DE3014688C2 - - Google Patents
Info
- Publication number
- DE3014688C2 DE3014688C2 DE3014688A DE3014688A DE3014688C2 DE 3014688 C2 DE3014688 C2 DE 3014688C2 DE 3014688 A DE3014688 A DE 3014688A DE 3014688 A DE3014688 A DE 3014688A DE 3014688 C2 DE3014688 C2 DE 3014688C2
- Authority
- DE
- Germany
- Prior art keywords
- silver
- recording material
- tribromoethyl
- optionally substituted
- tribromo
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 239000000463 material Substances 0.000 claims description 85
- 229910052709 silver Inorganic materials 0.000 claims description 56
- 239000004332 silver Substances 0.000 claims description 56
- -1 silver halide Chemical class 0.000 claims description 45
- BQCADISMDOOEFD-UHFFFAOYSA-N Silver Chemical compound [Ag] BQCADISMDOOEFD-UHFFFAOYSA-N 0.000 claims description 32
- JKFYKCYQEWQPTM-UHFFFAOYSA-N 2-azaniumyl-2-(4-fluorophenyl)acetate Chemical compound OC(=O)C(N)C1=CC=C(F)C=C1 JKFYKCYQEWQPTM-UHFFFAOYSA-N 0.000 claims description 21
- 229910021612 Silver iodide Inorganic materials 0.000 claims description 21
- 229940045105 silver iodide Drugs 0.000 claims description 21
- GGCZERPQGJTIQP-UHFFFAOYSA-N sodium;9,10-dioxoanthracene-2-sulfonic acid Chemical compound [Na+].C1=CC=C2C(=O)C3=CC(S(=O)(=O)O)=CC=C3C(=O)C2=C1 GGCZERPQGJTIQP-UHFFFAOYSA-N 0.000 claims description 21
- 230000004913 activation Effects 0.000 claims description 16
- 239000003638 chemical reducing agent Substances 0.000 claims description 13
- LNAOKZKISWEZNY-UHFFFAOYSA-N 1,2-bis(dibromomethyl)benzene Chemical group BrC(Br)C1=CC=CC=C1C(Br)Br LNAOKZKISWEZNY-UHFFFAOYSA-N 0.000 claims description 7
- 239000007800 oxidant agent Substances 0.000 claims description 7
- 125000006527 (C1-C5) alkyl group Chemical group 0.000 claims description 6
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 6
- 238000006479 redox reaction Methods 0.000 claims description 6
- HJUGFYREWKUQJT-UHFFFAOYSA-N tetrabromomethane Chemical compound BrC(Br)(Br)Br HJUGFYREWKUQJT-UHFFFAOYSA-N 0.000 claims description 6
- 125000006552 (C3-C8) cycloalkyl group Chemical group 0.000 claims description 4
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 4
- MVMXKFOAEMFVLO-UHFFFAOYSA-N (2,2,2-tribromo-1-phenylethyl)benzene Chemical compound C=1C=CC=CC=1C(C(Br)(Br)Br)C1=CC=CC=C1 MVMXKFOAEMFVLO-UHFFFAOYSA-N 0.000 claims description 3
- QIONYIKHPASLHO-UHFFFAOYSA-M 2,2,2-tribromoacetate Chemical compound [O-]C(=O)C(Br)(Br)Br QIONYIKHPASLHO-UHFFFAOYSA-M 0.000 claims description 3
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 3
- YFDSDPIBEUFTMI-UHFFFAOYSA-N tribromoethanol Chemical compound OCC(Br)(Br)Br YFDSDPIBEUFTMI-UHFFFAOYSA-N 0.000 claims description 3
- 125000006833 (C1-C5) alkylene group Chemical group 0.000 claims description 2
- JUGRTVJQTFZHOM-UHFFFAOYSA-N 1,1,1-tribromo-2-methylpropan-2-ol Chemical compound CC(C)(O)C(Br)(Br)Br JUGRTVJQTFZHOM-UHFFFAOYSA-N 0.000 claims description 2
- XBYRMPXUBGMOJC-UHFFFAOYSA-N 1,2-dihydropyrazol-3-one Chemical compound OC=1C=CNN=1 XBYRMPXUBGMOJC-UHFFFAOYSA-N 0.000 claims description 2
- LBVKFTFPHQJJEO-UHFFFAOYSA-N 2,2,2-tribromo-1-phenylethanol Chemical compound BrC(Br)(Br)C(O)C1=CC=CC=C1 LBVKFTFPHQJJEO-UHFFFAOYSA-N 0.000 claims description 2
- RAVWKGPSGWYSOG-UHFFFAOYSA-N 2,2,2-tribromoethyl benzenesulfonate Chemical compound BrC(Br)(Br)COS(=O)(=O)C1=CC=CC=C1 RAVWKGPSGWYSOG-UHFFFAOYSA-N 0.000 claims description 2
- ZLLNQSJGGHZDAV-UHFFFAOYSA-N 2,2,2-tribromoethyl benzoate Chemical compound BrC(Br)(Br)COC(=O)C1=CC=CC=C1 ZLLNQSJGGHZDAV-UHFFFAOYSA-N 0.000 claims description 2
- IKBHQIPWCQBBMP-UHFFFAOYSA-N 2,2,2-tribromoethyl carbamate Chemical compound NC(=O)OCC(Br)(Br)Br IKBHQIPWCQBBMP-UHFFFAOYSA-N 0.000 claims description 2
- CKCVDRMAADONAQ-UHFFFAOYSA-N 2,2,2-tribromoethyl furan-2-carboxylate Chemical compound BrC(Br)(Br)COC(=O)C1=CC=CO1 CKCVDRMAADONAQ-UHFFFAOYSA-N 0.000 claims description 2
- GCCPQCSKYDGNPB-UHFFFAOYSA-N 2,2,2-tribromoethyl octadecanoate Chemical compound CCCCCCCCCCCCCCCCCC(=O)OCC(Br)(Br)Br GCCPQCSKYDGNPB-UHFFFAOYSA-N 0.000 claims description 2
- OSJDAKQWOXQXDO-UHFFFAOYSA-N [1-(2,2,2-tribromoethyl)cyclohexyl] carbamate Chemical compound NC(=O)OC1(CC(Br)(Br)Br)CCCCC1 OSJDAKQWOXQXDO-UHFFFAOYSA-N 0.000 claims description 2
- QGJMYNGNTFVDNN-UHFFFAOYSA-N [2-(2,2,2-tribromoethyl)phenyl] carbamate Chemical compound NC(=O)OC1=CC=CC=C1CC(Br)(Br)Br QGJMYNGNTFVDNN-UHFFFAOYSA-N 0.000 claims description 2
