DE2724194C2 - - Google Patents
Info
- Publication number
- DE2724194C2 DE2724194C2 DE2724194A DE2724194A DE2724194C2 DE 2724194 C2 DE2724194 C2 DE 2724194C2 DE 2724194 A DE2724194 A DE 2724194A DE 2724194 A DE2724194 A DE 2724194A DE 2724194 C2 DE2724194 C2 DE 2724194C2
- Authority
- DE
- Germany
- Prior art keywords
- groups
- cyclic
- formula
- atoms
- compound
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- -1 siloxanes Chemical class 0.000 claims description 33
- 238000000034 method Methods 0.000 claims description 23
- 239000003054 catalyst Substances 0.000 claims description 19
- 238000006116 polymerization reaction Methods 0.000 claims description 18
- 229920001296 polysiloxane Polymers 0.000 claims description 13
- 150000001923 cyclic compounds Chemical class 0.000 claims description 12
- 125000004429 atom Chemical group 0.000 claims description 11
- 125000004432 carbon atom Chemical group C* 0.000 claims description 10
- 125000002950 monocyclic group Chemical group 0.000 claims description 9
- 239000003513 alkali Substances 0.000 claims description 8
- KPUWHANPEXNPJT-UHFFFAOYSA-N disiloxane Chemical class [SiH3]O[SiH3] KPUWHANPEXNPJT-UHFFFAOYSA-N 0.000 claims description 8
- HMMGMWAXVFQUOA-UHFFFAOYSA-N octamethylcyclotetrasiloxane Chemical compound C[Si]1(C)O[Si](C)(C)O[Si](C)(C)O[Si](C)(C)O1 HMMGMWAXVFQUOA-UHFFFAOYSA-N 0.000 claims description 8
- 150000001875 compounds Chemical class 0.000 claims description 7
- 239000000203 mixture Substances 0.000 claims description 7
- 229920000570 polyether Polymers 0.000 claims description 4
- 229910052717 sulfur Chemical group 0.000 claims description 4
- VSIKJPJINIDELZ-UHFFFAOYSA-N 2,2,4,4,6,6,8,8-octakis-phenyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocane Chemical compound O1[Si](C=2C=CC=CC=2)(C=2C=CC=CC=2)O[Si](C=2C=CC=CC=2)(C=2C=CC=CC=2)O[Si](C=2C=CC=CC=2)(C=2C=CC=CC=2)O[Si]1(C=1C=CC=CC=1)C1=CC=CC=C1 VSIKJPJINIDELZ-UHFFFAOYSA-N 0.000 claims description 3
- VMAWODUEPLAHOE-UHFFFAOYSA-N 2,4,6,8-tetrakis(ethenyl)-2,4,6,8-tetramethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocane Chemical compound C=C[Si]1(C)O[Si](C)(C=C)O[Si](C)(C=C)O[Si](C)(C=C)O1 VMAWODUEPLAHOE-UHFFFAOYSA-N 0.000 claims description 3
- 239000004215 Carbon black (E152) Substances 0.000 claims description 3
- 239000004721 Polyphenylene oxide Substances 0.000 claims description 3
- 150000008044 alkali metal hydroxides Chemical class 0.000 claims description 3
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 3
- 229910052736 halogen Inorganic materials 0.000 claims description 3
- 150000002367 halogens Chemical class 0.000 claims description 3
- 229930195733 hydrocarbon Natural products 0.000 claims description 3
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 3
- 150000002678 macrocyclic compounds Chemical class 0.000 claims description 3
- 229910052760 oxygen Inorganic materials 0.000 claims description 3
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 3
- 229910052710 silicon Inorganic materials 0.000 claims description 3
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 2
- 239000001301 oxygen Substances 0.000 claims description 2
- 125000004430 oxygen atom Chemical group O* 0.000 claims description 2
- 229920000768 polyamine Polymers 0.000 claims description 2
- 125000003367 polycyclic group Chemical group 0.000 claims description 2
