DE3221702A1 - Verfahren zur herstellung von acyloxysilanen - Google Patents
Verfahren zur herstellung von acyloxysilanenInfo
- Publication number
- DE3221702A1 DE3221702A1 DE19823221702 DE3221702A DE3221702A1 DE 3221702 A1 DE3221702 A1 DE 3221702A1 DE 19823221702 DE19823221702 DE 19823221702 DE 3221702 A DE3221702 A DE 3221702A DE 3221702 A1 DE3221702 A1 DE 3221702A1
- Authority
- DE
- Germany
- Prior art keywords
- column
- carboxylic acid
- aliphatic carboxylic
- chlorosilane
- acetic acid
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Withdrawn
Links
- 238000004519 manufacturing process Methods 0.000 title description 6
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 claims description 154
- KOPOQZFJUQMUML-UHFFFAOYSA-N chlorosilane Chemical compound Cl[SiH3] KOPOQZFJUQMUML-UHFFFAOYSA-N 0.000 claims description 116
- 239000005046 Chlorosilane Substances 0.000 claims description 115
- 150000007933 aliphatic carboxylic acids Chemical class 0.000 claims description 113
- 238000000034 method Methods 0.000 claims description 73
- 150000001732 carboxylic acid derivatives Chemical class 0.000 claims description 40
- 238000006243 chemical reaction Methods 0.000 claims description 32
- 238000009835 boiling Methods 0.000 claims description 23
- 239000005055 methyl trichlorosilane Substances 0.000 claims description 18
- JLUFWMXJHAVVNN-UHFFFAOYSA-N methyltrichlorosilane Chemical compound C[Si](Cl)(Cl)Cl JLUFWMXJHAVVNN-UHFFFAOYSA-N 0.000 claims description 18
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 claims description 17
- 239000007789 gas Substances 0.000 claims description 17
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 claims description 17
- 229910000041 hydrogen chloride Inorganic materials 0.000 claims description 17
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 15
- 239000000460 chlorine Substances 0.000 claims description 15
- 229910052801 chlorine Inorganic materials 0.000 claims description 15
- 238000002360 preparation method Methods 0.000 claims description 15
- TVJPBVNWVPUZBM-UHFFFAOYSA-N [diacetyloxy(methyl)silyl] acetate Chemical compound CC(=O)O[Si](C)(OC(C)=O)OC(C)=O TVJPBVNWVPUZBM-UHFFFAOYSA-N 0.000 claims description 13
- 239000006227 byproduct Substances 0.000 claims description 10
- 238000010992 reflux Methods 0.000 claims description 10
- 239000007795 chemical reaction product Substances 0.000 claims description 4
- 238000010924 continuous production Methods 0.000 claims description 4
- 238000009833 condensation Methods 0.000 claims description 2
- 230000005494 condensation Effects 0.000 claims description 2
- 238000001704 evaporation Methods 0.000 claims description 2
- 230000008020 evaporation Effects 0.000 claims description 2
- 229960000583 acetic acid Drugs 0.000 description 35
- -1 glacial acetic acid Chemical class 0.000 description 23
- 239000000047 product Substances 0.000 description 19
- 239000007788 liquid Substances 0.000 description 15
- 239000002253 acid Substances 0.000 description 12
- 239000000463 material Substances 0.000 description 10
- 239000000203 mixture Substances 0.000 description 10
- 238000012856 packing Methods 0.000 description 9
- 239000000539 dimer Substances 0.000 description 8
- 238000004821 distillation Methods 0.000 description 8
- 239000011521 glass Substances 0.000 description 8
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 7
- 239000004215 Carbon black (E152) Substances 0.000 description 7
- 229930195733 hydrocarbon Natural products 0.000 description 7
