DE2929687A1 - Mischungen von optischen aufhellern - Google Patents
Mischungen von optischen aufhellernInfo
- Publication number
- DE2929687A1 DE2929687A1 DE19792929687 DE2929687A DE2929687A1 DE 2929687 A1 DE2929687 A1 DE 2929687A1 DE 19792929687 DE19792929687 DE 19792929687 DE 2929687 A DE2929687 A DE 2929687A DE 2929687 A1 DE2929687 A1 DE 2929687A1
- Authority
- DE
- Germany
- Prior art keywords
- alkyl
- group
- phenyl
- substituted
- formula
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Withdrawn
Links
- 239000000203 mixture Substances 0.000 title claims abstract description 36
- 230000003287 optical effect Effects 0.000 title claims abstract description 15
- 150000001875 compounds Chemical class 0.000 claims abstract description 40
- 125000000217 alkyl group Chemical group 0.000 claims description 59
- -1 Cj-Cgalkyl Chemical group 0.000 claims description 40
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 37
- 125000003545 alkoxy group Chemical group 0.000 claims description 28
- 229910052739 hydrogen Inorganic materials 0.000 claims description 23
- 239000001257 hydrogen Substances 0.000 claims description 23
- 150000003254 radicals Chemical class 0.000 claims description 21
- 125000004435 hydrogen atom Chemical class [H]* 0.000 claims description 17
- LSNNMFCWUKXFEE-UHFFFAOYSA-M Bisulfite Chemical compound OS([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-M 0.000 claims description 16
- 125000004183 alkoxy alkyl group Chemical group 0.000 claims description 14
- 125000003118 aryl group Chemical group 0.000 claims description 13
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 claims description 12
- RWRDLPDLKQPQOW-UHFFFAOYSA-N Pyrrolidine Chemical compound C1CCNC1 RWRDLPDLKQPQOW-UHFFFAOYSA-N 0.000 claims description 12
- 229910052757 nitrogen Inorganic materials 0.000 claims description 10
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical class [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 9
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 9
- 125000001424 substituent group Chemical group 0.000 claims description 9
- YNAVUWVOSKDBBP-UHFFFAOYSA-N Morpholine Chemical compound C1COCCN1 YNAVUWVOSKDBBP-UHFFFAOYSA-N 0.000 claims description 8
- 125000004663 dialkyl amino group Chemical group 0.000 claims description 8
- 125000000623 heterocyclic group Chemical group 0.000 claims description 8
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 8
- 229910052760 oxygen Inorganic materials 0.000 claims description 8
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 7
- 150000003857 carboxamides Chemical class 0.000 claims description 7
- 125000001309 chloro group Chemical group Cl* 0.000 claims description 7
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 7
- CYRMSUTZVYGINF-UHFFFAOYSA-N trichlorofluoromethane Chemical compound FC(Cl)(Cl)Cl CYRMSUTZVYGINF-UHFFFAOYSA-N 0.000 claims description 7
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 claims description 6
- 125000004432 carbon atom Chemical group C* 0.000 claims description 6
- 125000005842 heteroatom Chemical group 0.000 claims description 6
- 125000002768 hydroxyalkyl group Chemical group 0.000 claims description 6
- 239000001301 oxygen Substances 0.000 claims description 6
- 125000004193 piperazinyl group Chemical group 0.000 claims description 6
- 229910052717 sulfur Chemical group 0.000 claims description 6
- XTEGARKTQYYJKE-UHFFFAOYSA-M Chlorate Chemical compound [O-]Cl(=O)=O XTEGARKTQYYJKE-UHFFFAOYSA-M 0.000 claims description 5
- 125000003710 aryl alkyl group Chemical group 0.000 claims description 5
- 150000005840 aryl radicals Chemical class 0.000 claims description 5
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 5
- 125000004985 dialkyl amino alkyl group Chemical group 0.000 claims description 5
- 229910052736 halogen Inorganic materials 0.000 claims description 5
- 150000002367 halogens Chemical class 0.000 claims description 5
