DE3420796A1 - 2,4,5-trihalogen- bzw. 2,3,4,5-tetrahalogenbenzolderivate und verfahren zu ihrer herstellung - Google Patents
2,4,5-trihalogen- bzw. 2,3,4,5-tetrahalogenbenzolderivate und verfahren zu ihrer herstellungInfo
- Publication number
- DE3420796A1 DE3420796A1 DE19843420796 DE3420796A DE3420796A1 DE 3420796 A1 DE3420796 A1 DE 3420796A1 DE 19843420796 DE19843420796 DE 19843420796 DE 3420796 A DE3420796 A DE 3420796A DE 3420796 A1 DE3420796 A1 DE 3420796A1
- Authority
- DE
- Germany
- Prior art keywords
- fluoride
- trifluoro
- chloride
- acid
- derivatives
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Withdrawn
Links
- 238000000034 method Methods 0.000 title claims description 8
- 238000004519 manufacturing process Methods 0.000 title claims description 3
- AKAMNXFLKYKFOJ-UHFFFAOYSA-N 2,4,5-trifluorobenzoic acid Chemical compound OC(=O)C1=CC(F)=C(F)C=C1F AKAMNXFLKYKFOJ-UHFFFAOYSA-N 0.000 claims abstract description 7
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims abstract description 5
- 229910052801 chlorine Inorganic materials 0.000 claims description 18
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 claims description 16
- 238000003682 fluorination reaction Methods 0.000 claims description 15
- 239000011698 potassium fluoride Substances 0.000 claims description 15
- 229910052731 fluorine Inorganic materials 0.000 claims description 12
- NROKBHXJSPEDAR-UHFFFAOYSA-M potassium fluoride Chemical compound [F-].[K+] NROKBHXJSPEDAR-UHFFFAOYSA-M 0.000 claims description 12
- KRHYYFGTRYWZRS-UHFFFAOYSA-N Fluorane Chemical compound F KRHYYFGTRYWZRS-UHFFFAOYSA-N 0.000 claims description 10
- 239000002904 solvent Substances 0.000 claims description 9
- IEDMMCZBIKXEJP-UHFFFAOYSA-N 3-chloro-2,4,5-trifluorobenzoyl chloride Chemical compound FC1=CC(C(Cl)=O)=C(F)C(Cl)=C1F IEDMMCZBIKXEJP-UHFFFAOYSA-N 0.000 claims description 7
- HDPODBQAFOAFJY-UHFFFAOYSA-N 5-chloro-2,3,4-trifluorobenzoyl fluoride Chemical compound FC(=O)C1=CC(Cl)=C(F)C(F)=C1F HDPODBQAFOAFJY-UHFFFAOYSA-N 0.000 claims description 7
- IROWIXYGGPOJFJ-UHFFFAOYSA-N 2,3,4,5-tetrachlorobenzoyl chloride Chemical compound ClC(=O)C1=CC(Cl)=C(Cl)C(Cl)=C1Cl IROWIXYGGPOJFJ-UHFFFAOYSA-N 0.000 claims description 6
- 235000003270 potassium fluoride Nutrition 0.000 claims description 6
- TXALMWNWYDSWQO-UHFFFAOYSA-N 2,4,5-trifluorobenzoyl fluoride Chemical compound FC(=O)C1=CC(F)=C(F)C=C1F TXALMWNWYDSWQO-UHFFFAOYSA-N 0.000 claims description 5
- VWNMVYACOKCDLR-UHFFFAOYSA-N 3,5-dichloro-2,4-difluorobenzoyl fluoride Chemical compound FC(=O)C1=CC(Cl)=C(F)C(Cl)=C1F VWNMVYACOKCDLR-UHFFFAOYSA-N 0.000 claims description 5
- 230000015572 biosynthetic process Effects 0.000 claims description 5
- 150000001875 compounds Chemical class 0.000 claims description 5
- IDOFZVGHXAVYEZ-UHFFFAOYSA-N 2,3,4,5-tetrachlorobenzonitrile Chemical compound ClC1=CC(C#N)=C(Cl)C(Cl)=C1Cl IDOFZVGHXAVYEZ-UHFFFAOYSA-N 0.000 claims description 4
- ZFZHCAIFWXGSNS-UHFFFAOYSA-N 2,3,4,5-tetrachlorobenzoyl fluoride Chemical compound FC(=O)C1=CC(Cl)=C(Cl)C(Cl)=C1Cl ZFZHCAIFWXGSNS-UHFFFAOYSA-N 0.000 claims description 4
- 229910052739 hydrogen Inorganic materials 0.000 claims description 4
- 238000002360 preparation method Methods 0.000 claims description 4
- 239000007858 starting material Substances 0.000 claims description 4
- 238000003786 synthesis reaction Methods 0.000 claims description 4
- KBESHLYCSZINAJ-UHFFFAOYSA-N 3-chloro-2,4,5-trifluorobenzoic acid Chemical compound OC(=O)C1=CC(F)=C(F)C(Cl)=C1F KBESHLYCSZINAJ-UHFFFAOYSA-N 0.000 claims description 3
- 239000000543 intermediate Substances 0.000 claims description 3
- 150000002825 nitriles Chemical class 0.000 claims description 3
- 239000003814 drug Substances 0.000 claims description 2
- 229940079593 drug Drugs 0.000 claims description 2
- SGZSJPBASHYOHQ-UHFFFAOYSA-N 2-chloro-5-fluorobenzoyl chloride Chemical compound FC1=CC=C(Cl)C(C(Cl)=O)=C1 SGZSJPBASHYOHQ-UHFFFAOYSA-N 0.000 claims 1
- STBGCAUUOPNJBH-UHFFFAOYSA-N 2,4,5-trifluorobenzoyl chloride Chemical compound FC1=CC(F)=C(C(Cl)=O)C=C1F STBGCAUUOPNJBH-UHFFFAOYSA-N 0.000 abstract 1
- 239000002253 acid Substances 0.000 description 14