- XMJGRXQNTOZRCV-UHFFFAOYSA-N [phenyl-bis(2,2,2-tribromoethoxy)methyl]benzene Chemical compound C=1C=CC=CC=1C(OCC(Br)(Br)Br)(OCC(Br)(Br)Br)C1=CC=CC=C1 XMJGRXQNTOZRCV-UHFFFAOYSA-N 0.000 claims description 2
- IEBWYEREWACYPS-UHFFFAOYSA-N bis(2,2,2-tribromoethyl) butanedioate Chemical compound BrC(Br)(Br)COC(=O)CCC(=O)OCC(Br)(Br)Br IEBWYEREWACYPS-UHFFFAOYSA-N 0.000 claims description 2
- 125000003884 phenylalkyl group Chemical group 0.000 claims description 2
- ZPGOAZCGLYPEJG-UHFFFAOYSA-N trimethyl(2,2,2-tribromoethoxy)silane Chemical compound C[Si](C)(C)OCC(Br)(Br)Br ZPGOAZCGLYPEJG-UHFFFAOYSA-N 0.000 claims description 2
- 230000001737 promoting effect Effects 0.000 claims 1
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 17
- 230000035945 sensitivity Effects 0.000 description 16
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 15
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Chemical group BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 14
- 150000001875 compounds Chemical class 0.000 description 14
- 229910052740 iodine Chemical group 0.000 description 14
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical group [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 13
- 230000000052 comparative effect Effects 0.000 description 13
- 229910052794 bromium Inorganic materials 0.000 description 11
- AQRYNYUOKMNDDV-UHFFFAOYSA-M silver behenate Chemical compound [Ag+].CCCCCCCCCCCCCCCCCCCCCC([O-])=O AQRYNYUOKMNDDV-UHFFFAOYSA-M 0.000 description 11
- HVLLSGMXQDNUAL-UHFFFAOYSA-N triphenyl phosphite Chemical compound C=1C=CC=CC=1OP(OC=1C=CC=CC=1)OC1=CC=CC=C1 HVLLSGMXQDNUAL-UHFFFAOYSA-N 0.000 description 10
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 9
- 239000000839 emulsion Substances 0.000 description 9
- 239000011630 iodine Substances 0.000 description 9
- 239000000203 mixture Substances 0.000 description 9
- ADZWSOLPGZMUMY-UHFFFAOYSA-M silver bromide Chemical compound [Ag]Br ADZWSOLPGZMUMY-UHFFFAOYSA-M 0.000 description 9
- 238000010438 heat treatment Methods 0.000 description 8
- 238000000034 method Methods 0.000 description 8
- 238000004519 manufacturing process Methods 0.000 description 7
- BRMYZIKAHFEUFJ-UHFFFAOYSA-L mercury diacetate Chemical compound CC(=O)O[Hg]OC(C)=O BRMYZIKAHFEUFJ-UHFFFAOYSA-L 0.000 description 7
- 239000000725 suspension Substances 0.000 description 7
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 6
- YRKCREAYFQTBPV-UHFFFAOYSA-N acetylacetone Chemical compound CC(=O)CC(C)=O YRKCREAYFQTBPV-UHFFFAOYSA-N 0.000 description 6
- 239000003795 chemical substances by application Substances 0.000 description 6
- 230000002140 halogenating effect Effects 0.000 description 6
- QSHDDOUJBYECFT-UHFFFAOYSA-N mercury Chemical compound [Hg] QSHDDOUJBYECFT-UHFFFAOYSA-N 0.000 description 6
- 229910052753 mercury Inorganic materials 0.000 description 6
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 5
- IJAPPYDYQCXOEF-UHFFFAOYSA-N phthalazin-1(2H)-one Chemical compound C1=CC=C2C(=O)NN=CC2=C1 IJAPPYDYQCXOEF-UHFFFAOYSA-N 0.000 description 5
- 229920002037 poly(vinyl butyral) polymer Polymers 0.000 description 5
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 4
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical class OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 4
- 239000013078 crystal Substances 0.000 description 4
- PNDPGZBMCMUPRI-UHFFFAOYSA-N iodine Chemical compound II PNDPGZBMCMUPRI-UHFFFAOYSA-N 0.000 description 4
- 229910052742 iron Inorganic materials 0.000 description 4
- RPWDFMGIRPZGTI-UHFFFAOYSA-N 2-[1-(2-hydroxy-3,5-dimethylphenyl)-3,5,5-trimethylhexyl]-4,6-dimethylphenol Chemical compound C=1C(C)=CC(C)=C(O)C=1C(CC(C)CC(C)(C)C)C1=CC(C)=CC(C)=C1O RPWDFMGIRPZGTI-UHFFFAOYSA-N 0.000 description 3
- 229910021607 Silver chloride Inorganic materials 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- BZRRQSJJPUGBAA-UHFFFAOYSA-L cobalt(ii) bromide Chemical compound Br[Co]Br BZRRQSJJPUGBAA-UHFFFAOYSA-L 0.000 description 3
- 230000006872 improvement Effects 0.000 description 3
- 238000010348 incorporation Methods 0.000 description 3
- 239000004615 ingredient Substances 0.000 description 3
- NGYIMTKLQULBOO-UHFFFAOYSA-L mercury dibromide Chemical compound Br[Hg]Br NGYIMTKLQULBOO-UHFFFAOYSA-L 0.000 description 3
- 150000003378 silver Chemical class 0.000 description 3
- HKZLPVFGJNLROG-UHFFFAOYSA-M silver monochloride Chemical compound [Cl-].[Ag+] HKZLPVFGJNLROG-UHFFFAOYSA-M 0.000 description 3
- 239000000126 substance Substances 0.000 description 3
