DE2656744C3 - Fluorierte Alkylamidoalkansulfonsäuren, Verfahren zu ihrer Herstellung und ihre Verwendung - Google Patents
Fluorierte Alkylamidoalkansulfonsäuren, Verfahren zu ihrer Herstellung und ihre VerwendungInfo
- Publication number
- DE2656744C3 DE2656744C3 DE2656744A DE2656744A DE2656744C3 DE 2656744 C3 DE2656744 C3 DE 2656744C3 DE 2656744 A DE2656744 A DE 2656744A DE 2656744 A DE2656744 A DE 2656744A DE 2656744 C3 DE2656744 C3 DE 2656744C3
- Authority
- DE
- Germany
- Prior art keywords
- acid
- mol
- reaction
- formula
- acids
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 239000002253 acid Substances 0.000 title claims description 15
- 150000007513 acids Chemical class 0.000 title claims description 8
- 238000000034 method Methods 0.000 title description 6
- 238000002360 preparation method Methods 0.000 title description 3
- 150000003839 salts Chemical class 0.000 claims description 9
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 18
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 18
- SVTBMSDMJJWYQN-UHFFFAOYSA-N 2-methylpentane-2,4-diol Chemical compound CC(O)CC(C)(C)O SVTBMSDMJJWYQN-UHFFFAOYSA-N 0.000 description 14
- 238000006243 chemical reaction Methods 0.000 description 14
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 14
- 239000000203 mixture Substances 0.000 description 13
- 239000000243 solution Substances 0.000 description 12
- 125000004432 carbon atom Chemical group C* 0.000 description 11
- 150000001875 compounds Chemical class 0.000 description 11
- 239000001257 hydrogen Substances 0.000 description 11
- 229910052739 hydrogen Inorganic materials 0.000 description 11
- 239000004094 surface-active agent Substances 0.000 description 11
- 239000000047 product Substances 0.000 description 10
- 229910052731 fluorine Inorganic materials 0.000 description 9
- -1 propionamido Chemical group 0.000 description 8
- 239000011734 sodium Substances 0.000 description 8
- 239000007787 solid Substances 0.000 description 8
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 7
- 229910052783 alkali metal Inorganic materials 0.000 description 7
- 239000002585 base Substances 0.000 description 7
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 6
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 6
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 6
- 229940051250 hexylene glycol Drugs 0.000 description 6
- 239000011777 magnesium Substances 0.000 description 6
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 6
- 125000005010 perfluoroalkyl group Chemical group 0.000 description 6
- 150000003573 thiols Chemical class 0.000 description 6
- UMGDCJDMYOKAJW-UHFFFAOYSA-N thiourea Chemical compound NC(N)=S UMGDCJDMYOKAJW-UHFFFAOYSA-N 0.000 description 6
- 229920000536 2-Acrylamido-2-methylpropane sulfonic acid Polymers 0.000 description 5
- XHZPRMZZQOIPDS-UHFFFAOYSA-N 2-Methyl-2-[(1-oxo-2-propenyl)amino]-1-propanesulfonic acid Chemical compound OS(=O)(=O)CC(C)(C)NC(=O)C=C XHZPRMZZQOIPDS-UHFFFAOYSA-N 0.000 description 5
- GTPHVVCYEWPQFE-UHFFFAOYSA-N 3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctane-1-thiol Chemical compound FC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)CCS GTPHVVCYEWPQFE-UHFFFAOYSA-N 0.000 description 5
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 5
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 5
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 5
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 5
- 150000001340 alkali metals Chemical class 0.000 description 5
- 150000002431 hydrogen Chemical class 0.000 description 5
