DE2822882C2 - - Google Patents
Info
- Publication number
- DE2822882C2 DE2822882C2 DE2822882A DE2822882A DE2822882C2 DE 2822882 C2 DE2822882 C2 DE 2822882C2 DE 2822882 A DE2822882 A DE 2822882A DE 2822882 A DE2822882 A DE 2822882A DE 2822882 C2 DE2822882 C2 DE 2822882C2
- Authority
- DE
- Germany
- Prior art keywords
- nifedipine
- solution
- cellulose
- mixed
- solvent
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- HYIMSNHJOBLJNT-UHFFFAOYSA-N nifedipine Chemical compound COC(=O)C1=C(C)NC(C)=C(C(=O)OC)C1C1=CC=CC=C1[N+]([O-])=O HYIMSNHJOBLJNT-UHFFFAOYSA-N 0.000 claims description 70
- 229960001597 nifedipine Drugs 0.000 claims description 67
- 239000000203 mixture Substances 0.000 claims description 30
- 229920000036 polyvinylpyrrolidone Polymers 0.000 claims description 16
- 235000013855 polyvinylpyrrolidone Nutrition 0.000 claims description 16
- 239000001267 polyvinylpyrrolidone Substances 0.000 claims description 12
- 239000007787 solid Substances 0.000 claims description 11
- 239000003814 drug Substances 0.000 claims description 9
- 229940079593 drug Drugs 0.000 claims description 8
- 229920000609 methyl cellulose Polymers 0.000 claims description 8
- 239000001923 methylcellulose Substances 0.000 claims description 8
- 235000010981 methylcellulose Nutrition 0.000 claims description 8
- 229920002153 Hydroxypropyl cellulose Polymers 0.000 claims description 5
- 239000001863 hydroxypropyl cellulose Substances 0.000 claims description 5
- 239000001866 hydroxypropyl methyl cellulose Substances 0.000 claims description 5
- 235000010979 hydroxypropyl methyl cellulose Nutrition 0.000 claims description 5
- 229920003088 hydroxypropyl methyl cellulose Polymers 0.000 claims description 5
- UFVKGYZPFZQRLF-UHFFFAOYSA-N hydroxypropyl methyl cellulose Chemical compound OC1C(O)C(OC)OC(CO)C1OC1C(O)C(O)C(OC2C(C(O)C(OC3C(C(O)C(O)C(CO)O3)O)C(CO)O2)O)C(CO)O1 UFVKGYZPFZQRLF-UHFFFAOYSA-N 0.000 claims description 5
- 235000010977 hydroxypropyl cellulose Nutrition 0.000 claims description 4
- LNAZSHAWQACDHT-XIYTZBAFSA-N (2r,3r,4s,5r,6s)-4,5-dimethoxy-2-(methoxymethyl)-3-[(2s,3r,4s,5r,6r)-3,4,5-trimethoxy-6-(methoxymethyl)oxan-2-yl]oxy-6-[(2r,3r,4s,5r,6r)-4,5,6-trimethoxy-2-(methoxymethyl)oxan-3-yl]oxyoxane Chemical compound CO[C@@H]1[C@@H](OC)[C@H](OC)[C@@H](COC)O[C@H]1O[C@H]1[C@H](OC)[C@@H](OC)[C@H](O[C@H]2[C@@H]([C@@H](OC)[C@H](OC)O[C@@H]2COC)OC)O[C@@H]1COC LNAZSHAWQACDHT-XIYTZBAFSA-N 0.000 claims 1
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 51
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 43
- 239000000243 solution Substances 0.000 description 32
- 238000002360 preparation method Methods 0.000 description 25
- 239000002904 solvent Substances 0.000 description 22
- 229920000168 Microcrystalline cellulose Polymers 0.000 description 15
- 235000019813 microcrystalline cellulose Nutrition 0.000 description 15
- 239000008108 microcrystalline cellulose Substances 0.000 description 15
- 229940016286 microcrystalline cellulose Drugs 0.000 description 15
- 239000000047 product Substances 0.000 description 15
- MKJXYGKVIBWPFZ-UHFFFAOYSA-L calcium lactate Chemical compound [Ca+2].CC(O)C([O-])=O.CC(O)C([O-])=O MKJXYGKVIBWPFZ-UHFFFAOYSA-L 0.000 description 11
- 239000001527 calcium lactate Substances 0.000 description 11
- 229960002401 calcium lactate Drugs 0.000 description 11
- 235000011086 calcium lactate Nutrition 0.000 description 11
- 238000000034 method Methods 0.000 description 11
- 239000003960 organic solvent Substances 0.000 description 11
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 10
- 239000002775 capsule Substances 0.000 description 9
- 239000006185 dispersion Substances 0.000 description 9
- 239000012265 solid product Substances 0.000 description 9
- 229940068918 polyethylene glycol 400 Drugs 0.000 description 7
- 239000000843 powder Substances 0.000 description 7
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 6
- 238000010438 heat treatment Methods 0.000 description 6
- 235000010980 cellulose Nutrition 0.000 description 5
- 229920002678 cellulose Polymers 0.000 description 5
- 239000001913 cellulose Substances 0.000 description 5
- 238000001694 spray drying Methods 0.000 description 5
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 4
- 206010002383 Angina Pectoris Diseases 0.000 description 4
- 238000010521 absorption reaction Methods 0.000 description 4
- 230000000694 effects Effects 0.000 description 4
- -1 hydroxypropyl Chemical group 0.000 description 4
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 4
- 238000010298 pulverizing process Methods 0.000 description 4
