywords
- hydroxy
- radical
- benzo
- thien
- alkyl
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired - Lifetime
Links
- 150000001875 compounds Chemical class 0.000 title claims description 85
- 230000002401 inhibitory effect Effects 0.000 title claims description 8
- FCEHBMOGCRZNNI-UHFFFAOYSA-N 1-benzothiophene Chemical compound C1=CC=C2SC=CC2=C1 FCEHBMOGCRZNNI-UHFFFAOYSA-N 0.000 title description 16
- 102000003820 Lipoxygenases Human genes 0.000 title description 9
- 108090000128 Lipoxygenases Proteins 0.000 title description 9
- SIKJAQJRHWYJAI-UHFFFAOYSA-N Indole Chemical compound C1=CC=C2NC=CC2=C1 SIKJAQJRHWYJAI-UHFFFAOYSA-N 0.000 title description 8
- PZOUSPYUWWUPPK-UHFFFAOYSA-N indole Natural products CC1=CC=CC2=C1C=CN2 PZOUSPYUWWUPPK-UHFFFAOYSA-N 0.000 title description 4
- RKJUIXBNRJVNHR-UHFFFAOYSA-N indolenine Natural products C1=CC=C2CC=NC2=C1 RKJUIXBNRJVNHR-UHFFFAOYSA-N 0.000 title description 4
- RFRXIWQYSOIBDI-UHFFFAOYSA-N benzarone Chemical compound CCC=1OC2=CC=CC=C2C=1C(=O)C1=CC=C(O)C=C1 RFRXIWQYSOIBDI-UHFFFAOYSA-N 0.000 title 1
- UUFQTNFCRMXOAE-UHFFFAOYSA-N 1-methylmethylene Chemical group C[CH] UUFQTNFCRMXOAE-UHFFFAOYSA-N 0.000 claims description 61
- 101100167062 Caenorhabditis elegans chch-3 gene Chemical group 0.000 claims description 61
- 239000001257 hydrogen Substances 0.000 claims description 21
- 229910052739 hydrogen Inorganic materials 0.000 claims description 21
- 125000000217 alkyl group Chemical group 0.000 claims description 19
- 125000004432 carbon atom Chemical group C* 0.000 claims description 18
- 238000011282 treatment Methods 0.000 claims description 15
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 14
- 102000001381 Arachidonate 5-Lipoxygenase Human genes 0.000 claims description 12
- 108010093579 Arachidonate 5-lipoxygenase Proteins 0.000 claims description 12
- 125000003545 alkoxy group Chemical group 0.000 claims description 10
- 229910052717 sulfur Inorganic materials 0.000 claims description 10
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical group [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims description 9
- 125000003118 aryl group Chemical group 0.000 claims description 9
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical group [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 9
- 239000001301 oxygen Substances 0.000 claims description 9
- 229910052760 oxygen Inorganic materials 0.000 claims description 9
- 239000011593 sulfur Chemical group 0.000 claims description 9
- 150000001768 cations Chemical class 0.000 claims description 8
- 150000002367 halogens Chemical class 0.000 claims description 8
- 125000003435 aroyl group Chemical group 0.000 claims description 7
- 229910052736 halogen Inorganic materials 0.000 claims description 7
- 230000005764 inhibitory process Effects 0.000 claims description 7
- 102000011730 Arachidonate 12-Lipoxygenase Human genes 0.000 claims description 6
- 108010076676 Arachidonate 12-lipoxygenase Proteins 0.000 claims description 6
- 125000003342 alkenyl group Chemical group 0.000 claims description 6
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 6
- 125000006539 C12 alkyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 claims description 5
- 201000004681 Psoriasis Diseases 0.000 claims description 5
- 208000006673 asthma Diseases 0.000 claims description 5
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 5
- 230000000694 effects Effects 0.000 claims description 5
- 150000002431 hydrogen Chemical group 0.000 claims description 5
- RAHZWNYVWXNFOC-UHFFFAOYSA-N Sulphur dioxide Chemical group O=S=O RAHZWNYVWXNFOC-UHFFFAOYSA-N 0.000 claims description 4
- QGZKDVFQNNGYKY-UHFFFAOYSA-O ammonium group Chemical group [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 claims description 4
- 206010039073 rheumatoid arthritis Diseases 0.000 claims description 4
- 125000001424 substituent group Chemical group 0.000 claims description 4
- 206010001052 Acute respiratory distress syndrome Diseases 0.000 claims description 3
- 208000011231 Crohn disease Diseases 0.000 claims description 3
- 206010014824 Endotoxic shock Diseases 0.000 claims description 3
- 201000005569 Gout Diseases 0.000 claims description 3
- 208000013616 Respiratory Distress Syndrome Diseases 0.000 claims description 3
- 206010039085 Rhinitis allergic Diseases 0.000 claims description 3
- 206010040070 Septic Shock Diseases 0.000 claims description 3
- 208000011341 adult acute respiratory distress syndrome Diseases 0.000 claims description 3
- 201000000028 adult respiratory distress syndrome Diseases 0.000 claims description 3
- 125000004390 alkyl sulfonyl group Chemical group 0.000 claims description 3
- 201000010105 allergic rhinitis Diseases 0.000 claims description 3
- 230000006931 brain damage Effects 0.000 claims description 3
- 231100000874 brain damage Toxicity 0.000 claims description 3
- 208000029028 brain injury Diseases 0.000 claims description 3
- 125000002837 carbocyclic group Chemical group 0.000 claims description 3
- 230000003683 cardiac damage Effects 0.000 claims description 3
- 239000003814 drug Substances 0.000 claims description 3
- 239000003937 drug carrier Substances 0.000 claims description 3
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 3
- 239000008194 pharmaceutical composition Substances 0.000 claims description 3
- 208000022559 Inflammatory bowel disease Diseases 0.000 claims description 2
- 125000004450 alkenylene group Chemical group 0.000 claims description 2
- 125000002947 alkylene group Chemical group 0.000 claims description 2
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 claims description 2
- 230000001575 pathological effect Effects 0.000 claims description 2
- 238000004519 manufacturing process Methods 0.000 claims 2
- 241000124008 Mammalia Species 0.000 claims 1
- IAZDPXIOMUYVGZ-WFGJKAKNSA-N Dimethyl sulfoxide Chemical compound [2H]C([2H])([2H])S(=O)C([2H])([2H])[2H] IAZDPXIOMUYVGZ-WFGJKAKNSA-N 0.000 description 102
- 238000000034 method Methods 0.000 description 90
- -1 superoxide ions Chemical class 0.000 description 76
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 57
- 238000002844 melting Methods 0.000 description 50
- 230000008018 melting Effects 0.000 description 50
- QGZKDVFQNNGYKY-UHFFFAOYSA-N ammonia Natural products N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 49
- 238000001819 mass spectrum Methods 0.000 description 49
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 48
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 48
- 229910000069 nitrogen hydride Inorganic materials 0.000 description 47
- 239000000203 mixture Substances 0.000 description 46
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 44
- 239000000243 solution Substances 0.000 description 42
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 40
- 239000000047 product Substances 0.000 description 39
- 239000000463 material Substances 0.000 description 36
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 24
- 238000004458 analytical method Methods 0.000 description 22
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 22
- 235000019341 magnesium sulphate Nutrition 0.000 description 22
- 239000002904 solvent Substances 0.000 description 22
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 21
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 20
- NIZHERJWXFHGGU-UHFFFAOYSA-N isocyanato(trimethyl)silane Chemical compound C[Si](C)(C)N=C=O NIZHERJWXFHGGU-UHFFFAOYSA-N 0.000 description 20
- SGSGCQGCVKWRNM-UHFFFAOYSA-N 1-(1-benzothiophen-2-yl)ethanone Chemical compound C1=CC=C2SC(C(=O)C)=CC2=C1 SGSGCQGCVKWRNM-UHFFFAOYSA-N 0.000 description 18
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 18
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 18
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 18
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 18
- 239000007787 solid Substances 0.000 description 18
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 15
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 15
- YZXBAPSDXZZRGB-DOFZRALJSA-N arachidonic acid Chemical compound CCCCC\C=C/C\C=C/C\C=C/C\C=C/CCCC(O)=O YZXBAPSDXZZRGB-DOFZRALJSA-N 0.000 description 14
- HAMGRBXTJNITHG-UHFFFAOYSA-N methyl isocyanate Chemical compound CN=C=O HAMGRBXTJNITHG-UHFFFAOYSA-N 0.000 description 13
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 12
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 12
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 12
- 239000004202 carbamide Substances 0.000 description 12
- 239000012074 organic phase Substances 0.000 description 12
- 239000011541 reaction mixture Substances 0.000 description 12
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 11
- 239000000741 silica gel Substances 0.000 description 11
- 229910002027 silica gel Inorganic materials 0.000 description 11
- AVXURJPOCDRRFD-UHFFFAOYSA-N Hydroxylamine Chemical compound ON AVXURJPOCDRRFD-UHFFFAOYSA-N 0.000 description 10
- MZRVEZGGRBJDDB-UHFFFAOYSA-N N-Butyllithium Chemical compound [Li]CCCC MZRVEZGGRBJDDB-UHFFFAOYSA-N 0.000 description 10
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical compound [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 9
- WMFOQBRAJBCJND-UHFFFAOYSA-M Lithium hydroxide Chemical compound [Li+].[OH-] WMFOQBRAJBCJND-UHFFFAOYSA-M 0.000 description 9
- WETWJCDKMRHUPV-UHFFFAOYSA-N acetyl chloride Chemical compound CC(Cl)=O WETWJCDKMRHUPV-UHFFFAOYSA-N 0.000 description 9
- 239000012346 acetyl chloride Substances 0.000 description 9
- 239000003921 oil Substances 0.000 description 9
- 238000010992 reflux Methods 0.000 description 9
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 8
- 230000015572 biosynthetic process Effects 0.000 description 8
- 201000010099 disease Diseases 0.000 description 8
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 8
- YPKATNMCYFSXKB-UHFFFAOYSA-N n-[1-(1-benzothiophen-2-yl)ethyl]hydroxylamine Chemical compound C1=CC=C2SC(C(NO)C)=CC2=C1 YPKATNMCYFSXKB-UHFFFAOYSA-N 0.000 description 8
- 150000003254 radicals Chemical class 0.000 description 8