- 239000012808 vapor phase Substances 0.000 description 7
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 6
- 125000004432 carbon atom Chemical group C* 0.000 description 6
- 238000010438 heat treatment Methods 0.000 description 5
- 239000012535 impurity Substances 0.000 description 5
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 4
- 239000012362 glacial acetic acid Substances 0.000 description 4
- 239000002904 solvent Substances 0.000 description 4
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- 239000004971 Cross linker Substances 0.000 description 3
- 125000001931 aliphatic group Chemical group 0.000 description 3
- 230000015572 biosynthetic process Effects 0.000 description 3
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 3
- 229910052573 porcelain Inorganic materials 0.000 description 3
- 239000000376 reactant Substances 0.000 description 3
- UHBIOBNJUHSVGA-UHFFFAOYSA-N triacetyloxysilyl 2-methylpropanoate Chemical compound CC(C)C(=O)O[Si](OC(C)=O)(OC(C)=O)OC(C)=O UHBIOBNJUHSVGA-UHFFFAOYSA-N 0.000 description 3
- FERIUCNNQQJTOY-UHFFFAOYSA-N Butyric acid Chemical compound CCCC(O)=O FERIUCNNQQJTOY-UHFFFAOYSA-N 0.000 description 2
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 2
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 description 2
- 239000005977 Ethylene Substances 0.000 description 2
- BLRPTPMANUNPDV-UHFFFAOYSA-N Silane Chemical compound [SiH4] BLRPTPMANUNPDV-UHFFFAOYSA-N 0.000 description 2
- XUIMIQQOPSSXEZ-UHFFFAOYSA-N Silicon Chemical compound [Si] XUIMIQQOPSSXEZ-UHFFFAOYSA-N 0.000 description 2
- 238000013459 approach Methods 0.000 description 2
- 150000005840 aryl radicals Chemical class 0.000 description 2
- 230000001174 ascending effect Effects 0.000 description 2
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 150000001244 carboxylic acid anhydrides Chemical class 0.000 description 2
- 239000003638 chemical reducing agent Substances 0.000 description 2
- 239000008139 complexing agent Substances 0.000 description 2
- 150000001875 compounds Chemical class 0.000 description 2
- 238000007796 conventional method Methods 0.000 description 2
- XBDQKXXYIPTUBI-UHFFFAOYSA-N dimethylselenoniopropionate Natural products CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 2
- 239000000945 filler Substances 0.000 description 2
- 150000002430 hydrocarbons Chemical group 0.000 description 2
- 229910052742 iron Inorganic materials 0.000 description 2
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 2
- 239000007791 liquid phase Substances 0.000 description 2
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 2
- 239000000178 monomer Substances 0.000 description 2
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 239000011541 reaction mixture Substances 0.000 description 2
- 238000011084 recovery Methods 0.000 description 2
- 230000000630 rising effect Effects 0.000 description 2
- 229910000077 silane Inorganic materials 0.000 description 2
- 229910052710 silicon Inorganic materials 0.000 description 2
- 239000010703 silicon Substances 0.000 description 2
- 229910052572 stoneware Inorganic materials 0.000 description 2
- 238000003860 storage Methods 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- NQPDZGIKBAWPEJ-UHFFFAOYSA-N valeric acid Chemical compound CCCCC(O)=O NQPDZGIKBAWPEJ-UHFFFAOYSA-N 0.000 description 2
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 1
- 125000005917 3-methylpentyl group Chemical group 0.000 description 1
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 1