- 239000007909 solid dosage form Substances 0.000 description 4
- 239000000126 substance Substances 0.000 description 4
- KDYFGRWQOYBRFD-UHFFFAOYSA-N succinic acid Chemical compound OC(=O)CCC(O)=O KDYFGRWQOYBRFD-UHFFFAOYSA-N 0.000 description 4
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 3
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 3
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- 229960001701 chloroform Drugs 0.000 description 3
- 238000001035 drying Methods 0.000 description 3
- 239000008101 lactose Substances 0.000 description 3
- 239000007788 liquid Substances 0.000 description 3
- 238000004519 manufacturing process Methods 0.000 description 3
- 239000000825 pharmaceutical preparation Substances 0.000 description 3
- 239000006187 pill Substances 0.000 description 3
- 238000012545 processing Methods 0.000 description 3
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 2
- 229920002134 Carboxymethyl cellulose Polymers 0.000 description 2
- 229920002261 Corn starch Polymers 0.000 description 2
- YZCKVEUIGOORGS-OUBTZVSYSA-N Deuterium Chemical compound [2H] YZCKVEUIGOORGS-OUBTZVSYSA-N 0.000 description 2
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 description 2
- DBMJMQXJHONAFJ-UHFFFAOYSA-M Sodium laurylsulphate Chemical compound [Na+].CCCCCCCCCCCCOS([O-])(=O)=O DBMJMQXJHONAFJ-UHFFFAOYSA-M 0.000 description 2
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 2
- YKTSYUJCYHOUJP-UHFFFAOYSA-N [O--].[Al+3].[Al+3].[O-][Si]([O-])([O-])[O-] Chemical compound [O--].[Al+3].[Al+3].[O-][Si]([O-])([O-])[O-] YKTSYUJCYHOUJP-UHFFFAOYSA-N 0.000 description 2
- 229940092980 adalat Drugs 0.000 description 2
- 239000008280 blood Substances 0.000 description 2
- 210000004369 blood Anatomy 0.000 description 2
- 229960005069 calcium Drugs 0.000 description 2
- 239000011575 calcium Substances 0.000 description 2
- 229910052791 calcium Inorganic materials 0.000 description 2
- 239000004202 carbamide Substances 0.000 description 2
- 239000001768 carboxy methyl cellulose Substances 0.000 description 2
- 235000010948 carboxy methyl cellulose Nutrition 0.000 description 2
- 239000008112 carboxymethyl-cellulose Substances 0.000 description 2
- 238000000975 co-precipitation Methods 0.000 description 2
- 239000003086 colorant Substances 0.000 description 2
- 239000008120 corn starch Substances 0.000 description 2
- 239000013078 crystal Substances 0.000 description 2
- 229910052805 deuterium Inorganic materials 0.000 description 2
- 239000003085 diluting agent Substances 0.000 description 2
- 238000001704 evaporation Methods 0.000 description 2
- 230000008020 evaporation Effects 0.000 description 2
- 238000002474 experimental method Methods 0.000 description 2
- 238000009477 fluid bed granulation Methods 0.000 description 2
- 235000003599 food sweetener Nutrition 0.000 description 2
- 238000004108 freeze drying Methods 0.000 description 2
- 238000011835 investigation Methods 0.000 description 2
- 150000002500 ions Chemical class 0.000 description 2
- 235000019359 magnesium stearate Nutrition 0.000 description 2
- 239000000463 material Substances 0.000 description 2
- 235000019333 sodium laurylsulphate Nutrition 0.000 description 2
- 239000008247 solid mixture Substances 0.000 description 2
- 239000001384 succinic acid Substances 0.000 description 2
- 239000003765 sweetening agent Substances 0.000 description 2
- 238000012360 testing method Methods 0.000 description 2
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 2
- YNGDWRXWKFWCJY-UHFFFAOYSA-N 1,4-Dihydropyridine Chemical group C1C=CNC=C1 YNGDWRXWKFWCJY-UHFFFAOYSA-N 0.000 description 1
- RWNNRGBCWXOVAC-UHFFFAOYSA-N 1,4-bis[bis(aziridin-1-yl)phosphoryl]piperazine Chemical compound C1CN1P(N1CCN(CC1)P(=O)(N1CC1)N1CC1)(=O)N1CC1 RWNNRGBCWXOVAC-UHFFFAOYSA-N 0.000 description 1
- 241000282472 Canis lupus familiaris Species 0.000 description 1
- 244000060011 Cocos nucifera Species 0.000 description 1
- 235000013162 Cocos nucifera Nutrition 0.000 description 1
- FBPFZTCFMRRESA-KVTDHHQDSA-N D-Mannitol Chemical compound OC[C@@H](O)[C@@H](O)[C@H](O)[C@H](O)CO FBPFZTCFMRRESA-KVTDHHQDSA-N 0.000 description 1
- 239000001856 Ethyl cellulose Substances 0.000 description 1
- ZZSNKZQZMQGXPY-UHFFFAOYSA-N Ethyl cellulose Chemical compound CCOCC1OC(OC)C(OCC)C(OCC)C1OC1C(O)C(O)C(OC)C(CO)O1 ZZSNKZQZMQGXPY-UHFFFAOYSA-N 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- 229930195725 Mannitol Natural products 0.000 description 1
- 101100421142 Mus musculus Selenon gene Proteins 0.000 description 1
- 229920003171 Poly (ethylene oxide) Polymers 0.000 description 1
