DE2813326A1 - Verfahren zur herstellung von granulatfoermigem natriumperborat-monohydrat und das dabei erhaltene produkt - Google Patents
Verfahren zur herstellung von granulatfoermigem natriumperborat-monohydrat und das dabei erhaltene produktInfo
- Publication number
- DE2813326A1 DE2813326A1 DE19782813326 DE2813326A DE2813326A1 DE 2813326 A1 DE2813326 A1 DE 2813326A1 DE 19782813326 DE19782813326 DE 19782813326 DE 2813326 A DE2813326 A DE 2813326A DE 2813326 A1 DE2813326 A1 DE 2813326A1
- Authority
- DE
- Germany
- Prior art keywords
- surfactant
- granules
- sodium perborate
- perborate monohydrate
- dipl
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Ceased
Links
- 238000000034 method Methods 0.000 title claims description 15
- XSVSPKKXQGNHMD-UHFFFAOYSA-N 5-bromo-3-methyl-1,2-thiazole Chemical compound CC=1C=C(Br)SN=1 XSVSPKKXQGNHMD-UHFFFAOYSA-N 0.000 title claims description 9
- 238000004519 manufacturing process Methods 0.000 title claims description 4
- 239000004094 surface-active agent Substances 0.000 claims description 24
- 239000008187 granular material Substances 0.000 claims description 13
- 239000007864 aqueous solution Substances 0.000 claims description 12
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 claims description 10
- 239000002736 nonionic surfactant Substances 0.000 claims description 9
- NVIFVTYDZMXWGX-UHFFFAOYSA-N sodium metaborate Chemical compound [Na+].[O-]B=O NVIFVTYDZMXWGX-UHFFFAOYSA-N 0.000 claims description 7
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 5
- 125000000129 anionic group Chemical group 0.000 claims description 4
- 239000003945 anionic surfactant Substances 0.000 claims description 4
- 238000005299 abrasion Methods 0.000 claims description 3
- 125000002091 cationic group Chemical group 0.000 claims description 3
- 239000003093 cationic surfactant Substances 0.000 claims description 3
- 239000007789 gas Substances 0.000 claims description 3
- 229910052708 sodium Inorganic materials 0.000 claims description 3
- 239000011734 sodium Substances 0.000 claims description 3
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 claims description 2
- 239000002280 amphoteric surfactant Substances 0.000 claims description 2
- 239000002563 ionic surfactant Substances 0.000 claims description 2
- 244000052616 bacterial pathogen Species 0.000 claims 1
- 230000008020 evaporation Effects 0.000 claims 1
- 238000001704 evaporation Methods 0.000 claims 1
- -1 polyol ethers Chemical class 0.000 description 8
- 150000001412 amines Chemical class 0.000 description 5
- 235000014113 dietary fatty acids Nutrition 0.000 description 5
- 229930195729 fatty acid Natural products 0.000 description 5
- 239000000194 fatty acid Substances 0.000 description 5
- 239000000243 solution Substances 0.000 description 5
- 239000007859 condensation product Substances 0.000 description 4
- 238000004090 dissolution Methods 0.000 description 4
- 150000004665 fatty acids Chemical class 0.000 description 4
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 description 3
- 239000002253 acid Substances 0.000 description 3
- 125000004432 carbon atom Chemical group C* 0.000 description 3
- 239000000047 product Substances 0.000 description 3
- 150000003871 sulfonates Chemical class 0.000 description 3
- 150000007513 acids Chemical class 0.000 description 2
