DE2759217C3 - Mischungen von optischen Aufhellern - Google Patents
Mischungen von optischen AufhellernInfo
- Publication number
- DE2759217C3 DE2759217C3 DE2759217A DE2759217A DE2759217C3 DE 2759217 C3 DE2759217 C3 DE 2759217C3 DE 2759217 A DE2759217 A DE 2759217A DE 2759217 A DE2759217 A DE 2759217A DE 2759217 C3 DE2759217 C3 DE 2759217C3
- Authority
- DE
- Germany
- Prior art keywords
- group
- formula
- alkyl
- compound
- hydrogen
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 239000000203 mixture Substances 0.000 title claims description 23
- 230000003287 optical effect Effects 0.000 title claims description 14
- 150000001875 compounds Chemical class 0.000 claims description 32
- 125000000217 alkyl group Chemical group 0.000 claims description 19
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 13
- 229910052739 hydrogen Inorganic materials 0.000 claims description 12
- 239000001257 hydrogen Substances 0.000 claims description 12
- 125000001309 chloro group Chemical group Cl* 0.000 claims description 10
- -1 alkylene radicals Chemical class 0.000 claims description 9
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical class [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 8
- YNAVUWVOSKDBBP-UHFFFAOYSA-N Morpholine Chemical compound C1COCCN1 YNAVUWVOSKDBBP-UHFFFAOYSA-N 0.000 claims description 8
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 claims description 8
- 239000000463 material Substances 0.000 claims description 8
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 8
- 125000003545 alkoxy group Chemical group 0.000 claims description 7
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 7
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 6
- 125000004432 carbon atom Chemical group C* 0.000 claims description 5
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 5
- 229920000728 polyester Polymers 0.000 claims description 5
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 claims description 4
- 125000004965 chloroalkyl group Chemical group 0.000 claims description 4
- 239000004744 fabric Substances 0.000 claims description 4
- 229910052731 fluorine Inorganic materials 0.000 claims description 4
- 239000011737 fluorine Substances 0.000 claims description 4
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 claims description 4
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 claims description 4
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 claims description 4
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 claims description 4
- 125000004430 oxygen atom Chemical group O* 0.000 claims description 4
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 claims description 4
- 125000004193 piperazinyl group Chemical group 0.000 claims description 4
- 125000005037 alkyl phenyl group Chemical group 0.000 claims description 3
- 125000003118 aryl group Chemical group 0.000 claims description 3
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 3
- 229910052801 chlorine Inorganic materials 0.000 claims description 3
- 125000001188 haloalkyl group Chemical group 0.000 claims description 3
- 125000005843 halogen group Chemical group 0.000 claims description 3
- 125000002768 hydroxyalkyl group Chemical group 0.000 claims description 3
- 229910052760 oxygen Inorganic materials 0.000 claims description 3
- 229910052717 sulfur Chemical group 0.000 claims description 3
- 239000004753 textile Substances 0.000 claims description 3
- 239000004952 Polyamide Substances 0.000 claims description 2
- SMEGJBVQLJJKKX-HOTMZDKISA-N [(2R,3S,4S,5R,6R)-5-acetyloxy-3,4,6-trihydroxyoxan-2-yl]methyl acetate Chemical compound CC(=O)OC[C@@H]1[C@H]([C@@H]([C@H]([C@@H](O1)O)OC(=O)C)O)O SMEGJBVQLJJKKX-HOTMZDKISA-N 0.000 claims description 2
