DE2825517C2 - Metallkomplexfarbstoffe und deren Verwendung - Google Patents
Metallkomplexfarbstoffe und deren VerwendungInfo
- Publication number
- DE2825517C2 DE2825517C2 DE2825517A DE2825517A DE2825517C2 DE 2825517 C2 DE2825517 C2 DE 2825517C2 DE 2825517 A DE2825517 A DE 2825517A DE 2825517 A DE2825517 A DE 2825517A DE 2825517 C2 DE2825517 C2 DE 2825517C2
- Authority
- DE
- Germany
- Prior art keywords
- parts
- metal complex
- dye
- complex dyes
- cobalt
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 239000000434 metal complex dye Substances 0.000 title 1
- 239000004952 Polyamide Substances 0.000 claims description 3
- 150000001447 alkali salts Chemical class 0.000 claims description 3
- 150000003863 ammonium salts Chemical class 0.000 claims description 3
- 238000004043 dyeing Methods 0.000 claims description 3
- 229920002647 polyamide Polymers 0.000 claims description 3
- 239000003513 alkali Substances 0.000 claims description 2
- 150000001875 compounds Chemical class 0.000 claims 1
- 239000000975 dye Substances 0.000 description 10
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 9
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 4
- -1 cobalt complex compound Chemical class 0.000 description 4
- 230000009918 complex formation Effects 0.000 description 4
- 230000008878 coupling Effects 0.000 description 4
- 238000010168 coupling process Methods 0.000 description 4
- 238000005859 coupling reaction Methods 0.000 description 4
- 239000000243 solution Substances 0.000 description 4
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 4
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 description 3
- VEXZGXHMUGYJMC-UHFFFAOYSA-N hydrochloric acid Substances Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 3
- YCTAOQGPWNTYJE-UHFFFAOYSA-N 3-amino-5-chloro-2-hydroxybenzenesulfonic acid Chemical compound NC1=CC(Cl)=CC(S(O)(=O)=O)=C1O YCTAOQGPWNTYJE-UHFFFAOYSA-N 0.000 description 2
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- 229910021580 Cobalt(II) chloride Inorganic materials 0.000 description 2
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 2
- 230000002378 acidificating effect Effects 0.000 description 2
- 239000007864 aqueous solution Substances 0.000 description 2
- GVPFVAHMJGGAJG-UHFFFAOYSA-L cobalt dichloride Chemical compound [Cl-].[Cl-].[Co+2] GVPFVAHMJGGAJG-UHFFFAOYSA-L 0.000 description 2
- 239000005457 ice water Substances 0.000 description 2
- 235000017557 sodium bicarbonate Nutrition 0.000 description 2
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 2
- LPXPTNMVRIOKMN-UHFFFAOYSA-M sodium nitrite Chemical compound [Na+].[O-]N=O LPXPTNMVRIOKMN-UHFFFAOYSA-M 0.000 description 2
- 210000002268 wool Anatomy 0.000 description 2
- NQRLWRODNCDUHY-UHFFFAOYSA-N 6-n,6-n,2-trimethylacridine-3,6-diamine Chemical compound C1=C(C)C(N)=CC2=NC3=CC(N(C)C)=CC=C3C=C21 NQRLWRODNCDUHY-UHFFFAOYSA-N 0.000 description 1
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonium chloride Substances [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 1
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 1
- GAWIXWVDTYZWAW-UHFFFAOYSA-N C[CH]O Chemical group C[CH]O GAWIXWVDTYZWAW-UHFFFAOYSA-N 0.000 description 1
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 description 1
