DE3344458A1 - Verfahren zur kontinuierlichen herstellung hochreiner terephthalsaeure - Google Patents
Verfahren zur kontinuierlichen herstellung hochreiner terephthalsaeureInfo
- Publication number
- DE3344458A1 DE3344458A1 DE19833344458 DE3344458A DE3344458A1 DE 3344458 A1 DE3344458 A1 DE 3344458A1 DE 19833344458 DE19833344458 DE 19833344458 DE 3344458 A DE3344458 A DE 3344458A DE 3344458 A1 DE3344458 A1 DE 3344458A1
- Authority
- DE
- Germany
- Prior art keywords
- oxidation step
- reaction mixture
- terephthalic acid
- temperature
- molecular oxygen
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Withdrawn
Links
- 238000000034 method Methods 0.000 title claims description 38
- 238000010924 continuous production Methods 0.000 title claims description 5
- 150000003504 terephthalic acids Chemical class 0.000 title 1
- KKEYFWRCBNTPAC-UHFFFAOYSA-N Terephthalic acid Chemical compound OC(=O)C1=CC=C(C(O)=O)C=C1 KKEYFWRCBNTPAC-UHFFFAOYSA-N 0.000 claims description 126
- 238000007254 oxidation reaction Methods 0.000 claims description 76
- 230000003647 oxidation Effects 0.000 claims description 72
- 239000011541 reaction mixture Substances 0.000 claims description 51
- URLKBWYHVLBVBO-UHFFFAOYSA-N Para-Xylene Chemical group CC1=CC=C(C)C=C1 URLKBWYHVLBVBO-UHFFFAOYSA-N 0.000 claims description 40
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 claims description 39
- 238000011282 treatment Methods 0.000 claims description 34
- MYMOFIZGZYHOMD-UHFFFAOYSA-N Dioxygen Chemical compound O=O MYMOFIZGZYHOMD-UHFFFAOYSA-N 0.000 claims description 30
- 229910001882 dioxygen Inorganic materials 0.000 claims description 30
- 239000002904 solvent Substances 0.000 claims description 20
- 239000003054 catalyst Substances 0.000 claims description 13
- 239000001301 oxygen Substances 0.000 claims description 13
- 229910052760 oxygen Inorganic materials 0.000 claims description 13
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 12
- 239000007789 gas Substances 0.000 claims description 11
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 9
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 8
- 229910052794 bromium Inorganic materials 0.000 claims description 8
- 229910001385 heavy metal Inorganic materials 0.000 claims description 5
- 238000006243 chemical reaction Methods 0.000 description 73
- GOUHYARYYWKXHS-UHFFFAOYSA-N 4-formylbenzoic acid Chemical compound OC(=O)C1=CC=C(C=O)C=C1 GOUHYARYYWKXHS-UHFFFAOYSA-N 0.000 description 28
- 238000004519 manufacturing process Methods 0.000 description 16
- 239000003570 air Substances 0.000 description 11
- 229920000728 polyester Polymers 0.000 description 10
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 9
- 229920000642 polymer Polymers 0.000 description 8
- 239000000543 intermediate Substances 0.000 description 7
- 239000012452 mother liquor Substances 0.000 description 7
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 7
- 239000007858 starting material Substances 0.000 description 6
- 239000013078 crystal Substances 0.000 description 5
- 239000007791 liquid phase Substances 0.000 description 5
- 238000002425 crystallisation Methods 0.000 description 4
- 230000008025 crystallization Effects 0.000 description 4
