DE2744134A1 - Verfahren zur selektiven hydrierung von ketogruppen in nicht konjugierten olefinischen ketonen - Google Patents
Verfahren zur selektiven hydrierung von ketogruppen in nicht konjugierten olefinischen ketonenInfo
- Publication number
- DE2744134A1 DE2744134A1 DE19772744134 DE2744134A DE2744134A1 DE 2744134 A1 DE2744134 A1 DE 2744134A1 DE 19772744134 DE19772744134 DE 19772744134 DE 2744134 A DE2744134 A DE 2744134A DE 2744134 A1 DE2744134 A1 DE 2744134A1
- Authority
- DE
- Germany
- Prior art keywords
- methyl
- hours
- carbon atoms
- chromium
- reaction
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Withdrawn
Links
- 238000000034 method Methods 0.000 title claims description 22
- 238000005984 hydrogenation reaction Methods 0.000 title claims description 18
- KJDGFQJCHFJTRH-YONAWACDSA-N 16-Ketoestradiol Chemical group OC1=CC=C2[C@H]3CC[C@](C)([C@H](C(=O)C4)O)[C@@H]4[C@@H]3CCC2=C1 KJDGFQJCHFJTRH-YONAWACDSA-N 0.000 title 1
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 claims description 74
- 150000002576 ketones Chemical class 0.000 claims description 36
- 238000006243 chemical reaction Methods 0.000 claims description 32
- 150000001298 alcohols Chemical class 0.000 claims description 28
- 239000007868 Raney catalyst Substances 0.000 claims description 25
- 229910000564 Raney nickel Inorganic materials 0.000 claims description 25
- VYZAMTAEIAYCRO-UHFFFAOYSA-N Chromium Chemical compound [Cr] VYZAMTAEIAYCRO-UHFFFAOYSA-N 0.000 claims description 24
- 239000002585 base Substances 0.000 claims description 24
- 229910052804 chromium Inorganic materials 0.000 claims description 24
- 239000011651 chromium Substances 0.000 claims description 24
- 239000003054 catalyst Substances 0.000 claims description 21
- BDAWXSQJJCIFIK-UHFFFAOYSA-N potassium methoxide Chemical group [K+].[O-]C BDAWXSQJJCIFIK-UHFFFAOYSA-N 0.000 claims description 17
- 125000004432 carbon atom Chemical group C* 0.000 claims description 15
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 15
- 229910052739 hydrogen Inorganic materials 0.000 claims description 12
- 239000001257 hydrogen Substances 0.000 claims description 12
- 239000003513 alkali Substances 0.000 claims description 11
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 9
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 claims description 8
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical group [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 claims description 8
- 125000001931 aliphatic group Chemical group 0.000 claims description 8
- -1 cycloalkylalkyl radicals Chemical class 0.000 claims description 8
- GFFWTYGLHZTFHM-UHFFFAOYSA-N 3,6-dimethylhept-5-en-2-one Chemical compound CC(=O)C(C)CC=C(C)C GFFWTYGLHZTFHM-UHFFFAOYSA-N 0.000 claims description 6
- 229910052799 carbon Inorganic materials 0.000 claims description 5
- 229910052757 nitrogen Inorganic materials 0.000 claims description 4
- 229910052783 alkali metal Inorganic materials 0.000 claims description 3
- 150000001340 alkali metals Chemical class 0.000 claims description 3
- 125000000217 alkyl group Chemical group 0.000 claims description 3
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 3
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 3
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 3
- 150000008044 alkali metal hydroxides Chemical class 0.000 claims description 2
- 125000002877 alkyl aryl group Chemical group 0.000 claims description 2
- 125000003710 aryl alkyl group Chemical group 0.000 claims description 2
- 125000003118 aryl group Chemical group 0.000 claims description 2
- QUPDWYMUPZLYJZ-UHFFFAOYSA-N ethyl Chemical compound C[CH2] QUPDWYMUPZLYJZ-UHFFFAOYSA-N 0.000 claims description 2
