DE3100263A1 - Verfahren zur herstellung von isocyanuratgruppen aufweisenden polyisocyanaten und ihre verwendung bei der herstellung von polyurethanen - Google Patents
Verfahren zur herstellung von isocyanuratgruppen aufweisenden polyisocyanaten und ihre verwendung bei der herstellung von polyurethanenInfo
- Publication number
- DE3100263A1 DE3100263A1 DE19813100263 DE3100263A DE3100263A1 DE 3100263 A1 DE3100263 A1 DE 3100263A1 DE 19813100263 DE19813100263 DE 19813100263 DE 3100263 A DE3100263 A DE 3100263A DE 3100263 A1 DE3100263 A1 DE 3100263A1
- Authority
- DE
- Germany
- Prior art keywords
- trimerization
- reaction
- process according
- isocyanate
- component
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Withdrawn
Links
- 239000005056 polyisocyanate Substances 0.000 title claims description 50
- 229920001228 polyisocyanate Polymers 0.000 title claims description 50
- ZFSLODLOARCGLH-UHFFFAOYSA-N isocyanuric acid Chemical group OC1=NC(O)=NC(O)=N1 ZFSLODLOARCGLH-UHFFFAOYSA-N 0.000 title claims description 11
- 239000004814 polyurethane Substances 0.000 title claims description 11
- 229920002635 polyurethane Polymers 0.000 title claims description 11
- 238000004519 manufacturing process Methods 0.000 title claims description 9
- 238000000034 method Methods 0.000 claims description 57
- 239000003054 catalyst Substances 0.000 claims description 52
- 238000005829 trimerization reaction Methods 0.000 claims description 43
- 239000002904 solvent Substances 0.000 claims description 42
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 claims description 31
- 238000006243 chemical reaction Methods 0.000 claims description 29
- IQPQWNKOIGAROB-UHFFFAOYSA-N isocyanate group Chemical group [N-]=C=O IQPQWNKOIGAROB-UHFFFAOYSA-N 0.000 claims description 19
- 229920000570 polyether Polymers 0.000 claims description 19
- 239000004721 Polyphenylene oxide Substances 0.000 claims description 17
- 239000012948 isocyanate Substances 0.000 claims description 16
- 150000002513 isocyanates Chemical class 0.000 claims description 15
- 150000001339 alkali metal compounds Chemical class 0.000 claims description 13
- 125000002947 alkylene group Chemical group 0.000 claims description 12
- -1 acyclic organic compounds Chemical class 0.000 claims description 11
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 11
- 239000000203 mixture Substances 0.000 claims description 11
- 239000002574 poison Substances 0.000 claims description 9
- 231100000614 poison Toxicity 0.000 claims description 9
- 125000004432 carbon atom Chemical group C* 0.000 claims description 6
- 150000001875 compounds Chemical class 0.000 claims description 6
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical group C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 claims description 5
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 claims description 4
- 239000002981 blocking agent Substances 0.000 claims description 4
- 229910052700 potassium Inorganic materials 0.000 claims description 4
- 239000011591 potassium Substances 0.000 claims description 4
- 229910052708 sodium Inorganic materials 0.000 claims description 4
- 239000011734 sodium Substances 0.000 claims description 4
- 239000007788 liquid Substances 0.000 claims description 2
- 239000000047 product Substances 0.000 description 24
- 239000000243 solution Substances 0.000 description 21
- SCVFZCLFOSHCOH-UHFFFAOYSA-M potassium acetate Chemical compound [K+].CC([O-])=O SCVFZCLFOSHCOH-UHFFFAOYSA-M 0.000 description 20
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 15
- 239000005057 Hexamethylene diisocyanate Chemical group 0.000 description 11
- 239000002202 Polyethylene glycol Substances 0.000 description 11
- WETWJCDKMRHUPV-UHFFFAOYSA-N acetyl chloride Chemical compound CC(Cl)=O WETWJCDKMRHUPV-UHFFFAOYSA-N 0.000 description 11
- 239000012346 acetyl chloride Substances 0.000 description 11
- RRAMGCGOFNQTLD-UHFFFAOYSA-N hexamethylene diisocyanate Chemical group O=C=NCCCCCCN=C=O RRAMGCGOFNQTLD-UHFFFAOYSA-N 0.000 description 11
- 229920001223 polyethylene glycol Polymers 0.000 description 11
- 235000011056 potassium acetate Nutrition 0.000 description 10
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 9
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 9
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 9
- 125000005442 diisocyanate group Chemical group 0.000 description 9
- 229910052751 metal Inorganic materials 0.000 description 9
- 239000002184 metal Substances 0.000 description 9
- 239000011541 reaction mixture Substances 0.000 description 9
- 150000003839 salts Chemical class 0.000 description 9
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 description 8
- 239000005058 Isophorone diisocyanate Substances 0.000 description 8
- 150000001298 alcohols Chemical class 0.000 description 8
- 238000001816 cooling Methods 0.000 description 8
- NIMLQBUJDJZYEJ-UHFFFAOYSA-N isophorone diisocyanate Chemical compound CC1(C)CC(N=C=O)CC(C)(CN=C=O)C1 NIMLQBUJDJZYEJ-UHFFFAOYSA-N 0.000 description 8
- 238000003756 stirring Methods 0.000 description 8
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 7
- 125000003118 aryl group Chemical group 0.000 description 7
- 230000035484 reaction time Effects 0.000 description 7
- DVKJHBMWWAPEIU-UHFFFAOYSA-N toluene 2,4-diisocyanate Chemical group CC1=CC=C(N=C=O)C=C1N=C=O DVKJHBMWWAPEIU-UHFFFAOYSA-N 0.000 description 7
- DKPFZGUDAPQIHT-UHFFFAOYSA-N Butyl acetate Natural products CCCCOC(C)=O DKPFZGUDAPQIHT-UHFFFAOYSA-N 0.000 description 6
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 6
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 6
- FUZZWVXGSFPDMH-UHFFFAOYSA-N hexanoic acid Chemical compound CCCCCC(O)=O FUZZWVXGSFPDMH-UHFFFAOYSA-N 0.000 description 6
- 238000002360 preparation method Methods 0.000 description 6
- 239000007858 starting material Substances 0.000 description 6
- 239000002253 acid Substances 0.000 description 5
- 238000010438 heat treatment Methods 0.000 description 5
- 239000010409 thin film Substances 0.000 description 5
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 4
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical group O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 4
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 4
- 238000007792 addition Methods 0.000 description 4
- 125000001931 aliphatic group Chemical group 0.000 description 4
- 239000008139 complexing agent Substances 0.000 description 4
- 238000004821 distillation Methods 0.000 description 4
- XLLIQLLCWZCATF-UHFFFAOYSA-N ethylene glycol monomethyl ether acetate Natural products COCCOC(C)=O XLLIQLLCWZCATF-UHFFFAOYSA-N 0.000 description 4
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 3
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 3
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 3
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 3