- 238000009835 boiling Methods 0.000 description 14
- 239000000460 chlorine Substances 0.000 description 13
- 238000006243 chemical reaction Methods 0.000 description 10
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 9
- 238000004821 distillation Methods 0.000 description 9
- 239000000203 mixture Substances 0.000 description 9
- -1 2-amino-4,5-difluorobenzoic acid ester Chemical class 0.000 description 8
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 6
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 6
- 238000002844 melting Methods 0.000 description 5
- 230000008018 melting Effects 0.000 description 5
- HXJUTPCZVOIRIF-UHFFFAOYSA-N sulfolane Chemical compound O=S1(=O)CCCC1 HXJUTPCZVOIRIF-UHFFFAOYSA-N 0.000 description 5
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 4
- 150000001805 chlorine compounds Chemical class 0.000 description 4
- 150000002222 fluorine compounds Chemical class 0.000 description 4
- 239000000047 product Substances 0.000 description 4
- 239000011541 reaction mixture Substances 0.000 description 4
- HZUAMCHAOQDNBJ-UHFFFAOYSA-N 1-chloro-5-(dichloromethyl)-2,3,4-trifluorobenzene Chemical compound FC1=C(Cl)C=C(C(Cl)Cl)C(F)=C1F HZUAMCHAOQDNBJ-UHFFFAOYSA-N 0.000 description 3
- WVDDGKGOMKODPV-UHFFFAOYSA-N Benzyl alcohol Chemical class OCC1=CC=CC=C1 WVDDGKGOMKODPV-UHFFFAOYSA-N 0.000 description 3
- 150000007513 acids Chemical class 0.000 description 3
- 238000004508 fractional distillation Methods 0.000 description 3
- 150000004820 halides Chemical class 0.000 description 3
- 230000007062 hydrolysis Effects 0.000 description 3
- 238000006460 hydrolysis reaction Methods 0.000 description 3
- 238000010992 reflux Methods 0.000 description 3
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 3
- XEMRAKSQROQPBR-UHFFFAOYSA-N (trichloromethyl)benzene Chemical class ClC(Cl)(Cl)C1=CC=CC=C1 XEMRAKSQROQPBR-UHFFFAOYSA-N 0.000 description 2
- KEQGZUUPPQEDPF-UHFFFAOYSA-N 1,3-dichloro-5,5-dimethylimidazolidine-2,4-dione Chemical compound CC1(C)N(Cl)C(=O)N(Cl)C1=O KEQGZUUPPQEDPF-UHFFFAOYSA-N 0.000 description 2
- KMWKVZQFAZDUFH-UHFFFAOYSA-N 1,3-dichloro-5-(chloromethyl)-2,4-difluorobenzene Chemical compound FC1=C(Cl)C=C(CCl)C(F)=C1Cl KMWKVZQFAZDUFH-UHFFFAOYSA-N 0.000 description 2
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 2
- VROGRHFTUYFGFX-UHFFFAOYSA-N 1-chloro-5-(chloromethyl)-2,3,4-trifluorobenzene Chemical compound FC1=C(F)C(Cl)=CC(CCl)=C1F VROGRHFTUYFGFX-UHFFFAOYSA-N 0.000 description 2
- ZYEWNAMVVRPNJX-UHFFFAOYSA-N 2,3,4,5-tetrafluorobenzoyl fluoride Chemical compound FC(=O)C1=CC(F)=C(F)C(F)=C1F ZYEWNAMVVRPNJX-UHFFFAOYSA-N 0.000 description 2
- DVXDXLUGMVTANY-UHFFFAOYSA-N 3-chloro-2,4,5-trifluorobenzoyl fluoride Chemical compound FC(=O)C1=CC(F)=C(F)C(Cl)=C1F DVXDXLUGMVTANY-UHFFFAOYSA-N 0.000 description 2
- FLFHKEPFQPBDPK-UHFFFAOYSA-N 5-chloro-2,3,4-trifluorobenzaldehyde Chemical compound FC1=C(F)C(Cl)=CC(C=O)=C1F FLFHKEPFQPBDPK-UHFFFAOYSA-N 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 2
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 2
- KRHYYFGTRYWZRS-UHFFFAOYSA-M Fluoride anion Chemical compound [F-] KRHYYFGTRYWZRS-UHFFFAOYSA-M 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- VSCWAEJMTAWNJL-UHFFFAOYSA-K aluminium trichloride Chemical compound Cl[Al](Cl)Cl VSCWAEJMTAWNJL-UHFFFAOYSA-K 0.000 description 2
- 235000019445 benzyl alcohol Nutrition 0.000 description 2
- 238000005660 chlorination reaction Methods 0.000 description 2
- 125000001309 chloro group Chemical group Cl* 0.000 description 2
- XTHPWXDJESJLNJ-UHFFFAOYSA-N chlorosulfonic acid Substances OS(Cl)(=O)=O XTHPWXDJESJLNJ-UHFFFAOYSA-N 0.000 description 2
- 239000013078 crystal Substances 0.000 description 2
- 238000001035 drying Methods 0.000 description 2
- 125000000896 monocarboxylic acid group Chemical group 0.000 description 2
- 239000012074 organic phase Substances 0.000 description 2
- 230000020477 pH reduction Effects 0.000 description 2
- MBDUIEKYVPVZJH-UHFFFAOYSA-N 1-ethylsulfonylethane Chemical compound CCS(=O)(=O)CC MBDUIEKYVPVZJH-UHFFFAOYSA-N 0.000 description 1
- SGKGFWQVQOSXQR-UHFFFAOYSA-N 2,3,4,5-tetrachlorobenzamide Chemical compound NC(=O)C1=CC(Cl)=C(Cl)C(Cl)=C1Cl SGKGFWQVQOSXQR-UHFFFAOYSA-N 0.000 description 1