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 4
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 4
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 4
- 150000001342 alkaline earth metals Chemical class 0.000 description 4
- 125000000217 alkyl group Chemical group 0.000 description 4
- 239000003054 catalyst Substances 0.000 description 4
- 239000008367 deionised water Substances 0.000 description 4
- 229910021641 deionized water Inorganic materials 0.000 description 4
- MTHSVFCYNBDYFN-UHFFFAOYSA-N diethylene glycol Chemical compound OCCOCCO MTHSVFCYNBDYFN-UHFFFAOYSA-N 0.000 description 4
- 229910052749 magnesium Inorganic materials 0.000 description 4
- 239000002904 solvent Substances 0.000 description 4
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 3
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 3
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 3
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 description 3
- 239000005977 Ethylene Substances 0.000 description 3
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 3
- LSDPWZHWYPCBBB-UHFFFAOYSA-N Methanethiol Chemical compound SC LSDPWZHWYPCBBB-UHFFFAOYSA-N 0.000 description 3
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 3
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- DNIAPMSPPWPWGF-UHFFFAOYSA-N Propylene glycol Chemical compound CC(O)CO DNIAPMSPPWPWGF-UHFFFAOYSA-N 0.000 description 3
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Natural products NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 3
- 239000007864 aqueous solution Substances 0.000 description 3
- 238000001816 cooling Methods 0.000 description 3
- 229910052700 potassium Inorganic materials 0.000 description 3
- 239000011591 potassium Substances 0.000 description 3
- 238000010992 reflux Methods 0.000 description 3
- 229910052708 sodium Inorganic materials 0.000 description 3
- 229910000029 sodium carbonate Inorganic materials 0.000 description 3
- ZNQVEEAIQZEUHB-UHFFFAOYSA-N 2-ethoxyethanol Chemical compound CCOCCO ZNQVEEAIQZEUHB-UHFFFAOYSA-N 0.000 description 2
- URJIJZCEKHSLHA-UHFFFAOYSA-N 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecane-1-thiol Chemical compound FC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)CCS URJIJZCEKHSLHA-UHFFFAOYSA-N 0.000 description 2
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 2
- XTHFKEDIFFGKHM-UHFFFAOYSA-N Dimethoxyethane Chemical compound COCCOC XTHFKEDIFFGKHM-UHFFFAOYSA-N 0.000 description 2
- YCKRFDGAMUMZLT-UHFFFAOYSA-N Fluorine atom Chemical compound [F] YCKRFDGAMUMZLT-UHFFFAOYSA-N 0.000 description 2
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 2
- ATHHXGZTWNVVOU-UHFFFAOYSA-N N-methylformamide Chemical compound CNC=O ATHHXGZTWNVVOU-UHFFFAOYSA-N 0.000 description 2
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 2
- 125000002947 alkylene group Chemical group 0.000 description 2
- 239000013011 aqueous formulation Substances 0.000 description 2
- 238000006555 catalytic reaction Methods 0.000 description 2
- 239000003085 diluting agent Substances 0.000 description 2
- 238000000921 elemental analysis Methods 0.000 description 2
- 239000011737 fluorine Substances 0.000 description 2
- 238000005187 foaming Methods 0.000 description 2
- 238000009472 formulation Methods 0.000 description 2
- 239000007789 gas Substances 0.000 description 2
- 150000004820 halides Chemical class 0.000 description 2
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 2
- 150000004694 iodide salts Chemical class 0.000 description 2
- ZXEKIIBDNHEJCQ-UHFFFAOYSA-N isobutanol Chemical compound CC(C)CO ZXEKIIBDNHEJCQ-UHFFFAOYSA-N 0.000 description 2