- WOZVHXUHUFLZGK-UHFFFAOYSA-N dimethyl terephthalate Chemical compound COC(=O)C1=CC=C(C(=O)OC)C=C1 WOZVHXUHUFLZGK-UHFFFAOYSA-N 0.000 description 4
- 239000012535 impurity Substances 0.000 description 4
- 239000000203 mixture Substances 0.000 description 4
- 230000003287 optical effect Effects 0.000 description 4
- 238000000926 separation method Methods 0.000 description 4
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 3
- PWHULOQIROXLJO-UHFFFAOYSA-N Manganese Chemical compound [Mn] PWHULOQIROXLJO-UHFFFAOYSA-N 0.000 description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- 239000012080 ambient air Substances 0.000 description 3
- 229910017052 cobalt Inorganic materials 0.000 description 3
- 239000010941 cobalt Substances 0.000 description 3
- GUTLYIVDDKVIGB-UHFFFAOYSA-N cobalt atom Chemical compound [Co] GUTLYIVDDKVIGB-UHFFFAOYSA-N 0.000 description 3
- 230000000052 comparative effect Effects 0.000 description 3
- WGCNASOHLSPBMP-UHFFFAOYSA-N hydroxyacetaldehyde Natural products OCC=O WGCNASOHLSPBMP-UHFFFAOYSA-N 0.000 description 3
- 239000011261 inert gas Substances 0.000 description 3
- 229910052748 manganese Inorganic materials 0.000 description 3
- 239000011572 manganese Substances 0.000 description 3
- 239000000463 material Substances 0.000 description 3
- 239000002245 particle Substances 0.000 description 3
- 239000000047 product Substances 0.000 description 3
- 238000010992 reflux Methods 0.000 description 3
- 238000002834 transmittance Methods 0.000 description 3
- ADCOVFLJGNWWNZ-UHFFFAOYSA-N antimony trioxide Chemical compound O=[Sb]O[Sb]=O ADCOVFLJGNWWNZ-UHFFFAOYSA-N 0.000 description 2
- 238000007664 blowing Methods 0.000 description 2
- 239000006227 byproduct Substances 0.000 description 2
- 229940011182 cobalt acetate Drugs 0.000 description 2
- 150000001869 cobalt compounds Chemical class 0.000 description 2
- QAHREYKOYSIQPH-UHFFFAOYSA-L cobalt(II) acetate Chemical compound [Co+2].CC([O-])=O.CC([O-])=O QAHREYKOYSIQPH-UHFFFAOYSA-L 0.000 description 2
- BZRRQSJJPUGBAA-UHFFFAOYSA-L cobalt(ii) bromide Chemical compound Br[Co]Br BZRRQSJJPUGBAA-UHFFFAOYSA-L 0.000 description 2
- 238000002485 combustion reaction Methods 0.000 description 2
- 150000001875 compounds Chemical class 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- 238000010586 diagram Methods 0.000 description 2
- RJYMRRJVDRJMJW-UHFFFAOYSA-L dibromomanganese Chemical compound Br[Mn]Br RJYMRRJVDRJMJW-UHFFFAOYSA-L 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 239000000835 fiber Substances 0.000 description 2
- -1 filaments Substances 0.000 description 2
- 239000007788 liquid Substances 0.000 description 2
- 150000002697 manganese compounds Chemical class 0.000 description 2
- 230000001590 oxidative effect Effects 0.000 description 2
- 230000035484 reaction time Effects 0.000 description 2
- 239000002002 slurry Substances 0.000 description 2
- JHJLBTNAGRQEKS-UHFFFAOYSA-M sodium bromide Chemical compound [Na+].[Br-] JHJLBTNAGRQEKS-UHFFFAOYSA-M 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
- GWEVSGVZZGPLCZ-UHFFFAOYSA-N Titan oxide Chemical compound O=[Ti]=O GWEVSGVZZGPLCZ-UHFFFAOYSA-N 0.000 description 1
- RTAQQCXQSZGOHL-UHFFFAOYSA-N Titanium Chemical compound [Ti] RTAQQCXQSZGOHL-UHFFFAOYSA-N 0.000 description 1
- 239000003125 aqueous solvent Substances 0.000 description 1