- WCYWZMWISLQXQU-UHFFFAOYSA-N methyl Chemical compound [CH3] WCYWZMWISLQXQU-UHFFFAOYSA-N 0.000 claims description 2
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 2
- 150000003254 radicals Chemical class 0.000 claims description 2
- NPXOKRUENSOPAO-UHFFFAOYSA-N Raney nickel Chemical compound [Al].[Ni] NPXOKRUENSOPAO-UHFFFAOYSA-N 0.000 claims 3
- YBOZNTGUYASNRA-UHFFFAOYSA-N 2-methyloct-2-ene Chemical compound CCCCCC=C(C)C YBOZNTGUYASNRA-UHFFFAOYSA-N 0.000 claims 1
- 125000005119 alkyl cycloalkyl group Chemical group 0.000 claims 1
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 30
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 26
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 23
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 11
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 9
- 239000000047 product Substances 0.000 description 9
- 229920006395 saturated elastomer Polymers 0.000 description 9
- 229910000831 Steel Inorganic materials 0.000 description 7
- 239000000203 mixture Substances 0.000 description 7
- 230000035484 reaction time Effects 0.000 description 7
- 239000010959 steel Substances 0.000 description 7
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 6
- 150000001412 amines Chemical class 0.000 description 6
- UHEPJGULSIKKTP-UHFFFAOYSA-N sulcatone Chemical compound CC(C)=CCCC(C)=O UHEPJGULSIKKTP-UHFFFAOYSA-N 0.000 description 6
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 5
- ROSDSFDQCJNGOL-UHFFFAOYSA-N Dimethylamine Chemical compound CNC ROSDSFDQCJNGOL-UHFFFAOYSA-N 0.000 description 5
- 241001122767 Theaceae Species 0.000 description 5
- 238000002474 experimental method Methods 0.000 description 5
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 4
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 4
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 4
- 235000011114 ammonium hydroxide Nutrition 0.000 description 4
- 230000000052 comparative effect Effects 0.000 description 4
- JQVDAXLFBXTEQA-UHFFFAOYSA-N dibutylamine Chemical compound CCCCNCCCC JQVDAXLFBXTEQA-UHFFFAOYSA-N 0.000 description 4
- 230000000694 effects Effects 0.000 description 4
- 239000000725 suspension Substances 0.000 description 4
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 4
- HEFCEAOQAPBGKX-UHFFFAOYSA-N 7-methyloct-6-en-3-one Chemical compound CCC(=O)CCC=C(C)C HEFCEAOQAPBGKX-UHFFFAOYSA-N 0.000 description 3
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- 238000004458 analytical method Methods 0.000 description 3
- 239000007795 chemical reaction product Substances 0.000 description 3
- HPNMFZURTQLUMO-UHFFFAOYSA-N diethylamine Chemical compound CCNCC HPNMFZURTQLUMO-UHFFFAOYSA-N 0.000 description 3
- 125000000468 ketone group Chemical group 0.000 description 3
- JPTOCTSNXXKSSN-UHFFFAOYSA-N methylheptenone Chemical compound CCCC=CC(=O)CC JPTOCTSNXXKSSN-UHFFFAOYSA-N 0.000 description 3
- 125000001453 quaternary ammonium group Chemical group 0.000 description 3
- 239000012429 reaction media Substances 0.000 description 3
- XKTQVJODAZKGGU-UHFFFAOYSA-N 2-methyloct-2-en-4-one Chemical compound CCCCC(=O)C=C(C)C XKTQVJODAZKGGU-UHFFFAOYSA-N 0.000 description 2
- SHOJXDKTYKFBRD-UHFFFAOYSA-N 4-Methyl-3-penten-2-one, 9CI Chemical compound CC(C)=CC(C)=O SHOJXDKTYKFBRD-UHFFFAOYSA-N 0.000 description 2
- HASNVACCRLSDMU-UHFFFAOYSA-N 5,6-dimethylhept-5-en-2-one Chemical compound CC(C)=C(C)CCC(C)=O HASNVACCRLSDMU-UHFFFAOYSA-N 0.000 description 2
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 2
- VTYYLEPIZMXCLO-UHFFFAOYSA-L Calcium carbonate Chemical compound [Ca+2].[O-]C([O-])=O VTYYLEPIZMXCLO-UHFFFAOYSA-L 0.000 description 2
- QUSNBJAOOMFDIB-UHFFFAOYSA-N Ethylamine Chemical compound CCN QUSNBJAOOMFDIB-UHFFFAOYSA-N 0.000 description 2