- 239000007788 liquid Substances 0.000 description 2
- 238000002844 melting Methods 0.000 description 2
- 230000008018 melting Effects 0.000 description 2
- 229910052757 nitrogen Inorganic materials 0.000 description 2
- 239000003960 organic solvent Substances 0.000 description 2
- 230000003647 oxidation Effects 0.000 description 2
- 238000007254 oxidation reaction Methods 0.000 description 2
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 2
- XAEFZNCEHLXOMS-UHFFFAOYSA-M potassium benzoate Chemical compound [K+].[O-]C(=O)C1=CC=CC=C1 XAEFZNCEHLXOMS-UHFFFAOYSA-M 0.000 description 2
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 2
- 239000000843 powder Substances 0.000 description 2
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 2
- 125000004076 pyridyl group Chemical group 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- 125000003944 tolyl group Chemical group 0.000 description 2
- PUPZLCDOIYMWBV-UHFFFAOYSA-N (+/-)-1,3-Butanediol Chemical compound CC(O)CCO PUPZLCDOIYMWBV-UHFFFAOYSA-N 0.000 description 1
- NWUYHJFMYQTDRP-UHFFFAOYSA-N 1,2-bis(ethenyl)benzene;1-ethenyl-2-ethylbenzene;styrene Chemical compound C=CC1=CC=CC=C1.CCC1=CC=CC=C1C=C.C=CC1=CC=CC=C1C=C NWUYHJFMYQTDRP-UHFFFAOYSA-N 0.000 description 1
- OZXIZRZFGJZWBF-UHFFFAOYSA-N 1,3,5-trimethyl-2-(2,4,6-trimethylphenoxy)benzene Chemical compound CC1=CC(C)=CC(C)=C1OC1=C(C)C=C(C)C=C1C OZXIZRZFGJZWBF-UHFFFAOYSA-N 0.000 description 1
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- VMRZUHSTSZRINS-UHFFFAOYSA-N 1-[2-(prop-2-enoylamino)-1h-pyridin-2-yl]ethanesulfonic acid Chemical compound C=CC(=O)NC1(C(C)S(O)(=O)=O)NC=CC=C1 VMRZUHSTSZRINS-UHFFFAOYSA-N 0.000 description 1
- YZUPZGFPHUVJKC-UHFFFAOYSA-N 1-bromo-2-methoxyethane Chemical compound COCCBr YZUPZGFPHUVJKC-UHFFFAOYSA-N 0.000 description 1
- RRQYJINTUHWNHW-UHFFFAOYSA-N 1-ethoxy-2-(2-ethoxyethoxy)ethane Chemical compound CCOCCOCCOCC RRQYJINTUHWNHW-UHFFFAOYSA-N 0.000 description 1
- AKEGTQKKWUFLBQ-UHFFFAOYSA-N 2,4,4-trimethyl-2-(prop-2-enoylamino)pentane-1-sulfonic acid Chemical compound CC(C)(C)CC(C)(CS(O)(=O)=O)NC(=O)C=C AKEGTQKKWUFLBQ-UHFFFAOYSA-N 0.000 description 1
- OAYXUHPQHDHDDZ-UHFFFAOYSA-N 2-(2-butoxyethoxy)ethanol Chemical compound CCCCOCCOCCO OAYXUHPQHDHDDZ-UHFFFAOYSA-N 0.000 description 1
- SBASXUCJHJRPEV-UHFFFAOYSA-N 2-(2-methoxyethoxy)ethanol Chemical compound COCCOCCO SBASXUCJHJRPEV-UHFFFAOYSA-N 0.000 description 1
- YQSVYZPYIXAYND-UHFFFAOYSA-N 2-(prop-2-enoylamino)butane-1-sulfonic acid Chemical compound OS(=O)(=O)CC(CC)NC(=O)C=C YQSVYZPYIXAYND-UHFFFAOYSA-N 0.000 description 1
- MVYVKSBVZFBBPL-UHFFFAOYSA-N 2-(prop-2-enoylamino)propane-1-sulfonic acid Chemical compound OS(=O)(=O)CC(C)NC(=O)C=C MVYVKSBVZFBBPL-UHFFFAOYSA-N 0.000 description 1
- XNWFRZJHXBZDAG-UHFFFAOYSA-N 2-METHOXYETHANOL Chemical compound COCCO XNWFRZJHXBZDAG-UHFFFAOYSA-N 0.000 description 1
- POAOYUHQDCAZBD-UHFFFAOYSA-N 2-butoxyethanol Chemical compound CCCCOCCO POAOYUHQDCAZBD-UHFFFAOYSA-N 0.000 description 1
- CGRRTNMGLUWMLJ-UHFFFAOYSA-N 2-phenyl-2-(prop-2-enoylamino)ethanesulfonic acid Chemical compound C=CC(=O)NC(CS(=O)(=O)O)C1=CC=CC=C1 CGRRTNMGLUWMLJ-UHFFFAOYSA-N 0.000 description 1
- NRVQUYCYEAKQIF-UHFFFAOYSA-N 2-phenyl-2-(prop-2-enoylamino)propane-1-sulfonic acid Chemical compound C=CC(=O)NC(CS(O)(=O)=O)(C)C1=CC=CC=C1 NRVQUYCYEAKQIF-UHFFFAOYSA-N 0.000 description 1
- DMLOUIGSRNIVFO-UHFFFAOYSA-N 3-(prop-2-enoylamino)butane-2-sulfonic acid Chemical compound OS(=O)(=O)C(C)C(C)NC(=O)C=C DMLOUIGSRNIVFO-UHFFFAOYSA-N 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-M Bisulfite Chemical compound OS([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-M 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 1
