DE285285C - - Google Patents
Info
- Publication number
- DE285285C DE285285C DENDAT285285D DE285285DA DE285285C DE 285285 C DE285285 C DE 285285C DE NDAT285285 D DENDAT285285 D DE NDAT285285D DE 285285D A DE285285D A DE 285285DA DE 285285 C DE285285 C DE 285285C
- Authority
- DE
- Germany
- Prior art keywords
- orthosilicate
- substance
- glycerol
- esters
- primary
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Active
Links
- 150000002148 esters Chemical class 0.000 claims description 10
- RMAQACBXLXPBSY-UHFFFAOYSA-N silicic acid Chemical compound O[Si](O)(O)O RMAQACBXLXPBSY-UHFFFAOYSA-N 0.000 claims description 5
- 150000005846 sugar alcohols Polymers 0.000 claims description 5
- 238000000034 method Methods 0.000 claims description 3
- 238000002360 preparation method Methods 0.000 claims description 2
- BOTDANWDWHJENH-UHFFFAOYSA-N Tetraethyl orthosilicate Chemical compound CCO[Si](OCC)(OCC)OCC BOTDANWDWHJENH-UHFFFAOYSA-N 0.000 claims 1
- LFQCEHFDDXELDD-UHFFFAOYSA-N tetramethyl orthosilicate Chemical compound CO[Si](OC)(OC)OC LFQCEHFDDXELDD-UHFFFAOYSA-N 0.000 claims 1
- 239000000126 substance Substances 0.000 description 22
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 description 21
- RLMSBRTUTKJSMJ-UHFFFAOYSA-N propane-1,2,3-triol;silicic acid Chemical group O[Si](O)(O)O.OCC(O)CO RLMSBRTUTKJSMJ-UHFFFAOYSA-N 0.000 description 13
- -1 orthosilicic acid ester Chemical class 0.000 description 11
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 10
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 10
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 9
- 235000019441 ethanol Nutrition 0.000 description 9
- 235000011187 glycerol Nutrition 0.000 description 9
- 235000012239 silicon dioxide Nutrition 0.000 description 9
- 229910004298 SiO 2 Inorganic materials 0.000 description 8
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 7
- BPQQTUXANYXVAA-UHFFFAOYSA-N Orthosilicate Chemical compound [O-][Si]([O-])([O-])[O-] BPQQTUXANYXVAA-UHFFFAOYSA-N 0.000 description 6
- 238000006243 chemical reaction Methods 0.000 description 6
- 238000010438 heat treatment Methods 0.000 description 6
- WGCNASOHLSPBMP-UHFFFAOYSA-N hydroxyacetaldehyde Natural products OCC=O WGCNASOHLSPBMP-UHFFFAOYSA-N 0.000 description 6
- 150000005374 primary esters Chemical class 0.000 description 5
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 4
- 239000000047 product Substances 0.000 description 4
- 239000007787 solid Substances 0.000 description 4
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 3
- 229920000159 gelatin Polymers 0.000 description 3
- 235000019322 gelatine Nutrition 0.000 description 3
- 239000007788 liquid Substances 0.000 description 3
- 239000000203 mixture Substances 0.000 description 3
- 238000007127 saponification reaction Methods 0.000 description 3
- 239000000377 silicon dioxide Substances 0.000 description 3
- VXEGSRKPIUDPQT-UHFFFAOYSA-N 4-[4-(4-methoxyphenyl)piperazin-1-yl]aniline Chemical compound C1=CC(OC)=CC=C1N1CCN(C=2C=CC(N)=CC=2)CC1 VXEGSRKPIUDPQT-UHFFFAOYSA-N 0.000 description 2
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 2
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- FBPFZTCFMRRESA-KVTDHHQDSA-N D-Mannitol Chemical compound OC[C@@H](O)[C@@H](O)[C@H](O)[C@H](O)CO FBPFZTCFMRRESA-KVTDHHQDSA-N 0.000 description 2
- 108010010803 Gelatin Proteins 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 2
- 229930195725 Mannitol Natural products 0.000 description 2
- 239000002253 acid Substances 0.000 description 2
- 150000007513 acids Chemical class 0.000 description 2
- 239000007864 aqueous solution Substances 0.000 description 2
- 229910052799 carbon Inorganic materials 0.000 description 2
- 239000007795 chemical reaction product Substances 0.000 description 2
- 238000001035 drying Methods 0.000 description 2
- 230000008030 elimination Effects 0.000 description 2
- 238000003379 elimination reaction Methods 0.000 description 2
- 230000029142 excretion Effects 0.000 description 2
- 235000011852 gelatine desserts Nutrition 0.000 description 2