- 230000009286 beneficial effect Effects 0.000 description 1
- 230000005540 biological transmission Effects 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 238000005119 centrifugation Methods 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 238000004140 cleaning Methods 0.000 description 1
- 150000001868 cobalt Chemical class 0.000 description 1
- ZBYYWKJVSFHYJL-UHFFFAOYSA-L cobalt(2+);diacetate;tetrahydrate Chemical compound O.O.O.O.[Co+2].CC([O-])=O.CC([O-])=O ZBYYWKJVSFHYJL-UHFFFAOYSA-L 0.000 description 1
- 238000011161 development Methods 0.000 description 1
- 230000018109 developmental process Effects 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 238000005265 energy consumption Methods 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- 230000002349 favourable effect Effects 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 229910000042 hydrogen bromide Inorganic materials 0.000 description 1
- 238000009776 industrial production Methods 0.000 description 1
- XGMZRSTUUZTDHL-UHFFFAOYSA-N lead;terephthalic acid Chemical compound [Pb].OC(=O)C1=CC=C(C(O)=O)C=C1 XGMZRSTUUZTDHL-UHFFFAOYSA-N 0.000 description 1
- 150000002696 manganese Chemical class 0.000 description 1
- 229940071125 manganese acetate Drugs 0.000 description 1
- 229940082328 manganese acetate tetrahydrate Drugs 0.000 description 1
- UOGMEBQRZBEZQT-UHFFFAOYSA-L manganese(2+);diacetate Chemical compound [Mn+2].CC([O-])=O.CC([O-])=O UOGMEBQRZBEZQT-UHFFFAOYSA-L 0.000 description 1
- CESXSDZNZGSWSP-UHFFFAOYSA-L manganese(2+);diacetate;tetrahydrate Chemical compound O.O.O.O.[Mn+2].CC([O-])=O.CC([O-])=O CESXSDZNZGSWSP-UHFFFAOYSA-L 0.000 description 1
- SGGOJYZMTYGPCH-UHFFFAOYSA-L manganese(2+);naphthalene-2-carboxylate Chemical compound [Mn+2].C1=CC=CC2=CC(C(=O)[O-])=CC=C21.C1=CC=CC2=CC(C(=O)[O-])=CC=C21 SGGOJYZMTYGPCH-UHFFFAOYSA-L 0.000 description 1
- GEMHFKXPOCTAIP-UHFFFAOYSA-N n,n-dimethyl-n'-phenylcarbamimidoyl chloride Chemical compound CN(C)C(Cl)=NC1=CC=CC=C1 GEMHFKXPOCTAIP-UHFFFAOYSA-N 0.000 description 1
- 229910000510 noble metal Inorganic materials 0.000 description 1
- 150000002926 oxygen Chemical class 0.000 description 1
- 230000035699 permeability Effects 0.000 description 1
- 238000006116 polymerization reaction Methods 0.000 description 1
- 239000010453 quartz Substances 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N silicon dioxide Inorganic materials O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 239000010936 titanium Substances 0.000 description 1
- 229910052719 titanium Inorganic materials 0.000 description 1
- OGIDPMRJRNCKJF-UHFFFAOYSA-N titanium oxide Inorganic materials [Ti]=O OGIDPMRJRNCKJF-UHFFFAOYSA-N 0.000 description 1
- DQWPFSLDHJDLRL-UHFFFAOYSA-N triethyl phosphate Chemical compound CCOP(=O)(OCC)OCC DQWPFSLDHJDLRL-UHFFFAOYSA-N 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C51/00—Preparation of carboxylic acids or their salts, halides or anhydrides
- C07C51/16—Preparation of carboxylic acids or their salts, halides or anhydrides by oxidation
- C07C51/21—Preparation of carboxylic acids or their salts, halides or anhydrides by oxidation with molecular oxygen
