CA1158249A - Preparation of 1h-pyrrol-2-acetic acid esters - Google Patents
Preparation of 1h-pyrrol-2-acetic acid estersInfo
- Publication number
- CA1158249A CA1158249A CA000392385A CA392385A CA1158249A CA 1158249 A CA1158249 A CA 1158249A CA 000392385 A CA000392385 A CA 000392385A CA 392385 A CA392385 A CA 392385A CA 1158249 A CA1158249 A CA 1158249A
- Authority
- CA
- Canada
- Prior art keywords
- pyrrol
- alkyl
- carbon atoms
- group
- formula
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 238000002360 preparation method Methods 0.000 title claims abstract description 8
- GVUHUYQEAGMUNJ-UHFFFAOYSA-N 2-(1h-pyrrol-2-yl)acetic acid Chemical class OC(=O)CC1=CC=CN1 GVUHUYQEAGMUNJ-UHFFFAOYSA-N 0.000 title claims abstract 8
- 238000000034 method Methods 0.000 claims abstract description 24
- 238000007127 saponification reaction Methods 0.000 claims abstract description 16
- 239000002168 alkylating agent Substances 0.000 claims abstract description 14
- 125000004432 carbon atom Chemical group C* 0.000 claims abstract description 10
- 150000003839 salts Chemical class 0.000 claims abstract description 10
- 239000012435 aralkylating agent Substances 0.000 claims abstract description 9
- 150000002148 esters Chemical class 0.000 claims abstract description 9
- 125000000217 alkyl group Chemical group 0.000 claims abstract description 8
- 230000002152 alkylating effect Effects 0.000 claims abstract description 6
- 150000001875 compounds Chemical class 0.000 claims abstract description 6
- 238000002955 isolation Methods 0.000 claims abstract description 6
- 125000003710 aryl alkyl group Chemical group 0.000 claims abstract description 5
- 239000003795 chemical substances by application Substances 0.000 claims abstract description 5
- 239000012736 aqueous medium Substances 0.000 claims abstract description 4
- 229910052739 hydrogen Inorganic materials 0.000 claims abstract description 4
- 239000001257 hydrogen Substances 0.000 claims abstract description 4
- 238000012546 transfer Methods 0.000 claims abstract description 4
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims abstract 3
- 239000003799 water insoluble solvent Substances 0.000 claims abstract 2
- 239000002585 base Substances 0.000 claims description 16
- 229940100198 alkylating agent Drugs 0.000 claims description 8
- 239000003444 phase transfer catalyst Substances 0.000 claims description 8
- -1 alkali metal bicar-bonate Chemical class 0.000 claims description 7
- 150000003242 quaternary ammonium salts Chemical group 0.000 claims description 6
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 6
- 229910052783 alkali metal Inorganic materials 0.000 claims description 4
- 150000008044 alkali metal hydroxides Chemical class 0.000 claims description 3
- 238000011065 in-situ storage Methods 0.000 claims description 3
- 239000002904 solvent Substances 0.000 claims description 3
- DSAJWYNOEDNPEQ-UHFFFAOYSA-N barium atom Chemical compound [Ba] DSAJWYNOEDNPEQ-UHFFFAOYSA-N 0.000 claims description 2
- AXCZMVOFGPJBDE-UHFFFAOYSA-L calcium dihydroxide Chemical compound [OH-].[OH-].[Ca+2] AXCZMVOFGPJBDE-UHFFFAOYSA-L 0.000 claims description 2
- 239000000920 calcium hydroxide Substances 0.000 claims description 2
- 229910001861 calcium hydroxide Inorganic materials 0.000 claims description 2
- 229910001866 strontium hydroxide Inorganic materials 0.000 claims description 2
- 229910001860 alkaline earth metal hydroxide Inorganic materials 0.000 claims 2
- NHNHWBFFDARHFO-UHFFFAOYSA-N 2-(1h-pyrrol-2-yl)acetamide Chemical compound NC(=O)CC1=CC=CN1 NHNHWBFFDARHFO-UHFFFAOYSA-N 0.000 claims 1
- MKVATVUOVMCHJJ-UHFFFAOYSA-N 2-(1h-pyrrol-2-yl)acetonitrile Chemical compound N#CCC1=CC=CN1 MKVATVUOVMCHJJ-UHFFFAOYSA-N 0.000 claims 1
- 125000002008 alkyl bromide group Chemical group 0.000 claims 1
- 125000005526 alkyl sulfate group Chemical group 0.000 claims 1
- 229910001863 barium hydroxide Inorganic materials 0.000 claims 1
- 235000011116 calcium hydroxide Nutrition 0.000 claims 1
- 229940095643 calcium hydroxide Drugs 0.000 claims 1
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims 1
- 125000000467 secondary amino group Chemical group [H]N([*:1])[*:2] 0.000 claims 1