- 229940081735 acetylcellulose Drugs 0.000 claims description 2
- 125000004183 alkoxy alkyl group Chemical group 0.000 claims description 2
- 125000000278 alkyl amino alkyl group Chemical group 0.000 claims description 2
- 125000002877 alkyl aryl group Chemical group 0.000 claims description 2
- 125000002947 alkylene group Chemical group 0.000 claims description 2
- 125000003710 aryl alkyl group Chemical group 0.000 claims description 2
- 125000004181 carboxyalkyl group Chemical group 0.000 claims description 2
- 229920002301 cellulose acetate Polymers 0.000 claims description 2
- 125000000068 chlorophenyl group Chemical group 0.000 claims description 2
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 2
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 2
- 125000004985 dialkyl amino alkyl group Chemical group 0.000 claims description 2
- 125000004663 dialkyl amino group Chemical group 0.000 claims description 2
- 125000003106 haloaryl group Chemical group 0.000 claims description 2
- 150000002431 hydrogen Chemical class 0.000 claims description 2
- 125000006203 morpholinoethyl group Chemical group [H]C([H])(*)C([H])([H])N1C([H])([H])C([H])([H])OC([H])([H])C1([H])[H] 0.000 claims description 2
- 229910052757 nitrogen Inorganic materials 0.000 claims description 2
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 2
- 239000001301 oxygen Substances 0.000 claims description 2
- 229920002647 polyamide Polymers 0.000 claims description 2
- 125000005581 pyrene group Chemical group 0.000 claims description 2
- 125000004434 sulfur atom Chemical group 0.000 claims description 2
- 150000003254 radicals Chemical class 0.000 claims 3
- 125000004178 (C1-C4) alkyl group Chemical group 0.000 claims 1
- 125000004201 2,4-dichlorophenyl group Chemical group [H]C1=C([H])C(*)=C(Cl)C([H])=C1Cl 0.000 claims 1
- 125000004182 2-chlorophenyl group Chemical group [H]C1=C([H])C(Cl)=C(*)C([H])=C1[H] 0.000 claims 1
- 150000005840 aryl radicals Chemical class 0.000 claims 1
- 238000005282 brightening Methods 0.000 claims 1
- 125000001664 diethylamino group Chemical group [H]C([H])([H])C([H])([H])N(*)C([H])([H])C([H])([H])[H] 0.000 claims 1
- 125000002147 dimethylamino group Chemical group [H]C([H])([H])N(*)C([H])([H])[H] 0.000 claims 1
- 125000003261 o-tolyl group Chemical group [H]C1=C([H])C(*)=C(C([H])=C1[H])C([H])([H])[H] 0.000 claims 1
- 229920002994 synthetic fiber Polymers 0.000 claims 1
- 239000012209 synthetic fiber Substances 0.000 claims 1
- 238000000034 method Methods 0.000 description 8
- 239000000460 chlorine Substances 0.000 description 5
- 238000006243 chemical reaction Methods 0.000 description 4
- 239000006185 dispersion Substances 0.000 description 4
- 239000000835 fiber Substances 0.000 description 4
- 238000010521 absorption reaction Methods 0.000 description 3
- 239000002904 solvent Substances 0.000 description 3
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 description 2
- 239000002253 acid Substances 0.000 description 2
- 125000005605 benzo group Chemical group 0.000 description 2
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 2
- 125000004218 chloromethyl group Chemical group [H]C([H])(Cl)* 0.000 description 2
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 2
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 2
- 239000007858 starting material Substances 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- 125000001424 substituent group Chemical group 0.000 description 2
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 1