- C07C51/255—Preparation of carboxylic acids or their salts, halides or anhydrides by oxidation with molecular oxygen of compounds containing six-membered aromatic rings without ring-splitting
- C07C51/265—Preparation of carboxylic acids or their salts, halides or anhydrides by oxidation with molecular oxygen of compounds containing six-membered aromatic rings without ring-splitting having alkyl side chains which are oxidised to carboxyl groups
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Engineering & Computer Science (AREA)
- Oil, Petroleum & Natural Gas (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP57216395A JPS59106435A (ja) | 1982-12-10 | 1982-12-10 | 高純度テレフタル酸の製法 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE3344458A1 true DE3344458A1 (de) | 1984-06-14 |
Family
ID=16687887
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19833344458 Withdrawn DE3344458A1 (de) | 1982-12-10 | 1983-12-08 | Verfahren zur kontinuierlichen herstellung hochreiner terephthalsaeure |
Country Status (4)
| Country | Link |
|---|---|
| US (1) | US4772748A (https=) |
| JP (1) | JPS59106435A (https=) |
| DE (1) | DE3344458A1 (https=) |
| NL (1) | NL8304249A (https=) |
Families Citing this family (62)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JP2504461B2 (ja) * | 1987-04-24 | 1996-06-05 | 三菱化学株式会社 | 高品質テレフタル酸の製法 |
| ZA903202B (en) * | 1989-05-24 | 1991-02-27 | Amoco Corp | Preparation of polyethylene terephthalate |
| DE69104280T2 (de) * | 1990-06-25 | 1995-02-16 | Mitsubishi Gas Chemical Co | Verfahren zur Herstellung von hochreiner Isophthalsäure. |
| KR970000136B1 (ko) * | 1993-09-28 | 1997-01-04 | 브이.피. 유리예프 | 고순도 벤젠디카르복실산 이성질체의 제조방법 |
| US6013835A (en) * | 1995-06-07 | 2000-01-11 | Hfm International, Inc. | Method and apparatus for preparing purified terephthalic acid |
| US5767311A (en) * | 1995-06-07 | 1998-06-16 | Glitsch International, Inc. | Method and apparatus for preparing purified terephtalic acid |
| US6054610A (en) * | 1995-06-07 | 2000-04-25 | Hfm International, Inc. | Method and apparatus for preparing purified terephthalic acid and isophthalic acid from mixed xylenes |
| US5929274A (en) * | 1995-06-07 | 1999-07-27 | Hfm International, Inc. | Method to reduce carboxybenzaldehyde isomers in terephthalic acid or isophthalic acid |
| US7196215B2 (en) * | 2001-06-04 | 2007-03-27 | Eastman Chemical Company | Process for the production of purified terephthalic acid |
| US7485747B2 (en) * | 2001-06-04 | 2009-02-03 | Eastman Chemical Company | Two stage oxidation process for the production of aromatic dicarboxylic acids |
| US20040215036A1 (en) * | 2003-04-25 | 2004-10-28 | Robert Lin | Method for heating a crude carboxylic acid slurry in a post oxidation zone by the addition of steam |
| US7586000B2 (en) | 2004-09-02 | 2009-09-08 | Eastman Chemical Company | Optimized liquid-phase oxidation |
| US7371894B2 (en) * | 2004-09-02 | 2008-05-13 | Eastman Chemical Company | Optimized liquid-phase oxidation |
| US7361784B2 (en) | 2004-09-02 | 2008-04-22 | Eastman Chemical Company | Optimized liquid-phase oxidation |
| US7563926B2 (en) * | 2004-09-02 | 2009-07-21 | Eastman Chemical Company | Optimized liquid-phase oxidation |
| US7390921B2 (en) | 2004-09-02 | 2008-06-24 | Eastman Chemical Company | Optimized liquid-phase oxidation |
