DE3232809A1 - Kathode fuer die elektrolyse von sauren loesungen - Google Patents
Kathode fuer die elektrolyse von sauren loesungenInfo
- Publication number
- DE3232809A1 DE3232809A1 DE19823232809 DE3232809A DE3232809A1 DE 3232809 A1 DE3232809 A1 DE 3232809A1 DE 19823232809 DE19823232809 DE 19823232809 DE 3232809 A DE3232809 A DE 3232809A DE 3232809 A1 DE3232809 A1 DE 3232809A1
- Authority
- DE
- Germany
- Prior art keywords
- cathode
- layer
- coating
- spray coating
- electrolysis
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Withdrawn
Links
- 238000005868 electrolysis reaction Methods 0.000 title claims description 18
- 239000002253 acid Substances 0.000 title description 7
- 238000005507 spraying Methods 0.000 claims description 41
- 239000011347 resin Substances 0.000 claims description 25
- 229920005989 resin Polymers 0.000 claims description 25
- 239000000758 substrate Substances 0.000 claims description 25
- 229910052751 metal Inorganic materials 0.000 claims description 20
- 239000002184 metal Substances 0.000 claims description 20
- 239000011247 coating layer Substances 0.000 claims description 17
- YCKRFDGAMUMZLT-UHFFFAOYSA-N Fluorine atom Chemical compound [F] YCKRFDGAMUMZLT-UHFFFAOYSA-N 0.000 claims description 16
- 239000011737 fluorine Substances 0.000 claims description 16
- 229910052731 fluorine Inorganic materials 0.000 claims description 16
- 239000010410 layer Substances 0.000 claims description 15
- UONOETXJSWQNOL-UHFFFAOYSA-N tungsten carbide Chemical compound [W+]#[C-] UONOETXJSWQNOL-UHFFFAOYSA-N 0.000 claims description 15
- 238000005470 impregnation Methods 0.000 claims description 14
- 239000000463 material Substances 0.000 claims description 13
- WFKWXMTUELFFGS-UHFFFAOYSA-N tungsten Chemical compound [W] WFKWXMTUELFFGS-UHFFFAOYSA-N 0.000 claims description 13
- 239000000843 powder Substances 0.000 claims description 12
- 239000007921 spray Substances 0.000 claims description 11
- 229910052721 tungsten Inorganic materials 0.000 claims description 11
- 239000010937 tungsten Substances 0.000 claims description 11
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 claims description 10
- 238000000034 method Methods 0.000 claims description 10
- 239000000203 mixture Substances 0.000 claims description 10
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Chemical compound [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 claims description 10
- 239000003929 acidic solution Substances 0.000 claims description 9
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 claims description 7
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 claims description 7
- BFKJFAAPBSQJPD-UHFFFAOYSA-N tetrafluoroethene Chemical group FC(F)=C(F)F BFKJFAAPBSQJPD-UHFFFAOYSA-N 0.000 claims description 7
- 239000006182 cathode active material Substances 0.000 claims description 6
- 239000011248 coating agent Substances 0.000 claims description 5
- 238000000576 coating method Methods 0.000 claims description 5
- 238000004519 manufacturing process Methods 0.000 claims description 4
- 229910052763 palladium Inorganic materials 0.000 claims description 4
- 229910045601 alloy Inorganic materials 0.000 claims description 3
- 239000000956 alloy Substances 0.000 claims description 3
- 229910052759 nickel Inorganic materials 0.000 claims description 3
- 239000010955 niobium Substances 0.000 claims description 3
- 229910052697 platinum Inorganic materials 0.000 claims description 3
