DE3325734A1 - Verfahren zur herstellung von n-(3,5-dichlorphenyl)-oxazolidin-2,4-dionen - Google Patents
Verfahren zur herstellung von n-(3,5-dichlorphenyl)-oxazolidin-2,4-dionenInfo
- Publication number
- DE3325734A1 DE3325734A1 DE19833325734 DE3325734A DE3325734A1 DE 3325734 A1 DE3325734 A1 DE 3325734A1 DE 19833325734 DE19833325734 DE 19833325734 DE 3325734 A DE3325734 A DE 3325734A DE 3325734 A1 DE3325734 A1 DE 3325734A1
- Authority
- DE
- Germany
- Prior art keywords
- dichlorophenyl
- oxazolidine
- carbon atoms
- alkyl
- diones
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Withdrawn
Links
- -1 3,5-DICHLORPHENYL Chemical class 0.000 title claims description 39
- 238000004519 manufacturing process Methods 0.000 title description 10
- MHXGWLFBKYHUAF-UHFFFAOYSA-N 3-(3,5-dichlorophenyl)-1,3-oxazolidine-2,4-dione Chemical class ClC1=CC(Cl)=CC(N2C(OCC2=O)=O)=C1 MHXGWLFBKYHUAF-UHFFFAOYSA-N 0.000 claims abstract description 40
- 239000012452 mother liquor Substances 0.000 claims abstract description 28
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims abstract description 21
- 238000000034 method Methods 0.000 claims abstract description 16
- IUTCEZPPWBHGIX-UHFFFAOYSA-N tin(2+) Chemical class [Sn+2] IUTCEZPPWBHGIX-UHFFFAOYSA-N 0.000 claims abstract description 9
- 125000000217 alkyl group Chemical group 0.000 claims abstract description 8
- 125000003342 alkenyl group Chemical group 0.000 claims abstract description 7
- 229910052739 hydrogen Inorganic materials 0.000 claims abstract description 7
- 238000001914 filtration Methods 0.000 claims abstract description 6
- 125000000262 haloalkenyl group Chemical group 0.000 claims abstract description 6
- 239000001257 hydrogen Chemical group 0.000 claims abstract description 6
- 239000011541 reaction mixture Substances 0.000 claims abstract description 6
- 239000007788 liquid Substances 0.000 claims abstract description 4
- 125000002030 1,2-phenylene group Chemical group [H]C1=C([H])C([*:1])=C([*:2])C([H])=C1[H] 0.000 claims abstract description 3
- XEFUJGURFLOFAN-UHFFFAOYSA-N 1,3-dichloro-5-isocyanatobenzene Chemical compound ClC1=CC(Cl)=CC(N=C=O)=C1 XEFUJGURFLOFAN-UHFFFAOYSA-N 0.000 claims abstract description 3
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical group [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims abstract description 3
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims abstract description 3
- 125000004218 chloromethyl group Chemical group [H]C([H])(Cl)* 0.000 claims abstract description 3
- 125000006350 alkyl thio alkyl group Chemical group 0.000 claims abstract 2
- 150000007514 bases Chemical class 0.000 claims abstract 2
- 150000002431 hydrogen Chemical class 0.000 claims abstract 2
- 125000004432 carbon atom Chemical group C* 0.000 claims description 22
- AEMRFAOFKBGASW-UHFFFAOYSA-N Glycolic acid Chemical class OCC(O)=O AEMRFAOFKBGASW-UHFFFAOYSA-N 0.000 claims description 15
- 238000006243 chemical reaction Methods 0.000 claims description 14
- 150000001298 alcohols Chemical class 0.000 claims description 10
- 239000000203 mixture Substances 0.000 claims description 9
- 230000001476 alcoholic effect Effects 0.000 claims description 6
- 229910052799 carbon Inorganic materials 0.000 claims description 4
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 4
- YUDRVAHLXDBKSR-UHFFFAOYSA-N [CH]1CCCCC1 Chemical compound [CH]1CCCCC1 YUDRVAHLXDBKSR-UHFFFAOYSA-N 0.000 claims description 2