- 125000004172 4-methoxyphenyl group Chemical group [H]C1=C([H])C(OC([H])([H])[H])=C([H])C([H])=C1* 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- 229920000742 Cotton Polymers 0.000 description 1
- CYTYCFOTNPOANT-UHFFFAOYSA-N Perchloroethylene Chemical group ClC(Cl)=C(Cl)Cl CYTYCFOTNPOANT-UHFFFAOYSA-N 0.000 description 1
- 241000253387 Rhodobiaceae Species 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 150000001412 amines Chemical group 0.000 description 1
- BFNBIHQBYMNNAN-UHFFFAOYSA-N ammonium sulfate Chemical compound N.N.OS(O)(=O)=O BFNBIHQBYMNNAN-UHFFFAOYSA-N 0.000 description 1
- 229910052921 ammonium sulfate Inorganic materials 0.000 description 1
- 235000011130 ammonium sulphate Nutrition 0.000 description 1
- 239000011324 bead Substances 0.000 description 1
- 125000004541 benzoxazolyl group Chemical group O1C(=NC2=C1C=CC=C2)* 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- 238000004061 bleaching Methods 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000000969 carrier Substances 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 125000004188 dichlorophenyl group Chemical group 0.000 description 1
- 125000000118 dimethyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 235000019253 formic acid Nutrition 0.000 description 1
- 230000026030 halogenation Effects 0.000 description 1
- 238000005658 halogenation reaction Methods 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- 150000002430 hydrocarbons Chemical class 0.000 description 1
- 239000012442 inert solvent Substances 0.000 description 1
- 238000002372 labelling Methods 0.000 description 1
- 125000001326 naphthylalkyl group Chemical group 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 125000003884 phenylalkyl group Chemical group 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000000344 soap Substances 0.000 description 1
- UKLNMMHNWFDKNT-UHFFFAOYSA-M sodium chlorite Chemical compound [Na+].[O-]Cl=O UKLNMMHNWFDKNT-UHFFFAOYSA-M 0.000 description 1
- 229960002218 sodium chlorite Drugs 0.000 description 1
- 238000005507 spraying Methods 0.000 description 1
- 125000000020 sulfo group Chemical group O=S(=O)([*])O[H] 0.000 description 1
- 230000002195 synergetic effect Effects 0.000 description 1
- 229950011008 tetrachloroethylene Drugs 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
Classifications
-
- D—TEXTILES; PAPER
- D06—TREATMENT OF TEXTILES OR THE LIKE; LAUNDERING; FLEXIBLE MATERIALS NOT OTHERWISE PROVIDED FOR
- D06L—DRY-CLEANING, WASHING OR BLEACHING FIBRES, FILAMENTS, THREADS, YARNS, FABRICS, FEATHERS OR MADE-UP FIBROUS GOODS; BLEACHING LEATHER OR FURS
- D06L4/00—Bleaching fibres, filaments, threads, yarns, fabrics, feathers or made-up fibrous goods; Bleaching leather or furs
- D06L4/60—Optical bleaching or brightening
- D06L4/664—Preparations of optical brighteners; Optical brighteners in aerosol form; Physical treatment of optical brighteners
-
- D—TEXTILES; PAPER
- D06—TREATMENT OF TEXTILES OR THE LIKE; LAUNDERING; FLEXIBLE MATERIALS NOT OTHERWISE PROVIDED FOR
- D06L—DRY-CLEANING, WASHING OR BLEACHING FIBRES, FILAMENTS, THREADS, YARNS, FABRICS, FEATHERS OR MADE-UP FIBROUS GOODS; BLEACHING LEATHER OR FURS
- D06L4/00—Bleaching fibres, filaments, threads, yarns, fabrics, feathers or made-up fibrous goods; Bleaching leather or furs
- D06L4/60—Optical bleaching or brightening
- D06L4/65—Optical bleaching or brightening with mixtures of optical brighteners
Landscapes
- Engineering & Computer Science (AREA)
- Textile Engineering (AREA)
- Detergent Compositions (AREA)
- Nitrogen And Oxygen Or Sulfur-Condensed Heterocyclic Ring Systems (AREA)
- Paper (AREA)