- 229910052715 tantalum Inorganic materials 0.000 claims description 3
- 229910000990 Ni alloy Inorganic materials 0.000 claims description 2
- RTAQQCXQSZGOHL-UHFFFAOYSA-N Titanium Chemical compound [Ti] RTAQQCXQSZGOHL-UHFFFAOYSA-N 0.000 claims description 2
- 229910052796 boron Inorganic materials 0.000 claims description 2
- 229910052799 carbon Inorganic materials 0.000 claims description 2
- 229910052804 chromium Inorganic materials 0.000 claims description 2
- 229910017052 cobalt Inorganic materials 0.000 claims description 2
- 239000010941 cobalt Substances 0.000 claims description 2
- GUTLYIVDDKVIGB-UHFFFAOYSA-N cobalt atom Chemical compound [Co] GUTLYIVDDKVIGB-UHFFFAOYSA-N 0.000 claims description 2
- 229910052741 iridium Inorganic materials 0.000 claims description 2
- 229910052758 niobium Inorganic materials 0.000 claims description 2
- 229910052703 rhodium Inorganic materials 0.000 claims description 2
- 229910052707 ruthenium Inorganic materials 0.000 claims description 2
- 239000010936 titanium Substances 0.000 claims description 2
- 229910052719 titanium Inorganic materials 0.000 claims description 2
- 229910052726 zirconium Inorganic materials 0.000 claims description 2
- ZOXJGFHDIHLPTG-UHFFFAOYSA-N Boron Chemical compound [B] ZOXJGFHDIHLPTG-UHFFFAOYSA-N 0.000 claims 1
- VYZAMTAEIAYCRO-UHFFFAOYSA-N Chromium Chemical compound [Cr] VYZAMTAEIAYCRO-UHFFFAOYSA-N 0.000 claims 1
- ZOKXTWBITQBERF-UHFFFAOYSA-N Molybdenum Chemical compound [Mo] ZOKXTWBITQBERF-UHFFFAOYSA-N 0.000 claims 1
- KJTLSVCANCCWHF-UHFFFAOYSA-N Ruthenium Chemical compound [Ru] KJTLSVCANCCWHF-UHFFFAOYSA-N 0.000 claims 1
- QCWXUUIWCKQGHC-UHFFFAOYSA-N Zirconium Chemical compound [Zr] QCWXUUIWCKQGHC-UHFFFAOYSA-N 0.000 claims 1
- 239000011651 chromium Substances 0.000 claims 1
- GKOZUEZYRPOHIO-UHFFFAOYSA-N iridium atom Chemical compound [Ir] GKOZUEZYRPOHIO-UHFFFAOYSA-N 0.000 claims 1
- 229910052750 molybdenum Inorganic materials 0.000 claims 1
- 239000011733 molybdenum Substances 0.000 claims 1
- GUCVJGMIXFAOAE-UHFFFAOYSA-N niobium atom Chemical compound [Nb] GUCVJGMIXFAOAE-UHFFFAOYSA-N 0.000 claims 1
- 239000010948 rhodium Substances 0.000 claims 1
- MHOVAHRLVXNVSD-UHFFFAOYSA-N rhodium atom Chemical compound [Rh] MHOVAHRLVXNVSD-UHFFFAOYSA-N 0.000 claims 1
- GUVRBAGPIYLISA-UHFFFAOYSA-N tantalum atom Chemical compound [Ta] GUVRBAGPIYLISA-UHFFFAOYSA-N 0.000 claims 1
- 229910052739 hydrogen Inorganic materials 0.000 description 16
- 239000001257 hydrogen Substances 0.000 description 16
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 12
- 229910002804 graphite Inorganic materials 0.000 description 9
- 239000010439 graphite Substances 0.000 description 9
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 8
- 239000013543 active substance Substances 0.000 description 8
- 230000007797 corrosion Effects 0.000 description 8
- 238000005260 corrosion Methods 0.000 description 8
- 239000006185 dispersion Substances 0.000 description 7
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 6
- 239000003792 electrolyte Substances 0.000 description 6
- 239000000243 solution Substances 0.000 description 6
- 230000015572 biosynthetic process Effects 0.000 description 5
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical compound [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 4
- 230000000694 effects Effects 0.000 description 4
- 150000002431 hydrogen Chemical class 0.000 description 4
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 3