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 claims description 4
- BDAGIHXWWSANSR-UHFFFAOYSA-N Formic acid Chemical group OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 claims description 4
- GLUUGHFHXGJENI-UHFFFAOYSA-N Piperazine Chemical compound C1CNCCN1 GLUUGHFHXGJENI-UHFFFAOYSA-N 0.000 claims description 4
- 125000004442 acylamino group Chemical group 0.000 claims description 4
- 125000004414 alkyl thio group Chemical group 0.000 claims description 4
- 125000002947 alkylene group Chemical group 0.000 claims description 4
- 125000003277 amino group Chemical group 0.000 claims description 4
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical group [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 4
- 125000005605 benzo group Chemical group 0.000 claims description 4
- 125000003236 benzoyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C(*)=O 0.000 claims description 4
- 229910052801 chlorine Inorganic materials 0.000 claims description 4
- 239000011737 fluorine Substances 0.000 claims description 4
- 229910052731 fluorine Inorganic materials 0.000 claims description 4
- 125000001188 haloalkyl group Chemical group 0.000 claims description 4
- 125000003106 haloaryl group Chemical group 0.000 claims description 4
- 125000005843 halogen group Chemical group 0.000 claims description 4
- 125000004430 oxygen atom Chemical group O* 0.000 claims description 4
- 125000000286 phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 claims description 4
- 125000005504 styryl group Chemical group 0.000 claims description 4
- 125000003944 tolyl group Chemical group 0.000 claims description 4
- 239000000460 chlorine Substances 0.000 claims description 3
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 3
- 125000004173 1-benzimidazolyl group Chemical group [H]C1=NC2=C([H])C([H])=C([H])C([H])=C2N1* 0.000 claims description 2
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 2
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims description 2
- CIUQDSCDWFSTQR-UHFFFAOYSA-N [C]1=CC=CC=C1 Chemical compound [C]1=CC=CC=C1 CIUQDSCDWFSTQR-UHFFFAOYSA-N 0.000 claims description 2
- 125000002252 acyl group Chemical group 0.000 claims description 2
- 125000004423 acyloxy group Chemical group 0.000 claims description 2
- 125000005036 alkoxyphenyl group Chemical group 0.000 claims description 2
- 125000000278 alkyl amino alkyl group Chemical group 0.000 claims description 2
- 125000002877 alkyl aryl group Chemical group 0.000 claims description 2
- 125000004104 aryloxy group Chemical group 0.000 claims description 2
- HJMZMZRCABDKKV-UHFFFAOYSA-N carbonocyanidic acid Chemical compound OC(=O)C#N HJMZMZRCABDKKV-UHFFFAOYSA-N 0.000 claims description 2
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims description 2
- 125000004181 carboxyalkyl group Chemical group 0.000 claims description 2
- 125000004965 chloroalkyl group Chemical group 0.000 claims description 2
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 claims description 2
- 125000001891 dimethoxy group Chemical group [H]C([H])([H])O* 0.000 claims description 2
- 125000005059 halophenyl group Chemical group 0.000 claims description 2
- 125000005113 hydroxyalkoxy group Chemical group 0.000 claims description 2
- 125000004464 hydroxyphenyl group Chemical group 0.000 claims description 2
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 claims description 2
- HRDXJKGNWSUIBT-UHFFFAOYSA-N methoxybenzene Chemical group [CH2]OC1=CC=CC=C1 HRDXJKGNWSUIBT-UHFFFAOYSA-N 0.000 claims description 2
- 125000001624 naphthyl group Chemical group 0.000 claims description 2
- 125000005561 phenanthryl group Chemical group 0.000 claims description 2
- 125000003386 piperidinyl group Chemical group 0.000 claims description 2
- 125000003367 polycyclic group Chemical group 0.000 claims description 2
- 229920006395 saturated elastomer Polymers 0.000 claims description 2