| US7482482B2 (en) | 2004-09-02 | 2009-01-27 | Eastman Chemical Company | Optimized liquid-phase oxidation |
| US7692036B2 (en) | 2004-11-29 | 2010-04-06 | Eastman Chemical Company | Optimized liquid-phase oxidation |
| US7568361B2 (en) | 2004-09-02 | 2009-08-04 | Eastman Chemical Company | Optimized liquid-phase oxidation |
| US7507857B2 (en) | 2004-09-02 | 2009-03-24 | Eastman Chemical Company | Optimized liquid-phase oxidation |
| US7608733B2 (en) | 2004-09-02 | 2009-10-27 | Eastman Chemical Company | Optimized liquid-phase oxidation |
| US7910769B2 (en) | 2004-09-02 | 2011-03-22 | Eastman Chemical Company | Optimized liquid-phase oxidation |
| US7399882B2 (en) | 2004-09-02 | 2008-07-15 | Eastman Chemical Company | Optimized liquid-phase oxidation |
| US7608732B2 (en) | 2005-03-08 | 2009-10-27 | Eastman Chemical Company | Optimized liquid-phase oxidation |
| US7692037B2 (en) | 2004-09-02 | 2010-04-06 | Eastman Chemical Company | Optimized liquid-phase oxidation |
| US7589231B2 (en) | 2004-09-02 | 2009-09-15 | Eastman Chemical Company | Optimized liquid-phase oxidation |
| US7381836B2 (en) | 2004-09-02 | 2008-06-03 | Eastman Chemical Company | Optimized liquid-phase oxidation |
| US7741515B2 (en) | 2004-09-02 | 2010-06-22 | Eastman Chemical Company | Optimized liquid-phase oxidation |
| US7572936B2 (en) | 2004-09-02 | 2009-08-11 | Eastman Chemical Company | Optimized liquid-phase oxidation |
| US7683210B2 (en) | 2004-09-02 | 2010-03-23 | Eastman Chemical Company | Optimized liquid-phase oxidation |
| US7572932B2 (en) * | 2004-09-02 | 2009-08-11 | Eastman Chemical Company | Optimized liquid-phase oxidation |
| US7504535B2 (en) | 2004-09-02 | 2009-03-17 | Eastman Chemical Company | Optimized liquid-phase oxidation |
| US7495125B2 (en) | 2004-09-02 | 2009-02-24 | Eastman Chemical Company | Optimized liquid-phase oxidation |
| US7582793B2 (en) | 2004-09-02 | 2009-09-01 | Eastman Chemical Company | Optimized liquid-phase oxidation |
| PL1866273T3 (pl) * | 2005-03-21 | 2010-12-31 | Bp Corp North America Inc | Sposób i urządzenie do wytwarzania aromatycznych kwasów karboksylowych, włącznie z ich czystymi postaciami |
| US20060264662A1 (en) * | 2005-05-19 | 2006-11-23 | Gibson Philip E | Esterification of an enriched composition |
| US7897809B2 (en) * | 2005-05-19 | 2011-03-01 | Eastman Chemical Company | Process to produce an enrichment feed |
| US7741516B2 (en) | 2005-05-19 | 2010-06-22 | Eastman Chemical Company | Process to enrich a carboxylic acid composition |
| US7880031B2 (en) * | 2005-05-19 | 2011-02-01 | Eastman Chemical Company | Process to produce an enrichment feed |
| US7834208B2 (en) * | 2005-05-19 | 2010-11-16 | Eastman Chemical Company | Process to produce a post catalyst removal composition |
| US7557243B2 (en) | 2005-05-19 | 2009-07-07 | Eastman Chemical Company | Enriched terephthalic acid composition |
| US7432395B2 (en) * | 2005-05-19 | 2008-10-07 | Eastman Chemical Company | Enriched carboxylic acid composition |
| US7919652B2 (en) * | 2005-05-19 | 2011-04-05 | Eastman Chemical Company | Process to produce an enriched composition through the use of a catalyst removal zone and an enrichment zone |
| US7304178B2 (en) * | 2005-05-19 | 2007-12-04 | Eastman Chemical Company | Enriched isophthalic acid composition |