- WMFOQBRAJBCJND-UHFFFAOYSA-M Lithium hydroxide Chemical compound [Li+].[OH-] WMFOQBRAJBCJND-UHFFFAOYSA-M 0.000 description 2
- BAVYZALUXZFZLV-UHFFFAOYSA-N Methylamine Chemical compound NC BAVYZALUXZFZLV-UHFFFAOYSA-N 0.000 description 2
- YNAVUWVOSKDBBP-UHFFFAOYSA-N Morpholine Chemical compound C1COCCN1 YNAVUWVOSKDBBP-UHFFFAOYSA-N 0.000 description 2
- GLUUGHFHXGJENI-UHFFFAOYSA-N Piperazine Chemical compound C1CNCCN1 GLUUGHFHXGJENI-UHFFFAOYSA-N 0.000 description 2
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 description 2
- KYQCOXFCLRTKLS-UHFFFAOYSA-N Pyrazine Chemical compound C1=CN=CC=N1 KYQCOXFCLRTKLS-UHFFFAOYSA-N 0.000 description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 2
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 2
- ACIAHEMYLLBZOI-ZZXKWVIFSA-N Unsaturated alcohol Chemical compound CC\C(CO)=C/C ACIAHEMYLLBZOI-ZZXKWVIFSA-N 0.000 description 2
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- HQABUPZFAYXKJW-UHFFFAOYSA-N butan-1-amine Chemical compound CCCCN HQABUPZFAYXKJW-UHFFFAOYSA-N 0.000 description 2
- 230000003197 catalytic effect Effects 0.000 description 2
- 238000009903 catalytic hydrogenation reaction Methods 0.000 description 2
- JHIVVAPYMSGYDF-UHFFFAOYSA-N cyclohexanone Chemical compound O=C1CCCCC1 JHIVVAPYMSGYDF-UHFFFAOYSA-N 0.000 description 2
- PAFZNILMFXTMIY-UHFFFAOYSA-N cyclohexylamine Chemical compound NC1CCCCC1 PAFZNILMFXTMIY-UHFFFAOYSA-N 0.000 description 2
- 150000004985 diamines Chemical class 0.000 description 2
- 229910052759 nickel Inorganic materials 0.000 description 2
- MUMZUERVLWJKNR-UHFFFAOYSA-N oxoplatinum Chemical compound [Pt]=O MUMZUERVLWJKNR-UHFFFAOYSA-N 0.000 description 2
- 229910052763 palladium Inorganic materials 0.000 description 2
- 229910003446 platinum oxide Inorganic materials 0.000 description 2
- 238000002360 preparation method Methods 0.000 description 2
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 2
- WGYKZJWCGVVSQN-UHFFFAOYSA-N propylamine Chemical compound CCCN WGYKZJWCGVVSQN-UHFFFAOYSA-N 0.000 description 2
- 230000036632 reaction speed Effects 0.000 description 2
- 150000003333 secondary alcohols Chemical class 0.000 description 2
- 239000011734 sodium Substances 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- IMFACGCPASFAPR-UHFFFAOYSA-N tributylamine Chemical compound CCCCN(CCCC)CCCC IMFACGCPASFAPR-UHFFFAOYSA-N 0.000 description 2
- GETQZCLCWQTVFV-UHFFFAOYSA-N trimethylamine Chemical compound CN(C)C GETQZCLCWQTVFV-UHFFFAOYSA-N 0.000 description 2
- VILCJCGEZXAXTO-UHFFFAOYSA-N 2,2,2-tetramine Chemical compound NCCNCCNCCN VILCJCGEZXAXTO-UHFFFAOYSA-N 0.000 description 1
- HZAXFHJVJLSVMW-UHFFFAOYSA-N 2-Aminoethan-1-ol Chemical compound NCCO HZAXFHJVJLSVMW-UHFFFAOYSA-N 0.000 description 1
- QQZOPKMRPOGIEB-UHFFFAOYSA-N 2-Oxohexane Chemical compound CCCCC(C)=O QQZOPKMRPOGIEB-UHFFFAOYSA-N 0.000 description 1
- VSCXSOIJQDYIOX-UHFFFAOYSA-N 3,6-dimethyloct-5-en-2-one Chemical compound CCC(C)=CCC(C)C(C)=O VSCXSOIJQDYIOX-UHFFFAOYSA-N 0.000 description 1
- JJYPMNFTHPTTDI-UHFFFAOYSA-N 3-methylaniline Chemical compound CC1=CC=CC(N)=C1 JJYPMNFTHPTTDI-UHFFFAOYSA-N 0.000 description 1
- WKQWDIFHKYWRTA-UHFFFAOYSA-N 4,7-dimethyloct-6-en-3-one Chemical compound CCC(=O)C(C)CC=C(C)C WKQWDIFHKYWRTA-UHFFFAOYSA-N 0.000 description 1
- ZIJWGEHOVHJHKB-BQYQJAHWSA-N 4-Phenyl-3-buten-2-ol Chemical compound CC(O)\C=C\C1=CC=CC=C1 ZIJWGEHOVHJHKB-BQYQJAHWSA-N 0.000 description 1
- PQIXRYBSJBIXHN-UHFFFAOYSA-N 5-cyclohexylidenepentan-2-one Chemical compound CC(=O)CCC=C1CCCCC1 PQIXRYBSJBIXHN-UHFFFAOYSA-N 0.000 description 1
- IOQNEVQHSYUJMO-UHFFFAOYSA-N 6-ethyl-3-methyloct-5-en-2-one Chemical compound CC(C(C)=O)CC=C(CC)CC IOQNEVQHSYUJMO-UHFFFAOYSA-N 0.000 description 1