- 229920006295 polythiol Polymers 0.000 claims description 2
- 125000004434 sulfur atom Chemical group 0.000 claims description 2
- 239000004305 biphenyl Substances 0.000 claims 1
- 125000001183 hydrocarbyl group Chemical group 0.000 claims 1
- 230000000379 polymerizing effect Effects 0.000 claims 1
- 150000003254 radicals Chemical class 0.000 description 11
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 10
- 125000004122 cyclic group Chemical group 0.000 description 7
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 6
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 6
- 229920001971 elastomer Polymers 0.000 description 5
- 239000000126 substance Substances 0.000 description 5
- 238000006243 chemical reaction Methods 0.000 description 4
- 150000003983 crown ethers Chemical class 0.000 description 4
- 229910052757 nitrogen Inorganic materials 0.000 description 4
- 239000011591 potassium Substances 0.000 description 4
- XEZNGIUYQVAUSS-UHFFFAOYSA-N 18-crown-6 Chemical compound C1COCCOCCOCCOCCOCCO1 XEZNGIUYQVAUSS-UHFFFAOYSA-N 0.000 description 3
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- 239000000806 elastomer Substances 0.000 description 3
- 238000002474 experimental method Methods 0.000 description 3
- 238000004519 manufacturing process Methods 0.000 description 3
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 3
- 229910052700 potassium Inorganic materials 0.000 description 3
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 2
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 2
- AHUXYBVKTIBBJW-UHFFFAOYSA-N dimethoxy(diphenyl)silane Chemical compound C=1C=CC=CC=1[Si](OC)(OC)C1=CC=CC=C1 AHUXYBVKTIBBJW-UHFFFAOYSA-N 0.000 description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 2
- HTDJPCNNEPUOOQ-UHFFFAOYSA-N hexamethylcyclotrisiloxane Chemical compound C[Si]1(C)O[Si](C)(C)O[Si](C)(C)O1 HTDJPCNNEPUOOQ-UHFFFAOYSA-N 0.000 description 2
- 150000002430 hydrocarbons Chemical group 0.000 description 2
- 239000000178 monomer Substances 0.000 description 2
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 2
- 229920000435 poly(dimethylsiloxane) Polymers 0.000 description 2
- 229920000642 polymer Polymers 0.000 description 2
- 239000011734 sodium Substances 0.000 description 2
- WRXCBRHBHGNNQA-UHFFFAOYSA-N (2,4-dichlorobenzoyl) 2,4-dichlorobenzenecarboperoxoate Chemical compound ClC1=CC(Cl)=CC=C1C(=O)OOC(=O)C1=CC=C(Cl)C=C1Cl WRXCBRHBHGNNQA-UHFFFAOYSA-N 0.000 description 1
- JAVBBFXUGDCHLZ-UHFFFAOYSA-N 1-$l^{1}-oxidanylpropane Chemical compound CCC[O] JAVBBFXUGDCHLZ-UHFFFAOYSA-N 0.000 description 1
- BOIFXPDTOHPTOD-UHFFFAOYSA-N 2,2,4,4,6,6-hexamethyl-8,8-diphenyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocane Chemical compound O1[Si](C)(C)O[Si](C)(C)O[Si](C)(C)O[Si]1(C=1C=CC=CC=1)C1=CC=CC=C1 BOIFXPDTOHPTOD-UHFFFAOYSA-N 0.000 description 1
- FDJVUTSAGSRHAY-UHFFFAOYSA-N 2,4,6,8,10-pentaethyl-2,4,6,8,10-pentamethyl-1,3,5,7,9,2,4,6,8,10-pentaoxapentasilecane Chemical compound CC[Si]1(C)O[Si](C)(CC)O[Si](C)(CC)O[Si](C)(CC)O[Si](C)(CC)O1 FDJVUTSAGSRHAY-UHFFFAOYSA-N 0.000 description 1
- MFGOFGRYDNHJTA-UHFFFAOYSA-N 2-amino-1-(2-fluorophenyl)ethanol Chemical compound NCC(O)C1=CC=CC=C1F MFGOFGRYDNHJTA-UHFFFAOYSA-N 0.000 description 1
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 1