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 3
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 3
- 150000007513 acids Chemical class 0.000 description 3
- 150000001412 amines Chemical class 0.000 description 3
- 239000003963 antioxidant agent Substances 0.000 description 3
- JFDZBHWFFUWGJE-UHFFFAOYSA-N benzonitrile Chemical compound N#CC1=CC=CC=C1 JFDZBHWFFUWGJE-UHFFFAOYSA-N 0.000 description 3
- 238000009835 boiling Methods 0.000 description 3
- 150000007942 carboxylates Chemical class 0.000 description 3
- 239000007795 chemical reaction product Substances 0.000 description 3
- 150000001805 chlorine compounds Chemical class 0.000 description 3
- 238000006006 cyclotrimerization reaction Methods 0.000 description 3
- 230000000694 effects Effects 0.000 description 3
- 235000011187 glycerol Nutrition 0.000 description 3
- 238000011534 incubation Methods 0.000 description 3
- 239000003446 ligand Substances 0.000 description 3
- OFBQJSOFQDEBGM-UHFFFAOYSA-N n-pentane Natural products CCCCC OFBQJSOFQDEBGM-UHFFFAOYSA-N 0.000 description 3
- DGTNSSLYPYDJGL-UHFFFAOYSA-N phenyl isocyanate Chemical compound O=C=NC1=CC=CC=C1 DGTNSSLYPYDJGL-UHFFFAOYSA-N 0.000 description 3
- 150000003003 phosphines Chemical class 0.000 description 3
- 239000011877 solvent mixture Substances 0.000 description 3
- 238000003860 storage Methods 0.000 description 3
- JOYRKODLDBILNP-UHFFFAOYSA-N urethane group Chemical group NC(=O)OCC JOYRKODLDBILNP-UHFFFAOYSA-N 0.000 description 3
- OVBFMUAFNIIQAL-UHFFFAOYSA-N 1,4-diisocyanatobutane Chemical group O=C=NCCCCN=C=O OVBFMUAFNIIQAL-UHFFFAOYSA-N 0.000 description 2
- MGYGFNQQGAQEON-UHFFFAOYSA-N 4-tolyl isocyanate Chemical compound CC1=CC=C(N=C=O)C=C1 MGYGFNQQGAQEON-UHFFFAOYSA-N 0.000 description 2
- IKHGUXGNUITLKF-UHFFFAOYSA-N Acetaldehyde Chemical compound CC=O IKHGUXGNUITLKF-UHFFFAOYSA-N 0.000 description 2
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 2
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 2
- IRIAEXORFWYRCZ-UHFFFAOYSA-N Butylbenzyl phthalate Chemical compound CCCCOC(=O)C1=CC=CC=C1C(=O)OCC1=CC=CC=C1 IRIAEXORFWYRCZ-UHFFFAOYSA-N 0.000 description 2
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- LCGLNKUTAGEVQW-UHFFFAOYSA-N Dimethyl ether Chemical compound COC LCGLNKUTAGEVQW-UHFFFAOYSA-N 0.000 description 2
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 2
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 2
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- DKGAVHZHDRPRBM-UHFFFAOYSA-N Tert-Butanol Chemical compound CC(C)(C)O DKGAVHZHDRPRBM-UHFFFAOYSA-N 0.000 description 2
- ZJCCRDAZUWHFQH-UHFFFAOYSA-N Trimethylolpropane Chemical compound CCC(CO)(CO)CO ZJCCRDAZUWHFQH-UHFFFAOYSA-N 0.000 description 2
- 238000005917 acylation reaction Methods 0.000 description 2
- 230000029936 alkylation Effects 0.000 description 2
- 238000005804 alkylation reaction Methods 0.000 description 2
- 239000000010 aprotic solvent Substances 0.000 description 2
- HUMNYLRZRPPJDN-UHFFFAOYSA-N benzaldehyde Chemical compound O=CC1=CC=CC=C1 HUMNYLRZRPPJDN-UHFFFAOYSA-N 0.000 description 2
- PASDCCFISLVPSO-UHFFFAOYSA-N benzoyl chloride Chemical compound ClC(=O)C1=CC=CC=C1 PASDCCFISLVPSO-UHFFFAOYSA-N 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- 238000006555 catalytic reaction Methods 0.000 description 2
- XLJMAIOERFSOGZ-UHFFFAOYSA-M cyanate group Chemical group [O-]C#N XLJMAIOERFSOGZ-UHFFFAOYSA-M 0.000 description 2
- JHIVVAPYMSGYDF-UHFFFAOYSA-N cyclohexanone Chemical compound O=C1CCCCC1 JHIVVAPYMSGYDF-UHFFFAOYSA-N 0.000 description 2
- DOIRQSBPFJWKBE-UHFFFAOYSA-N dibutyl phthalate Chemical compound CCCCOC(=O)C1=CC=CC=C1C(=O)OCCCC DOIRQSBPFJWKBE-UHFFFAOYSA-N 0.000 description 2
- 239000003085 diluting agent Substances 0.000 description 2
- JBKVHLHDHHXQEQ-UHFFFAOYSA-N epsilon-caprolactam Chemical compound O=C1CCCCCN1 JBKVHLHDHHXQEQ-UHFFFAOYSA-N 0.000 description 2
- 150000002148 esters Chemical class 0.000 description 2
- 150000002576 ketones Chemical class 0.000 description 2
- 238000002844 melting Methods 0.000 description 2
- 230000008018 melting Effects 0.000 description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 2
- 150000002825 nitriles Chemical class 0.000 description 2
- LQNUZADURLCDLV-UHFFFAOYSA-N nitrobenzene Chemical compound [O-][N+](=O)C1=CC=CC=C1 LQNUZADURLCDLV-UHFFFAOYSA-N 0.000 description 2
- 229910052757 nitrogen Inorganic materials 0.000 description 2
- 150000007530 organic bases Chemical class 0.000 description 2
- 239000003973 paint Substances 0.000 description 2
- 150000002989 phenols Chemical class 0.000 description 2
- 229920003023 plastic Polymers 0.000 description 2
- 239000004033 plastic Substances 0.000 description 2
- 239000002244 precipitate Substances 0.000 description 2
- 238000001556 precipitation Methods 0.000 description 2
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 2
- ULWHHBHJGPPBCO-UHFFFAOYSA-N propane-1,1-diol Chemical compound CCC(O)O ULWHHBHJGPPBCO-UHFFFAOYSA-N 0.000 description 2
- YPFDHNVEDLHUCE-UHFFFAOYSA-N propane-1,3-diol Chemical compound OCCCO YPFDHNVEDLHUCE-UHFFFAOYSA-N 0.000 description 2
- 239000012429 reaction media Substances 0.000 description 2
- 230000009257 reactivity Effects 0.000 description 2
- 239000007787 solid Substances 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- 150000005846 sugar alcohols Polymers 0.000 description 2
- RUELTTOHQODFPA-UHFFFAOYSA-N toluene 2,6-diisocyanate Chemical compound CC1=C(N=C=O)C=CC=C1N=C=O RUELTTOHQODFPA-UHFFFAOYSA-N 0.000 description 2
- 238000005292 vacuum distillation Methods 0.000 description 2
- 239000008096 xylene Substances 0.000 description 2
- PUPZLCDOIYMWBV-UHFFFAOYSA-N (+/-)-1,3-Butanediol Chemical compound CC(O)CCO PUPZLCDOIYMWBV-UHFFFAOYSA-N 0.000 description 1
- UOCLXMDMGBRAIB-UHFFFAOYSA-N 1,1,1-trichloroethane Chemical compound CC(Cl)(Cl)Cl UOCLXMDMGBRAIB-UHFFFAOYSA-N 0.000 description 1
- AVQQQNCBBIEMEU-UHFFFAOYSA-N 1,1,3,3-tetramethylurea Chemical compound CN(C)C(=O)N(C)C AVQQQNCBBIEMEU-UHFFFAOYSA-N 0.000 description 1
- KEQGZUUPPQEDPF-UHFFFAOYSA-N 1,3-dichloro-5,5-dimethylimidazolidine-2,4-dione Chemical compound CC1(C)N(Cl)C(=O)N(Cl)C1=O KEQGZUUPPQEDPF-UHFFFAOYSA-N 0.000 description 1
- OHLKMGYGBHFODF-UHFFFAOYSA-N 1,4-bis(isocyanatomethyl)benzene Chemical compound O=C=NCC1=CC=C(CN=C=O)C=C1 OHLKMGYGBHFODF-UHFFFAOYSA-N 0.000 description 1
- QWDQYHPOSSHSAW-UHFFFAOYSA-N 1-isocyanatooctadecane Chemical compound CCCCCCCCCCCCCCCCCCN=C=O QWDQYHPOSSHSAW-UHFFFAOYSA-N 0.000 description 1
- DYQFCTCUULUMTQ-UHFFFAOYSA-N 1-isocyanatooctane Chemical compound CCCCCCCCN=C=O DYQFCTCUULUMTQ-UHFFFAOYSA-N 0.000 description 1
- HKKZPBCWTDFVFB-UHFFFAOYSA-N 1-methoxy-2-[2-[2-[2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethane Chemical compound COCCOCCOCCOCCOCCOCCOCCOCCOC HKKZPBCWTDFVFB-UHFFFAOYSA-N 0.000 description 1