- 238000002156 mixing Methods 0.000 description 3
- 150000007524 organic acids Chemical class 0.000 description 3
- 239000002245 particle Substances 0.000 description 3
- 239000000126 substance Substances 0.000 description 3
- 239000003513 alkali Substances 0.000 description 2
- 235000019270 ammonium chloride Nutrition 0.000 description 2
- 229920001577 copolymer Polymers 0.000 description 2
- 239000007789 gas Substances 0.000 description 2
- 229910000856 hastalloy Inorganic materials 0.000 description 2
- 238000005259 measurement Methods 0.000 description 2
- 239000007769 metal material Substances 0.000 description 2
- MUMZUERVLWJKNR-UHFFFAOYSA-N oxoplatinum Chemical class [Pt]=O MUMZUERVLWJKNR-UHFFFAOYSA-N 0.000 description 2
- 238000007747 plating Methods 0.000 description 2
- -1 platinum group metals Chemical class 0.000 description 2
- 238000005245 sintering Methods 0.000 description 2
- FPBWSPZHCJXUBL-UHFFFAOYSA-N 1-chloro-1-fluoroethene Chemical group FC(Cl)=C FPBWSPZHCJXUBL-UHFFFAOYSA-N 0.000 description 1
- 229910000792 Monel Inorganic materials 0.000 description 1
- 229910018054 Ni-Cu Inorganic materials 0.000 description 1
- 229910003296 Ni-Mo Inorganic materials 0.000 description 1
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 1
- 229910018481 Ni—Cu Inorganic materials 0.000 description 1
- 229920006361 Polyflon Polymers 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 239000012670 alkaline solution Substances 0.000 description 1
- 230000001680 brushing effect Effects 0.000 description 1
- 230000000052 comparative effect Effects 0.000 description 1
- 230000003247 decreasing effect Effects 0.000 description 1
- 230000006866 deterioration Effects 0.000 description 1
- 238000009826 distribution Methods 0.000 description 1
- 238000009713 electroplating Methods 0.000 description 1
- 230000004927 fusion Effects 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 238000007654 immersion Methods 0.000 description 1
- NPURPEXKKDAKIH-UHFFFAOYSA-N iodoimino(oxo)methane Chemical compound IN=C=O NPURPEXKKDAKIH-UHFFFAOYSA-N 0.000 description 1
- 229910052742 iron Inorganic materials 0.000 description 1
- 238000011068 loading method Methods 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- DDTIGTPWGISMKL-UHFFFAOYSA-N molybdenum nickel Chemical compound [Ni].[Mo] DDTIGTPWGISMKL-UHFFFAOYSA-N 0.000 description 1
- 229910017604 nitric acid Inorganic materials 0.000 description 1
- 230000035515 penetration Effects 0.000 description 1
- 229920000642 polymer Polymers 0.000 description 1
- 238000006116 polymerization reaction Methods 0.000 description 1
- 239000012255 powdered metal Substances 0.000 description 1
- 229910001925 ruthenium oxide Inorganic materials 0.000 description 1
- WOCIAKWEIIZHES-UHFFFAOYSA-N ruthenium(iv) oxide Chemical compound O=[Ru]=O WOCIAKWEIIZHES-UHFFFAOYSA-N 0.000 description 1
- 239000002344 surface layer Substances 0.000 description 1
- 238000005979 thermal decomposition reaction Methods 0.000 description 1
- MTPVUVINMAGMJL-UHFFFAOYSA-N trimethyl(1,1,2,2,2-pentafluoroethyl)silane Chemical compound C[Si](C)(C)C(F)(F)C(F)(F)F MTPVUVINMAGMJL-UHFFFAOYSA-N 0.000 description 1
- 238000007738 vacuum evaporation Methods 0.000 description 1
- 238000007740 vapor deposition Methods 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C25—ELECTROLYTIC OR ELECTROPHORETIC PROCESSES; APPARATUS THEREFOR