- 229920002472 Starch Polymers 0.000 description 1
- 206010043417 Therapeutic response unexpected Diseases 0.000 description 1
- FUFJGUQYACFECW-UHFFFAOYSA-L calcium hydrogenphosphate Chemical compound [Ca+2].OP([O-])([O-])=O FUFJGUQYACFECW-UHFFFAOYSA-L 0.000 description 1
- 239000004359 castor oil Substances 0.000 description 1
- 235000019438 castor oil Nutrition 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 230000000052 comparative effect Effects 0.000 description 1
- 150000001875 compounds Chemical class 0.000 description 1
- 239000012141 concentrate Substances 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- 230000003247 decreasing effect Effects 0.000 description 1
- 238000011161 development Methods 0.000 description 1
- 235000019700 dicalcium phosphate Nutrition 0.000 description 1
- 235000019325 ethyl cellulose Nutrition 0.000 description 1
- 229920001249 ethyl cellulose Polymers 0.000 description 1
- 210000003608 fece Anatomy 0.000 description 1
- 238000011049 filling Methods 0.000 description 1
- 239000000796 flavoring agent Substances 0.000 description 1
- 235000019634 flavors Nutrition 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 239000007903 gelatin capsule Substances 0.000 description 1
- 235000011187 glycerol Nutrition 0.000 description 1
- ZEMPKEQAKRGZGQ-XOQCFJPHSA-N glycerol triricinoleate Natural products CCCCCC[C@@H](O)CC=CCCCCCCCC(=O)OC[C@@H](COC(=O)CCCCCCCC=CC[C@@H](O)CCCCCC)OC(=O)CCCCCCCC=CC[C@H](O)CCCCCC ZEMPKEQAKRGZGQ-XOQCFJPHSA-N 0.000 description 1
- 239000008187 granular material Substances 0.000 description 1
- 238000000227 grinding Methods 0.000 description 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 1
- 239000000594 mannitol Substances 0.000 description 1
- 235000010355 mannitol Nutrition 0.000 description 1
- 239000012044 organic layer Substances 0.000 description 1
- 239000012057 packaged powder Substances 0.000 description 1
- 230000036470 plasma concentration Effects 0.000 description 1
- 238000012805 post-processing Methods 0.000 description 1
- 238000001556 precipitation Methods 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 150000003222 pyridines Chemical class 0.000 description 1
- 239000008159 sesame oil Substances 0.000 description 1
- 235000011803 sesame oil Nutrition 0.000 description 1
- 239000000377 silicon dioxide Substances 0.000 description 1
- RYYKJJJTJZKILX-UHFFFAOYSA-M sodium octadecanoate Chemical compound [Na+].CCCCCCCCCCCCCCCCCC([O-])=O RYYKJJJTJZKILX-UHFFFAOYSA-M 0.000 description 1
- 239000006104 solid solution Substances 0.000 description 1
- 241000894007 species Species 0.000 description 1
- 239000007921 spray Substances 0.000 description 1
- 239000008107 starch Substances 0.000 description 1
- 235000019698 starch Nutrition 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 239000003826 tablet Substances 0.000 description 1
- 230000001225 therapeutic effect Effects 0.000 description 1
- 238000005303 weighing Methods 0.000 description 1
Classifications
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K47/00—Medicinal preparations characterised by the non-active ingredients used, e.g. carriers or inert additives; Targeting or modifying agents chemically bound to the active ingredient
- A61K47/30—Macromolecular organic or inorganic compounds, e.g. inorganic polyphosphates
- A61K47/36—Polysaccharides; Derivatives thereof, e.g. gums, starch, alginate, dextrin, hyaluronic acid, chitosan, inulin, agar or pectin
- A61K47/38—Cellulose; Derivatives thereof
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K31/00—Medicinal preparations containing organic active ingredients
- A61K31/33—Heterocyclic compounds
- A61K31/395—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins
- A61K31/435—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins having six-membered rings with one nitrogen as the only ring hetero atom
- A61K31/44—Non condensed pyridines; Hydrogenated derivatives thereof
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K47/00—Medicinal preparations characterised by the non-active ingredients used, e.g. carriers or inert additives; Targeting or modifying agents chemically bound to the active ingredient
- A61K47/30—Macromolecular organic or inorganic compounds, e.g. inorganic polyphosphates
- A61K47/32—Macromolecular compounds obtained by reactions only involving carbon-to-carbon unsaturated bonds, e.g. carbomers, poly(meth)acrylates, or polyvinyl pyrrolidone
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K9/00—Medicinal preparations characterised by special physical form