- CIOAGBVUUVVLOB-UHFFFAOYSA-N strontium atom Chemical compound [Sr] CIOAGBVUUVVLOB-UHFFFAOYSA-N 0.000 claims 1
- 125000001302 tertiary amino group Chemical group 0.000 claims 1
- ZXUCBXRTRRIBSO-UHFFFAOYSA-L tetrabutylazanium;sulfate Chemical group [O-]S([O-])(=O)=O.CCCC[N+](CCCC)(CCCC)CCCC.CCCC[N+](CCCC)(CCCC)CCCC ZXUCBXRTRRIBSO-UHFFFAOYSA-L 0.000 claims 1
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 14
- 239000000203 mixture Substances 0.000 description 11
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 9
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 6
- 230000000875 corresponding effect Effects 0.000 description 6
- 239000000243 solution Substances 0.000 description 6
- 239000011541 reaction mixture Substances 0.000 description 5
- DLFVBJFMPXGRIB-UHFFFAOYSA-N Acetamide Chemical compound CC(N)=O DLFVBJFMPXGRIB-UHFFFAOYSA-N 0.000 description 4
- GZUXJHMPEANEGY-UHFFFAOYSA-N bromomethane Chemical compound BrC GZUXJHMPEANEGY-UHFFFAOYSA-N 0.000 description 4
- 238000006243 chemical reaction Methods 0.000 description 4
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 3
- 239000003960 organic solvent Substances 0.000 description 3
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 2
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 2
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 2
- 150000003869 acetamides Chemical class 0.000 description 2
- 239000002253 acid Substances 0.000 description 2
- 150000001350 alkyl halides Chemical class 0.000 description 2
- 150000001408 amides Chemical class 0.000 description 2
- 239000007864 aqueous solution Substances 0.000 description 2
- 239000003054 catalyst Substances 0.000 description 2
- 125000004093 cyano group Chemical group *C#N 0.000 description 2
- VAYGXNSJCAHWJZ-UHFFFAOYSA-N dimethyl sulfate Chemical compound COS(=O)(=O)OC VAYGXNSJCAHWJZ-UHFFFAOYSA-N 0.000 description 2
- 238000004821 distillation Methods 0.000 description 2
- 230000032050 esterification Effects 0.000 description 2
- 238000005886 esterification reaction Methods 0.000 description 2
- 150000002168 ethanoic acid esters Chemical class 0.000 description 2
- 239000012535 impurity Substances 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- 229940102396 methyl bromide Drugs 0.000 description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 2
- 239000012074 organic phase Substances 0.000 description 2
- 239000007858 starting material Substances 0.000 description 2
- ANOUHTITMWZCEC-UHFFFAOYSA-N 1,5-dimethylpyrrole-2-carboxamide Chemical compound CC1=CC=C(C(N)=O)N1C ANOUHTITMWZCEC-UHFFFAOYSA-N 0.000 description 1
- BMVXCPBXGZKUPN-UHFFFAOYSA-N 1-hexanamine Chemical compound CCCCCCN BMVXCPBXGZKUPN-UHFFFAOYSA-N 0.000 description 1
- LHTWORABVYVKEC-UHFFFAOYSA-N 5-methyl-1h-pyrrole-2-carbonitrile Chemical group CC1=CC=C(C#N)N1 LHTWORABVYVKEC-UHFFFAOYSA-N 0.000 description 1
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical compound OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 1
- 235000011054 acetic acid Nutrition 0.000 description 1
- 150000001243 acetic acids Chemical class 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 150000003973 alkyl amines Chemical class 0.000 description 1
- 150000008051 alkyl sulfates Chemical class 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 229910021529 ammonia Inorganic materials 0.000 description 1
- 229910052921 ammonium sulfate Inorganic materials 0.000 description 1
- 235000011130 ammonium sulphate Nutrition 0.000 description 1
- 229940125715 antihistaminic agent Drugs 0.000 description 1
- 239000000739 antihistaminic agent Substances 0.000 description 1
- 239000008346 aqueous phase Substances 0.000 description 1
- 229910052788 barium Inorganic materials 0.000 description 1
- RDHPKYGYEGBMSE-UHFFFAOYSA-N bromoethane Chemical compound CCBr RDHPKYGYEGBMSE-UHFFFAOYSA-N 0.000 description 1
- 239000006227 byproduct Substances 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- HPNMFZURTQLUMO-UHFFFAOYSA-N diethylamine Chemical compound CCNCC HPNMFZURTQLUMO-UHFFFAOYSA-N 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-M hydrogensulfate Chemical compound OS([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-M 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- 229910000000 metal hydroxide Inorganic materials 0.000 description 1