- JYAVJLTUVOJMPZ-UHFFFAOYSA-N 1-bromo-4-(tribromomethyl)benzene Chemical compound BrC1=CC=C(C(Br)(Br)Br)C=C1 JYAVJLTUVOJMPZ-UHFFFAOYSA-N 0.000 description 2
- KJCVRFUGPWSIIH-UHFFFAOYSA-N 1-naphthol Chemical compound C1=CC=C2C(O)=CC=CC2=C1 KJCVRFUGPWSIIH-UHFFFAOYSA-N 0.000 description 2
- KGRVJHAUYBGFFP-UHFFFAOYSA-N 2,2'-Methylenebis(4-methyl-6-tert-butylphenol) Chemical compound CC(C)(C)C1=CC(C)=CC(CC=2C(=C(C=C(C)C=2)C(C)(C)C)O)=C1O KGRVJHAUYBGFFP-UHFFFAOYSA-N 0.000 description 2
- WHTZQYDVDPHTAM-UHFFFAOYSA-N 2,2,2-tribromo-1-phenylethanone Chemical compound BrC(Br)(Br)C(=O)C1=CC=CC=C1 WHTZQYDVDPHTAM-UHFFFAOYSA-N 0.000 description 2
- SGWZVZZVXOJRAQ-UHFFFAOYSA-N 2,6-Dimethyl-1,4-benzenediol Chemical compound CC1=CC(O)=CC(C)=C1O SGWZVZZVXOJRAQ-UHFFFAOYSA-N 0.000 description 2
- PHXLONCQBNATSL-UHFFFAOYSA-N 2-[[2-hydroxy-5-methyl-3-(1-methylcyclohexyl)phenyl]methyl]-4-methyl-6-(1-methylcyclohexyl)phenol Chemical compound OC=1C(C2(C)CCCCC2)=CC(C)=CC=1CC(C=1O)=CC(C)=CC=1C1(C)CCCCC1 PHXLONCQBNATSL-UHFFFAOYSA-N 0.000 description 2
- GCZWLZBNDSJSQF-UHFFFAOYSA-N 2-isothiocyanatohexane Chemical compound CCCCC(C)N=C=S GCZWLZBNDSJSQF-UHFFFAOYSA-N 0.000 description 2
- JWAZRIHNYRIHIV-UHFFFAOYSA-N 2-naphthol Chemical compound C1=CC=CC2=CC(O)=CC=C21 JWAZRIHNYRIHIV-UHFFFAOYSA-N 0.000 description 2
- MKMDCEXRIPLNGJ-UHFFFAOYSA-N 2-phenyl-1h-pyrazol-5-one Chemical compound N1=C(O)C=CN1C1=CC=CC=C1 MKMDCEXRIPLNGJ-UHFFFAOYSA-N 0.000 description 2
- GPNYZBKIGXGYNU-UHFFFAOYSA-N 2-tert-butyl-6-[(3-tert-butyl-5-ethyl-2-hydroxyphenyl)methyl]-4-ethylphenol Chemical compound CC(C)(C)C1=CC(CC)=CC(CC=2C(=C(C=C(CC)C=2)C(C)(C)C)O)=C1O GPNYZBKIGXGYNU-UHFFFAOYSA-N 0.000 description 2
- DLFVBJFMPXGRIB-UHFFFAOYSA-N Acetamide Chemical compound CC(N)=O DLFVBJFMPXGRIB-UHFFFAOYSA-N 0.000 description 2
- CIWBSHSKHKDKBQ-JLAZNSOCSA-N Ascorbic acid Chemical compound OC[C@H](O)[C@H]1OC(=O)C(O)=C1O CIWBSHSKHKDKBQ-JLAZNSOCSA-N 0.000 description 2
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 2
- NLZUEZXRPGMBCV-UHFFFAOYSA-N Butylhydroxytoluene Chemical compound CC1=CC(C(C)(C)C)=C(O)C(C(C)(C)C)=C1 NLZUEZXRPGMBCV-UHFFFAOYSA-N 0.000 description 2
- QIGBRXMKCJKVMJ-UHFFFAOYSA-N Hydroquinone Chemical compound OC1=CC=C(O)C=C1 QIGBRXMKCJKVMJ-UHFFFAOYSA-N 0.000 description 2
- SECXISVLQFMRJM-UHFFFAOYSA-N N-Methylpyrrolidone Chemical compound CN1CCCC1=O SECXISVLQFMRJM-UHFFFAOYSA-N 0.000 description 2
- LQZMLBORDGWNPD-UHFFFAOYSA-N N-iodosuccinimide Chemical compound IN1C(=O)CCC1=O LQZMLBORDGWNPD-UHFFFAOYSA-N 0.000 description 2
- FZERHIULMFGESH-UHFFFAOYSA-N N-phenylacetamide Chemical compound CC(=O)NC1=CC=CC=C1 FZERHIULMFGESH-UHFFFAOYSA-N 0.000 description 2
- SMWDFEZZVXVKRB-UHFFFAOYSA-N Quinoline Chemical compound N1=CC=CC2=CC=CC=C21 SMWDFEZZVXVKRB-UHFFFAOYSA-N 0.000 description 2
- 239000000654 additive Substances 0.000 description 2
- VEQOALNAAJBPNY-UHFFFAOYSA-N antipyrine Chemical compound CN1C(C)=CC(=O)N1C1=CC=CC=C1 VEQOALNAAJBPNY-UHFFFAOYSA-N 0.000 description 2
- 235000010323 ascorbic acid Nutrition 0.000 description 2
- QRUDEWIWKLJBPS-UHFFFAOYSA-N benzotriazole Chemical class C1=CC=C2N[N][N]C2=C1 QRUDEWIWKLJBPS-UHFFFAOYSA-N 0.000 description 2
- 239000012964 benzotriazole Chemical class 0.000 description 2
- 239000011230 binding agent Substances 0.000 description 2
- YXVFYQXJAXKLAK-UHFFFAOYSA-N biphenyl-4-ol Chemical compound C1=CC(O)=CC=C1C1=CC=CC=C1 YXVFYQXJAXKLAK-UHFFFAOYSA-N 0.000 description 2
- OQROAIRCEOBYJA-UHFFFAOYSA-N bromodiphenylmethane Chemical compound C=1C=CC=CC=1C(Br)C1=CC=CC=C1 OQROAIRCEOBYJA-UHFFFAOYSA-N 0.000 description 2
- 235000010354 butylated hydroxytoluene Nutrition 0.000 description 2
- 125000004432 carbon atom Chemical group C* 0.000 description 2
- 230000003197 catalytic effect Effects 0.000 description 2
- YCIMNLLNPGFGHC-UHFFFAOYSA-N catechol Chemical compound OC1=CC=CC=C1O YCIMNLLNPGFGHC-UHFFFAOYSA-N 0.000 description 2
- 229920002301 cellulose acetate Polymers 0.000 description 2
- 229920006217 cellulose acetate butyrate Polymers 0.000 description 2
- 239000011248 coating agent Substances 0.000 description 2
- 238000000576 coating method Methods 0.000 description 2
- 229910017052 cobalt Inorganic materials 0.000 description 2
- 239000010941 cobalt Substances 0.000 description 2
- GUTLYIVDDKVIGB-UHFFFAOYSA-N cobalt atom Chemical compound [Co] GUTLYIVDDKVIGB-UHFFFAOYSA-N 0.000 description 2
- 229910052736 halogen Inorganic materials 0.000 description 2
- 150000002367 halogens Chemical class 0.000 description 2
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 2