- RWSOTUBLDIXVET-UHFFFAOYSA-N Dihydrogen sulfide Chemical class S RWSOTUBLDIXVET-UHFFFAOYSA-N 0.000 description 1
- 101100042793 Gallus gallus SMC2 gene Proteins 0.000 description 1
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 1
- GQWNECFJGBQMBO-UHFFFAOYSA-N Molindone hydrochloride Chemical compound Cl.O=C1C=2C(CC)=C(C)NC=2CCC1CN1CCOCC1 GQWNECFJGBQMBO-UHFFFAOYSA-N 0.000 description 1
- 238000005481 NMR spectroscopy Methods 0.000 description 1
- 229910006069 SO3H Inorganic materials 0.000 description 1
- UWHCKJMYHZGTIT-UHFFFAOYSA-N Tetraethylene glycol, Natural products OCCOCCOCCOCCO UWHCKJMYHZGTIT-UHFFFAOYSA-N 0.000 description 1
- 229910052788 barium Inorganic materials 0.000 description 1
- DSAJWYNOEDNPEQ-UHFFFAOYSA-N barium atom Chemical compound [Ba] DSAJWYNOEDNPEQ-UHFFFAOYSA-N 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 239000001569 carbon dioxide Substances 0.000 description 1
- 229910002092 carbon dioxide Inorganic materials 0.000 description 1
- 239000000969 carrier Substances 0.000 description 1
- 230000003197 catalytic effect Effects 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 239000013065 commercial product Substances 0.000 description 1
- 230000000052 comparative effect Effects 0.000 description 1
- 239000012084 conversion product Substances 0.000 description 1
- 238000006704 dehydrohalogenation reaction Methods 0.000 description 1
- 229940019778 diethylene glycol diethyl ether Drugs 0.000 description 1
- 229940028356 diethylene glycol monobutyl ether Drugs 0.000 description 1
- XXJWXESWEXIICW-UHFFFAOYSA-N diethylene glycol monoethyl ether Chemical compound CCOCCOCCO XXJWXESWEXIICW-UHFFFAOYSA-N 0.000 description 1
- 229940075557 diethylene glycol monoethyl ether Drugs 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- 239000006260 foam Substances 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- 239000003456 ion exchange resin Substances 0.000 description 1
- 229920003303 ion-exchange polymer Polymers 0.000 description 1
- 238000002955 isolation Methods 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- 229910052744 lithium Inorganic materials 0.000 description 1
- ZLNQQNXFFQJAID-UHFFFAOYSA-L magnesium carbonate Chemical compound [Mg+2].[O-]C([O-])=O ZLNQQNXFFQJAID-UHFFFAOYSA-L 0.000 description 1
- 239000001095 magnesium carbonate Substances 0.000 description 1
- 229910000021 magnesium carbonate Inorganic materials 0.000 description 1
- SHOJXDKTYKFBRD-UHFFFAOYSA-N mesityl oxide Natural products CC(C)=CC(C)=O SHOJXDKTYKFBRD-UHFFFAOYSA-N 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- APVPOHHVBBYQAV-UHFFFAOYSA-N n-(4-aminophenyl)sulfonyloctadecanamide Chemical compound CCCCCCCCCCCCCCCCCC(=O)NS(=O)(=O)C1=CC=C(N)C=C1 APVPOHHVBBYQAV-UHFFFAOYSA-N 0.000 description 1
- 238000006386 neutralization reaction Methods 0.000 description 1
- 238000000655 nuclear magnetic resonance spectrum Methods 0.000 description 1
- HVFSJXUIRWUHRG-UHFFFAOYSA-N oic acid Natural products C1CC2C3CC=C4CC(OC5C(C(O)C(O)C(CO)O5)O)CC(O)C4(C)C3CCC2(C)C1C(C)C(O)CC(C)=C(C)C(=O)OC1OC(COC(C)=O)C(O)C(O)C1OC(C(C1O)O)OC(COC(C)=O)C1OC1OC(CO)C(O)C(O)C1O HVFSJXUIRWUHRG-UHFFFAOYSA-N 0.000 description 1
- JCGNDDUYTRNOFT-UHFFFAOYSA-N oxolane-2,4-dione Chemical compound O=C1COC(=O)C1 JCGNDDUYTRNOFT-UHFFFAOYSA-N 0.000 description 1
- 150000002978 peroxides Chemical class 0.000 description 1
- 239000002798 polar solvent Substances 0.000 description 1
- 238000005498 polishing Methods 0.000 description 1