- HPVRZSQOEHEUKJ-UHFFFAOYSA-N 1-methoxyhexan-2-one Chemical compound CCCCC(=O)COC HPVRZSQOEHEUKJ-UHFFFAOYSA-N 0.000 description 1
- LTMRRSWNXVJMBA-UHFFFAOYSA-L 2,2-diethylpropanedioate Chemical compound CCC(CC)(C([O-])=O)C([O-])=O LTMRRSWNXVJMBA-UHFFFAOYSA-L 0.000 description 1
- OBETXYAYXDNJHR-UHFFFAOYSA-N 2-Ethylhexanoic acid Chemical compound CCCCC(CC)C(O)=O OBETXYAYXDNJHR-UHFFFAOYSA-N 0.000 description 1
- LBLYYCQCTBFVLH-UHFFFAOYSA-N 2-Methylbenzenesulfonic acid Chemical compound CC1=CC=CC=C1S(O)(=O)=O LBLYYCQCTBFVLH-UHFFFAOYSA-N 0.000 description 1
- QQZOPKMRPOGIEB-UHFFFAOYSA-N 2-Oxohexane Chemical compound CCCCC(C)=O QQZOPKMRPOGIEB-UHFFFAOYSA-N 0.000 description 1
- SVONRAPFKPVNKG-UHFFFAOYSA-N 2-ethoxyethyl acetate Chemical compound CCOCCOC(C)=O SVONRAPFKPVNKG-UHFFFAOYSA-N 0.000 description 1
- QTWJRLJHJPIABL-UHFFFAOYSA-N 2-methylphenol;3-methylphenol;4-methylphenol Chemical compound CC1=CC=C(O)C=C1.CC1=CC=CC(O)=C1.CC1=CC=CC=C1O QTWJRLJHJPIABL-UHFFFAOYSA-N 0.000 description 1
- UPMLOUAZCHDJJD-UHFFFAOYSA-N 4,4'-Diphenylmethane Diisocyanate Chemical compound C1=CC(N=C=O)=CC=C1CC1=CC=C(N=C=O)C=C1 UPMLOUAZCHDJJD-UHFFFAOYSA-N 0.000 description 1
- RREANTFLPGEWEN-MBLPBCRHSA-N 7-[4-[[(3z)-3-[4-amino-5-[(3,4,5-trimethoxyphenyl)methyl]pyrimidin-2-yl]imino-5-fluoro-2-oxoindol-1-yl]methyl]piperazin-1-yl]-1-cyclopropyl-6-fluoro-4-oxoquinoline-3-carboxylic acid Chemical compound COC1=C(OC)C(OC)=CC(CC=2C(=NC(\N=C/3C4=CC(F)=CC=C4N(CN4CCN(CC4)C=4C(=CC=5C(=O)C(C(O)=O)=CN(C=5C=4)C4CC4)F)C\3=O)=NC=2)N)=C1 RREANTFLPGEWEN-MBLPBCRHSA-N 0.000 description 1
- DLFVBJFMPXGRIB-UHFFFAOYSA-N Acetamide Chemical compound CC(N)=O DLFVBJFMPXGRIB-UHFFFAOYSA-N 0.000 description 1
- 239000004970 Chain extender Substances 0.000 description 1
- XTHFKEDIFFGKHM-UHFFFAOYSA-N Dimethoxyethane Chemical compound COCCOC XTHFKEDIFFGKHM-UHFFFAOYSA-N 0.000 description 1
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 description 1
- 239000005977 Ethylene Substances 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 1
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 1
- KDXKERNSBIXSRK-UHFFFAOYSA-N Lysine Natural products NCCCCC(N)C(O)=O KDXKERNSBIXSRK-UHFFFAOYSA-N 0.000 description 1
- 239000004472 Lysine Substances 0.000 description 1
- NTIZESTWPVYFNL-UHFFFAOYSA-N Methyl isobutyl ketone Chemical compound CC(C)CC(C)=O NTIZESTWPVYFNL-UHFFFAOYSA-N 0.000 description 1
- UIHCLUNTQKBZGK-UHFFFAOYSA-N Methyl isobutyl ketone Natural products CCC(C)C(C)=O UIHCLUNTQKBZGK-UHFFFAOYSA-N 0.000 description 1
- SECXISVLQFMRJM-UHFFFAOYSA-N N-Methylpyrrolidone Chemical compound CN1CCCC1=O SECXISVLQFMRJM-UHFFFAOYSA-N 0.000 description 1
- PHSPJQZRQAJPPF-UHFFFAOYSA-N N-alpha-Methylhistamine Chemical compound CNCCC1=CN=CN1 PHSPJQZRQAJPPF-UHFFFAOYSA-N 0.000 description 1
- 229910019142 PO4 Inorganic materials 0.000 description 1
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 description 1
- XBDQKXXYIPTUBI-UHFFFAOYSA-M Propionate Chemical compound CCC([O-])=O XBDQKXXYIPTUBI-UHFFFAOYSA-M 0.000 description 1
- DNIAPMSPPWPWGF-UHFFFAOYSA-N Propylene glycol Chemical class CC(O)CO DNIAPMSPPWPWGF-UHFFFAOYSA-N 0.000 description 1
- GOOHAUXETOMSMM-UHFFFAOYSA-N Propylene oxide Chemical group CC1CO1 GOOHAUXETOMSMM-UHFFFAOYSA-N 0.000 description 1
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 description 1
- XSTXAVWGXDQKEL-UHFFFAOYSA-N Trichloroethylene Chemical group ClC=C(Cl)Cl XSTXAVWGXDQKEL-UHFFFAOYSA-N 0.000 description 1
- 238000006359 acetalization reaction Methods 0.000 description 1
- 150000001242 acetic acid derivatives Chemical class 0.000 description 1
- 125000005595 acetylacetonate group Chemical group 0.000 description 1
- 230000010933 acylation Effects 0.000 description 1
- 150000001299 aldehydes Chemical class 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 229910000288 alkali metal carbonate Inorganic materials 0.000 description 1
- 150000008041 alkali metal carbonates Chemical class 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 239000002168 alkylating agent Substances 0.000 description 1
- 229940100198 alkylating agent Drugs 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 235000011114 ammonium hydroxide Nutrition 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 1
- 150000001541 aziridines Chemical class 0.000 description 1
- 239000002585 base Substances 0.000 description 1
- 150000003819 basic metal compounds Chemical class 0.000 description 1
- FYXKZNLBZKRYSS-UHFFFAOYSA-N benzene-1,2-dicarbonyl chloride Chemical compound ClC(=O)C1=CC=CC=C1C(Cl)=O FYXKZNLBZKRYSS-UHFFFAOYSA-N 0.000 description 1
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 1
- 230000000903 blocking effect Effects 0.000 description 1
- 239000001273 butane Substances 0.000 description 1
- 239000006227 byproduct Substances 0.000 description 1
- 229910052792 caesium Inorganic materials 0.000 description 1
- TVFDJXOCXUVLDH-UHFFFAOYSA-N caesium atom Chemical compound [Cs] TVFDJXOCXUVLDH-UHFFFAOYSA-N 0.000 description 1
- SHZIWNPUGXLXDT-UHFFFAOYSA-N caproic acid ethyl ester Natural products CCCCCC(=O)OCC SHZIWNPUGXLXDT-UHFFFAOYSA-N 0.000 description 1
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 1
- 150000004651 carbonic acid esters Chemical class 0.000 description 1
- 150000001735 carboxylic acids Chemical class 0.000 description 1
- 229940112021 centrally acting muscle relaxants carbamic acid ester Drugs 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 150000008280 chlorinated hydrocarbons Chemical class 0.000 description 1
- XTHPWXDJESJLNJ-UHFFFAOYSA-N chlorosulfonic acid Substances OS(Cl)(=O)=O XTHPWXDJESJLNJ-UHFFFAOYSA-N 0.000 description 1
- 239000003426 co-catalyst Substances 0.000 description 1
- 230000009918 complex formation Effects 0.000 description 1
- 229930003836 cresol Natural products 0.000 description 1
- 239000012043 crude product Substances 0.000 description 1
- 150000001913 cyanates Chemical class 0.000 description 1
- 230000003247 decreasing effect Effects 0.000 description 1
- 125000000118 dimethyl group Chemical group [H]C([H])([H])* 0.000 description 1
- VAYGXNSJCAHWJZ-UHFFFAOYSA-N dimethyl sulfate Chemical compound COS(=O)(=O)OC VAYGXNSJCAHWJZ-UHFFFAOYSA-N 0.000 description 1
- 150000002009 diols Chemical class 0.000 description 1
- 238000005516 engineering process Methods 0.000 description 1
- 238000007046 ethoxylation reaction Methods 0.000 description 1
- XYIBRDXRRQCHLP-UHFFFAOYSA-N ethyl acetoacetate Chemical compound CCOC(=O)CC(C)=O XYIBRDXRRQCHLP-UHFFFAOYSA-N 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 235000019256 formaldehyde Nutrition 0.000 description 1
- 150000004675 formic acid derivatives Chemical class 0.000 description 1
- 239000007863 gel particle Substances 0.000 description 1
- KWIUHFFTVRNATP-UHFFFAOYSA-N glycine betaine Chemical group C[N+](C)(C)CC([O-])=O KWIUHFFTVRNATP-UHFFFAOYSA-N 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 125000000623 heterocyclic group Chemical group 0.000 description 1