- BQPIGGFYSBELGY-UHFFFAOYSA-N mercury(2+) Chemical compound [Hg+2] BQPIGGFYSBELGY-UHFFFAOYSA-N 0.000 description 2
- 230000003287 optical effect Effects 0.000 description 2
- 230000003647 oxidation Effects 0.000 description 2
- 238000007254 oxidation reaction Methods 0.000 description 2
- 230000001590 oxidative effect Effects 0.000 description 2
- 229910052763 palladium Inorganic materials 0.000 description 2
- 150000002989 phenols Chemical class 0.000 description 2
- 239000002985 plastic film Substances 0.000 description 2
- 229920006255 plastic film Polymers 0.000 description 2
- 229920000728 polyester Polymers 0.000 description 2
- 229920000139 polyethylene terephthalate Polymers 0.000 description 2
- 239000005020 polyethylene terephthalate Substances 0.000 description 2
- MNMYRUHURLPFQW-UHFFFAOYSA-M silver;dodecanoate Chemical compound [Ag+].CCCCCCCCCCCC([O-])=O MNMYRUHURLPFQW-UHFFFAOYSA-M 0.000 description 2
- 238000003860 storage Methods 0.000 description 2
- WVJRAJZMOVQFEC-UHFFFAOYSA-N 1,2,3,4-tetrabromo-5,6-dimethylbenzene Chemical group CC1=C(C)C(Br)=C(Br)C(Br)=C1Br WVJRAJZMOVQFEC-UHFFFAOYSA-N 0.000 description 1
- ZMCUKNMLHBAGMS-UHFFFAOYSA-N 1,3-bis(dibromomethyl)benzene Chemical group BrC(Br)C1=CC=CC(C(Br)Br)=C1 ZMCUKNMLHBAGMS-UHFFFAOYSA-N 0.000 description 1
- CBCKQZAAMUWICA-UHFFFAOYSA-N 1,4-phenylenediamine Chemical compound NC1=CC=C(N)C=C1 CBCKQZAAMUWICA-UHFFFAOYSA-N 0.000 description 1
- BDBIMDGQZXKYGF-UHFFFAOYSA-N 1-methyl-2,5-diphenylpyrazol-3-one Chemical compound CN1C(C=2C=CC=CC=2)=CC(=O)N1C1=CC=CC=C1 BDBIMDGQZXKYGF-UHFFFAOYSA-N 0.000 description 1
- PVRZMTHMPKVOBP-UHFFFAOYSA-N 1-n,4-n-dimethylbenzene-1,4-diamine Chemical compound CNC1=CC=C(NC)C=C1 PVRZMTHMPKVOBP-UHFFFAOYSA-N 0.000 description 1
- MQCPOLNSJCWPGT-UHFFFAOYSA-N 2,2'-Bisphenol F Chemical class OC1=CC=CC=C1CC1=CC=CC=C1O MQCPOLNSJCWPGT-UHFFFAOYSA-N 0.000 description 1
- YGRXMOCJHCFIEY-UHFFFAOYSA-N 2,3,4-triphenyl-1h-pyrazol-5-one Chemical compound O=C1NN(C=2C=CC=CC=2)C(C=2C=CC=CC=2)=C1C1=CC=CC=C1 YGRXMOCJHCFIEY-UHFFFAOYSA-N 0.000 description 1
- JFZFRIKFAXTVMP-UHFFFAOYSA-N 2,4-bis(3-tert-butyl-2-hydroxy-5-methylphenyl)-3-methylbicyclo[3.1.1]hepta-1,3,5-trien-6-ol Chemical compound C1C2=C(C1=C(C(=C2C1=C(C(=CC(=C1)C)C(C)(C)C)O)C)C1=C(C(=CC(=C1)C)C(C)(C)C)O)O JFZFRIKFAXTVMP-UHFFFAOYSA-N 0.000 description 1
- KDSWJARIOMTMHM-UHFFFAOYSA-N 2,5-diethyl-1-phenylpyrazol-3-one Chemical compound CCC1=CC(=O)N(CC)N1C1=CC=CC=C1 KDSWJARIOMTMHM-UHFFFAOYSA-N 0.000 description 1
- FLLRQABPKFCXSO-UHFFFAOYSA-N 2,5-ditert-butyl-4-methoxyphenol Chemical compound COC1=CC(C(C)(C)C)=C(O)C=C1C(C)(C)C FLLRQABPKFCXSO-UHFFFAOYSA-N 0.000 description 1
- LKALLEFLBKHPTQ-UHFFFAOYSA-N 2,6-bis[(3-tert-butyl-2-hydroxy-5-methylphenyl)methyl]-4-methylphenol Chemical compound OC=1C(CC=2C(=C(C=C(C)C=2)C(C)(C)C)O)=CC(C)=CC=1CC1=CC(C)=CC(C(C)(C)C)=C1O LKALLEFLBKHPTQ-UHFFFAOYSA-N 0.000 description 1
- DUUBQTCYVNKWFW-UHFFFAOYSA-N 2-(1-hydroxy-4-methoxynaphthalen-2-yl)-4-methoxynaphthalen-1-ol Chemical group C1=CC=CC2=C(O)C(C=3C=C(C4=CC=CC=C4C=3O)OC)=CC(OC)=C21 DUUBQTCYVNKWFW-UHFFFAOYSA-N 0.000 description 1
- AGUJUBACOOIWDV-UHFFFAOYSA-N 2-(1-hydroxynaphthalen-2-yl)naphthalen-1-ol Chemical group C1=CC=CC2=C(O)C(C3=C(C4=CC=CC=C4C=C3)O)=CC=C21 AGUJUBACOOIWDV-UHFFFAOYSA-N 0.000 description 1
- XXWAWQIKRVMXFR-UHFFFAOYSA-N 2-(4-iodophenyl)-1,5-dimethylpyrazol-3-one Chemical compound CN1C(C)=CC(=O)N1C1=CC=C(I)C=C1 XXWAWQIKRVMXFR-UHFFFAOYSA-N 0.000 description 1
- DVBKBUGAIYQNOE-XBXARRHUSA-N 2-[(E)-hydroxyiminomethyl]-4-nitrophenol Chemical class [N+](=O)([O-])C=1C=CC(=C(/C=N/O)C=1)O DVBKBUGAIYQNOE-XBXARRHUSA-N 0.000 description 1
- QERLMZHBYRDSJW-UHFFFAOYSA-L 2-acetamidobenzoate;mercury(2+) Chemical compound [Hg+2].CC(=O)NC1=CC=CC=C1C([O-])=O.CC(=O)NC1=CC=CC=C1C([O-])=O QERLMZHBYRDSJW-UHFFFAOYSA-L 0.000 description 1
- CDAWCLOXVUBKRW-UHFFFAOYSA-N 2-aminophenol Chemical class NC1=CC=CC=C1O CDAWCLOXVUBKRW-UHFFFAOYSA-N 0.000 description 1
- KLJDGTASMZJZDR-UHFFFAOYSA-N 2-cyclohexyl-1,5-dimethylpyrazol-3-one Chemical compound CN1C(C)=CC(=O)N1C1CCCCC1 KLJDGTASMZJZDR-UHFFFAOYSA-N 0.000 description 1
- XDJCDCSISYCXPC-UHFFFAOYSA-N 2-cyclohexyl-1h-pyrazol-5-one Chemical compound N1=C(O)C=CN1C1CCCCC1 XDJCDCSISYCXPC-UHFFFAOYSA-N 0.000 description 1
- KMSJRPACYKIQMT-UHFFFAOYSA-N 2-ethyl-1,5-dimethyl-4-propan-2-ylpyrazol-3-one Chemical compound CCN1N(C)C(C)=C(C(C)C)C1=O KMSJRPACYKIQMT-UHFFFAOYSA-N 0.000 description 1
- DILXLMRYFWFBGR-UHFFFAOYSA-N 2-formylbenzene-1,4-disulfonic acid Chemical compound OS(=O)(=O)C1=CC=C(S(O)(=O)=O)C(C=O)=C1 DILXLMRYFWFBGR-UHFFFAOYSA-N 0.000 description 1