- 239000004280 Sodium formate Substances 0.000 description 1
- 150000007933 aliphatic carboxylic acids Chemical class 0.000 description 1
- 125000000217 alkyl group Chemical group 0.000 description 1
- 229910021529 ammonia Inorganic materials 0.000 description 1
- 235000011114 ammonium hydroxide Nutrition 0.000 description 1
- 239000007900 aqueous suspension Substances 0.000 description 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 150000001805 chlorine compounds Chemical class 0.000 description 1
- 150000004700 cobalt complex Chemical class 0.000 description 1
- XLJKHNWPARRRJB-UHFFFAOYSA-N cobalt(2+) Chemical class [Co+2] XLJKHNWPARRRJB-UHFFFAOYSA-N 0.000 description 1
- 238000004040 coloring Methods 0.000 description 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 150000008049 diazo compounds Chemical class 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- LYCAIKOWRPUZTN-UHFFFAOYSA-N ethylene glycol Natural products OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 1
- 239000000835 fiber Substances 0.000 description 1
- 150000002334 glycols Chemical class 0.000 description 1
- WGCNASOHLSPBMP-UHFFFAOYSA-N hydroxyacetaldehyde Natural products OCC=O WGCNASOHLSPBMP-UHFFFAOYSA-N 0.000 description 1
- 238000009413 insulation Methods 0.000 description 1
- 150000003951 lactams Chemical class 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- NYGZLYXAPMMJTE-UHFFFAOYSA-M metanil yellow Chemical group [Na+].[O-]S(=O)(=O)C1=CC=CC(N=NC=2C=CC(NC=3C=CC=CC=3)=CC=2)=C1 NYGZLYXAPMMJTE-UHFFFAOYSA-M 0.000 description 1
- 238000000034 method Methods 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- KOHNUEXAOQRRPI-UHFFFAOYSA-N n-benzyl-3-oxobutanamide Chemical compound CC(=O)CC(=O)NCC1=CC=CC=C1 KOHNUEXAOQRRPI-UHFFFAOYSA-N 0.000 description 1
- 230000007935 neutral effect Effects 0.000 description 1
- 238000006386 neutralization reaction Methods 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 239000007800 oxidant agent Substances 0.000 description 1
- 239000001301 oxygen Substances 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 239000001632 sodium acetate Substances 0.000 description 1
- 235000017281 sodium acetate Nutrition 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- HLBBKKJFGFRGMU-UHFFFAOYSA-M sodium formate Chemical compound [Na+].[O-]C=O HLBBKKJFGFRGMU-UHFFFAOYSA-M 0.000 description 1
- 235000019254 sodium formate Nutrition 0.000 description 1
- 235000010288 sodium nitrite Nutrition 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 238000010626 work up procedure Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C09—DYES; PAINTS; POLISHES; NATURAL RESINS; ADHESIVES; COMPOSITIONS NOT OTHERWISE PROVIDED FOR; APPLICATIONS OF MATERIALS NOT OTHERWISE PROVIDED FOR
- C09B—ORGANIC DYES OR CLOSELY-RELATED COMPOUNDS FOR PRODUCING DYES, e.g. PIGMENTS; MORDANTS; LAKES
- C09B45/00—Complex metal compounds of azo dyes
- C09B45/02—Preparation from dyes containing in o-position a hydroxy group and in o'-position hydroxy, alkoxy, carboxyl, amino or keto groups
- C09B45/14—Monoazo compounds
- C09B45/20—Monoazo compounds containing cobalt
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Coloring (AREA)
Priority Applications (7)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2825517A DE2825517C2 (de) | 1978-06-10 | 1978-06-10 | Metallkomplexfarbstoffe und deren Verwendung |