- UGNKQWGYIRQBNO-UHFFFAOYSA-N 6-ethyloct-5-en-2-one Chemical compound CCC(CC)=CCCC(C)=O UGNKQWGYIRQBNO-UHFFFAOYSA-N 0.000 description 1
- SAXWRVSDVXCTEL-UHFFFAOYSA-N 6-methyloct-5-en-2-one Chemical compound CCC(C)=CCCC(C)=O SAXWRVSDVXCTEL-UHFFFAOYSA-N 0.000 description 1
- LPURUSPXSJAUIM-UHFFFAOYSA-N 7-ethylnon-6-en-3-one Chemical compound C(C)C(=CCCC(CC)=O)CC LPURUSPXSJAUIM-UHFFFAOYSA-N 0.000 description 1
- GHJLLLILWMDFDE-UHFFFAOYSA-N 7-methyloct-6-en-2-one Chemical compound CC(C)=CCCCC(C)=O GHJLLLILWMDFDE-UHFFFAOYSA-N 0.000 description 1
- 229910000838 Al alloy Inorganic materials 0.000 description 1
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical class [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 1
- 229910000599 Cr alloy Inorganic materials 0.000 description 1
- PIICEJLVQHRZGT-UHFFFAOYSA-N Ethylenediamine Chemical compound NCCN PIICEJLVQHRZGT-UHFFFAOYSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- 239000005909 Kieselgur Substances 0.000 description 1
- 229910018487 Ni—Cr Inorganic materials 0.000 description 1
- PCNDJXKNXGMECE-UHFFFAOYSA-N Phenazine Natural products C1=CC=CC2=NC3=CC=CC=C3N=C21 PCNDJXKNXGMECE-UHFFFAOYSA-N 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- KJTLSVCANCCWHF-UHFFFAOYSA-N Ruthenium Chemical compound [Ru] KJTLSVCANCCWHF-UHFFFAOYSA-N 0.000 description 1
- GSEJCLTVZPLZKY-UHFFFAOYSA-N Triethanolamine Chemical compound OCCN(CCO)CCO GSEJCLTVZPLZKY-UHFFFAOYSA-N 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 150000001299 aldehydes Chemical class 0.000 description 1
- 229910052782 aluminium Inorganic materials 0.000 description 1
- SMZOGRDCAXLAAR-UHFFFAOYSA-N aluminium isopropoxide Chemical compound [Al+3].CC(C)[O-].CC(C)[O-].CC(C)[O-] SMZOGRDCAXLAAR-UHFFFAOYSA-N 0.000 description 1
- DIZPMCHEQGEION-UHFFFAOYSA-H aluminium sulfate (anhydrous) Chemical compound [Al+3].[Al+3].[O-]S([O-])(=O)=O.[O-]S([O-])(=O)=O.[O-]S([O-])(=O)=O DIZPMCHEQGEION-UHFFFAOYSA-H 0.000 description 1
- 229910021529 ammonia Inorganic materials 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- 229910052788 barium Inorganic materials 0.000 description 1
- DSAJWYNOEDNPEQ-UHFFFAOYSA-N barium atom Chemical compound [Ba] DSAJWYNOEDNPEQ-UHFFFAOYSA-N 0.000 description 1
- BWHOZHOGCMHOBV-UHFFFAOYSA-N benzylideneacetone Chemical compound CC(=O)C=CC1=CC=CC=C1 BWHOZHOGCMHOBV-UHFFFAOYSA-N 0.000 description 1
- NDKBVBUGCNGSJJ-UHFFFAOYSA-M benzyltrimethylammonium hydroxide Chemical class [OH-].C[N+](C)(C)CC1=CC=CC=C1 NDKBVBUGCNGSJJ-UHFFFAOYSA-M 0.000 description 1
- 229910021538 borax Inorganic materials 0.000 description 1
- ZWLQACFYTXLLEJ-UHFFFAOYSA-N butan-1-ol;methanol Chemical compound OC.CCCCO ZWLQACFYTXLLEJ-UHFFFAOYSA-N 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 229910000019 calcium carbonate Inorganic materials 0.000 description 1
- 150000001721 carbon Chemical group 0.000 description 1
- 239000006229 carbon black Substances 0.000 description 1
- 238000004587 chromatography analysis Methods 0.000 description 1
- 239000000788 chromium alloy Substances 0.000 description 1
- VNNRSPGTAMTISX-UHFFFAOYSA-N chromium nickel Chemical compound [Cr].[Ni] VNNRSPGTAMTISX-UHFFFAOYSA-N 0.000 description 1
- APEJMQOBVMLION-UHFFFAOYSA-N cinnamic acid amide Natural products NC(=O)C=CC1=CC=CC=C1 APEJMQOBVMLION-UHFFFAOYSA-N 0.000 description 1
- 229910017052 cobalt Inorganic materials 0.000 description 1
- 239000010941 cobalt Substances 0.000 description 1
- GUTLYIVDDKVIGB-UHFFFAOYSA-N cobalt atom Chemical compound [Co] GUTLYIVDDKVIGB-UHFFFAOYSA-N 0.000 description 1
- 150000001875 compounds Chemical class 0.000 description 1