- C25B—ELECTROLYTIC OR ELECTROPHORETIC PROCESSES FOR THE PRODUCTION OF COMPOUNDS OR NON-METALS; APPARATUS THEREFOR
- C25B11/00—Electrodes; Manufacture thereof not otherwise provided for
- C25B11/04—Electrodes; Manufacture thereof not otherwise provided for characterised by the material
- C25B11/051—Electrodes formed of electrocatalysts on a substrate or carrier
- C25B11/073—Electrodes formed of electrocatalysts on a substrate or carrier characterised by the electrocatalyst material
- C25B11/091—Electrodes formed of electrocatalysts on a substrate or carrier characterised by the electrocatalyst material consisting of at least one catalytic element and at least one catalytic compound; consisting of two or more catalytic elements or catalytic compounds
-
- C—CHEMISTRY; METALLURGY
- C25—ELECTROLYTIC OR ELECTROPHORETIC PROCESSES; APPARATUS THEREFOR
- C25B—ELECTROLYTIC OR ELECTROPHORETIC PROCESSES FOR THE PRODUCTION OF COMPOUNDS OR NON-METALS; APPARATUS THEREFOR
- C25B11/00—Electrodes; Manufacture thereof not otherwise provided for
- C25B11/02—Electrodes; Manufacture thereof not otherwise provided for characterised by shape or form
-
- C—CHEMISTRY; METALLURGY
- C25—ELECTROLYTIC OR ELECTROPHORETIC PROCESSES; APPARATUS THEREFOR
- C25B—ELECTROLYTIC OR ELECTROPHORETIC PROCESSES FOR THE PRODUCTION OF COMPOUNDS OR NON-METALS; APPARATUS THEREFOR
- C25B11/00—Electrodes; Manufacture thereof not otherwise provided for
- C25B11/04—Electrodes; Manufacture thereof not otherwise provided for characterised by the material
- C25B11/051—Electrodes formed of electrocatalysts on a substrate or carrier
- C25B11/073—Electrodes formed of electrocatalysts on a substrate or carrier characterised by the electrocatalyst material
- C25B11/091—Electrodes formed of electrocatalysts on a substrate or carrier characterised by the electrocatalyst material consisting of at least one catalytic element and at least one catalytic compound; consisting of two or more catalytic elements or catalytic compounds
- C25B11/095—Electrodes formed of electrocatalysts on a substrate or carrier characterised by the electrocatalyst material consisting of at least one catalytic element and at least one catalytic compound; consisting of two or more catalytic elements or catalytic compounds at least one of the compounds being organic
Landscapes
- Chemical & Material Sciences (AREA)
- Engineering & Computer Science (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Electrochemistry (AREA)
- Materials Engineering (AREA)
- Metallurgy (AREA)
- Organic Chemistry (AREA)
- Electrodes For Compound Or Non-Metal Manufacture (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP56148698A JPS6022070B2 (ja) | 1981-09-22 | 1981-09-22 | 酸性溶液電解用陰極及びその製造方法 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE3232809A1 true DE3232809A1 (de) | 1983-03-31 |
Family
ID=15458591
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19823232809 Withdrawn DE3232809A1 (de) | 1981-09-22 | 1982-09-03 | Kathode fuer die elektrolyse von sauren loesungen |
Country Status (12)
| Country | Link |
|---|---|
| US (2) | US4500405A (enExample) |
| JP (1) | JPS6022070B2 (enExample) |
| KR (1) | KR890001070B1 (enExample) |
| CA (1) | CA1203775A (enExample) |
| DE (1) | DE3232809A1 (enExample) |
| FR (1) | FR2513272A1 (enExample) |
| GB (1) | GB2107737B (enExample) |
| IN (1) | IN158498B (enExample) |
| IT (1) | IT1149085B (enExample) |
| MY (1) | MY8600257A (enExample) |
| PH (1) | PH18512A (enExample) |
| SE (1) | SE454892B (enExample) |