- A61K9/14—Particulate form, e.g. powders, Processes for size reducing of pure drugs or the resulting products, Pure drug nanoparticles
- A61K9/141—Intimate drug-carrier mixtures characterised by the carrier, e.g. ordered mixtures, adsorbates, solid solutions, eutectica, co-dried, co-solubilised, co-kneaded, co-milled, co-ground products, co-precipitates, co-evaporates, co-extrudates, co-melts; Drug nanoparticles with adsorbed surface modifiers
- A61K9/145—Intimate drug-carrier mixtures characterised by the carrier, e.g. ordered mixtures, adsorbates, solid solutions, eutectica, co-dried, co-solubilised, co-kneaded, co-milled, co-ground products, co-precipitates, co-evaporates, co-extrudates, co-melts; Drug nanoparticles with adsorbed surface modifiers with organic compounds
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K9/00—Medicinal preparations characterised by special physical form
- A61K9/14—Particulate form, e.g. powders, Processes for size reducing of pure drugs or the resulting products, Pure drug nanoparticles
- A61K9/141—Intimate drug-carrier mixtures characterised by the carrier, e.g. ordered mixtures, adsorbates, solid solutions, eutectica, co-dried, co-solubilised, co-kneaded, co-milled, co-ground products, co-precipitates, co-evaporates, co-extrudates, co-melts; Drug nanoparticles with adsorbed surface modifiers
- A61K9/146—Intimate drug-carrier mixtures characterised by the carrier, e.g. ordered mixtures, adsorbates, solid solutions, eutectica, co-dried, co-solubilised, co-kneaded, co-milled, co-ground products, co-precipitates, co-evaporates, co-extrudates, co-melts; Drug nanoparticles with adsorbed surface modifiers with organic macromolecular compounds
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K9/00—Medicinal preparations characterised by special physical form
- A61K9/20—Pills, tablets, discs, rods
- A61K9/2004—Excipients; Inactive ingredients
Landscapes
- Health & Medical Sciences (AREA)
- Chemical & Material Sciences (AREA)
- General Health & Medical Sciences (AREA)
- Public Health (AREA)
- Pharmacology & Pharmacy (AREA)
- Epidemiology (AREA)
- Life Sciences & Earth Sciences (AREA)
- Animal Behavior & Ethology (AREA)
- Veterinary Medicine (AREA)
- Medicinal Chemistry (AREA)
- Engineering & Computer Science (AREA)
- Bioinformatics & Cheminformatics (AREA)
- Inorganic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Medicinal Preparation (AREA)
- Hydrogenated Pyridines (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP6703977A JPS542316A (en) | 1977-06-07 | 1977-06-07 | Solid pharmaceutical composition containing nifedipene |
| JP8437277A JPS5420127A (en) | 1977-07-14 | 1977-07-14 | Solid nifedipine preparaton |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE2822882A1 DE2822882A1 (de) | 1978-12-21 |
| DE2822882C2 true DE2822882C2 (OSRAM) | 1987-06-25 |
Family
ID=26408243
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19782822882 Granted DE2822882A1 (de) | 1977-06-07 | 1978-05-26 | Nifedipine-enthaltende feste praeparatzusammensetzung, verfahren zu ihrer herstellung und ihre verwendung |
Country Status (5)
| Country | Link |
|---|---|
| US (1) | US4412986A (OSRAM) |
| DE (1) | DE2822882A1 (OSRAM) |
| GB (1) | GB1579818A (OSRAM) |
| HK (1) | HK40583A (OSRAM) |
| MY (1) | MY8400231A (OSRAM) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3829398A1 (de) * | 1988-08-30 | 1990-03-08 | Rentschler Arzneimittel | Fixe arzneimittelkombination mit verzoegerter freisetzung |
Families Citing this family (103)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2966564D1 (en) * | 1978-11-20 | 1984-02-23 | American Home Prod | Therapeutic compositions with enhanced bioavailability and process for their preparation |
| JPS55129221A (en) * | 1979-03-29 | 1980-10-06 | Kaken Pharmaceut Co Ltd | Preparation of oral preparation containing hardly soluble medicine |
| CA1146866A (en) * | 1979-07-05 | 1983-05-24 | Yamanouchi Pharmaceutical Co. Ltd. | Process for the production of sustained release pharmaceutical composition of solid medical material |
| JPS5948810B2 (ja) * | 1980-03-22 | 1984-11-29 | 山之内製薬株式会社 | ニカルジピン持続性製剤用組成物 |
| JPS5668609A (en) | 1979-11-07 | 1981-06-09 | Nippon Kayaku Co Ltd | Phthalazinol preparation |
| DE3033919A1 (de) * | 1980-09-09 | 1982-04-22 | Bayer Ag, 5090 Leverkusen | Feste arzneizubereitungen enthaltend nifedipin und verfahren zu ihrer herstellung |
| EP0070127A3 (en) * | 1981-07-10 | 1983-08-17 | Beecham Group Plc | Tablets |
| DE3142853A1 (de) * | 1981-10-29 | 1983-05-11 | Bayer Ag, 5090 Leverkusen | Feste arzneizubereitungen mit nifedipin und verfahren zu ihrer herstellung |