- 239000000725 suspension Substances 0.000 description 8
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 8
- 125000000175 2-thienyl group Chemical group S1C([*])=C([H])C([H])=C1[H] 0.000 description 7
- FUGKCSRLAQKUHG-UHFFFAOYSA-N 5-chloro-2-hydroxybenzaldehyde Chemical compound OC1=CC=C(Cl)C=C1C=O FUGKCSRLAQKUHG-UHFFFAOYSA-N 0.000 description 7
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 7
- VSCWAEJMTAWNJL-UHFFFAOYSA-K aluminium trichloride Chemical compound Cl[Al](Cl)Cl VSCWAEJMTAWNJL-UHFFFAOYSA-K 0.000 description 7
- 229940114079 arachidonic acid Drugs 0.000 description 7
- 235000021342 arachidonic acid Nutrition 0.000 description 7
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 6
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 6
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 6
- 241000700159 Rattus Species 0.000 description 6
- 239000002671 adjuvant Substances 0.000 description 6
- 238000006243 chemical reaction Methods 0.000 description 6
- DNJIEGIFACGWOD-UHFFFAOYSA-N ethanethiol Chemical compound CCS DNJIEGIFACGWOD-UHFFFAOYSA-N 0.000 description 6
- 231100000252 nontoxic Toxicity 0.000 description 6
- 230000003000 nontoxic effect Effects 0.000 description 6
- 239000000546 pharmaceutical excipient Substances 0.000 description 6
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 5
- COIGEOKAXNVRIN-UHFFFAOYSA-N [acetyl-[1-(1-benzothiophen-2-yl)ethyl]amino] acetate Chemical compound C1=CC=C2SC(C(N(OC(C)=O)C(C)=O)C)=CC2=C1 COIGEOKAXNVRIN-UHFFFAOYSA-N 0.000 description 5
- 239000012267 brine Substances 0.000 description 5
- 238000004587 chromatography analysis Methods 0.000 description 5
- 150000002617 leukotrienes Chemical class 0.000 description 5
- QHXPDZPAJHZYNT-UHFFFAOYSA-N n-[1-(1-benzothiophen-2-yl)ethyl]-n-hydroxyacetamide Chemical compound C1=CC=C2SC(C(N(O)C(C)=O)C)=CC2=C1 QHXPDZPAJHZYNT-UHFFFAOYSA-N 0.000 description 5
- PRXXZFOJOLCEHU-UHFFFAOYSA-N n-[1-(1-benzothiophen-3-yl)ethyl]-n-hydroxyacetamide Chemical compound C1=CC=C2C(C(N(O)C(C)=O)C)=CSC2=C1 PRXXZFOJOLCEHU-UHFFFAOYSA-N 0.000 description 5
- OYVXVLSZQHSNDK-UHFFFAOYSA-N n-methoxy-n-methylacetamide Chemical compound CON(C)C(C)=O OYVXVLSZQHSNDK-UHFFFAOYSA-N 0.000 description 5
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 5
- 238000003786 synthesis reaction Methods 0.000 description 5
- IANQTJSKSUMEQM-UHFFFAOYSA-N 1-benzofuran Chemical compound C1=CC=C2OC=CC2=C1 IANQTJSKSUMEQM-UHFFFAOYSA-N 0.000 description 4
- IKHGUXGNUITLKF-UHFFFAOYSA-N Acetaldehyde Chemical compound CC=O IKHGUXGNUITLKF-UHFFFAOYSA-N 0.000 description 4
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 4
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 4
- OFBQJSOFQDEBGM-UHFFFAOYSA-N Pentane Chemical compound CCCCC OFBQJSOFQDEBGM-UHFFFAOYSA-N 0.000 description 4
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 4
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 4
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 4
- 239000004480 active ingredient Substances 0.000 description 4
- 235000019270 ammonium chloride Nutrition 0.000 description 4
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 4
- LOKCTEFSRHRXRJ-UHFFFAOYSA-I dipotassium trisodium dihydrogen phosphate hydrogen phosphate dichloride Chemical compound P(=O)(O)(O)[O-].[K+].P(=O)(O)([O-])[O-].[Na+].[Na+].[Cl-].[K+].[Cl-].[Na+] LOKCTEFSRHRXRJ-UHFFFAOYSA-I 0.000 description 4
- 239000002552 dosage form Substances 0.000 description 4
- 238000001914 filtration Methods 0.000 description 4
- 239000007788 liquid Substances 0.000 description 4
- 239000012044 organic layer Substances 0.000 description 4
- JJVNINGBHGBWJH-UHFFFAOYSA-N ortho-vanillin Chemical compound COC1=CC=CC(C=O)=C1O JJVNINGBHGBWJH-UHFFFAOYSA-N 0.000 description 4
- 239000002953 phosphate buffered saline Substances 0.000 description 4
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 4
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 4
- 150000003839 salts Chemical class 0.000 description 4
- 229910052938 sodium sulfate Inorganic materials 0.000 description 4
- 235000011152 sodium sulphate Nutrition 0.000 description 4
- 238000003756 stirring Methods 0.000 description 4
- 238000012360 testing method Methods 0.000 description 4
- ARMOAXPOGUQCFQ-UHFFFAOYSA-N 1-(1-benzothiophen-2-ylmethyl)-1-hydroxy-3-methylurea Chemical compound C1=CC=C2SC(CN(O)C(=O)NC)=CC2=C1 ARMOAXPOGUQCFQ-UHFFFAOYSA-N 0.000 description 3
- ZTTZKDDWXHQKSY-UHFFFAOYSA-N 1-(1-benzothiophen-3-yl)ethanone Chemical compound C1=CC=C2C(C(=O)C)=CSC2=C1 ZTTZKDDWXHQKSY-UHFFFAOYSA-N 0.000 description 3
- VRVUCGDJGNKXLK-UHFFFAOYSA-N 1-(1-benzothiophen-7-ylmethyl)-1-hydroxyurea Chemical compound NC(=O)N(O)CC1=CC=CC2=C1SC=C2 VRVUCGDJGNKXLK-UHFFFAOYSA-N 0.000 description 3
- BPLMZHUJZIEHGA-UHFFFAOYSA-N 1-[1-(1-acetylindol-2-yl)ethyl]-1-hydroxyurea Chemical compound C1=CC=C2N(C(C)=O)C(C(N(O)C(N)=O)C)=CC2=C1 BPLMZHUJZIEHGA-UHFFFAOYSA-N 0.000 description 3
- AWCTYMBDCUCOKZ-UHFFFAOYSA-N 1-[1-(1-benzothiophen-2-yl)propan-2-yl]-1-hydroxyurea Chemical compound C1=CC=C2SC(CC(C)N(O)C(N)=O)=CC2=C1 AWCTYMBDCUCOKZ-UHFFFAOYSA-N 0.000 description 3
- MMDDMAXORDYDRX-UHFFFAOYSA-N 1-[1-(2,3-dihydro-1-benzofuran-2-yl)ethyl]-1-hydroxyurea Chemical compound C1=CC=C2OC(C(C)N(O)C(N)=O)CC2=C1 MMDDMAXORDYDRX-UHFFFAOYSA-N 0.000 description 3
- GQBYORHBDRICMD-UHFFFAOYSA-N 1-[1-(5-fluoro-1-benzothiophen-2-yl)ethyl]-1-hydroxyurea Chemical compound FC1=CC=C2SC(C(N(O)C(N)=O)C)=CC2=C1 GQBYORHBDRICMD-UHFFFAOYSA-N 0.000 description 3
- VRZAJYHHMUREKK-UHFFFAOYSA-N 1-hydroxy-1-[1-(1h-indol-2-yl)ethyl]-3-methylurea Chemical compound C1=CC=C2NC(C(C)N(O)C(=O)NC)=CC2=C1 VRZAJYHHMUREKK-UHFFFAOYSA-N 0.000 description 3
- UMLSQYPCDZHVHT-UHFFFAOYSA-N 1-hydroxy-1-[1-(7-methoxy-1-benzofuran-2-yl)ethyl]urea Chemical compound COC1=CC=CC2=C1OC(C(C)N(O)C(N)=O)=C2 UMLSQYPCDZHVHT-UHFFFAOYSA-N 0.000 description 3
- GNXBFFHXJDZGEK-UHFFFAOYSA-N 4-tert-butylbenzenethiol Chemical compound CC(C)(C)C1=CC=C(S)C=C1 GNXBFFHXJDZGEK-UHFFFAOYSA-N 0.000 description 3
- KGIJOOYOSFUGPC-MSFIICATSA-N 5-Hydroxyeicosatetraenoic acid Chemical compound CCCCCC=CCC=CCC=C\C=C\[C@@H](O)CCCC(O)=O KGIJOOYOSFUGPC-MSFIICATSA-N 0.000 description 3
- KGIJOOYOSFUGPC-XRXZHELTSA-N 5-hydroxyeicosatetraenoic acid Natural products CCCCCC=CCC=CCC=C\C=C\C(O)CCCC(O)=O KGIJOOYOSFUGPC-XRXZHELTSA-N 0.000 description 3
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 3
- KZMGYPLQYOPHEL-UHFFFAOYSA-N Boron trifluoride etherate Chemical compound FB(F)F.CCOCC KZMGYPLQYOPHEL-UHFFFAOYSA-N 0.000 description 3
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 3
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 3
- YXHKONLOYHBTNS-UHFFFAOYSA-N Diazomethane Chemical compound C=[N+]=[N-] YXHKONLOYHBTNS-UHFFFAOYSA-N 0.000 description 3
- 102000004190 Enzymes Human genes 0.000 description 3
- 108090000790 Enzymes Proteins 0.000 description 3
- YGYAWVDWMABLBF-UHFFFAOYSA-N Phosgene Chemical compound ClC(Cl)=O YGYAWVDWMABLBF-UHFFFAOYSA-N 0.000 description 3
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- 210000000683 abdominal cavity Anatomy 0.000 description 3
- 239000000908 ammonium hydroxide Substances 0.000 description 3
- 239000008346 aqueous phase Substances 0.000 description 3
- 239000012530 fluid Substances 0.000 description 3
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 3
- 239000005457 ice water Substances 0.000 description 3
- 238000001727 in vivo Methods 0.000 description 3
- 238000011534 incubation Methods 0.000 description 3
- 239000010410 layer Substances 0.000 description 3
- XRQVPFATDIHLFU-UHFFFAOYSA-N n-[3-(1-benzothiophen-2-yl)prop-2-enyl]-n-hydroxyacetamide Chemical compound C1=CC=C2SC(C=CCN(O)C(=O)C)=CC2=C1 XRQVPFATDIHLFU-UHFFFAOYSA-N 0.000 description 3
- RBNDXTSRTRBOHM-UHFFFAOYSA-N n-hydroxy-n-[1-(1-methylindol-3-yl)ethyl]acetamide Chemical compound C1=CC=C2C(C(N(O)C(C)=O)C)=CN(C)C2=C1 RBNDXTSRTRBOHM-UHFFFAOYSA-N 0.000 description 3
- MCSAJNNLRCFZED-UHFFFAOYSA-N nitroethane Chemical compound CC[N+]([O-])=O MCSAJNNLRCFZED-UHFFFAOYSA-N 0.000 description 3
- XYEOALKITRFCJJ-UHFFFAOYSA-N o-benzylhydroxylamine Chemical compound NOCC1=CC=CC=C1 XYEOALKITRFCJJ-UHFFFAOYSA-N 0.000 description 3
- 150000002923 oximes Chemical class 0.000 description 3
- 239000000843 powder Substances 0.000 description 3
- 239000002244 precipitate Substances 0.000 description 3
- 238000002360 preparation method Methods 0.000 description 3
- 239000011734 sodium Substances 0.000 description 3
- WRIKHQLVHPKCJU-UHFFFAOYSA-N sodium bis(trimethylsilyl)amide Chemical compound C[Si](C)(C)N([Na])[Si](C)(C)C WRIKHQLVHPKCJU-UHFFFAOYSA-N 0.000 description 3
- 239000000375 suspending agent Substances 0.000 description 3
- RMVRSNDYEFQCLF-UHFFFAOYSA-N thiophenol Chemical compound SC1=CC=CC=C1 RMVRSNDYEFQCLF-UHFFFAOYSA-N 0.000 description 3
- MWLSOWXNZPKENC-UHFFFAOYSA-N zileuton Chemical compound C1=CC=C2SC(C(N(O)C(N)=O)C)=CC2=C1 MWLSOWXNZPKENC-UHFFFAOYSA-N 0.000 description 3
- PUPZLCDOIYMWBV-UHFFFAOYSA-N (+/-)-1,3-Butanediol Chemical compound CC(O)CCO PUPZLCDOIYMWBV-UHFFFAOYSA-N 0.000 description 2
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 2
- NJECAGMFWPQGNI-UHFFFAOYSA-N 1-(1-benzofuran-2-ylmethyl)-1-hydroxy-3-methylurea Chemical compound C1=CC=C2OC(CN(O)C(=O)NC)=CC2=C1 NJECAGMFWPQGNI-UHFFFAOYSA-N 0.000 description 2
- WTJOPSWRVLFZDI-UHFFFAOYSA-N 1-(1-benzofuran-2-ylmethyl)-1-hydroxyurea Chemical compound C1=CC=C2OC(CN(O)C(=O)N)=CC2=C1 WTJOPSWRVLFZDI-UHFFFAOYSA-N 0.000 description 2
- WMVHNTHZNGEFBE-UHFFFAOYSA-N 1-(1-benzothiophen-2-ylmethyl)-1-hydroxy-3,3-dimethylurea Chemical compound C1=CC=C2SC(CN(O)C(=O)N(C)C)=CC2=C1 WMVHNTHZNGEFBE-UHFFFAOYSA-N 0.000 description 2
- AGYNYQIKNDGVQT-UHFFFAOYSA-N 1-(1-benzothiophen-2-ylmethyl)-1-hydroxyurea Chemical compound C1=CC=C2SC(CN(O)C(=O)N)=CC2=C1 AGYNYQIKNDGVQT-UHFFFAOYSA-N 0.000 description 2
- PXRUMOWEMPBNGB-UHFFFAOYSA-N 1-(1-benzothiophen-2-ylmethyl)-3-ethyl-1-hydroxyurea Chemical compound C1=CC=C2SC(CN(O)C(=O)NCC)=CC2=C1 PXRUMOWEMPBNGB-UHFFFAOYSA-N 0.000 description 2
- SVUKISNBRDNDMF-UHFFFAOYSA-N 1-(1-methylindol-2-yl)ethanone Chemical compound C1=CC=C2N(C)C(C(=O)C)=CC2=C1 SVUKISNBRDNDMF-UHFFFAOYSA-N 0.000 description 2