- 150000001298 alcohols Chemical class 0.000 description 2
- 125000000217 alkyl group Chemical group 0.000 description 2
- 150000002148 esters Chemical class 0.000 description 2
- 125000001033 ether group Chemical group 0.000 description 2
- 239000000203 mixture Substances 0.000 description 2
- 229960001922 sodium perborate Drugs 0.000 description 2
- YKLJGMBLPUQQOI-UHFFFAOYSA-M sodium;oxidooxy(oxo)borane Chemical compound [Na+].[O-]OB=O YKLJGMBLPUQQOI-UHFFFAOYSA-M 0.000 description 2
- CTKINSOISVBQLD-UHFFFAOYSA-N Glycidol Chemical compound OCC1CO1 CTKINSOISVBQLD-UHFFFAOYSA-N 0.000 description 1
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 1
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 description 1
- 239000002202 Polyethylene glycol Substances 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- GOOHAUXETOMSMM-UHFFFAOYSA-N Propylene oxide Chemical compound CC1CO1 GOOHAUXETOMSMM-UHFFFAOYSA-N 0.000 description 1
- GSEJCLTVZPLZKY-UHFFFAOYSA-N Triethanolamine Chemical compound OCCN(CCO)CCO GSEJCLTVZPLZKY-UHFFFAOYSA-N 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 150000008051 alkyl sulfates Chemical class 0.000 description 1
- 229940045714 alkyl sulfonate alkylating agent Drugs 0.000 description 1
- 150000008052 alkyl sulfonates Chemical class 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 150000003863 ammonium salts Chemical class 0.000 description 1
- 150000004982 aromatic amines Chemical class 0.000 description 1
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- YRIUSKIDOIARQF-UHFFFAOYSA-N dodecyl benzenesulfonate Chemical compound CCCCCCCCCCCCOS(=O)(=O)C1=CC=CC=C1 YRIUSKIDOIARQF-UHFFFAOYSA-N 0.000 description 1
- 229940071161 dodecylbenzenesulfonate Drugs 0.000 description 1
- 239000012530 fluid Substances 0.000 description 1
- RNYJXPUAFDFIQJ-UHFFFAOYSA-N hydron;octadecan-1-amine;chloride Chemical compound [Cl-].CCCCCCCCCCCCCCCCCC[NH3+] RNYJXPUAFDFIQJ-UHFFFAOYSA-N 0.000 description 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 150000004682 monohydrates Chemical class 0.000 description 1
- NHLUVTZJQOJKCC-UHFFFAOYSA-N n,n-dimethylhexadecan-1-amine Chemical compound CCCCCCCCCCCCCCCCN(C)C NHLUVTZJQOJKCC-UHFFFAOYSA-N 0.000 description 1
- 150000007530 organic bases Chemical class 0.000 description 1
- MPQXHAGKBWFSNV-UHFFFAOYSA-N oxidophosphanium Chemical group [PH3]=O MPQXHAGKBWFSNV-UHFFFAOYSA-N 0.000 description 1
- 229910052698 phosphorus Inorganic materials 0.000 description 1
- 239000011574 phosphorus Substances 0.000 description 1
- 229920001223 polyethylene glycol Polymers 0.000 description 1
- 229920005862 polyol Polymers 0.000 description 1
- 229920001451 polypropylene glycol Polymers 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 239000000344 soap Substances 0.000 description 1
- 150000003385 sodium Chemical class 0.000 description 1
- NASFKTWZWDYFER-UHFFFAOYSA-N sodium;hydrate Chemical compound O.[Na] NASFKTWZWDYFER-UHFFFAOYSA-N 0.000 description 1
- 210000000278 spinal cord Anatomy 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- 125000000020 sulfo group Chemical group O=S(=O)([*])O[H] 0.000 description 1
- BDHFUVZGWQCTTF-UHFFFAOYSA-M sulfonate Chemical compound [O-]S(=O)=O BDHFUVZGWQCTTF-UHFFFAOYSA-M 0.000 description 1
- 150000003460 sulfonic acids Chemical class 0.000 description 1