- ACCCMOQWYVYDOT-UHFFFAOYSA-N hexane-1,1-diol Chemical class CCCCCC(O)O ACCCMOQWYVYDOT-UHFFFAOYSA-N 0.000 description 1
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 1
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 1
- 150000004679 hydroxides Chemical class 0.000 description 1
- 230000006698 induction Effects 0.000 description 1
- 239000012263 liquid product Substances 0.000 description 1
- 150000002642 lithium compounds Chemical class 0.000 description 1
- 150000002736 metal compounds Chemical class 0.000 description 1
- 229940098779 methanesulfonic acid Drugs 0.000 description 1
- WSFSSNUMVMOOMR-NJFSPNSNSA-N methanone Chemical compound O=[14CH2] WSFSSNUMVMOOMR-NJFSPNSNSA-N 0.000 description 1
- 238000010327 methods by industry Methods 0.000 description 1
- HAMGRBXTJNITHG-UHFFFAOYSA-N methyl isocyanate Chemical compound CN=C=O HAMGRBXTJNITHG-UHFFFAOYSA-N 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 239000000178 monomer Substances 0.000 description 1
- IJDNQMDRQITEOD-UHFFFAOYSA-N n-butane Chemical compound CCCC IJDNQMDRQITEOD-UHFFFAOYSA-N 0.000 description 1
- HNHVTXYLRVGMHD-UHFFFAOYSA-N n-butyl isocyanate Chemical compound CCCCN=C=O HNHVTXYLRVGMHD-UHFFFAOYSA-N 0.000 description 1
- 125000005609 naphthenate group Chemical group 0.000 description 1
- 230000003472 neutralizing effect Effects 0.000 description 1
- 150000002828 nitro derivatives Chemical class 0.000 description 1
- LYGJENNIWJXYER-UHFFFAOYSA-N nitromethane Chemical compound C[N+]([O-])=O LYGJENNIWJXYER-UHFFFAOYSA-N 0.000 description 1
- 239000012454 non-polar solvent Substances 0.000 description 1
- QIQXTHQIDYTFRH-UHFFFAOYSA-N octadecanoic acid Chemical compound CCCCCCCCCCCCCCCCCC(O)=O QIQXTHQIDYTFRH-UHFFFAOYSA-N 0.000 description 1
- ZQPPMHVWECSIRJ-KTKRTIGZSA-M oleate Chemical compound CCCCCCCC\C=C/CCCCCCCC([O-])=O ZQPPMHVWECSIRJ-KTKRTIGZSA-M 0.000 description 1
- 229940049964 oleate Drugs 0.000 description 1
- 238000006384 oligomerization reaction Methods 0.000 description 1
- 150000002894 organic compounds Chemical class 0.000 description 1
- QNGNSVIICDLXHT-UHFFFAOYSA-N para-ethylbenzaldehyde Natural products CCC1=CC=C(C=O)C=C1 QNGNSVIICDLXHT-UHFFFAOYSA-N 0.000 description 1
- JGTNAGYHADQMCM-UHFFFAOYSA-N perfluorobutanesulfonic acid Chemical compound OS(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F JGTNAGYHADQMCM-UHFFFAOYSA-N 0.000 description 1
- 150000002978 peroxides Chemical class 0.000 description 1
- 150000004707 phenolate Chemical class 0.000 description 1
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 1
- 239000010452 phosphate Substances 0.000 description 1
- 150000003014 phosphoric acid esters Chemical class 0.000 description 1
- 229910052698 phosphorus Inorganic materials 0.000 description 1
- 239000011574 phosphorus Substances 0.000 description 1
- FAIAAWCVCHQXDN-UHFFFAOYSA-N phosphorus trichloride Chemical compound ClP(Cl)Cl FAIAAWCVCHQXDN-UHFFFAOYSA-N 0.000 description 1
- 150000003021 phthalic acid derivatives Chemical class 0.000 description 1
- 239000003880 polar aprotic solvent Substances 0.000 description 1
- 239000002798 polar solvent Substances 0.000 description 1
- 150000003112 potassium compounds Chemical class 0.000 description 1
- 230000002035 prolonged effect Effects 0.000 description 1
- FVSKHRXBFJPNKK-UHFFFAOYSA-N propionitrile Chemical compound CCC#N FVSKHRXBFJPNKK-UHFFFAOYSA-N 0.000 description 1
- RUOJZAUFBMNUDX-UHFFFAOYSA-N propylene carbonate Chemical compound CC1COC(=O)O1 RUOJZAUFBMNUDX-UHFFFAOYSA-N 0.000 description 1
- 235000013772 propylene glycol Nutrition 0.000 description 1
- 239000003586 protic polar solvent Substances 0.000 description 1
- 125000001453 quaternary ammonium group Chemical group 0.000 description 1
- 238000007086 side reaction Methods 0.000 description 1
- 239000001632 sodium acetate Substances 0.000 description 1
- 235000017281 sodium acetate Nutrition 0.000 description 1
- 239000012265 solid product Substances 0.000 description 1
- 150000003462 sulfoxides Chemical class 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- PVFOMCVHYWHZJE-UHFFFAOYSA-N trichloroacetyl chloride Chemical compound ClC(=O)C(Cl)(Cl)Cl PVFOMCVHYWHZJE-UHFFFAOYSA-N 0.000 description 1
- QXJQHYBHAIHNGG-UHFFFAOYSA-N trimethylolethane Chemical compound OCC(C)(CO)CO QXJQHYBHAIHNGG-UHFFFAOYSA-N 0.000 description 1
- 150000003673 urethanes Chemical class 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D251/00—Heterocyclic compounds containing 1,3,5-triazine rings
- C07D251/02—Heterocyclic compounds containing 1,3,5-triazine rings not condensed with other rings
- C07D251/12—Heterocyclic compounds containing 1,3,5-triazine rings not condensed with other rings having three double bonds between ring members or between ring members and non-ring members
- C07D251/26—Heterocyclic compounds containing 1,3,5-triazine rings not condensed with other rings having three double bonds between ring members or between ring members and non-ring members with only hetero atoms directly attached to ring carbon atoms
- C07D251/30—Only oxygen atoms
- C07D251/34—Cyanuric or isocyanuric esters
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08G—MACROMOLECULAR COMPOUNDS OBTAINED OTHERWISE THAN BY REACTIONS ONLY INVOLVING UNSATURATED CARBON-TO-CARBON BONDS
- C08G18/00—Polymeric products of isocyanates or isothiocyanates
- C08G18/06—Polymeric products of isocyanates or isothiocyanates with compounds having active hydrogen
- C08G18/70—Polymeric products of isocyanates or isothiocyanates with compounds having active hydrogen characterised by the isocyanates or isothiocyanates used
- C08G18/72—Polyisocyanates or polyisothiocyanates
- C08G18/77—Polyisocyanates or polyisothiocyanates having heteroatoms in addition to the isocyanate or isothiocyanate nitrogen and oxygen or sulfur
- C08G18/78—Nitrogen
- C08G18/79—Nitrogen characterised by the polyisocyanates used, these having groups formed by oligomerisation of isocyanates or isothiocyanates
- C08G18/791—Nitrogen characterised by the polyisocyanates used, these having groups formed by oligomerisation of isocyanates or isothiocyanates containing isocyanurate groups
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Polyurethanes Or Polyureas (AREA)
Priority Applications (5)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19813100263 DE3100263A1 (de) | 1981-01-08 | 1981-01-08 | Verfahren zur herstellung von isocyanuratgruppen aufweisenden polyisocyanaten und ihre verwendung bei der herstellung von polyurethanen |
| DE8181110813T DE3173857D1 (en) | 1981-01-08 | 1981-12-29 | Process for the production of isocyanurate groups containing polyisocyanates and their use for the production of polyurethanes |
| EP81110813A EP0056159B1 (de) | 1981-01-08 | 1981-12-29 | Verfahren zur Herstellung von Isocyanuratgruppen aufweisenden Polyisocyanaten und ihre Verwendung bei der Herstellung von Polyurethanen |