- HYLFRICFKVJJOZ-UHFFFAOYSA-N 1-(1-methylindol-3-yl)ethanone Chemical compound C1=CC=C2C(C(=O)C)=CN(C)C2=C1 HYLFRICFKVJJOZ-UHFFFAOYSA-N 0.000 description 2
- QXJMCSBBTMVSJS-UHFFFAOYSA-N 1-(1h-indol-2-yl)ethanone Chemical compound C1=CC=C2NC(C(=O)C)=CC2=C1 QXJMCSBBTMVSJS-UHFFFAOYSA-N 0.000 description 2
- HZBNCXPGQZKMRB-UHFFFAOYSA-N 1-[1-(1-benzofuran-2-yl)ethyl]-1-hydroxyurea Chemical compound C1=CC=C2OC(C(N(O)C(N)=O)C)=CC2=C1 HZBNCXPGQZKMRB-UHFFFAOYSA-N 0.000 description 2
- QMGMGUYQDFAYML-UHFFFAOYSA-N 1-[1-(1-benzothiophen-2-yl)ethyl]-1,3-dihydroxyurea Chemical compound C1=CC=C2SC(C(N(O)C(=O)NO)C)=CC2=C1 QMGMGUYQDFAYML-UHFFFAOYSA-N 0.000 description 2
- IULSACVIPGNTQW-UHFFFAOYSA-N 1-[1-(1-benzothiophen-2-yl)ethyl]-1-hydroxy-3,3-dimethylurea Chemical compound C1=CC=C2SC(C(N(O)C(=O)N(C)C)C)=CC2=C1 IULSACVIPGNTQW-UHFFFAOYSA-N 0.000 description 2
- RDHDSYZDJCGIRV-UHFFFAOYSA-N 1-[1-(1-benzothiophen-2-yl)ethyl]-1-hydroxy-3-methylthiourea Chemical compound C1=CC=C2SC(C(C)N(O)C(=S)NC)=CC2=C1 RDHDSYZDJCGIRV-UHFFFAOYSA-N 0.000 description 2
- MOWYMDVLTLHNSE-UHFFFAOYSA-N 1-[1-(1-benzothiophen-2-yl)ethyl]-1-hydroxy-3-methylurea Chemical compound C1=CC=C2SC(C(C)N(O)C(=O)NC)=CC2=C1 MOWYMDVLTLHNSE-UHFFFAOYSA-N 0.000 description 2
- BUSAZYSMMVJRAU-UHFFFAOYSA-N 1-[1-(1-benzothiophen-2-yl)ethyl]-1-hydroxythiourea Chemical compound C1=CC=C2SC(C(N(O)C(N)=S)C)=CC2=C1 BUSAZYSMMVJRAU-UHFFFAOYSA-N 0.000 description 2
- BNUSMOMTJVLQSO-UHFFFAOYSA-N 1-[1-(1-benzothiophen-2-yl)ethyl]-1-hydroxyurea;potassium Chemical compound [K].C1=CC=C2SC(C(N(O)C(N)=O)C)=CC2=C1 BNUSMOMTJVLQSO-UHFFFAOYSA-N 0.000 description 2
- QECDFJOPYQTXGU-UHFFFAOYSA-N 1-[1-(1-benzothiophen-2-yl)ethyl]-3-ethyl-1-hydroxyurea Chemical compound C1=CC=C2SC(C(C)N(O)C(=O)NCC)=CC2=C1 QECDFJOPYQTXGU-UHFFFAOYSA-N 0.000 description 2
- AMMPGBYIKIGTPN-UHFFFAOYSA-N 1-[1-(1-benzothiophen-3-yl)ethyl]-1-hydroxyurea Chemical compound C1=CC=C2C(C(N(O)C(N)=O)C)=CSC2=C1 AMMPGBYIKIGTPN-UHFFFAOYSA-N 0.000 description 2
- YZWZPHFNXGWELU-UHFFFAOYSA-N 1-[1-(5,7-dichloro-1-benzofuran-2-yl)ethyl]-1-hydroxyurea Chemical compound ClC1=CC(Cl)=C2OC(C(N(O)C(N)=O)C)=CC2=C1 YZWZPHFNXGWELU-UHFFFAOYSA-N 0.000 description 2
- BPZSEQWLJDZAQC-UHFFFAOYSA-N 1-[1-(5-chloro-1-benzofuran-2-yl)ethyl]-1-hydroxyurea Chemical compound ClC1=CC=C2OC(C(N(O)C(N)=O)C)=CC2=C1 BPZSEQWLJDZAQC-UHFFFAOYSA-N 0.000 description 2
- WCBHFTRELWKDOD-UHFFFAOYSA-N 1-[1-(5-chloro-1h-indol-2-yl)ethyl]-1-hydroxy-3-methylurea Chemical compound ClC1=CC=C2NC(C(C)N(O)C(=O)NC)=CC2=C1 WCBHFTRELWKDOD-UHFFFAOYSA-N 0.000 description 2
- ZVDRITGCXHQQRH-UHFFFAOYSA-N 1-[3-(1-benzothiophen-2-yl)prop-2-enyl]-1-hydroxyurea Chemical compound C1=CC=C2SC(C=CCN(O)C(=O)N)=CC2=C1 ZVDRITGCXHQQRH-UHFFFAOYSA-N 0.000 description 2
- NXSVNPSWARVMAY-UHFFFAOYSA-N 1-benzothiophene-2-carbaldehyde Chemical compound C1=CC=C2SC(C=O)=CC2=C1 NXSVNPSWARVMAY-UHFFFAOYSA-N 0.000 description 2
- XHCAGOVGSDHHNP-UHFFFAOYSA-N 1-bromo-4-tert-butylbenzene Chemical compound CC(C)(C)C1=CC=C(Br)C=C1 XHCAGOVGSDHHNP-UHFFFAOYSA-N 0.000 description 2
- RWYJZLHQTSAZEC-UHFFFAOYSA-N 1-hydroxy-1-[1-(1-methylindol-2-yl)ethyl]urea Chemical compound C1=CC=C2N(C)C(C(N(O)C(N)=O)C)=CC2=C1 RWYJZLHQTSAZEC-UHFFFAOYSA-N 0.000 description 2
- LENVEWKCVMWJDA-UHFFFAOYSA-N 1-hydroxy-1-[1-(1-methylindol-3-yl)ethyl]urea Chemical compound C1=CC=C2C(C(N(O)C(N)=O)C)=CN(C)C2=C1 LENVEWKCVMWJDA-UHFFFAOYSA-N 0.000 description 2
- ONYARHFXBSXWIV-UHFFFAOYSA-N 1-hydroxy-1-[1-(1-methylsulfonylindol-2-yl)ethyl]urea Chemical compound C1=CC=C2N(S(C)(=O)=O)C(C(N(O)C(N)=O)C)=CC2=C1 ONYARHFXBSXWIV-UHFFFAOYSA-N 0.000 description 2
- FDBCQPDUFMUJTI-UHFFFAOYSA-N 1-hydroxy-1-[1-(1h-indol-2-yl)ethyl]urea Chemical compound C1=CC=C2NC(C(N(O)C(N)=O)C)=CC2=C1 FDBCQPDUFMUJTI-UHFFFAOYSA-N 0.000 description 2
- LRYQNCAJFPHGOY-UHFFFAOYSA-N 1-hydroxy-1-[1-(3-hydroxy-1-benzothiophen-2-yl)ethyl]urea Chemical compound C1=CC=C2C(O)=C(C(N(O)C(N)=O)C)SC2=C1 LRYQNCAJFPHGOY-UHFFFAOYSA-N 0.000 description 2
- QCJLSLKIBCZLRS-UHFFFAOYSA-N 1-hydroxy-1-[1-(3-methoxy-1-benzothiophen-2-yl)ethyl]urea Chemical compound C1=CC=C2C(OC)=C(C(C)N(O)C(N)=O)SC2=C1 QCJLSLKIBCZLRS-UHFFFAOYSA-N 0.000 description 2
- RHVLJIBGJYGCLW-UHFFFAOYSA-N 1-hydroxy-1-[1-(5-methoxy-1-benzofuran-2-yl)ethyl]urea Chemical compound COC1=CC=C2OC(C(C)N(O)C(N)=O)=CC2=C1 RHVLJIBGJYGCLW-UHFFFAOYSA-N 0.000 description 2
- MKMKVIUKECVRCB-UHFFFAOYSA-N 1-hydroxy-1-[1-(5-phenyl-1-benzothiophen-2-yl)ethyl]urea Chemical compound C=1C=C2SC(C(N(O)C(N)=O)C)=CC2=CC=1C1=CC=CC=C1 MKMKVIUKECVRCB-UHFFFAOYSA-N 0.000 description 2
- GKKUYNNFFYCBJK-UHFFFAOYSA-N 1-hydroxy-1-[1-(5-phenylmethoxy-1-benzothiophen-2-yl)ethyl]urea Chemical compound C=1C=C2SC(C(N(O)C(N)=O)C)=CC2=CC=1OCC1=CC=CC=C1 GKKUYNNFFYCBJK-UHFFFAOYSA-N 0.000 description 2
- PZJJJYIAPXWVQK-UHFFFAOYSA-N 1-hydroxy-1-[1-(6-phenylmethoxy-1-benzofuran-2-yl)ethyl]urea Chemical compound C1=C2OC(C(N(O)C(N)=O)C)=CC2=CC=C1OCC1=CC=CC=C1 PZJJJYIAPXWVQK-UHFFFAOYSA-N 0.000 description 2
- HYUZRVSKLIOPIN-UHFFFAOYSA-N 1-hydroxy-1-[1-(7-methoxy-1-benzothiophen-2-yl)ethyl]urea Chemical compound COC1=CC=CC2=C1SC(C(C)N(O)C(N)=O)=C2 HYUZRVSKLIOPIN-UHFFFAOYSA-N 0.000 description 2
- XUBDSRKLUASATM-UHFFFAOYSA-N 1-hydroxy-1-[1-[5-(2-methylpropyl)-1-benzothiophen-3-yl]ethyl]urea Chemical compound CC(C)CC1=CC=C2SC=C(C(C)N(O)C(N)=O)C2=C1 XUBDSRKLUASATM-UHFFFAOYSA-N 0.000 description 2
- XGDKTSSEWILQIH-UHFFFAOYSA-N 1-hydroxy-1-[1-[5-(trifluoromethyl)-1-benzothiophen-2-yl]ethyl]urea Chemical compound FC(F)(F)C1=CC=C2SC(C(N(O)C(N)=O)C)=CC2=C1 XGDKTSSEWILQIH-UHFFFAOYSA-N 0.000 description 2
- CVFDQSAIBGDRFZ-UHFFFAOYSA-N 1-hydroxy-3-methyl-1-[1-(1-methylindol-3-yl)ethyl]urea Chemical compound C1=CC=C2C(C(C)N(O)C(=O)NC)=CN(C)C2=C1 CVFDQSAIBGDRFZ-UHFFFAOYSA-N 0.000 description 2
- ZNOCFYCEOMJCSC-UHFFFAOYSA-N 1-hydroxy-3-methyl-1-[1-(6-phenylmethoxy-1-benzofuran-2-yl)ethyl]urea Chemical compound C1=C2OC(C(C)N(O)C(=O)NC)=CC2=CC=C1OCC1=CC=CC=C1 ZNOCFYCEOMJCSC-UHFFFAOYSA-N 0.000 description 2
- ZIOZYRSDNLNNNJ-LQWMCKPYSA-N 12(S)-HPETE Chemical compound CCCCC\C=C/C[C@H](OO)\C=C\C=C/C\C=C/CCCC(O)=O ZIOZYRSDNLNNNJ-LQWMCKPYSA-N 0.000 description 2
- ZNHVWPKMFKADKW-UHFFFAOYSA-N 12-HETE Chemical compound CCCCCC=CCC(O)C=CC=CCC=CCCCC(O)=O ZNHVWPKMFKADKW-UHFFFAOYSA-N 0.000 description 2
- ZNHVWPKMFKADKW-ZYBDYUKJSA-N 12-HETE Natural products CCCCC\C=C/C[C@@H](O)\C=C\C=C/C\C=C/CCCC(O)=O ZNHVWPKMFKADKW-ZYBDYUKJSA-N 0.000 description 2
- BFWYTORDSFIVKP-USWFWKISSA-N 15-HPETE Chemical compound CCCCCC(OO)\C=C\C=C/C\C=C/C\C=C/CCCC(O)=O BFWYTORDSFIVKP-USWFWKISSA-N 0.000 description 2
- WZUODJNEIXSNEU-UHFFFAOYSA-N 2-Hydroxy-4-methoxybenzaldehyde Chemical compound COC1=CC=C(C=O)C(O)=C1 WZUODJNEIXSNEU-UHFFFAOYSA-N 0.000 description 2
- AMLKEDBYDOCGEG-UHFFFAOYSA-N 2-hydroxy-4-phenylmethoxybenzaldehyde Chemical compound C1=C(C=O)C(O)=CC(OCC=2C=CC=CC=2)=C1 AMLKEDBYDOCGEG-UHFFFAOYSA-N 0.000 description 2
- SEBRPHZZSLCDRQ-UHFFFAOYSA-N 3-methyl-1-benzothiophene Chemical compound C1=CC=C2C(C)=CSC2=C1 SEBRPHZZSLCDRQ-UHFFFAOYSA-N 0.000 description 2
- RDEYORKJEDLLDB-DQVHGTJVSA-N 5-Hydroperoxyeicosatetraenoic acid Chemical compound CCCCCCCCCCC\C=C\C=C\C(\OO)=C\C=C\C(O)=O RDEYORKJEDLLDB-DQVHGTJVSA-N 0.000 description 2
- DLFVBJFMPXGRIB-UHFFFAOYSA-N Acetamide Chemical compound CC(N)=O DLFVBJFMPXGRIB-UHFFFAOYSA-N 0.000 description 2
- 206010002198 Anaphylactic reaction Diseases 0.000 description 2
- 239000005711 Benzoic acid Substances 0.000 description 2
- ROSDSFDQCJNGOL-UHFFFAOYSA-N Dimethylamine Chemical compound CNC ROSDSFDQCJNGOL-UHFFFAOYSA-N 0.000 description 2
- YIIMEMSDCNDGTB-UHFFFAOYSA-N Dimethylcarbamoyl chloride Chemical compound CN(C)C(Cl)=O YIIMEMSDCNDGTB-UHFFFAOYSA-N 0.000 description 2
- QUSNBJAOOMFDIB-UHFFFAOYSA-N Ethylamine Chemical compound CCN QUSNBJAOOMFDIB-UHFFFAOYSA-N 0.000 description 2
- WTDHULULXKLSOZ-UHFFFAOYSA-N Hydroxylamine hydrochloride Chemical compound Cl.ON WTDHULULXKLSOZ-UHFFFAOYSA-N 0.000 description 2
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 2
- 206010061218 Inflammation Diseases 0.000 description 2
- XUJNEKJLAYXESH-REOHCLBHSA-N L-Cysteine Chemical compound SC[C@H](N)C(O)=O XUJNEKJLAYXESH-REOHCLBHSA-N 0.000 description 2
- 229930184725 Lipoxin Natural products 0.000 description 2
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 2
- 241001465754 Metazoa Species 0.000 description 2
- BAVYZALUXZFZLV-UHFFFAOYSA-N Methylamine Chemical compound NC BAVYZALUXZFZLV-UHFFFAOYSA-N 0.000 description 2
- PCLIMKBDDGJMGD-UHFFFAOYSA-N N-bromosuccinimide Chemical compound BrN1C(=O)CCC1=O PCLIMKBDDGJMGD-UHFFFAOYSA-N 0.000 description 2
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 2
- KFSLWBXXFJQRDL-UHFFFAOYSA-N Peracetic acid Chemical compound CC(=O)OO KFSLWBXXFJQRDL-UHFFFAOYSA-N 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- PXIPVTKHYLBLMZ-UHFFFAOYSA-N Sodium azide Chemical compound [Na+].[N-]=[N+]=[N-] PXIPVTKHYLBLMZ-UHFFFAOYSA-N 0.000 description 2
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 2
- YTPLMLYBLZKORZ-UHFFFAOYSA-N Thiophene Chemical compound C=1C=CSC=1 YTPLMLYBLZKORZ-UHFFFAOYSA-N 0.000 description 2
- DTQVDTLACAAQTR-UHFFFAOYSA-N Trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 description 2
- TZMCNXPERDBNQT-UHFFFAOYSA-N [1-(1-benzothiophen-2-yl)ethyl-carbamoylamino] benzoate Chemical compound C=1C2=CC=CC=C2SC=1C(C)N(C(N)=O)OC(=O)C1=CC=CC=C1 TZMCNXPERDBNQT-UHFFFAOYSA-N 0.000 description 2
- WIEVAISADSTZFP-UHFFFAOYSA-N [1-(1-benzothiophen-2-yl)ethyl-carbamoylamino] butanoate Chemical compound C1=CC=C2SC(C(C)N(OC(=O)CCC)C(N)=O)=CC2=C1 WIEVAISADSTZFP-UHFFFAOYSA-N 0.000 description 2
- ZDFRINUXNZOBQB-UHFFFAOYSA-N [Na].CC(N(O)C(N)=O)c1cc2ccccc2s1 Chemical compound [Na].CC(N(O)C(N)=O)c1cc2ccccc2s1 ZDFRINUXNZOBQB-UHFFFAOYSA-N 0.000 description 2
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 2
- 230000036783 anaphylactic response Effects 0.000 description 2
- 208000003455 anaphylaxis Diseases 0.000 description 2
- 150000005840 aryl radicals Chemical group 0.000 description 2
- NKIFOJPUJRRONL-UHFFFAOYSA-N azane N-[1-(1-benzothiophen-2-yl)ethyl]-N-hydroxyacetamide Chemical compound N.C1=CC=C2SC(C(N(O)C(C)=O)C)=CC2=C1 NKIFOJPUJRRONL-UHFFFAOYSA-N 0.000 description 2