- 125000003375 sulfoxide group Chemical group 0.000 description 1
- 150000003462 sulfoxides Chemical class 0.000 description 1
- 150000003467 sulfuric acid derivatives Chemical class 0.000 description 1
Classifications
-
- B—PERFORMING OPERATIONS; TRANSPORTING
- B01—PHYSICAL OR CHEMICAL PROCESSES OR APPARATUS IN GENERAL
- B01J—CHEMICAL OR PHYSICAL PROCESSES, e.g. CATALYSIS OR COLLOID CHEMISTRY; THEIR RELEVANT APPARATUS
- B01J2/00—Processes or devices for granulating materials, e.g. fertilisers in general; Rendering particulate materials free flowing in general, e.g. making them hydrophobic
- B01J2/16—Processes or devices for granulating materials, e.g. fertilisers in general; Rendering particulate materials free flowing in general, e.g. making them hydrophobic by suspending the powder material in a gas, e.g. in fluidised beds or as a falling curtain
-
- C—CHEMISTRY; METALLURGY
- C01—INORGANIC CHEMISTRY
- C01B—NON-METALLIC ELEMENTS; COMPOUNDS THEREOF; METALLOIDS OR COMPOUNDS THEREOF NOT COVERED BY SUBCLASS C01C
- C01B15/00—Peroxides; Peroxyhydrates; Peroxyacids or salts thereof; Superoxides; Ozonides
- C01B15/055—Peroxyhydrates; Peroxyacids or salts thereof
- C01B15/12—Peroxyhydrates; Peroxyacids or salts thereof containing boron
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Inorganic Chemistry (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Detergent Compositions (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| LU77094A LU77094A1 (en:Method) | 1977-04-08 | 1977-04-08 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE2813326A1 true DE2813326A1 (de) | 1978-10-19 |
Family
ID=19728519
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19782813326 Ceased DE2813326A1 (de) | 1977-04-08 | 1978-03-28 | Verfahren zur herstellung von granulatfoermigem natriumperborat-monohydrat und das dabei erhaltene produkt |
Country Status (14)
| Country | Link |
|---|---|
| US (1) | US4215097A (en:Method) |
| JP (1) | JPS53149898A (en:Method) |
| AT (1) | AT371079B (en:Method) |
| BE (1) | BE865652A (en:Method) |
| DE (1) | DE2813326A1 (en:Method) |
| ES (1) | ES468641A2 (en:Method) |
| FR (1) | FR2386477A2 (en:Method) |
| GB (1) | GB1600107A (en:Method) |
| IT (1) | IT1113124B (en:Method) |
| LU (1) | LU77094A1 (en:Method) |
| NL (1) | NL7803598A (en:Method) |
| PT (1) | PT67859B (en:Method) |
| SE (1) | SE437653B (en:Method) |
| TR (1) | TR19965A (en:Method) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US5653950A (en) * | 1995-05-10 | 1997-08-05 | Degussa Aktiengesellschaft | Process for producing abrasion-resistant sodium perborate monohydrate with high bulk density and high rate of solution |
Families Citing this family (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR2455564A1 (fr) * | 1979-05-03 | 1980-11-28 | Air Liquide | Procede de fabrication de perborate de sodium |
| FR2459203A1 (fr) * | 1979-06-21 | 1981-01-09 | Interox | Particules de composes peroxygenes stabilises, procede pour leur fabrication et composition en contenant |
| GB8333875D0 (en) * | 1983-12-20 | 1984-02-01 | Partington E C | Dual stage combustion system |
| DE3505158A1 (de) * | 1985-02-15 | 1986-08-21 | Peroxid-Chemie GmbH, 8023 Höllriegelskreuth | Superoxidiertes natriumperborat |