Priority Applications (13)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2759217A DE2759217C3 (de) | 1977-12-31 | 1977-12-31 | Mischungen von optischen Aufhellern |
| US05/971,735 US4231741A (en) | 1977-12-31 | 1978-12-21 | Mixtures of optical brighteners |
| JP16022478A JPS5497625A (en) | 1977-12-31 | 1978-12-27 | Admixture consisting of ultravilolet whitner |
| CH1321478A CH655825GA3 (enExample) | 1977-12-31 | 1978-12-28 | |
| SE7813395A SE7813395L (sv) | 1977-12-31 | 1978-12-28 | Blandningar av optiska klarmedel |
| AT0931678A AT382406B (de) | 1977-12-31 | 1978-12-28 | Mischungen von optischen aufhellern |
| GB7850289A GB2011499B (en) | 1977-12-31 | 1978-12-29 | Mixtures of optical brighteners |
| NLAANVRAGE7812675,A NL186647C (nl) | 1977-12-31 | 1978-12-29 | Mengsel van optische bleekmiddelen. |
| CA318,809A CA1110013A (en) | 1977-12-31 | 1978-12-29 | Mixtures of optical brighteners |
| BR7808616A BR7808616A (pt) | 1977-12-31 | 1978-12-29 | Misturas de aclaradores oticos,e sua aplicacao |
| PH22002A PH14707A (en) | 1977-12-31 | 1978-12-29 | Mixtures of optical brighteners |
| FR7900008A FR2413496A1 (fr) | 1977-12-31 | 1979-01-02 | Melanges d'azureurs optiques |
| BE0/192734A BE873275A (fr) | 1977-12-31 | 1979-01-02 | Melanges d'azureurs optiques |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2759217A DE2759217C3 (de) | 1977-12-31 | 1977-12-31 | Mischungen von optischen Aufhellern |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| DE2759217A1 DE2759217A1 (de) | 1979-07-12 |
| DE2759217B2 DE2759217B2 (de) | 1980-07-31 |
| DE2759217C3 true DE2759217C3 (de) | 1981-05-27 |
Family
ID=6027909
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2759217A Expired DE2759217C3 (de) | 1977-12-31 | 1977-12-31 | Mischungen von optischen Aufhellern |
Country Status (13)
| Country | Link |
|---|---|
| US (1) | US4231741A (enExample) |
| JP (1) | JPS5497625A (enExample) |
| AT (1) | AT382406B (enExample) |
| BE (1) | BE873275A (enExample) |
| BR (1) | BR7808616A (enExample) |
| CA (1) | CA1110013A (enExample) |
| CH (1) | CH655825GA3 (enExample) |
| DE (1) | DE2759217C3 (enExample) |
| FR (1) | FR2413496A1 (enExample) |
| GB (1) | GB2011499B (enExample) |
| NL (1) | NL186647C (enExample) |
| PH (1) | PH14707A (enExample) |
| SE (1) | SE7813395L (enExample) |
Families Citing this family (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3104992A1 (de) * | 1981-02-12 | 1982-08-26 | Hoechst Ag, 6000 Frankfurt | "mischungen von optischen aufhellern" |
| DE3878550D1 (de) * | 1987-11-27 | 1993-03-25 | Ciba Geigy Ag | Aufhellerdispersion. |
| WO1999013824A1 (en) * | 1997-09-17 | 1999-03-25 | The Procter & Gamble Company | Hair care compositions comprising bulky optical brighteners |
Citations (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1273479B (de) * | 1961-12-04 | 1968-07-25 | Ici Ltd | Verfahren zum optischen Aufhellen von polymeren Stoffen |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2629703C3 (de) * | 1976-07-02 | 1981-07-23 | Hoechst Ag, 6000 Frankfurt | Aufhellermischungen und deren Verwendung |
-
1977
- 1977-12-31 DE DE2759217A patent/DE2759217C3/de not_active Expired
-
1978
- 1978-12-21 US US05/971,735 patent/US4231741A/en not_active Expired - Lifetime
- 1978-12-27 JP JP16022478A patent/JPS5497625A/ja active Granted
- 1978-12-28 SE SE7813395A patent/SE7813395L/xx unknown
- 1978-12-28 AT AT0931678A patent/AT382406B/de not_active IP Right Cessation
- 1978-12-28 CH CH1321478A patent/CH655825GA3/de unknown
- 1978-12-29 GB GB7850289A patent/GB2011499B/en not_active Expired
- 1978-12-29 BR BR7808616A patent/BR7808616A/pt unknown
- 1978-12-29 NL NLAANVRAGE7812675,A patent/NL186647C/xx not_active IP Right Cessation
- 1978-12-29 PH PH22002A patent/PH14707A/en unknown