- 239000011593 sulfur Substances 0.000 claims description 2
- 125000004434 sulfur atom Chemical group 0.000 claims description 2
- 125000005208 trialkylammonium group Chemical group 0.000 claims description 2
- 125000002221 trityl group Chemical group [H]C1=C([H])C([H])=C([H])C([H])=C1C([*])(C1=C(C(=C(C(=C1[H])[H])[H])[H])[H])C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 claims description 2
- 239000000306 component Substances 0.000 claims 4
- 125000004174 2-benzimidazolyl group Chemical group [H]N1C(*)=NC2=C([H])C([H])=C([H])C([H])=C12 0.000 claims 1
- 150000001735 carboxylic acids Chemical class 0.000 claims 1
- 239000008358 core component Substances 0.000 claims 1
- 125000003396 thiol group Chemical group [H]S* 0.000 claims 1
- 238000000034 method Methods 0.000 description 8
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 6
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 6
- 239000002904 solvent Substances 0.000 description 6
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 5
- 238000006243 chemical reaction Methods 0.000 description 5
- 239000000463 material Substances 0.000 description 5
- 239000000370 acceptor Substances 0.000 description 4
- 229940125782 compound 2 Drugs 0.000 description 4
- 229940126214 compound 3 Drugs 0.000 description 4
- 239000006185 dispersion Substances 0.000 description 4
- 239000000835 fiber Substances 0.000 description 4
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- UHOVQNZJYSORNB-UHFFFAOYSA-N benzene Substances C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- 229940125904 compound 1 Drugs 0.000 description 3
- 229920000728 polyester Polymers 0.000 description 3
- 239000004753 textile Substances 0.000 description 3
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 2
- ZHNUHDYFZUAESO-UHFFFAOYSA-N Formamide Chemical compound NC=O ZHNUHDYFZUAESO-UHFFFAOYSA-N 0.000 description 2
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 2
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 2
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 2
- 238000010521 absorption reaction Methods 0.000 description 2
- 125000003172 aldehyde group Chemical group 0.000 description 2
- 239000004744 fabric Substances 0.000 description 2
- 238000004128 high performance liquid chromatography Methods 0.000 description 2
- 229930195733 hydrocarbon Natural products 0.000 description 2
- 150000002430 hydrocarbons Chemical class 0.000 description 2
- QFLWZFQWSBQYPS-AWRAUJHKSA-N (3S)-3-[[(2S)-2-[[(2S)-2-[5-[(3aS,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoylamino]-3-methylbutanoyl]amino]-3-(4-hydroxyphenyl)propanoyl]amino]-4-[1-bis(4-chlorophenoxy)phosphorylbutylamino]-4-oxobutanoic acid Chemical compound CCCC(NC(=O)[C@H](CC(O)=O)NC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)[C@@H](NC(=O)CCCCC1SC[C@@H]2NC(=O)N[C@H]12)C(C)C)P(=O)(Oc1ccc(Cl)cc1)Oc1ccc(Cl)cc1 QFLWZFQWSBQYPS-AWRAUJHKSA-N 0.000 description 1
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- PIGFYZPCRLYGLF-UHFFFAOYSA-N Aluminum nitride Chemical group [Al]#N PIGFYZPCRLYGLF-UHFFFAOYSA-N 0.000 description 1
- 229920000742 Cotton Polymers 0.000 description 1
- ZAFNJMIOTHYJRJ-UHFFFAOYSA-N Diisopropyl ether Chemical compound CC(C)OC(C)C ZAFNJMIOTHYJRJ-UHFFFAOYSA-N 0.000 description 1
- SECXISVLQFMRJM-UHFFFAOYSA-N N-Methylpyrrolidone Chemical compound CN1CCCC1=O SECXISVLQFMRJM-UHFFFAOYSA-N 0.000 description 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
- CYTYCFOTNPOANT-UHFFFAOYSA-N Perchloroethylene Chemical group ClC(Cl)=C(Cl)Cl CYTYCFOTNPOANT-UHFFFAOYSA-N 0.000 description 1
- 239000004952 Polyamide Substances 0.000 description 1
- SMEGJBVQLJJKKX-HOTMZDKISA-N [(2R,3S,4S,5R,6R)-5-acetyloxy-3,4,6-trihydroxyoxan-2-yl]methyl acetate Chemical compound CC(=O)OC[C@@H]1[C@H]([C@@H]([C@H]([C@@H](O1)O)OC(=O)C)O)O SMEGJBVQLJJKKX-HOTMZDKISA-N 0.000 description 1