- 150000004692 metal hydroxides Chemical class 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- XTAZYLNFDRKIHJ-UHFFFAOYSA-N n,n-dioctyloctan-1-amine Chemical compound CCCCCCCCN(CCCCCCCC)CCCCCCCC XTAZYLNFDRKIHJ-UHFFFAOYSA-N 0.000 description 1
- SYSQUGFVNFXIIT-UHFFFAOYSA-N n-[4-(1,3-benzoxazol-2-yl)phenyl]-4-nitrobenzenesulfonamide Chemical class C1=CC([N+](=O)[O-])=CC=C1S(=O)(=O)NC1=CC=C(C=2OC3=CC=CC=C3N=2)C=C1 SYSQUGFVNFXIIT-UHFFFAOYSA-N 0.000 description 1
- 150000002825 nitriles Chemical class 0.000 description 1
- IOQPZZOEVPZRBK-UHFFFAOYSA-N octan-1-amine Chemical compound CCCCCCCCN IOQPZZOEVPZRBK-UHFFFAOYSA-N 0.000 description 1
- 239000012071 phase Substances 0.000 description 1
- 150000004714 phosphonium salts Chemical class 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 150000003141 primary amines Chemical class 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- WRHZVMBBRYBTKZ-UHFFFAOYSA-N pyrrole-2-carboxylic acid Chemical class OC(=O)C1=CC=CN1 WRHZVMBBRYBTKZ-UHFFFAOYSA-N 0.000 description 1
- 125000001453 quaternary ammonium group Chemical group 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 150000003335 secondary amines Chemical class 0.000 description 1
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 1
- 235000017557 sodium bicarbonate Nutrition 0.000 description 1
- 230000003381 solubilizing effect Effects 0.000 description 1
- 239000011877 solvent mixture Substances 0.000 description 1
- 230000002048 spasmolytic effect Effects 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- UUCCCPNEFXQJEL-UHFFFAOYSA-L strontium dihydroxide Chemical compound [OH-].[OH-].[Sr+2] UUCCCPNEFXQJEL-UHFFFAOYSA-L 0.000 description 1
- LMBFAGIMSUYTBN-MPZNNTNKSA-N teixobactin Chemical compound C([C@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H](CCC(N)=O)C(=O)N[C@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H]1C(N[C@@H](C)C(=O)N[C@@H](C[C@@H]2NC(=N)NC2)C(=O)N[C@H](C(=O)O[C@H]1C)[C@@H](C)CC)=O)NC)C1=CC=CC=C1 LMBFAGIMSUYTBN-MPZNNTNKSA-N 0.000 description 1
- 150000003512 tertiary amines Chemical class 0.000 description 1
- YFTHZRPMJXBUME-UHFFFAOYSA-N tripropylamine Chemical compound CCCN(CCC)CCC YFTHZRPMJXBUME-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D207/00—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D207/02—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D207/30—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having two double bonds between ring members or between ring members and non-ring members
- C07D207/32—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having two double bonds between ring members or between ring members and non-ring members with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to ring carbon atoms
- C07D207/33—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having two double bonds between ring members or between ring members and non-ring members with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to ring carbon atoms with substituted hydrocarbon radicals, directly attached to ring carbon atoms
- C07D207/337—Radicals substituted by carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D207/00—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D207/02—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D207/30—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having two double bonds between ring members or between ring members and non-ring members
- C07D207/34—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having two double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pyrrole Compounds (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
- Catalysts (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DEP3145510.7 | 1981-11-17 | ||
| DE19813145510 DE3145510A1 (de) | 1981-11-17 | 1981-11-17 | Verbessertes verfahren zur herstellung von 1h-pyrrol-2-essigsaeureestern |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1158249A true CA1158249A (en) | 1983-12-06 |
Family
ID=6146546