Cited By (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3322125A1 (de) * | 1982-06-30 | 1984-01-05 | Permelec Electrode Ltd., Fujisawa, Kanagawa | Kathode fuer die elektrolyse von saeureloesungen und verfahren zu ihrer herstellung |
| DE3322169A1 (de) * | 1983-06-21 | 1985-01-10 | Sigri Elektrographit Gmbh, 8901 Meitingen | Kathode fuer waesserige elektrolysen |
| DE102010023418A1 (de) | 2010-06-11 | 2011-12-15 | Uhde Gmbh | Ein- oder mehrseitige Substratbeschichtung |
Families Citing this family (26)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4554172A (en) * | 1984-07-05 | 1985-11-19 | Olin Corporation | Method of repairing electrode surfaces |
| JPS62262777A (ja) * | 1986-05-09 | 1987-11-14 | Kansai Paint Co Ltd | 防食塗膜形成法 |
| JPS62284095A (ja) * | 1986-06-02 | 1987-12-09 | Permelec Electrode Ltd | 耐久性を有する電解用電極及びその製造方法 |
| JPH06108279A (ja) * | 1992-09-28 | 1994-04-19 | Tadahiro Omi | 水素酸素発生装置 |
| US6024935A (en) * | 1996-01-26 | 2000-02-15 | Blacklight Power, Inc. | Lower-energy hydrogen methods and structures |
| KR100504412B1 (ko) * | 1996-04-02 | 2005-11-08 | 페르메렉덴꾜꾸가부시끼가이샤 | 전해용전극및당해전극을사용하는전해조 |
| US20090142257A1 (en) * | 1997-07-22 | 2009-06-04 | Blacklight Power, Inc. | Inorganic hydrogen compounds and applications thereof |
| US20090129992A1 (en) * | 1997-07-22 | 2009-05-21 | Blacklight Power, Inc. | Reactor for Preparing Hydrogen Compounds |
| JP2001511429A (ja) * | 1997-07-22 | 2001-08-14 | ブラック ライト パワー インコーポレイテッド | 無機水素化合物、分離方法及び燃料用途 |
| US20090123356A1 (en) * | 1997-07-22 | 2009-05-14 | Blacklight Power, Inc. | Inorganic hydrogen compounds |
| US6852618B2 (en) * | 2001-04-19 | 2005-02-08 | Micron Technology, Inc. | Combined barrier layer and seed layer |
| CA2466953A1 (en) * | 2001-11-14 | 2003-08-14 | Blacklight Power, Inc. | Hydrogen power, plasma, and reactor for lasing, and power conversion |
| US20040095705A1 (en) * | 2001-11-28 | 2004-05-20 | Mills Randell L. | Plasma-to-electric power conversion |
| US20030129117A1 (en) * | 2002-01-02 | 2003-07-10 | Mills Randell L. | Synthesis and characterization of a highly stable amorphous silicon hydride as the product of a catalytic hydrogen plasma reaction |
| US20040118348A1 (en) * | 2002-03-07 | 2004-06-24 | Mills Randell L.. | Microwave power cell, chemical reactor, and power converter |
| CA2483780A1 (en) * | 2002-05-01 | 2003-11-13 | Blacklight Power, Inc. | Diamond synthesis |
| GB2417953A (en) * | 2003-04-15 | 2006-03-15 | Black Light Power Inc | Plasma reactor and process for producing lower-energy hydrogen species |
| US7332065B2 (en) * | 2003-06-19 | 2008-02-19 | Akzo Nobel N.V. | Electrode |
| US7188033B2 (en) * | 2003-07-21 | 2007-03-06 | Blacklight Power Incorporated | Method and system of computing and rendering the nature of the chemical bond of hydrogen-type molecules and molecular ions |
| EP1683240A1 (en) | 2003-10-24 | 2006-07-26 | Blacklight Power, Inc. | Novel molecular hydrogen gas laser |
| GB2426093A (en) * | 2004-01-05 | 2006-11-15 | Black Light Power Inc | Method and system of computing and rendering the nature of atoms and atomic ions |
| WO2005116630A2 (en) * | 2004-05-17 | 2005-12-08 | Blacklight Power, Inc. | Method and system of computing and rendering the nature of the excited electronic states of atoms and atomic ions |
| US20070198199A1 (en) * | 2004-07-19 | 2007-08-23 | Mills Randell L | Method and system of computing and rendering the nature of the chemical bond of hydrogen-type molecules and molecular ions |