- 229940081735 acetylcellulose Drugs 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 229910001854 alkali hydroxide Inorganic materials 0.000 description 1
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 1
- 229910001860 alkaline earth metal hydroxide Inorganic materials 0.000 description 1
- 125000004390 alkyl sulfonyl group Chemical group 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 239000003957 anion exchange resin Substances 0.000 description 1
- 150000007514 bases Chemical class 0.000 description 1
- 239000011324 bead Substances 0.000 description 1
- 125000005521 carbonamide group Chemical group 0.000 description 1
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 1
- 239000000969 carrier Substances 0.000 description 1
- 229920002301 cellulose acetate Polymers 0.000 description 1
- 239000003638 chemical reducing agent Substances 0.000 description 1
- 239000000084 colloidal system Substances 0.000 description 1
- 229940125898 compound 5 Drugs 0.000 description 1
- HPXRVTGHNJAIIH-UHFFFAOYSA-N cyclohexanol Chemical class OC1CCCCC1 HPXRVTGHNJAIIH-UHFFFAOYSA-N 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- 125000002485 formyl group Chemical class [H]C(*)=O 0.000 description 1
- 150000002334 glycols Chemical class 0.000 description 1
- ZSIAUFGUXNUGDI-UHFFFAOYSA-N hexan-1-ol Chemical class CCCCCCO ZSIAUFGUXNUGDI-UHFFFAOYSA-N 0.000 description 1
- 150000002431 hydrogen Chemical class 0.000 description 1
- 238000009413 insulation Methods 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 150000002894 organic compounds Chemical class 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 239000007800 oxidant agent Substances 0.000 description 1
- 230000001590 oxidative effect Effects 0.000 description 1
- 229920002647 polyamide Polymers 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- DIORMHZUUKOISG-UHFFFAOYSA-N sulfoformic acid Chemical compound OC(=O)S(O)(=O)=O DIORMHZUUKOISG-UHFFFAOYSA-N 0.000 description 1
- 229940124530 sulfonamide Drugs 0.000 description 1
- 150000003456 sulfonamides Chemical class 0.000 description 1
- 229950011008 tetrachloroethylene Drugs 0.000 description 1
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
Classifications
-
- D—TEXTILES; PAPER
- D06—TREATMENT OF TEXTILES OR THE LIKE; LAUNDERING; FLEXIBLE MATERIALS NOT OTHERWISE PROVIDED FOR
- D06L—DRY-CLEANING, WASHING OR BLEACHING FIBRES, FILAMENTS, THREADS, YARNS, FABRICS, FEATHERS OR MADE-UP FIBROUS GOODS; BLEACHING LEATHER OR FURS
- D06L4/00—Bleaching fibres, filaments, threads, yarns, fabrics, feathers or made-up fibrous goods; Bleaching leather or furs
- D06L4/60—Optical bleaching or brightening
- D06L4/65—Optical bleaching or brightening with mixtures of optical brighteners
Landscapes
- Engineering & Computer Science (AREA)
- Textile Engineering (AREA)
- Detergent Compositions (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Coloring (AREA)
- Prostheses (AREA)
- Dental Preparations (AREA)
- Medicinal Preparation (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Preparation Of Compounds By Using Micro-Organisms (AREA)
- Paper (AREA)
Priority Applications (11)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19792929687 DE2929687A1 (de) | 1979-07-21 | 1979-07-21 | Mischungen von optischen aufhellern |
| ES493376A ES493376A0 (es) | 1979-07-21 | 1980-07-15 | Procedimiento para la preparacion de mezclas de aclaradores opticos |
| EP80104163A EP0023028B1 (de) | 1979-07-21 | 1980-07-16 | Mischungen von optischen Aufhellern und deren Verwendung |
| DE8080104163T DE3061345D1 (en) | 1979-07-21 | 1980-07-16 | Mixtures of optical brighteners and their use |
| AT80104163T ATE2017T1 (de) | 1979-07-21 | 1980-07-16 | Mischungen von optischen aufhellern und deren verwendung. |
| US06/169,296 US4330427A (en) | 1979-07-21 | 1980-07-16 | Mixtures of optical brighteners |
| BR8004478A BR8004478A (pt) | 1979-07-21 | 1980-07-18 | Misturas de aclaradores oticos e sua aplicacao |
