DE3145510A1 - Verbessertes verfahren zur herstellung von 1h-pyrrol-2-essigsaeureestern - Google Patents
Verbessertes verfahren zur herstellung von 1h-pyrrol-2-essigsaeureesternInfo
- Publication number
- DE3145510A1 DE3145510A1 DE19813145510 DE3145510A DE3145510A1 DE 3145510 A1 DE3145510 A1 DE 3145510A1 DE 19813145510 DE19813145510 DE 19813145510 DE 3145510 A DE3145510 A DE 3145510A DE 3145510 A1 DE3145510 A1 DE 3145510A1
- Authority
- DE
- Germany
- Prior art keywords
- pyrrole
- phase transfer
- acetic acid
- carbon atoms
- pyrrol
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Withdrawn
Links
- GVUHUYQEAGMUNJ-UHFFFAOYSA-N 2-(1h-pyrrol-2-yl)acetic acid Chemical class OC(=O)CC1=CC=CN1 GVUHUYQEAGMUNJ-UHFFFAOYSA-N 0.000 title claims abstract description 25
- 238000004519 manufacturing process Methods 0.000 title description 6
- 238000000034 method Methods 0.000 claims abstract description 18
- 239000002168 alkylating agent Substances 0.000 claims abstract description 14
- 238000007127 saponification reaction Methods 0.000 claims abstract description 14
- 125000000217 alkyl group Chemical group 0.000 claims abstract description 10
- 239000012435 aralkylating agent Substances 0.000 claims abstract description 9
- 150000003839 salts Chemical class 0.000 claims abstract description 9
- 125000004432 carbon atom Chemical group C* 0.000 claims abstract description 8
- -1 alkali metal bicarbonate Chemical class 0.000 claims abstract description 7
- 230000002152 alkylating effect Effects 0.000 claims abstract description 6
- 238000002955 isolation Methods 0.000 claims abstract description 5
- 238000002360 preparation method Methods 0.000 claims abstract description 5
- 125000003710 aryl alkyl group Chemical group 0.000 claims abstract description 4
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims abstract description 4
- 229910052739 hydrogen Inorganic materials 0.000 claims abstract 2
- 239000001257 hydrogen Substances 0.000 claims abstract 2
- 150000002825 nitriles Chemical class 0.000 claims description 16
- 150000001408 amides Chemical class 0.000 claims description 13
- 239000003444 phase transfer catalyst Substances 0.000 claims description 9
- 229940100198 alkylating agent Drugs 0.000 claims description 8
- 239000002904 solvent Substances 0.000 claims description 7
- 239000003960 organic solvent Substances 0.000 claims description 5
- 150000003869 acetamides Chemical class 0.000 claims description 4
- 239000007864 aqueous solution Substances 0.000 claims description 3
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 claims description 2
- 150000008044 alkali metal hydroxides Chemical class 0.000 claims description 2
- 229910052788 barium Inorganic materials 0.000 claims description 2
- DSAJWYNOEDNPEQ-UHFFFAOYSA-N barium atom Chemical compound [Ba] DSAJWYNOEDNPEQ-UHFFFAOYSA-N 0.000 claims description 2
- 229910052791 calcium Inorganic materials 0.000 claims description 2
- 239000011575 calcium Substances 0.000 claims description 2
- 150000003141 primary amines Chemical class 0.000 claims description 2
- 229910052712 strontium Inorganic materials 0.000 claims description 2
- CIOAGBVUUVVLOB-UHFFFAOYSA-N strontium atom Chemical compound [Sr] CIOAGBVUUVVLOB-UHFFFAOYSA-N 0.000 claims description 2
- 150000003242 quaternary ammonium salts Chemical class 0.000 claims 4
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 claims 1
- 229910001854 alkali hydroxide Inorganic materials 0.000 claims 1
- 150000001347 alkyl bromides Chemical class 0.000 claims 1
- 150000008051 alkyl sulfates Chemical class 0.000 claims 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 claims 1