| JP57000468A JPS57137314A (en) | 1981-01-08 | 1982-01-06 | Manufacture of polyisocyanate having isocyanurate groups and use for polyurethane manufacture |
| US06/337,344 US4379905A (en) | 1981-01-08 | 1982-01-06 | Process for the preparation of polyisocyanates containing isocyanurate groups and their use in the production of polyurethanes |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19813100263 DE3100263A1 (de) | 1981-01-08 | 1981-01-08 | Verfahren zur herstellung von isocyanuratgruppen aufweisenden polyisocyanaten und ihre verwendung bei der herstellung von polyurethanen |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE3100263A1 true DE3100263A1 (de) | 1982-08-12 |
Family
ID=6122280
Family Applications (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19813100263 Withdrawn DE3100263A1 (de) | 1981-01-08 | 1981-01-08 | Verfahren zur herstellung von isocyanuratgruppen aufweisenden polyisocyanaten und ihre verwendung bei der herstellung von polyurethanen |
| DE8181110813T Expired DE3173857D1 (en) | 1981-01-08 | 1981-12-29 | Process for the production of isocyanurate groups containing polyisocyanates and their use for the production of polyurethanes |
Family Applications After (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE8181110813T Expired DE3173857D1 (en) | 1981-01-08 | 1981-12-29 | Process for the production of isocyanurate groups containing polyisocyanates and their use for the production of polyurethanes |
Country Status (4)
| Country | Link |
|---|---|
| US (1) | US4379905A (https=) |
| EP (1) | EP0056159B1 (https=) |
| JP (1) | JPS57137314A (https=) |
| DE (2) | DE3100263A1 (https=) |
Cited By (23)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0339396A1 (de) * | 1988-04-27 | 1989-11-02 | Bayer Ag | Verfahren zur Herstellung von Isocyanuratgruppen aufweisenden Polyisocyanaten |
| EP0778298A2 (de) | 1995-12-07 | 1997-06-11 | Bayer Ag | Festkörperreiche Bindemittelkombination |
| EP2088165A1 (en) | 2008-02-05 | 2009-08-12 | Bayer MaterialScience LLC | Dual-cure coating compositions based on polyaspartates polyisocyanates and acrylatecontaining compounds |
| DE102009010068A1 (de) | 2008-03-05 | 2009-10-08 | Bayer Materialscience Llc | Acrylatmodifizierte Aspartate und aus diesen erzeugte Gelbeschichtungszusammensetzungen |
| EP2180011A1 (de) | 2008-10-22 | 2010-04-28 | Bayer MaterialScience AG | Feuchtigkeitshärtende Polyisocyanatmischungen |
| DE102009007194A1 (de) | 2009-02-03 | 2010-08-05 | Bayer Materialscience Ag | Flexible Beschichtungen |
| DE102009007228A1 (de) | 2009-02-03 | 2010-08-05 | Bayer Materialscience Ag | Beschichtungen |
| US8063144B2 (en) | 2004-11-25 | 2011-11-22 | Bayer Materialscience Ag | Polyisocyanate mixtures, a process for their preparation and their use in coating compositions |
| WO2012010528A1 (de) | 2010-07-20 | 2012-01-26 | Bayer Materialscience Ag | Bindemittelkombinationen für konstruktive trinkwasserrohrbeschichtungen |
| WO2013026804A2 (en) | 2011-08-19 | 2013-02-28 | Ppg Europe Bv | Coating composition and use thereof |
| EP3085720A1 (de) | 2015-04-21 | 2016-10-26 | Covestro Deutschland AG | Hydrophil modifizierter polyisocyanuratkunststoff und verfahren zu dessen herstellung |
| WO2016170058A1 (en) | 2015-04-21 | 2016-10-27 | Covestro Deutschland Ag | Process for producing polyisocyanurate plastics |
| WO2016170057A1 (en) | 2015-04-21 | 2016-10-27 | Covestro Deutschland Ag | Solids based on polyisocvanurate polymers produced under adiabatic conditions |
| WO2017191216A1 (de) | 2016-05-04 | 2017-11-09 | Covestro Deutschland Ag | Verfahren zur herstellung eines polyisocyanurat-kompositwerkstoffs |
| WO2017191175A1 (de) | 2016-05-04 | 2017-11-09 | Covestro Deutschland Ag | Verfahren zur herstellung eines polyisocyanurat-kompositwerkstoffs |
| WO2018054776A1 (en) | 2016-09-20 | 2018-03-29 | Covestro Deutschland Ag | Anisotropic composite materials based on polyisocyanates |
| WO2018087382A1 (de) | 2016-11-14 | 2018-05-17 | Covestro Deutschland Ag | Verfahren zur herstellung eines gegenstandes aus einem vorläufer und verwendung eines radikalisch vernetzbaren harzes in einem additiven fertigungsverfahren |
| WO2019219603A1 (de) | 2018-05-17 | 2019-11-21 | Covestro Deutschland Ag | Verfahren zur herstellung eines polyisocyanatpolymers und eines polyisocyanuratkunststoffs |
| US10597484B2 (en) | 2015-04-21 | 2020-03-24 | Covestro Deutschland Ag | Polyisocyanurate plastics having high thermal stability |
| US10752723B2 (en) | 2015-04-21 | 2020-08-25 | Covestro Deutschland Ag | Polyisocyanurate polymer and process for the production of polyisocyanurate polymers |
| US10752724B2 (en) | 2015-04-21 | 2020-08-25 | Covestro Deutschland Ag | Process for producing polyisocvanurate plastics having functionalized surfaces |
| EP3708602A1 (en) | 2019-03-14 | 2020-09-16 | Covestro LLC | Process for producing polycyclic polyether polyols |
| WO2020185995A1 (en) | 2019-03-14 | 2020-09-17 | Covestro Llc | Polyurethane coating compositions and their use as gel coats |
Families Citing this family (64)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3144672A1 (de) * | 1981-11-10 | 1983-05-26 | Bayer Ag, 5090 Leverkusen | Verfahren zur herstellung von mischtrimerisaten organischer isocyanate, die nach dem verfahren erhaltenen mischtrimerisate, sowie ihre verwendung zur herstellung von polyurethanen |
| DE3151854A1 (de) * | 1981-12-30 | 1983-07-07 | Chemische Werke Hüls AG, 4370 Marl | Thermisch- und oxidations-bestaendige polyurethanbeschichtungen |
| DE3151855C2 (de) * | 1981-12-30 | 1993-11-04 | Huels Chemische Werke Ag | Isocyanato-isocyanurate sowie ein verfahren zu deren herstellung |
| DE3244407A1 (de) * | 1982-12-01 | 1984-06-07 | Bayer Ag, 5090 Leverkusen | Neue polyisocyanatgemische, ein verfahren zu ihrer herstellung und ihre verwendung als aufbaukomponente bei der herstellung von polyurethankunststoffen |
| DE3303221A1 (de) * | 1983-02-01 | 1984-08-02 | Bayer Ag, 5090 Leverkusen | Verfahren zur herstellung von isocyanuratgruppen aufweisenden polyisocyanaten, die nach diesem verfahren erhaeltlichen verbindungen und ihre verwendung zur herstellung von polyurethanen |
| DE3304889A1 (de) * | 1983-02-12 | 1984-08-16 | Basf Ag, 6700 Ludwigshafen | Fluessige, isocyanuratgruppen enthaltende polyisocyanatmischungen aus 4,4'- und 2,4'-diphenylmethan-diisocyanaten, verfahren zu deren herstellung und deren verwendung fuer polyurethan- oder polyisocyanurat-kunststoffe |
| JPS59166537A (ja) * | 1983-03-10 | 1984-09-19 | Inoue Mtp Co Ltd | ウレタン変性ポリイソシアヌレ−トフオ−ムの製造方法 |
| DE3318147A1 (de) * | 1983-05-18 | 1984-11-22 | Bayer Ag, 5090 Leverkusen | Verfahren zur herstellung von, isocyanuratgruppen und olefinische doppelbindungen aufweisenden verbindungen, die nach diesem verfahren erhaeltlichen verbindungen und ihre verwendung als bindemittel bzw. bindemittelkomponente in ueberzugsmitteln |