- 238000010924 continuous production Methods 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- NISGSNTVMOOSJQ-UHFFFAOYSA-N cyclopentanamine Chemical compound NC1CCCC1 NISGSNTVMOOSJQ-UHFFFAOYSA-N 0.000 description 1
- ZBCBWPMODOFKDW-UHFFFAOYSA-N diethanolamine Chemical compound OCCNCCO ZBCBWPMODOFKDW-UHFFFAOYSA-N 0.000 description 1
- 230000029087 digestion Effects 0.000 description 1
- WEHWNAOGRSTTBQ-UHFFFAOYSA-N dipropylamine Chemical compound CCCNCCC WEHWNAOGRSTTBQ-UHFFFAOYSA-N 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- LYAOUQAGWKWFOX-UHFFFAOYSA-N ethanol;methanol;propan-1-ol Chemical compound OC.CCO.CCCO LYAOUQAGWKWFOX-UHFFFAOYSA-N 0.000 description 1
- 238000011010 flushing procedure Methods 0.000 description 1
- HNZUNIKWNYHEJJ-FMIVXFBMSA-N geranyl acetone Chemical compound CC(C)=CCC\C(C)=C\CCC(C)=O HNZUNIKWNYHEJJ-FMIVXFBMSA-N 0.000 description 1
- HNZUNIKWNYHEJJ-UHFFFAOYSA-N geranyl acetone Natural products CC(C)=CCCC(C)=CCCC(C)=O HNZUNIKWNYHEJJ-UHFFFAOYSA-N 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 125000000623 heterocyclic group Chemical group 0.000 description 1
- 150000004679 hydroxides Chemical class 0.000 description 1
- 239000012535 impurity Substances 0.000 description 1
- 239000000543 intermediate Substances 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 239000007791 liquid phase Substances 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- YNGJZCUAHVBRJA-UHFFFAOYSA-N methanol;2-methylpropan-1-ol Chemical compound OC.CC(C)CO YNGJZCUAHVBRJA-UHFFFAOYSA-N 0.000 description 1
- RNVCVTLRINQCPJ-UHFFFAOYSA-N o-toluidine Chemical compound CC1=CC=CC=C1N RNVCVTLRINQCPJ-UHFFFAOYSA-N 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- RZXMPPFPUUCRFN-UHFFFAOYSA-N p-toluidine Chemical compound CC1=CC=C(N)C=C1 RZXMPPFPUUCRFN-UHFFFAOYSA-N 0.000 description 1
- 125000000913 palmityl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 229910052697 platinum Inorganic materials 0.000 description 1
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Substances [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 description 1
- 229920000768 polyamine Polymers 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- LPNYRYFBWFDTMA-UHFFFAOYSA-N potassium tert-butoxide Chemical compound [K+].CC(C)(C)[O-] LPNYRYFBWFDTMA-UHFFFAOYSA-N 0.000 description 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
- OENLEHTYJXMVBG-UHFFFAOYSA-N pyridine;hydrate Chemical compound [OH-].C1=CC=[NH+]C=C1 OENLEHTYJXMVBG-UHFFFAOYSA-N 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 229910052707 ruthenium Inorganic materials 0.000 description 1
- 239000000377 silicon dioxide Substances 0.000 description 1
- 235000012239 silicon dioxide Nutrition 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000004328 sodium tetraborate Substances 0.000 description 1
- 235000010339 sodium tetraborate Nutrition 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 239000004575 stone Substances 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- QEMXHQIAXOOASZ-UHFFFAOYSA-N tetramethylammonium Chemical compound C[N+](C)(C)C QEMXHQIAXOOASZ-UHFFFAOYSA-N 0.000 description 1
- YFTHZRPMJXBUME-UHFFFAOYSA-N tripropylamine Chemical compound CCCN(CCC)CCC YFTHZRPMJXBUME-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C403/00—Derivatives of cyclohexane or of a cyclohexene or of cyclohexadiene, having a side-chain containing an acyclic unsaturated part of at least four carbon atoms, this part being directly attached to the cyclohexane or cyclohexene or cyclohexadiene rings, e.g. vitamin A, beta-carotene, beta-ionone