- WETWJCDKMRHUPV-UHFFFAOYSA-N Chloride-Acetic acid Natural products CC(Cl)=O WETWJCDKMRHUPV-UHFFFAOYSA-N 0.000 description 1
- ZMTWKHBVSGSBQP-UHFFFAOYSA-N Cl[SiH2]C(=O)O Chemical compound Cl[SiH2]C(=O)O ZMTWKHBVSGSBQP-UHFFFAOYSA-N 0.000 description 1
- 229910002808 Si–O–Si Inorganic materials 0.000 description 1
- ICOSCCLBHWPTNJ-UHFFFAOYSA-N [diacetyloxy(methyl)silyl] acetate trichloro(methyl)silane Chemical compound C[Si](Cl)(Cl)Cl.C[Si](OC(C)=O)(OC(C)=O)OC(C)=O ICOSCCLBHWPTNJ-UHFFFAOYSA-N 0.000 description 1
- WJGAPUXHSQQWQF-UHFFFAOYSA-N acetic acid;hydrochloride Chemical compound Cl.CC(O)=O WJGAPUXHSQQWQF-UHFFFAOYSA-N 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 125000003342 alkenyl group Chemical group 0.000 description 1
- 150000004945 aromatic hydrocarbons Chemical group 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- 238000009530 blood pressure measurement Methods 0.000 description 1
- 239000003990 capacitor Substances 0.000 description 1
- 239000001569 carbon dioxide Substances 0.000 description 1
- 229910002092 carbon dioxide Inorganic materials 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 125000001309 chloro group Chemical group Cl* 0.000 description 1
- 125000004218 chloromethyl group Chemical group [H]C([H])(Cl)* 0.000 description 1
- 238000004587 chromatography analysis Methods 0.000 description 1
- 239000000306 component Substances 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 238000005260 corrosion Methods 0.000 description 1
- 230000007797 corrosion Effects 0.000 description 1
- 125000000582 cycloheptyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- MROCJMGDEKINLD-UHFFFAOYSA-N dichlorosilane Chemical compound Cl[SiH2]Cl MROCJMGDEKINLD-UHFFFAOYSA-N 0.000 description 1
- 238000007599 discharging Methods 0.000 description 1
- 238000005485 electric heating Methods 0.000 description 1
- 235000019253 formic acid Nutrition 0.000 description 1
- 238000004508 fractional distillation Methods 0.000 description 1
- 238000004817 gas chromatography Methods 0.000 description 1
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 239000001257 hydrogen Substances 0.000 description 1
- 229910052739 hydrogen Inorganic materials 0.000 description 1
- 239000004615 ingredient Substances 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- KQNPFQTWMSNSAP-UHFFFAOYSA-N isobutyric acid Chemical compound CC(C)C(O)=O KQNPFQTWMSNSAP-UHFFFAOYSA-N 0.000 description 1
- 210000004072 lung Anatomy 0.000 description 1
- 238000005259 measurement Methods 0.000 description 1
- 125000001624 naphthyl group Chemical group 0.000 description 1
- 125000002347 octyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000003921 oil Substances 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- 125000000843 phenylene group Chemical group C1(=C(C=CC=C1)*)* 0.000 description 1
- 125000000286 phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 description 1
- 235000019260 propionic acid Nutrition 0.000 description 1
- IUVKMZGDUIUOCP-BTNSXGMBSA-N quinbolone Chemical compound O([C@H]1CC[C@H]2[C@H]3[C@@H]([C@]4(C=CC(=O)C=C4CC3)C)CC[C@@]21C)C1=CCCC1 IUVKMZGDUIUOCP-BTNSXGMBSA-N 0.000 description 1
- 230000002441 reversible effect Effects 0.000 description 1
- 238000005070 sampling Methods 0.000 description 1
- 125000002914 sec-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 238000007086 side reaction Methods 0.000 description 1
- 150000004756 silanes Chemical class 0.000 description 1
- 229920002379 silicone rubber Polymers 0.000 description 1