| EP0078430B2 (de) * | 1981-10-29 | 1993-02-10 | Bayer Ag | Verfahren zur Herstellung von festen, schnellfreisetzenden Arzneizubereitungen mit Dihydropyridinen |
| USRE33963E (en) * | 1981-10-29 | 1992-06-16 | Bayer Aktiengesellschaft | Solid rapidly released medicament preparations containing dihydropyridines, and processes for their preparation |
| DE3381877D1 (de) * | 1982-03-16 | 1990-10-18 | Univ Rockefeller | Verwendung von opium antagonisten zur herstellung von arzneimitteln zur behebung gastro-intestinaler stoerungen. |
| DE3212736A1 (de) * | 1982-04-06 | 1983-10-13 | Bayer Ag, 5090 Leverkusen | Verwendung von dihydropyridinen in arzneimitteln mit salidiuretischer wirkung |
| FR2525108B1 (fr) * | 1982-04-19 | 1989-05-12 | Elan Corp Ltd | Medicaments a haut degre de solubilite et procede pour leur obtention |
| JPS59101423A (ja) * | 1982-12-02 | 1984-06-12 | Takada Seiyaku Kk | 新規なニフエジピン固形製剤 |
| DE3318649A1 (de) * | 1983-05-21 | 1984-11-22 | Bayer Ag, 5090 Leverkusen | Zweiphasenformulierung |
| JPS6038322A (ja) * | 1983-08-11 | 1985-02-27 | Fujisawa Pharmaceut Co Ltd | ジヒドロピリジンa物質含有易溶性固形製剤 |
| DE3376198D1 (en) * | 1983-11-30 | 1988-05-11 | Siegfried Ag | Therapeutic coronary composition in the form of soft gelatine capsules |
| DE3582439D1 (de) * | 1984-01-28 | 1991-05-16 | Roshdy Ismail | Mittel zur behandlung von herzerkrankungen. |
| US5656620A (en) * | 1984-01-28 | 1997-08-12 | Ismail; Roshdy | Method for treating pain |
| US4740365A (en) * | 1984-04-09 | 1988-04-26 | Toyo Boseki Kabushiki Kaisha | Sustained-release preparation applicable to mucous membrane in oral cavity |
| DE3419131A1 (de) * | 1984-05-23 | 1985-11-28 | Bayer Ag, 5090 Leverkusen | Dihydropyridinkombinationspraeparate und verfahren zu ihrer herstellung |
| DE3419130A1 (de) * | 1984-05-23 | 1985-11-28 | Bayer Ag, 5090 Leverkusen | Nifedipinkombinationspraeparate und verfahren zu ihrer herstellung |
| DE3419129A1 (de) * | 1984-05-23 | 1985-11-28 | Bayer Ag, 5090 Leverkusen | Nifedipinpraeparate und verfahren zu ihrer herstellung |
| DE3419128A1 (de) * | 1984-05-23 | 1985-11-28 | Bayer Ag, 5090 Leverkusen | Dihydropyridinpraeparate und verfahren zu ihrer herstellung |
| HU198844B (en) * | 1984-06-14 | 1989-12-28 | Sandoz Ag | Process for producing new galenic pharmaceutical composition ensuring retarded release of active ingredient |
| US5266581A (en) * | 1984-07-04 | 1993-11-30 | Bayer Aktiengesellschaft | Solid composition containing dihydropyridine, PVP and PVPP |
| DE3424553A1 (de) * | 1984-07-04 | 1986-01-09 | Bayer Ag, 5090 Leverkusen | Feste arzneizubereitungen mit dihydropyridinen und verfahren zu ihrer herstellung |
| AU592065B2 (en) * | 1984-10-09 | 1990-01-04 | Dow Chemical Company, The | Sustained release dosage form based on highly plasticized cellulose ether gels |
| DE3438830A1 (de) * | 1984-10-23 | 1986-04-30 | Rentschler Arzneimittel | Nifedipin enthaltende darreichungsform und verfahren zu ihrer herstellung |
| US4867984A (en) * | 1984-11-06 | 1989-09-19 | Nagin K. Patel | Drug in bead form and process for preparing same |
| DE3515335C2 (de) * | 1985-04-27 | 1995-01-26 | Bayer Ag | Arzneizubereitung enthaltend Dihydropyridine und Verfahren zu ihrer Herstellung |
| IT1187751B (it) * | 1985-10-15 | 1987-12-23 | Eurand Spa | Procedimento per la preparazione di formulazioni solidi di nifedipina ad elevata biodisponibilita' e ad effetto prolungato e formulazioni cosi' ottenute |
| DE3544692A1 (de) * | 1985-12-18 | 1987-06-19 | Bayer Ag | Dihydropyridinspray, verfahren zu seiner herstellung und seine pharmazeutische verwendung |
| US4689233A (en) * | 1986-01-06 | 1987-08-25 | Siegfried Aktiengesellschaft | Coronary therapeutic agent in the form of soft gelatin capsules |
| US4940556A (en) * | 1986-01-30 | 1990-07-10 | Syntex (U.S.A.) Inc. | Method of preparing long acting formulation |
| US5198226A (en) * | 1986-01-30 | 1993-03-30 | Syntex (U.S.A.) Inc. | Long acting nicardipine hydrochloride formulation |
| IE63321B1 (en) * | 1986-02-03 | 1995-04-05 | Elan Corp Plc | Drug delivery system |
| WO1987005211A1 (fr) * | 1986-03-10 | 1987-09-11 | Kurt Burghart | Preparation pharmaceutique et son procede de production |
| GB8608080D0 (en) * | 1986-04-02 | 1986-05-08 | Fujisawa Pharmaceutical Co | Solid dispersion composition |
| DE3639073A1 (de) * | 1986-11-14 | 1988-05-26 | Klinge Co Chem Pharm Fab | Feste arzneizubereitungen und verfahren zu ihrer herstellung |
| ATE68704T1 (de) * | 1986-12-18 | 1991-11-15 | Bauer Kurt Heinz | Gegenueber lichteinfluss stabilisiertes nifedipin- konzentrat und verfahren zu seiner herstellung. |