- CIUQDSCDWFSTQR-UHFFFAOYSA-N [C]1=CC=CC=C1 Chemical class [C]1=CC=CC=C1 CIUQDSCDWFSTQR-UHFFFAOYSA-N 0.000 claims description 2
- 125000003187 heptyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 claims description 2
- 125000004184 methoxymethyl group Chemical group [H]C([H])([H])OC([H])([H])* 0.000 claims description 2
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 claims description 2
- 229920002554 vinyl polymer Polymers 0.000 claims description 2
- 238000010923 batch production Methods 0.000 claims 1
- 150000001875 compounds Chemical class 0.000 claims 1
- 238000002360 preparation method Methods 0.000 claims 1
- 150000003254 radicals Chemical class 0.000 claims 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 abstract description 4
- GAWIXWVDTYZWAW-UHFFFAOYSA-N C[CH]O Chemical group C[CH]O GAWIXWVDTYZWAW-UHFFFAOYSA-N 0.000 abstract description 2
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 abstract description 2
- 125000004183 alkoxy alkyl group Chemical group 0.000 abstract description 2
- AEMRFAOFKBGASW-UHFFFAOYSA-M Glycolate Chemical compound OCC([O-])=O AEMRFAOFKBGASW-UHFFFAOYSA-M 0.000 abstract 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 abstract 1
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 60
- FSCWZHGZWWDELK-UHFFFAOYSA-N 3-(3,5-dichlorophenyl)-5-ethenyl-5-methyl-2,4-oxazolidinedione Chemical compound O=C1C(C)(C=C)OC(=O)N1C1=CC(Cl)=CC(Cl)=C1 FSCWZHGZWWDELK-UHFFFAOYSA-N 0.000 description 9
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 6
- 150000002148 esters Chemical class 0.000 description 6
- 238000005406 washing Methods 0.000 description 6
- 239000002253 acid Substances 0.000 description 5
- 230000015572 biosynthetic process Effects 0.000 description 5
- 150000001735 carboxylic acids Chemical class 0.000 description 5
- 239000003054 catalyst Substances 0.000 description 5
- 239000007787 solid Substances 0.000 description 4
- CSBPGCNNCFKIHE-UHFFFAOYSA-N 2-methylpropyl 2-hydroxy-2-methylbut-3-enoate Chemical compound CC(C)COC(=O)C(C)(O)C=C CSBPGCNNCFKIHE-UHFFFAOYSA-N 0.000 description 3
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 3
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 3
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 3
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 3
- 239000002244 precipitate Substances 0.000 description 3
- 238000001556 precipitation Methods 0.000 description 3
- 239000000047 product Substances 0.000 description 3
- KSBAEPSJVUENNK-UHFFFAOYSA-L tin(ii) 2-ethylhexanoate Chemical compound [Sn+2].CCCCC(CC)C([O-])=O.CCCCC(CC)C([O-])=O KSBAEPSJVUENNK-UHFFFAOYSA-L 0.000 description 3
- YFTHZRPMJXBUME-UHFFFAOYSA-N tripropylamine Chemical compound CCCN(CCC)CCC YFTHZRPMJXBUME-UHFFFAOYSA-N 0.000 description 3
- AVWRKZWQTYIKIY-UHFFFAOYSA-N urea-1-carboxylic acid Chemical class NC(=O)NC(O)=O AVWRKZWQTYIKIY-UHFFFAOYSA-N 0.000 description 3
- FTCOKXNKPOUEFH-UHFFFAOYSA-N Myclozolin Chemical compound O=C1C(COC)(C)OC(=O)N1C1=CC(Cl)=CC(Cl)=C1 FTCOKXNKPOUEFH-UHFFFAOYSA-N 0.000 description 2
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 2
- ATJFFYVFTNAWJD-UHFFFAOYSA-N Tin Chemical compound [Sn] ATJFFYVFTNAWJD-UHFFFAOYSA-N 0.000 description 2
- 230000003197 catalytic effect Effects 0.000 description 2
- 239000012535 impurity Substances 0.000 description 2
- 238000002156 mixing Methods 0.000 description 2
- 238000011084 recovery Methods 0.000 description 2
- 238000000926 separation method Methods 0.000 description 2