- 239000004945 silicone rubber Substances 0.000 description 1
- 239000013589 supplement Substances 0.000 description 1
- 238000005979 thermal decomposition reaction Methods 0.000 description 1
- 229940005605 valeric acid Drugs 0.000 description 1
- 230000008016 vaporization Effects 0.000 description 1
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 1
- 229920002554 vinyl polymer Polymers 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07F—ACYCLIC, CARBOCYCLIC OR HETEROCYCLIC COMPOUNDS CONTAINING ELEMENTS OTHER THAN CARBON, HYDROGEN, HALOGEN, OXYGEN, NITROGEN, SULFUR, SELENIUM OR TELLURIUM
- C07F7/00—Compounds containing elements of Groups 4 or 14 of the Periodic Table
- C07F7/02—Silicon compounds
- C07F7/08—Compounds having one or more C—Si linkages
- C07F7/18—Compounds having one or more C—Si linkages as well as one or more C—O—Si linkages
- C07F7/1896—Compounds having one or more Si-O-acyl linkages
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US06/278,541 US4332956A (en) | 1981-06-26 | 1981-06-26 | Process for preparing acyloxysilanes |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE3221702A1 true DE3221702A1 (de) | 1983-03-03 |
Family
ID=23065380
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19823221702 Withdrawn DE3221702A1 (de) | 1981-06-26 | 1982-06-09 | Verfahren zur herstellung von acyloxysilanen |
Country Status (5)
| Country | Link |
|---|---|
| US (1) | US4332956A (enExample) |
| JP (1) | JPS5821685A (enExample) |
| DE (1) | DE3221702A1 (enExample) |
| FR (1) | FR2508460A1 (enExample) |
| GB (1) | GB2101144A (enExample) |
Families Citing this family (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4715039A (en) * | 1985-07-12 | 1987-12-22 | Spectra-Physics, Inc. | Internal resonator water cooled ion laser |
| US4912242A (en) * | 1989-05-15 | 1990-03-27 | Dow Corning Corporation | Process for preparing silicon esters |
| DE4112650A1 (de) * | 1991-04-18 | 1992-10-22 | Huels Chemische Werke Ag | Verfahren zur gleichzeitigen und kontinuierlichen herstellung von carbonoyloxysilanen und carbonsaeurechloriden |
| US5387706A (en) | 1994-06-27 | 1995-02-07 | Dow Corning Corporation | Process for preparing acyloxysilanes |
| US5473826A (en) * | 1994-08-19 | 1995-12-12 | Yazaki Corporation | Process for drying sol-gel derived porous bodies at elevated subcritical temperatures and pressures |
| KR100342576B1 (ko) * | 1995-02-08 | 2002-11-23 | 고려화학 주식회사 | 실리콘실란트용초산형가교제의제조방법 |
| US5523446A (en) * | 1995-10-03 | 1996-06-04 | General Electric Company | Process for preparing a mixture of alkoxyacyloxy silane and alkyltriacyloxsilane |
| DE19837010A1 (de) * | 1998-08-14 | 2000-02-17 | Degussa | Verfahren zur Herstellung von Acetoxysilanen |
Family Cites Families (11)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2017000A (en) * | 1932-04-22 | 1935-10-08 | Henkel & Cie Gmbh | Silicon carboxylate and process of making the same |
| US2405988A (en) * | 1943-12-10 | 1946-08-20 | Dow Chemical Co | Organo-silicon esters and materials treated therewith |
| US2566347A (en) * | 1946-04-17 | 1951-09-04 | Montclair Res Corp | Silicon acylates |
| US2537073A (en) * | 1946-07-16 | 1951-01-09 | Montclair Res Corp | Substituted silicon acylates |
| US2866800A (en) * | 1951-01-08 | 1958-12-30 | Montclair Res Corp | Substituted silicon acylates |
| US3701753A (en) * | 1970-09-28 | 1972-10-31 | Gen Electric | Solutions of room temperature vulcanizable silicone rubber compositions |