| US5051272A (en) * | 1988-07-19 | 1991-09-24 | United States Surgical Corporation | Method for improving the storage stability of a polymeric article susceptible to hydrolytic degradation and resulting article |
| US5366081A (en) | 1987-08-26 | 1994-11-22 | United States Surgical Corporation | Packaged synthetic absorbable surgical elements |
| US5226912A (en) * | 1987-08-26 | 1993-07-13 | United States Surgical Corporation | Combined surgical needle-braided suture device |
| US5222978A (en) | 1987-08-26 | 1993-06-29 | United States Surgical Corporation | Packaged synthetic absorbable surgical elements |
| US5306289A (en) * | 1987-08-26 | 1994-04-26 | United States Surgical Corporation | Braided suture of improved characteristics |
| DE3877331T2 (de) * | 1987-11-11 | 1993-05-27 | Pharmascience Lab | Exifon und ein wasserloesliches polymer enthaltende pharmazeutische zubereitung. |
| GB8903328D0 (en) * | 1989-02-14 | 1989-04-05 | Ethical Pharma Ltd | Nifedipine-containing pharmaceutical compositions and process for the preparation thereof |
| US5359831A (en) | 1989-08-01 | 1994-11-01 | United States Surgical Corporation | Molded suture retainer |
| US5246104A (en) * | 1989-08-01 | 1993-09-21 | United States Surgical Corporation | Molded suture retainer |
| US5215756A (en) * | 1989-12-22 | 1993-06-01 | Gole Dilip J | Preparation of pharmaceutical and other matrix systems by solid-state dissolution |
| JP2845342B2 (ja) * | 1990-04-28 | 1999-01-13 | 大正製薬株式会社 | ビタミンd▲下3▼誘導体含有固形製剤組成物 |
| ES2093106T3 (es) * | 1990-07-19 | 1996-12-16 | Otsuka Pharma Co Ltd | Preparacion solida. |
| GB9025251D0 (en) * | 1990-11-20 | 1991-01-02 | Solomon Montague C | Nifedipine dosage forms |
| CA2056032A1 (en) * | 1990-11-29 | 1992-05-30 | Minoru Aoki | Hard capsule preparation |
| US5145859A (en) * | 1991-03-20 | 1992-09-08 | Case Western Reserve University | Methods of treating interstitial cystitis and urethral syndrome |
| GR910100193A (el) * | 1991-05-03 | 1993-03-31 | Mediventures Inc | Παρασκευη φαρμακευτικων και αλλων περιβληματων με διαλυση σε στερεα κατασταση. |
| JP3110794B2 (ja) * | 1991-06-05 | 2000-11-20 | ユーシービージャパン株式会社 | 1,4−ジヒドロピリジン誘導体を含有する製剤 |
| GB9200607D0 (en) * | 1992-01-13 | 1992-03-11 | Ethical Pharma Ltd | Pharmaceutical compositions containing nifedipine and process for the preparation thereof |
| US5876754A (en) * | 1992-01-17 | 1999-03-02 | Alfatec-Pharma Gmbh | Solid bodies containing active substances and a structure consisting of hydrophilic macromolecules, plus a method of producing such bodies |
| IL104192A (en) * | 1992-02-17 | 1998-01-04 | Siegfried Ag Pharma | Pharmaceutical dosage forms having prolonged release rate of zero order of the active ingredient |
| WO1994005262A1 (en) * | 1992-09-10 | 1994-03-17 | F.H. Faulding & Co. Limited | Sustained release matrix composition |
| DK0661045T3 (da) * | 1992-09-18 | 2002-10-28 | Yamanouchi Pharma Co Ltd | Hydrogelpræparat med forsinket frigivelse |
| US5603945A (en) * | 1993-02-19 | 1997-02-18 | Takeda Chemical Industries, Ltd. | Therapeutic/prophylactic agents and method of treating for urinary calculosis in pets |
| IS4198A (is) * | 1993-08-13 | 1995-02-14 | Somatogen, Inc | Meðferð vegna aukaverkana sem tengjast gjöf á utanfrumublóðrauða |
| US5455046A (en) * | 1993-09-09 | 1995-10-03 | Edward Mendell Co., Inc. | Sustained release heterodisperse hydrogel systems for insoluble drugs |
| US5773025A (en) * | 1993-09-09 | 1998-06-30 | Edward Mendell Co., Inc. | Sustained release heterodisperse hydrogel systems--amorphous drugs |
| US6726930B1 (en) | 1993-09-09 | 2004-04-27 | Penwest Pharmaceuticals Co. | Sustained release heterodisperse hydrogel systems for insoluble drugs |
| US5662933A (en) * | 1993-09-09 | 1997-09-02 | Edward Mendell Co., Inc. | Controlled release formulation (albuterol) |
| SI9300504A (en) * | 1993-09-28 | 1995-04-30 | Krka | Process for preparation solid dispersions and deposits of calcium antagonist dihidropyrimidine derivates and pharmaceutical compositions comprising the same |
| RU2138525C1 (ru) * | 1993-10-25 | 1999-09-27 | Байер Аг | Композиция с биологической активностью и водное средство защиты растений |
| ATE372966T1 (de) * | 1994-03-25 | 2007-09-15 | Isotechnika Inc | Verbesserung der effektivität von arzneimitteln duren deuterierung |
| US6334997B1 (en) | 1994-03-25 | 2002-01-01 | Isotechnika, Inc. | Method of using deuterated calcium channel blockers |
| FR2722984B1 (fr) * | 1994-07-26 | 1996-10-18 | Effik Lab | Procede de preparation de formes pharmaceutiques seches et les compositions pharmaceutiques ainsi realisees |