- 150000003512 tertiary amines Chemical class 0.000 claims 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 abstract description 8
- 239000002585 base Substances 0.000 abstract description 6
- 150000002148 esters Chemical class 0.000 abstract description 5
- NHNHWBFFDARHFO-UHFFFAOYSA-N 2-(1h-pyrrol-2-yl)acetamide Chemical compound NC(=O)CC1=CC=CN1 NHNHWBFFDARHFO-UHFFFAOYSA-N 0.000 abstract description 4
- MKVATVUOVMCHJJ-UHFFFAOYSA-N 2-(1h-pyrrol-2-yl)acetonitrile Chemical compound N#CCC1=CC=CN1 MKVATVUOVMCHJJ-UHFFFAOYSA-N 0.000 abstract description 3
- 239000003795 chemical substances by application Substances 0.000 abstract description 3
- 229910052783 alkali metal Inorganic materials 0.000 abstract description 2
- 239000012736 aqueous medium Substances 0.000 abstract 1
- 150000001875 compounds Chemical class 0.000 abstract 1
- 239000003799 water insoluble solvent Substances 0.000 abstract 1
- HEMHJVSKTPXQMS-UHFFFAOYSA-M sodium hydroxide Inorganic materials [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 30
- 235000011121 sodium hydroxide Nutrition 0.000 description 11
- 238000006243 chemical reaction Methods 0.000 description 8
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 6
- 239000003054 catalyst Substances 0.000 description 6
- 239000003513 alkali Substances 0.000 description 5
- 239000008346 aqueous phase Substances 0.000 description 5
- 239000000203 mixture Substances 0.000 description 5
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 4
- 230000029936 alkylation Effects 0.000 description 4
- 238000005804 alkylation reaction Methods 0.000 description 4
- 238000004821 distillation Methods 0.000 description 4
- SHFJWMWCIHQNCP-UHFFFAOYSA-M hydron;tetrabutylazanium;sulfate Chemical compound OS([O-])(=O)=O.CCCC[N+](CCCC)(CCCC)CCCC SHFJWMWCIHQNCP-UHFFFAOYSA-M 0.000 description 4
- ROSYAUHHRKAPHX-UHFFFAOYSA-N 2-(1-methylpyrrol-2-yl)acetonitrile Chemical compound CN1C=CC=C1CC#N ROSYAUHHRKAPHX-UHFFFAOYSA-N 0.000 description 3
- NAMYKGVDVNBCFQ-UHFFFAOYSA-N 2-bromopropane Chemical compound CC(C)Br NAMYKGVDVNBCFQ-UHFFFAOYSA-N 0.000 description 3
- 238000005886 esterification reaction Methods 0.000 description 3
- 239000012074 organic phase Substances 0.000 description 3
- 239000011541 reaction mixture Substances 0.000 description 3
- ANOUHTITMWZCEC-UHFFFAOYSA-N 1,5-dimethylpyrrole-2-carboxamide Chemical compound CC1=CC=C(C(N)=O)N1C ANOUHTITMWZCEC-UHFFFAOYSA-N 0.000 description 2
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 2
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 2
- KAESVJOAVNADME-UHFFFAOYSA-N Pyrrole Chemical compound C=1C=CNC=1 KAESVJOAVNADME-UHFFFAOYSA-N 0.000 description 2
- GZUXJHMPEANEGY-UHFFFAOYSA-N bromomethane Chemical compound BrC GZUXJHMPEANEGY-UHFFFAOYSA-N 0.000 description 2
- 239000006227 byproduct Substances 0.000 description 2
- VAYGXNSJCAHWJZ-UHFFFAOYSA-N dimethyl sulfate Chemical compound COS(=O)(=O)OC VAYGXNSJCAHWJZ-UHFFFAOYSA-N 0.000 description 2
- 230000032050 esterification Effects 0.000 description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 2
- 150000004679 hydroxides Chemical class 0.000 description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 2
- 238000005580 one pot reaction Methods 0.000 description 2
- 239000000047 product Substances 0.000 description 2
- 230000009257 reactivity Effects 0.000 description 2
- 238000010992 reflux Methods 0.000 description 2
- 235000017557 sodium bicarbonate Nutrition 0.000 description 2
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 2
- 239000000243 solution Substances 0.000 description 2
- OXHNLMTVIGZXSG-UHFFFAOYSA-N 1-Methylpyrrole Chemical compound CN1C=CC=C1 OXHNLMTVIGZXSG-UHFFFAOYSA-N 0.000 description 1