- SZKKRCSOSQAJDE-UHFFFAOYSA-N Schradan Chemical group CN(C)P(=O)(N(C)C)OP(=O)(N(C)C)N(C)C SZKKRCSOSQAJDE-UHFFFAOYSA-N 0.000 description 1
- BLRPTPMANUNPDV-UHFFFAOYSA-N Silane Chemical compound [SiH4] BLRPTPMANUNPDV-UHFFFAOYSA-N 0.000 description 1
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 1
- BOTDANWDWHJENH-UHFFFAOYSA-N Tetraethyl orthosilicate Chemical compound CCO[Si](OCC)(OCC)OCC BOTDANWDWHJENH-UHFFFAOYSA-N 0.000 description 1
- YUDRVAHLXDBKSR-UHFFFAOYSA-N [CH]1CCCCC1 Chemical compound [CH]1CCCCC1 YUDRVAHLXDBKSR-UHFFFAOYSA-N 0.000 description 1
- CIUQDSCDWFSTQR-UHFFFAOYSA-N [C]1=CC=CC=C1 Chemical compound [C]1=CC=CC=C1 CIUQDSCDWFSTQR-UHFFFAOYSA-N 0.000 description 1
- 229910001854 alkali hydroxide Inorganic materials 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 150000004703 alkoxides Chemical class 0.000 description 1
- 125000005360 alkyl sulfoxide group Chemical group 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 235000011114 ammonium hydroxide Nutrition 0.000 description 1
- 150000005840 aryl radicals Chemical class 0.000 description 1
- FSIJKGMIQTVTNP-UHFFFAOYSA-N bis(ethenyl)-methyl-trimethylsilyloxysilane Chemical compound C[Si](C)(C)O[Si](C)(C=C)C=C FSIJKGMIQTVTNP-UHFFFAOYSA-N 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 238000012662 bulk polymerization Methods 0.000 description 1
- HUCVOHYBFXVBRW-UHFFFAOYSA-M caesium hydroxide Inorganic materials [OH-].[Cs+] HUCVOHYBFXVBRW-UHFFFAOYSA-M 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 239000003245 coal Substances 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- DMSZORWOGDLWGN-UHFFFAOYSA-N ctk1a3526 Chemical compound NP(N)(N)=O DMSZORWOGDLWGN-UHFFFAOYSA-N 0.000 description 1
- HKUNCLWSEMQQIB-UHFFFAOYSA-N dihydroxy-phenyl-triphenylsilyloxysilane Chemical compound C=1C=CC=CC=1[Si](O)(O)O[Si](C=1C=CC=CC=1)(C=1C=CC=CC=1)C1=CC=CC=C1 HKUNCLWSEMQQIB-UHFFFAOYSA-N 0.000 description 1
- 239000004205 dimethyl polysiloxane Substances 0.000 description 1
- 235000013870 dimethyl polysiloxane Nutrition 0.000 description 1
- MBGQQKKTDDNCSG-UHFFFAOYSA-N ethenyl-diethoxy-methylsilane Chemical compound CCO[Si](C)(C=C)OCC MBGQQKKTDDNCSG-UHFFFAOYSA-N 0.000 description 1
- WOXXJEVNDJOOLV-UHFFFAOYSA-N ethenyl-tris(2-methoxyethoxy)silane Chemical compound COCCO[Si](OCCOC)(OCCOC)C=C WOXXJEVNDJOOLV-UHFFFAOYSA-N 0.000 description 1
- 239000000945 filler Substances 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 125000005842 heteroatom Chemical group 0.000 description 1
- XEEYBQQBJWHFJM-UHFFFAOYSA-N iron Substances [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 1
- 229910052742 iron Inorganic materials 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- WMFOQBRAJBCJND-UHFFFAOYSA-M lithium hydroxide Inorganic materials [Li+].[OH-] WMFOQBRAJBCJND-UHFFFAOYSA-M 0.000 description 1
- WCYWZMWISLQXQU-UHFFFAOYSA-N methyl Chemical compound [CH3] WCYWZMWISLQXQU-UHFFFAOYSA-N 0.000 description 1
- 238000006386 neutralization reaction Methods 0.000 description 1
- 230000003472 neutralizing effect Effects 0.000 description 1
- 150000002826 nitrites Chemical class 0.000 description 1
- 239000003921 oil Substances 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 150000003961 organosilicon compounds Chemical class 0.000 description 1
- 150000002978 peroxides Chemical class 0.000 description 1