| US5543099A (en) * | 1994-09-29 | 1996-08-06 | Hallmark Pharmaceutical, Inc. | Process to manufacture micronized nifedipine granules for sustained release medicaments |
| WO1996011672A1 (en) * | 1994-10-13 | 1996-04-25 | Wakamoto Pharmaceutical Co., Ltd. | Lyophilized preparation providing reversibly thermogelling water-base medicinal composition |
| NZ270439A (en) * | 1995-02-02 | 1996-04-26 | Bernard Charles Sherman | Solid slow release pharmaceutical composition: carrier is polyethylene glycol and hydrophilic gel-forming polymer |
| US5900425A (en) * | 1995-05-02 | 1999-05-04 | Bayer Aktiengesellschaft | Pharmaceutical preparations having controlled release of active compound and processes for their preparation |
| SI9500173B (sl) * | 1995-05-19 | 2002-02-28 | Lek, | Trofazna farmacevtska oblika s konstantnim in kontroliranim sproščanjem amorfne učinkovine za enkrat dnevno aplikacijo |
| TW487582B (en) * | 1995-08-11 | 2002-05-21 | Nissan Chemical Ind Ltd | Method for converting sparingly water-soluble medical substance to amorphous state |
| DE19531684A1 (de) * | 1995-08-29 | 1997-03-06 | Bayer Ag | Verfahren zur Herstellung von Arzneimittelzubereitungen mit kontrollierter Freisetzung |
| NZ286451A (en) * | 1996-04-24 | 1998-04-27 | Bernard Charles Sherman | Controlled release pharmaceutical composition containing granules comprising drug, water-insoluble polymer and meltable carrier |
| IL123505A (en) * | 1996-07-08 | 2004-12-15 | Penwest Pharmaceuticals Compan | Sustained release matrix for high-dose insoluble drugs |
| US5891469A (en) * | 1997-04-02 | 1999-04-06 | Pharmos Corporation | Solid Coprecipitates for enhanced bioavailability of lipophilic substances |
| JP2001523221A (ja) * | 1996-09-01 | 2001-11-20 | ファーモス コーポレイション | 親油性物質の促進された生物学的利用能のための固形共沈物 |
| FR2758459B1 (fr) * | 1997-01-17 | 1999-05-07 | Pharma Pass | Composition pharmaceutique de fenofibrate presentant une biodisponibilite elevee et son procede de preparation |
| US5922352A (en) * | 1997-01-31 | 1999-07-13 | Andrx Pharmaceuticals, Inc. | Once daily calcium channel blocker tablet having a delayed release core |
| US5837379A (en) * | 1997-01-31 | 1998-11-17 | Andrx Pharmaceuticals, Inc. | Once daily pharmaceutical tablet having a unitary core |
| IN186245B (OSRAM) | 1997-09-19 | 2001-07-14 | Ranbaxy Lab Ltd | |
| US6056977A (en) | 1997-10-15 | 2000-05-02 | Edward Mendell Co., Inc. | Once-a-day controlled release sulfonylurea formulation |
| US6485748B1 (en) | 1997-12-12 | 2002-11-26 | Andrx Pharmaceuticals, Inc. | Once daily pharmaceutical tablet having a unitary core |
| US7863331B2 (en) | 1999-07-09 | 2011-01-04 | Ethypharm | Pharmaceutical composition containing fenofibrate and method for the preparation thereof |
| FR2795961B1 (fr) * | 1999-07-09 | 2004-05-28 | Ethypharm Lab Prod Ethiques | Composition pharmaceutique contenant du fenofibrate micronise, un tensioactif et un derive cellulosique liant et procede de preparation |
| ATE391495T1 (de) * | 1999-09-30 | 2008-04-15 | Penwest Pharmaceuticals Co | Matrixsystem mit verzögerter freisetzung für hochlösliche wirkstoffe |
| US20020132839A1 (en) * | 2000-06-22 | 2002-09-19 | Ganter Sabina Maria | Tablet formulations comprising valsartan |
| US6531158B1 (en) | 2000-08-09 | 2003-03-11 | Impax Laboratories, Inc. | Drug delivery system for enhanced bioavailability of hydrophobic active ingredients |
| JP3386052B2 (ja) * | 2001-02-13 | 2003-03-10 | トヨタ自動車株式会社 | ポンプ装置 |
| DE10135494A1 (de) * | 2001-07-20 | 2003-11-06 | Jobst Krauskopf | Verwendung eines Lactatsalzes zur Behandlung und Prophylaxe der Athereosklerose |
| US7039078B2 (en) * | 2002-09-17 | 2006-05-02 | Nippon Telegraph And Telephone Corporation | Semiconductor optical modulator and laser with optical modulator |
| US20040247689A1 (en) * | 2003-03-26 | 2004-12-09 | Guy Samburski | Process for preparing a pharmaceutical active ingredient with high specific surface area |
| AU2005297923B2 (en) * | 2004-10-25 | 2010-12-23 | Japan Tobacco Inc. | Solid medicinal preparation improved in solubility and stability and process for producing the same |
| WO2007108463A1 (ja) * | 2006-03-23 | 2007-09-27 | Shionogi & Co., Ltd. | 溶解性が改善された固形製剤 |
| WO2019241519A1 (en) | 2018-06-14 | 2019-12-19 | Astrazeneca Uk Limited | Methods for lowering blood pressure with a dihydropyridine-type calcium channel blocker pharmaceutical composition |
Family Cites Families (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3862161A (en) * | 1970-01-24 | 1975-01-21 | Bayer Ag | 4-pyridyl substituted 1,4-dihydropyridines |