- 1978-12-29 CA CA318,809A patent/CA1110013A/en not_active Expired
-
1979
- 1979-01-02 FR FR7900008A patent/FR2413496A1/fr active Granted
- 1979-01-02 BE BE0/192734A patent/BE873275A/xx not_active IP Right Cessation
Patent Citations (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1273479B (de) * | 1961-12-04 | 1968-07-25 | Ici Ltd | Verfahren zum optischen Aufhellen von polymeren Stoffen |
Also Published As
| Publication number | Publication date |
|---|---|
| BR7808616A (pt) | 1979-07-10 |
| DE2759217B2 (de) | 1980-07-31 |
| ATA931678A (de) | 1986-07-15 |
| CA1110013A (en) | 1981-10-06 |
| FR2413496A1 (fr) | 1979-07-27 |
| PH14707A (en) | 1981-11-13 |
| GB2011499B (en) | 1982-03-10 |
| SE7813395L (sv) | 1979-07-01 |
| NL186647B (nl) | 1990-08-16 |
| JPS5497625A (en) | 1979-08-01 |
| CH655825GA3 (enExample) | 1986-05-30 |
| BE873275A (fr) | 1979-07-02 |
| NL7812675A (nl) | 1979-07-03 |
| US4231741A (en) | 1980-11-04 |
| FR2413496B1 (enExample) | 1983-06-24 |
| AT382406B (de) | 1987-02-25 |
| DE2759217A1 (de) | 1979-07-12 |
| GB2011499A (en) | 1979-07-11 |
| NL186647C (nl) | 1991-01-16 |
| JPS627953B2 (enExample) | 1987-02-19 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2721084C3 (de) | Mischungen von optischen Aufhellern | |
| DE2207979C2 (de) | Trockenes Bleichmittel auf der Basis von Peroxy-Bleichverbindungen | |
| DE2733156A1 (de) | Benzofuranyl-benzimidazole | |
| EP0387663B1 (de) | Mittel gegen Keratinschädlinge | |
| DE2929687A1 (de) | Mischungen von optischen aufhellern | |
| DE2704825B2 (de) | Fluoreszenzfarbstoffe, Verfahren zu deren Herstellung und deren Verwendung zum Weißtönen organischer Materialien | |
| DE2759217C3 (de) | Mischungen von optischen Aufhellern | |
| DE2629703C3 (de) | Aufhellermischungen und deren Verwendung | |
| EP0023026B1 (de) | Mischungen von optischen Aufhellern und deren Verwendung | |
| DE2163003A1 (de) | Textilbehandlungslösung | |
| EP0045279B1 (de) | Neue Aminoxidverbindungen, Verfahren zu deren Herstellung und deren Verwendung als optische Aufheller | |
| EP0023333B1 (de) | Wäscheweichspülmittel | |
| EP0044996B1 (de) | Mischungen von optischen Aufhellern | |
| DE2209128C3 (de) | Bis-Stilbenverbindungen, Verfahren zu deren Herstellung und deren Verwendung als optische Aufheller | |
| DE1245898C2 (de) | Schaumarmes, egalisierendes Netzmittel | |
| DE2839936C2 (de) | Mischungen von optischen Aufhellern und deren Verwendung zum optischen Aufhellen | |
| DE3248947C2 (de) | Salze von N-Oxiranmethan-N,N,N-trialkylammoniumderivaten Verfahren zu deren Herstellung und deren Verwendung zum Impr{gnieren von Textillien | |
| EP0058880B1 (de) | Mischungen von optischen Aufhellern | |
| DE2703864C2 (enExample) | ||
| DE3134942A1 (de) | Aufhellersalze und deren verwendung fuer das nassspinnen von acrylfasern | |
| DE1298996B (de) | Verfahren zur Herstellung von quaternaeren Ammoniumperoxysulfaten | |
| DE1094696B (de) | Verfahren zum optischen Aufhellen von Materialien aus Polyestern | |
| DE1237124B (de) | Verfahren zur Herstellung von als optische Aufheller verwendbaren 1, 3-Diphenylpyrazolin-derivaten | |
| DE1802642C3 (de) | Fluoreszierende 1- (Pyrazolinylphenylsulfonyl)-piperazine | |
| EP0060439B1 (de) | Weisstönerhaltige Spinnmassen zur Herstellung von Celluloseregeneratfasern |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| OAP | Request for examination filed | ||
| OD | Request for examination | ||
| C3 | Grant after two publication steps (3rd publication) | ||
| AG | Has addition no. |
Ref country code: DE Ref document number: 2839936 Format of ref document f/p: P |
|
| 8339 | Ceased/non-payment of the annual fee |