- SYYOUHJJSOLSJD-UHFFFAOYSA-N 2-(1-methylpyrrol-2-yl)acetic acid Chemical class CN1C=CC=C1CC(O)=O SYYOUHJJSOLSJD-UHFFFAOYSA-N 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical compound OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 description 1
- 235000011054 acetic acid Nutrition 0.000 description 1
- 150000001243 acetic acids Chemical class 0.000 description 1
- WEVYAHXRMPXWCK-UHFFFAOYSA-N acetonitrile Substances CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 1
- 150000001447 alkali salts Chemical class 0.000 description 1
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 1
- 150000001342 alkaline earth metals Chemical class 0.000 description 1
- 239000012670 alkaline solution Substances 0.000 description 1
- 150000001350 alkyl halides Chemical class 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 229910021529 ammonia Inorganic materials 0.000 description 1
- 230000002921 anti-spasmodic effect Effects 0.000 description 1
- 229940125715 antihistaminic agent Drugs 0.000 description 1
- 239000000739 antihistaminic agent Substances 0.000 description 1
- 229940124575 antispasmodic agent Drugs 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- RDHPKYGYEGBMSE-UHFFFAOYSA-N bromoethane Chemical compound CCBr RDHPKYGYEGBMSE-UHFFFAOYSA-N 0.000 description 1
- 150000001735 carboxylic acids Chemical class 0.000 description 1
- LMQRNRKIACTFHG-UHFFFAOYSA-N chloromethylbenzene;n,n-diethylethanamine Chemical compound CCN(CC)CC.ClCC1=CC=CC=C1 LMQRNRKIACTFHG-UHFFFAOYSA-N 0.000 description 1
- 230000001419 dependent effect Effects 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 230000002349 favourable effect Effects 0.000 description 1
- 150000002334 glycols Chemical class 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- CGYVDYLHQYNGFC-UHFFFAOYSA-N methyl 2-(1-methylpyrrol-2-yl)acetate Chemical compound COC(=O)CC1=CC=CN1C CGYVDYLHQYNGFC-UHFFFAOYSA-N 0.000 description 1
- 229940102396 methyl bromide Drugs 0.000 description 1
- XTAZYLNFDRKIHJ-UHFFFAOYSA-N n,n-dioctyloctan-1-amine Chemical compound CCCCCCCCN(CCCCCCCC)CCCCCCCC XTAZYLNFDRKIHJ-UHFFFAOYSA-N 0.000 description 1
- SYSQUGFVNFXIIT-UHFFFAOYSA-N n-[4-(1,3-benzoxazol-2-yl)phenyl]-4-nitrobenzenesulfonamide Chemical class C1=CC([N+](=O)[O-])=CC=C1S(=O)(=O)NC1=CC=C(C=2OC3=CC=CC=C3N=2)C=C1 SYSQUGFVNFXIIT-UHFFFAOYSA-N 0.000 description 1
- IOQPZZOEVPZRBK-UHFFFAOYSA-N octan-1-amine Chemical compound CCCCCCCCN IOQPZZOEVPZRBK-UHFFFAOYSA-N 0.000 description 1
- 239000012071 phase Substances 0.000 description 1
- 125000001484 phenothiazinyl group Chemical class C1(=CC=CC=2SC3=CC=CC=C3NC12)* 0.000 description 1
- 125000001453 quaternary ammonium group Chemical group 0.000 description 1
- 239000011877 solvent mixture Substances 0.000 description 1
- 239000012258 stirred mixture Substances 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 150000003467 sulfuric acid derivatives Chemical class 0.000 description 1
- 229940066767 systemic antihistamines phenothiazine derivative Drugs 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D207/00—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D207/02—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D207/30—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having two double bonds between ring members or between ring members and non-ring members
- C07D207/32—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having two double bonds between ring members or between ring members and non-ring members with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to ring carbon atoms