- 239000002585 base Substances 0.000 description 2
- 125000005605 benzo group Chemical group 0.000 description 2
- 235000010233 benzoic acid Nutrition 0.000 description 2
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 2
- 230000004071 biological effect Effects 0.000 description 2
- 230000017531 blood circulation Effects 0.000 description 2
- 230000037396 body weight Effects 0.000 description 2
- UWTDFICHZKXYAC-UHFFFAOYSA-N boron;oxolane Chemical compound [B].C1CCOC1 UWTDFICHZKXYAC-UHFFFAOYSA-N 0.000 description 2
- NNTOJPXOCKCMKR-UHFFFAOYSA-N boron;pyridine Chemical compound [B].C1=CC=NC=C1 NNTOJPXOCKCMKR-UHFFFAOYSA-N 0.000 description 2
- 239000002775 capsule Substances 0.000 description 2
- 210000004027 cell Anatomy 0.000 description 2
- BULLHNJGPPOUOX-UHFFFAOYSA-N chloroacetone Chemical compound CC(=O)CCl BULLHNJGPPOUOX-UHFFFAOYSA-N 0.000 description 2
- 239000003085 diluting agent Substances 0.000 description 2
- 125000002147 dimethylamino group Chemical group [H]C([H])([H])N(*)C([H])([H])[H] 0.000 description 2
- 239000000839 emulsion Substances 0.000 description 2
- WUDNUHPRLBTKOJ-UHFFFAOYSA-N ethyl isocyanate Chemical compound CCN=C=O WUDNUHPRLBTKOJ-UHFFFAOYSA-N 0.000 description 2
- 238000001704 evaporation Methods 0.000 description 2
- 230000008020 evaporation Effects 0.000 description 2
- 238000002474 experimental method Methods 0.000 description 2
- 239000000706 filtrate Substances 0.000 description 2
- 238000009472 formulation Methods 0.000 description 2
- 238000000338 in vitro Methods 0.000 description 2
- 230000004054 inflammatory process Effects 0.000 description 2
- 239000007924 injection Substances 0.000 description 2
- 238000002347 injection Methods 0.000 description 2
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 2
- 150000002639 lipoxins Chemical class 0.000 description 2
- NUJOXMJBOLGQSY-UHFFFAOYSA-N manganese dioxide Chemical compound O=[Mn]=O NUJOXMJBOLGQSY-UHFFFAOYSA-N 0.000 description 2
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 2
- MKBPUCZUQAJMHK-UHFFFAOYSA-N n-[1-(1-benzofuran-2-yl)ethyl]-n-hydroxyacetamide Chemical compound C1=CC=C2OC(C(N(O)C(C)=O)C)=CC2=C1 MKBPUCZUQAJMHK-UHFFFAOYSA-N 0.000 description 2
- KJUGBWDAGXXVIP-UHFFFAOYSA-N n-[1-(1-benzothiophen-2-yl)ethyl]-n-hydroxy-2-methylpropanamide Chemical compound C1=CC=C2SC(C(C)N(O)C(=O)C(C)C)=CC2=C1 KJUGBWDAGXXVIP-UHFFFAOYSA-N 0.000 description 2
- YBBCKUHJPVFIJV-UHFFFAOYSA-N n-[1-(1-benzothiophen-2-yl)ethyl]-n-hydroxyformamide Chemical compound C1=CC=C2SC(C(N(O)C=O)C)=CC2=C1 YBBCKUHJPVFIJV-UHFFFAOYSA-N 0.000 description 2
- DUPYSIVXMZRUMZ-UHFFFAOYSA-N n-[1-(1-benzothiophen-2-yl)ethyl]-n-hydroxyprop-2-enamide Chemical compound C1=CC=C2SC(C(N(O)C(=O)C=C)C)=CC2=C1 DUPYSIVXMZRUMZ-UHFFFAOYSA-N 0.000 description 2
- NSTCHGQTYVCQEB-UHFFFAOYSA-N n-[1-(1-benzothiophen-2-yl)ethyl]-n-hydroxypropanamide Chemical compound C1=CC=C2SC(C(C)N(O)C(=O)CC)=CC2=C1 NSTCHGQTYVCQEB-UHFFFAOYSA-N 0.000 description 2
- VSEHHKLRTXQXCI-UHFFFAOYSA-N n-[1-(5-fluoro-1-benzofuran-2-yl)ethyl]-n-hydroxyacetamide Chemical compound FC1=CC=C2OC(C(N(O)C(C)=O)C)=CC2=C1 VSEHHKLRTXQXCI-UHFFFAOYSA-N 0.000 description 2
- PTEOTYXWMJWVBD-UHFFFAOYSA-N n-hydroxy-n-[1-(5-phenoxy-1-benzofuran-2-yl)ethyl]acetamide Chemical compound C=1C=C2OC(C(N(O)C(C)=O)C)=CC2=CC=1OC1=CC=CC=C1 PTEOTYXWMJWVBD-UHFFFAOYSA-N 0.000 description 2
- SQDFHQJTAWCFIB-UHFFFAOYSA-N n-methylidenehydroxylamine Chemical compound ON=C SQDFHQJTAWCFIB-UHFFFAOYSA-N 0.000 description 2
- 229910052757 nitrogen Inorganic materials 0.000 description 2
- 239000000346 nonvolatile oil Substances 0.000 description 2
- CTSLXHKWHWQRSH-UHFFFAOYSA-N oxalyl chloride Chemical compound ClC(=O)C(Cl)=O CTSLXHKWHWQRSH-UHFFFAOYSA-N 0.000 description 2
- 239000012071 phase Substances 0.000 description 2
- 239000006187 pill Substances 0.000 description 2
- 229910000027 potassium carbonate Inorganic materials 0.000 description 2
- 230000003389 potentiating effect Effects 0.000 description 2
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 238000000746 purification Methods 0.000 description 2
- 229920006395 saturated elastomer Polymers 0.000 description 2
- 229910052708 sodium Inorganic materials 0.000 description 2
- 229910000029 sodium carbonate Inorganic materials 0.000 description 2
- 239000007909 solid dosage form Substances 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- 239000003826 tablet Substances 0.000 description 2
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 2
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 description 2
- GETQZCLCWQTVFV-UHFFFAOYSA-N trimethylamine Chemical compound CN(C)C GETQZCLCWQTVFV-UHFFFAOYSA-N 0.000 description 2
- 239000000080 wetting agent Substances 0.000 description 2
- 238000010626 work up procedure Methods 0.000 description 2
- WRIDQFICGBMAFQ-UHFFFAOYSA-N (E)-8-Octadecenoic acid Natural products CCCCCCCCCC=CCCCCCCC(O)=O WRIDQFICGBMAFQ-UHFFFAOYSA-N 0.000 description 1
- UYTMLDBQFLIQJA-XQRVVYSFSA-N (nz)-n-(furan-2-ylmethylidene)hydroxylamine Chemical compound O\N=C/C1=CC=CO1 UYTMLDBQFLIQJA-XQRVVYSFSA-N 0.000 description 1
- YUTFQTAITWWGFH-UHFFFAOYSA-N 1-(1-benzofuran-2-yl)ethanone Chemical compound C1=CC=C2OC(C(=O)C)=CC2=C1 YUTFQTAITWWGFH-UHFFFAOYSA-N 0.000 description 1
- FPWOHENJFYCQBW-UHFFFAOYSA-N 1-(1-benzothiophen-2-yl)-2-methylpropan-1-one Chemical compound C1=CC=C2SC(C(=O)C(C)C)=CC2=C1 FPWOHENJFYCQBW-UHFFFAOYSA-N 0.000 description 1
- QHMJSLRJAHUWEE-UHFFFAOYSA-N 1-(2,3-dihydro-1-benzofuran-2-yl)ethanol Chemical compound C1=CC=C2OC(C(O)C)CC2=C1 QHMJSLRJAHUWEE-UHFFFAOYSA-N 0.000 description 1
- OGBIPSQISUSEHB-UHFFFAOYSA-N 1-(2,3-dihydro-1-benzofuran-2-yl)ethanone Chemical compound C1=CC=C2OC(C(=O)C)CC2=C1 OGBIPSQISUSEHB-UHFFFAOYSA-N 0.000 description 1
- XQNRBPYRMAXIOB-UHFFFAOYSA-N 1-(3-hydroxy-1-benzothiophen-2-yl)ethanone Chemical compound C1=CC=C2C(O)=C(C(=O)C)SC2=C1 XQNRBPYRMAXIOB-UHFFFAOYSA-N 0.000 description 1
- HRIHWICATXXUBD-UHFFFAOYSA-N 1-(3-methoxy-1-benzothiophen-2-yl)ethanone Chemical compound C1=CC=C2C(OC)=C(C(C)=O)SC2=C1 HRIHWICATXXUBD-UHFFFAOYSA-N 0.000 description 1
- QMWLGJBCKQTGIF-UHFFFAOYSA-N 1-[1-(4,7-dimethyl-1-benzothiophen-2-yl)ethyl]-1-hydroxyurea Chemical compound C1=CC(C)=C2SC(C(N(O)C(N)=O)C)=CC2=C1C QMWLGJBCKQTGIF-UHFFFAOYSA-N 0.000 description 1
- XRILLUAJCNTTRI-UHFFFAOYSA-N 1-[2-(1-benzothiophen-2-yl)ethyl]-1-hydroxyurea Chemical compound C1=CC=C2SC(CCN(O)C(=O)N)=CC2=C1 XRILLUAJCNTTRI-UHFFFAOYSA-N 0.000 description 1
- AQJJFNFAYMLSNA-UHFFFAOYSA-N 1-benzothiophen-7-ylmethanol Chemical compound OCC1=CC=CC2=C1SC=C2 AQJJFNFAYMLSNA-UHFFFAOYSA-N 0.000 description 1
- WSSVAOKEXMFMIO-UHFFFAOYSA-N 1-benzothiophene-7-carbaldehyde Chemical compound O=CC1=CC=CC2=C1SC=C2 WSSVAOKEXMFMIO-UHFFFAOYSA-N 0.000 description 1
- 125000004973 1-butenyl group Chemical group C(=CCC)* 0.000 description 1
- NBLQZTAAMULKEF-UHFFFAOYSA-N 1-hydroxy-1-[1-(3-methyl-1-benzothiophen-2-yl)ethyl]urea Chemical compound C1=CC=C2C(C)=C(C(N(O)C(N)=O)C)SC2=C1 NBLQZTAAMULKEF-UHFFFAOYSA-N 0.000 description 1
- GWMZSBIXNRZUHR-UHFFFAOYSA-N 1-hydroxy-1-[1-(7-methoxy-1-benzofuran-2-yl)ethyl]-3-methylurea Chemical compound C1=CC(OC)=C2OC(C(C)N(O)C(=O)NC)=CC2=C1 GWMZSBIXNRZUHR-UHFFFAOYSA-N 0.000 description 1
- WBXVUMOSSJDPAN-UHFFFAOYSA-N 1-methylsulfonylindole Chemical compound C1=CC=C2N(S(=O)(=O)C)C=CC2=C1 WBXVUMOSSJDPAN-UHFFFAOYSA-N 0.000 description 1
- 125000001088 1-naphthoyl group Chemical group C1(=CC=CC2=CC=CC=C12)C(=O)* 0.000 description 1
- 125000001637 1-naphthyl group Chemical group [H]C1=C([H])C([H])=C2C(*)=C([H])C([H])=C([H])C2=C1[H] 0.000 description 1
- 125000004343 1-phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 125000006017 1-propenyl group Chemical group 0.000 description 1
- HNGUSSVXGRWXCQ-UHFFFAOYSA-N 1-tert-butyl-4-(diethoxymethylsulfanylmethyl)benzene Chemical compound CCOC(OCC)SCC1=CC=C(C(C)(C)C)C=C1 HNGUSSVXGRWXCQ-UHFFFAOYSA-N 0.000 description 1
- 125000000453 2,2,2-trichloroethyl group Chemical group [H]C([H])(*)C(Cl)(Cl)Cl 0.000 description 1
- YQTCQNIPQMJNTI-UHFFFAOYSA-N 2,2-dimethylpropan-1-one Chemical group CC(C)(C)[C]=O YQTCQNIPQMJNTI-UHFFFAOYSA-N 0.000 description 1
- JWNVGVCOAIMEQQ-UHFFFAOYSA-N 2-(2-nitroprop-1-enyl)-1-benzothiophene Chemical compound C1=CC=C2SC(C=C(C)[N+]([O-])=O)=CC2=C1 JWNVGVCOAIMEQQ-UHFFFAOYSA-N 0.000 description 1
- JRRVXMNNTAEETD-UHFFFAOYSA-N 2-(3-bromoprop-1-enyl)-1-benzothiophene Chemical compound C1=CC=C2SC(C=CCBr)=CC2=C1 JRRVXMNNTAEETD-UHFFFAOYSA-N 0.000 description 1
- CAFHRBVXNXKTNA-UHFFFAOYSA-N 2-(3-fluorophenyl)-1-benzothiophene Chemical compound FC1=CC=CC(C=2SC3=CC=CC=C3C=2)=C1 CAFHRBVXNXKTNA-UHFFFAOYSA-N 0.000 description 1
- GVNVAWHJIKLAGL-UHFFFAOYSA-N 2-(cyclohexen-1-yl)cyclohexan-1-one Chemical compound O=C1CCCCC1C1=CCCCC1 GVNVAWHJIKLAGL-UHFFFAOYSA-N 0.000 description 1
- LXUNZSDDXMPKLP-UHFFFAOYSA-N 2-Methylbenzenethiol Chemical compound CC1=CC=CC=C1S LXUNZSDDXMPKLP-UHFFFAOYSA-N 0.000 description 1
- LILXDMFJXYAKMK-UHFFFAOYSA-N 2-bromo-1,1-diethoxyethane Chemical compound CCOC(CBr)OCC LILXDMFJXYAKMK-UHFFFAOYSA-N 0.000 description 1
- QXISTPDUYKNPLU-UHFFFAOYSA-N 2-bromo-1,4-dimethylbenzene Chemical compound CC1=CC=C(C)C(Br)=C1 QXISTPDUYKNPLU-UHFFFAOYSA-N 0.000 description 1
- 125000004974 2-butenyl group Chemical group C(C=CC)* 0.000 description 1
- NEAQRZUHTPSBBM-UHFFFAOYSA-N 2-hydroxy-3,3-dimethyl-7-nitro-4h-isoquinolin-1-one Chemical compound C1=C([N+]([O-])=O)C=C2C(=O)N(O)C(C)(C)CC2=C1 NEAQRZUHTPSBBM-UHFFFAOYSA-N 0.000 description 1
- 125000006020 2-methyl-1-propenyl group Chemical group 0.000 description 1
- DGMOBVGABMBZSB-UHFFFAOYSA-N 2-methylpropanoyl chloride Chemical compound CC(C)C(Cl)=O DGMOBVGABMBZSB-UHFFFAOYSA-N 0.000 description 1
- 125000001216 2-naphthoyl group Chemical group C1=C(C=CC2=CC=CC=C12)C(=O)* 0.000 description 1
- 125000001622 2-naphthyl group Chemical group [H]C1=C([H])C([H])=C2C([H])=C(*)C([H])=C([H])C2=C1[H] 0.000 description 1
- 125000000094 2-phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 1
- 125000004105 2-pyridyl group Chemical group N1=C([*])C([H])=C([H])C([H])=C1[H] 0.000 description 1