- 238000006116 polymerization reaction Methods 0.000 description 1
- 229910000027 potassium carbonate Inorganic materials 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 239000001294 propane Substances 0.000 description 1
- KCXFHTAICRTXLI-UHFFFAOYSA-N propane-1-sulfonic acid Chemical compound CCCS(O)(=O)=O KCXFHTAICRTXLI-UHFFFAOYSA-N 0.000 description 1
- 230000001681 protective effect Effects 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
- 238000007086 side reaction Methods 0.000 description 1
- 239000002002 slurry Substances 0.000 description 1
- 159000000000 sodium salts Chemical class 0.000 description 1
- XVCDQXABFKLFCH-UHFFFAOYSA-M sodium;n-prop-2-enoylsulfamate Chemical compound [Na+].[O-]S(=O)(=O)NC(=O)C=C XVCDQXABFKLFCH-UHFFFAOYSA-M 0.000 description 1
- IIACRCGMVDHOTQ-UHFFFAOYSA-N sulfamic acid Chemical class NS(O)(=O)=O IIACRCGMVDHOTQ-UHFFFAOYSA-N 0.000 description 1
- 125000000020 sulfo group Chemical group O=S(=O)([*])O[H] 0.000 description 1
- 150000008054 sulfonate salts Chemical class 0.000 description 1
- 150000003871 sulfonates Chemical class 0.000 description 1
- 150000003457 sulfones Chemical class 0.000 description 1
- 150000003462 sulfoxides Chemical class 0.000 description 1
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 1
- 150000003568 thioethers Chemical class 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C309/00—Sulfonic acids; Halides, esters, or anhydrides thereof
- C07C309/01—Sulfonic acids
- C07C309/02—Sulfonic acids having sulfo groups bound to acyclic carbon atoms
- C07C309/03—Sulfonic acids having sulfo groups bound to acyclic carbon atoms of an acyclic saturated carbon skeleton
- C07C309/17—Sulfonic acids having sulfo groups bound to acyclic carbon atoms of an acyclic saturated carbon skeleton containing carboxyl groups bound to the carbon skeleton
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C303/00—Preparation of esters or amides of sulfuric acids; Preparation of sulfonic acids or of their esters, halides, anhydrides or amides
- C07C303/02—Preparation of esters or amides of sulfuric acids; Preparation of sulfonic acids or of their esters, halides, anhydrides or amides of sulfonic acids or halides thereof
- C07C303/22—Preparation of esters or amides of sulfuric acids; Preparation of sulfonic acids or of their esters, halides, anhydrides or amides of sulfonic acids or halides thereof from sulfonic acids, by reactions not involving the formation of sulfo or halosulfonyl groups; from sulfonic halides by reactions not involving the formation of halosulfonyl groups
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C309/00—Sulfonic acids; Halides, esters, or anhydrides thereof
- C07C309/01—Sulfonic acids
- C07C309/02—Sulfonic acids having sulfo groups bound to acyclic carbon atoms
- C07C309/03—Sulfonic acids having sulfo groups bound to acyclic carbon atoms of an acyclic saturated carbon skeleton
- C07C309/07—Sulfonic acids having sulfo groups bound to acyclic carbon atoms of an acyclic saturated carbon skeleton containing oxygen atoms bound to the carbon skeleton
- C07C309/09—Sulfonic acids having sulfo groups bound to acyclic carbon atoms of an acyclic saturated carbon skeleton containing oxygen atoms bound to the carbon skeleton containing etherified hydroxy groups bound to the carbon skeleton
- C07C309/10—Sulfonic acids having sulfo groups bound to acyclic carbon atoms of an acyclic saturated carbon skeleton containing oxygen atoms bound to the carbon skeleton containing etherified hydroxy groups bound to the carbon skeleton with the oxygen atom of at least one of the etherified hydroxy groups further bound to an acyclic carbon atom