- C07D207/33—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having two double bonds between ring members or between ring members and non-ring members with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to ring carbon atoms with substituted hydrocarbon radicals, directly attached to ring carbon atoms
- C07D207/337—Radicals substituted by carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D207/00—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D207/02—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D207/30—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having two double bonds between ring members or between ring members and non-ring members
- C07D207/34—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having two double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pyrrole Compounds (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
- Catalysts (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
Priority Applications (7)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19813145510 DE3145510A1 (de) | 1981-11-17 | 1981-11-17 | Verbessertes verfahren zur herstellung von 1h-pyrrol-2-essigsaeureestern |
| CA000392385A CA1158249A (en) | 1981-11-17 | 1981-12-16 | Preparation of 1h-pyrrol-2-acetic acid esters |
| DE8282200311T DE3265526D1 (en) | 1981-11-17 | 1982-03-10 | Process for the preparation of 1h-pyrrole-2-acetic esters |
| AT82200311T ATE15040T1 (de) | 1981-11-17 | 1982-03-10 | Verbessertes verfahren zur herstellung von 1hpyrrol-2-essigsaeureestern. |
| EP82200311A EP0079623B1 (de) | 1981-11-17 | 1982-03-10 | Verbessertes Verfahren zur Herstellung von 1H-Pyrrol-2-essigsäureestern |
| JP57199140A JPS5896065A (ja) | 1981-11-17 | 1982-11-15 | ピロ−ル−2−酢酸エステルの製法 |
| US06/576,202 US4493935A (en) | 1981-11-17 | 1984-02-02 | Preparation of 1H-pyrrol-2-acetic acid esters |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19813145510 DE3145510A1 (de) | 1981-11-17 | 1981-11-17 | Verbessertes verfahren zur herstellung von 1h-pyrrol-2-essigsaeureestern |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE3145510A1 true DE3145510A1 (de) | 1983-05-26 |
Family
ID=6146546
Family Applications (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19813145510 Withdrawn DE3145510A1 (de) | 1981-11-17 | 1981-11-17 | Verbessertes verfahren zur herstellung von 1h-pyrrol-2-essigsaeureestern |
| DE8282200311T Expired DE3265526D1 (en) | 1981-11-17 | 1982-03-10 | Process for the preparation of 1h-pyrrole-2-acetic esters |
Family Applications After (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE8282200311T Expired DE3265526D1 (en) | 1981-11-17 | 1982-03-10 | Process for the preparation of 1h-pyrrole-2-acetic esters |
Country Status (6)
| Country | Link |
|---|---|
| US (1) | US4493935A (cg-RX-API-DMAC10.html) |
| EP (1) | EP0079623B1 (cg-RX-API-DMAC10.html) |
| JP (1) | JPS5896065A (cg-RX-API-DMAC10.html) |
| AT (1) | ATE15040T1 (cg-RX-API-DMAC10.html) |
| CA (1) | CA1158249A (cg-RX-API-DMAC10.html) |
| DE (2) | DE3145510A1 (cg-RX-API-DMAC10.html) |
Families Citing this family (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US5258360A (en) * | 1986-04-17 | 1993-11-02 | Imperial Chemical Industries Plc | Alphamethoxy acrylic acid derivatives as fungicides |
| GB8609452D0 (en) * | 1986-04-17 | 1986-05-21 | Ici Plc | Fungicides |
| US5240956A (en) * | 1990-11-07 | 1993-08-31 | Cortech, Inc. | Ester inhibitors |
Family Cites Families (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1301313B (de) * | 1966-12-03 | 1969-08-21 | Ruetgerswerke Ag | Verfahren zur Herstellung von Pyrryl-(2)-essigsaeureestern |
| US3752826A (en) * | 1970-01-26 | 1973-08-14 | Mcneilab Inc | Aroyl substituted pyrroles |