- GLTGXIGJLCSEAM-UHFFFAOYSA-N 2,3,4,5-tetrafluorobenzonitrile Chemical compound FC1=CC(C#N)=C(F)C(F)=C1F GLTGXIGJLCSEAM-UHFFFAOYSA-N 0.000 description 1
- CTRNNNGFIZOMED-UHFFFAOYSA-N 2,3,4-trifluorobenzoyl fluoride Chemical compound FC(=O)C1=CC=C(F)C(F)=C1F CTRNNNGFIZOMED-UHFFFAOYSA-N 0.000 description 1
- YQRPJVUZSKXCJN-UHFFFAOYSA-N 2,4,5-trifluorobenzamide Chemical compound NC(=O)C1=CC(F)=C(F)C=C1F YQRPJVUZSKXCJN-UHFFFAOYSA-N 0.000 description 1
- RPZXUSJCSDQNTE-UHFFFAOYSA-N 2,4-dichloro-5-fluorobenzoyl chloride Chemical compound FC1=CC(C(Cl)=O)=C(Cl)C=C1Cl RPZXUSJCSDQNTE-UHFFFAOYSA-N 0.000 description 1
- RKSFYVMVPGFXLN-UHFFFAOYSA-N 2,4-dichloro-5-fluorobenzoyl fluoride Chemical compound FC(=O)C1=CC(F)=C(Cl)C=C1Cl RKSFYVMVPGFXLN-UHFFFAOYSA-N 0.000 description 1
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 1
- ICUICNRYLHKQGS-UHFFFAOYSA-N 3,4,5-trichlorobenzoic acid Chemical compound OC(=O)C1=CC(Cl)=C(Cl)C(Cl)=C1 ICUICNRYLHKQGS-UHFFFAOYSA-N 0.000 description 1
- NIVPXTOLMUUWNY-UHFFFAOYSA-N 3,5-dichloro-2,4-difluorobenzaldehyde Chemical compound FC1=C(Cl)C=C(C=O)C(F)=C1Cl NIVPXTOLMUUWNY-UHFFFAOYSA-N 0.000 description 1
- MUZBUPSZMGQWMU-UHFFFAOYSA-N 3,5-dichloro-2,4-difluorobenzamide Chemical compound NC(=O)C1=CC(Cl)=C(F)C(Cl)=C1F MUZBUPSZMGQWMU-UHFFFAOYSA-N 0.000 description 1
- SHLNHUHKYANNLC-UHFFFAOYSA-N 3,5-dichloro-2,4-difluorobenzoic acid Chemical compound OC(=O)C1=CC(Cl)=C(F)C(Cl)=C1F SHLNHUHKYANNLC-UHFFFAOYSA-N 0.000 description 1
- QJBAXMSOYNWHMV-UHFFFAOYSA-N 3,5-dichloro-2,4-difluorobenzonitrile Chemical compound FC1=C(Cl)C=C(C#N)C(F)=C1Cl QJBAXMSOYNWHMV-UHFFFAOYSA-N 0.000 description 1
- ASQQXYQZMYOGIL-UHFFFAOYSA-N 3,5-dichloro-2,4-difluorobenzoyl chloride Chemical compound FC1=C(Cl)C=C(C(Cl)=O)C(F)=C1Cl ASQQXYQZMYOGIL-UHFFFAOYSA-N 0.000 description 1
- OVSJMIKVDNAXDN-UHFFFAOYSA-N 3-chloro-1-(chloromethyl)-2,4,5-trifluorobenzene Chemical compound FC1=CC(CCl)=C(F)C(Cl)=C1F OVSJMIKVDNAXDN-UHFFFAOYSA-N 0.000 description 1
- FNOTUPISSVMOCU-UHFFFAOYSA-N 3-chloro-2,4,5-trifluorobenzaldehyde Chemical compound FC1=CC(C=O)=C(F)C(Cl)=C1F FNOTUPISSVMOCU-UHFFFAOYSA-N 0.000 description 1
- VCGGTGFOOHOYMA-UHFFFAOYSA-N 3-fluorobenzoyl fluoride Chemical compound FC(=O)C1=CC=CC(F)=C1 VCGGTGFOOHOYMA-UHFFFAOYSA-N 0.000 description 1
- LKJCRANQTRBCON-UHFFFAOYSA-N 5-chloro-2,3,4-trifluorobenzamide Chemical compound NC(=O)C1=CC(Cl)=C(F)C(F)=C1F LKJCRANQTRBCON-UHFFFAOYSA-N 0.000 description 1
- GWEORAFZBMNWGX-UHFFFAOYSA-N 5-chloro-2,3,4-trifluorobenzoic acid Chemical compound OC(=O)C1=CC(Cl)=C(F)C(F)=C1F GWEORAFZBMNWGX-UHFFFAOYSA-N 0.000 description 1
- ZTFLZDAEKQPVLD-UHFFFAOYSA-N 5-chloro-2,3,4-trifluorobenzonitrile Chemical compound FC1=C(F)C(Cl)=CC(C#N)=C1F ZTFLZDAEKQPVLD-UHFFFAOYSA-N 0.000 description 1
- HRGAJVOGQZVZSW-UHFFFAOYSA-N 5-chloro-2,3,4-trifluorobenzoyl chloride Chemical compound FC1=C(F)C(Cl)=CC(C(Cl)=O)=C1F HRGAJVOGQZVZSW-UHFFFAOYSA-N 0.000 description 1
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonium chloride Substances [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 1
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 1
- CAHQGWAXKLQREW-UHFFFAOYSA-N Benzal chloride Chemical class ClC(Cl)C1=CC=CC=C1 CAHQGWAXKLQREW-UHFFFAOYSA-N 0.000 description 1
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 1
- SECXISVLQFMRJM-UHFFFAOYSA-N N-Methylpyrrolidone Chemical compound CN1CCCC1=O SECXISVLQFMRJM-UHFFFAOYSA-N 0.000 description 1
- 238000006350 Schiemann fluorination reaction Methods 0.000 description 1
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 1
- AVAYCNNAMOJZHO-UHFFFAOYSA-N [Na+].[Na+].[O-]B[O-] Chemical compound [Na+].[Na+].[O-]B[O-] AVAYCNNAMOJZHO-UHFFFAOYSA-N 0.000 description 1
- 238000005903 acid hydrolysis reaction Methods 0.000 description 1
- 230000004913 activation Effects 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 238000005904 alkaline hydrolysis reaction Methods 0.000 description 1
- QGZKDVFQNNGYKY-UHFFFAOYSA-N ammonia Natural products N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 1
- 235000011114 ammonium hydroxide Nutrition 0.000 description 1