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA000392385A Expired CA1158249A (en) | 1981-11-17 | 1981-12-16 | Preparation of 1h-pyrrol-2-acetic acid esters |
Country Status (6)
| Country | Link |
|---|---|
| US (1) | US4493935A (cg-RX-API-DMAC10.html) |
| EP (1) | EP0079623B1 (cg-RX-API-DMAC10.html) |
| JP (1) | JPS5896065A (cg-RX-API-DMAC10.html) |
| AT (1) | ATE15040T1 (cg-RX-API-DMAC10.html) |
| CA (1) | CA1158249A (cg-RX-API-DMAC10.html) |
| DE (2) | DE3145510A1 (cg-RX-API-DMAC10.html) |
Families Citing this family (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US5258360A (en) * | 1986-04-17 | 1993-11-02 | Imperial Chemical Industries Plc | Alphamethoxy acrylic acid derivatives as fungicides |
| GB8609452D0 (en) * | 1986-04-17 | 1986-05-21 | Ici Plc | Fungicides |
| US5240956A (en) * | 1990-11-07 | 1993-08-31 | Cortech, Inc. | Ester inhibitors |
Family Cites Families (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1301313B (de) * | 1966-12-03 | 1969-08-21 | Ruetgerswerke Ag | Verfahren zur Herstellung von Pyrryl-(2)-essigsaeureestern |
| US3752826A (en) * | 1970-01-26 | 1973-08-14 | Mcneilab Inc | Aroyl substituted pyrroles |
| US4255335A (en) * | 1980-04-03 | 1981-03-10 | Mcneilab, Inc. | Preparation of 5-aroyl-1-loweralkylpyrrole-2-acetic acid derivatives |
-
1981
- 1981-11-17 DE DE19813145510 patent/DE3145510A1/de not_active Withdrawn
- 1981-12-16 CA CA000392385A patent/CA1158249A/en not_active Expired
-
1982
- 1982-03-10 EP EP82200311A patent/EP0079623B1/de not_active Expired
- 1982-03-10 DE DE8282200311T patent/DE3265526D1/de not_active Expired
- 1982-03-10 AT AT82200311T patent/ATE15040T1/de not_active IP Right Cessation
- 1982-11-15 JP JP57199140A patent/JPS5896065A/ja active Granted
-
1984
- 1984-02-02 US US06/576,202 patent/US4493935A/en not_active Expired - Fee Related
Also Published As
| Publication number | Publication date |
|---|---|
| ATE15040T1 (de) | 1985-09-15 |
| US4493935A (en) | 1985-01-15 |
| JPS5896065A (ja) | 1983-06-07 |
| EP0079623A2 (de) | 1983-05-25 |
| EP0079623B1 (de) | 1985-08-21 |
| JPH0354657B2 (cg-RX-API-DMAC10.html) | 1991-08-20 |
| EP0079623A3 (en) | 1983-09-21 |
| DE3145510A1 (de) | 1983-05-26 |
| DE3265526D1 (en) | 1985-09-26 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| JP2515427B2 (ja) | プレウロムチリン類 | |
| CA1158249A (en) | Preparation of 1h-pyrrol-2-acetic acid esters | |
| US4772711A (en) | Method for the preparation of 3-aminoacrylic acid esters | |
| US5095149A (en) | Process for producing 4-halogeno-2-alkoxyimino-3-oxo fatty acid | |
| JP2682687B2 (ja) | 新規チオフエン化合物およびそれらの製造 | |
| RU2149874C1 (ru) | Способ получения диметиламинборана | |
| JPS597136A (ja) | マロン酸エステルの製法 | |
| US4948916A (en) | Process for producing aminooxyacetic acid salts | |
| CA2183426A1 (en) | Process for producing 3-isoxazolecarboxylic acid | |
| EP0179487B1 (en) | 2-phenylpropionic acid esters, method for optical resolution thereof and optically active substance thereof | |
| US5808153A (en) | Conversion of N-(4-fluorophenyl)-2-hydroxy-N-(1-methylethyl) acetamide acetate to N-4-fluorophenyl)-2-hydroxy-N-(1-methylethyl) acetamide | |
| GB2029414A (en) | Process for preparing 4(5) - hydroxymethyl 5 (4)-alkyl imidazoles | |
| KR100407720B1 (ko) | N-[3-{3-(1-피페리디닐메틸)페녹시}프로필]아세톡시아세트아미드의 제조방법 | |
| EP0088008B1 (en) | Improved process for the production of 2-(4-(2-thiazolyloxy)phenyl)propionic acid | |
| EP0781270B1 (en) | Ring-opening amidation process | |
| JPH0142253B2 (cg-RX-API-DMAC10.html) | ||
| CA1265143A (en) | Process for preparing 3-(pyrid-4-yl)propanoic acid derivatives | |
| US6175024B1 (en) | Synthesis of functionalized esters | |
| US5708182A (en) | Method for preparation of 2-imino 4-oxo-5-phenyloxazolidine | |
| JP3486922B2 (ja) | 酸アミドの製造法 | |
| JPH0558953A (ja) | 2−ヒドロキシイソ酪酸エステルの製造方法 | |
| JP2000143590A (ja) | 3−オキソカルボン酸エステルの製造法 | |
| KR920003898B1 (ko) | 3,4-디하이드로-2-메틸-4-옥소-2h-1,2-벤조티아진-3-카르복실산-1,1-디옥사이드의 제조방법 | |
| GB1580783A (en) | Process for producing 4' - (2 - carboxyethyl)phenyl trans - 4 - aminomethyl-cyclohexanecarboxylate or the acid-additsalts thereof and intermediates for producing the same | |
| KR20000021998A (ko) | 심바스타틴 및 이의 중간체 화합물을 제조하는 방법 |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MKEX | Expiry |