- 238000003786 synthesis reaction Methods 0.000 description 2
- 238000010626 work up procedure Methods 0.000 description 2
- 150000001477 2,4-oxazolidinediones Chemical class 0.000 description 1
- AMXXEFCIMONLKH-UHFFFAOYSA-N 3-(3,5-dichlorophenyl)-1,3-oxazolidine Chemical class ClC1=CC(Cl)=CC(N2COCC2)=C1 AMXXEFCIMONLKH-UHFFFAOYSA-N 0.000 description 1
- LNYCRXIGNQFREW-UHFFFAOYSA-N 3-(3,5-dichlorophenyl)-5-ethenyl-1,3-oxazolidine-2,4-dione Chemical compound ClC1=CC(Cl)=CC(N2C(C(C=C)OC2=O)=O)=C1 LNYCRXIGNQFREW-UHFFFAOYSA-N 0.000 description 1
- 241000551547 Dione <red algae> Species 0.000 description 1
- 241000220317 Rosa Species 0.000 description 1
- ISKQADXMHQSTHK-UHFFFAOYSA-N [4-(aminomethyl)phenyl]methanamine Chemical compound NCC1=CC=C(CN)C=C1 ISKQADXMHQSTHK-UHFFFAOYSA-N 0.000 description 1
- UKLDJPRMSDWDSL-UHFFFAOYSA-L [dibutyl(dodecanoyloxy)stannyl] dodecanoate Chemical compound CCCCCCCCCCCC(=O)O[Sn](CCCC)(CCCC)OC(=O)CCCCCCCCCCC UKLDJPRMSDWDSL-UHFFFAOYSA-L 0.000 description 1
- 125000001931 aliphatic group Chemical class 0.000 description 1
- 125000004414 alkyl thio group Chemical group 0.000 description 1
- 239000000010 aprotic solvent Substances 0.000 description 1
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 150000004292 cyclic ethers Chemical class 0.000 description 1
- PNOXNTGLSKTMQO-UHFFFAOYSA-L diacetyloxytin Chemical compound CC(=O)O[Sn]OC(C)=O PNOXNTGLSKTMQO-UHFFFAOYSA-L 0.000 description 1
- 239000012975 dibutyltin dilaurate Substances 0.000 description 1
- PYBNTRWJKQJDRE-UHFFFAOYSA-L dodecanoate;tin(2+) Chemical compound [Sn+2].CCCCCCCCCCCC([O-])=O.CCCCCCCCCCCC([O-])=O PYBNTRWJKQJDRE-UHFFFAOYSA-L 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 239000012943 hotmelt Substances 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- 150000002430 hydrocarbons Chemical class 0.000 description 1
- 125000004435 hydrogen atom Chemical class [H]* 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 238000002955 isolation Methods 0.000 description 1
- 125000002960 margaryl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000000155 melt Substances 0.000 description 1
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- COWNFYYYZFRNOY-UHFFFAOYSA-N oxazolidinedione Chemical compound O=C1COC(=O)N1 COWNFYYYZFRNOY-UHFFFAOYSA-N 0.000 description 1
- 150000002917 oxazolidines Chemical class 0.000 description 1
- 125000002958 pentadecyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 238000007363 ring formation reaction Methods 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 125000002914 sec-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 1
- 125000002948 undecyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000003643 water by type Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D263/00—Heterocyclic compounds containing 1,3-oxazole or hydrogenated 1,3-oxazole rings
- C07D263/02—Heterocyclic compounds containing 1,3-oxazole or hydrogenated 1,3-oxazole rings not condensed with other rings
- C07D263/30—Heterocyclic compounds containing 1,3-oxazole or hydrogenated 1,3-oxazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D263/34—Heterocyclic compounds containing 1,3-oxazole or hydrogenated 1,3-oxazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D263/44—Two oxygen atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Heterocyclic Carbon Compounds Containing A Hetero Ring Having Nitrogen And Oxygen As The Only Ring Hetero Atoms (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