- C07C403/02—Derivatives of cyclohexane or of a cyclohexene or of cyclohexadiene, having a side-chain containing an acyclic unsaturated part of at least four carbon atoms, this part being directly attached to the cyclohexane or cyclohexene or cyclohexadiene rings, e.g. vitamin A, beta-carotene, beta-ionone having side-chains containing only carbon and hydrogen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C29/00—Preparation of compounds having hydroxy or O-metal groups bound to a carbon atom not belonging to a six-membered aromatic ring
- C07C29/132—Preparation of compounds having hydroxy or O-metal groups bound to a carbon atom not belonging to a six-membered aromatic ring by reduction of an oxygen containing functional group
- C07C29/136—Preparation of compounds having hydroxy or O-metal groups bound to a carbon atom not belonging to a six-membered aromatic ring by reduction of an oxygen containing functional group of >C=O containing groups, e.g. —COOH
- C07C29/143—Preparation of compounds having hydroxy or O-metal groups bound to a carbon atom not belonging to a six-membered aromatic ring by reduction of an oxygen containing functional group of >C=O containing groups, e.g. —COOH of ketones
- C07C29/145—Preparation of compounds having hydroxy or O-metal groups bound to a carbon atom not belonging to a six-membered aromatic ring by reduction of an oxygen containing functional group of >C=O containing groups, e.g. —COOH of ketones with hydrogen or hydrogen-containing gases
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C403/00—Derivatives of cyclohexane or of a cyclohexene or of cyclohexadiene, having a side-chain containing an acyclic unsaturated part of at least four carbon atoms, this part being directly attached to the cyclohexane or cyclohexene or cyclohexadiene rings, e.g. vitamin A, beta-carotene, beta-ionone
- C07C403/06—Derivatives of cyclohexane or of a cyclohexene or of cyclohexadiene, having a side-chain containing an acyclic unsaturated part of at least four carbon atoms, this part being directly attached to the cyclohexane or cyclohexene or cyclohexadiene rings, e.g. vitamin A, beta-carotene, beta-ionone having side-chains substituted by singly-bound oxygen atoms
- C07C403/08—Derivatives of cyclohexane or of a cyclohexene or of cyclohexadiene, having a side-chain containing an acyclic unsaturated part of at least four carbon atoms, this part being directly attached to the cyclohexane or cyclohexene or cyclohexadiene rings, e.g. vitamin A, beta-carotene, beta-ionone having side-chains substituted by singly-bound oxygen atoms by hydroxy groups
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C2601/00—Systems containing only non-condensed rings
- C07C2601/12—Systems containing only non-condensed rings with a six-membered ring
- C07C2601/14—The ring being saturated
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C2601/00—Systems containing only non-condensed rings
- C07C2601/12—Systems containing only non-condensed rings with a six-membered ring
- C07C2601/16—Systems containing only non-condensed rings with a six-membered ring the ring being unsaturated
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Catalysts (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US05/728,346 US4041083A (en) | 1976-09-30 | 1976-09-30 | Process for the selective hydrogenation of the keto group in nonconjugated olefinic ketones |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE2744134A1 true DE2744134A1 (de) | 1978-04-06 |
Family
ID=24926471
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19772744134 Withdrawn DE2744134A1 (de) | 1976-09-30 | 1977-09-30 | Verfahren zur selektiven hydrierung von ketogruppen in nicht konjugierten olefinischen ketonen |
Country Status (11)
| Country | Link |
|---|---|
| US (1) | US4041083A (enExample) |
| JP (1) | JPS5344506A (enExample) |
| BE (1) | BE859220A (enExample) |
| CA (1) | CA1086332A (enExample) |
| CH (1) | CH624372A5 (enExample) |