- 125000003827 glycol group Chemical group 0.000 description 2
- 239000000594 mannitol Substances 0.000 description 2
- 235000010355 mannitol Nutrition 0.000 description 2
- 239000000741 silica gel Substances 0.000 description 2
- 229910002027 silica gel Inorganic materials 0.000 description 2
- 239000005049 silicon tetrachloride Substances 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- 239000006188 syrup Substances 0.000 description 2
- 235000020357 syrup Nutrition 0.000 description 2
- 230000001225 therapeutic effect Effects 0.000 description 2
- 210000002700 urine Anatomy 0.000 description 2
- 229910014033 C-OH Inorganic materials 0.000 description 1
- 229910014570 C—OH Inorganic materials 0.000 description 1
- 239000001828 Gelatine Substances 0.000 description 1
- WQZGKKKJIJFFOK-GASJEMHNSA-N Glucose Natural products OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-GASJEMHNSA-N 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- XUIMIQQOPSSXEZ-UHFFFAOYSA-N Silicon Chemical compound [Si] XUIMIQQOPSSXEZ-UHFFFAOYSA-N 0.000 description 1
- CZMRCDWAGMRECN-UGDNZRGBSA-N Sucrose Chemical compound O[C@H]1[C@H](O)[C@@H](CO)O[C@@]1(CO)O[C@@H]1[C@H](O)[C@@H](O)[C@H](O)[C@@H](CO)O1 CZMRCDWAGMRECN-UGDNZRGBSA-N 0.000 description 1
- 229930006000 Sucrose Natural products 0.000 description 1
- SUYWKHZCLXUWRR-BTVCFUMJSA-N [Si](O)(O)(O)O.O=C[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO Chemical compound [Si](O)(O)(O)O.O=C[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO SUYWKHZCLXUWRR-BTVCFUMJSA-N 0.000 description 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
- 238000003287 bathing Methods 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- CETPSERCERDGAM-UHFFFAOYSA-N ceric oxide Chemical compound O=[Ce]=O CETPSERCERDGAM-UHFFFAOYSA-N 0.000 description 1
- 229910000422 cerium(IV) oxide Inorganic materials 0.000 description 1
- 150000001875 compounds Chemical class 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 239000008273 gelatin Substances 0.000 description 1
- 239000008103 glucose Substances 0.000 description 1
- 150000002314 glycerols Chemical class 0.000 description 1
- 150000002334 glycols Chemical class 0.000 description 1
- 229910052739 hydrogen Inorganic materials 0.000 description 1
- 239000001257 hydrogen Substances 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- 239000000479 mixture part Substances 0.000 description 1
- 229910052605 nesosilicate Inorganic materials 0.000 description 1
- 150000004762 orthosilicates Chemical class 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- 239000001301 oxygen Substances 0.000 description 1
- 239000003208 petroleum Substances 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 150000008028 secondary esters Chemical class 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 229910052710 silicon Inorganic materials 0.000 description 1
- 239000010703 silicon Substances 0.000 description 1
- 150000003377 silicon compounds Chemical class 0.000 description 1
- 239000000243 solution Substances 0.000 description 1
- 229960004793 sucrose Drugs 0.000 description 1
- 235000019605 sweet taste sensations Nutrition 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07F—ACYCLIC, CARBOCYCLIC OR HETEROCYCLIC COMPOUNDS CONTAINING ELEMENTS OTHER THAN CARBON, HYDROGEN, HALOGEN, OXYGEN, NITROGEN, SULFUR, SELENIUM OR TELLURIUM
- C07F7/00—Compounds containing elements of Groups 4 or 14 of the Periodic Table
- C07F7/02—Silicon compounds
- C07F7/04—Esters of silicic acids
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Silicon Compounds (AREA)
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE285285C true DE285285C (enExample) |
Family
ID=540681
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DENDAT285285D Active DE285285C (enExample) |
Country Status (1)
| Country | Link |
|---|---|
| DE (1) | DE285285C (enExample) |
Cited By (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1004134B (de) * | 1951-02-07 | 1957-03-14 | Traitement Et L Amelioration D | Verfahren zur Behandlung von Faserstoffen |