- 238000006068 polycondensation reaction Methods 0.000 description 1
- 238000010926 purge Methods 0.000 description 1
- 125000001453 quaternary ammonium group Chemical group 0.000 description 1
- 229910000077 silane Inorganic materials 0.000 description 1
- 239000010703 silicon Substances 0.000 description 1
- 150000003377 silicon compounds Chemical class 0.000 description 1
- 239000000377 silicon dioxide Substances 0.000 description 1
- 235000012239 silicon dioxide Nutrition 0.000 description 1
- 125000005625 siliconate group Chemical group 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- HEMHJVSKTPXQMS-UHFFFAOYSA-M sodium hydroxide Inorganic materials [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 1
- 229910001220 stainless steel Inorganic materials 0.000 description 1
- 239000010935 stainless steel Substances 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 239000011593 sulfur Substances 0.000 description 1
- CPUDPFPXCZDNGI-UHFFFAOYSA-N triethoxy(methyl)silane Chemical compound CCO[Si](C)(OCC)OCC CPUDPFPXCZDNGI-UHFFFAOYSA-N 0.000 description 1
- JCVQKRGIASEUKR-UHFFFAOYSA-N triethoxy(phenyl)silane Chemical compound CCO[Si](OCC)(OCC)C1=CC=CC=C1 JCVQKRGIASEUKR-UHFFFAOYSA-N 0.000 description 1
- ZQTYRTSKQFQYPQ-UHFFFAOYSA-N trisiloxane Chemical compound [SiH3]O[SiH2]O[SiH3] ZQTYRTSKQFQYPQ-UHFFFAOYSA-N 0.000 description 1
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 1
- 229920002554 vinyl polymer Polymers 0.000 description 1
- ORGHESHFQPYLAO-UHFFFAOYSA-N vinyl radical Chemical compound C=[CH] ORGHESHFQPYLAO-UHFFFAOYSA-N 0.000 description 1
- 238000004073 vulcanization Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08G—MACROMOLECULAR COMPOUNDS OBTAINED OTHERWISE THAN BY REACTIONS ONLY INVOLVING UNSATURATED CARBON-TO-CARBON BONDS
- C08G77/00—Macromolecular compounds obtained by reactions forming a linkage containing silicon with or without sulfur, nitrogen, oxygen or carbon in the main chain of the macromolecule
- C08G77/04—Polysiloxanes
- C08G77/06—Preparatory processes
- C08G77/08—Preparatory processes characterised by the catalysts used
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Silicon Polymers (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| FR7617170A FR2353589A1 (fr) | 1976-05-31 | 1976-05-31 | Procede de preparation d'organopolysiloxanes |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE2724194A1 DE2724194A1 (de) | 1977-12-15 |
| DE2724194C2 true DE2724194C2 (enExample) | 1988-04-14 |
Family
ID=9174071
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19772724194 Granted DE2724194A1 (de) | 1976-05-31 | 1977-05-27 | Verfahren zur herstellung von organopolysiloxanen |
Country Status (10)
| Country | Link |
|---|---|
| US (1) | US4138543A (enExample) |
| JP (1) | JPS6050209B2 (enExample) |
| BE (1) | BE855221A (enExample) |
| CA (1) | CA1093736A (enExample) |
| DE (1) | DE2724194A1 (enExample) |
| FR (1) | FR2353589A1 (enExample) |
| GB (1) | GB1542187A (enExample) |
| IT (1) | IT1076788B (enExample) |
| LU (1) | LU77434A1 (enExample) |
| NL (1) | NL186965C (enExample) |
Families Citing this family (15)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR2461730A1 (fr) * | 1979-07-18 | 1981-02-06 | Rhone Poulenc Ind | Procede de polycondensation des polysiloxanes comportant des groupements hydroxysilyles par metal alcalin ou alcalino-terreux et compose polyheteromacropolycyclique |