| DE (1) | DE2744134A1 (enExample) |
| ES (1) | ES462810A1 (enExample) |
| FR (1) | FR2366247A1 (enExample) |
| GB (1) | GB1569334A (enExample) |
| IT (1) | IT1084796B (enExample) |
| NL (1) | NL7710677A (enExample) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| WO2020020434A1 (de) * | 2018-07-23 | 2020-01-30 | Symrise Ag | Neue riechstoffe mit rosengeruch |
Families Citing this family (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2934251A1 (de) * | 1979-08-24 | 1981-03-26 | Basf Ag, 67063 Ludwigshafen | Verfahren zur herstellung von ungesaettigten alkoholen. |
| IT1129758B (it) * | 1980-01-23 | 1986-06-11 | Montedison Spa | Processo per la riduzione catalitica di chetoni insaturi |
| CH648281A5 (fr) * | 1981-04-21 | 1985-03-15 | Firmenich & Cie | Composes macrocycliques et leur utilisation. |
| DE3130805A1 (de) * | 1981-08-04 | 1983-02-24 | Basf Ag, 6700 Ludwigshafen | Neue ruthenium/kohle-hydrierkatalysatoren, deren herstellung und verwendung zur selektiven hydrierung von ungesaettigten carbonylverbindungen |
| GB2215330A (en) * | 1988-03-04 | 1989-09-20 | Shell Int Research | Hydrogenation of esters into alcohols |
| DE3824625A1 (de) * | 1988-07-20 | 1990-01-25 | Bayer Ag, 5090 Leverkusen | Verfahren zur hydrierung von (alpha),(beta)-ungesaettigten ketonen |
| DE3824518A1 (de) * | 1988-07-20 | 1990-01-25 | Bayer Ag | Verfahren zur herstellung von 4,4-dimethyl-1-(p-chlor-phenyl)-pentan-3-on |
| JPH0753680B2 (ja) * | 1989-07-17 | 1995-06-07 | 高砂香料工業株式会社 | 光学活性ケトンの製造法 |
| DE19505938A1 (de) * | 1995-02-21 | 1996-08-22 | Bayer Ag | Verfahren zur Herstellung von 1-(4-Chlorphenyl)-4,4-dimethyl-pentan-3-on |
| CN102603473A (zh) * | 2012-01-13 | 2012-07-25 | 河北科技大学 | 一种羰基化合物选择性加氢制备相应醇的方法 |
Family Cites Families (16)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2983734A (en) * | 1961-05-09 | Catalytic hydrogenation | ||
| US2009948A (en) * | 1931-08-27 | 1935-07-30 | Ig Farbenindustrie Ag | Production of unsaturated alcohols |
| US2448047A (en) * | 1947-02-15 | 1948-08-31 | Burton T Bush Inc | Preparation of unsaturated alcohols |
| US2767221A (en) * | 1953-06-11 | 1956-10-16 | Shell Dev | Production of unsaturated alcohols |
| US3102150A (en) * | 1960-02-19 | 1963-08-27 | Exxon Research Engineering Co | Process for hydrogenating carbonyl compounds |
| US3109865A (en) * | 1961-10-24 | 1963-11-05 | Standard Oil Co | Manufacture of allyl alcohol |
| US3471575A (en) * | 1962-04-28 | 1969-10-07 | Shiro Kudo | Catalytic hydrogenation of alpha,beta-unsaturated carbonyl compounds,unsaturated fatty acids,and unsaturated fatty acid esters |
| US3268589A (en) * | 1963-05-29 | 1966-08-23 | Reynolds Tobacco Co R | Process for preparing 4-(2-butenylidene)-3, 5, 5-trimethyl-2-cyclohexene-1-one |
| US3284517A (en) * | 1963-09-11 | 1966-11-08 | Engelhard Ind Inc | Hydrogenation of alpiia, beta-unsaturated aldehydes to alpha, beta-unsaturated alcohols |
| US3463818A (en) * | 1966-01-25 | 1969-08-26 | Int Flavors & Fragrances Inc | Unsaturated aldehydes and alcohols |
| US3991127A (en) * | 1967-03-18 | 1976-11-09 | Basf Aktiengesellschaft | Production of saturated aliphatic alcohols |
| NL6712077A (enExample) * | 1967-09-01 | 1969-03-04 | ||
| US3655777A (en) * | 1968-11-12 | 1972-04-11 | Engelhard Min & Chem | Hydrogenation of unsaturated aldehydes to unsaturated alcohols |
| GB1383246A (en) * | 1971-01-13 | 1975-02-05 | Yeda Res & Dev | Production of alcohols from aldehydes and ketones |
| CH566113A5 (enExample) * | 1973-02-09 | 1975-09-15 | Firmenich & Cie | |
| CH576926A5 (enExample) * | 1973-03-21 | 1976-06-30 | Hoffmann La Roche |
-
1976
- 1976-09-30 US US05/728,346 patent/US4041083A/en not_active Expired - Lifetime
-
1977