- 125000006479 2-pyridyl methyl group Chemical group [H]C1=C([H])C([H])=C([H])C(=N1)C([H])([H])* 0.000 description 1
- LQJBNNIYVWPHFW-UHFFFAOYSA-N 20:1omega9c fatty acid Natural products CCCCCCCCCCC=CCCCCCCCC(O)=O LQJBNNIYVWPHFW-UHFFFAOYSA-N 0.000 description 1
- FABVMBDCVAJXMB-UHFFFAOYSA-N 3,5-dichloro-2-hydroxybenzaldehyde Chemical compound OC1=C(Cl)C=C(Cl)C=C1C=O FABVMBDCVAJXMB-UHFFFAOYSA-N 0.000 description 1
- MBXVUUSDTUUUFT-UHFFFAOYSA-N 3-(1-benzothiophen-2-yl)-n-(oxan-2-yloxy)prop-2-en-1-amine Chemical compound C=1C2=CC=CC=C2SC=1C=CCNOC1CCCCO1 MBXVUUSDTUUUFT-UHFFFAOYSA-N 0.000 description 1
- LCZXAWVZKNFOCY-UHFFFAOYSA-N 3-(1-bromoprop-2-enyl)-1-benzothiophene Chemical compound C1=CC=C2C(C(C=C)Br)=CSC2=C1 LCZXAWVZKNFOCY-UHFFFAOYSA-N 0.000 description 1
- LYDKRPVKILVEIA-UHFFFAOYSA-N 3-(carboxymethoxy)-6-(4-hydroxyphenyl)-1-benzothiophene-2-carboxylic acid Chemical compound C=1C=C2C(OCC(=O)O)=C(C(O)=O)SC2=CC=1C1=CC=C(O)C=C1 LYDKRPVKILVEIA-UHFFFAOYSA-N 0.000 description 1
- OFQBYHLLIJGMNP-UHFFFAOYSA-N 3-ethoxy-2-hydroxybenzaldehyde Chemical compound CCOC1=CC=CC(C=O)=C1O OFQBYHLLIJGMNP-UHFFFAOYSA-N 0.000 description 1
- ZRXHLJNBNWVNIM-UHFFFAOYSA-N 3-methyl-1-benzofuran Chemical compound C1=CC=C2C(C)=COC2=C1 ZRXHLJNBNWVNIM-UHFFFAOYSA-N 0.000 description 1
- 125000006192 3-phenylprop-2-enyl group Chemical group [H]\C(=C(\[H])C([H])([H])*)C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 1
- 125000003349 3-pyridyl group Chemical group N1=C([H])C([*])=C([H])C([H])=C1[H] 0.000 description 1
- OKIHXNKYYGUVTE-UHFFFAOYSA-N 4-Fluorothiophenol Chemical compound FC1=CC=C(S)C=C1 OKIHXNKYYGUVTE-UHFFFAOYSA-N 0.000 description 1
- QCQCHGYLTSGIGX-GHXANHINSA-N 4-[[(3ar,5ar,5br,7ar,9s,11ar,11br,13as)-5a,5b,8,8,11a-pentamethyl-3a-[(5-methylpyridine-3-carbonyl)amino]-2-oxo-1-propan-2-yl-4,5,6,7,7a,9,10,11,11b,12,13,13a-dodecahydro-3h-cyclopenta[a]chrysen-9-yl]oxy]-2,2-dimethyl-4-oxobutanoic acid Chemical compound N([C@@]12CC[C@@]3(C)[C@]4(C)CC[C@H]5C(C)(C)[C@@H](OC(=O)CC(C)(C)C(O)=O)CC[C@]5(C)[C@H]4CC[C@@H]3C1=C(C(C2)=O)C(C)C)C(=O)C1=CN=CC(C)=C1 QCQCHGYLTSGIGX-GHXANHINSA-N 0.000 description 1
- QNZWAJZEJAOVPN-UHFFFAOYSA-N 4-chloro-2-hydroxybenzaldehyde Chemical compound OC1=CC(Cl)=CC=C1C=O QNZWAJZEJAOVPN-UHFFFAOYSA-N 0.000 description 1
- UQRONKZLYKUEMO-UHFFFAOYSA-N 4-methyl-1-(2,4,6-trimethylphenyl)pent-4-en-2-one Chemical group CC(=C)CC(=O)Cc1c(C)cc(C)cc1C UQRONKZLYKUEMO-UHFFFAOYSA-N 0.000 description 1
- 125000000339 4-pyridyl group Chemical group N1=C([H])C([H])=C([*])C([H])=C1[H] 0.000 description 1
- MYTGFBZJLDLWQG-UHFFFAOYSA-N 5-chloro-1h-indole Chemical compound ClC1=CC=C2NC=CC2=C1 MYTGFBZJLDLWQG-UHFFFAOYSA-N 0.000 description 1
- VKBPSLNJNKFVAC-UHFFFAOYSA-N 5-fluoro-1-benzothiophene Chemical compound FC1=CC=C2SC=CC2=C1 VKBPSLNJNKFVAC-UHFFFAOYSA-N 0.000 description 1
- PIEDRQBNWAWCDI-UHFFFAOYSA-N 5-tert-butyl-1-benzothiophene Chemical compound CC(C)(C)C1=CC=C2SC=CC2=C1 PIEDRQBNWAWCDI-UHFFFAOYSA-N 0.000 description 1
- CBWUJYGWPDPIFY-UHFFFAOYSA-N 7-(bromomethyl)-1-benzothiophene Chemical compound BrCC1=CC=CC2=C1SC=C2 CBWUJYGWPDPIFY-UHFFFAOYSA-N 0.000 description 1
- PIHVNUSWMTZFBD-UHFFFAOYSA-N 7-methyl-1-benzothiophene Chemical compound CC1=CC=CC2=C1SC=C2 PIHVNUSWMTZFBD-UHFFFAOYSA-N 0.000 description 1
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- QSBYPNXLFMSGKH-UHFFFAOYSA-N 9-Heptadecensaeure Natural products CCCCCCCC=CCCCCCCCC(O)=O QSBYPNXLFMSGKH-UHFFFAOYSA-N 0.000 description 1
- GUBGYTABKSRVRQ-XLOQQCSPSA-N Alpha-Lactose Chemical compound O[C@@H]1[C@@H](O)[C@@H](O)[C@@H](CO)O[C@H]1O[C@@H]1[C@@H](CO)O[C@H](O)[C@H](O)[C@H]1O GUBGYTABKSRVRQ-XLOQQCSPSA-N 0.000 description 1
- 102000009515 Arachidonate 15-Lipoxygenase Human genes 0.000 description 1
- 108010048907 Arachidonate 15-lipoxygenase Proteins 0.000 description 1
- 239000004342 Benzoyl peroxide Substances 0.000 description 1
- OMPJBNCRMGITSC-UHFFFAOYSA-N Benzoylperoxide Chemical compound C=1C=CC=CC=1C(=O)OOC(=O)C1=CC=CC=C1 OMPJBNCRMGITSC-UHFFFAOYSA-N 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- 206010006482 Bronchospasm Diseases 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- CKDWPUIZGOQOOM-UHFFFAOYSA-N Carbamyl chloride Chemical compound NC(Cl)=O CKDWPUIZGOQOOM-UHFFFAOYSA-N 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- 101150065749 Churc1 gene Proteins 0.000 description 1
- KCXVZYZYPLLWCC-UHFFFAOYSA-N EDTA Chemical compound OC(=O)CN(CC(O)=O)CCN(CC(O)=O)CC(O)=O KCXVZYZYPLLWCC-UHFFFAOYSA-N 0.000 description 1
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 1
- 108010010803 Gelatin Proteins 0.000 description 1
- 239000007818 Grignard reagent Substances 0.000 description 1
- 206010020751 Hypersensitivity Diseases 0.000 description 1
- KSMITTDZTTZFML-LURJTMIESA-N Jasminine Chemical compound C[C@@H]1NC(=O)CC2=C1C=NC=C2C(=O)OC KSMITTDZTTZFML-LURJTMIESA-N 0.000 description 1
- 239000003810 Jones reagent Substances 0.000 description 1
- 239000005909 Kieselgur Substances 0.000 description 1
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 1
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 1
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical class CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 1
- 239000007832 Na2SO4 Substances 0.000 description 1
- 239000005642 Oleic acid Substances 0.000 description 1
- ZQPPMHVWECSIRJ-UHFFFAOYSA-N Oleic acid Natural products CCCCCCCCC=CCCCCCCCC(O)=O ZQPPMHVWECSIRJ-UHFFFAOYSA-N 0.000 description 1
- 241000283973 Oryctolagus cuniculus Species 0.000 description 1
- 102000016387 Pancreatic elastase Human genes 0.000 description 1
- 108010067372 Pancreatic elastase Proteins 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- 102100038239 Protein Churchill Human genes 0.000 description 1
- 101100545004 Saccharomyces cerevisiae (strain ATCC 204508 / S288c) YSP2 gene Proteins 0.000 description 1
- 206010070834 Sensitisation Diseases 0.000 description 1
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 1
- 229920002472 Starch Polymers 0.000 description 1
- CZMRCDWAGMRECN-UGDNZRGBSA-N Sucrose Chemical compound O[C@H]1[C@H](O)[C@@H](CO)O[C@@]1(CO)O[C@@H]1[C@H](O)[C@@H](O)[C@H](O)[C@@H](CO)O1 CZMRCDWAGMRECN-UGDNZRGBSA-N 0.000 description 1
- 229930006000 Sucrose Natural products 0.000 description 1
- DRGKLKLKQOORMX-UHFFFAOYSA-N [1-(1-acetylindol-2-yl)ethyl-carbamoylamino] acetate Chemical compound C1=CC=C2N(C(C)=O)C(C(N(OC(C)=O)C(N)=O)C)=CC2=C1 DRGKLKLKQOORMX-UHFFFAOYSA-N 0.000 description 1
- 238000010521 absorption reaction Methods 0.000 description 1
- DHKHKXVYLBGOIT-UHFFFAOYSA-N acetaldehyde Diethyl Acetal Natural products CCOC(C)OCC DHKHKXVYLBGOIT-UHFFFAOYSA-N 0.000 description 1
- 150000001241 acetals Chemical class 0.000 description 1
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 239000003929 acidic solution Substances 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 230000009471 action Effects 0.000 description 1
- 239000013543 active substance Substances 0.000 description 1
- 239000000443 aerosol Substances 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 150000001342 alkaline earth metals Chemical class 0.000 description 1
- 208000026935 allergic disease Diseases 0.000 description 1
- 230000007815 allergy Effects 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 229910021529 ammonia Inorganic materials 0.000 description 1
- 238000000540 analysis of variance Methods 0.000 description 1
- 150000008064 anhydrides Chemical class 0.000 description 1
- 239000000427 antigen Substances 0.000 description 1
- 102000036639 antigens Human genes 0.000 description 1
- 108091007433 antigens Proteins 0.000 description 1
- 206010003246 arthritis Diseases 0.000 description 1
- 125000005018 aryl alkenyl group Chemical group 0.000 description 1
- 125000003710 aryl alkyl group Chemical group 0.000 description 1
- 125000002102 aryl alkyloxo group Chemical group 0.000 description 1
- 125000004104 aryloxy group Chemical group 0.000 description 1
- 239000012298 atmosphere Substances 0.000 description 1
- 230000008901 benefit Effects 0.000 description 1
- PASDCCFISLVPSO-UHFFFAOYSA-N benzoyl chloride Chemical compound ClC(=O)C1=CC=CC=C1 PASDCCFISLVPSO-UHFFFAOYSA-N 0.000 description 1
- 125000003236 benzoyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C(*)=O 0.000 description 1
- 235000019400 benzoyl peroxide Nutrition 0.000 description 1
- 125000000051 benzyloxy group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])O* 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- 230000008238 biochemical pathway Effects 0.000 description 1
- 230000036760 body temperature Effects 0.000 description 1
- UORVGPXVDQYIDP-BJUDXGSMSA-N borane Chemical class [10BH3] UORVGPXVDQYIDP-BJUDXGSMSA-N 0.000 description 1
- LRJRPHROCLHMHK-UHFFFAOYSA-N boron;n,n-dimethylmethanamine Chemical compound [B].CN(C)C LRJRPHROCLHMHK-UHFFFAOYSA-N 0.000 description 1
- 229940098773 bovine serum albumin Drugs 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- 150000001649 bromium compounds Chemical class 0.000 description 1
- 230000007885 bronchoconstriction Effects 0.000 description 1
- 239000006172 buffering agent Substances 0.000 description 1
- DVECBJCOGJRVPX-UHFFFAOYSA-N butyryl chloride Chemical compound CCCC(Cl)=O DVECBJCOGJRVPX-UHFFFAOYSA-N 0.000 description 1
- 125000004063 butyryl group Chemical group O=C([*])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 239000001569 carbon dioxide Substances 0.000 description 1
- 235000011089 carbon dioxide Nutrition 0.000 description 1
- 229910002092 carbon dioxide Inorganic materials 0.000 description 1
- 239000000969 carrier Substances 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 239000005482 chemotactic factor Substances 0.000 description 1
- 239000000460 chlorine Substances 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 125000004218 chloromethyl group Chemical group [H]C([H])(Cl)* 0.000 description 1
- 238000013375 chromatographic separation Methods 0.000 description 1
- 238000000576 coating method Methods 0.000 description 1
- 229940110456 cocoa butter Drugs 0.000 description 1