| DE2117571C3 (de) * | 1971-04-10 | 1979-10-11 | Bayer Ag, 5090 Leverkusen | Unsymmetrische 1,4-Dihydropyridin-33-dicarbonsäureester, Verfahren zu ihrer Herstellung sowie ihre Verwendung als Arzneimittel |
| US3932645A (en) * | 1971-04-10 | 1976-01-13 | Farbenfabriken Bayer Ag | Pharmaceutical compositions containing unsymmetrical esters of 1,4-dihydropyridine 3,5-dicarboxylic acid |
| SU432703A3 (OSRAM) * | 1971-08-24 | 1974-06-15 | Фридрих Боссерт, Вульф Фатер, Курт Бауер | |
| US3920823A (en) * | 1972-03-06 | 1975-11-18 | Bayer Ag | Use of unsymmetrical esters of n-substituted 1,4-dihydropyridine 3,5-dicarboxylic acid as cardio-vascular agents |
| US3959296A (en) * | 1972-06-10 | 1976-05-25 | Bayer Aktiengesellschaft | 1,4-Dihydropyridines |
| US3943140A (en) * | 1972-09-30 | 1976-03-09 | Bayer Aktiengesellschaft | 2,3,5,6-Tetracarboxy-1,4-dihydropyridine derivatives |
| US3971796A (en) * | 1973-07-12 | 1976-07-27 | Bayer Aktiengesellschaft | 1,4-Dihydropyridine esters |
| DE2400819C2 (de) | 1974-01-09 | 1982-04-22 | Bayer Ag, 5090 Leverkusen | Verfahren zur Herstellung fester Zubereitungen von schwerlöslichen Arzneimittelwirkstoffen in feinster Verteilung |
-
1978
- 1978-05-18 GB GB20503/78A patent/GB1579818A/en not_active Expired
- 1978-05-26 DE DE19782822882 patent/DE2822882A1/de active Granted
-
1981
- 1981-04-16 US US06/254,882 patent/US4412986A/en not_active Expired - Lifetime
-
1983
- 1983-10-13 HK HK405/83A patent/HK40583A/xx not_active IP Right Cessation
-
1984
- 1984-12-30 MY MY231/84A patent/MY8400231A/xx unknown
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3829398A1 (de) * | 1988-08-30 | 1990-03-08 | Rentschler Arzneimittel | Fixe arzneimittelkombination mit verzoegerter freisetzung |
Also Published As
| Publication number | Publication date |
|---|---|
| DE2822882A1 (de) | 1978-12-21 |
| US4412986A (en) | 1983-11-01 |
| HK40583A (en) | 1983-10-21 |
| GB1579818A (en) | 1980-11-26 |
| MY8400231A (en) | 1984-12-31 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2822882C2 (OSRAM) | ||
| EP0078430B1 (de) | Verfahren zur Herstellung von festen, schnellfreisetzenden Arzneizubereitungen mit Dihydropyridinen | |
| DE60108154T2 (de) | Pharmazeutische Zubereitungen enthaltend Clavulansäure | |
| DE69222950T2 (de) | Darmlösliche oral verabreichbare arzneimittel welche säurelabile verbindungen enthalten | |
| DE3786316T2 (de) | Überzugsmembran und damit hergestellte Mittel. | |
| DE3420283A1 (de) | Nifedipin-trockenpraeparate und verfahren zu ihrer herstellung | |
| DE3877331T2 (de) | Exifon und ein wasserloesliches polymer enthaltende pharmazeutische zubereitung. | |
| AT413795B (de) | Stabilisierte orale pharmazeutische zusammensetzung, die jodid und jodat enthält und verfahren zu deren herstellung | |
| CH658190A5 (de) | Zweiphasige feste arzneizubereitung. | |
| DE2224534B2 (de) | Pharmazeutisches praeparat mit langsamer wirkstoffabgabe | |
| CH647675A5 (de) | Verfahren zur herstellung von pharmazeutisch aktive verbindungen enthaltenden mikrokapseln. | |
| DE60025503T2 (de) | Pharmazeutische Zusammensetzungen, die Faropenem-Natrium und eine Diaminoacetat Verbindung zur Verbesserung der Magen-Darm-Trakt Absorption enthalten | |
| DE2218147C2 (de) | Pharmazeutische Zubereitung | |
| DE2951077C2 (OSRAM) | ||
| CH654004A5 (de) | Kristallmodifikationen des monohydrats und der wasserfreien form von (+)-catechin, verfahren zu deren herstellung und die sie enthaltenden pharmazeutischen zusammensetzungen. | |
| DE3424553A1 (de) | Feste arzneizubereitungen mit dihydropyridinen und verfahren zu ihrer herstellung | |
| DE3100191A1 (de) | Pharmazeutische zubereitung und verfahren zu ihrer herstellung | |
| DE3212736A1 (de) | Verwendung von dihydropyridinen in arzneimitteln mit salidiuretischer wirkung | |
| DE19740983A1 (de) | Verfahren zur Erschwerung der Extraktion von Wirkstoffen aus Tabletten | |
| DE2515001A1 (de) | Prostaglandin enthaltende gefriergetrocknete pulver | |
| DE3142853C2 (OSRAM) | ||
| EP0164588A2 (de) | Dihydropyridinpräparate und Verfahren zu ihrer Herstellung | |
| EP0931087A1 (de) | Neue pyranosidderivate | |
| DE69609314T2 (de) | Amorph piretanide, polymorphe davon, verfahren zur dessen herstellung und ihre verwendung | |
| DE3530780C2 (de) | Neue pharmazeutische Verwendung von 5-(3-n-Butyloxalylaminophenyl)-tetrazol |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| OD | Request for examination | ||
| 8127 | New person/name/address of the applicant |
Owner name: BAYER AG, 5090 LEVERKUSEN, DE |
|
| D2 | Grant after examination | ||
| 8363 | Opposition against the patent | ||
| 8331 | Complete revocation |