- 1977-09-29 CH CH1193077A patent/CH624372A5/fr not_active IP Right Cessation
- 1977-09-29 CA CA287,795A patent/CA1086332A/en not_active Expired
- 1977-09-29 BE BE181329A patent/BE859220A/xx unknown
- 1977-09-29 GB GB40571/77A patent/GB1569334A/en not_active Expired
- 1977-09-29 FR FR7729903A patent/FR2366247A1/fr active Granted
- 1977-09-29 NL NL7710677A patent/NL7710677A/xx not_active Application Discontinuation
- 1977-09-30 IT IT28175/77A patent/IT1084796B/it active
- 1977-09-30 DE DE19772744134 patent/DE2744134A1/de not_active Withdrawn
- 1977-09-30 ES ES462810A patent/ES462810A1/es not_active Expired
- 1977-09-30 JP JP11696277A patent/JPS5344506A/ja active Pending
Cited By (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| WO2020020434A1 (de) * | 2018-07-23 | 2020-01-30 | Symrise Ag | Neue riechstoffe mit rosengeruch |
| US11634659B2 (en) | 2018-07-23 | 2023-04-25 | Symrise Ag | Fragrances with rose scent |
Also Published As
| Publication number | Publication date |
|---|---|
| BE859220A (fr) | 1978-03-29 |
| CA1086332A (en) | 1980-09-23 |
| GB1569334A (en) | 1980-06-11 |
| CH624372A5 (enExample) | 1981-07-31 |
| FR2366247A1 (fr) | 1978-04-28 |
| IT1084796B (it) | 1985-05-28 |
| FR2366247B1 (enExample) | 1980-04-25 |
| NL7710677A (nl) | 1978-04-03 |
| JPS5344506A (en) | 1978-04-21 |
| ES462810A1 (es) | 1978-05-16 |
| US4041083A (en) | 1977-08-09 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2907869C2 (enExample) | ||
| DE69415572T2 (de) | Verfahren zur Herstellung von Etheralkoholen durch Hydrogenolyse von zyklischem Ketal | |
| DE60001881T3 (de) | Verfahren zur Herstellung von Olefinoxiden | |
| DE2744134A1 (de) | Verfahren zur selektiven hydrierung von ketogruppen in nicht konjugierten olefinischen ketonen | |
| DE3728222A1 (de) | Verfahren zur herstellung von ethercarbonsaeuren | |
| DE4322065A1 (de) | Verfahren zur Herstellung primärer Amine aus Aldehyden | |
| DE19754848C2 (de) | Verfahren zur Herstellung von Alkoholen | |
| DE60002538T2 (de) | Verfahren zur Herstellung von Cyclododecanon und Cyclododecanol | |
| DE2720839C2 (de) | Verfahren zur Herstellung eines kettenförmigen Terpenalkohols | |
| EP0300323B1 (de) | Verfahren zur Herstellung von aliphatischen N,N-dialkylsubstituierten Aminoalkoholen | |
| EP0435072B1 (de) | Verfahren zur Herstellung von N,N-Dimethylaminen | |
| DE2816460A1 (de) | Verfahren zur herstellung von asymmetrischen n-phenyl-n'-substituierten p-phenylendiaminen | |
| DE19500479A1 (de) | Hydrierung von Acetylenverbindungen | |
| EP0452693B1 (de) | Verfahren zur Herstellung von 2,2-disubstituierten Pentan-1,5-diaminen | |
| EP0322760A1 (de) | Verfahren zur Herstellung von Kobaltkatalysatoren | |
| DE2709864A1 (de) | Verfahren zur herstellung von tertiaeren aliphatischen aminen | |
| DE2706862A1 (de) | Verfahren zur hydrierung von aethylenischen aldehyden | |
| EP1004564B1 (de) | Verfahren zur Herstellung von Hydroxyethylcyclohexanen und Hydroxyethylpiperidinen | |
| DE2416584C2 (de) | Verfahren zur Herstellung von Squalan | |
| EP0142070B1 (de) | Verfahren zur Herstellung von N-Methylhomoveratrylamin | |
| DE69202934T2 (de) | Verfahren zur Herstellung von sekundären aliphatischen unsymmetrischen Alkylaminen. | |
| DE4210311A1 (de) | Verfahren zur Herstellung von Aminen aus Azinen | |
| DE2558806C2 (de) | Substituierte 1-Alkeninyl-cyclohexanole und Verfahren zu deren Herstellung sowie deren Verwendung zur Herstellung von β-Damasconen | |
| DE10062771A1 (de) | Verfahren zur Herstellung von 1-(2,2,6-Trimethylcyclohexyl)-3-alkanolen | |
| DE1068719B (de) | Verfahren zur Herstellung von Pentamethylendiamin und Piperidin |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8139 | Disposal/non-payment of the annual fee |