| IT22676/79A IT1113366B (it) | 1978-06-10 | 1979-05-14 | Coloranti complessi metallizzati |
| JP5922579A JPS54162727A (en) | 1978-06-10 | 1979-05-16 | Metal complex compound dye |
| FR7914422A FR2428065B1 (fr) | 1978-06-10 | 1979-06-06 | Colorants complexes metalliques utilisables en particulier dans la teinture des polyamides |
| CH527479A CH639408A5 (de) | 1978-06-10 | 1979-06-06 | Metallkomplexfarbstoffe. |
| GB7920024A GB2026521B (en) | 1978-06-10 | 1979-06-08 | Metal complex dyes |
| US06/047,246 US4280955A (en) | 1978-06-10 | 1979-06-11 | Sulfo, chloro phenolazoacetoacetylbenzamide dyes |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2825517A DE2825517C2 (de) | 1978-06-10 | 1978-06-10 | Metallkomplexfarbstoffe und deren Verwendung |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE2825517A1 DE2825517A1 (de) | 1979-12-20 |
| DE2825517C2 true DE2825517C2 (de) | 1986-10-09 |
Family
ID=6041502
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2825517A Expired DE2825517C2 (de) | 1978-06-10 | 1978-06-10 | Metallkomplexfarbstoffe und deren Verwendung |
Country Status (7)
| Country | Link |
|---|---|
| US (1) | US4280955A (OSRAM) |
| JP (1) | JPS54162727A (OSRAM) |
| CH (1) | CH639408A5 (OSRAM) |
| DE (1) | DE2825517C2 (OSRAM) |
| FR (1) | FR2428065B1 (OSRAM) |
| GB (1) | GB2026521B (OSRAM) |
| IT (1) | IT1113366B (OSRAM) |
Families Citing this family (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE4335282C2 (de) * | 1993-10-15 | 1998-01-29 | Wifag Maschf | Verfahren zur Steuerung des Ablaufs einer angetriebenen Farbauftragwalze in Bezug auf einen angetriebenen Formzylinder im Druckwerk einer Offsetrotationsdruckmaschine sowie ein entsprechend gesteuertes Druckwerk |
Family Cites Families (11)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB910120A (OSRAM) * | ||||
| US2366633A (en) * | 1945-01-02 | Metalized azo dyestuffs | ||
| AT102950B (de) * | 1924-06-17 | 1926-03-25 | Chem Ind Basel | Verfahren zur Herstellung von Farbstoffen. |
| US1656844A (en) * | 1924-06-17 | 1928-01-17 | Chem Ind Basel | Dyestuffs containing chromium and process of making same |
| US2421315A (en) * | 1943-06-09 | 1947-05-27 | Du Pont | Chromium complex of monazo pyrazolone |
| US2556743A (en) * | 1948-07-16 | 1951-06-12 | American Cyanamid Co | Metallized azo dyes |
| CH355550A (de) * | 1957-03-11 | 1961-07-15 | Durand & Huguenin Ag | Verfahren zur Herstellung von metallkomplexen a,a'-Dioxymonoazofarbstoffen |
| DE1084401B (de) * | 1957-03-11 | 1960-06-30 | Durand & Huguenin Ag | Verfahren zur Herstellung von Metallkomplexverbindungen von o, o'-Dioxy-monoazofarbstoffen |
| US2969351A (en) * | 1957-03-11 | 1961-01-24 | Durand & Huguenin Ag | New metalliferous ortho:ortho'-dihydroxy-monoazo-dyestuffs |
| FR1331221A (fr) * | 1962-08-20 | 1963-06-28 | Sandoz Sa | Colorants azoïques, leur fabrication et leurs applications |
| NL129233C (OSRAM) * | 1965-01-15 |
-
1978
- 1978-06-10 DE DE2825517A patent/DE2825517C2/de not_active Expired
-
1979
- 1979-05-14 IT IT22676/79A patent/IT1113366B/it active
- 1979-05-16 JP JP5922579A patent/JPS54162727A/ja active Granted
- 1979-06-06 FR FR7914422A patent/FR2428065B1/fr not_active Expired
- 1979-06-06 CH CH527479A patent/CH639408A5/de not_active IP Right Cessation