| NL8303152A (nl) * | 1983-09-13 | 1985-04-01 | Dsm Resins Bv | Werkwijze voor het bereiden van een isocyanaat groepen bevattende isocyanuraatverbinding. |
| DE3339579A1 (de) * | 1983-11-02 | 1985-05-09 | Bayer Ag, 5090 Leverkusen | Neue isocyanato-isocyanurate, ein verfahren zu ihrer herstellung sowie ihre verwendung als isocyanat-komponente in polyurethanlacken |
| DE3415531A1 (de) * | 1984-04-26 | 1985-10-31 | Bayer Ag, 5090 Leverkusen | Verfahren zur herstellung von hydroxylgruppen aufweisenden alkoxylierungsprodukten von organischen carbonsaeuren und ihre verwendung zur herstellung von polyurethankunststoffen |
| JPS60262816A (ja) * | 1984-06-08 | 1985-12-26 | Sanyo Chem Ind Ltd | ポリイソシアヌレ−ト樹脂の製法 |
| US4808471A (en) * | 1985-03-01 | 1989-02-28 | Minnesota Mining And Manufacturing Company | Flat transparent top coat for retroreflective sheeting |
| JP3158387B2 (ja) * | 1991-02-22 | 2001-04-23 | 大日本インキ化学工業株式会社 | イソシアヌレート環含有ポリウレタンポリ尿素架橋粒子およびその製造方法 |
| US5221743A (en) * | 1992-03-02 | 1993-06-22 | Olin Corporation | Process for producing isocyanurates by cyclotrimerizing isocyanates using polymer-bound catalysts |
| US5905151A (en) * | 1993-02-18 | 1999-05-18 | Bayer Corporation | Trimer catalyst for aliphatic and aromatic isocyanates |
| US5714564A (en) * | 1996-08-21 | 1998-02-03 | Bayer Corporation | Low viscosity polyisocyanates prepared from monomeric triisocyanates |
| US5955609A (en) * | 1997-12-31 | 1999-09-21 | Bayer Corporation | Trimer catalyst system for aliphatic and aromatic isocyanates |
| US6028158A (en) * | 1997-12-31 | 2000-02-22 | Bayer Corporation | Freeze-stable allophanate-modified toluene diisocyanate trimers |
| DE10033099A1 (de) | 2000-07-07 | 2002-01-17 | Degussa | Verfahren zur Herstellung von geruchsarmen und lagerstabilen monomerhaltigen Polyisocyanuraten aus Isophorondiisocyanat |
| US6515125B1 (en) | 2001-03-09 | 2003-02-04 | Bayer Corporation | Liquid partially trimerized polyisocyanates based on toluene diisocyanate and diphenylmethane diisocyanate |
| DE10123416A1 (de) | 2001-05-14 | 2002-11-21 | Bayer Ag | Verfahren zur Herstellung von Polyisocyanaten |
| DE10131525A1 (de) | 2001-07-02 | 2003-01-16 | Degussa | Verfahren zur Herstellung von geruchsarmen und lagerstabilen monomerhaltigen Polyisocyanuraten aus Isophorondiisocyanat |
| DE10322620A1 (de) * | 2003-05-20 | 2004-12-16 | Bayer Materialscience Ag | Festkörperreiche Bindemittelkombinationen für kratzfeste Decklacke |
| DE10336186A1 (de) * | 2003-08-07 | 2005-03-03 | Bayer Materialscience Ag | Sulfonamid-Anionen als Katalysatoren für die NCO-Oligomerisierung |
| DE10336184A1 (de) * | 2003-08-07 | 2005-02-24 | Bayer Materialscience Ag | Neue Katalysatoren für die selektive Isocyanatdimerisierung |
| US7553963B2 (en) * | 2003-10-29 | 2009-06-30 | Bayer Materialscience Llc | Liquid partially trimerized and allophanized polyisocyanates based on toluene diisocyanate and diphenylmethane diisocyanate |
| US20050101754A1 (en) * | 2003-11-12 | 2005-05-12 | Slack William E. | Stable liquid, allophanate-modified diphenylmethane diisocyanate trimers, prepolymers thereof, and processes for their preparation |
| KR100732217B1 (ko) * | 2006-07-25 | 2007-06-27 | 광주과학기술원 | 폴리이소시아네이트 중합용 금속카보네이트 개시제 및 이를이용한 폴리이소시아네이트의 중합방법 |
| WO2008068198A1 (de) | 2006-12-04 | 2008-06-12 | Basf Se | Verfahren zur herstellung von polyisocyanaten |
| US20080227878A1 (en) | 2007-03-14 | 2008-09-18 | James Garrett | Trimer and allophanate modified isocyanates, a process for their production, foams comprising these modified isocyanates, and a process for the production of these foams |
| EP2139935B1 (de) * | 2007-03-26 | 2010-12-01 | Basf Se | Wasseremulgierbare polyisocyanate |
| EP2132244B1 (de) * | 2007-03-27 | 2018-08-22 | Basf Se | Verfahren zur herstellung von farblosen isocyanuraten von diisocyanaten |
| DE102009027395A1 (de) | 2009-07-01 | 2011-01-05 | Evonik Degussa Gmbh | Reaktive Derivate auf Basis Dianhydrohexitol basierender Isocyanate |
| US9815739B2 (en) | 2015-10-30 | 2017-11-14 | Covestro Llc | Polyisocyanurate based cement for wellbore fluid loss prevention |
| US20210388153A1 (en) | 2016-10-18 | 2021-12-16 | Covestro Deutschland Ag | Coating of wires with catalytically crosslinked blocked polyisocyanates |
| WO2018073299A1 (en) | 2016-10-18 | 2018-04-26 | Covestro Deutschland Ag | Production of plastics by catalytic crosslinking of blocked polvisocvanates |
| CN110062794B (zh) | 2016-10-18 | 2022-05-13 | 科思创德国股份有限公司 | 具有高化学和机械耐受性的硬涂层 |
| EP3381962A1 (de) | 2017-03-29 | 2018-10-03 | Covestro Deutschland AG | Erzeugung von polyisocyanuratschichten durch getrennte auftragung von isocyanatkomponenten und katalysatoren |
| EP3401344B1 (de) | 2017-05-09 | 2020-04-08 | Evonik Operations GmbH | Verfahren zur herstellung von trimeren und/oder oligomeren von diisocyanaten |
| EP3401096A1 (de) | 2017-05-09 | 2018-11-14 | Covestro Deutschland AG | Verfahren zur herstellung von produkten mit hilfe von additiven fertigungsverfahren mit reaktivpulvern sowie deren produkte |
| EP3421516A1 (de) | 2017-06-28 | 2019-01-02 | Covestro Deutschland AG | Gefärbte kunststoffe basierend auf vernetzten polyisocyanaten |
| WO2019061019A1 (en) | 2017-09-26 | 2019-04-04 | Covestro Deutschland Ag | TWO-COMPONENT SYSTEM FOR ELASTIC COATINGS |
| EP3707188B1 (de) | 2017-11-09 | 2021-08-18 | Covestro Deutschland AG | Verfahren zur herstellung eines gegenstandes und verwendung eines radikalisch vernetzbaren harzes in einem additiven fertigungsverfahren |
| ES2981974T3 (es) | 2017-11-14 | 2024-10-14 | Covestro Deutschland Ag | Productos semiacabados basados en el mecanismo de reticulación dual |
| WO2019121388A1 (de) | 2017-12-21 | 2019-06-27 | Covestro Deutschland Ag | Frostbeständige klebstoffe auf basis von polyisocyanaten |
| ES2909427T3 (es) | 2017-12-21 | 2022-05-06 | Covestro Deutschland Ag | Barnices al agua resistentes a las heladas a base de poliisocianatos |
| WO2019157625A1 (en) | 2018-02-13 | 2019-08-22 | Covestro Deutschland Ag | Aromatic polyisocyanates with a high solids content |
| CN113166364A (zh) | 2018-05-17 | 2021-07-23 | 科思创知识产权两合公司 | 由具有超高分子量的聚乙烯纤维和交联多异氰酸酯生产复合材料的方法 |
| EP3626201A1 (de) | 2018-09-20 | 2020-03-25 | Covestro Deutschland AG | 3d-gedruckte kieferorthopädische zahnschiene aus vernetzten polymeren |
| EP3867293A1 (de) * | 2018-10-19 | 2021-08-25 | Covestro Intellectual Property GmbH & Co. KG | Wasserfrei härtende klebstoffe auf polyisocyanatbasis |
| KR20210119396A (ko) | 2019-01-22 | 2021-10-05 | 코베스트로 인텔렉쳐 프로퍼티 게엠베하 운트 콤파니 카게 | 이중-경화 우레탄 중합체 및 이중-경화 이소시아누레이트 중합체를 기재로 하는 복합 물질 |
| WO2020174009A1 (de) | 2019-02-27 | 2020-09-03 | Covestro Intellectual Property Gmbh & Co. Kg | Polyisocyanuratwerkstoffe als elektrovergussmassen |
| EP3763792A1 (de) | 2019-07-11 | 2021-01-13 | Covestro Deutschland AG | Verfahren zur herstellung von isocyanuraten aus uretdionen |