| US20080304522A1 (en) * | 2006-04-04 | 2008-12-11 | Mills Randell L | Catalyst laser |
| US9393115B2 (en) * | 2008-01-24 | 2016-07-19 | Medtronic, Inc. | Delivery systems and methods of implantation for prosthetic heart valves |
| KR20200071675A (ko) | 2018-12-11 | 2020-06-19 | 에이지씨 가부시키가이샤 | 유리 조성물, 유리 분말, 봉착 재료, 유리 페이스트, 봉착 방법, 봉착 패키지 및 유기 일렉트로루미네센스 소자 |
Citations (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3922226A (en) * | 1973-05-16 | 1975-11-25 | Ici Ltd | Anodes for mercury-cathode electrolytic cells |
| US3977959A (en) * | 1973-09-13 | 1976-08-31 | Basf Aktiengesellschaft | Anodes for electrolysis |
| US4175023A (en) * | 1976-06-11 | 1979-11-20 | Basf Wyandotte Corporation | Combined cathode and diaphragm unit for electrolytic cells |
Family Cites Families (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3649485A (en) * | 1968-10-02 | 1972-03-14 | Ppg Industries Inc | Electrolysis of brine using coated carbon anodes |
| BE789853A (fr) * | 1971-10-07 | 1973-04-09 | Hoechst Ag | Electrode d'electrochimie a dimensions stables et resistant auxcorrosions |
| DE2150411B2 (de) * | 1971-10-09 | 1974-08-15 | Rheinisch-Westfaelisches Elektrizitaetswerk Ag, 4300 Essen | Chemisch inerte Elektrode |
| US3798063A (en) * | 1971-11-29 | 1974-03-19 | Diamond Shamrock Corp | FINELY DIVIDED RuO{11 {11 PLASTIC MATRIX ELECTRODE |
| JPS6013074B2 (ja) * | 1978-02-20 | 1985-04-04 | クロリンエンジニアズ株式会社 | 電解用陰極及びその製造法 |
| US4354915A (en) * | 1979-12-17 | 1982-10-19 | Hooker Chemicals & Plastics Corp. | Low overvoltage hydrogen cathodes |
-
1981
- 1981-09-22 JP JP56148698A patent/JPS6022070B2/ja not_active Expired
-
1982
- 1982-08-19 PH PH27753A patent/PH18512A/en unknown
- 1982-09-03 DE DE19823232809 patent/DE3232809A1/de not_active Withdrawn
- 1982-09-14 GB GB08226171A patent/GB2107737B/en not_active Expired
- 1982-09-20 IT IT49136/82A patent/IT1149085B/it active
- 1982-09-20 KR KR8204238A patent/KR890001070B1/ko not_active Expired
- 1982-09-21 CA CA000411837A patent/CA1203775A/en not_active Expired
- 1982-09-21 SE SE8205405A patent/SE454892B/sv not_active IP Right Cessation
- 1982-09-22 IN IN1095/CAL/82A patent/IN158498B/en unknown
- 1982-09-22 FR FR8215982A patent/FR2513272A1/fr active Granted
-
1984
- 1984-01-09 US US06/568,515 patent/US4500405A/en not_active Expired - Fee Related
-
1985
- 1985-01-03 US US06/688,204 patent/US4568568A/en not_active Expired - Fee Related
-
1986
- 1986-12-30 MY MY257/86A patent/MY8600257A/xx unknown
Patent Citations (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3922226A (en) * | 1973-05-16 | 1975-11-25 | Ici Ltd | Anodes for mercury-cathode electrolytic cells |
| US3977959A (en) * | 1973-09-13 | 1976-08-31 | Basf Aktiengesellschaft | Anodes for electrolysis |
| US4175023A (en) * | 1976-06-11 | 1979-11-20 | Basf Wyandotte Corporation | Combined cathode and diaphragm unit for electrolytic cells |
Cited By (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3322125A1 (de) * | 1982-06-30 | 1984-01-05 | Permelec Electrode Ltd., Fujisawa, Kanagawa | Kathode fuer die elektrolyse von saeureloesungen und verfahren zu ihrer herstellung |
| DE3322169A1 (de) * | 1983-06-21 | 1985-01-10 | Sigri Elektrographit Gmbh, 8901 Meitingen | Kathode fuer waesserige elektrolysen |
| DE102010023418A1 (de) | 2010-06-11 | 2011-12-15 | Uhde Gmbh | Ein- oder mehrseitige Substratbeschichtung |
| WO2011154094A1 (de) | 2010-06-11 | 2011-12-15 | Uhde Gmbh | Ein- oder mehrseitige substratbeschichtung |