| US7884231B2 (en) * | 2005-05-19 | 2011-02-08 | Eastman Chemical Company | Process to produce an enriched composition |
| US20060264656A1 (en) * | 2005-05-19 | 2006-11-23 | Fujitsu Limited | Enrichment process using compounds useful in a polyester process |
| US20060264664A1 (en) * | 2005-05-19 | 2006-11-23 | Parker Kenny R | Esterification of an exchange solvent enriched composition |
| US7884232B2 (en) | 2005-06-16 | 2011-02-08 | Eastman Chemical Company | Optimized liquid-phase oxidation |
| US20070155987A1 (en) * | 2006-01-04 | 2007-07-05 | O'meadhra Ruairi S | Oxidative digestion with optimized agitation |
| US7355068B2 (en) | 2006-01-04 | 2008-04-08 | Eastman Chemical Company | Oxidation system with internal secondary reactor |
| US7358389B2 (en) | 2006-01-04 | 2008-04-15 | Eastman Chemical Company | Oxidation system employing internal structure for enhanced hydrodynamics |
| US7501537B2 (en) * | 2006-03-01 | 2009-03-10 | Eastman Chemical Company | Polycarboxylic acid production system employing oxidative digestion with reduced or eliminated upstream liquor exchange |
| US7420082B2 (en) | 2006-03-01 | 2008-09-02 | Eastman Chemical Company | Polycarboxylic acid production system employing hot liquor removal downstream of oxidative digestion |
| US7888529B2 (en) | 2006-03-01 | 2011-02-15 | Eastman Chemical Company | Process to produce a post catalyst removal composition |
| US7326808B2 (en) * | 2006-03-01 | 2008-02-05 | Eastman Chemical Company | Polycarboxylic acid production system employing cooled mother liquor from oxidative digestion as feed to impurity purge system |
| US7326807B2 (en) | 2006-03-01 | 2008-02-05 | Eastman Chemical Company | Polycarboxylic acid production system with enhanced heating for oxidative digestion |
| US7816556B2 (en) * | 2006-03-01 | 2010-10-19 | Eastman Chemical Company | Polycarboxylic acid production system employing enhanced multistage oxidative digestion |
| US20070208194A1 (en) | 2006-03-01 | 2007-09-06 | Woodruff Thomas E | Oxidation system with sidedraw secondary reactor |
| US7772424B2 (en) * | 2006-03-01 | 2010-08-10 | Eastman Chemical Company | Polycarboxylic acid production system employing enhanced evaporative concentration downstream of oxidative digestion |
| US7393973B2 (en) * | 2006-03-01 | 2008-07-01 | Eastman Chemical Company | Polycarboxylic acid production system with enhanced residence time distribution for oxidative digestion |
| CN102675090B (zh) * | 2012-05-15 | 2015-09-23 | 中国昆仑工程公司 | 聚合级对苯二甲酸生产中的深度氧化方法及深度氧化装置 |
| KR20160098471A (ko) | 2013-12-18 | 2016-08-18 | 비피 코포레이션 노쓰 아메리카 인코포레이티드 | 방향족 카르복시산의 생산을 위한 개선된 공정 및 장치 |
Family Cites Families (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS5555138A (en) * | 1978-10-19 | 1980-04-22 | Mitsubishi Chem Ind Ltd | Preparation of highly pure terephthalic acid |
| JPS5718647A (en) * | 1980-07-10 | 1982-01-30 | Mitsubishi Chem Ind Ltd | Preparation of terephthalic acid |
| JPS5735544A (en) * | 1980-08-13 | 1982-02-26 | Mitsubishi Chem Ind Ltd | Preparation of terephthalic acid |
| JPS57188543A (en) * | 1981-05-13 | 1982-11-19 | Mitsubishi Chem Ind Ltd | Preparation of terephthalic acid |
| JPS57200328A (en) * | 1981-06-03 | 1982-12-08 | Mitsubishi Chem Ind Ltd | Preparation of terephthalic acid |
-
1982