| WO2022002679A1 (en) | 2020-06-29 | 2022-01-06 | Covestro Deutschland Ag | Two-component coating composition |
| EP4172225B1 (en) | 2020-06-29 | 2024-12-18 | Covestro Deutschland AG | Polyether-modified polyisocyanate composition |
| EP4175820A1 (de) | 2020-07-02 | 2023-05-10 | Covestro Deutschland AG | Beschichtungen aus polyisocyanuratbeschichtungen (rim) und deren anwendung in spritzgiessprozessen |
| EP4222186A1 (en) | 2020-09-30 | 2023-08-09 | Covestro Deutschland AG | Water-dispersible modified polyisocyanates |
| EP4015554A1 (en) | 2020-12-17 | 2022-06-22 | Covestro Deutschland AG | Water-dispersible modified polyisocyanates |
| CN112574389B (zh) * | 2020-12-09 | 2022-07-15 | 万华化学(宁波)有限公司 | 一种多异氰酸酯组合物及其制备方法 |
| US20240301154A1 (en) | 2021-03-29 | 2024-09-12 | Covestro Deutschland Ag | Polyisocyanurate-prepregs and fiber composite components produced therefrom |
| EP4303246A1 (de) | 2022-07-04 | 2024-01-10 | Covestro Deutschland AG | Polyisocyanatgemisch |
| EP4570782A1 (de) | 2023-12-14 | 2025-06-18 | Evonik Operations GmbH | Trimerisierungskatalysatoren |
| CN119529232A (zh) * | 2024-12-18 | 2025-02-28 | 万华化学集团股份有限公司 | 一种封闭型多异氰酸酯组合物及其制备方法 |
Family Cites Families (19)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2952665A (en) * | 1955-12-08 | 1960-09-13 | Mobay Chemical Corp | High molecular weight cyclic trimers containing blocked isocyanate groups |
| DE1013869B (de) | 1956-01-26 | 1957-08-14 | Bayer Ag | Verfahren zur Herstellung von Isocyanat-Polymerisationsprodukten |
| GB809809A (en) | 1956-11-16 | 1959-03-04 | Ici Ltd | Polymeric isocyanates and their manufacture |
| NL270400A (https=) * | 1960-10-20 | |||
| GB952931A (en) | 1961-05-25 | 1964-03-18 | Ici Ltd | Improved polyisocyanate compositions |
| GB966338A (en) | 1961-10-26 | 1964-08-12 | Ici Ltd | Polyurethane surface coatings |
| DE1201992B (de) * | 1963-04-11 | 1965-09-30 | Bayer Ag | Verfahren zur Herstellung von Polymeren mit Cyanuratstruktur |
| DE1226109B (de) * | 1964-04-20 | 1966-10-06 | Bayer Ag | Verfahren zur Herstellung von Polyisocyanaten mit Isocyanuratstruktur |
| DE1954093C3 (de) * | 1968-11-15 | 1978-12-21 | Mobay Chemical Corp., Pittsburgh, Pa. (V.St.A.) | Verfahren zur Herstellung von polymeren organischen Isocyanaten |
| US3686225A (en) * | 1969-04-01 | 1972-08-22 | Du Pont | Complexes of polyether compounds and ionic compounds |
| GB1433642A (en) * | 1973-01-11 | 1976-04-28 | Celotex Corp | Polyisocyanurate composition related products and processes |
| DE2325826C3 (de) * | 1973-05-22 | 1981-01-29 | Chemische Werke Huels Ag, 4370 Marl | Isocyanato-isocyanurate und Herstellung lagerstabiler Lösungen hiervon |
| DD105813A1 (https=) * | 1973-09-27 | 1974-05-12 | ||
| DE2551634C3 (de) * | 1975-11-18 | 1980-07-17 | Bayer Ag, 5090 Leverkusen | Verfahren zur Herstellung von Isocyanuratgruppen aufweisenden Polyisocyanaten |
| DE2641380C2 (de) * | 1976-09-15 | 1989-11-23 | Bayer Ag, 5090 Leverkusen | Verfahren zur Herstellung von Polyisocyanaten mit Isocyanuratstruktur |
| JPS5822118B2 (ja) * | 1978-03-31 | 1983-05-06 | 日本化成株式会社 | イソシアヌル酸トリアリルの製造法 |
| JPS5724619Y2 (https=) * | 1978-05-17 | 1982-05-28 | ||
| DE2842641A1 (de) * | 1978-09-29 | 1980-04-10 | Bayer Ag | Lackpolyisocyanat auf basis von modifiziertem 1-isocyanato-3,3,5-trimethyl-5-isocyanatomethyl-cyclohexan, ein verfahren zu seiner herstellung und seine verwendung in zweikomponenten-polyurethan-pulverlacken |
| DE3006634A1 (de) * | 1980-02-22 | 1981-08-27 | Basf Ag, 6700 Ludwigshafen | Verfahren zur herstellung von gegebenenfalls geschaeumten, isocyanuratgruppenhaltigen polyurethanen |
-
1981
- 1981-01-08 DE DE19813100263 patent/DE3100263A1/de not_active Withdrawn
- 1981-12-29 DE DE8181110813T patent/DE3173857D1/de not_active Expired
- 1981-12-29 EP EP81110813A patent/EP0056159B1/de not_active Expired
-
1982
- 1982-01-06 JP JP57000468A patent/JPS57137314A/ja active Granted
- 1982-01-06 US US06/337,344 patent/US4379905A/en not_active Expired - Lifetime
Cited By (40)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0339396A1 (de) * | 1988-04-27 | 1989-11-02 | Bayer Ag | Verfahren zur Herstellung von Isocyanuratgruppen aufweisenden Polyisocyanaten |
| EP0778298A2 (de) | 1995-12-07 | 1997-06-11 | Bayer Ag | Festkörperreiche Bindemittelkombination |
| US8063144B2 (en) | 2004-11-25 | 2011-11-22 | Bayer Materialscience Ag | Polyisocyanate mixtures, a process for their preparation and their use in coating compositions |
| EP2088165A1 (en) | 2008-02-05 | 2009-08-12 | Bayer MaterialScience LLC | Dual-cure coating compositions based on polyaspartates polyisocyanates and acrylatecontaining compounds |
| DE102009010068A1 (de) | 2008-03-05 | 2009-10-08 | Bayer Materialscience Llc | Acrylatmodifizierte Aspartate und aus diesen erzeugte Gelbeschichtungszusammensetzungen |
| EP2180011A1 (de) | 2008-10-22 | 2010-04-28 | Bayer MaterialScience AG | Feuchtigkeitshärtende Polyisocyanatmischungen |
| DE102008052765A1 (de) | 2008-10-22 | 2010-04-29 | Bayer Materialscience Ag | Feuchtigkeitshärtende Polyisocyanatmischungen |
| US8476362B2 (en) | 2008-10-22 | 2013-07-02 | Bayer Materialscience Ag | Moisture-curing polyisocyanate mixtures |
| DE102009007194A1 (de) | 2009-02-03 | 2010-08-05 | Bayer Materialscience Ag | Flexible Beschichtungen |
| WO2010089034A1 (de) | 2009-02-03 | 2010-08-12 | Bayer Materialscience Ag | Zweikomponenten-beschichtungszusammensetzungen für flexible beschichtungen |
| WO2010089033A1 (de) | 2009-02-03 | 2010-08-12 | Bayer Materialscience Ag | Beschichtungen auf basis allophanatgruppen haltiger polyisocyanate |
| DE102009007228A1 (de) | 2009-02-03 | 2010-08-05 | Bayer Materialscience Ag | Beschichtungen |
| WO2012010528A1 (de) | 2010-07-20 | 2012-01-26 | Bayer Materialscience Ag | Bindemittelkombinationen für konstruktive trinkwasserrohrbeschichtungen |
| DE102010031682A1 (de) | 2010-07-20 | 2012-01-26 | Bayer Materialscience Ag | Bindemittelkombinationen für konstruktive Trinkwasserrohrbeschichtungen |
| WO2013026804A2 (en) | 2011-08-19 | 2013-02-28 | Ppg Europe Bv | Coating composition and use thereof |
| WO2017182109A1 (de) | 2015-04-21 | 2017-10-26 | Covestro Deutschland Ag | Hydrophob modifizierter polyisocyanuratkunststoff und verfahren zu dessen herstellung |
| US11286331B2 (en) | 2015-04-21 | 2022-03-29 | Covestro Deutschland Ag | Hydrophilically modified polyisocyanurate plastic and process for production thereof |
| EP3085719A1 (de) | 2015-04-21 | 2016-10-26 | Covestro Deutschland AG | Hydrophob modifizierter polyisocyanuratkunststoff und verfahren zu dessen herstellung |
| WO2016170058A1 (en) | 2015-04-21 | 2016-10-27 | Covestro Deutschland Ag | Process for producing polyisocyanurate plastics |
| WO2016170057A1 (en) | 2015-04-21 | 2016-10-27 | Covestro Deutschland Ag | Solids based on polyisocvanurate polymers produced under adiabatic conditions |