| DE973716C (de) * | 1950-07-07 | 1960-05-19 | Siemens Ag | Verfahren zur Herstellung eines haertbaren siliciumhaltigen Kunstharzes |
| DE1191968B (de) * | 1958-04-05 | 1965-04-29 | Siemens Ag | Verfahren zur Herstellung von linear-polymeren Kieselsaeuremischestern |
| US4870191A (en) * | 1988-07-22 | 1989-09-26 | Ethyl Corporation | Silicon containing reaction product |
| WO1990000884A1 (en) * | 1988-07-22 | 1990-02-08 | Ethyl Corporation | Silicon compounds in bone treatment |
| US4917045A (en) * | 1988-07-22 | 1990-04-17 | Ethyl Corporation | Silicon compounds in poultry hatching |
| US5183061A (en) * | 1988-07-22 | 1993-02-02 | Ethyl Corporation | Silicon compounds in bone treatment |
-
0
- DE DENDAT285285D patent/DE285285C/de active Active
Cited By (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE973716C (de) * | 1950-07-07 | 1960-05-19 | Siemens Ag | Verfahren zur Herstellung eines haertbaren siliciumhaltigen Kunstharzes |
| DE1004134B (de) * | 1951-02-07 | 1957-03-14 | Traitement Et L Amelioration D | Verfahren zur Behandlung von Faserstoffen |
| DE1191968B (de) * | 1958-04-05 | 1965-04-29 | Siemens Ag | Verfahren zur Herstellung von linear-polymeren Kieselsaeuremischestern |
| US4870191A (en) * | 1988-07-22 | 1989-09-26 | Ethyl Corporation | Silicon containing reaction product |
| WO1990000884A1 (en) * | 1988-07-22 | 1990-02-08 | Ethyl Corporation | Silicon compounds in bone treatment |
| WO1990001032A1 (en) * | 1988-07-22 | 1990-02-08 | Ethyl Corporation | Silicon containing reaction product |
| US4917045A (en) * | 1988-07-22 | 1990-04-17 | Ethyl Corporation | Silicon compounds in poultry hatching |
| US5183061A (en) * | 1988-07-22 | 1993-02-02 | Ethyl Corporation | Silicon compounds in bone treatment |
| EP0427783B1 (en) * | 1988-07-22 | 1995-04-19 | Ethyl Corporation | Silicon containing reaction product |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE69726309T2 (de) | Zuckerderivate, geliermittel, geliermittelzubereitungen, verfahren zu ihrer herstellung und gelzubereitungen | |
| DE69333716T2 (de) | Zusammensetzung zum aufbringen auf die haut, die durch körperkontakt aktivierte duftstoffe enthält, und verfahren zu ihrer verwendung | |
| DE2856277C2 (enExample) | ||
| DE1467848B2 (de) | Unter Druck stehendes, bei Aufhebung des Drucks einen Schaum bildendes Haut-Pflegemittel | |
| DE285285C (enExample) | ||
| DE1930954B2 (de) | Lippenstift | |
| DE69919737T2 (de) | Pumpfähige wässrige zusammensetzungen mit hohem feststoffgehalt und hohem anteil an monoalkylphosphatestersalz | |
| AT72463B (de) | Verfahren zur Darstellung von Estern der Orthokieselsäure mit mehrwertigen Alkoholen. | |
| DE907769C (de) | Verfahren zur Herstellung eines gelartigen Produktes aus niederen Alkoholen | |
| EP1029586B1 (de) | Emulgatoren | |
| EP0779070A1 (de) | Alkylpolyglycosid enthaltende Ölemulsion | |
| DE2023786A1 (enExample) | ||
| DE4340015C2 (de) | Verfahren zur Herstellung wasserfreier, rieselfähiger Zuckertensidpulver und deren Verwendung | |
| DE2646435A1 (de) | Verfahren zur herstellung einer stabilen oel/wasser-emulsion und diese enthaltende kosmetische mittel | |
| DE68916753T2 (de) | Anethol enthaltende ethanolische Zusammensetzungen. | |
| DE3873525T2 (de) | Verwendung von 2,4-monofurfuryliden-sorbitol und dessen tetraalkyl-derivaten in kosmetika und in der dermatologie. | |
| DE523144C (de) | Verfahren zur Herstellung wasserreicher Cholesterinloesungen | |
| DE2354038C3 (enExample) | ||
| DE3723237C2 (enExample) | ||
| DE552886C (de) | Verfahren zur Gewinnung von Alkoholen in freier oder gebundener Form durch Oxydationvon festen oder fluessigen Kohlenwasserstoffen | |
| DE2015263C3 (de) | Verfahren zur Herstellung einer oral verabreichbaren Suspension von feinteiligem Chloramphenicolpalmitat | |
| DE1955764C3 (enExample) | ||
| DE885536C (de) | Verfahren zur Gelierung bzw. zum Festmachen niederer Alkohole oder ihrer Loesungen | |
| DE3334208A1 (de) | Ketocarbonsaeureester und ihre verwendung in kosmetika | |
| DE3600947A1 (de) | Antimykotische emulsionen |