- LZHCVNIARUXHAL-UHFFFAOYSA-N 2-tert-butyl-4-ethylphenol Chemical compound CCC1=CC=C(O)C(C(C)(C)C)=C1 LZHCVNIARUXHAL-UHFFFAOYSA-N 0.000 description 1
- DSVIHYOAKPVFEH-UHFFFAOYSA-N 4-(hydroxymethyl)-4-methyl-1-phenylpyrazolidin-3-one Chemical compound N1C(=O)C(C)(CO)CN1C1=CC=CC=C1 DSVIHYOAKPVFEH-UHFFFAOYSA-N 0.000 description 1
- BOTGCZBEERTTDQ-UHFFFAOYSA-N 4-Methoxy-1-naphthol Chemical compound C1=CC=C2C(OC)=CC=C(O)C2=C1 BOTGCZBEERTTDQ-UHFFFAOYSA-N 0.000 description 1
- ABJQKDJOYSQVFX-UHFFFAOYSA-N 4-aminonaphthalen-1-ol Chemical compound C1=CC=C2C(N)=CC=C(O)C2=C1 ABJQKDJOYSQVFX-UHFFFAOYSA-N 0.000 description 1
- FXAILOLNECSGMI-RUDMXATFSA-N 4-chloro-2-[(E)-hydroxyiminomethyl]phenol Chemical class O\N=C\C1=C(O)C=CC(Cl)=C1 FXAILOLNECSGMI-RUDMXATFSA-N 0.000 description 1
- IQJZREJFFIRNFQ-UHFFFAOYSA-N 4-ethyl-3-methyl-2-(2-methylphenyl)-1h-pyrazol-5-one Chemical compound N1C(=O)C(CC)=C(C)N1C1=CC=CC=C1C IQJZREJFFIRNFQ-UHFFFAOYSA-N 0.000 description 1
- ZFIQGRISGKSVAG-UHFFFAOYSA-N 4-methylaminophenol Chemical compound CNC1=CC=C(O)C=C1 ZFIQGRISGKSVAG-UHFFFAOYSA-N 0.000 description 1
- PUGUFBAPNSPHHY-UHFFFAOYSA-N 4-phenyl-1h-1,2,4-triazole-5-thione Chemical class SC1=NN=CN1C1=CC=CC=C1 PUGUFBAPNSPHHY-UHFFFAOYSA-N 0.000 description 1
- ROFVEXUMMXZLPA-UHFFFAOYSA-N Bipyridyl Chemical group N1=CC=CC=C1C1=CC=CC=N1 ROFVEXUMMXZLPA-UHFFFAOYSA-N 0.000 description 1
- 229930185605 Bisphenol Natural products 0.000 description 1
- 101150071146 COX2 gene Proteins 0.000 description 1
- 101100114534 Caenorhabditis elegans ctc-2 gene Proteins 0.000 description 1
- 229910021584 Cobalt(II) iodide Inorganic materials 0.000 description 1
- 240000000731 Fagus sylvatica Species 0.000 description 1
- 235000010099 Fagus sylvatica Nutrition 0.000 description 1
- 150000000996 L-ascorbic acids Chemical class 0.000 description 1
- 229910021585 Nickel(II) bromide Inorganic materials 0.000 description 1
- 101150000187 PTGS2 gene Proteins 0.000 description 1
- 229910021605 Palladium(II) bromide Inorganic materials 0.000 description 1
- 229910021606 Palladium(II) iodide Inorganic materials 0.000 description 1
- 239000004952 Polyamide Substances 0.000 description 1
- 239000004698 Polyethylene Substances 0.000 description 1
- 239000004743 Polypropylene Substances 0.000 description 1
- BGNXCDMCOKJUMV-UHFFFAOYSA-N Tert-Butylhydroquinone Chemical compound CC(C)(C)C1=CC(O)=CC=C1O BGNXCDMCOKJUMV-UHFFFAOYSA-N 0.000 description 1
- DGEZNRSVGBDHLK-UHFFFAOYSA-N [1,10]phenanthroline Chemical compound C1=CN=C2C3=NC=CC=C3C=CC2=C1 DGEZNRSVGBDHLK-UHFFFAOYSA-N 0.000 description 1
- 229960001413 acetanilide Drugs 0.000 description 1
- 150000007933 aliphatic carboxylic acids Chemical class 0.000 description 1
- XIWMTQIUUWJNRP-UHFFFAOYSA-N amidol Chemical compound NC1=CC=C(O)C(N)=C1 XIWMTQIUUWJNRP-UHFFFAOYSA-N 0.000 description 1
- 229960005070 ascorbic acid Drugs 0.000 description 1
- 239000011668 ascorbic acid Substances 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- FQUNFJULCYSSOP-UHFFFAOYSA-N bisoctrizole Chemical compound N1=C2C=CC=CC2=NN1C1=CC(C(C)(C)CC(C)(C)C)=CC(CC=2C(=C(C=C(C=2)C(C)(C)CC(C)(C)C)N2N=C3C=CC=CC3=N2)O)=C1O FQUNFJULCYSSOP-UHFFFAOYSA-N 0.000 description 1
- IISBACLAFKSPIT-UHFFFAOYSA-N bisphenol A Chemical compound C=1C=C(O)C=CC=1C(C)(C)C1=CC=C(O)C=C1 IISBACLAFKSPIT-UHFFFAOYSA-N 0.000 description 1
- 125000001246 bromo group Chemical group Br* 0.000 description 1
- 229910001622 calcium bromide Inorganic materials 0.000 description 1
- WGEFECGEFUFIQW-UHFFFAOYSA-L calcium dibromide Chemical compound [Ca+2].[Br-].[Br-] WGEFECGEFUFIQW-UHFFFAOYSA-L 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- 230000008859 change Effects 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 239000000460 chlorine Substances 0.000 description 1
- 125000001309 chloro group Chemical group Cl* 0.000 description 1
- AJPXTSMULZANCB-UHFFFAOYSA-N chlorohydroquinone Chemical compound OC1=CC=C(O)C(Cl)=C1 AJPXTSMULZANCB-UHFFFAOYSA-N 0.000 description 1
- 150000001869 cobalt compounds Chemical class 0.000 description 1
- AVWLPUQJODERGA-UHFFFAOYSA-L cobalt(2+);diiodide Chemical compound [Co+2].[I-].[I-] AVWLPUQJODERGA-UHFFFAOYSA-L 0.000 description 1
- FJKFBLLIOVQLFS-UHFFFAOYSA-L dibenzoyloxymercury Chemical compound [Hg+2].[O-]C(=O)C1=CC=CC=C1.[O-]C(=O)C1=CC=CC=C1 FJKFBLLIOVQLFS-UHFFFAOYSA-L 0.000 description 1
- CZZYITDELCSZES-UHFFFAOYSA-N diphenylmethane Chemical compound C=1C=CC=CC=1CC1=CC=CC=C1 CZZYITDELCSZES-UHFFFAOYSA-N 0.000 description 1