- 230000000844 anti-bacterial effect Effects 0.000 description 1
- 229940124350 antibacterial drug Drugs 0.000 description 1
- 150000003935 benzaldehydes Chemical class 0.000 description 1
- 150000003938 benzyl alcohols Chemical class 0.000 description 1
- KCXMKQUNVWSEMD-UHFFFAOYSA-N benzyl chloride Chemical compound ClCC1=CC=CC=C1 KCXMKQUNVWSEMD-UHFFFAOYSA-N 0.000 description 1
- 229940073608 benzyl chloride Drugs 0.000 description 1
- 150000005524 benzylchlorides Chemical class 0.000 description 1
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 1
- 239000000969 carrier Substances 0.000 description 1
- 230000003197 catalytic effect Effects 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 238000004140 cleaning Methods 0.000 description 1
- 230000006735 deficit Effects 0.000 description 1
- 229960004698 dichlorobenzyl alcohol Drugs 0.000 description 1
- 230000002349 favourable effect Effects 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 239000012025 fluorinating agent Substances 0.000 description 1
- CJXGPJZUDUOZDX-UHFFFAOYSA-N fluoromethanone Chemical group F[C]=O CJXGPJZUDUOZDX-UHFFFAOYSA-N 0.000 description 1
- 238000005194 fractionation Methods 0.000 description 1
- 238000007306 functionalization reaction Methods 0.000 description 1
- 229910052736 halogen Inorganic materials 0.000 description 1
- 150000002367 halogens Chemical class 0.000 description 1
- 239000012442 inert solvent Substances 0.000 description 1
- PNDPGZBMCMUPRI-UHFFFAOYSA-N iodine Chemical compound II PNDPGZBMCMUPRI-UHFFFAOYSA-N 0.000 description 1
- 229910052740 iodine Inorganic materials 0.000 description 1
- 239000011630 iodine Substances 0.000 description 1
- 238000002955 isolation Methods 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 239000000155 melt Substances 0.000 description 1
- 125000000325 methylidene group Chemical group [H]C([H])=* 0.000 description 1
- 230000003647 oxidation Effects 0.000 description 1
- 238000007254 oxidation reaction Methods 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 230000005855 radiation Effects 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 229910052938 sodium sulfate Inorganic materials 0.000 description 1
- 235000011152 sodium sulphate Nutrition 0.000 description 1
- 229910001220 stainless steel Inorganic materials 0.000 description 1
- 239000010935 stainless steel Substances 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D215/00—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems
- C07D215/02—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom
- C07D215/16—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D215/48—Carbon atoms having three bonds to hetero atoms with at the most one bond to halogen
- C07D215/54—Carbon atoms having three bonds to hetero atoms with at the most one bond to halogen attached in position 3
- C07D215/56—Carbon atoms having three bonds to hetero atoms with at the most one bond to halogen attached in position 3 with oxygen atoms in position 4
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C63/00—Compounds having carboxyl groups bound to a carbon atoms of six-membered aromatic rings
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P31/00—Antiinfectives, i.e. antibiotics, antiseptics, chemotherapeutics
- A61P31/04—Antibacterial agents
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C17/00—Preparation of halogenated hydrocarbons
- C07C17/093—Preparation of halogenated hydrocarbons by replacement by halogens
- C07C17/10—Preparation of halogenated hydrocarbons by replacement by halogens of hydrogen atoms
- C07C17/14—Preparation of halogenated hydrocarbons by replacement by halogens of hydrogen atoms in the side-chain of aromatic compounds
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C17/00—Preparation of halogenated hydrocarbons
- C07C17/093—Preparation of halogenated hydrocarbons by replacement by halogens
- C07C17/16—Preparation of halogenated hydrocarbons by replacement by halogens of hydroxyl groups
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C25/00—Compounds containing at least one halogen atom bound to a six-membered aromatic ring