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C309/00—Sulfonic acids; Halides, esters, or anhydrides thereof
- C07C309/01—Sulfonic acids
- C07C309/02—Sulfonic acids having sulfo groups bound to acyclic carbon atoms
- C07C309/03—Sulfonic acids having sulfo groups bound to acyclic carbon atoms of an acyclic saturated carbon skeleton
- C07C309/13—Sulfonic acids having sulfo groups bound to acyclic carbon atoms of an acyclic saturated carbon skeleton containing nitrogen atoms, not being part of nitro or nitroso groups, bound to the carbon skeleton
- C07C309/14—Sulfonic acids having sulfo groups bound to acyclic carbon atoms of an acyclic saturated carbon skeleton containing nitrogen atoms, not being part of nitro or nitroso groups, bound to the carbon skeleton containing amino groups bound to the carbon skeleton
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C309/00—Sulfonic acids; Halides, esters, or anhydrides thereof
- C07C309/01—Sulfonic acids
- C07C309/02—Sulfonic acids having sulfo groups bound to acyclic carbon atoms
- C07C309/03—Sulfonic acids having sulfo groups bound to acyclic carbon atoms of an acyclic saturated carbon skeleton
- C07C309/13—Sulfonic acids having sulfo groups bound to acyclic carbon atoms of an acyclic saturated carbon skeleton containing nitrogen atoms, not being part of nitro or nitroso groups, bound to the carbon skeleton
- C07C309/14—Sulfonic acids having sulfo groups bound to acyclic carbon atoms of an acyclic saturated carbon skeleton containing nitrogen atoms, not being part of nitro or nitroso groups, bound to the carbon skeleton containing amino groups bound to the carbon skeleton
- C07C309/15—Sulfonic acids having sulfo groups bound to acyclic carbon atoms of an acyclic saturated carbon skeleton containing nitrogen atoms, not being part of nitro or nitroso groups, bound to the carbon skeleton containing amino groups bound to the carbon skeleton the nitrogen atom of at least one of the amino groups being part of any of the groups, X being a hetero atom, Y being any atom
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C309/00—Sulfonic acids; Halides, esters, or anhydrides thereof
- C07C309/01—Sulfonic acids
- C07C309/02—Sulfonic acids having sulfo groups bound to acyclic carbon atoms
- C07C309/20—Sulfonic acids having sulfo groups bound to acyclic carbon atoms of an acyclic unsaturated carbon skeleton
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Emulsifying, Dispersing, Foam-Producing Or Wetting Agents (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US05/642,271 US4014926A (en) | 1975-12-19 | 1975-12-19 | Fluorinated sulfonic acids and derivatives thereof |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| DE2656744A1 DE2656744A1 (de) | 1977-06-30 |
| DE2656744B2 DE2656744B2 (de) | 1980-02-14 |
| DE2656744C3 true DE2656744C3 (de) | 1980-10-09 |
Family
ID=24575903
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2656744A Expired DE2656744C3 (de) | 1975-12-19 | 1976-12-15 | Fluorierte Alkylamidoalkansulfonsäuren, Verfahren zu ihrer Herstellung und ihre Verwendung |
Country Status (10)
| Country | Link |
|---|---|
| US (1) | US4014926A (enExample) |
| JP (1) | JPS5277013A (enExample) |
| BE (1) | BE849505A (enExample) |
| CA (1) | CA1089465A (enExample) |
| CH (1) | CH622246A5 (enExample) |
| DE (1) | DE2656744C3 (enExample) |
| FR (1) | FR2335500A1 (enExample) |
| GB (1) | GB1531838A (enExample) |
| IT (1) | IT1069080B (enExample) |
| NL (2) | NL171267B (enExample) |