- 239000006185 dispersion Substances 0.000 description 1
- PYSUTOYFAKZHFO-UHFFFAOYSA-L docosanoate;mercury(2+) Chemical compound [Hg+2].CCCCCCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCCCCCC([O-])=O PYSUTOYFAKZHFO-UHFFFAOYSA-L 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 1
- 230000000977 initiatory effect Effects 0.000 description 1
- CBEQRNSPHCCXSH-UHFFFAOYSA-N iodine monobromide Chemical compound IBr CBEQRNSPHCCXSH-UHFFFAOYSA-N 0.000 description 1
- 150000004668 long chain fatty acids Chemical class 0.000 description 1
- IIWXAHZLDCJKDM-UHFFFAOYSA-L mercury(2+) 3-methylbenzoate Chemical compound [Hg+2].CC1=CC=CC(C([O-])=O)=C1.CC1=CC=CC(C([O-])=O)=C1 IIWXAHZLDCJKDM-UHFFFAOYSA-L 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 229910001507 metal halide Inorganic materials 0.000 description 1
- 150000005309 metal halides Chemical class 0.000 description 1
- HAYLIGDJFXRLMU-UHFFFAOYSA-N n-(3,5-dibromo-4-hydroxyphenyl)-4-methylbenzenesulfonamide Chemical compound C1=CC(C)=CC=C1S(=O)(=O)NC1=CC(Br)=C(O)C(Br)=C1 HAYLIGDJFXRLMU-UHFFFAOYSA-N 0.000 description 1
- GMOBYFRCKHKXDW-UHFFFAOYSA-N n-(4-hydroxyphenyl)-4-methylbenzenesulfonamide Chemical compound C1=CC(C)=CC=C1S(=O)(=O)NC1=CC=C(O)C=C1 GMOBYFRCKHKXDW-UHFFFAOYSA-N 0.000 description 1
- 150000004780 naphthols Chemical class 0.000 description 1
- IPLJNQFXJUCRNH-UHFFFAOYSA-L nickel(2+);dibromide Chemical compound [Ni+2].[Br-].[Br-] IPLJNQFXJUCRNH-UHFFFAOYSA-L 0.000 description 1
- ITGNJVOPUNCDRU-UHFFFAOYSA-N octane-1-sulfinic acid Chemical compound CCCCCCCCS(O)=O ITGNJVOPUNCDRU-UHFFFAOYSA-N 0.000 description 1
- NWVVVBRKAWDGAB-UHFFFAOYSA-N p-methoxyphenol Chemical compound COC1=CC=C(O)C=C1 NWVVVBRKAWDGAB-UHFFFAOYSA-N 0.000 description 1
- 150000002941 palladium compounds Chemical class 0.000 description 1
- MUJIDPITZJWBSW-UHFFFAOYSA-N palladium(2+) Chemical compound [Pd+2] MUJIDPITZJWBSW-UHFFFAOYSA-N 0.000 description 1
- INIOZDBICVTGEO-UHFFFAOYSA-L palladium(ii) bromide Chemical compound Br[Pd]Br INIOZDBICVTGEO-UHFFFAOYSA-L 0.000 description 1
- HNNUTDROYPGBMR-UHFFFAOYSA-L palladium(ii) iodide Chemical compound [Pd+2].[I-].[I-] HNNUTDROYPGBMR-UHFFFAOYSA-L 0.000 description 1
- 230000000737 periodic effect Effects 0.000 description 1
- CMCWWLVWPDLCRM-UHFFFAOYSA-N phenidone Chemical compound N1C(=O)CCN1C1=CC=CC=C1 CMCWWLVWPDLCRM-UHFFFAOYSA-N 0.000 description 1
- 150000004986 phenylenediamines Chemical class 0.000 description 1
- XKJCHHZQLQNZHY-UHFFFAOYSA-N phthalimide Chemical compound C1=CC=C2C(=O)NC(=O)C2=C1 XKJCHHZQLQNZHY-UHFFFAOYSA-N 0.000 description 1
- 229920002647 polyamide Polymers 0.000 description 1
- 229920000573 polyethylene Polymers 0.000 description 1
- 229920001155 polypropylene Polymers 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- NDGRWYRVNANFNB-UHFFFAOYSA-N pyrazolidin-3-one Chemical class O=C1CCNN1 NDGRWYRVNANFNB-UHFFFAOYSA-N 0.000 description 1
- 230000009467 reduction Effects 0.000 description 1
- 230000029058 respiratory gaseous exchange Effects 0.000 description 1
- 230000000717 retained effect Effects 0.000 description 1
- CVHZOJJKTDOEJC-UHFFFAOYSA-N saccharin Chemical class C1=CC=C2C(=O)NS(=O)(=O)C2=C1 CVHZOJJKTDOEJC-UHFFFAOYSA-N 0.000 description 1
- 229940081974 saccharin Drugs 0.000 description 1
- 235000019204 saccharin Nutrition 0.000 description 1
- 239000000901 saccharin and its Na,K and Ca salt Substances 0.000 description 1
- 239000004576 sand Substances 0.000 description 1
- 230000001235 sensitizing effect Effects 0.000 description 1
- YRSQDSCQMOUOKO-KVVVOXFISA-M silver;(z)-octadec-9-enoate Chemical compound [Ag+].CCCCCCCC\C=C/CCCCCCCC([O-])=O YRSQDSCQMOUOKO-KVVVOXFISA-M 0.000 description 1
- LTYHQUJGIQUHMS-UHFFFAOYSA-M silver;hexadecanoate Chemical compound [Ag+].CCCCCCCCCCCCCCCC([O-])=O LTYHQUJGIQUHMS-UHFFFAOYSA-M 0.000 description 1
- ORYURPRSXLUCSS-UHFFFAOYSA-M silver;octadecanoate Chemical compound [Ag+].CCCCCCCCCCCCCCCCCC([O-])=O ORYURPRSXLUCSS-UHFFFAOYSA-M 0.000 description 1
- OHGHHPYRRURLHR-UHFFFAOYSA-M silver;tetradecanoate Chemical compound [Ag+].CCCCCCCCCCCCCC([O-])=O OHGHHPYRRURLHR-UHFFFAOYSA-M 0.000 description 1
- 239000011877 solvent mixture Substances 0.000 description 1
- 230000003595 spectral effect Effects 0.000 description 1
- 125000003107 substituted aryl group Chemical group 0.000 description 1
- BUUPQKDIAURBJP-UHFFFAOYSA-N sulfinic acid Chemical compound OS=O BUUPQKDIAURBJP-UHFFFAOYSA-N 0.000 description 1
- 150000003455 sulfinic acids Chemical class 0.000 description 1