| DE2061189C3 (de) * | 1970-12-11 | 1974-12-05 | Wacker-Chemie Gmbh, 8000 Muenchen | Verfahren zur kontinuierlichen Herstellung von Alkoxysilanen oder Alkoxypolysiloxanen |
| US3700714A (en) * | 1971-06-24 | 1972-10-24 | Stephen B Hamilton | Curable compositions |
| US4028391A (en) * | 1973-12-26 | 1977-06-07 | Owens-Corning Fiberglas Corporation | Method of preparing organosilicon carboxylates |
| US3974198A (en) * | 1975-09-02 | 1976-08-10 | General Electric Company | Process for producing methyltriacetoxysilane |
| DE2801780A1 (de) * | 1978-01-17 | 1979-07-19 | Wacker Chemie Gmbh | Verfahren zum herstellen von acyloxysilanen und gegebenenfalls acyloxysiloxanen |
-
1981
- 1981-06-26 US US06/278,541 patent/US4332956A/en not_active Expired - Lifetime
-
1982
- 1982-05-10 GB GB08213455A patent/GB2101144A/en not_active Withdrawn
- 1982-06-09 DE DE19823221702 patent/DE3221702A1/de not_active Withdrawn
- 1982-06-24 FR FR8211063A patent/FR2508460A1/fr active Granted
- 1982-06-25 JP JP57108586A patent/JPS5821685A/ja active Granted
Also Published As
| Publication number | Publication date |
|---|---|
| FR2508460A1 (fr) | 1982-12-31 |
| JPS5821685A (ja) | 1983-02-08 |
| US4332956A (en) | 1982-06-01 |
| JPH0359077B2 (enExample) | 1991-09-09 |
| GB2101144A (en) | 1983-01-12 |
| FR2508460B1 (enExample) | 1985-04-19 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE69109187T2 (de) | Trimethoxysilan-Herstellung über die Methanol-Silizium-Reaktion mit Recycling. | |
| DE3236628C2 (de) | Verfahren zur kontinuierlichen Herstellung von Alkoxysilanen | |
| DE3780514T2 (de) | Verfahren zur herstellung von methacryloxy- oder acryloxyorganosilanen oder -organosiliconen. | |
| DE2148669C3 (de) | Verfahren zur Herstellung von Organosiloxanen | |
| DE2800017C2 (de) | Verfahren zur Herstellung von Organoalkoxysilanen | |
| CH615684A5 (enExample) | ||
| DE2521742C3 (de) | Verfahren zur Herstellung von Organosiloxanen | |
| DE3221702A1 (de) | Verfahren zur herstellung von acyloxysilanen | |
| DE69032906T2 (de) | Verfahren zur Herstellung von Organoalkoxysilanen | |
| DE69205692T2 (de) | Verfahren zur Herstellung von Teilweise alkoxyliertem Polysiloxan. | |
| EP0003317B1 (de) | Verfahren zum Herstellen von Acyloxysilanen und gegebenenfalls Acyloxysiloxanen | |
| DE2815316C2 (de) | Verfahren zur Herstellung von Alkylsilanen | |
| DE19641562A1 (de) | Verfahren zur Herstellung von 1,2-Dichlorethan durch Direktchlorierung | |
| DE60012337T2 (de) | Verfahren zur Herstellung von Fluorcarbonsäureanhydriden | |
| DE2816748C2 (de) | Verfahren zur Herstellung von Dimethylaluminiumchlorid | |
| EP0509213A1 (de) | Verfahren zur gleichzeitigen und kontinuierlichen Herstellung von Carbonoyloxysilanen und Carbonsäurechloriden | |
| EP0021238A1 (de) | Verfahren zur Herstellung von Silicium enthaltenden Derivaten des Acetamids | |
| DE2352922A1 (de) | Verfahren zur herstellung von perchlormethylmercaptan | |
| DE1618826B1 (de) | Verfahren zur Herstellung von Essigsäureäthylester | |
| DE3431839C2 (enExample) | ||
| DE2815978C2 (de) | Verfahren zur Herstellung von Athylsilanen | |
| DE3416478A1 (de) | Verfahren zur herstellung von organosiloxanen und alkylhalogeniden aus alkyldialkoxysilanen | |
| DE888850C (de) | Verfahren zur Herstellung von Poly-(chlormethyl)-silanen | |
| DE69216490T2 (de) | Verfahren zur Herstellung von Methoxy-Methyl-Silanen | |
| DE2740585A1 (de) | Verfahren zur herstellung von 1,1-difluor-1-chloraethan |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8139 | Disposal/non-payment of the annual fee |