| US4255335A (en) * | 1980-04-03 | 1981-03-10 | Mcneilab, Inc. | Preparation of 5-aroyl-1-loweralkylpyrrole-2-acetic acid derivatives |
-
1981
- 1981-11-17 DE DE19813145510 patent/DE3145510A1/de not_active Withdrawn
- 1981-12-16 CA CA000392385A patent/CA1158249A/en not_active Expired
-
1982
- 1982-03-10 EP EP82200311A patent/EP0079623B1/de not_active Expired
- 1982-03-10 DE DE8282200311T patent/DE3265526D1/de not_active Expired
- 1982-03-10 AT AT82200311T patent/ATE15040T1/de not_active IP Right Cessation
- 1982-11-15 JP JP57199140A patent/JPS5896065A/ja active Granted
-
1984
- 1984-02-02 US US06/576,202 patent/US4493935A/en not_active Expired - Fee Related
Also Published As
| Publication number | Publication date |
|---|---|
| ATE15040T1 (de) | 1985-09-15 |
| US4493935A (en) | 1985-01-15 |
| JPS5896065A (ja) | 1983-06-07 |
| CA1158249A (en) | 1983-12-06 |
| EP0079623A2 (de) | 1983-05-25 |
| EP0079623B1 (de) | 1985-08-21 |
| JPH0354657B2 (cg-RX-API-DMAC10.html) | 1991-08-20 |
| EP0079623A3 (en) | 1983-09-21 |
| DE3265526D1 (en) | 1985-09-26 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE69207681T2 (de) | Verfahren zur Herstellung von einer Alpha-Aminosäure, und dem entsprechenden Ester und Amid | |
| EP0079623B1 (de) | Verbessertes Verfahren zur Herstellung von 1H-Pyrrol-2-essigsäureestern | |
| DE3511273A1 (de) | Verbessertes verfahren zur herstellung von 2-methyl-4-amino-5-aminomethyl-pyrimidin | |
| DE2602846C2 (de) | Verfahren zur Herstellung von 2-(2-Thienyl)äthylaminen | |
| EP0006180B1 (de) | 3-Phenoxybenzylidenamine und 3-Benzylbenzylidenamine, ein Verfahren zu deren Herstellung sowie deren Verwendung zur Herstellung der entsprechenden Aldehyde | |
| DE2920413C3 (de) | Verfahren zur Herstellung von alpha eckige Klammer auf 4-(4-Chlorbenzoylamino-äthyl)-phenoxy eckige Klammer zu -isobuttersäure | |
| CH652389A5 (en) | Process for the preparation of o,o'-disubstituted phenylhydrazines | |
| EP0006140B1 (de) | Verfahren zur Herstellung von alpha-Hydroxycarbonsäureamiden | |
| DE2758883A1 (de) | Verfahren zur kontinuierlichen herstellung von alpha-hydroxy-beta,beta- dimethyl-gamma-butyrolacton | |
| EP1019356B1 (de) | Verfahren zur herstellung von 3-hydroxy-2-methylbenzoesäure | |
| CH562213A5 (cg-RX-API-DMAC10.html) | ||
| DE69813388T2 (de) | Verfahren zur Herstellung von 2,4-Oxazolidindion | |
| DE2845863A1 (de) | Verfahren zur herstellung von 6-hydroxypyrid-2-onen | |
| EP0084329B1 (de) | Verfahren zur Herstellung von 1,4-Bis-(dicyanomethylen)-cyclohexan | |
| DE2058237C (cg-RX-API-DMAC10.html) | ||
| DE1543979C (de) | Verfahren zur Herstellung von Cyclohexadiene 1,3)-yl-nitril | |
| AT360549B (de) | Verfahren zur herstellung von neuen glycidsaeure- bzw. thioglycidsaeurederivaten und deren salzen | |
| DE2640616B2 (de) | Verfahren zur Herstellung von N-Acyl-2-arylglycinen | |
| AT319195B (de) | Verfahren zur Herstellung von Penicillamin | |
| DE69809057T2 (de) | Process for the preparation of 1,3-diaza-spiro [4.4] non-1-en-4-one derivatives and 1-cyano-1-acylamino-cyclopentane intermediates | |
| DE1493550C3 (de) | Verfahren zur Herstellung von Azoverbindungen | |
| AT315175B (de) | Verfahren zur Hertellung von 2-Pyridylthioacetamid bzw. von seinen Salzen | |
| AT162933B (de) | Verfahren zur Herstellung von neuen Amiden α, β-ungesättigter Carbonsäuren | |
| AT401931B (de) | Verfahren zur herstellung von (s,s)-(n-(1- ethoxycarbonyl-3-oxo-3-phenylpropyl)-alanin)- (phenylmethyl)ester | |
| AT376417B (de) | Verfahren zur herstellung von phenylaethanolaminen und ihren salzen |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8139 | Disposal/non-payment of the annual fee |