| CA000356458A CA1151806A (en) | 1979-07-21 | 1980-07-18 | Mixtures of optical brighteners |
| ZA00804365A ZA804365B (en) | 1979-07-21 | 1980-07-18 | Mixtures of optical brighteners |
| JP9769380A JPS5618655A (en) | 1979-07-21 | 1980-07-18 | Optically whitening agent mixture |
| AU60636/80A AU533417B2 (en) | 1979-07-21 | 1980-07-18 | Mixtures of stilbene optical brighteners |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19792929687 DE2929687A1 (de) | 1979-07-21 | 1979-07-21 | Mischungen von optischen aufhellern |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE2929687A1 true DE2929687A1 (de) | 1981-02-12 |
Family
ID=6076455
Family Applications (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19792929687 Withdrawn DE2929687A1 (de) | 1979-07-21 | 1979-07-21 | Mischungen von optischen aufhellern |
| DE8080104163T Expired DE3061345D1 (en) | 1979-07-21 | 1980-07-16 | Mixtures of optical brighteners and their use |
Family Applications After (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE8080104163T Expired DE3061345D1 (en) | 1979-07-21 | 1980-07-16 | Mixtures of optical brighteners and their use |
Country Status (10)
| Country | Link |
|---|---|
| US (1) | US4330427A (enExample) |
| EP (1) | EP0023028B1 (enExample) |
| JP (1) | JPS5618655A (enExample) |
| AT (1) | ATE2017T1 (enExample) |
| AU (1) | AU533417B2 (enExample) |
| BR (1) | BR8004478A (enExample) |
| CA (1) | CA1151806A (enExample) |
| DE (2) | DE2929687A1 (enExample) |
| ES (1) | ES493376A0 (enExample) |
| ZA (1) | ZA804365B (enExample) |
Families Citing this family (17)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CH650792A5 (en) * | 1979-12-13 | 1985-08-15 | Ciba Geigy Ag | Optical brighteners from bisstyrylbenzene compounds and preparation thereof |
| EP0030917B2 (de) * | 1979-12-13 | 1991-03-20 | Ciba-Geigy Ag | Optische Aufheller aus Bis-styrylbenzolverbindungen, Verfahren zu deren Herstellung und deren Verwendung |
| DE3001065A1 (de) * | 1980-01-12 | 1981-07-16 | Basf Ag, 6700 Ludwigshafen | Verfahren zur herstellung von optischen aufhellern |
| DE3027479A1 (de) * | 1980-07-19 | 1982-03-04 | Hoechst Ag, 6000 Frankfurt | Mischungen von optischen aufhellern und deren verwendung |
| DE3104992A1 (de) * | 1981-02-12 | 1982-08-26 | Hoechst Ag, 6000 Frankfurt | "mischungen von optischen aufhellern" |
| DE3313332A1 (de) * | 1983-04-13 | 1984-10-18 | Hoechst Ag, 6230 Frankfurt | Mischungen von optischen aufhellern zum aufhellen von polyvinylchlorid |
| DE3339383A1 (de) * | 1983-10-29 | 1985-05-09 | Bayer Ag, 5090 Leverkusen | Distyrylverbindungen |
| JPS60217999A (ja) * | 1984-03-31 | 1985-10-31 | 株式会社新潟鐵工所 | 流体荷役装置 |
| US4778622A (en) * | 1986-03-21 | 1988-10-18 | Ciba-Geigy Corporation | Mixtures of fluorescent whitening agents |
| EP0252009B1 (de) * | 1986-07-01 | 1990-08-01 | Ciba-Geigy Ag | 1,4-Distryrylbenzolverbindungen und deren Mischungen mit anderen 1,4-Distryrylbenzolverbindungen |
| CH671956A5 (enExample) * | 1987-01-29 | 1989-10-13 | Ciba Geigy Ag | |
| US4830763A (en) * | 1987-02-26 | 1989-05-16 | Ciba-Geigy Corporation | Process for increasing the degree of whiteness of polyester-containing textile material |
| EP0321393B1 (de) * | 1987-11-27 | 1993-02-17 | Ciba-Geigy Ag | Aufhellerdispersion |
| EP0323399B1 (de) * | 1987-11-27 | 1993-02-17 | Ciba-Geigy Ag | Aufhellerdispersion |
| US6492032B1 (en) | 2000-10-12 | 2002-12-10 | Eastman Chemical Company | Multi-component optically brightened polyolefin blend |
| DE10219993A1 (de) * | 2002-05-03 | 2003-11-20 | Basf Ag | Verfahren zum Aufhellen von textilen Materialien |
| JP4580241B2 (ja) * | 2002-12-10 | 2010-11-10 | チバ ホールディング インコーポレーテッド | 蛍光増白剤の混合物 |
Family Cites Families (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1469821B2 (de) * | 1959-06-24 | 1972-03-23 | Badische Anilin & Soda Fabrik AG, 6700 Ludwigshafen | Optische Aufheller für makromolekulare organische Stoffe |