- Adhesives Or Adhesive Processes (AREA)
- Polyurethanes Or Polyureas (AREA)
Priority Applications (6)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19833325734 DE3325734A1 (de) | 1983-07-16 | 1983-07-16 | Verfahren zur herstellung von n-(3,5-dichlorphenyl)-oxazolidin-2,4-dionen |
| AT84108131T ATE37542T1 (de) | 1983-07-16 | 1984-07-11 | Verfahren zur herstellung von n-(3,5dichlorphenyl)-oxazolidin-2,4-dionen. |
| DE8484108131T DE3474302D1 (en) | 1983-07-16 | 1984-07-11 | Process for the preparation of n-(3,5-dichlorophenyl)-oxazolidine-2,4-diones |
| EP84108131A EP0131903B1 (de) | 1983-07-16 | 1984-07-11 | Verfahren zur Herstellung von N-(3,5-Dichlorphenyl)-oxazolidin-2,4-dionen |
| JP59144534A JPS6064973A (ja) | 1983-07-16 | 1984-07-13 | N−(3,5−ジクロルフエニル)−オキサゾリジン−2,4−ジオンの製造法 |
| US06/631,183 US4810799A (en) | 1983-07-16 | 1984-07-16 | Preparation of N-(3,5-dichlorophenyl)oxazolidine-2,4-diones |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19833325734 DE3325734A1 (de) | 1983-07-16 | 1983-07-16 | Verfahren zur herstellung von n-(3,5-dichlorphenyl)-oxazolidin-2,4-dionen |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE3325734A1 true DE3325734A1 (de) | 1985-01-24 |
Family
ID=6204171
Family Applications (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19833325734 Withdrawn DE3325734A1 (de) | 1983-07-16 | 1983-07-16 | Verfahren zur herstellung von n-(3,5-dichlorphenyl)-oxazolidin-2,4-dionen |
| DE8484108131T Expired DE3474302D1 (en) | 1983-07-16 | 1984-07-11 | Process for the preparation of n-(3,5-dichlorophenyl)-oxazolidine-2,4-diones |
Family Applications After (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE8484108131T Expired DE3474302D1 (en) | 1983-07-16 | 1984-07-11 | Process for the preparation of n-(3,5-dichlorophenyl)-oxazolidine-2,4-diones |
Country Status (5)
| Country | Link |
|---|---|
| US (1) | US4810799A (enExample) |
| EP (1) | EP0131903B1 (enExample) |
| JP (1) | JPS6064973A (enExample) |
| AT (1) | ATE37542T1 (enExample) |
| DE (2) | DE3325734A1 (enExample) |
Families Citing this family (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPH07308915A (ja) * | 1994-05-19 | 1995-11-28 | Goei Seisakusho:Kk | 消音カッター |
| US6160122A (en) * | 1996-06-28 | 2000-12-12 | Abbott Laboratories | Process for the preparation of a disubstituted thiazole |
| FR2751965B1 (fr) * | 1996-08-01 | 1998-11-27 | Oreal | Nouveaux composes de la famille des aryl-2,4-dioxo-oxazolidines |
| PT922720E (pt) | 1997-12-11 | 2002-01-30 | Bayer Ag | Processo para a preparacao e utilizacao de camadas ou pos reactivos latentes estaveis a armazenagem de poliisocianatos solidos desactivados superficialmente e polimeros de dispersao com grupos funcionais |
| DE19924138A1 (de) | 1999-05-26 | 2000-11-30 | Henkel Kgaa | Lösbare Klebeverbindungen |
| DE19951599A1 (de) | 1999-10-27 | 2001-05-23 | Henkel Kgaa | Verfahren zur adhesiven Trennung von Klebeverbunden |
| DE10037884A1 (de) | 2000-08-03 | 2002-02-21 | Henkel Kgaa | Verfahren zur beschleunigten Klebstoffaushärtung |
| GB2400104B (en) | 2003-04-03 | 2007-10-10 | Bostik Findley Ltd | Storage stable adhesive paste compositions |
Family Cites Families (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB1051945A (enExample) * | 1963-09-18 | 1900-01-01 | ||
| DE2324591C2 (de) * | 1973-05-16 | 1985-12-12 | Basf Ag, 6700 Ludwigshafen | Oxazolidin-Derivate |