- C07C25/02—Monocyclic aromatic halogenated hydrocarbons
- C07C25/13—Monocyclic aromatic halogenated hydrocarbons containing fluorine
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C255/00—Carboxylic acid nitriles
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C33/00—Unsaturated compounds having hydroxy or O-metal groups bound to acyclic carbon atoms
- C07C33/40—Halogenated unsaturated alcohols
- C07C33/46—Halogenated unsaturated alcohols containing only six-membered aromatic rings as cyclic parts
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C45/00—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds
- C07C45/27—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by oxidation
- C07C45/29—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by oxidation of hydroxy groups
- C07C45/292—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by oxidation of hydroxy groups with chromium derivatives
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C45/00—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds
- C07C45/42—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by hydrolysis
- C07C45/43—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by hydrolysis of >CX2 groups, X being halogen
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C47/00—Compounds having —CHO groups
- C07C47/52—Compounds having —CHO groups bound to carbon atoms of six—membered aromatic rings
- C07C47/55—Compounds having —CHO groups bound to carbon atoms of six—membered aromatic rings containing halogen
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C63/00—Compounds having carboxyl groups bound to a carbon atoms of six-membered aromatic rings
- C07C63/68—Compounds having carboxyl groups bound to a carbon atoms of six-membered aromatic rings containing halogen
- C07C63/70—Monocarboxylic acids
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D401/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom
- C07D401/02—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings
- C07D401/04—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings directly linked by a ring-member-to-ring-member bond
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D413/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and oxygen atoms as the only ring hetero atoms
- C07D413/02—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and oxygen atoms as the only ring hetero atoms containing two hetero rings
- C07D413/04—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and oxygen atoms as the only ring hetero atoms containing two hetero rings directly linked by a ring-member-to-ring-member bond
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Life Sciences & Earth Sciences (AREA)
- General Health & Medical Sciences (AREA)
- General Chemical & Material Sciences (AREA)
- Medicinal Chemistry (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Oncology (AREA)
- Pharmacology & Pharmacy (AREA)
- Communicable Diseases (AREA)
- Animal Behavior & Ethology (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Public Health (AREA)
- Veterinary Medicine (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Quinoline Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
Priority Applications (15)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19843420796 DE3420796A1 (de) | 1984-06-04 | 1984-06-04 | 2,4,5-trihalogen- bzw. 2,3,4,5-tetrahalogenbenzolderivate und verfahren zu ihrer herstellung |
| CN 85101737 CN1013370B (zh) | 1984-06-04 | 1985-04-01 | 制备2,4,5-三卤代苯和2,3,4,5-四卤代苯的衍生物方法 |
| DE8585106251T DE3565528D1 (en) | 1984-06-04 | 1985-05-22 | 2,4,5-trihalo or 2,3,4,5-tetrahalo benzene derivatives and process for producing them |
| AT85106251T ATE37866T1 (de) | 1984-06-04 | 1985-05-22 | 2,4,5-trihalogen- bzw. 2,3,4,5tetrahalogenbenzolderivate und verfahren zu ihrer herstellung. |
| EP85106251A EP0164619B1 (de) | 1984-06-04 | 1985-05-22 | 2,4,5-Trihalogen- bzw. 2,3,4,5-Tetrahalogenbenzolderivate und Verfahren zu ihrer Herstellung |
| CA000482913A CA1242742A (en) | 1984-06-04 | 1985-05-31 | 2,4,5-trihalogeno- and 2,3,4,5-tetrahalogenobenzene |