- 235000019868 cocoa butter Nutrition 0.000 description 1
- 235000014510 cooky Nutrition 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 125000000753 cycloalkyl group Chemical group 0.000 description 1
- 125000001995 cyclobutyl group Chemical group [H]C1([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 description 1
- 239000008355 dextrose injection Substances 0.000 description 1
- 235000005911 diet Nutrition 0.000 description 1
- 230000037213 diet Effects 0.000 description 1
- 235000014113 dietary fatty acids Nutrition 0.000 description 1
- VAYGXNSJCAHWJZ-UHFFFAOYSA-N dimethyl sulfate Chemical compound COS(=O)(=O)OC VAYGXNSJCAHWJZ-UHFFFAOYSA-N 0.000 description 1
- OIKHZBFJHONJJB-UHFFFAOYSA-N dimethyl(phenyl)silicon Chemical compound C[Si](C)C1=CC=CC=C1 OIKHZBFJHONJJB-UHFFFAOYSA-N 0.000 description 1
- YWEUIGNSBFLMFL-UHFFFAOYSA-N diphosphonate Chemical compound O=P(=O)OP(=O)=O YWEUIGNSBFLMFL-UHFFFAOYSA-N 0.000 description 1
- 230000006806 disease prevention Effects 0.000 description 1
- 239000002270 dispersing agent Substances 0.000 description 1
- 229940079593 drug Drugs 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 239000003995 emulsifying agent Substances 0.000 description 1
- 230000001804 emulsifying effect Effects 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- 125000000219 ethylidene group Chemical group [H]C(=[*])C([H])([H])[H] 0.000 description 1
- 125000006125 ethylsulfonyl group Chemical group 0.000 description 1
- 230000029142 excretion Effects 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- 239000000194 fatty acid Substances 0.000 description 1
- 229930195729 fatty acid Natural products 0.000 description 1
- 150000004665 fatty acids Chemical class 0.000 description 1
- 239000000796 flavoring agent Substances 0.000 description 1
- 239000011737 fluorine Substances 0.000 description 1
- 229910052731 fluorine Inorganic materials 0.000 description 1
- 239000006260 foam Substances 0.000 description 1
- 235000013355 food flavoring agent Nutrition 0.000 description 1
- 235000003599 food sweetener Nutrition 0.000 description 1
- 125000002485 formyl group Chemical group [H]C(*)=O 0.000 description 1
- 239000003205 fragrance Substances 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 238000003304 gavage Methods 0.000 description 1
- 239000008273 gelatin Substances 0.000 description 1
- 229920000159 gelatin Polymers 0.000 description 1
- 235000019322 gelatine Nutrition 0.000 description 1
- 235000011852 gelatine desserts Nutrition 0.000 description 1
- 210000000224 granular leucocyte Anatomy 0.000 description 1
- 239000008187 granular material Substances 0.000 description 1
- 150000004795 grignard reagents Chemical class 0.000 description 1
- 125000001188 haloalkyl group Chemical group 0.000 description 1
- 125000005843 halogen group Chemical group 0.000 description 1
- 230000036541 health Effects 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 125000000623 heterocyclic group Chemical group 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- 150000002443 hydroxylamines Chemical class 0.000 description 1
- UTWGRMYWDUMKNY-UHFFFAOYSA-N indole-1-carboxylic acid Chemical compound C1=CC=C2N(C(=O)O)C=CC2=C1 UTWGRMYWDUMKNY-UHFFFAOYSA-N 0.000 description 1
- 239000003701 inert diluent Substances 0.000 description 1
- 238000001802 infusion Methods 0.000 description 1
- 239000003112 inhibitor Substances 0.000 description 1
- 239000007972 injectable composition Substances 0.000 description 1
- 230000000968 intestinal effect Effects 0.000 description 1
- 238000001361 intraarterial administration Methods 0.000 description 1
- 238000007912 intraperitoneal administration Methods 0.000 description 1
- 238000001990 intravenous administration Methods 0.000 description 1
- 150000004694 iodide salts Chemical class 0.000 description 1
- 239000011630 iodine Substances 0.000 description 1
- 229910052740 iodine Inorganic materials 0.000 description 1
- QXJSBBXBKPUZAA-UHFFFAOYSA-N isooleic acid Natural products CCCCCCCC=CCCCCCCCCC(O)=O QXJSBBXBKPUZAA-UHFFFAOYSA-N 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- XLTUPERVRFLGLJ-UHFFFAOYSA-N isothiocyanato(trimethyl)silane Chemical compound C[Si](C)(C)N=C=S XLTUPERVRFLGLJ-UHFFFAOYSA-N 0.000 description 1
- 239000008101 lactose Substances 0.000 description 1
- VNYSSYRCGWBHLG-AMOLWHMGSA-N leukotriene B4 Chemical compound CCCCC\C=C/C[C@@H](O)\C=C\C=C\C=C/[C@@H](O)CCCC(O)=O VNYSSYRCGWBHLG-AMOLWHMGSA-N 0.000 description 1
- GWNVDXQDILPJIG-NXOLIXFESA-N leukotriene C4 Chemical compound CCCCC\C=C/C\C=C/C=C/C=C/[C@H]([C@@H](O)CCCC(O)=O)SC[C@@H](C(=O)NCC(O)=O)NC(=O)CC[C@H](N)C(O)=O GWNVDXQDILPJIG-NXOLIXFESA-N 0.000 description 1
- 238000012417 linear regression Methods 0.000 description 1
- 125000005647 linker group Chemical group 0.000 description 1
- 150000002632 lipids Chemical class 0.000 description 1
- 239000008297 liquid dosage form Substances 0.000 description 1
- 229910052744 lithium Inorganic materials 0.000 description 1
- 229910003002 lithium salt Inorganic materials 0.000 description 1
- 159000000002 lithium salts Chemical class 0.000 description 1
- UBJFKNSINUCEAL-UHFFFAOYSA-N lithium;2-methylpropane Chemical compound [Li+].C[C-](C)C UBJFKNSINUCEAL-UHFFFAOYSA-N 0.000 description 1
- 239000007937 lozenge Substances 0.000 description 1
- 239000000314 lubricant Substances 0.000 description 1
- 239000011777 magnesium Substances 0.000 description 1
- 229910052749 magnesium Inorganic materials 0.000 description 1
- RMGJCSHZTFKPNO-UHFFFAOYSA-M magnesium;ethene;bromide Chemical compound [Mg+2].[Br-].[CH-]=C RMGJCSHZTFKPNO-UHFFFAOYSA-M 0.000 description 1
- 230000037353 metabolic pathway Effects 0.000 description 1
- 230000004060 metabolic process Effects 0.000 description 1
- 229920000609 methyl cellulose Polymers 0.000 description 1
- JYQQWQJCEUMXQZ-UHFFFAOYSA-N methyl cyanate Chemical group COC#N JYQQWQJCEUMXQZ-UHFFFAOYSA-N 0.000 description 1
- 239000001923 methylcellulose Substances 0.000 description 1
- 125000004170 methylsulfonyl group Chemical group [H]C([H])([H])S(*)(=O)=O 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 210000004400 mucous membrane Anatomy 0.000 description 1
- UTTMHMHHOULJMD-UHFFFAOYSA-N n-(oxan-2-yl)hydroxylamine Chemical compound ONC1CCCCO1 UTTMHMHHOULJMD-UHFFFAOYSA-N 0.000 description 1
- LYNWDHNMGAKITE-UHFFFAOYSA-N n-[1-(1-benzothiophen-2-yl)ethylidene]hydroxylamine Chemical compound C1=CC=C2SC(C(=NO)C)=CC2=C1 LYNWDHNMGAKITE-UHFFFAOYSA-N 0.000 description 1
- MDNKDODTEXBCCG-UHFFFAOYSA-N n-[1-(3-methoxy-1-benzothiophen-2-yl)ethyl]hydroxylamine Chemical compound C1=CC=C2C(OC)=C(C(C)NO)SC2=C1 MDNKDODTEXBCCG-UHFFFAOYSA-N 0.000 description 1
- OJSPRVRFZJRMOE-UHFFFAOYSA-N n-[1-(5-fluoro-1-benzothiophen-2-yl)ethyl]hydroxylamine Chemical compound FC1=CC=C2SC(C(NO)C)=CC2=C1 OJSPRVRFZJRMOE-UHFFFAOYSA-N 0.000 description 1
- DBWMDDOOEIGZPC-UHFFFAOYSA-N n-[3-(1-benzothiophen-2-yl)prop-2-enyl]hydroxylamine Chemical compound C1=CC=C2SC(C=CCNO)=CC2=C1 DBWMDDOOEIGZPC-UHFFFAOYSA-N 0.000 description 1
- HVPVKLTWYRYQCF-UHFFFAOYSA-N n-[3-(1-benzothiophen-3-yl)prop-2-enyl]hydroxylamine Chemical compound C1=CC=C2C(C=CCNO)=CSC2=C1 HVPVKLTWYRYQCF-UHFFFAOYSA-N 0.000 description 1
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- VDUIPQNXOQMTBF-UHFFFAOYSA-N n-ethylhydroxylamine Chemical compound CCNO VDUIPQNXOQMTBF-UHFFFAOYSA-N 0.000 description 1
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 210000000440 neutrophil Anatomy 0.000 description 1
- 231100000344 non-irritating Toxicity 0.000 description 1
- NLXXVSKHVGDQAT-UHFFFAOYSA-N o-(oxan-2-yl)hydroxylamine Chemical compound NOC1CCCCO1 NLXXVSKHVGDQAT-UHFFFAOYSA-N 0.000 description 1
- ZQPPMHVWECSIRJ-KTKRTIGZSA-N oleic acid Chemical compound CCCCCCCC\C=C/CCCCCCCC(O)=O ZQPPMHVWECSIRJ-KTKRTIGZSA-N 0.000 description 1
- 150000002894 organic compounds Chemical class 0.000 description 1
- 238000006213 oxygenation reaction Methods 0.000 description 1
- 230000020477 pH reduction Effects 0.000 description 1
- 230000002085 persistent effect Effects 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- DLYUQMMRRRQYAE-UHFFFAOYSA-N phosphorus pentoxide Inorganic materials O1P(O2)(=O)OP3(=O)OP1(=O)OP2(=O)O3 DLYUQMMRRRQYAE-UHFFFAOYSA-N 0.000 description 1
- 239000004033 plastic Substances 0.000 description 1
- 229920003023 plastic Polymers 0.000 description 1
- 229920001223 polyethylene glycol Polymers 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- IUBQJLUDMLPAGT-UHFFFAOYSA-N potassium bis(trimethylsilyl)amide Chemical compound C[Si](C)(C)N([K])[Si](C)(C)C IUBQJLUDMLPAGT-UHFFFAOYSA-N 0.000 description 1
- GKKCIDNWFBPDBW-UHFFFAOYSA-M potassium cyanate Chemical compound [K]OC#N GKKCIDNWFBPDBW-UHFFFAOYSA-M 0.000 description 1
- 239000002243 precursor Substances 0.000 description 1
- 230000002265 prevention Effects 0.000 description 1
- 125000001501 propionyl group Chemical group O=C([*])C([H])([H])C([H])([H])[H] 0.000 description 1
- OSFBJERFMQCEQY-UHFFFAOYSA-N propylidene Chemical compound [CH]CC OSFBJERFMQCEQY-UHFFFAOYSA-N 0.000 description 1
- 125000001453 quaternary ammonium group Chemical group 0.000 description 1
- 238000003127 radioimmunoassay Methods 0.000 description 1
- 210000000664 rectum Anatomy 0.000 description 1
- 230000009467 reduction Effects 0.000 description 1
- 125000002914 sec-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 230000008313 sensitization Effects 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 235000017557 sodium bicarbonate Nutrition 0.000 description 1
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 1
- 239000012279 sodium borohydride Substances 0.000 description 1
- 229910000033 sodium borohydride Inorganic materials 0.000 description 1
- ZVCDLGYNFYZZOK-UHFFFAOYSA-M sodium cyanate Chemical compound [Na]OC#N ZVCDLGYNFYZZOK-UHFFFAOYSA-M 0.000 description 1
- BEOOHQFXGBMRKU-UHFFFAOYSA-N sodium cyanoborohydride Chemical compound [Na+].[B-]C#N BEOOHQFXGBMRKU-UHFFFAOYSA-N 0.000 description 1
- 239000012312 sodium hydride Substances 0.000 description 1
- 229910000104 sodium hydride Inorganic materials 0.000 description 1