- 230000001629 suppression Effects 0.000 description 1
- 239000004250 tert-Butylhydroquinone Substances 0.000 description 1
- 235000019281 tert-butylhydroquinone Nutrition 0.000 description 1
- WFKWXMTUELFFGS-UHFFFAOYSA-N tungsten Chemical compound [W] WFKWXMTUELFFGS-UHFFFAOYSA-N 0.000 description 1
- 229910052721 tungsten Inorganic materials 0.000 description 1
- 239000010937 tungsten Substances 0.000 description 1
- 230000000007 visual effect Effects 0.000 description 1
- 229910052724 xenon Inorganic materials 0.000 description 1
- FHNFHKCVQCLJFQ-UHFFFAOYSA-N xenon atom Chemical compound [Xe] FHNFHKCVQCLJFQ-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- G—PHYSICS
- G03—PHOTOGRAPHY; CINEMATOGRAPHY; ANALOGOUS TECHNIQUES USING WAVES OTHER THAN OPTICAL WAVES; ELECTROGRAPHY; HOLOGRAPHY
- G03C—PHOTOSENSITIVE MATERIALS FOR PHOTOGRAPHIC PURPOSES; PHOTOGRAPHIC PROCESSES, e.g. CINE, X-RAY, COLOUR, STEREO-PHOTOGRAPHIC PROCESSES; AUXILIARY PROCESSES IN PHOTOGRAPHY
- G03C1/00—Photosensitive materials
- G03C1/494—Silver salt compositions other than silver halide emulsions; Photothermographic systems ; Thermographic systems using noble metal compounds
- G03C1/498—Photothermographic systems, e.g. dry silver
Landscapes
- Chemical & Material Sciences (AREA)
- Engineering & Computer Science (AREA)
- Materials Engineering (AREA)
- Physics & Mathematics (AREA)
- General Physics & Mathematics (AREA)
- Non-Silver Salt Photosensitive Materials And Non-Silver Salt Photography (AREA)
- Heat Sensitive Colour Forming Recording (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP4525779A JPS55153937A (en) | 1979-04-16 | 1979-04-16 | Image forming material |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE3014688A1 DE3014688A1 (de) | 1980-10-23 |
| DE3014688C2 true DE3014688C2 (enExample) | 1988-01-14 |
Family
ID=12714222
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19803014688 Granted DE3014688A1 (de) | 1979-04-16 | 1980-04-16 | Trocken-bildaufzeichnungsmaterial vom nachaktivierungstyp |
Country Status (14)
| Country | Link |
|---|---|
| US (1) | US4442202A (enExample) |
| JP (1) | JPS55153937A (enExample) |
| AT (1) | AT393918B (enExample) |
| AU (1) | AU535623B2 (enExample) |
| BE (1) | BE882774A (enExample) |
| CA (1) | CA1144801A (enExample) |
| CH (1) | CH646533A5 (enExample) |
| DE (1) | DE3014688A1 (enExample) |
| DK (1) | DK160847C (enExample) |
| FR (1) | FR2454641A1 (enExample) |
| GB (1) | GB2049971B (enExample) |
| IT (1) | IT1194649B (enExample) |
| NL (1) | NL176979C (enExample) |
| SE (1) | SE446565B (enExample) |
Families Citing this family (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB2116735B (en) * | 1982-02-27 | 1986-11-26 | Arthur R Zingher | Optically annotatable recording film |
| US4546075A (en) * | 1982-09-09 | 1985-10-08 | Fuji Photo Film Co., Ltd. | Heat-developable photographic material |
| GB9121795D0 (en) * | 1991-10-14 | 1991-11-27 | Minnesota Mining & Mfg | Positive-acting photothermographic materials |
| JP3616130B2 (ja) * | 1993-06-04 | 2005-02-02 | イーストマン コダック カンパニー | 感赤外線性光熱写真ハロゲン化銀要素及び画像形成性媒体の露光方法 |
| EP0851284B1 (en) * | 1996-12-30 | 2005-06-22 | Agfa-Gevaert | Photothermographic recording material coatable from an aqueous medium |
| US6143488A (en) * | 1996-12-30 | 2000-11-07 | Agfa-Gevaert | Photothermographic recording material coatable from an aqueous medium |
| JP2002360340A (ja) * | 2001-06-08 | 2002-12-17 | Azuma Industrial Co Ltd | 目地用清掃ブラシ |
| US6514678B1 (en) | 2001-12-11 | 2003-02-04 | Eastman Kodak Company | Photothermographic materials containing solubilized antifoggants |
Family Cites Families (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1572203C3 (de) * | 1964-04-27 | 1978-03-09 | Minnesota Mining And Manufacturing Co., Saint Paul, Minn. (V.St.A.) | Verfahren zur Herstellung eines wärmeentwickelbaren Blattmaterials mit einem strahlungsempfindlichen Überzug |
| US3846136A (en) * | 1970-05-01 | 1974-11-05 | Eastman Kodak Co | Certain activator-toners in photosensitive and thermosensitive elements,compositions and processes |
| US3707377A (en) * | 1971-02-02 | 1972-12-26 | Minnesota Mining & Mfg | Photothermic dry silver coatings stabilized with halogen-containing organic oxidizing agents |
| BE790370A (fr) * | 1971-10-22 | 1973-04-20 | Minnesota Mining & Mfg | Feuille stable a la lumiere pour l'enregistrement d'images lumineuses |
| US4099999A (en) * | 1977-06-13 | 1978-07-11 | Xerox Corporation | Method of making etched-striped substrate planar laser |