| US10030300B2 (en) | 2010-06-11 | 2018-07-24 | Thyssenkrupp Industrial Solutions Ag | Substrate coating on one or more sides |
Also Published As
| Publication number | Publication date |
|---|---|
| JPS6022070B2 (ja) | 1985-05-30 |
| SE8205405D0 (sv) | 1982-09-21 |
| KR890001070B1 (ko) | 1989-04-22 |
| IT1149085B (it) | 1986-12-03 |
| IT8249136A0 (it) | 1982-09-20 |
| GB2107737B (en) | 1985-01-16 |
| KR840001648A (ko) | 1984-05-16 |
| SE8205405L (sv) | 1983-03-23 |
| IN158498B (enExample) | 1986-11-29 |
| MY8600257A (en) | 1986-12-31 |
| JPS5852489A (ja) | 1983-03-28 |
| PH18512A (en) | 1985-08-02 |
| FR2513272A1 (fr) | 1983-03-25 |
| SE454892B (sv) | 1988-06-06 |
| US4500405A (en) | 1985-02-19 |
| CA1203775A (en) | 1986-04-29 |
| US4568568A (en) | 1986-02-04 |
| FR2513272B1 (enExample) | 1985-04-26 |
| GB2107737A (en) | 1983-05-05 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE3232809A1 (de) | Kathode fuer die elektrolyse von sauren loesungen | |
| DE2640225C2 (de) | Kathode für die Elektrolyse von Wasser oder Alkalichloridlösungen und Verfahren zu deren Herstellung | |
| DE3219003C2 (enExample) | ||
| DE69305668T2 (de) | Sauerstoff-Entwicklungselektrode | |
| DE2532553A1 (de) | Anode fuer elektrolytische verfahren | |
| DE2403573A1 (de) | Neue elektroden und verfahren zu ihrer herstellung | |
| DE3507071C2 (de) | Elektrode für die Elektrolyse und Verfahren zu ihrer Herstellung | |
| DE3401952A1 (de) | Dauerhafte elektrode zur elektrolyse und verfahren zu deren herstellung | |
| DD243718A5 (de) | Elektrode fuer elektrochemiesche prozesse, verfahren zur herstellung derselben | |
| DE2657979A1 (de) | Elektrode fuer elektrochemische verfahren und verfahren zu deren herstellung | |
| DE69521588T2 (de) | Stabile Beschichtungslösungen zur Bildung von elektrokatalytischen Beschichtungen aus gemischten Oxyden auf Metall oder metallisierten Trägern und Verfahren zur Herstellung von dimensionstabilen Anoden unter Verwendung dieser Lösungen | |
| DE2213083A1 (de) | Elektroden für elektrochemische Verfahren | |
| DE2619670A1 (de) | Anode fuer elektrolytische prozesse | |
| DE3507072C2 (de) | Elektrode für die elektrolytische Erzeugung von Sauerstoff und Verfahren zu ihrer Herstellung | |
| DE2752875A1 (de) | Elektrode fuer elektrochemische prozesse und verfahren zu deren herstellung | |
| DE1964293B2 (de) | Anode, Verfahren zu ihrer Herstellung und ihre Verwendung bei der Elektrolyse von Alkalichloridlösungen | |
| DE69901201T2 (de) | Elektrode für Elektrolyse und deren Herstellungsverfahren | |
| DE3047636A1 (de) | Kathode, verfahren zu ihrer herstellung, ihre verwendung und elektrolysezelle | |
| DE3322125C2 (de) | Kathode für die Elektrolyse von Säurelösungen und Verfahren zu ihrer Herstellung | |
| DE3872228T2 (de) | Elektrode fuer die entwicklung von sauerstoff und deren herstellungsverfahren. | |
| DE3322169C2 (enExample) | ||
| DE3780075T2 (de) | Niedrigueberspannungs-elektroden fuer alkalische elektrolyte. | |
| DE2338549B2 (enExample) | ||
| EP0042984B1 (de) | Edelmetallfreie Elektrode und Verfahren zu ihrer Herstellung | |
| DE2844558A1 (de) | Elektrode fuer die verwendung in einem elektrolytischen verfahren |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8128 | New person/name/address of the agent |
Representative=s name: GRUENECKER, A., DIPL.-ING. KINKELDEY, H., DIPL.-IN |
|
| 8110 | Request for examination paragraph 44 | ||
| 8130 | Withdrawal |