| HU852148A HU195176B (en) | 1984-06-04 | 1985-06-03 | Process for producing 2,4-difluor-5-halogen- resp. 2,4-difluor-3,5-dihalogen-benzol derivatives |
| JP60119907A JPS617220A (ja) | 1984-06-04 | 1985-06-04 | 2,3,4,5―テトラハロゲノベンゼン誘導体 |
| KR1019850003889A KR920005845B1 (ko) | 1984-06-04 | 1985-06-04 | 2,4,5-트리할로게노- 및 2,3,4,5-테트라할로게노벤젠 유도체의 제조방법 |
| US07/459,876 US5072038A (en) | 1984-06-04 | 1990-01-02 | 2,3,4,5-tetrahalogenobenzene derivatives |
| US07/763,027 US5200548A (en) | 1984-06-04 | 1991-09-20 | 2,4,5-Trihalogeno- and 2,3,4,5-tetrahalogenobenzene derivatives |
| US07/968,603 US5362909A (en) | 1984-06-04 | 1992-10-29 | Process for the preparation of 3-chloro-2,4,5-trifluorobenzoyl chloride, 2,4,5-trifuluorobenzoyl fluoride, and 2,3,4,5-tetrahalogenobenzene derivatives |
| US08/409,282 US5530158A (en) | 1984-06-04 | 1995-03-23 | 2,4,5-trihalogeno- and 2,3,4,5-tetrahalogenobenzene derivatives |
| US08/419,969 US5565614A (en) | 1984-06-04 | 1995-04-07 | 2,4,5-trihalogeno-and 2,3,4,5-tetrahalogenobenzene derivatives |
| US08/631,732 US5777181A (en) | 1984-06-04 | 1996-04-10 | 2, 4, 5-trihalogeno- and 2, 3, 4, 5-tetrahalogenobenzene derivatives |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19843420796 DE3420796A1 (de) | 1984-06-04 | 1984-06-04 | 2,4,5-trihalogen- bzw. 2,3,4,5-tetrahalogenbenzolderivate und verfahren zu ihrer herstellung |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE3420796A1 true DE3420796A1 (de) | 1985-12-05 |
Family
ID=6237596
Family Applications (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19843420796 Withdrawn DE3420796A1 (de) | 1984-06-04 | 1984-06-04 | 2,4,5-trihalogen- bzw. 2,3,4,5-tetrahalogenbenzolderivate und verfahren zu ihrer herstellung |
| DE8585106251T Expired DE3565528D1 (en) | 1984-06-04 | 1985-05-22 | 2,4,5-trihalo or 2,3,4,5-tetrahalo benzene derivatives and process for producing them |
Family Applications After (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE8585106251T Expired DE3565528D1 (en) | 1984-06-04 | 1985-05-22 | 2,4,5-trihalo or 2,3,4,5-tetrahalo benzene derivatives and process for producing them |
Country Status (8)
| Country | Link |
|---|---|
| US (1) | US5072038A (OSRAM) |
| EP (1) | EP0164619B1 (OSRAM) |
| JP (1) | JPS617220A (OSRAM) |
| KR (1) | KR920005845B1 (OSRAM) |
| AT (1) | ATE37866T1 (OSRAM) |
| CA (1) | CA1242742A (OSRAM) |
| DE (2) | DE3420796A1 (OSRAM) |
| HU (1) | HU195176B (OSRAM) |
Cited By (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4935541A (en) * | 1989-11-20 | 1990-06-19 | Occidental Chemical Corporation | Preparation of 2,4,5-trifluorobenzoic acid by decarboxylation of 3,4,6-trifluorophthalic anhydride |
| US4996355A (en) * | 1989-04-14 | 1991-02-26 | Mallinckrodt, Inc. | Novel intermediates for the production of 2,4,5-trifluorobenzoyl fluoride |
| US5068449A (en) * | 1987-08-14 | 1991-11-26 | Asahi Glass Company, Ltd. | Fluorinated benzoyl compounds |
| EP0653412A1 (de) * | 1993-11-11 | 1995-05-17 | Bayer Ag | Verfahren zur Herstellung von 4,5-Difluorbenzaldehyden |
| EP0673912A1 (de) * | 1994-03-21 | 1995-09-27 | Bayer Ag | Verfahren zur Herstellung von 2-halogen-4,5-difluor-benzofluoriden |
| US6075165A (en) * | 1993-01-19 | 2000-06-13 | Bayer Aktiengesellschaft | Process for the preparation of polyhalogenated benzotrifluorides, benzotrichlorides and benzoyl chlorides and new trihalogenobenzotrichlorides and -benzoyl chlorides |
| EP0908438A3 (de) * | 1997-09-16 | 2001-11-14 | Bayer Ag | Verfahren zur Herstellung von 2,3,4,5-Tetrafluorbenzolderivaten |
Families Citing this family (17)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0174131A3 (en) * | 1984-09-01 | 1989-06-07 | FISONS plc | Dihydropyridines, processes and intermediates for their production, and pharmaceutical formulations containing them |
| EP0230946A3 (en) * | 1986-01-20 | 1988-09-07 | Kyorin Pharmaceutical Co., Ltd. | Process for the preparation of quinolonecarboxylic acid derivatives |
| US4791225A (en) * | 1986-01-20 | 1988-12-13 | Kyorin Pharmaceutical Co., Ltd. | Halogenobenzoic acid derivatives and their preparation |
| DE3601566A1 (de) * | 1986-01-21 | 1987-07-23 | Bayer Ag | Pharmazeutische zubereitungen von ciprofloxacin |