| US4271425A (en) * | 1979-11-02 | 1981-06-02 | Western Electric Company, Inc. | Encapsulated electronic devices and encapsulating compositions having crown ethers |
| US4278784A (en) * | 1980-02-06 | 1981-07-14 | Western Electric Company, Inc. | Encapsulated electronic devices and encapsulating compositions |
| FR2481295A1 (fr) * | 1980-04-29 | 1981-10-30 | Rhone Poulenc Ind | Procede d'obtention de polysiloxanes de masses moleculaires elevees par polymerisation et rearrangement de polysiloxanes en presence de catalyseur alcalin et de tris(oxaalkyl)amine |
| JPS5867728A (ja) * | 1981-10-20 | 1983-04-22 | Nippon Yunikaa Kk | オルガノポリシロキサンおよびその製造方法 |
| DE3248546A1 (de) * | 1982-12-29 | 1984-07-05 | Wacker-Chemie GmbH, 8000 München | Verfahren zur herstellung von fluoralkylgruppen aufweisendem diorganopolysiloxan |
| US5663269A (en) * | 1992-03-31 | 1997-09-02 | Loctite Corporation | Organosiloxane fluids prepared using organo-lithium reagents |
| US5300608A (en) * | 1992-03-31 | 1994-04-05 | Loctite Corporation | Process for preparing alkoxy-terminated organosiloxane fluids using organo-lithium reagents |
| DE19901191A1 (de) * | 1999-01-14 | 2000-08-03 | Wacker Chemie Gmbh | Basische Kondensationskatalysatorsysteme für Siloxane |
| FR2853656A1 (fr) * | 2003-04-11 | 2004-10-15 | Rhodia Chimie Sa | Procede de preparation de polyorganosiloxanes lineaires |
| FR2876695B1 (fr) * | 2004-10-15 | 2006-12-08 | Rhodia Chimie Sa | Procede de preparation d'organopolysiloxane par polymerisation et rearrangement de siloxanes cycliques |
| JP5726632B2 (ja) * | 2011-05-19 | 2015-06-03 | メルクパフォーマンスマテリアルズIp合同会社 | 感光性シロキサン樹脂組成物 |
| FR3000070B1 (fr) | 2012-12-21 | 2015-02-06 | Bluestar Silicones France | Procede de preparation de polyorganosiloxanes fonctionnalises |
| JP6614560B1 (ja) * | 2019-03-29 | 2019-12-04 | 株式会社メンテック | 汚染防止剤組成物 |
| CN118325093B (zh) * | 2024-05-15 | 2025-10-21 | 江西蓝星星火有机硅有限公司 | 一种一釜法制备苯基硅橡胶生胶的方法 |
Family Cites Families (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB966059A (enExample) * | 1961-09-05 | 1900-01-01 | ||
| US3305524A (en) * | 1962-11-27 | 1967-02-21 | Gen Electric | Polysiloxanes |
| US3477988A (en) * | 1967-04-05 | 1969-11-11 | Union Carbide Corp | Preparation of organopolysiloxanes by siloxane rearrangement |
| GB1426747A (en) * | 1972-10-03 | 1976-03-03 | Poudres & Explosifs Ste Nale | Anionic polymerization |
| DE2618815A1 (de) | 1975-05-05 | 1976-11-18 | Gen Electric | Verfahren zum polymerisieren cyclischer diorganopolysiloxane |
| US4028338A (en) * | 1975-10-09 | 1977-06-07 | General Electric Company | Fluorosiloxydiphenylsiloxy block copolymers |
-
1976
- 1976-05-31 FR FR7617170A patent/FR2353589A1/fr active Granted
-
1977
- 1977-05-25 US US05/800,391 patent/US4138543A/en not_active Expired - Lifetime
- 1977-05-27 LU LU77434A patent/LU77434A1/xx unknown
- 1977-05-27 DE DE19772724194 patent/DE2724194A1/de active Granted
- 1977-05-30 GB GB7722821A patent/GB1542187A/en not_active Expired
- 1977-05-30 CA CA279,417A patent/CA1093736A/fr not_active Expired
- 1977-05-31 IT IT24205/77A patent/IT1076788B/it active
- 1977-05-31 NL NLAANVRAGE7705956,A patent/NL186965C/xx not_active IP Right Cessation
- 1977-05-31 JP JP52062882A patent/JPS6050209B2/ja not_active Expired