| EP3085720A1 (de) | 2015-04-21 | 2016-10-26 | Covestro Deutschland AG | Hydrophil modifizierter polyisocyanuratkunststoff und verfahren zu dessen herstellung |
| US11390707B2 (en) | 2015-04-21 | 2022-07-19 | Covestro Deutschland Ag | Polyisocyanurate polymers and process for the production of polyisocyanurate polymers |
| US11286332B2 (en) | 2015-04-21 | 2022-03-29 | Covestro Deutschland Ag | Hydrophobically modified polyisocyanurate plastic and method for production thereof |
| EP3085718A1 (de) | 2015-04-21 | 2016-10-26 | Covestro Deutschland AG | Polyisocyanuratkunststoff enthaltend siloxangruppen und verfahren zu dessen herstellung |
| US10752724B2 (en) | 2015-04-21 | 2020-08-25 | Covestro Deutschland Ag | Process for producing polyisocvanurate plastics having functionalized surfaces |
| US10752723B2 (en) | 2015-04-21 | 2020-08-25 | Covestro Deutschland Ag | Polyisocyanurate polymer and process for the production of polyisocyanurate polymers |
| US10590226B2 (en) | 2015-04-21 | 2020-03-17 | Covestro Deutschland Ag | Solids based on polyisocyanurate polymers produced under adiabatic conditions |
| US10597484B2 (en) | 2015-04-21 | 2020-03-24 | Covestro Deutschland Ag | Polyisocyanurate plastics having high thermal stability |
| US10717805B2 (en) | 2015-04-21 | 2020-07-21 | Covestro Deutschland Ag | Process for producing polyisocyanurate plastics |
| US11236191B2 (en) | 2016-05-04 | 2022-02-01 | Covestro Deutschland Ag | Method for producing a polyisocyanurate composite material |
| WO2017191175A1 (de) | 2016-05-04 | 2017-11-09 | Covestro Deutschland Ag | Verfahren zur herstellung eines polyisocyanurat-kompositwerkstoffs |
| WO2017191216A1 (de) | 2016-05-04 | 2017-11-09 | Covestro Deutschland Ag | Verfahren zur herstellung eines polyisocyanurat-kompositwerkstoffs |
| US11530290B2 (en) | 2016-05-04 | 2022-12-20 | Covestro Deutschland Ag | Method for producing a polyisocyanurate composite material |
| WO2018054776A1 (en) | 2016-09-20 | 2018-03-29 | Covestro Deutschland Ag | Anisotropic composite materials based on polyisocyanates |
| US12447699B2 (en) | 2016-09-20 | 2025-10-21 | Covestro Deutschland Ag | Anisotropic composite materials based on polyisocyanates |
| WO2018087382A1 (de) | 2016-11-14 | 2018-05-17 | Covestro Deutschland Ag | Verfahren zur herstellung eines gegenstandes aus einem vorläufer und verwendung eines radikalisch vernetzbaren harzes in einem additiven fertigungsverfahren |
| US11590692B2 (en) | 2016-11-14 | 2023-02-28 | Covestro Deutschland Ag | Method for producing an object from a precursor, and use of a radically crosslinkable resin in an additive production method |
| WO2019219603A1 (de) | 2018-05-17 | 2019-11-21 | Covestro Deutschland Ag | Verfahren zur herstellung eines polyisocyanatpolymers und eines polyisocyanuratkunststoffs |
| EP3708602A1 (en) | 2019-03-14 | 2020-09-16 | Covestro LLC | Process for producing polycyclic polyether polyols |
| WO2020185995A1 (en) | 2019-03-14 | 2020-09-17 | Covestro Llc | Polyurethane coating compositions and their use as gel coats |
Also Published As
| Publication number | Publication date |
|---|---|
| JPS57137314A (en) | 1982-08-24 |
| US4379905A (en) | 1983-04-12 |
| DE3173857D1 (en) | 1986-03-27 |
| EP0056159B1 (de) | 1986-02-19 |
| EP0056159A1 (de) | 1982-07-21 |
| JPH0233727B2 (https=) | 1990-07-30 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| EP0056159B1 (de) | Verfahren zur Herstellung von Isocyanuratgruppen aufweisenden Polyisocyanaten und ihre Verwendung bei der Herstellung von Polyurethanen | |
| EP0102482B1 (de) | Verfahren zur Herstellung von Isocyanuratgruppen aufweisenden Polyisocyanaten und ihre Verwendung als Isocyanatkomponente zur Herstellung von Polyurethanen | |
| EP0078991B1 (de) | Verfahren zur Herstellung von Mischtrimerisaten organischer Isocyanate, die nach dem Verfahren erhaltenen Mischtrimerisate, sowie ihre Verwendung zur Herstellung von Polyurethanen | |
| EP0668271B1 (de) | Verfahren zur Herstellung von Isocyanuratgruppen aufweisenden Polyisocyanaten | |
| EP0330966B1 (de) | Verfahren zur Herstellung von Isocyanuratgruppen aufweisenden Polyisocyanaten | |
| DE2551634C3 (de) | Verfahren zur Herstellung von Isocyanuratgruppen aufweisenden Polyisocyanaten | |
| DE69214890T3 (de) | Verfahren zur Herstellung von Allophanat- und Isocyanuratgruppen enthaltenden Polyisocyanaten | |
| EP0962454B1 (de) | Verfahren zur Herstellung Iminooxadiazindiongruppen enhaltender Polyisocyanate | |
| EP0003765B1 (de) | Verfahren zur Herstellung von Isocyanuratgruppen aufweisenden Polyisocyanaten auf Basis von 1-Isocyanato-3,3,5-trimethyl-5-isocyanatomethylcyclohexan und ihre Verwendung als Isocyanatkomponente in Polyurethanlacken | |
| EP0017998B1 (de) | Verfahren zur kontinuierlichen Herstellung von Isocyanuratgruppen enhaltenden (cyclo)-aliphatischen Polyisocyanaten | |
| DE69215152T2 (de) | Allophanat- und Isocyanuratgruppen enthaltende Polyisocyanate, Verfahren zu deren Herstellung sowie Beschichtungszusammensetzungen mit zwei Komponenten | |
| EP0056158A1 (de) | Verfahren zur Herstellung von Isocyanuratgruppen aufweisenden Polyisocyanaten, als Katalysator-Komponente für dieses Verfahren geeignete Lösungen, sowie die Verwendung der Verfahrensprodukte als Isocyanat-Komponente bei der Herstellung von Polyurethanen | |
| EP0825211B1 (de) | Verfahren zur Herstellung von aliphatischen und/oder cycloaliphatischen und/oder araliphatischen Isocyanatgruppen aufweisenden Allophanaten | |
| EP0671426A1 (de) | Modifizierte (cyclo)aliphatische Polyisocyanatmischungen, Verfahren zu ihrer Herstellung und ihre Verwendung | |
| EP1085030A2 (de) | Katalysator und Verfahren zur Herstellung von farbreduzierten isocyanuratgruppenhaltigen Polyisocyanaten | |
| EP0585835A2 (de) | Verfahren zur Herstellung von niedrigviskosen Isocyanurat- und Urethangruppen enthaltenden Polyisocyanatmischungen | |
| EP1170283A2 (de) | Verfahren zur Herstellung von geruchsarmen und lagerstabilen monomerhaltigen Polyisocyanuraten aus Isophorondiisocyanat | |
| EP1645577B1 (de) | Verfahren zur Herstellung von Iminooxadiazindiongruppen aufweisenden Polyisocyanaten | |
| DE1013869B (de) | Verfahren zur Herstellung von Isocyanat-Polymerisationsprodukten | |
| DE2403858A1 (de) | Stabile, fluessige amid- und/oder acylharnstoffgruppenhaltige isocyanurat-polyisocyanatloesungen | |
| DE2342603C3 (de) | Verfahren zur Herstellung von Malonsäuredialkylesterblockierten Biuretpolyisocyanaten sowie deren Verwendung | |
| EP0226109A1 (de) | Verfahren zur Herstellung von Isocyanuratgruppen aufweisenden Polyisocyanaten und ihre Verwendung als Isocyanatkomponente zur Herstellung von Polyurethanen | |
| DE10123417A1 (de) | Verfahren zur Dimerisierung von Isophorondiisocyanat | |
| DE3001060C2 (https=) | ||
| EP0082987B1 (de) | Neue Isocyanato-isocyanurate sowie ein Verfahren zu deren Herstellung |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8130 | Withdrawal |