| US5286754A (en) * | 1986-01-21 | 1994-02-15 | Bayer Aktiengesellschaft | Pharmaceutical formulations of ciprofloxacin |
| JPS62192321A (ja) * | 1986-02-19 | 1987-08-22 | Bayer Japan Kk | 魚類用抗菌剤 |
| DE3631906A1 (de) * | 1986-09-19 | 1988-03-31 | Bayer Ag | Verfahren zur herstellung von benzoesaeure-derivaten |
| US5227531A (en) * | 1986-10-31 | 1993-07-13 | Hoechst Aktiengesellschaft | Process for the preparation of fluorobenzaldehydes |
| DE3637156C2 (de) * | 1986-10-31 | 1995-12-21 | Hoechst Ag | Verfahren zur Herstellung von Fluorbenzaldehyden |
| US4831190A (en) * | 1986-12-04 | 1989-05-16 | Ube Industries, Ltd. | Trifluorohydroxyaromatic acid and preparation thereof |
| JPH072679B2 (ja) * | 1988-04-15 | 1995-01-18 | 旭硝子株式会社 | 2―クロロ―4,5―ジフルオロ安息香酸誘導体 |
| IE72169B1 (en) * | 1989-11-17 | 1997-03-26 | Asahi Glass Co Ltd | Processes for producing 5-fluorobenzoic acids and their intermediates |
| DE4416329A1 (de) * | 1994-05-09 | 1995-11-16 | Hoechst Ag | Substituierte 2-Chlor-3,4,5-trifluorbenzole und ein Verfahren zu ihrer Herstellung |
| US5639888A (en) * | 1994-10-03 | 1997-06-17 | American Cyanamid Co. | Process for the preparation of acid chloride compounds |
| DE19627411A1 (de) * | 1996-07-09 | 1998-01-15 | Bayer Ag | Verfahren zur Decarboxylierung halogenierter aromatischer Carbonsäuren |
| JP2000086583A (ja) * | 1998-09-17 | 2000-03-28 | Asahi Glass Co Ltd | 含フッ素ベンジル誘導体の製造方法 |
| JP4200704B2 (ja) * | 2002-07-24 | 2008-12-24 | 昭和電工株式会社 | フッ素化ベンゾニトリルの製造方法 |
Family Cites Families (12)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB977963A (en) * | 1960-05-12 | 1964-12-16 | Imp Smelting Corp Ltd | Derivatives of carboxylic acids containing the pentafluorophenyl group |
| US3230268A (en) * | 1962-04-09 | 1966-01-18 | Fuso Chemical Co Ltd | Preparation of chloro-substituted benzene derivatives |
| NL129620C (OSRAM) * | 1963-04-01 | |||
| US3485865A (en) * | 1967-04-05 | 1969-12-23 | Velsicol Chemical Corp | N-methoxy and n-ethoxy benzamides |
| US3816526A (en) * | 1972-10-03 | 1974-06-11 | Mobil Oil Corp | Method for producing halobenzoyl halides |
| DE3142856A1 (de) * | 1981-10-29 | 1983-05-11 | Bayer Ag, 5090 Leverkusen | Verfahren zur herstellung von 2,4-dichlor-5-fluor-benzoylchlorid |
| US4582948A (en) * | 1982-02-09 | 1986-04-15 | Occidental Chemical Corporation | 3-chloro-4-fluoro-5-nitrobenzotrifluoride |
| JPS58150543A (ja) * | 1982-03-04 | 1983-09-07 | Chisso Corp | 2,4,5−トリフルオロ安息香酸トランス−4−(トランス−4′−アルキルシクロヘキシル)シクロヘキシルエステル |
| JPS6072885A (ja) * | 1983-09-28 | 1985-04-24 | Dai Ichi Seiyaku Co Ltd | トリフルオロベンゾイル化合物類 |
| JPH0665676B2 (ja) * | 1984-04-26 | 1994-08-24 | アボツト ラボラトリーズ | キノリン‐ベノキサジン抗菌性化合物 |
| US4792618A (en) * | 1984-05-02 | 1988-12-20 | Occidental Chemical Corporation | Fluorinated carbocylic compounds |
| US4791225A (en) * | 1986-01-20 | 1988-12-13 | Kyorin Pharmaceutical Co., Ltd. | Halogenobenzoic acid derivatives and their preparation |
-
1984
- 1984-06-04 DE DE19843420796 patent/DE3420796A1/de not_active Withdrawn
-
1985
- 1985-05-22 AT AT85106251T patent/ATE37866T1/de not_active IP Right Cessation
- 1985-05-22 EP EP85106251A patent/EP0164619B1/de not_active Expired
- 1985-05-22 DE DE8585106251T patent/DE3565528D1/de not_active Expired
- 1985-05-31 CA CA000482913A patent/CA1242742A/en not_active Expired
- 1985-06-03 HU HU852148A patent/HU195176B/hu not_active IP Right Cessation
- 1985-06-04 JP JP60119907A patent/JPS617220A/ja active Granted
- 1985-06-04 KR KR1019850003889A patent/KR920005845B1/ko not_active Expired
-
1990
- 1990-01-02 US US07/459,876 patent/US5072038A/en not_active Expired - Lifetime
Cited By (11)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US5068449A (en) * | 1987-08-14 | 1991-11-26 | Asahi Glass Company, Ltd. | Fluorinated benzoyl compounds |
| US4996355A (en) * | 1989-04-14 | 1991-02-26 | Mallinckrodt, Inc. | Novel intermediates for the production of 2,4,5-trifluorobenzoyl fluoride |
| US4935541A (en) * | 1989-11-20 | 1990-06-19 | Occidental Chemical Corporation | Preparation of 2,4,5-trifluorobenzoic acid by decarboxylation of 3,4,6-trifluorophthalic anhydride |