- 1982-12-10 JP JP57216395A patent/JPS59106435A/ja active Granted
-
1983
- 1983-12-08 DE DE19833344458 patent/DE3344458A1/de not_active Withdrawn
- 1983-12-09 NL NL8304249A patent/NL8304249A/nl not_active Application Discontinuation
-
1986
- 1986-03-31 US US06/845,497 patent/US4772748A/en not_active Expired - Lifetime
Also Published As
| Publication number | Publication date |
|---|---|
| JPH0451539B2 (https=) | 1992-08-19 |
| JPS59106435A (ja) | 1984-06-20 |
| NL8304249A (nl) | 1984-07-02 |
| US4772748A (en) | 1988-09-20 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE3344458A1 (de) | Verfahren zur kontinuierlichen herstellung hochreiner terephthalsaeure | |
| DE69104280T2 (de) | Verfahren zur Herstellung von hochreiner Isophthalsäure. | |
| DE2942375C2 (de) | Verfahren zur Herstellung von Terephthalsäure | |
| DE3209069C2 (https=) | ||
| DE2436177C3 (de) | Verfahren zur Herstellung von Benzolcarbonsäuren durch Oxidation von Alkylbenzolen in flüssiger Phase | |
| DE2647698A1 (de) | Sekundaere oxydation eines fluiden abflusses der primaeren oxydation von meta- oder paraxylol | |
| DE2613871A1 (de) | Verbessertes verfahren zur kontinuierlichen herstellung hochreiner terephthalsaeure | |
| DE2437846A1 (de) | Verfahren zur gewinnung von terephthalsaeure durch kontinuierliche entspannungsverdampfungs-kristallisation | |
| DE2423408B2 (de) | Verfahren zur Herstellung von Terephthalsäure durch katalytische FlUssigphasenoxydation von p-Xylol | |
| DE69923839T2 (de) | Verfahren zur reindarstellung von terephthalsäure und isophthalsäure aus xylolgemischen | |
| DE2627475C3 (de) | Verfahren zur Herstellung von Terephthalsäure | |
| DE2856529C2 (de) | Verfahren zur Herstellung von Terephthalsäure | |
| DE2741382A1 (de) | Kontinuierliches verfahren zur herstellung von terephthalsaeure | |
| DE2847170A1 (de) | Verfahren zur herstellung von terephthalsaeure | |
| DE69820488T2 (de) | Verbessertes verfahren zur herstellung von carbonsäuren | |
| DE2747758C3 (de) | Verfahren zur Herstellung von Isophthaloyldichlorid oder Terephthaloyldichlorid | |
| DE2119118B2 (de) | Verfahren zur katalytischen Oxydation von Pseudocumol in flüssiger Phase zu Trimellithsäure unter stufenweiser Katalysatorzugabe | |
| DE2334096A1 (de) | Verfahren zur gewinnung reiner 1,12dodecandicarbonsaeure | |
| DE3045890A1 (de) | Verfahren zur herstellung von nassphosphorsaeure | |
| DE2905672A1 (de) | Verfahren und vorrichtung zur herstellung von hochreiner terephthalsaeure | |
| DE2319493B2 (de) | Verfahren zur Gewinnung von optisch aktivem a -Phenylglycin-benzolsulfonat durch optische Aufspaltung von DL- a -Phenylglycinbenzolsulfonat | |
| DE2504332C3 (de) | Verfahren zur Gewinnung reiner 11-Cyanundecansäure | |
| DE2703161A1 (de) | Verfahren zur herstellung von hochgradig reiner terephthalsaeure | |
| DE2759026A1 (de) | Verfahren zur herstellung von terephthalsaeure | |
| DE1925038C3 (de) | Verfahren zur Gewinnung von Terephthalsäure |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8128 | New person/name/address of the agent |
Representative=s name: KADOR, U., DIPL.-CHEM. DR.RER.NAT., PAT.-ANW., 800 |
|
| 8127 | New person/name/address of the applicant |
Owner name: MITSUBISHI KASEI CORP., TOKIO/TOKYO, JP |
|
| 8141 | Disposal/no request for examination |