| JPS5421326A (en) * | 1977-07-18 | 1979-02-17 | Asahi Chemical Ind | Dryytype image forming material |
| JPS5458022A (en) * | 1977-10-17 | 1979-05-10 | Asahi Chemical Ind | Picture forming material |
| US4201583A (en) * | 1977-12-08 | 1980-05-06 | Eastman Kodak Company | Electrically activated recording material and process |
| JPS5821251B2 (ja) * | 1978-08-28 | 1983-04-28 | 旭化成株式会社 | 乾式画像形成材料 |
-
1979
- 1979-04-16 JP JP4525779A patent/JPS55153937A/ja active Pending
-
1980
- 1980-04-11 SE SE8002748A patent/SE446565B/sv not_active IP Right Cessation
- 1980-04-14 BE BE0/200211A patent/BE882774A/fr not_active IP Right Cessation
- 1980-04-15 NL NLAANVRAGE8002189,A patent/NL176979C/xx not_active IP Right Cessation
- 1980-04-15 FR FR8008419A patent/FR2454641A1/fr active Granted
- 1980-04-15 DK DK159680A patent/DK160847C/da not_active IP Right Cessation
- 1980-04-15 GB GB8012445A patent/GB2049971B/en not_active Expired
- 1980-04-15 AU AU57467/80A patent/AU535623B2/en not_active Ceased
- 1980-04-16 CH CH295380A patent/CH646533A5/de not_active IP Right Cessation
- 1980-04-16 CA CA000350008A patent/CA1144801A/en not_active Expired
- 1980-04-16 IT IT21407/80A patent/IT1194649B/it active
- 1980-04-16 DE DE19803014688 patent/DE3014688A1/de active Granted
- 1980-04-16 AT AT0205380A patent/AT393918B/de not_active IP Right Cessation
-
1983
- 1983-02-28 US US06/468,692 patent/US4442202A/en not_active Expired - Fee Related
Also Published As
| Publication number | Publication date |
|---|---|
| NL8002189A (nl) | 1980-10-20 |
| JPS55153937A (en) | 1980-12-01 |
| DK160847C (da) | 1991-10-07 |
| CH646533A5 (de) | 1984-11-30 |
| CA1144801A (en) | 1983-04-19 |
| NL176979B (nl) | 1985-02-01 |
| AU535623B2 (en) | 1984-03-29 |
| DE3014688A1 (de) | 1980-10-23 |
| NL176979C (nl) | 1985-07-01 |
| US4442202A (en) | 1984-04-10 |
| IT1194649B (it) | 1988-09-22 |
| AT393918B (de) | 1992-01-10 |
| ATA205380A (de) | 1991-06-15 |
| DK159680A (da) | 1980-10-17 |
| SE446565B (sv) | 1986-09-22 |
| GB2049971B (en) | 1983-05-18 |
| GB2049971A (en) | 1980-12-31 |
| FR2454641A1 (fr) | 1980-11-14 |
| FR2454641B1 (enExample) | 1985-05-17 |
| BE882774A (fr) | 1980-10-14 |
| SE8002748L (sv) | 1980-10-17 |
| DK160847B (da) | 1991-04-22 |
| IT8021407A0 (it) | 1980-04-16 |
| AU5746780A (en) | 1980-10-23 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE3120540C2 (enExample) | ||
| EP0067638B1 (en) | Image enhancement of photothermographic elements | |
| DE69125752T2 (de) | Photothermographische Elemente | |
| DE2640040A1 (de) | Tonergemisch und dieses enthaltendes lichtempfindliches waermeentwickelbares photographisches aufzeichnungsmaterial | |
| DE2855932C2 (de) | Thermophotographisches Aufzeichnungsmaterial | |
| DE2336395A1 (de) | Photothermographisches aufzeichnungsmaterial | |
| DE2811557C2 (de) | Thermophotographisches-Aufzeichnungsmaterial | |
| DE3014688C2 (enExample) | ||
| DE2502479A1 (de) | Photothermographisches aufzeichnungsmaterial | |
| DE2460547A1 (de) | Verfahren zur herstellung einer photothermographischen beschichtungsmasse sowie photothermographisches aufzeichnungsmaterial | |
| DE2745048A1 (de) | Photothermographische aufzeichnungsschicht | |
| DE2404591A1 (de) | Waermeentwicklungsfaehiges photographisches material | |
| DE3042331C2 (enExample) | ||
| EP0194026B1 (en) | Photothermographic stabilizers for syringaldazine leuco dyes | |
| DE2934751C2 (de) | Thermophotographisches Aufzeichnungsmaterial | |
| DE2428125A1 (de) | Thermisch entwicklungsfaehiges lichtempfindliches material | |
| DE2845187C2 (de) | Thermophotographisches Aufzeichnungsmaterial | |
| DE2817408A1 (de) | Photothermographische emulsion und ihre verwendung | |
| DE3005714A1 (de) | Hitzeentwickelbares, lichtempfindliches material | |
| JP2008525858A (ja) | フォトサーモグラフィ材料のためのブロックされた脂肪族チオール安定剤 | |
| DE2506802C3 (de) | Thermophotographisches Aufzeichnungsmaterial | |
| DE3207001A1 (de) | Fotothermografisches element | |
| DE2844790A1 (de) | Thermisch entwickelbares silber-bildaufzeichnungsmaterial | |
| US4450229A (en) | Stabilization of latent images in photothermographic elements | |
| DE2831102A1 (de) | Thermisch entwicklungsfaehiges lichtempfindliches material mit verringertem schleier |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| OAP | Request for examination filed | ||
| OD | Request for examination | ||
| D2 | Grant after examination | ||
| 8364 | No opposition during term of opposition | ||
| 8339 | Ceased/non-payment of the annual fee |