| DE2813873A1 (de) * | 1978-03-31 | 1979-10-11 | Basf Ag | Verfahren zur herstellung von oxazolidin-2,4-dionen |
| DE3014119A1 (de) * | 1980-04-12 | 1981-10-15 | Basf Ag, 6700 Ludwigshafen | Verfahren zur herstellung von n-(3,5-dichlorphenyl)-oxazolidin-2,4-dionen |
-
1983
- 1983-07-16 DE DE19833325734 patent/DE3325734A1/de not_active Withdrawn
-
1984
- 1984-07-11 DE DE8484108131T patent/DE3474302D1/de not_active Expired
- 1984-07-11 EP EP84108131A patent/EP0131903B1/de not_active Expired
- 1984-07-11 AT AT84108131T patent/ATE37542T1/de not_active IP Right Cessation
- 1984-07-13 JP JP59144534A patent/JPS6064973A/ja active Granted
- 1984-07-16 US US06/631,183 patent/US4810799A/en not_active Expired - Lifetime
Also Published As
| Publication number | Publication date |
|---|---|
| EP0131903A3 (en) | 1986-03-05 |
| ATE37542T1 (de) | 1988-10-15 |
| JPS6064973A (ja) | 1985-04-13 |
| DE3474302D1 (en) | 1988-11-03 |
| EP0131903A2 (de) | 1985-01-23 |
| EP0131903B1 (de) | 1988-09-28 |
| US4810799A (en) | 1989-03-07 |
| JPH0585547B2 (enExample) | 1993-12-07 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| EP0131902A2 (de) | Bei Raumtemperatur flüssige, lagerstabile, wärmeaktivierbare Stoffgemische aus Polyolen und/oder Polyaminen und Polyisocyanaten für Polyurethan-Haftkleber | |
| DE2715503C2 (de) | Verfahren zur Herstellung von Maleinimiden | |
| EP0069926B1 (de) | Verfahren zur Herstellung von Fumarsäuremonoestern | |
| EP0454624B1 (de) | Verfahren zur Herstellung von 1,3-Diketonen | |
| EP0131903B1 (de) | Verfahren zur Herstellung von N-(3,5-Dichlorphenyl)-oxazolidin-2,4-dionen | |
| DE3235933A1 (de) | Verfahren zur herstellung bicyclischer orthoesteramide | |
| EP0008102B1 (de) | Verfahren zur Herstellung von Azaspirodecanen | |
| DE1240866B (de) | Verfahren zur Herstellung von Indolin-6-sulfonylharnstoffen | |
| DE2757506C2 (de) | Verfahren zur Herstellung von Piperonylidencrotonsaureamiden | |
| DE2454856A1 (de) | Verfahren zur herstellung von maleinimiden | |
| EP0171584B1 (de) | Verfahren zur Herstellung von 2-Alkyl-4,5-dihydroximethylimidazolen | |
| EP0038007B1 (de) | Verfahren zur Herstellung von N-(3,5-Dichlorphenyl)-oxazolidin-2,4-dionen | |
| DE2900506C2 (enExample) | ||
| DE69607568T2 (de) | Verfahren zur Herstellung von Additionsprodukten aus Aminen und Alpha-Beta ungesättigten Verbindungen | |
| DE3125990A1 (de) | Verfahren zur herstellung von imidazolderivaten | |
| DE69420331T2 (de) | Verfahren zur Herstellung von 3-Methyl-1-phenylphospholenoxyd | |
| DE2649536C2 (de) | Verwendung eines Silazans und/oder Silylamins in Kombination mit Bis(trimethylsilyl)sulfat zur Silylierung einer organischen Verbindung | |
| DE2628653C2 (de) | Verfahren zur Herstellung von Naphtholactam | |
| DE2451725C2 (de) | Verfahren zur Herstellung von 4- Methyloxazol | |
| DE2250469A1 (de) | Verfahren zur herstellung von substituierten benzimidazolen | |
| DE2428249C3 (de) | Verfahren zur Herstellung von | |
| DE2065698A1 (de) | Verfahren zur herstellung von 2isopropyl-6-methyl-4(3h)-pyrimidon | |
| DE2235377A1 (de) | 2,4-thiazol-dimethanol-carbamat und verfahren zu dessen herstellung | |
| EP0131801A1 (de) | Verfahren zur Herstellung substituierter Ethylenharnstoffe sowie neue N-Vinylethylenharnstoffe | |
| DE60018740T2 (de) | Verfahren zur Herstellung von 5-(2-substituiertem-4-Nitrophenyl)-oxazol, Oxazolverbindung, und Verfahren zu deren Herstellung |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8130 | Withdrawal |