| IT1187668B (it) * | 1985-05-16 | 1987-12-23 | Montefluos Spa | Procedimento per ottenere perborato di sodio moncidrato granulare dotato di una buona resistenza meccanica |
| DE3804509A1 (de) * | 1988-02-13 | 1989-08-24 | Degussa | Kontinuierliches verfahren zur herstellung von natriumperborat-granulaten |
| DE3941851C1 (en:Method) * | 1989-12-19 | 1991-06-20 | Degussa Ag, 6000 Frankfurt, De | |
| GB9706083D0 (en) * | 1997-03-24 | 1997-05-14 | Unilever Plc | Detergent compositions |
Citations (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE901287C (de) * | 1949-04-29 | 1954-01-11 | Borax Cons Ltd | Verfahren zur Herstellung von Peroxyd enthaltenden Boraten |
| DE1138381B (de) * | 1959-12-07 | 1962-10-25 | Solvay | Verfahren zur Herstellung von Natriumperborat |
| US3109706A (en) * | 1958-04-28 | 1963-11-05 | Solvay | Method for producing sodium perborate |
| US3194768A (en) * | 1960-07-07 | 1965-07-13 | Henkel & Cie Gmbh | Production of storage stable active oxygen containing liquid concentrates |
| DE2201581A1 (de) * | 1971-01-13 | 1972-07-27 | Pechiney Ugine Kuhlmann | Natriumperborat |
| DE2421924A1 (de) * | 1973-05-08 | 1975-01-09 | Ugine Kuhlmann | Natriumperborat |
Family Cites Families (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB944121A (en) * | 1959-08-18 | 1963-12-11 | Laporte Chemical | Improvements in or relating to the production of sodium perborate |
| GB1211228A (en) * | 1967-06-24 | 1970-11-04 | Ici Ltd | Sodium perborate compositions |
| DE2258319C3 (de) * | 1972-11-29 | 1978-04-13 | Peroxid-Chemie Gmbh, 8023 Hoellriegelskreuth | Verfahren zur Herstellung von abriebfestem Natriumperboratmonohydrat |
| JPS5122700A (en) * | 1974-08-20 | 1976-02-23 | Kao Corp | Kohyokatansansooda mataha kahosansoodano seizoho |
| LU73751A1 (en:Method) * | 1975-11-06 | 1977-06-03 |
-
1977
- 1977-04-08 LU LU77094A patent/LU77094A1/xx unknown
-
1978
- 1978-03-24 JP JP3316778A patent/JPS53149898A/ja active Granted
- 1978-03-28 DE DE19782813326 patent/DE2813326A1/de not_active Ceased
- 1978-03-31 PT PT67859A patent/PT67859B/pt unknown
- 1978-04-04 BE BE1008809A patent/BE865652A/xx not_active IP Right Cessation
- 1978-04-04 NL NL7803598A patent/NL7803598A/xx not_active Application Discontinuation
- 1978-04-05 FR FR7810363A patent/FR2386477A2/fr active Granted
- 1978-04-05 TR TR19965A patent/TR19965A/xx unknown
- 1978-04-06 SE SE7803902A patent/SE437653B/sv not_active IP Right Cessation
- 1978-04-07 AT AT0247478A patent/AT371079B/de active
- 1978-04-07 IT IT22095/78A patent/IT1113124B/it active
- 1978-04-07 GB GB13703/78A patent/GB1600107A/en not_active Expired
- 1978-04-07 ES ES468641A patent/ES468641A2/es not_active Expired
- 1978-04-10 US US05/895,273 patent/US4215097A/en not_active Expired - Lifetime
Patent Citations (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE901287C (de) * | 1949-04-29 | 1954-01-11 | Borax Cons Ltd | Verfahren zur Herstellung von Peroxyd enthaltenden Boraten |
| US3109706A (en) * | 1958-04-28 | 1963-11-05 | Solvay | Method for producing sodium perborate |
| DE1138381B (de) * | 1959-12-07 | 1962-10-25 | Solvay | Verfahren zur Herstellung von Natriumperborat |
| US3194768A (en) * | 1960-07-07 | 1965-07-13 | Henkel & Cie Gmbh | Production of storage stable active oxygen containing liquid concentrates |
| DE2201581A1 (de) * | 1971-01-13 | 1972-07-27 | Pechiney Ugine Kuhlmann | Natriumperborat |