- 238000004611 spectroscopical analysis Methods 0.000 description 1
- 238000012453 sprague-dawley rat model Methods 0.000 description 1
- 239000007921 spray Substances 0.000 description 1
- 239000008107 starch Substances 0.000 description 1
- 235000019698 starch Nutrition 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 238000007920 subcutaneous administration Methods 0.000 description 1
- 239000000758 substrate Substances 0.000 description 1
- 239000005720 sucrose Substances 0.000 description 1
- 239000006228 supernatant Substances 0.000 description 1
- 239000000829 suppository Substances 0.000 description 1
- 239000003765 sweetening agent Substances 0.000 description 1
- 208000024891 symptom Diseases 0.000 description 1
- 238000002636 symptomatic treatment Methods 0.000 description 1
- 210000001179 synovial fluid Anatomy 0.000 description 1
- 238000010189 synthetic method Methods 0.000 description 1
- 239000006188 syrup Substances 0.000 description 1
- 235000020357 syrup Nutrition 0.000 description 1
- 230000009897 systematic effect Effects 0.000 description 1
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- CBXCPBUEXACCNR-UHFFFAOYSA-N tetraethylammonium Chemical compound CC[N+](CC)(CC)CC CBXCPBUEXACCNR-UHFFFAOYSA-N 0.000 description 1
- 229940073455 tetraethylammonium hydroxide Drugs 0.000 description 1
- LRGJRHZIDJQFCL-UHFFFAOYSA-M tetraethylazanium;hydroxide Chemical compound [OH-].CC[N+](CC)(CC)CC LRGJRHZIDJQFCL-UHFFFAOYSA-M 0.000 description 1
- QEMXHQIAXOOASZ-UHFFFAOYSA-N tetramethylammonium Chemical compound C[N+](C)(C)C QEMXHQIAXOOASZ-UHFFFAOYSA-N 0.000 description 1
- PXLVRFQEBVNJOH-UHFFFAOYSA-N thialbarbital Chemical compound C1CCC=CC1C1(CC=C)C(=O)NC(=S)NC1=O PXLVRFQEBVNJOH-UHFFFAOYSA-N 0.000 description 1
- 239000010409 thin film Substances 0.000 description 1
- 125000004001 thioalkyl group Chemical group 0.000 description 1
- 125000004014 thioethyl group Chemical group [H]SC([H])([H])C([H])([H])* 0.000 description 1
- 125000004055 thiomethyl group Chemical group [H]SC([H])([H])* 0.000 description 1
- 229930192474 thiophene Natural products 0.000 description 1
- NBOMNTLFRHMDEZ-UHFFFAOYSA-N thiosalicylic acid Chemical compound OC(=O)C1=CC=CC=C1S NBOMNTLFRHMDEZ-UHFFFAOYSA-N 0.000 description 1
- 229940103494 thiosalicylic acid Drugs 0.000 description 1
- 210000001519 tissue Anatomy 0.000 description 1
- 125000005490 tosylate group Chemical group 0.000 description 1
- 230000009466 transformation Effects 0.000 description 1
- 238000000844 transformation Methods 0.000 description 1
- 150000003626 triacylglycerols Chemical class 0.000 description 1
- 150000008648 triflates Chemical class 0.000 description 1
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
- XOOUIPVCVHRTMJ-UHFFFAOYSA-L zinc stearate Chemical class [Zn+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O XOOUIPVCVHRTMJ-UHFFFAOYSA-L 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D209/00—Heterocyclic compounds containing five-membered rings, condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D209/02—Heterocyclic compounds containing five-membered rings, condensed with other rings, with one nitrogen atom as the only ring hetero atom condensed with one carbocyclic ring
- C07D209/04—Indoles; Hydrogenated indoles
- C07D209/10—Indoles; Hydrogenated indoles with substituted hydrocarbon radicals attached to carbon atoms of the hetero ring
- C07D209/14—Radicals substituted by nitrogen atoms, not forming part of a nitro radical
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P11/00—Drugs for disorders of the respiratory system
- A61P11/16—Central respiratory analeptics
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P29/00—Non-central analgesic, antipyretic or antiinflammatory agents, e.g. antirheumatic agents; Non-steroidal antiinflammatory drugs [NSAID]
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P37/00—Drugs for immunological or allergic disorders
- A61P37/08—Antiallergic agents
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P43/00—Drugs for specific purposes, not provided for in groups A61P1/00-A61P41/00
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D307/00—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom
- C07D307/77—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom ortho- or peri-condensed with carbocyclic rings or ring systems
- C07D307/78—Benzo [b] furans; Hydrogenated benzo [b] furans
- C07D307/79—Benzo [b] furans; Hydrogenated benzo [b] furans with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to carbon atoms of the hetero ring
- C07D307/81—Radicals substituted by nitrogen atoms not forming part of a nitro radical
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D333/00—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom
- C07D333/50—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom condensed with carbocyclic rings or ring systems
- C07D333/52—Benzo[b]thiophenes; Hydrogenated benzo[b]thiophenes
- C07D333/54—Benzo[b]thiophenes; Hydrogenated benzo[b]thiophenes with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to carbon atoms of the hetero ring
- C07D333/58—Radicals substituted by nitrogen atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Life Sciences & Earth Sciences (AREA)
- General Health & Medical Sciences (AREA)
- Veterinary Medicine (AREA)
- Chemical Kinetics & Catalysis (AREA)
- General Chemical & Material Sciences (AREA)
- Medicinal Chemistry (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Public Health (AREA)
- Pharmacology & Pharmacy (AREA)
- Animal Behavior & Ethology (AREA)
- Engineering & Computer Science (AREA)
- Bioinformatics & Cheminformatics (AREA)
- Pulmonology (AREA)
- Immunology (AREA)
- Pain & Pain Management (AREA)
- Rheumatology (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Furan Compounds (AREA)
- Indole Compounds (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
- Heterocyclic Carbon Compounds Containing A Hetero Ring Having Oxygen Or Sulfur (AREA)
Applications Claiming Priority (3)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US1297087A | 1987-02-10 | 1987-02-10 | |
| US6078487A | 1987-06-10 | 1987-06-10 | |
| US07/138,073 US4873259A (en) | 1987-06-10 | 1988-01-11 | Indole, benzofuran, benzothiophene containing lipoxygenase inhibiting compounds |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE3882732D1 DE3882732D1 (de) | 1993-09-09 |
| DE3882732T2 true DE3882732T2 (de) | 1993-12-02 |
Family
ID=27359744
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE88101386T Expired - Lifetime DE3882732T2 (de) | 1987-02-10 | 1988-02-01 | Indol, Benzofuran, Benzothiophen enthaltende, Lipoxygenase hemmende Verbindungen. |
Country Status (8)
| Country | Link |
|---|---|
| EP (1) | EP0279263B1 (show.php) |
| JP (1) | JPS63264456A (show.php) |
| KR (1) | KR960004865B1 (show.php) |
| AU (1) | AU608804B2 (show.php) |
| CA (2) | CA1306744C (show.php) |
| DE (1) | DE3882732T2 (show.php) |
| ES (1) | ES2059408T3 (show.php) |
| MX (2) | MX9202874A (show.php) |
Families Citing this family (65)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0292699B1 (en) * | 1987-04-24 | 1994-03-23 | Abbott Laboratories | Urea based lipoxygenase inhibiting compounds |
| CA1334975C (en) * | 1987-11-13 | 1995-03-28 | James H. Holms | Furan and pyrrole containing lipoxygenase inhibiting compounds |
| US4822811A (en) * | 1987-11-13 | 1989-04-18 | Abbott Laboratories | Carbazole lipoxygenase inhibiting compounds, compositions and use |
| GB8830427D0 (en) * | 1988-12-30 | 1989-03-01 | Fujisawa Pharmaceutical Co | New hydroxylamine derivatives,a process for the preparation thereof and pharmaceutical composition comprising the same |
| US5096919A (en) * | 1989-01-05 | 1992-03-17 | Ciba-Geigy Corporation | Pyrrolylphenyl-substituted hydroxamic acid derivatives |
| US5175183A (en) * | 1989-02-01 | 1992-12-29 | Abbott Laboratories | Lipoxygenase inhibiting compounds |
| EP0456760A4 (en) * | 1989-02-01 | 1992-01-08 | Abbott Laboratories | Lipoxygenase inhibiting compounds |
| US4960787A (en) * | 1989-02-06 | 1990-10-02 | Ciba-Geigy Corporation | Certain pyrrolyl-substituted hydroxamic acid derivatives |
| US5075330A (en) * | 1989-05-26 | 1991-12-24 | Warner-Lambert Co. | N-hydroxyamide, N-hydroxythioamide, N-hydroxyurea, and N-hydroxythiourea derivatives of selected NSAIDS as antiinflammatory agents |
| US4981865A (en) * | 1989-05-26 | 1991-01-01 | Warner-Lambert Co. | N-hydroxyamide, N-hydroxythioamide, hydroxyurea, and N-hydroxythiourea derivatives of selected nsaids as antiinflammatory agents |
| US5112846A (en) * | 1989-05-26 | 1992-05-12 | Warner-Lambert Company | N-hydroxyamide, N-hydroxythioamide, hydroxyurea, and N-hydroxythiourea derivatives of selected nsaids as antiinflammatory agents |
| JP3065636B2 (ja) * | 1989-06-29 | 2000-07-17 | 塩野義製薬株式会社 | [ジ―tert―ブチル(ヒドロキシ)フェニルチオ]置換ヒドロキサム酸誘導体 |
| US5272145A (en) * | 1989-08-22 | 1993-12-21 | Merck Frosst Canada, Inc. | (Quinolin-2-ylmethoxy)indoles as inhibitors of the biosynthesis of leukotrienes |
| IL95584A (en) * | 1989-09-07 | 1995-03-15 | Abbott Lab | Indole-, benzoporene- and benzothiophene compounds including lipoxygenase-inhibiting compounds and pharmaceutical compounds containing them |
| US5120752A (en) * | 1989-12-28 | 1992-06-09 | Abbott Laboratories | Cyclopropyl derivative lipoxygenase inhibitors |
| US5093356A (en) * | 1990-01-16 | 1992-03-03 | Merck Frosst Canada, Inc. | Indenyl hydroxamic acids and hydroxy ureas as inhibitors of 5-lipoxygenase |
| GB9002375D0 (en) * | 1990-02-02 | 1990-04-04 | Pfizer Ltd | Triazole antifungal agents |
| US5036067A (en) * | 1990-03-14 | 1991-07-30 | Merck & Co., Inc. | Dibenzoheterocyclic hydroxamic acids and hydroxy ureas as inhibitors of 5-lipoxygenase |
| KR900016822A (ko) * | 1990-04-20 | 1990-11-14 | 하라 레이노스께 | 슬라이드 프로젝터 |
| GB9012252D0 (en) * | 1990-06-01 | 1990-07-18 | Lilly Industries Ltd | Pharmaceutical compounds |
| ES2095325T3 (es) * | 1990-07-25 | 1997-02-16 | Abbott Lab | Derivados de acetileno con una actividad de inhibicion de la lipoxigenasa. |