Families Citing this family (19)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3926821A (en) * | 1973-12-12 | 1975-12-16 | Lubrizol Corp | Phosphorus, nitrogen and sulfo-containing additives |
| USRE30142E (en) * | 1973-12-12 | 1979-11-06 | The Lubrizol Corporation | Phosphorus, nitrogen and sulfo-containing additives |
| DE2702584C2 (de) * | 1977-01-22 | 1982-10-14 | Bayer Ag, 5090 Leverkusen | Konzentrierte wäßrige oder wäßrig-organische Lösungen von Acetoacetylaminoarylsulfonsäuresalzen, Verfahren zu deren Herstellung und Verfahren zur Herstellung von konzentrierten Lösungen sulfonsäuregruppenhaltiger Azofarbstoffe aus den vorgenannten Lösungen |
| JPS6012892B2 (ja) * | 1980-03-14 | 1985-04-04 | 大日本インキ化学工業株式会社 | 含フッ素アミノスルホネ−ト系界面活性剤 |
| US4404377A (en) * | 1982-03-08 | 1983-09-13 | Nalco Chemical Company | Heterocyclic/aromatic fluorocarbon surfactants |
| US4408043A (en) * | 1982-03-08 | 1983-10-04 | Nalco Chemical Company | Fluorocarbon surfactants |
| US4505990A (en) * | 1983-07-14 | 1985-03-19 | Hercules Incorporated | Coating compositions |
| US4594200A (en) * | 1984-11-15 | 1986-06-10 | Halliburton Company | Compositions for increasing hydrocarbon production from subterranean formations |
| US4781865A (en) * | 1986-09-29 | 1988-11-01 | Ecolab, Inc. | Phosphinated and phosphonated sulfonic acids |
| US4923009A (en) * | 1989-05-05 | 1990-05-08 | Union Oil Company Of California | Steam enhanced oil recovery processes and compositions for use therein |
| JP3217116B2 (ja) * | 1992-03-06 | 2001-10-09 | 日産化学工業株式会社 | 低表面張力洗浄用組成物 |
| US6201122B1 (en) * | 1992-12-08 | 2001-03-13 | 3M Innovative Properties Company | Fluoroaliphatic radical-containing anionic sulfonamido compounds |
| US5660815A (en) * | 1995-04-28 | 1997-08-26 | Molecular Biosystems, Inc. | Water soluble fluorinated fatty acid sulfonate derivatives useful as magnetic resonance imaging agents |
| KR100761815B1 (ko) | 2006-11-21 | 2007-10-04 | 재단법인서울대학교산학협력재단 | 생물부착 방지용 고분자 및 이를 이용한 생물부착 방지막의형성방법 |
| US9060560B2 (en) * | 2007-08-10 | 2015-06-23 | Greenhill Antiballistics Corporation | Composite material |
| US8524104B1 (en) | 2008-08-28 | 2013-09-03 | Ansul, Incorporated | Fluoroalkenyl sulfate surfactants |
| US8669212B2 (en) * | 2009-09-03 | 2014-03-11 | Halliburton Energy Services, Inc. | Fluorosurfactants and treatment fluids for reduction of water blocks, oil blocks, and/or gas condensates and associated methods |
| JP6038798B2 (ja) | 2010-10-18 | 2016-12-07 | グリーンヒル・アンチバリスティクス・コーポレーション | 勾配ナノ粒子−炭素同素体−ポリマー複合材料 |
| WO2017177040A1 (en) | 2016-04-06 | 2017-10-12 | Sanctioned Risk Solutions, Inc. | Heat dissipation using nanoscale materials |
Family Cites Families (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3235549A (en) * | 1962-08-21 | 1966-02-15 | Monsanto Co | 2-dioxy-1, 2, 5-oxathiazine compounds and processes for their manufacture |
| US3544597A (en) * | 1969-06-12 | 1970-12-01 | Rohm & Haas | Process for manufacturing sulfonated amides |
| US3798265A (en) * | 1969-10-22 | 1974-03-19 | Du Pont | Polyfluoroalkoxy alkyl amidocarboxylic acids and salts thereof |
-
0
- NL NLAANVRAGE7614059,A patent/NL171267C/xx active
-
1975
- 1975-12-19 US US05/642,271 patent/US4014926A/en not_active Expired - Lifetime
-
1976
- 1976-12-10 CH CH1557676A patent/CH622246A5/de not_active IP Right Cessation
- 1976-12-15 DE DE2656744A patent/DE2656744C3/de not_active Expired
- 1976-12-16 IT IT52642/76A patent/IT1069080B/it active
- 1976-12-16 GB GB52609/76A patent/GB1531838A/en not_active Expired
- 1976-12-16 FR FR7637989A patent/FR2335500A1/fr active Granted