| DE2421924A1 (de) * | 1973-05-08 | 1975-01-09 | Ugine Kuhlmann | Natriumperborat |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US5653950A (en) * | 1995-05-10 | 1997-08-05 | Degussa Aktiengesellschaft | Process for producing abrasion-resistant sodium perborate monohydrate with high bulk density and high rate of solution |
Also Published As
| Publication number | Publication date |
|---|---|
| US4215097A (en) | 1980-07-29 |
| TR19965A (tr) | 1980-06-02 |
| FR2386477B2 (en:Method) | 1982-04-16 |
| PT67859A (fr) | 1978-04-01 |
| SE7803902L (sv) | 1978-10-09 |
| GB1600107A (en) | 1981-10-14 |
| FR2386477A2 (fr) | 1978-11-03 |
| AT371079B (de) | 1983-05-25 |
| BE865652A (fr) | 1978-10-04 |
| SE437653B (sv) | 1985-03-11 |
| ES468641A2 (es) | 1978-12-01 |
| PT67859B (fr) | 1979-09-28 |
| JPS6112842B2 (en:Method) | 1986-04-10 |
| ATA247478A (de) | 1982-10-15 |
| IT1113124B (it) | 1986-01-20 |
| LU77094A1 (en:Method) | 1978-11-03 |
| IT7822095A0 (it) | 1978-04-07 |
| NL7803598A (nl) | 1978-10-10 |
| JPS53149898A (en) | 1978-12-27 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2941584C2 (en:Method) | ||
| EP0570398B1 (de) | Fliessfähiges perlglanzkonzentrat | |
| EP0376083B1 (de) | Fliessfähiges Perlglanzkonzentrat | |
| DE2609039C3 (de) | Verfahren zum Herstellen von beständigem Natriumpercarbonat | |
| EP2902010B1 (de) | Wäßrige tensid-Zusammensetzungen | |
| DE19921187C2 (de) | Verfahren zur kalten Herstellung von perlglänzenden Tensidzubereitungen | |
| EP0613457B1 (de) | Ester von fettsäuren mit ethoxylierten polyolen | |
| DE69220535T2 (de) | Oberflächenaktive, von Sulfobernsteinsäureestern abgeleitete Verbindungen | |
| EP2354122A1 (de) | Sulfosuccinate | |
| DE2813326A1 (de) | Verfahren zur herstellung von granulatfoermigem natriumperborat-monohydrat und das dabei erhaltene produkt | |
| EP0164058A2 (de) | Fliessfähige Perlglanzdispersion mit niedrigem Tensidanteil | |
| EP0303187A2 (de) | Wässrige Zubereitungen ionischer Tenside mit erhöhter Viskosität | |
| DE1617169B2 (de) | Reinigungsmittel | |
| DE3910974A1 (de) | Fluessigwaschmittel | |
| DE4433070C1 (de) | Milde Detergensgemische | |
| DE1792163A1 (de) | Detergenzzusammensetzungen | |
| DE2817626C2 (en:Method) | ||
| DE1959651A1 (de) | Verfahren zur Herstellung neuer Oligopeptidderivate | |
| EP3246010A1 (de) | Wässrige tensid-zusammensetzungen | |
| DE1216471B (de) | Waschmittel in fester oder fluessiger Form | |
| DE752692C (de) | Verfahren zur Herstellung von Eiweissabbauprodukten | |
| DE19519405A1 (de) | Wäßrige Reinigungsmittelzusammensetzung | |
| AT221278B (de) | Verfahren zur Herstellung von oberflächenaktiven Mitteln auf Basis von Derivaten von Polyalkylenglykolen | |
| DE861250C (de) | Verfahren zur Herstellung von Kondensationsprodukten aus Eiweiss-stoffen und Monocarbonsaeuren bzw. deren funktionellen Derivaten | |
| DE2442571C3 (de) | Flüssige Detergenszubereitung |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8110 | Request for examination paragraph 44 | ||
| AF | Is addition to no. |
Ref country code: DE Ref document number: 2650225 Format of ref document f/p: P |
|
| 8176 | Proceedings suspended because of application no: |
Ref document number: 2650225 Country of ref document: DE Format of ref document f/p: P |
|
| 8178 | Suspension cancelled | ||
| 8131 | Rejection |