| US6075165A (en) * | 1993-01-19 | 2000-06-13 | Bayer Aktiengesellschaft | Process for the preparation of polyhalogenated benzotrifluorides, benzotrichlorides and benzoyl chlorides and new trihalogenobenzotrichlorides and -benzoyl chlorides |
| US6114590A (en) * | 1993-01-19 | 2000-09-05 | Bayer Aktiengesellschaft | Process for the preparation of polyhalogenated benzotrifluorides, benzotrichlorides and benzoyl chlorides and new trihalogenobenzotrichlorides and -benzoyl chlorides |
| EP0653412A1 (de) * | 1993-11-11 | 1995-05-17 | Bayer Ag | Verfahren zur Herstellung von 4,5-Difluorbenzaldehyden |
| US5489715A (en) * | 1993-11-11 | 1996-02-06 | Bayer Aktiengesellschaft | Process for preparing 4,5-difluorobenzaldehydes |
| EP0673912A1 (de) * | 1994-03-21 | 1995-09-27 | Bayer Ag | Verfahren zur Herstellung von 2-halogen-4,5-difluor-benzofluoriden |
| US5859298A (en) * | 1994-03-21 | 1999-01-12 | Bayer Aktiengesellschaft | Process for the preparation of 2-halogeno-4,5-difluorobenzoyl fluorides |
| EP0908438A3 (de) * | 1997-09-16 | 2001-11-14 | Bayer Ag | Verfahren zur Herstellung von 2,3,4,5-Tetrafluorbenzolderivaten |
| US6613948B1 (en) | 1997-09-16 | 2003-09-02 | Bayer Ag | Process for the preparation of 2,3,4,5-tetrafluorobenzene derivatives |
Also Published As
| Publication number | Publication date |
|---|---|
| ATE37866T1 (de) | 1988-10-15 |
| KR860000240A (ko) | 1986-01-27 |
| CA1242742A (en) | 1988-10-04 |
| KR920005845B1 (ko) | 1992-07-23 |
| HUT38297A (en) | 1986-05-28 |
| HU195176B (en) | 1988-04-28 |
| US5072038A (en) | 1991-12-10 |
| DE3565528D1 (en) | 1988-11-17 |
| JPS617220A (ja) | 1986-01-13 |
| EP0164619A1 (de) | 1985-12-18 |
| JPH0246015B2 (OSRAM) | 1990-10-12 |
| EP0164619B1 (de) | 1988-10-12 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE3420796A1 (de) | 2,4,5-trihalogen- bzw. 2,3,4,5-tetrahalogenbenzolderivate und verfahren zu ihrer herstellung | |
| DE3142856A1 (de) | Verfahren zur herstellung von 2,4-dichlor-5-fluor-benzoylchlorid | |
| EP0038987A1 (de) | Verfahren zur Herstellung von Acylcyaniden | |
| EP0607824B1 (de) | Verfahren zur Herstellung mehrfach halogenierter Benzotrichloride und Benzoylchloride sowie neue, mehrfach halogenierte Benzotrichloride | |
| DE69029587T2 (de) | Verfahren zur herstellung von 3-trifluormethylbenzylchlorid | |
| DE3006685C2 (de) | 3-Brom-4-fluorbenzonitril und Verfahren zur Herstellung eines substituierten 3-Brom-4-fluorbenzols | |
| DE69506749T2 (de) | Verfahren zur Herstellung von Tetrafluorphtalsäureanhydrid | |
| EP0398061B1 (de) | Verfahren zur Herstellung von alpha-Fluoracrylsäurederivaten und neue 1,1-Difluor-2-halogenethyl-(halogen) methyl-ketone | |
| DE2015840C3 (de) | Verfahren zur Herstellung von Fettsäuredialkylamiden | |
| DE2548970C3 (de) | Verfahren zur Herstellung von Trichlormethyl-trifluormethyl-benzolen | |
| DE2857580A1 (de) | P-tert.-butylbenzalbromid und dessen am kern durch halogen substituierte derivate | |
| EP0411252B1 (de) | Verfahren zur Herstellung von fluorierten Benzoesäuren | |
| EP0061113B1 (de) | Verfahren zur Herstellung von gegebenenfalls substituierten Fluor-nitro-benzaldehyden | |
| DE69115758T2 (de) | Verfahren zur Herstellung von 3,5-Difluoranilin und dessen Derivat | |
| EP0653412B1 (de) | Verfahren zur Herstellung von 4,5-Difluorbenzaldehyden | |
| EP0600317B1 (de) | Verfahren zur Herstellung von halogenierten Benzoesäuren | |
| EP0682008B1 (de) | Substituierte 2-Chlor-3,4,5-trifluorbenzole und ein Verfahren zu ihrer Herstellung | |
| DE3421946C2 (de) | Verfahren zur Reinigung von 4-Fluorphenol | |
| EP0608714B1 (de) | Verfahren zur Herstellung chlorierter 4,5-Difluorbenzoesäuren, -benzoesäurederivate und -benzaldehyde | |
| DE3726890C2 (OSRAM) | ||
| DE69602040T2 (de) | Verfahren zur Herstellung von Alkylbenzoylchlorid | |
| DE2044832B2 (de) | Verfahren zur Herstellung aromatischer Aldehyde | |
| EP0034837A1 (de) | P-tert.-Butylbenzalbromid und dessen am Kern durch Halogen substituierte Derivate | |
| EP0673912B1 (de) | Verfahren zur Herstellung von 2-Halogen-4,5-difluor-benzofluoriden | |
| DE3144316A1 (de) | Verfahren zur herstellung von benzoylchlorid |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8130 | Withdrawal |