- 1976-12-17 NL NLAANVRAGE7614059,A patent/NL171267B/xx not_active IP Right Cessation
- 1976-12-17 BE BE173347A patent/BE849505A/xx not_active IP Right Cessation
- 1976-12-17 CA CA268,118A patent/CA1089465A/en not_active Expired
- 1976-12-18 JP JP51152780A patent/JPS5277013A/ja active Granted
Also Published As
| Publication number | Publication date |
|---|---|
| FR2335500A1 (fr) | 1977-07-15 |
| IT1069080B (it) | 1985-03-25 |
| NL7614059A (nl) | 1977-06-21 |
| GB1531838A (en) | 1978-11-08 |
| CA1089465A (en) | 1980-11-11 |
| JPS5277013A (en) | 1977-06-29 |
| DE2656744B2 (de) | 1980-02-14 |
| FR2335500B1 (enExample) | 1979-07-13 |
| JPS5725034B2 (enExample) | 1982-05-27 |
| NL171267B (nl) | 1982-10-01 |
| CH622246A5 (enExample) | 1981-03-31 |
| BE849505A (fr) | 1977-06-17 |
| US4014926A (en) | 1977-03-29 |
| DE2656744A1 (de) | 1977-06-30 |
| NL171267C (nl) |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2656744C3 (de) | Fluorierte Alkylamidoalkansulfonsäuren, Verfahren zu ihrer Herstellung und ihre Verwendung | |
| EP0594574B1 (de) | Verfahren zur herstellung von salzen sulfierter fettsäureglycerinester | |
| EP0531359A1 (de) | Verfahren zur herstellung hellfarbiger pasten von alpha-sulfofettsäurealkylester-alkalimetallsalzen. | |
| DE1942264C3 (de) | Polyfluorsulfonsäuren und deren Sulfonate, Verfahren zur Herstellung der Polyfluorsulfonate, sowie Verwendung der genannten Verbindungen als oberflächenaktive Mittel | |
| DE69403495T2 (de) | Verfahren zur Herstellung von alkoxylierten Thioverbindungen | |
| DE69115083T2 (de) | Verfahren zur Herstellung ein Verdickungsmittel. | |
| EP0428039B1 (de) | Verfahren zur Herstellung von weitgehend fluorierten Alkylbromiden | |
| DE2656711A1 (de) | Alkylthio-alkylamidoalkan-sulfonsaeuren, verfahren zu deren herstellung und deren verwendung | |
| DE2362648A1 (de) | Verfahren zur herstellung von halogenphenolen | |
| DE2523402C2 (enExample) | ||
| DE1617991A1 (de) | 2-Phenylbenzoxazol-Derivate als Ultraviolett-Absorber fuer kosmetische Zwecke | |
| DE2361144C3 (de) | SuIfon-Alkohole und deren Ester und Verfahren zu ihrer Herstellung | |
| DE2523616B2 (de) | Verfahren zur herstellung von 2- acrylamido-2-alkylsulfonsaeuren | |
| DE69201880T2 (de) | 2,5-Dichlorophenylthioglycolsäurederivat und Verfahren zu seiner Herstellung. | |
| DE1643126C3 (de) | Verfahren zur Herstellung von Gemischen aus aromatischen Sulfonylchloriden und aromatischen SuNonen | |
| EP0461563B1 (de) | Verfahren zur Herstellung von weitgehend fluorierten Alkylbromiden | |
| EP0037510B1 (de) | Verfahren zur Herstellung von 1-Naphthylamin-4,6-disulfonsäure und 1-Naphthylamin-2,4,6-trisulfonsäure | |
| DE971715C (de) | Verfahren zur Herstellung von Schwefelsaeurehalbestern von vorzugsweise hoehermolekularen organischen Verbindungen, die Hydroxylgruppen in nichtaromatischer Bindung enthalten | |
| EP0328980B1 (de) | Verfahren zur Herstellung niedrigviskoser Estersulfonatpasten | |
| DE888736C (de) | Verfahren zur Herstellung hochwirksamer Trockenstoffkombinationen | |
| DE961533C (de) | Verfahren zur Herstellung von Verbindungen, die Schwefelsaeurereste adduktmaessig an AEthersauerstoffatome, gegebenenfalls auch esterartig an alkoholische Sauerstoffatome gebunden enthalten | |
| DE2854643A1 (de) | Verfahren zur herstellung von aethersulfonaten | |
| AT221536B (de) | Verfahren zur Sulfonierung von aromatischen Kohlenwasserstoffen | |
| DE2016582A1 (enExample) | ||
| DE1138036B (de) | Verfahren zur Herstellung von Schwefelsaeure-vinyl-alkylestern |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| C3 | Grant after two publication steps (3rd publication) |