| US5476873A (en) * | 1990-07-25 | 1995-12-19 | Abbott Laboratories | Acetylene derivatives having lipoxygenase inhibitory activity |
| GB9017351D0 (en) * | 1990-08-08 | 1990-09-19 | Wellcome Found | Medicaments for treatment of atherosclerosis |
| JP2528741B2 (ja) * | 1991-01-09 | 1996-08-28 | ファイザー製薬株式会社 | オキサゾ―ル、チアゾ―ルおよびイミダゾ―ル化合物 |
| JPH0730061B2 (ja) * | 1991-02-07 | 1995-04-05 | ファイザー製薬株式会社 | ヒドロキサム酸誘導体および組成物 |
| US5132319A (en) * | 1991-03-28 | 1992-07-21 | Merck Frosst Canada, Inc. | 1-(hydroxylaminoalkyl) indole derivatives as inhibitors of leukotriene biosynthesis |
| US5128364A (en) * | 1991-03-28 | 1992-07-07 | Merck Frosst Canada, Inc. | Pyrrolo[1,2-a]indole hydroxylamine derivatives as inhibitors of leukotriene biosynthesis |
| US5283361A (en) * | 1991-04-23 | 1994-02-01 | Eli Lilly And Company | N-hydroxy-N-[3-[2-(halophenylthio)phenyl]prop-2-enyl]ureas as lipoxygenase inhibitors |
| US5130485A (en) * | 1991-04-23 | 1992-07-14 | Eli Lilly And Company | N-hydroxy-N-(3-(2-substituted phenyl)prop-2-enyl)ureas and thioureas useful as 5-lipoxygenase inhibiting agents |
| US5250552A (en) * | 1991-05-09 | 1993-10-05 | Warner-Lambert Company | 3-[thiazolidinone, oxazolidinone, imidazolidinone]-indoles as antiinflammatory agents |
| US5143927A (en) * | 1991-05-09 | 1992-09-01 | Warner-Lambert Company | 3-(thiazolidone, oxazolidinone, imidazolidinone)-indoles as antiinflammatory agents |
| US5442111A (en) * | 1991-05-24 | 1995-08-15 | Warner-Lambert Company | 3,5-di-tetriary-4-butyl-4-hydroxyphenyloxy- or tioalkylene N-hydroxyamides, N-hydroxythioamides, N-hydroxyureas, and N-hydroxythioureas as 5-lipoxygenase inhibitors |
| JPH0717612B2 (ja) * | 1991-06-28 | 1995-03-01 | ファイザー製薬株式会社 | 新規なテトラヒドロベンズアゼピン誘導体 |
| US5214204A (en) * | 1991-07-19 | 1993-05-25 | Abbott Laboratories | Arylamidoalkyl-n-hydroxyurea compounds having lipoxygenase inhibitory activity |
| DE4124345A1 (de) * | 1991-07-23 | 1993-01-28 | Gruenenthal Gmbh | Substituierte 3,4-dihydronaphthaline, diese verbindungen enthaltende arzneimittel und verfahren zur herstellung dieser verbindungen und arzneimittel |
| US5260316A (en) * | 1991-07-30 | 1993-11-09 | Ciba-Geigy Corporation | Isoquinolyl substituted hydroxylamine derivatives |
| EP0526402B1 (en) * | 1991-07-30 | 1998-01-21 | Novartis AG | Heteroaryl substituted hydroxylamine derivatives as lipoxygenase inhibitors |
| US5334600A (en) * | 1991-07-30 | 1994-08-02 | Ciba-Geigy Corporation | Isoquinolyl substituted hydroxylamine derivatives |
| US5350761A (en) * | 1991-07-30 | 1994-09-27 | Ciba-Geigy Corporation | Indolyl substituted hydroxylamine derivatives |
| US5124347A (en) * | 1991-07-31 | 1992-06-23 | Warner-Lambert Co. | 3-5-ditertiarybutylphenyl-4-hydroxymethylidene derivatives of 1,3-dihydro-2H-indole-2-ones as antiinflammatory agents |
| US5389650A (en) * | 1991-09-30 | 1995-02-14 | Merck Frosst Canada, Inc. | (Azaarylmethoxy)indoles as inhibitors of leukotriene biosynthesis |
| US5308850A (en) * | 1991-09-30 | 1994-05-03 | Merck Frosst Canada, Inc. | (Bicyclic-hetero-arylmethoxy)indoles as inhibitors of leukotriene biosynthesis |
| US5290798A (en) * | 1991-09-30 | 1994-03-01 | Merck Frosst Canada, Inc. | (hetero-arylmethoxy)indoles as inhibitors of leukotriene biosynthesis |
| US5190968A (en) * | 1991-09-30 | 1993-03-02 | Merck Frosst Canada, Inc. | (Polycyclic-arylmethoxy) indoles as inhibitors of leukotriene biosynthesis |
| US5234933A (en) * | 1991-10-31 | 1993-08-10 | Board Of Governors Of Wayne State University And Vanderbilt University | Cyclic hydroxamic acids |
| FR2687402B1 (fr) * | 1992-02-14 | 1995-06-30 | Lipha | Nouveaux azaindoles, procedes de preparation et medicaments les contenant. |
| US5541218A (en) * | 1992-07-23 | 1996-07-30 | Pfizer Inc. | Indolinyl N-hydroxyurea and N-hydroxamic acid derivatives as lipoxygenase inhibitors |
| JP2661841B2 (ja) * | 1992-07-23 | 1997-10-08 | ファイザー製薬株式会社 | インドリン誘導体 |
| FR2695930B1 (fr) * | 1992-09-22 | 1994-12-23 | Sanofi Elf | Dérivé du 2-éthyl benzo[b]thiophène, son procédé de préparation et son utilisation comme intermédiaire de synthèse. |
| US5374635A (en) * | 1993-03-29 | 1994-12-20 | Merck Frosst Canada, Inc. | Furo[3,2-b]pyridines and thieno[3,2-b]pyridines as inhibitors of leukotriene biosynthesis |
| WO1994026269A1 (en) * | 1993-05-10 | 1994-11-24 | Sepracor, Inc. | Methods and compositions for treating asthma, atherosclerosis andinflammatory diseases using optically pure (-)-zileuton |
| JP3322885B2 (ja) * | 1995-02-02 | 2002-09-09 | 日研化学株式会社 | N−ヒドロキシウレア誘導体 |
| DE10103506A1 (de) * | 2001-01-26 | 2002-08-14 | Ingo S Neu | Pharmazeutische Zusammensetzung zur Behandlung von Multiple Sklerose |
| US20030055084A1 (en) * | 2001-07-30 | 2003-03-20 | Millennium Pharmaceutical, Inc. | Pharmaceutical compounds and methods of use thereof |
| JP2004256511A (ja) * | 2003-02-27 | 2004-09-16 | Yasuo Kikukawa | ピコリンボランを用いる還元反応 |
| TW200616967A (en) | 2004-06-24 | 2006-06-01 | Smithkline Beecham Corp | Novel indazole carboxamides and their use |
| TW200626142A (en) | 2004-09-21 | 2006-08-01 | Glaxo Group Ltd | Chemical compounds |
| US8063071B2 (en) | 2007-10-31 | 2011-11-22 | GlaxoSmithKline, LLC | Chemical compounds |
| EP2409973A1 (en) * | 2006-02-21 | 2012-01-25 | Critical Therapeutics, Inc. | New crystal form and pharmaceutical compositions of (+)-R-zileuton |
| JPWO2007114213A1 (ja) | 2006-03-30 | 2009-08-13 | 旭化成ファーマ株式会社 | 置換二環式環状誘導体及びその用途 |
| AR065804A1 (es) | 2007-03-23 | 2009-07-01 | Smithkline Beecham Corp | Compuesto de indol carboxamida, composicion farmaceutica que lo comprende y uso de dicho compuesto para preparar un medicamento |
| RU2479579C2 (ru) | 2008-04-28 | 2013-04-20 | Асахи Касеи Фарма Корпорейшн | Производное фенилпропионовой кислоты и его применение |
| WO2010050445A1 (ja) * | 2008-10-27 | 2010-05-06 | 武田薬品工業株式会社 | 二環性化合物 |
| EP2406249A1 (en) | 2009-03-10 | 2012-01-18 | Glaxo Group Limited | Indole derivatives as ikk2 inhibitors |
| US10266488B2 (en) | 2013-10-10 | 2019-04-23 | Eastern Virginia Medical School | 4-((2-hydroxy-3-methoxybenzyl)amino)benzenesulfonamide derivatives as potent and selective inhibitors of 12-lipoxygenase |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB1231170A (show.php) * | 1967-12-15 | 1971-05-12 |
-
1988
- 1988-02-01 DE DE88101386T patent/DE3882732T2/de not_active Expired - Lifetime
- 1988-02-01 EP EP88101386A patent/EP0279263B1/en not_active Expired - Lifetime
- 1988-02-01 ES ES88101386T patent/ES2059408T3/es not_active Expired - Lifetime
- 1988-02-09 CA CA000558457A patent/CA1306744C/en not_active Expired - Lifetime
- 1988-02-09 AU AU11433/88A patent/AU608804B2/en not_active Expired
- 1988-02-09 KR KR1019880001201A patent/KR960004865B1/ko not_active Expired - Lifetime
- 1988-02-10 JP JP63031683A patent/JPS63264456A/ja active Granted
-
1991
- 1991-06-18 CA CA000616096A patent/CA1327204C/en not_active Expired - Lifetime
-
1992
- 1992-06-15 MX MX9202874A patent/MX9202874A/es unknown
- 1992-06-24 MX MX9203187A patent/MX9203187A/es unknown
Also Published As
| Publication number | Publication date |
|---|---|
| MX9203187A (es) | 1992-07-01 |
| JPS63264456A (ja) | 1988-11-01 |
| CA1327204C (en) | 1994-02-22 |
| EP0279263B1 (en) | 1993-08-04 |
| ES2059408T3 (es) | 1994-11-16 |
| DE3882732D1 (de) | 1993-09-09 |
| KR890012994A (ko) | 1989-09-20 |
| EP0279263A3 (en) | 1989-12-27 |
| AU1143388A (en) | 1988-08-11 |
| JPH0569822B2 (show.php) | 1993-10-01 |
| KR960004865B1 (ko) | 1996-04-16 |
| EP0279263A2 (en) | 1988-08-24 |
| MX9202874A (es) | 1992-06-30 |
| AU608804B2 (en) | 1991-04-18 |
| CA1306744C (en) | 1992-08-25 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE3882732T2 (de) | Indol, Benzofuran, Benzothiophen enthaltende, Lipoxygenase hemmende Verbindungen. | |
| US4873259A (en) | Indole, benzofuran, benzothiophene containing lipoxygenase inhibiting compounds | |
| EP0320628B1 (en) | Substituted furan compounds which are useful in inhibiting lipoxygenase enzymes, particularly 5-lipoxygenase | |
| JPS63284155A (ja) | リポキシゲナーゼ抑制化合物 | |
| DE69524428T2 (de) | Dihydrobenzofuran und verwandte verbindungen als entzündungshemmende mittel | |
| DE69524186T2 (de) | Tricyclische Amidverbindungen, Verfahren zu deren Herstellung und sie enthaltende pharmazeutische Zusammensetzungen | |
| DE60316984T2 (de) | Benzoylsulfonamide als antitumor-mittel | |
| US4822809A (en) | Benzazole lipoxygenase inhibiting compounds | |
| US4822811A (en) | Carbazole lipoxygenase inhibiting compounds, compositions and use | |
| US4769387A (en) | Dibenzofuran lipoxygenase inhibiting compounds, compositions and use | |
| DE2727802A1 (de) | Sulfamoyl-arylketone und verfahren zu ihrer herstellung | |
| DE69605975T2 (de) | Arylalkyl(thio)carboxamidverbindungen mit Affinität für Melatoninrezeptoren, Verfahren zu ihrer Herstellung und sie enthaltende pharmazeutische Zusammensetzungen | |
| US3558667A (en) | Benzofurans from o-phenyl ketoximes | |
| DE69729083T2 (de) | Als entzündungshemmende mittel nützliche dihydrobenzofurane und verwandte verbindungen | |
| DE69803894T2 (de) | Heterozyclische Verbindungen, Verfahren zu deren Herstellung und diese enthaltende pharmazeutische Zusammenstellungen | |
| DE2737407A1 (de) | Verfahren zur herstellung neuer benzopyranderivate | |
| DE2717415A1 (de) | Verfahren zur herstellung von phenylpiperazinderivaten, phenylpiperazinderivate und diese enthaltende pharmazeutische zubereitungen | |
| DE1493672A1 (de) | Verfahren zur Herstellung von Benzolsulfonylharnstoffen | |
| DD283817A5 (de) | Verfahren zur herstellung heterocyclischer nitromethanderivate | |
| DE3300522C2 (show.php) | ||
| DE3889497T2 (de) | 3,4-Dihydro-2-alkyl-3-oxo-N-aryl-2H-[1]benzothieno[3,2-e]-1,2-thiazine-4-carboxamid-1,1-dioxide. | |
| DE2217329A1 (de) | Benzofuranderivate | |
| EP0008367A1 (de) | N-Arylsulfonylpyrrole, ihre Herstellung und diese enthaltende therapeutische Mittel | |
| US3684802A (en) | New anthelmintic agents | |
| EP0000574B1 (de) | Benzimidazol-2-Derivate, Verfahren zu ihrer Herstellung und ihre Verwendung zur Herstellung von Arzneimitteln |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8364 | No opposition during term of opposition |