- 1977-05-31 BE BE178056A patent/BE855221A/xx not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| NL186965B (nl) | 1990-11-16 |
| FR2353589B1 (enExample) | 1979-10-12 |
| GB1542187A (en) | 1979-03-14 |
| NL186965C (nl) | 1991-04-16 |
| DE2724194A1 (de) | 1977-12-15 |
| JPS52151399A (en) | 1977-12-15 |
| US4138543A (en) | 1979-02-06 |
| BE855221A (fr) | 1977-11-30 |
| FR2353589A1 (fr) | 1977-12-30 |
| JPS6050209B2 (ja) | 1985-11-07 |
| LU77434A1 (enExample) | 1978-06-26 |
| NL7705956A (nl) | 1977-12-02 |
| IT1076788B (it) | 1985-04-27 |
| CA1093736A (fr) | 1981-01-13 |
| US4138543B1 (enExample) | 1987-08-18 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2724194C2 (enExample) | ||
| DE2644555C2 (enExample) | ||
| DE2737698A1 (de) | Verfahren zur herstellung eines diorganopolysiloxans und katalysator hierfuer | |
| DE2350369A1 (de) | Verfahren zur herstellung von diorganopolysiloxanen | |
| DE3780528T2 (de) | Verfahren zur herstellung von fluorierten polydiorganosiloxanen mit vinylendgruppen. | |
| DE2849092A1 (de) | Silylphosphate und verfahren zu deren herstellung | |
| DE19514987A1 (de) | Verfahren zum Herstellen von vernetzten Siloxanen durch Disproportionierung | |
| DE3041296A1 (de) | Verfahren zur synthese fluessiger fluorsiloxane mit als silanol endender kette | |
| DE4424115B4 (de) | Verfahren zum Herstellen von linearen Triorganosiloxyendgruppen aufweisenden Silicon-Flüssigkeiten mit geringem Silianolgehalt | |
| DE2754703C3 (de) | Verfahren zur Herstellung von Mercaptoorganopolysiloxanelastomeren | |
| DE4424001A1 (de) | Verfahren zum Herstellen linearer Organosiloxanpolymere durch Disproportionierung | |
| CH502404A (de) | Verfahren zur Herstellung eines Organopolysiloxan- Blockcopolymers und Anwendung dieses Verfahrens | |
| DE3041686A1 (de) | Verfahren zur herstellung von triorganosilylendgruppen aufweisenden, fluessigen diorganopolysiloxanen | |
| DE1495859A1 (de) | Organopolysiloxane und Verfahren zur Herstellung derselben | |
| DE2918196C2 (de) | Bis(polyorganosiloxanyl)-amine und Basiszusammensetzungen für elastomere Silicone, die eine dieser Verbindungen enthalten | |
| DE3725377A1 (de) | Verfahren zum kondensieren und/oder aequilibrieren von organo(poly)siloxanen | |
| EP0285091A1 (de) | Verfahren zur Herstellung von Diorganopolysiloxanen mit Triorganosiloxygruppen als endständige Einheiten | |
| DE2945786A1 (de) | Verfahren zum herstellen von fluorsilikon-polymeren | |
| CH646987A5 (de) | Mit sauerstoff vernetzbare mischung auf basis von mercaptofunktionellen organosiloxanen. | |
| DE3306295A1 (de) | Verfahren zum stabilisieren von organopolysiloxanen | |
| DE1495903B2 (de) | Verfahren zur erhoehung des molekulargewichts von organopolysiloxanen | |
| DE4241713A1 (de) | Zu Elastomeren vernetzbare Organopolysiloxanmassen | |
| DE1745320C3 (de) | Verfahren zur Herstellung von linearen oder vernetzten Organopolysiloxanen | |
| DE2351685A1 (de) | Trennmittelgemische | |
| DE69518477T2 (de) | Verfahren zur Herstellung von Organopolysiloxanen |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8110 | Request for examination paragraph 44 | ||
| D2 | Grant after examination | ||
| 8380 | Miscellaneous part iii |
Free format text: DER VERTRETER LAUTET RICHTIG: EGGERT, H., DIPL.-CHEM. DR., PAT.-ANW., 5000 KOELN |
|
| 8364 | No opposition during term of opposition |