- 1979-06-08 GB GB7920024A patent/GB2026521B/en not_active Expired
- 1979-06-11 US US06/047,246 patent/US4280955A/en not_active Expired - Lifetime
Also Published As
| Publication number | Publication date |
|---|---|
| DE2825517A1 (de) | 1979-12-20 |
| US4280955A (en) | 1981-07-28 |
| JPS54162727A (en) | 1979-12-24 |
| GB2026521B (en) | 1982-11-10 |
| IT7922676A0 (it) | 1979-05-14 |
| IT1113366B (it) | 1986-01-20 |
| FR2428065A1 (fr) | 1980-01-04 |
| JPS6243468B2 (OSRAM) | 1987-09-14 |
| GB2026521A (en) | 1980-02-06 |
| FR2428065B1 (fr) | 1986-04-18 |
| CH639408A5 (de) | 1983-11-15 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE742517C (de) | Verfahren zur Herstellung von metallhaltigen Azofarbstoffen | |
| DE2206551B2 (de) | Azofarbstoffe, ihre herstellung und verwendung zum faerben und bedrucken von papier sowie natuerlicher und regenerierter cellulose | |
| DE2825517C2 (de) | Metallkomplexfarbstoffe und deren Verwendung | |
| DE2531445C3 (de) | Sulfogruppenfreie wasserlösliche Azofarbstoffe und deren Verwendung zum Färben und/oder Bedrucken von synthetischen Textilfasern | |
| EP0062824B1 (de) | Sulfonsäuregruppenhaltige kationische Azofarbstoffe, ihre Herstellung und ihre Verwendung | |
| EP0072515B1 (de) | Schädlingsbekämpfungsmittel, ihre Herstellung und Verwendung | |
| EP0754732A1 (de) | Azofarbstoffe, Verfahren zu deren Herstellung und deren Verwendung | |
| EP0016975A2 (de) | Polyazofarbstoffe sowie ihre Verwendung zum Färben von amino- und hydroxygruppenhaltigen Fasermaterialien und Leder | |
| DE1904112C3 (de) | Faserreaktive, schwermetallhaltige Formazanfarbstoffe, Verfahren zu ihrer Herstellung und deren Verwendung zum Färben oder Bedrucken von Textilmaterial | |
| DE2500071A1 (de) | Azofarbstoffe fuer den transferdruck | |
| DE2806950C2 (de) | Eisenkomplexazofarbstoffe und deren Verwendung | |
| DE2951403A1 (de) | Pyridonfarbstoffe | |
| DE2324198C3 (de) | Neue quaternäre Monoazofarbstoffe, Verfahren zu ihrer Herstellung und Färbeverfahren | |
| DE2708441A1 (de) | 2-amino-5-thiocyanato-thiadiazol- (1,3,4), dessen herstellung und verwendung zum aufbau von azofarbstoffen | |
| DE3510410A1 (de) | Azofarbstoffe | |
| CH634339A5 (de) | Sulfonsaeuregruppenhaltige azofarbstoffe mit oxdiazolylresten. | |
| DE1019025B (de) | Verfahren zur Herstellung von Monoazofarbstoffen | |
| DE2126299B2 (de) | Pheny 1-naphthotriazolmonoazofarbstoffe, deren Herstellung und Verwendung | |
| DE842098C (de) | Verfahren zur Herstellung von metallisierbaren Dis- oder Polyazofarbstoffen der Dipyrazolonreihe | |
| DE2166911C3 (de) | 4-Amino-33-disulfo-acetessigsäureanilid | |
| EP0568892A2 (de) | Monoazoreaktivfarbstoffe | |
| DE1964148C3 (de) | Chromhaltige Azo-Triazol-Komplexfarbstoffe und Verfahren zur Herstellung derselben und deren Verwendung | |
| EP0073377A1 (de) | Asymmetrische 1:2-Chromkomplexfarbstoffe und Verfahren zu ihrer Herstellung und zum Färben | |
| DE956793C (de) | Verfahren zur Herstellung neuer Disazofarbstoffe | |
| DE915381C (de) | Verfahren zur Herstellung unsymmetrischer Harnstoffderivate von Monoazofarbstoffen |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8110 | Request for examination paragraph 44 | ||
| D2 | Grant after examination | ||
| 8364 | No opposition during term of opposition | ||
| 8330 | Complete renunciation |