| CH533670A (de) * | 1968-12-05 | 1973-02-15 | Ciba Geigy Ag | Optische Aufhellmittel enthaltende anorganische Weisspigmente |
| DE2037854C2 (de) * | 1970-07-30 | 1983-07-07 | Bayer Ag, 5090 Leverkusen | 3-(4-Chlor-1-pyrazolyl)-7-v-triazol-2-yl-cumarin-Verbindungen und deren Verwendung zum optischen Aufhellen |
| JPS51100522A (ja) * | 1975-03-01 | 1976-09-04 | Kubota Ltd | Sagyokiratsukaboshisochi |
| JPS544973A (en) * | 1977-06-13 | 1979-01-16 | Daiken Trade & Industry | Waterproof treatment for board |
-
1979
- 1979-07-21 DE DE19792929687 patent/DE2929687A1/de not_active Withdrawn
-
1980
- 1980-07-15 ES ES493376A patent/ES493376A0/es active Granted
- 1980-07-16 US US06/169,296 patent/US4330427A/en not_active Expired - Lifetime
- 1980-07-16 AT AT80104163T patent/ATE2017T1/de not_active IP Right Cessation
- 1980-07-16 DE DE8080104163T patent/DE3061345D1/de not_active Expired
- 1980-07-16 EP EP80104163A patent/EP0023028B1/de not_active Expired
- 1980-07-18 ZA ZA00804365A patent/ZA804365B/xx unknown
- 1980-07-18 AU AU60636/80A patent/AU533417B2/en not_active Ceased
- 1980-07-18 BR BR8004478A patent/BR8004478A/pt not_active IP Right Cessation
- 1980-07-18 JP JP9769380A patent/JPS5618655A/ja active Granted
- 1980-07-18 CA CA000356458A patent/CA1151806A/en not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| AU6063680A (en) | 1981-01-22 |
| US4330427A (en) | 1982-05-18 |
| BR8004478A (pt) | 1981-01-27 |
| ES8105055A1 (es) | 1981-05-16 |
| ZA804365B (en) | 1981-07-29 |
| AU533417B2 (en) | 1983-11-24 |
| JPS5618655A (en) | 1981-02-21 |
| ES493376A0 (es) | 1981-05-16 |
| DE3061345D1 (en) | 1983-01-20 |
| EP0023028A1 (de) | 1981-01-28 |
| JPH0116867B2 (enExample) | 1989-03-28 |
| CA1151806A (en) | 1983-08-16 |
| EP0023028B1 (de) | 1982-12-15 |
| ATE2017T1 (de) | 1982-12-15 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2929687A1 (de) | Mischungen von optischen aufhellern | |
| DE2733156C2 (enExample) | ||
| DE2238734A1 (de) | Benzofuran-derivate, verfahren zu deren herstellung und verwendung als optische aufheller | |
| DE2248772C3 (de) | Pyrazolinverbindungen | |
| DE2721084A1 (de) | Mischungen von optischen aufhellern | |
| EP0136259B1 (de) | 4-Heterocyclylvinyl-4'-styryl-biphenyle | |
| EP0023026B1 (de) | Mischungen von optischen Aufhellern und deren Verwendung | |
| DE2050725C3 (de) | Aufhellungsmittel | |
| EP0023027A1 (de) | Mischungen von optischen Aufhellern, deren Herstellung und Verwendung | |
| EP0603130B1 (de) | Kationische Verbindungen, deren Herstellung und deren Anwendung zur fotochemischen Stabilisierung basisch anfärbbarer Polyamidfasermaterialien | |
| EP0058880B1 (de) | Mischungen von optischen Aufhellern | |
| DE3008812A1 (de) | Mischungen von optischen aufhellern | |
| DE69321249T2 (de) | Farbstoffe | |
| EP0054511B1 (de) | 4-Styryl-4'-vinylbiphenyle, Verfahren zu deren Herstellung und deren Verwendung als optische Aufheller | |
| DE2703864C2 (enExample) | ||
| DE2921641C2 (enExample) | ||
| EP0011824A1 (de) | Benzofuranyl-benzimidazole, Verfahren zu ihrer Herstellung sowie ihre Verwendung zum optischen Aufhellen von organischen Materialien | |
| DE1545895C3 (de) | Pyrazolinverbindungen | |
| DE2839936C2 (de) | Mischungen von optischen Aufhellern und deren Verwendung zum optischen Aufhellen | |
| EP0050263B1 (de) | Kationische Farbstoffe, ihre Herstellung und Verwendung zum Färben kationisch färbbarer Fasern und Papier | |
| EP0713940B1 (de) | Verfahren zum Färben von wollhaltigen Fasermaterialien | |
| DE2848149A1 (de) | Benzoxazolyl-phenylstilbene, verfahren zu deren herstellung sowie deren verwendung als optische aufheller | |
| DE1670398A1 (de) | Verfahren zur Herstellung heterocyclischer Stilbenverbindungen | |
| DE1802642A1 (de) | Fluoreszierende 1-(Pyrazolinylphenylsulfonyl)-piperazine | |
| DE2759217A1 (de) | Mischungen von optischen aufhellern |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8139 | Disposal/non-payment of the annual fee |